From 8c1cdcd70c9dbea7c42dff9238aa56a14097c086 Mon Sep 17 00:00:00 2001 From: Arthur Date: Fri, 22 Mar 2024 12:10:53 -0700 Subject: [PATCH] 9856 move static files --- .../dist/graphiql/graphiql.min.css | 641 + .../dist/graphiql/graphiql.min.js | 83667 ++++++++++++++++ .../project-static/dist/graphiql/index.umd.js | 1 + .../dist/graphiql/js.cookie.min.js | 2 + .../dist/graphiql/plugin-explorer-style.css | 1 + .../dist/graphiql/react-dom.production.min.js | 267 + .../dist/graphiql/react.production.min.js | 31 + 7 files changed, 84610 insertions(+) create mode 100644 netbox/project-static/dist/graphiql/graphiql.min.css create mode 100644 netbox/project-static/dist/graphiql/graphiql.min.js create mode 100644 netbox/project-static/dist/graphiql/index.umd.js create mode 100644 netbox/project-static/dist/graphiql/js.cookie.min.js create mode 100644 netbox/project-static/dist/graphiql/plugin-explorer-style.css create mode 100644 netbox/project-static/dist/graphiql/react-dom.production.min.js create mode 100644 netbox/project-static/dist/graphiql/react.production.min.js diff --git a/netbox/project-static/dist/graphiql/graphiql.min.css b/netbox/project-static/dist/graphiql/graphiql.min.css new file mode 100644 index 000000000..6318023d0 --- /dev/null +++ b/netbox/project-static/dist/graphiql/graphiql.min.css @@ -0,0 +1,641 @@ +/*!*********************************************************************************************!*\ + !*** css ../../../node_modules/css-loader/dist/cjs.js!../../graphiql-react/font/roboto.css ***! + \*********************************************************************************************/ +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAC80AA4AAAAAVTAAAC7cAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGoFOG5JCHDYGYACCWBEMCoGBAOoVC4NaAAE2AiQDhzAEIAWDCgcgG/JGo6Kq1zUjEcLGASoGnAv+MoEbQ7A+yIsRMaSqAH+x1tYTX0OAvwSG6Gnrf1VwxGnKQe5khBE+tEwjJJnl4f/39/9zH3wYTYp0ApGJBFek79HVxOSqxnvfW8fza2ve/3+bDaKWCouyQIHzUEAlImQJWZCoUGiJVCINFmUxaEEFDxMwUE8x+vSs0zs9gbEtUOt5+nf46f2redKa+RgB44pNjY1bKkA4gAaHdRjNfbr07S5vRmAFgEt6PXefZnfWp411rPPJDtDpNB9bu2gDXFTU/SrYr7QBGv6av3h1FWmwKhzogW1gXz/q/m+bb5WFCh76QhNtX2ZS2gglnsLhs//TZbYja2R4OtKzA3shb3GERZVLC9hUWKH0R5I1M4vSkVaGXRPv7RHtrZOnAGCVMkVpOkConAq5oqa6dF3aFrmowvPvn6i9WDxg1tRefhp/gB+LExjQhBdfRstouIxoFOipBSwYNtfkZYAjWYpznajtsdQCKLYbjyAiXY/PrZ9xbxfh7m/XQvLKY423auq+f0olGBYAd2HkbGcI2cMKYsMG4sAJ4sIVzos3JAAPEiQIwhcGiRILSZAISZEGyZIFyVUIKVEKqVQJqVYNqVMHadAEadECOeIIpEsPpN9JiMAjyBNPIM+9gLzyFoJgQCOgDQziwh1IQAIaUKeFGPtx6lyaX6bbNtD84frK9TR/7ezYRBNa/23bJhwIiwRAAjIgIyYNxMUdzu8jgAHhxj2zwyo+pnlY5ZPazg6ZqjT0Loxv/6gmxYhhee7JeQOp9eApRZlFr8wiWbaanHx8Aq/N87DyuMUV62R1R5AmpqXLeomnfUYUaF6q8Pg+Vzrxtmh63qW+acoKWEkJfXXiy1vwWjPbDnDXJNa+zrWc1L6P0M9e/K11//hLeGYvSOjd04+l76vO1ccnDzs+9xOAO35k/juy1hdd6Wu3PnjcBRI7mib6tHdVc3vP9J0L6zDjj00yNZpa+qzVtPHBlvcsDg6I0/2jGZJwms3oy02LrrBgc6JYd3VzJcLTHL2+d8JlTtfhst0RiMV+dm9V2N/Tr9Dhh2KZzsXEvSVqv8aJ/t05ikZmnZMWZh3rZrXxHdVqDAoKCH6rypYwkUILuq/bSF5XK7eBNDVxpSPixl8DiR4jO1iw4hev2pmBgu3nZzFi5cpX6FBc+p8exw0QGHTKaUOEhp0xYdJls+Zdc90NN92yYNGyPz3yzHMvURj2OofeF1p7yW1R1b8d7ifNtYak9S9kSX0muc+l0mVln6ruE01W0dN1JBSHpNaVXD9U+JQtnPhceW2nuSXIDPuRQz8L1anqw30d6AU0p+9INj5L7W1pvaiwL1Viqiai+fp9Sz9BmvoYiWH/5tCPQvtWVb9q7juYOd4Vj2hseo1fHwpJVWT/WXJfS+uyso6p7yNNRKHw+SMxhs2krucQ27LJnulCezqfozNNahuf8Vu4wr5Q1jBVrXK4J9Q3VRO25lZi3GH7PQrOa5L6Mn9+pLI3VVM39SiPm1YjGuMcj2RY4cciIsvv6/24TK73QzbGL/SQovd+CZ1hT7HpLQ6dFYp5d109S2a+5iF/5MOxnUbXWTaju7l1wkk63ee8EWPGaXU8aSZmM6OOuB0wFnCWxFih8UMRgImHLRBdMLr96GIwxWIrhBwiqgRTKbZuYnrQHMdyAsdJDANoBjGdwjYEI0Q2DHMG2XkkI4O63qaaAEyT2C5DZuHm4a6huE7KDTQ3SbmFZoGURTTLRPxJ0iOiniA8I+E5SS8HfcvcYX0PTOtiSvNmCCyUYz6KxFUW/lxW1QCjR6wXzWuAADXoV5riZLWqGmFqZUFLuT8hwI3gNRukjBH8BLnRVNFQUHol8qle8MR0hH5AXowhQNQPnSjlFFYBqn60pmieSUmaoqKoKqpy1VKqp4jVTefF5kcFEigvzGaQuoq1+UvBFx7DqmSnjAmfZkyAiiUjvuEXwKrT+ATK0FVAMWoElCnDx5OSt8IKTCHSWNoj9sNFwIpliUxyClKeI+nLQM7nWu5kJV8Hlc1GvKugWBJeopKSolTlaPpzKiO5nrt5kn8GK5t3FVTugsotQGUWVCZB5RmorIBK6YBEFegFDLELmAcsAw4CZ4AbwEiGnunUZW80gXiR2aeXB888OvMpH778clvP375Ys7F+xwQKEizES6/ii7fsfoxZ9olUaR5biTaHly5DpizZcuTK88BD+QoUGjMaezKnXFCkmLXdcdfB2NX3a2+UueetVkcIcrpSYVFsgO+A9AF4B5p8BJ0WQLEXZJ89DfSj6MSUiRgRVpbfAVfIeXKbXk3QXIWAAzNlOWxZVKJRiAJpwlGYilkyeDPlK7EsgGygO8OkuVea0943N1qrxJuKFsA21quXc0fIskBQRMJSERPJrEkUSVFx2IO47RgaWDQHcHuRTVW+3tCSpDBUgvSS5mSOJbtWDNumUG3GblmoblUYAA9kIAF9zqL8hSgZY1HSVex2VkirkoRExLN1nYoQyyR4YAolcrpkGJomCDxvWo1QMqpoW1rKhHT3tju06zCUSaViX5ZplgVBEjpOB7hzoUK9C3he02RZ4pe4lNF4TWHj8WwRGe2ZkVweGRCcwu1wQdxHN7rRDfOXf6cuFHymU40lIqdUbVgiG9OcJBSZeB19jywI2jjDkGIyvZ5dQpbFK+vzZbig+8IeY7U9uC73znT5cVJtYhvzoAQJeJ0UeHMRxiOYjHFSkGXrQhXGf6PkR1DK/o0KAEqJvPE7osjSg2TzqzbMekWSU71ztpPj1BraN9iaOZOn+OYH7GbeeY2YYQlxGGA/Qiw2p0MzXKcpeRfXPA8oGmKpA60e07q8yWsxnoLscZizoVw0rZ3IZtPaMxz7oGk1nn06gx0schwtQqsPxQLmguVHekl8EvHnrVDui9Ovbm7/98aJ57d6sn4k4ljm0qgPrraIe4mrMJs2WruHwahxCdecqU8EO0/mod19L/dQiSfjbf+qpwhiV7Y7myqZ4zGsKqU9l8nM7uYHKrWSD4+Vu+op7EOrp1WjA9g5iUqQZOINZ2jdhwykTSmDGXFZrOZ5Fd6YBVdXx+oKIsfzItL4dK1IH2Hg5KhISu9ae+dRNX66uYlLUjQbF7CQwU2QMS5ihhb3S5WsGlKwN7fd7RMYhAWAef6Loq2ZlpYU7SvwhYPyoyTg0z7kcjZhNbuYfjthtcpnNsYrIXMBzIMlOyGRScfAUh1EC1rbMe/k9R5uX+L4cYZG+POa6GSPEXLvRCxgIIU+FC2cxxQNkoJPwEKwp8kiRChwGmdzO4ebFKZBN8lyqgy5akZ6RYNVTzUJfQ6qijBFH6OJZy5PfhA4WMzAlRCci43yPvEyu1YE93+QzQ44nGXiNo3gE+B07gQ7D86FXH1/sYrDMrTKw6VzGuqsNpPAYEDaBr48s8IREoYixIwQ+FFjTJddfDHohD60rPY2Cj3TC9wDDvynURdS4B653OWMnKFvhB7i0Nh/4/ycw7ClqQjPhVrdhgOtabwqD4vC1GSLtcruqqLSi08b0sctZFsxQEcvb8T39CbmS0j1RCvpe6YL/Hghfv7wpL3xvJOXLDakQXz23A6eTcl43QghF3CaYL4U84JgHsrEr4P1inFTvGRjlzt1vbSD807udkiRYyZ+/WJR5pk+tGZV4aDHRBtIpdO9Cn6gC1zn4ga2vAmW8/g7qFtQMuxPaazxBggjVlTC/0ZbEiCxZYMhRjzq1esbisUbPEcQTGdXmNtWVjJWl/TM+zTWcoCxwXT+8mdW1Br/hY8fcRKk+fhw6SOOmf8gw8CgS6SzMd7mWlPpzf6ndSD8xyHrzCSA+x09k7syz10ruZ29EznBQ4x9yu5HxnWndL4ZYEXu3rzb5Y16oYTd96hsB5P6DXdSXztmOww5UnXgNP6PUmrEA+AtXMlVn7HSk7vuU40VJxREOftWl7k5ovoapE14t727Vg5BkFJruqF/lVKDKXCBcR9lumB21r2pG4q0gVyzOnVT7NuxiooVs0vVu5xwbn3b9TZPL6Uj4oqRAipomlegaCblNTCwpFVkZKyHrcAoX/multkQ/r6q3xan09IWA6lsTNEMNnWoW67vcke29VS73NzWvexgi+enG+apJYGNLiMZKSxrCwtyiyRBkWae9y7RteEqaxYObtbCDtOx6j2M9X0mBpZAlankhxty1378EIMLmidBDaoKS7obmb5iubkIC0DA4O8wrwQWkhGw852CyTOJ07kozg44bmwS5CFQwXkz5s8TZwlFZbI1bxGmMQVluFLb/evvvASAI3r6OnmbRsJx4CTTvWQmeIyHMiJI+htujuzdOjigE32EGq8z9V6I7nI+B+A57zmJzckX84bByJyou9hD53g0u4PNTgIOZ5kVB0EZC5ZoIF27wDqCMpR7c2ISFyvdhV0NRzBEOviwkkv4tUwLOXeCwcK7FC5oX2xGToLTttPdDzpM1RX85R+nrLkWxcRoxhV/ZLPdyanN28a17HZb/77yRuLHTJUnZYkTuUL3rwuHP3h34mZyRFP5M0wSi8YV4g/jSq5eoRizM+9NUWC8uv8URrleQd10k6d0LM/Y5fbXl5GIE+pnCBIyXZWp3HnHazMsL2fO5ZeybjIW6slph2zlN5eplEXlSHfgSimyHmRiLg0zriGD03PmGdmNjNqInKpNzHJ1vMBhQnYDv11U6r6nIFDbhFBkFc4Vx00ErCGQOY1W9HQIXQxnwGafWsnujG/muam0Z/if7mX+FIGpXnXXJw5m+pDA0kdLwBfSvrtKFvlgmnOq+8V2cB6KLvcUkfQrUFQyL+0pF13zZd8j9HSQom+YnKnWxH+E07KeDLjxpcLZ5kdBtkh2M3xTcii4Q5ALnMecKm0GJeb8yVU2mX+Si0MlaPEJ5DeOAhXJyzw0iTiexC0Sk+aYhxR7JlFOrvjFtNazAGXFRqydiaPcuMsq9iTI5W3GmJYy4Y3gn5VmQqFCuYCxSsefYAJYYiUxx/7wikMw+tdEbV+9o0t05LD5r1g0B7eF84v7gIfdyhkgCWbwIG8gUURzzBM+MBKftuHIp0i+83GgqoZYxpbJlcjWDkoUqD2FbTfTbC+lzm2MF3SJkQTnfpd9lNQNFqI31q2YUZ6QCrC5jMj3pArcgW7DSdTZE5FCJubxD0B+OiKy8Yk0GiV+qqr/kKwluZHOlN0tweuIS02bj8NvWFugBz4r15zLXhIky7WM2S8EQspo3NHLcrJR9pJgNDz6UmoMiJHdXkdA1UXA/tK+bqb9W7Mh3u8JFuvMDlZwzNo8Yv219F59YC9+EJvPjP9OaiQl7eS1KcS6NMfO4ov4V0XqF3z/JtMcyUCfgQ7O0zrSTM3dajwfv1VXoCP6EjMhTdc9rMBHie/ctavi6WC7JHaRJSk20v8vxEW5FnNY15Hbq/VKf9lxcQHpC/Vf7XphMXsDApbe33u8dqHJW2LEb52EU8E8CMPl1x4u7sbL0CkBJY92TGby+SgwXGj+vlG+yBuV+bJthED1za76wz4c9eIjM6x2N2nCWmqJs3DIFTW6Glhr/lkEx4RhjACqlXsgvMz2R01x0r79wArK65nzCcUK0Pkity/M+p1iTeVfXxYdwvvwP+739QIKjc7xx0uw83ekptb54abkuPhCcFQU7yylXc9Nw4Zw/8yQLUJON3SJxWYeGsFr8MEn5PH1QkmsLKwlBDWTkztdPhtVt+B8rL3A+RN8Ep/Dn6qIrlhyjjbTVgpysG58bIk6jJmQTeiO06JVeVdz8SN4YXWIm+m+2xFI/Gok1t2i18SE39npUd0gLT5c2ngWr0NV82Jn42eECZftLTiHqrEuPHGQyiOEnGEQwpo820I0Ve79k1UjKdZS8+uv0lK8AF0o9/gmcpjVU8d4X/VoTwTZlBafdCgQ88DqfEMmWHEUL1tGUvKhQPwQNr0iNQwfBjSK/xxUoshePFWtV/1wfMMq8y20c2TE182uVX+fT76JmezhsGueueBpzrq+JqmMIbUxYHZ5MJs/3rjC0hlZedx3VIvZsvL3ebbu+ZUbc7DNXKpUqqwUwqLAQ8dfnvB/Za4haOfWte64vYNba7Bb7IStStKQ303YAxJJ6Kz3JufeM+J4Jeo9TiuhHfn/9L0VYLgwQlySPPAQVM5nuZwSY9f+GDiHwlG7q4p1W+8UnoFOpFs84BSLxo9TTctF+FlpIeCBmo0sdLYUFSfuENSYo9a9O7et/+sKJHVFMTypFh6uRqe3HsD6mre00P0K9tHtgrzgqZAxYygE9TjbfDRyyOUr6/BmTs1heFaRjU+SJiiyC6JJp9P8aOGxWX5YL6kqwjg9JeEWnXh6hYd1NujX/gSvuCi6zX4f2HLxDiOtvyoTT0FVlSipCsiVWfhucHBmmIBO0Ord7TqnN+tcpeocAenAZ0P/0d5M0o5M0m7D3hqxXpak2Bh7SRAEvyhNMvO35Nu9ZEa91de/MVZ8L2UaOmYWdl3h9lbuihtz1J1FNSOb0EITSnjSdF7nGIxJyk6rT6rmidhdFTq/YTz9MAjEn2mHfWjuVItUr1CMj3r4HNchYLcwzk8TB1HI1g4X2nHamRcOO1WsY/FdpIP3jo/QJk8QiwNYySAgyxjvACy8zpNhL1Z5nbQA3GrQHzKkOwmX1N/vpEpoM7LVU4aQZgolS36Zcq+j4KOY0yWh85WHitfNlX84PBc6vKJZ4XuJlKTWSBl69SBYONY3x9SNxtY1YHX/aObSDbtu0hK7DiSOHEisep74Wv+swz8PQHNhy+HRPGaiSMzh7EyUjs4XiUecA1Hhhkc30TLx4QF7iLNAjw3W8j1GiaDn1s6Q+fXoOv7pJXX0HFDiqqtScTOUr+Z8wIqdwYzLzq4mjoNcC1heFFxgLwlGRCRcDSRcp/eE0dHA1UXAvjjQLEmx7/RYuonIypd+kptos14Bpevp+l+SaWV9kM9TyLV+orVl3L7qdFIyGnwlWedO4pkFGGwPEnNePwfO5gLQEx7hJdCfRffR0hupRatLo5aXKWZx0p3XsKPYo61pwyAT67sV7sDbFc44+9Kaz69lzf9cyf7gp2oBpRMtnBxmfGphKg6618jdJU2l+DHiLUX/5yaQa1lXyMXO1t+swMuImQ69/vOg/dyYcp90CLualvCWXE2KthQsmx4xjdBNwxbx7/9THoN+bNtTunjbMGPGsBGMpm7n2i8JHZYSE5c+rmz/snptciLLZkJoOxHrO/HyjISo+h2AuOAUF4otdXeAm7sHKvXj2JwG9uHvJ4+hXjTZSTtIa5pyt1Q2SyPsSSEJNX/YJWC9aPEcqU4AuEMs3xcFoyoe3Uni6DycBbkmMKhsxJ/moObSNE1p5/oYosbSYWy+2H7+Rluf3VzEwNxrxPFcextMDxuOTsowXa0t0D5aMmzLx7GrhzFb0bZ9/qTUo0onRIP33YO2f5R4pi+m7jmWpGBKymDiWtSnWkNO5+eQIrS/uiKJgdeM/eJjh0UhGD/t9KerdQ7RxTs9ZGsiwGzYsihFOR4NovP3JM5uNBJuMnayZle3kA5gRYr7uMPgO/MOCWDqPL2e3vlpdmwO8l3oydhduwpjVBAl4kN3deW74qB2+kwAqksU9+kHGi+nf9Y3DMKwjoCA89QEwoRkslb+v/XbrxOd+Nx9Sk8/kAL5RX54LDEg0DtRwa3Lo1TEDEDEVgHDTI07/evJWTwUNfkq2R0cfkDqJ51+ISac2M5RxhZ1a2OyjYOHGRZONJVzkhnO6heG7zRGok+xD8bDSvMlEhiBuuDzxTD5jszAgz+O4R6o0FrRLKVuDK/D265yOpPvDiXf26qha2p3yhPPSRTlp9wbTr5HC7JNsEXOWGKcaHjyPdAONDTYbvcTOkkj04wW5sB/i0P4H4wZw/Pc2rPbzIbl+2BbV4b1+V8oBJWmMPaLeLomuOAgyzM5p1ye+t3DdaDvO3ENf4+RVs6Te4qPZmH9xKfPxt8luLVUYNrIkw78NpHF88bqicvNm4+dA50n5sQT0hz+jzT5GWbHtPO6CAm9acnAg1XwoMkHmR8XiG78jweop58fmeuLp2GCXt2+k9zaDlZN/FA8FoTq42R9jwErsKD3D18+No4vi4ldmwC768O7aMBhq8Nwj5XwrLWw9qFwTrdL0MPOF5x97lHguRu61sZtXivcvDamZ+2UZp5hM9vMcLB4UmOPOWG1xhMy3BPkxd3GlZ8zF061eM0j4eyLMzuszwTjTmPcza75Hvc0+0lsf1LTM3ZEsGtt/Oa1wi1rY3vWTvWtubR5jRDJd4h9ksYec5KVpieYqa1h3l18Ln3dKGrMOJqyiydxZBZLQIvh+8eiEx0zsXrUUyhdYZwwahylsMz+87s6nrfXH5vOZYe8XA+wTrZP4ea720vUkYcdMSv99O6nkjMyHcMyneFitJ4h8k6S7YDQaWRtRQ5qzJYukxv+4pX1Zvc+2LPrkHKPb0AVFlPt3K1G5pozciu+FokvQUh0SIzUrA5BvHpApAJ/ER48Gp3Ay0SHUV+O9OHfEtZWr8fRF12uT/6Ub2gkZju9vq/A6eHU9MPO2CcnRDqeSk4hWmjNbpRdXSRVHzDYj7ncZv3q8Rx2MsM/MimG+ngLcOsUIBm7EODfR4niLIpGhm7gnaBG0bIPzrzll+rZY+47XNgRpab2yeHb+EcxTyJ9tKhPuWSigZXGTMrPqyAOA7dOdrpb0HMEY8pzIufZrBoEhSGF9S50x7Jg63BMD+TqpeE0ca2Dkk3sDY6P3+Si6hiPW1LqiFOLqq0EJ4bNL93rkBS8Neoo7kOknSs+W1LvS7eXqPlG6gBunfhnRUFPKyaiYOQ1v1P8Fv6PIu0zcUDfbnex3/k1U8P4Av5VnvoP5kRzZDgp3p2ykOnEJQ0ExD9kQ/xXohw2VnddSr30BOnLj+3//wqiDtZdBycl8ZZG0vuyMrwQHy9z+8GukRJvbkLvS0o7fq2Vun1jH64tTCTO9BoM2DPKUyc5sZuSsOG+LW025PJ0IVAPUBKM8qUXVPf2NabxVST66SGYWbXas6Ie1pJgBho24q4b9n9QCPrruLGhWqW7uOX2KG6uUTEj0HAQ6hncLCE3a0DpohL2GA7INmxUNvR/rSiTMASyySc1zymh+ykKbZsldexFcidYmNBYfN8QSAY1qPxBVlvkRFMDxQOfm0sGD4FUUK3mNFnloeIsqAWaS0UNgXTUUY02DcmrUnLLv9RmlKTChkDqQItGi6rEnIbCkx/KIp/rinQaJGcCLcrNFCQChkCSF7W+ZE6qQiJg+41ik8l/pYHT14F+6sA/UjNehmJFqTcnDyTjYajdW9WmULCMtxOCx7SzGr5OqrNJUUmRY7hoyz2y3ib39daiyN2Ob4GHEfWHJNJ3Hx81P86MCyoJxv2x/MPS5d67fBFytg7ZSzo2Q8u6aU5iJ1vrmxnmiaaBGjUsLzoc/e0qLbT1lF49YGXPMhH1awBWoFhEozvsMTNroNY9Fh1cp8ydvvugA9+HSm2VTdMaRkh1WMsTsaENOvLjt6+ewDl1Z8maImvltLCAnXwT5EnkJHH4Gm+H1N7See7JrsgBiywUy9TahJu2pYq8m6NluSEHKYG1m6y2ifn2GZWK08PzotDjPRlzcJbAE/faLUqENwIzUDy6zvWA+Monvq6cAlY4avBTsi05u0ypbiSfaCiWzGSYdWtQ8UqMLynK3ymZ1inhjtFryh2pkw/n+/ExwrSsvoEb8dYFTmu3mxwY4nwJNn+XVGYXvk7BPXXE7EC29ODAXhHxao3PCuOjmtSqBuwB/g+deXeU3lTeX4qHYMIDuSuSReuYuE1XyXQqngLwKl1oHr1fprh6+woz21Csofb/Z8WFeCc++5DS03dcfpv64vWkK+roKVYY2h5EOgCwYfjHMYfoH72vdwrUD//X7xD9f59I3M9+p9gffR+tjm9o/dXvHPVvL2h8VZNKa4N1rxiiYUdB4w5omdf8nbj2gFbCmslAiIgggjSTQZzC88MFTqL/Bu4iLICRAYo1z8WjB7i16tHW20D6ufTuPXZJEhmD0rmgufiZ5h4V6AlusD/IPQyIIAdHJB/UKkl1iwryAPfQ/a6d3To6IG4Q5xvFOSrYKzE8JNCd/0mc5Hl5FIprTLAbYm0usrxr8tARxDo7IIUgueeyTYkJ9ED7edhEiyFuUOQ3qlvkKAlaHJ25PI3pBXd4hU7ktL9guH3qmH1Qhh9dov16v31guu+x9336GRyv3832KBs3GF9/nr+bGt88qWxVb2y9aXx7bqyKZf1vNpvH9z9D3ra7fqvW3bCZ+9HHxmxHpQ7oLskY+GvnBcNYGjKNdedUJofli2+TX/B9qfbYHrD9fvm+/glF+Hw4b5qZIXouJ2VfeYxPaF3m1l4D7hZrEVfR9PyadNwNAgyNfT0UnTNjveH3XdJKf5c0u+bE+jim7DcIRGcQL8WfJuSYL3eAeFJ++Xm8ER94REyxw4aB5IQdjGjj4814dL0n2bCkATdzWmuTGOtjFrInQqrku9Mpsb/RAV3469LQVU63HCan8gZnVlZhQ1elLkle6L55Ek5BbOuXq1O29XPbMz25ACjA5xN5t0RyOb1fYVBDrSZJqaWZncEqKm7LwJPB6UkW/Yo55wvwkTWfH6+UOq7/XLnhc2B06Sj7omAsMitQa7VSe9W8Nwssthj2Mgjte+fnOZoXKlWn9tnND+cGJ3Bun8Zi5frb/pZXYJtj2WBU6RhLQ+Yqt644IrvYK/tby9zo87vwcf6g3XwaXFMhV2+WIAfe4ByvzjKxOy6FR2uuUX6aj/yQQzKTHsA0cMV+UZFbv385OWR3dUUSs58V2Iub8H+SyJtlfzlisYm2m8fx7NiWbzv0TA+pwo7owg4svwYOYrcT9i8wcznHvvxyRs+ZKjVtrER2bkV3EX5iaxuii7c9+U7xS9IaHOwV5vF2s8adragEu5ud/YHeQPZi+cl06MkqWy8Qop0FxOAP5QdyU5jLuZ7Hh1GlFXv8xdqtKg80//1/yzmCh1WG28yiBNZ+tZdbHL7N+IjHIqaAtlSfsNygZ6R0lemO29GflJFD8PJZhUmV+7SdsFPA7MRztuTuzEYH4EQk7yY5kxy7iRx5ppsfhom2+BGJV9kX1yA/7dYgl72gfL9UKP+B7i47P/mpgojD88ewI8hWMk91ual5F8sfVfZI3sxJtLKxeEwfX0f0ueK5uLIYqOTLhMvWBqJRlMGtjReJSz3LkhQfY0myD/NXe4196SAl3kGXrR3k1n6k5oo8oat1DNOBp/PutBuYSIGihsBylmoex7A74MAnGW6tMtDZJ1KqnDp81QZ69IBXnGoaQ/t9lfbrBfLNFak7lpfAd9iiaEegiFxhlVxBjWj9gujxjUbCzcaWFOxgivxW6erNUpc9xPy5wyAPtK5I72H9aewhfuuV1ILVxRH+bqeYBTHsIxz5GA9NKPpLpQ6BgZ5kP/zbGa7I7RcLzpPNvEivq0IGarR4/npxKxuakeYdYhZ/SiPegYeIA5sXwPJheNAd2fk9DQcxH9Sn7ayuUp7pp4q79SOmjRx2tFiQi5fgt+aMrr8GO/E8dKXc9YNU0SY/Be9+cn4Z6GM+78yvS7/rJbrw0TskoRLFhOE4LVaXO5eBeaEKe2OTELc9Iff3g9PVcOJ48+ZWJtoYx6M77Q+GT0R+O4RHJflGvY1MvSV9R0/6tSymov6aRG+oREPzUtOSE+23jgMdIMyvXanvJbuN0/npo0BdrSZDsbZBJIKVcai8ihiAW+0E2V+dewNKFwXRlcKYyhFOAiFzfOrMYaSzV1yhPmptierNxDlhRJb5ziAbaOiwuCJ3c0gkrlqye+xsDdKyFFestNtQonrLQ+52+nYDPdL0GQSnonbKXmQ4y1+9bqfa14mdxN92B2jJjoun/gb4BokAqh+rafRsHdaFzbmoVpjqLGzF8n/rJP77svvjxiwUwHKn2bGzOirA4KJYpFyLo1T+g/un2dPPmefoOeWXP4aVYGP4g7eMc+cpsSlVB/AcfLyGncE5lF15EK8GuSOwabrNl1tvLZFx9/Vp0fEV5hBnev2ne/jo6O05M0SJSa2LxPPxC42sdHZJYXnxhrivdWM8NsB4nL0kIGCW9OwN5wJnXvvjo5XbAQYWUDrewMllJyQ3p5BgBeYpT95xxsXm13984gc84zGWhqQllKCWF8QN5CBmdxJY9hQ7Vn+MxLOaKoSa9xlYQMnERP+xJKU1J+LgjCQGD0leKcjETuDemeE2QpEvk5u32O60yGmnXjShqKAANq8HRHhYAPl2oR823oX9RWgJDp7/A69FggXykJbnys4dmeV4ISH8U+GWWpgOEc7P8MdcsRzHTTt9ISuOGh9QEEDMIrmWbGg7k8fOFYlOSc3Eg0GuZRv8B9EZvqGsHokX9EhzRYdkkv1mRhJ5t6HXU2+iPNdVijSBBbB5AwweHkBayvb/MN6KylBtD6URKm5RHB3wUKKmTbpctmVNcy+wbKg2ok1Rms+OlmNpKC2VFE2xph8S0O6ATE0/xB9yp9lLtC7QqSBe8w2GiUudtFJKUb3tgzoD1iCcTOLWVkHPyEFWlkhiSmYmLg3c2r/gATy7wxmhRxV15xqW/87u3xQoVejWB1Ilag/OVodYuQbrJPjTid1bMiSbRGKCS0NxOHJGpnYaEkrd6I40e3+XYEwJuDUUGLL7hiXs+MnRWgla7PS9bgzLRpAsVVkeORxs5ROzIcX7IMmJU8ZqFVBhL0lsKUFVc2SH+jvaMG7FaVJNZzQ/WP9BprS8bw9jxm3TZhuTvQGt1AvGFGUUwOGd3KbCu0WfZ6IDP0JqnuL0wlbxtu0Ov8V0J9bmwCOl9ypdELHYBq45ZUVV3W6XtX8R6agGgYMPx6dXxIfwoUwnWT8dKMcb8eYJzjFwyRcwOj1U1Wx27jVppUzvIClYFQYQvsnlIm800YU14U3TIr06mr3+2e9YTGVvdCVsVLn6xu5notkOS6/lBoUpK5u2ECYmFjFFpI61GFgu7GH+zPCmXE7au3KyCtWj5ousHtgjcZH4/4fYVbIVzVbzu5ZCqNcPNIsOupgdTDerRQPoF0n1vuZXniTW3DKdj0Kw7hDXKRj0pLufpp0iL+azUDV8zbZAoTu0o1EsiusjxWKtgSNTvCSsAB8vcfvGrlwn/986g5uoB4Wabiv1N87IQxP3ZAWMYJI5LTblEGjGi12Va/GTa1mii5+j7NsVvgvx8fZydxlsAALYvBPA5GEBxJCvvk9IdecDvA4duSByDBRyO71ka6Ih4e9vdRN9W1jm5JHaEekWZi9q2w1MW6otuy1qzZMjVdCAmqdF+mC+bux6GTODFTdwsBk7jB5XSaSMADO3dZIc1IjVo7/DYs/RkiV+bQzw1eUdIbwpmdWTrP3dKB+7ExgvJBLOAxHelJtHNCH+7wl72BnMqPrkRjgNci3w8yCfW8sH1dJTUaUpwtfOSER2sXf2t9YrI89uQ0zwsPvqMLDqNAnukZETZWjjY27rQ5SvdmrtD1jnbP9s3cefN7thfLG/wq2dU50dpSd7bqr5O+ftPnafko8R8cfGEo71c2v7wsKD5Fp67a+RwO5PruOfw2g1ultvsJ1ulKt/unm9HGzYYvBMm7oMXrq2BGPIwM4+r1kZ0Vx5Duucpxb9N8WkHnt29au+6Sz9S47rl2HmlqmVklyR7xHKpRbBSKy1c3vL/1O7TGup49ZWaqTc+KnVq/XqXUoZ6H1cGXz7+D+S45b9uI1b27o8dam7WKP4z+CpFgBNWAMAa0AB+aFdQAGCcFgdc7HecGhYfSfjnkhDM4PtZD0ArCMTX6U2BV+9eGMA3w2AqTIRhLfIeLDEFM9jSRm7jtfLhAbWx7iwFnCLu0ObmIx7Y6pMuOMtMu6B6TKpFG+WiXZbedercvScSXEHvHa0bfrkpjL/MvaSDvyQXsrYUbxWJtTxpkLcsAYjg4qgBRAmWjYpEWbwH2KrUvzk6gKIEkEpIhEAMxySv76oGWxHuatnw7pM0V49J5H5FRWJQ3eDRwYWBq4qCDRzUydSwLSQKdahgLxX/1LEpADSQQaY3QBHAamMkkabkb4nDV12uKzAuVCY4sBPa2ExJuZLhS4VSeRE+bA8IC8vsUYA24h2YZ0GtG/1nUNGSMN35NZEBukQAHFNUAbtRJZcT6FEJvULAeJRsFhPhn7MCCBntC0socKr18T3CtwCKd4bQP7oN2wRgArAJC3FGrlL25Q8gNA6dDK8w1JFulRpnSBnKpwl7QslishHlwbgKEB4vbZohvWHhb6Dwg3stjVAI2qciKgIbAPoLZEj6Esg/uo7jAyikGER/+PaUrxVRmfxehl7ifVlFBEvsHKICtaWXcOpgaenHcVpSzxedvKJTNytD1DT6q/dhwGDU+sHeNN42MfPL4Ext7GIw6V7GzWbmR6/DRc/gnbpbpZVjGJ26+LbhXSLdBthdBtKRPpFXUQbCjtTyJci16hZTEidEojRvXIbC7Jm0XE3DG7UCJsW7RmkV1jJaP1+x/ky1tfocMOOZI7MNRSu6LCKuRbBAlBeXtTurh27GDsBiSn7FTXUS3KmmNNojxdHidv5rWeWxnWwfi5TuY70x14cNf47c3brOC/itJeEQZl5119uDKlpJXurPQ7q7jxy7QJ1mpSP+9FAv8Wxw7a5r9a7ucfk/X/pP3O5eaPV3TMC4vu498WREShuHTnmfbMezz0OfT3r93079PD1KLYahmftSrSe7tDom9QfRSr5XTk7l5mCctP+QBcUw6dBPvjQ9uW0xL4cZp1g3ldRmstC+zo/Z9Yuqo1ynNigQ5wzc+KGKdkSX0u5TVX3xZjsD+265rybE2zwoUmX83ZW6zur1IyVY2Pw1kOBdIc5qHOGkF5ReX3dVn2V+A1w7TZEK2/y1w/BK9rEmQLtIqodE3JffwevSxdnFqX2s3viRAnk3zZA/75cz2MDAVnPV6fxuzeLY+P/qLLPAHj0p+hrwNuH4+//bft/6YX1cywMDca7S6DuhisCUL9NKbrhLwB0R2uC76tWoB1Ov0E63fLhdmCkxSWW0VQxilPxfcPq2V9ijunNyy7mtP4zaGpzuHaHzyqazGNPKYnM19POrOF2rb2WV71vFKvm7Trij690omLH8nxQsl8ugOr9eDGd/QrWX/Ky3bpJZnckezxdNKaK6RT1St6oHk/X8or+mItbVrTnR7vWDyrJpxsjuino7PxBL3l01wz/7JKanfSib8t+IHKT2eV3OvsXi1mklTM9H92270c85yXb3UNzxq17nrP3HKETZvy2LvfKOAhNjF35y4n1Xt444CeS2V4SN6scbWz3SAiOHpusMAHVV6CGAVAr3SOjov/bFrfrOdPcpIsH5d1lmKjeySTT9Tf1E93j27Bdk8wsrXTzjn6Cae9AI8MTN/cZZZzuaWE4VdTPT7v2HPW5Ijpn+eVHFyPRmb3q+PzGbRpdS7rUsTMTR/W0qPymO5gOFNqbW2P6S7PcK1no7FQwTST1+YtRbtA9Koy2DL0J4ZAyxinrz7T0+2ro6+F0Mes6k2Ubd5hN+xzrrevEMO3PJgPrk6OnvI+2TZfPLKOdRC3L+KGwnkMaB5c+5vjzZ6/kdmdXnuqhMHuUd+zxrWxKoEJuP561mb+QkkgL246eqIeGqIOiaIMWZCiMnolREKVR1dpQ0Wn62UA7tEpEe7SOCpWoiF7oie6vIsqi4bEnmW8OPT/hP+iZCvqjc1uzfeh+ZcPpigzOoy9GjkXEbH7Ht/jJBwR8V0GKK5L0kp3BLbAOyG+brCcYDhX1gUWAbAQiwlfAJP4IHFfChYkRJJoqRpBxDe8vi7MbTEWKkixGqBD7xVG2iZ6NXamyPSI1XwkXNKaFCDw6dKcjhEcdtXmslAbppiAxEtgNpOO4kQIuQhy1QLov/cRQvP47KjfcFcaNFQo8ApOg07GZASOEdzQop9WGIj1OFEO6nZhIdULFUfa5QXRwRIwQul6QCPQ01qHWmG7KnC0nxbVRfEV6cBBfQPAFagEA) + format('woff2'); + unicode-range: U+0460-052F, U+1C80-1C88, U+20B4, U+2DE0-2DFF, U+A640-A69F, + U+FE2E-FE2F; +} +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAByUAA4AAAAANagAABw8AAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGmobllYcNgZgAIIEEQwKw3y2PwuCEAABNgIkA4QcBCAFgwoHIBvkLKOipNV2jiiCjQMF4peCvzqwwRj5aGHyaBhljLHOdnTs2BiTuV25u1Hu0SDvNTVqKC5bf7FJY/2tfvWUhxyhsU9yefhvf/C/596ZO/MENLIS7fkLWag/SRVe3dEZrMT5e53l+5IMzCtYQMlmeYFA9gLZC4DVXbgFmj6TOlVKwipFmaK64Wlu/+5ueYNtbESZjQXaZAxjCCpRNoKjU6Id+aFFMKYyaoQxYtAywMYxqhTQ/vBPdI/vedmZTYC+6udyoVIBzj3aX1+exrsHsGWqXShK7WrWx5UudbrMrsCMRWlnesTTrfK6WAaWgf9eG2zfRQtUtE5SVEBVcvpT/E3C9vzUkmry11e6UhpapxbAcjihCQ9h0pP85adnbZG95a9SXK7putfXuvdKSmuEBK3SrxW0G+IsC2qNBweGwAAA72iOhQUwFtv+RXfa4Civ8G7GmqvL12C2mdRFYfNNEQkiEkQGCUf/fQ3XR7QxxALR33neIsGoATgNo+Tnh8SQEAYDadAAadICadMF6dED6TMAGTIEmbYAWbIB2fIAQTBgNDAaAhIwUlANYu/+nhEI//XZ3YTwvzvlDQj/t9vfhjB07cLuNmghakaABHRAR+8TEKsSkPJSBLB9SgfNQbNsb65Ft/i3F+VVc22uDZ3drmVx0HTFEzceQoeaob2ub5N1b1Wv1u1zTauP629yC/koi6cUl8nPYD04sq1Xx/dt4S2hvWjdbbkJrb/N53Dytwms3YYAtvGISlYGi22i7hA3SiY8i7pqqDGbIjPCHmuAp/1ZRIhXIMtKvrugCkXk9foEJQb0jPh64OmxaDhwTnywcUbLvY2vnhErvnsQ395nLAGmiDZn7yaGCNUYl3ViPFFTqJ893pqiIh5uSgw3rSisulmk17dQxZQR+Z7mNlqqTeZpidXQ0hYH4nkdBYLwB0E93DvRZtCh3/p7g+hL+3jEJQ6YFS8EbDsuhWcrNCDB4hD0jl/gEcvYD2uI7fkNjSXo+Fnj05VQxjZL/f+VHl1rHAL7rkBT7Ro6mLJOtbs7JCSxzfLXS4kiEsRUM1WWJyUl/+8SfW/2q9rjgV7PhUmKT0BQSFhEVExcQg0SjVGrTr0GjZo0a9GqDYuTwStq16Vbrz79ho0YN2HGnHmLlghKlq1Zt2FLRdWOXfsOHDlx6todL19vhHoj1jKyOUwijQmx9Um2IJ3zmfrkkEchzyfQzp2GLvSin0eQLTSn0hvVlu0BB5sfNe64BacVXzFf13xvWQ/1k/DVKGSbNibAN6wCd2gvuGaVhPGDjYv1Ddk8pkmNtUn2dWR6CR1XjKsaH1v60ATd2HzhH6QBWqEqH2VU45V06zzHIMsdlh+mVeKNGW8zV3Cwh4Yp+Poq0IpQJkxcUxmyJZivBEfF/bvuyF5ktMbL1KmHowzDGdQzqFsoMI2l5yb/Mhy9LA2+CR1NGqYhUCjRFHKn/JAZW/xalh4YzWKBxoQ8jTYiVnEN35lsSrZpwyyAKxpX++ShUTdGMIoRiDCqRpmDcwNmcjMYcQyEmRFiVDZ/aIkJ28KseV6yRemKM4Yc8igwr3C7oZO7gF70Y4T3gAM+vgOnuMI94+PmZUetuOaUwDE2Zk4HmrsbIVEc8hCwm+434zDzCXC3uQpXuWxPZHAMx3AlOy5wMOjk/BGFE1zjTsTHqH/mB9zByQDlHbBCQBusqViRUrrohyFjtZv5kHGCuxUSXAtQ0mxLhpEctVyUr3MWwlcH09pQfHQtmWiPNdJru8CD9kiqQT0NG+iNsW7FRCPw2zGNNU/tdkqcSUVaa5hbBjO/75gu8dU7DFlflR8IbyxrohMwUSYcM2YyfO2kPFiGi0UJNBi18mfmjmA8QwCC4YMAOwPO+hFPiTJUDYs2V41MK5i3OZAIBNpsvhVpedleOyz2oq1iJRXfL/2LpkfvwuRy9K7MR25PPozoePJNbP4ACRCYKAfRGJmbBtGUZw4mYtzCMChq8m46zauZSs+5UGBGkFNqgTF0ipgsCRhPTUlFRAL0xHSkNCRRmqR5UXlUGJ9yI1gVNIhGlYOubXpAL6Pl1Tg13AYp0moAAEiytlk0oPszgSjqxAopBXE8iBWIhFLtlecRCdGuV5Z217mwciu/8r/cDzy2xeqR+3xjSiIC5bFyEKR59x+2/9jyC4AOXmBkSg789rcDynw/A3gH4OI7qwNe6GlA3lw4vLz+o0Mvk32he5vwv0yM2lRgeUnel3WyWbbJyfnpAnOskhFLs0rWzYyclDnvjH+JbEFb/dP6549hLSiG158G7v60u0zzmeE3y3Z/5OcltVUQVhLhPUfD7wNWrVpUI4Joc52QKCnoXuD0diWlpO3JyMrJ21cQCfPBxeC74MHYesiZcxcuZfdxo67cuzYG5fRBLFZ5hQdsaaz10GHqR2DszyDdANJRhnOFu/VI9ACmFT2CTXuPlpoPxG2CT4U9Ag8as699fI2AYrsvpXgBkqkG5R4daD1fFKDBHDi2tCNIOGhSIQlQ2KfS3Ge3TjCQKCl1i5CGAgtYnBuj98X5HTnNToAg+PPbBadQNYUksig3QEkJJ0lD1LqglfNxpx7X+TJjEqihDJtmXh++5rmF84nyF84lHnshMJZg2x1FHt8ZGDEi+1H9AVtVbjA0bityQi5j80dWNoc7TlT9P559D+CMOVJ5K4QwWZBZYk/5opa90NBvwJ2ngFH5MbrmhNHmxy0VQs9IUYSmy4u4WUJpGOKY+1M1laVT+WqVbNCX5Y9/G8O2qZjconuBk+uey0/7AU5OyNHADjXwBTfnYWEOigvIUED/iQIvB1bY3zghjd1CWGtPPhNKHG5oPb4tkSwLR0w2XjmjHvvhaWWOHHp2UwqMSadTsdRiBxEfWHjTBzk///7VfmNtjHwn6dXhHeLooL/5i2UNp1/Pss2IViOFleEbVasODTurQba/4ohhk0stUgGTsJserYfZyyuxUD8Mb1jpJQIbS/u6/kWY4KlvfGIUvBhQvIeSWZybh8IUJKM4y6hz+ZpJw34lKTKwWc4XBwrP6mc4Bf5ErLFkUtiigesa8L7RwBw6UDc/BLnuwfODrKmg0ySAa+3QF8uNh71Pnw8VNU6lY+vDUSLPBdAFOxRRvEWtpezH+LFPmF2+KXkgkhCioAUHQ9pndnp21MDWYJ02UC1BVCvFcWBzMnWa9Ao7ocgZFMSwCbyA8xijQp4wvzQn5LfP4diNz1UVyN0vY0kkZd4dp7tFjs4NMou4+Ja4MDxCk0d4MfgZQ9nAd2HyHxIuZ5QH/yVb/U1I8bFZMMxovqxotGJ/fb+AK+r5CnFWitF5bPrIV4tZuxJdD6b8zFdy6wP9SPfOBzB4Nw8Vb/3jbd+XZ7OCWr1I/kkgHPhfymTnrj5Z4uSMQMrvD+2H35Jcpy7mOUhkZg46bVeNx7IslIKMLg7e0fM/QWQJjdD8MMIGj7hTDOo5RVB1BXLSYCGcXhCUpRR46DOyHPmRYI83G5+MnTBnONsUpiAp4COMFMHCkKIZAe9gCzY08X37u2c4noW6RHqsTS/dHM70fiBaUQjTbaMOV86y340qD2RUV4WcXH8HEfKY6ki10byVWCuEyMiyNx9vom+1ZJtx313Tr3QyS/oQrPmg/sqIP0HeNdN9tXWsaTH7cM3jxKVVX3HDGtEHjOJ0JXbam7ybiSqYtn0fcXX0qKDzp0M22iHXDiYoF/eoNOa5Dcdi0ZjfXfPi24ETZnsbrSFypmCWFyMWz6sFkTSFxkKiWVZm0ls8RvhkbZFbOoRCGRHuZPvyklU/o44qKxMBL7Vv5ArHDLCve0pS7xbyh90IP453DoWDbzSQV1UQD09R1e2lzlCjpCtHmFl2c80jP/2FkmDRIrI23CYtVAdZYEextEdF0UiRTC1Wyhu/KLa6modmMTf46cW5/NPi129KA2pRTVTD1vHDr2QfQ5ji4wQ1LlGfHs8s8Yl7d9v5AMvhI06XABYvFarjuUDyEhcg0OXo/SyLgCN9/qYtfoL9HpwSGpZTe1ph2LsUHKcMcMrB8KdWyWdSvcvX7LbYVhNcyPw14+LWMivSdhBdnUz2k/S4FeaB7Moig6DHIWQ3iWs3bwRg1gDQKdW7Q6SNH8FGwoLA2/PYJMQcNaF67dVz8cVhOpEFgBPzJPaPyEH1mL8bN/+RuYe1wFYnvI1D2JiW7IMPwUm4wNESaVPKCaMMcHyUchsY/Y7At949v/XrDvWUAU79TbeWWgPA8FaVB46MNVOBLuOVu+jLXUgT0jdMes1DvW4n3IZ8kQcFtGCwrlDYeFZs4BT9+GP8b8Wxymc394GN5zmU5cId/MIf+g7lcNrTYIf23SSqdoEly3a30ncLMOh34c4gj5/YLKy3hkPBGtb5HFYbIkRW1hKWkasHtEJlHC8/KaKK2Vh++ttUJAJ5w47cKzUBq2Nfsz8lIfWYn4rbV+kBwPKo/VHNHRoDoqV5arNU7/aFpVO5WiDzdSY1muIbkRGEXACgb4DWTJah8fi/Ac1KuTpgR1FY2e5J1fdnhP2QKld1UnPcoK0XbKx8n9C5pQtwbypvT4spRRKgZxx8OLFC/sVYPSCdJ9pau1pDl6AEa4oJFxCsQ1I6GDehMoTHJxdayGGMZQeo/bFMKIupZrz1czSo4N4g2ROMLjiCb3QBIt4gJTKk5ucQRZGhcCnSMECogtVx6uiZ11Ip4V1hSB4SlXrFQstu0AWid92GS3NVsiXBaUqAaykQV5L4xyq33u1rVyFXXEZqocu5QMHxmISQR88ozguHNDSkKKn6fSEKmRLLvLVK5PivfZ17yTzRSx7YFm4aBb1MvPSXnC5Dy03/fy4+HomEXiVa/pBII99nk+ZThvVccFpED+9YR9gSZltfaSK74y+akrx9Yh2RWPi1SLYKnD4gTy+OwXeE+sE8xMHXlsil6rwvAnTviMQ6JBt59AnzinKRizmb4pJ1FclB3DKscCcSc5FIuP4tqN9Mvh2zh6c6Z45vwCV8ryqFiqDOOiT9OYAY15wsoMuQ1r5Zor7E5aCdVvK1+7IzsW5YR6/0VlNXuAIa5iNZleAi65aTPZTIBAtPtsR8froOr9D8LFUl9VPjrlXJd6CQKk/f0bZ983wErg9W16NS0kfPI/7n9lmr+5EqNzUAyRJLyZyvve3kvTzRlwf5uyVzRYt1lH11ol4BUPoOJvZvyQNiLol/jAsONQ+R/MtTghBfKCUZ8k4BuORgRBeYnyOpA/10WhlZhtZAGeA4AVb9GVeDCPiV7gOmJbRf51sL93vAA9DCIrVLqn/D3DcEZd+DanLJCZIR0UnhkB9cusenVH3jVKVcA2DgVs5n0BboOodNxt42rh7Tvq9+c6cvPPml1+Hux+QHw48wK3/aYBWlnI0Yhec7sLfUG0McLsKZmJacAxXg/BjH/pAe6MCOLFCbaJ07vo8qkbfQFrx2rc04uX9Btg4xlspmhGHvT+xEpD0THnx543DaAMS9LJaKJPsFpnoiQH7paPUtT941O1XQCxY/kuuoLdtmJ+RZ2dU7+fxNqJ/73wrVB7FNKdRA8i3/SH8EmDXTAIOTvb0M+oy8mZbtM2xpMGrFa3uQGC5nrsOx8Ksdga/qyVto8Uq5+oC+wqmGZejVdUivLBN6dtK54ZTzS6BXQiszfH4YDIEZEbWR0rJtaUopwmfpA4WLNhsNQHxTLjVU0sMvyg8BZnZOvJOOy6eceBfg61B3mWMA3SQ1z4y8hV6rGYw8gyUcPT7eWlZ2u8QEBmcycu6w61nsTJj9fWsYeqykj+hVcsuLd8srZcxrSrXG/PtHsLX/UFp9uKSXxJ20kCAoAKqLprvUAinuruE+6D1m4SOlktqPspx3W1fgXdCwe3zc9QyoB/k2QaivBXj31BQ/RBuK2HTulhElUNI9JCQV8xBgOTBs5rxqeFUJaabazq/PUL8MMM9zKAJl///FT5SFqkuIlsuxFlI5KpH4EvHO/2X8Ex6ACIc1YcYjuw81MlKee/tATydl2BewDtr2akedaOd2CsDJiDUqbHjqniuBki11v1Z6c0YpWL/1ddU2ftlM+h0SJY9S+IyilF2AqO7o4uwRb5CtzhotIPURl66t5cFgJfk7UXxtTS0MluRbZRqLxKU4QB/LjZM/kpJ+bbU8aY2Cczoc+B1wuchRbYM+QAPTskKjlnrDVry2u1xxN5wPDx/2rwLruJw77DGyjNlCHzGSgrFJAtb2I8e3Vki8ulJ4wvoy49MTQnU4hs7mh8E7MDlKrae2bV2cVDwa8gkjFgTINVq+r1RwsCZKqBDRZwtZ2FWaGv9YL1iepfR9BPu6caVx2fFIBWYGr/r3AFDK3RGlCNdk9CUhCRh+kUp5HdgzdgL/ARsLd/l7zuBSsW6GnPdaeVou+/xhIfLzn+QL0FgvnQV/Krh6mMLtvuUP44+Yld26vuulhnxhCTySndpae9XTkar9vNtuR6+0ooFSPQcXZnuD9u/F5qJvFL/wHH9EHjic/AeymjPB9v6/PhAn4PwwKXLrmqXtG3sxEdDLuAuLlISTxltNt5Z8VXGVvrde3iWdaGPoGaOvc7qv+nRp2aPMrECYW66Y5gKfg8O8c25A0XBdl0KrJDug0hsBKiT+sQAgAG9TiLHELMF5MznLYOQsNnms9AW0+P6IzhrgetcKZRD1bE1tYYW0TyAs2Rw1kY6fwS0C0MQqEKP0gioS/1gW2J3q4hT1Z92js+ml6KaiKHNhperJD6onuWeEm+AROOyHhpa2liI4/nIwjDHANR/w8hr4Kjq6vNr9oinYpIlr2sSybpqolpbaPATAvrPvebwpQdfe4oIlFG9DNXkOKGk/H1dAZdCLYuJdYvbLC4brtf0xDOwVz/QOM0+4DBLWYtkcgJizrltDzlCKA3pWOr8T1AClbKDGP8Yj8Y9xCWHErVrERx9TSWChoKEzhtH5FziYmcDliWAKolptHwRaacfeTUkVuqnAkeEmc+PQ14auNNhUqsDOFuuXv+6RlLPdO1DwfZ2D1rjubBZ2jRY2UBLZTRDvrmzWHgO+XEaXaPcsZDOEX8yFXODHRTcVjDi9PHcYgxPiYlt0U3ElSi+2VEh3ARvdGeaQ+hpmD/fCgPFGBhDC6tNKzhAL77Vuw89FRzXMhIzWm1VwGWX6yrog6T8hXIMySea7V6dpKqFaqAOsS/lWgtvwmiCWaioIhMpaFLhq6pLnTq2jNebgRMkEMX3/Tn8ov3NdNyBXHuOi9CIRuqmIyx0NdBgqVFOXBdpVhtG+6z2gp1DdO+ma/ce5B06cNaak5mJvwdFr7RSrgCLm2OccBG/qgnJvzHtBGgYKjpewyXGuvIgAVN00zX6oSE3939eDlz42q+7+DxQiDbUoGy3+1sbrQOmFahUs3Xur1qFIV4nLKPP8dQsEWPNnIQ54WYdmfB43CKL5DCvStIV5nYkk7w7zvlD63YBNz6vtIbYX/XI5IDqElrdZ3wA34CJ7+zqCJ0Ydq75d+ffOoz2YYkTwAX+/HGAdr0fbICzME47KoyRFdjg+6c4TYOayrDG6cbWJiEIaE5i/yGzCBuTg4SFMAPQi7NIwGgHA0GDHNnnTfQYS8V75t5C7mHaxYpsLRpvg5RHnhMRiWkcUqsHpZZr9IvSL8erFPdb8czvMsrGX0Kxf1TX4s0Tj8xYmyAZwyvk7uArFO4FdlbUyh+H4rFokE0nqplUS6Gtl7jfVpiF7DOlrk8n7Yze+IdBlGEepsWlwCeL1lOCA4Upurs1TYOetfczd//5kwWKILZRzR9G2ApAdw+932VyHBZjebbKzO9dAu1UGMWWI4CN0v/yGa6g14oN5WqryMEGRHUZO96gEGo7H9LL/gWJMw0NCEiFrsbGxHd1UoMNwk/M4MN7Umwn0aQXm0piI7sHTrqugDMXeRC+gBhaWVhhwIV+km8HVy8l/o+kRIVFbVWBFFLmXxejgr5fH3JCwXMC0vPgX7JFu3KeCj8+qQdhQSietxoPP9WxlGFBjU/381EONsYr37q4p564r38NPojXpbtY/5VB50sGsGA30deQRHKf7/1RKM+fZcbPHQPVgwWTL+iZOqh2vBO7JOUyFeCa6iZ2I5L4ipRCY1OKel+lIApL/kpSMP08u6G81eIm3N3Q2gEzg645UGyXUnoDNi4LNoZs3Je3W8a+8lBN6Srh7VlKaOWczln229HkONsY/c42vHx/O61xCYi6F/PivnTc6CFT7vGTyeAYPT2VsCqctEr2Taxcdo+AwuPv2jTZsQD0gRsSmhEDRUHWYpBs9rd047ZDhOoUQ6VU0TXz23S4ejgYjdzxacYE8QAj5L2MDwgsBEyG2ULa7nHU5IDuF3xdcvgZHQnXRFsuSGRq07MSViehY5AHS8eFBGYCuuYXaInFw3ZDsyx02iBbO3SMKqL0ivrMi8CwJA4r30qWKqJ0lmn83/+7LxufUN+CHkcP7HuXyaYP2ew0K+ktPpamLbe9sfrHO4XEjYEtJgMrxQGl3t5UHqJxPa9LscGSgW0pG2FiuZgd5MpgyRAqX4SSVUpGp+5FNWqIQdhGxeIRIvFHCrG4opZIqlXhJqZVYaZRW6cUQ2JW+wpfNKbOyKLvYSBkSh1dVsanTTzH7UlZljFxlbedWxbSLMjXtozEDuzUM/YHgXaR71KKEqkq7DBXfpy2MR/73rWbis1r9L34CtoD8aiXKg/xi1dQJulRekf39iD6Vx/gY1lahv1zFHVlQDlYV799g1atSPJmVH3Edz3hxBe569cpyQ1WqDG/zzHJn61ETK1k+jI9u8uGX4j6a5lcR+MatEf0hNKzKrm/y9GRzfNPnS2YaZkNprrMmZ10+E0PfBfyvjV/y5fHZfCz4oP81+1wrrUg/+D1lFtXUqcoMNEjf9BaV0b1dWkL6W0QDoPgHTpSZuEp5V2du1Sxpxg4MIMc3YRYCukUTn7Lf02OjOfGbVKEBwLs/6vYCPk9nvvjd8u8PonFjwchgAAnU6/5nACOmSjP/33wHQK9bbvXAuafkJNLvoMyMJzOMXTn7w8oHT8G+tuqcM+T5B+zt7ZbZOpoFVKfCN/iHEcKXq5+zlvrZin9m0c9oSI8XfpxiaFDUEQf/VEXJ0fdv5+OPtII6Vgmfz8hvqsJ+8OnqOP5YRufnpvy18u2myM28hv0SsW+ZeDglQpsiv9HRPtPev3jTWyW7Vn6sFnLvBLmd83Jf4GdS0+rYv791zp+YnHOK44M5Rsipjfj9EyXnD99EoOc4eiKjbTswE47+yzh8C1uuZ4rqg2s6uwz09RCcD8YuVWcNTlU1XJvcbBxNw+Dx5r6bF69v7ZRdQSc2NdJ4ggQ/2FxfvAJWql6fEhG0Gq9nsSaonu6B7IUhefSlFPyEjTqgnnQPmuh0gD9RVETvOlkIAXVCPVEP1BUhIKs+F0S1PvfNmTN7fVs/4A2zMSJVvF1OYCbpR2yW4VAeAZwHtGsRpTlguXXGPTocdyWuFQl7w+I+912r2oif5T9p4ORga1as2udVh1FL3V7tKq7Zm8o37rRNQHG2wWbvkFv2VFO2x2bXYZgSqjEVS4Z97jSzaHP4SGH/SO+UsRizZw2ynQnUmnrN2ISPbOaFSCI30qo2NKkjpqSLqhZNGeXX7lpBJ2Xb6Xmv4R5L8vhPLgmPTJHFwEEsg7i+2i0AAAA=) + format('woff2'); + unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAAMwAA4AAAAABZgAAALdAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGiYbIBw2BmAANBEMCoI4ghsLEAABNgIkAxwEIAWDCgcgG3YEyI7DdHsjE9IUV+CFDh74vPL9/MmgO0un0soqjWt7En2kQoCMtXsRxyxkMqP9iO6NfSiUaLJuoRIKnhI0+ImbcWOB5XOAFVmCgxZQQmuBJRhZtsUCXm/492Dyuk2YZJdkdApZeOzyEQgKOwDgRjASBEEBVmAlgACtOHEhpjLyyrACMAB0vaLa6cAw5bc5bvhA2uwO7zXAyKPmkYNnAJgBxLEMDxFLqVBPI6EQ/daTr/QOAgfCngRoZc4UZiL623qCkf/oHVsfRCOuAIbJyF4ajQQKQLmQhNBAA4aygH9b19Xw4iAC8DkKM6WrYw/ABMAOWEAamA7sgBWACgAUSlc3SCmlc95o45idYD92Qt/+5gF19v3FALtB9+7dq/h6/Ljyu/zzYfnngwdlHxO+k39nOcO/e7nPf2vCoo3HVlmNTdnWwW3JZffuVU6cQX14kb3qUGOOJ+mjP9iMeb1Nivq5gXpJUWm+cmVK56e6PjI2uce23hHlG48vyDvym5/5q+wbkjq90rN+z53D6zXqmVUPVshZoVtrZgc4vleS1NNrni6VR8I/vTrpzpPwu1+1Pel4xBIzK16W3KcLNnVGl2RGZHbPXBAvhw4M02Ci/t0BBfw/p79XS9V7CKAMF0++DK9rtI/7MXvGATjz0TEA4K4oef476t9dS555BAoLBYCA6ei/FSzVgvg/cIR45gpTaLWeLiB+oa4xJuTks7r7/xwCmCzlpoJKALCDQmkyEsCsN0mELUADghGsGgAF6c9IXkabDYyqg6WMkZd9z7BT5gaphhhqnOH66aOvkTQhggQLpsk0xBB9DNSLJttgPQTQJBtoIE0JEY2wb+1lhF6GG62XngKUGKLFECMNkW2kZgP10+M31GZUwfojwkU0uAcQkISKFNtqGMlau3vIjjRUjMANjYkDNKeouYh7CRBmuD4CHQgHG6GXET8oT7ZU6QqUStddiABBJPSv6P315AAA) + format('woff2'); + unicode-range: U+1F00-1FFF; +} +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAABX0AA4AAAAAJRAAABWfAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGmQbjEocNgZgAIFkEQwKrnCmEwuBSAABNgIkA4MMBCAFgwoHIBv2HiMRwsYBgKA2n+CvErg5YHVUkRAJo8aMqlEXjSMQVVUI6BratcEu3sY+K7ZekZeA+A0njZBklodqv8j3p3tmdw+YExmNDtAheGKX00EoHxYmFQmkWBjkHp7m9u9iY7vbmoqRigEWosAXkErltiNG5XAoTBmcQQn+AUahfoRWfpmA0V8wEmSBYEEbCfqjFvQsfYGTMtEF8B8A/Q/gH/Cv6Te7j3ct9L3rjt41CA3K4LLvWjZl/uaX4W9oNRdKPr2H7jgL6jQS1ZoqpSsOBRLXhEI4hwUJGhujCVj/LcbY6dJ0qD2ma4OVuMgfXDi53SubwDhW8tKexpmpkSF27EEcOWQ+hyzkkMUc4mIyd7WCu/HmPmK5VAppTwWWnVdAgFxyvMoF0LPPDSWAw3VF+bnA4ab8dBlwuD1ZIQcOoNtuyJcDHgiHPlDsNFpZIAmo0nzO01UoYE+jI1djPK62RW11i25b2/4sa0daU8CIV+Tk/iiJyuiU+hla6b4Ymsp/SdD1c54WYrICuy+DAnm6W+LBnUx2DVCOxqn53kqk+eZrgq/O7P74j7aIk+5z1vtg/Lj/SWHqK7OfGWUqjh35+oQWvdQg5a8d64pqw6dbvqMlDoZHj9/Hqzc//TxeY5mToe174gl9Z2qQ2k6OWKlP6mwi72fEfM5dCn1fuVRWDLlqPpr+5U0wKzsnN69AwUJFihUvWSYoW75ipWq16ukbmVpY29ja2Tt6ePnhBCWL28URN/PpHCv5T5T4q/x99f/W/pTgmIFEvTPrMyTHpKDfQEq9k9YnsWzjXOPAqJZx/QNGx+0O2H/ieADJ9pDrobwvLQ+NPoSCJKiS9/QinokZEfdBwqSUmbS3Ml7L+pQzpeCZomdKxpQ9V/FIlVrNsNNnLmdun3vUeh3x/dyv1v9zsohPMc+kvQPJct4o+FT0qaRH2UcVU04/3X70+sz3R/8fcWJ6pX0AKeW8UyJS9vn282uv78//n0kRUyBZwZSi7rpTUKV4vGPTou4R915OoDAtpyEtOMnIj2+88H6FmJjZl74WQtCEkH6QWskdmBHdVzXOyN7z9J0QnpmAT/CWEBf3VfQL+YMeADgBd9lWQyarMqSzhjI5ZQpmS8BMgHrJp7T308pXIEzBBP9AHPaSPg71xrOet8zDhtfrai2qaYvr4jS8hvswNPU21BZfBHfetK0hy+KIMIwZS0AojprPaRZfjs6DNz2+orBJiFuI5Zak3ErSdxWBmPHHBYPATjrPdEsTM4h3IG36hMlLTnJwzpsLNBsGASu5UIdIzeLJQcz5o4MnTE7iJBDQsrij4tG6YfDJJcYByHmkBCAv1CBxJnsvRfuhFDugJdqgzd427d48qhCZN+1GA/rTfSkw7UxPJD6W0QDoeuLB7D2fd0FEAICiIrQD/AfAjbMjDYhALwDkWf0UcRHEa9ajdRBQ5Ki+e9+AB0EPVdTE3miOU3Eh7sajeBLa+p941D73ztgXrXE6Lsa96P8r+Lfz37MAS4U+w/5/s/5NBzG0GmcHN8DFrraJCQ+mvrOKJzPnbjxAIAtBglkKEcpKGJFw1h9TaZNerS07a0UhiEmQosVwEkfKWaxFFltiqWVcLBf/uycfe8PFSrwO3r+VK4B+Elh8AUwPAtP5wAK0bRDQGcBbcXtDy6lIWQLCkOYkCcv3g6hsTUcXrpMjTORn8GfKQH7nOEwmi4WyuJiQhzMZLCbGF+ixWPosNoriOB1FUCFfD0VRBttQT890jglb35BpzXW0EAowJtfU2UifbSPkCgzNmJbz7XEzI0NLPofiKqmsHIZMys2BZByKE41ReBG2iZ2AU8nVGkJNaIpZr7AEaXc1HanTSlJSRXFGexA8ik/M4gqxRBEvCKXcRJztgkIimmoLcUWRVZQsJWYlar9YilrCWyoR8VCt02aXl2iHh0mdWPNUrBkcJNSU7rLUDTNojVjzhJQNir+hSraaPs9SYvoeSSElwxXZWE4WVpiDF8pwpRRLLMZJPiEgKc6qKE3WnTBWl0m0cVI3rJM2iQ3zbNHpSJ1NBYGaSK3wa4txqnHA9Vy/eUnfss4nqdxsSqq2HrRJ8SlJtUQlicaoxFZdALYeaOrz7dRmYjero/HM/6FM/fkKSY0Dun6gI/MG7Pr4QLoBiqPEKD6FFxWn8ospFslWaock2mFSN9YDi/D+4KskQuVgtHpqnI7CdRqM5BM8iktwqDojxBRnCQsV3KYmC3OQDCe7YdNHrwgCI9dx3RhJ4gp1sChTFemOG1DqdIU6HZmIS9XjRDQWpx3iqC8bUXiebpgkSfw0oAhWVw3FrWp4jAnbNQ8SaoIkWJSyyaTZBTcS3/HXStQS7dCsmhJjGVJRd4aMAzuF0jw4ZpuwWbrMjgdfv4iUNzS4JhuTkJkUrsR0XDG+3oBYIya0hEotUouDNE8JY/W4d9LsBZZRTf4F4itiol2mQNUp0XbIfzNxM4oh4UJXjYaQoLRaUSwmKCLN4xpbbE1JPEW3SiQT6w5nZnJIitCJx2JKjGq11JqUcZMfF3PVyZqng+sTg+PFXFudZGiTSeZAi2niKOUhkzqsDiDU/lMPSVHV4iKNHz6HaFum0koSlBglOXN1uYMdeY7SYhVnxERlA2o0mocakbpFEqWzbbWfjdPNbRLDmShMeshEg3e5EmqrduKjzjA7EWG9H5lm4p6eJ5Fisi6kdJ13JbnAeDC54aZ5bLl2iLTSZRGVpCH0wRKyQiPdFL5OWfKq5ufhPGqKJTUvwatDxDW0kHxKSoxVw7FeScSN4Ol4yohgnXYIkyt+XOxE/8hxNZ4ULZkt3rEG0UNQSl1xLkl911XG4dGKIiQgQElHhRXUi9RMRie5Lq0ZrMOVPLcbDcdRdwhCTbArxZHRTdaa24+0Q6SRzsONo3UB+WqNOI7siMw0r6s6iDiGaYksKZaYoPU/uExyH9cgbq0BJZPQIzOLIKm0mC1WP1Lz4kicyPg6avBXGCPDs2I0/S4urkSnnVoiic3CqFithCBvz+0BtFM9SLoU0PT4ZX6bPuKFY80IFL8DikfAiv7N4beou4s3nmoX0E5d8DR5qTwG3LmaUz+Bl89vs8/w+2azk+2TzjHknB6LybHbHbH4XLDj3B4Oxd64rnwjMv8IB2w7UcrZwMrOlW1BLQBow81pMcgds/pyruZUkdnRK5EDaaD4sqLpdj7CZa7m1OXcDbdmXwHopeYGl4BVi/pq1NiI66R6Jnq+tFWbR9n1AxvxKe5si2NPy+/iK6V6bgpy9FXt5vk2xxQkLSg6DSjuFlXksHxzrjgzfoz781hE3iUQKVTBD7Zt/IN2hKb0Tm22KBDXF9xB1MhXS8YskrXEp8wgLf5kK2+sjtZzYHAfsh15UlfpxJ+CvWg3657vRi6jf5jO/V+4BcSsTFk52TOaACMzH3i9/L65H2dWHfUBh28e5u3gFm8/tA2JBmCjEfRyDASX9B9Vr9lRP+DYWt6xYHr50Fr1ALS8a/n06smgO30gRfPh6au5Az9I9S8lOupHVT4Ar+ttzOpppoc90pSzZkeHTA6CORXhVdCNXdJ/OAcMBEcP/Pe+thaphH7bFfM7az/neB3+Ye/LADndh7lRWZ0Gx8B1CZnXOAq9uHBcWVSdhlTDN0cMu8Hxf4xTv7tmo++mYvu6nQHs9hh2/ee+exynSyOvfmxawD468uki1/niSN9dYDLulpHHjHJkdu+Bu2lJ9Yyz1t14j1uLIF/+fTNUFREcrenk+Q2BNg3w8OJ//rcA/oNueLmBpgfyiAcF77k78m5k391pU4MCWzUwMfQ89XOkAsw9tuPqbj3Vyjmc+njkkpPzpZHTg7vqT7915lzqH7kAxR8FgQcEHRwDgXefbjpYZH/quFB8am0fsKlfwvZ1AG5f9v1uWve7cbnnE+SbJXMGTXb29q6W3nTuu4IMIF/NGd/gKOZaPMpy8EaQcZuBzwGk2P1qVVoKfB39P2+rxy0Aq2nXDrzah1yg/2U6Fwi3AKeeKntFVb/z11MdvPRTv4E59TvN8lNxojyfmdY/R8o5Rfc6xaDgMsdAcE6T83Fn8PkxtuQzfIpR0zrXoHX+RpVnYnt5GOUIVqq/7tYbqsn+wt3Nbfzlb4OadsT2xFXbU7tpQ9U5M9y93Iaf/zaqbUfsz19pmdA/vqu3hc0Yw0/SJgZcvVr12/feacT7f+3P6o1owH96Pxg/eGLeEmd8WWo3742H5QdDn+wrvrLHFloX0xGSfTmaw/ClezGzN9WkGmGpbVdAcVOdqNfI/htPqZcD//j9zSrkODrxR2A3sgXen3Uiwci4+YVZvQZqgucuFZZbnO0U6dUdhbfCvRsLXjBU9EyP1OgDEZWb4nWwWb0O+Ni5MXwMijwC9vC/MFUR16sRbsP3HdeQE3CnmeEkFjz/D+CeR6/RyHqn2tJQNBIuzz2QDrXCiish113PHKZXo13vTO6DhfY9PyMPtex23iXNhviFiRcYm7n3TP69h/yMyKXi+93cA6d5G1QXdNkseRF0uATLZSZllSQjMqhjp0DOGPtOVeUaVAZdOMatYK/PbEhCDwLTg+CKgclNu+s2FayIh13EG3zs42mgP/ueXjvS9iNUBO1aLmwqXbUFEivCGjnSnV4BncFtpsIbdqKv82360UrkcpX4I3uPveGZwX9aLBeE2EVt92pah3ph1ZLVs6FQBXrtocVdzo7ikVxOJf/mJEBfbN4fz4xmBFFx2XAOdDyHJ+kE3KP4xZuoCsp0aRUzf2Gem1zjbR1agKymqZ7+col5/VdUfRKuOQ2g4HxpCpxbF4tHCvY8pg0A033Ap/eUYUnfy/perfFjZvDcrCDTB76qxcxyZl3vobhoYVgU06cowUou+n7elp+4u8xw7yBxSKppHTC2c9ffUdt4EWlHDj7Rv453irvwzrXiVawf2uAOZF0Ho1zw6v1GgmGhEm7bEvwOOQjnhz1Pbtg1DdO6kHNM2jsomOFr1r0k2HCN4Vl34x2cDVAQxjtHr0JOTM39+NdjI4NtcBpcnbo3Bp7BY3cD8x43RrmjowEtKBy2WYnX+fP7ZZCsDi9nFDgA44l33XN+5diJhWvLhHza4cENkcliK8XmMJMBZr+tgrf0JfOY9foSvPYv0BEzttjH1JzJYsVyUnfK9wEVMK3bCm5MneAdwWXrf5hZHW31zsbXBg3I+iExMFXyy3c+Ww+TRscW+IhmCwwN8J0XH51YIXVM34+Ksc7W+J2RPXAZVOwAAvc118l3ORrQQyK83zIOefO9QS6UW4dXyGoqMGFzl/5/rs30kCPY7sXLk9zxD/x+Vy+aD7fJyAfwVpyRLKgr+XKnpAS6hKQUJTG6nc541RxCdsDdDwx+ZOTQW1JP5iJF0PEBi24wpzPiJ6RHxzzxI6DnZpakIWXo5SHTKx4WnKUpYvP9rswq1D+nUeofF6PyD2b454YZDj9acYsu6HHjHTjw/2QNCLJtFsC7Ogw/Mi3eL3V4QFsHfk5Pv8bYiHrTV1tZfXF0HF4G3M5U7spvlCEq9PoLk/OMmBBGnqIiBc6G20vJaeCZ2paVV8ciAq2PWZSHL5YCGZRxgLUnp2aN6QE5MNV3y92LSuODsv2hVtqQgm5gwCyz3twF2W9GSzkVK/sg2gnk+EfDB7m1AOK8NH+1wnxCeLwNr40RV5VkF88RlLNl23fnGhU/YmXs2bYO2gLd2Cf9nV1pOhu1ENEnHnTZpFy3fCekXaHXFran6J3le4HlnW5YVJfG7oM3Q38hXmpX3Ak5FOuVmA/pPW2t/CyIutVF3Htu+dhP9Peaia4108wQJBAtVjbkGWP7TgPR/pUBW4PLYmlQA7YtvCIIfsJyD1+yqttpfgITylmzNQLqpIfMWXpf+JBVtmBzN+REMUt5T+XNLwePIDKorkQo2/z1BT0D3pXn1Q9vQ+O184F/fv7iRJZlt0N/af62vHNoEXxWEfWYs9UlrAtyicxMw8RZqQS8CT5Yb7DLouOafb+Q3WPFPnz/1n5kN3LwIb/VLTkMizeLYG5bd36LnRuJBCA1cigAis1iRgObAcaCv1zSlWQ45PW308E7Bt6Qy9oD+5OcLqYF/FJsEtjyitQ/FL0qGEqVWCWClILmEnpcbN+Got8uVCBy6GAZP2fLt2f0JLh0g+sQbTN9v8+kp1wBmR2KTQKhYXAMFrukD4pQBb6mH0a3etR6o4Ns10z7b+cc/qb50svXqMRQB+IeZt4EeMv8o6FCheNebyQSuv50uPCJYYTV0lejHvULvPagvpfMJYRPwaq7ogIzWatDmQT1g9n7LcaXYDAE2gEoYDBOAB9AB8wY/78VaAfosbwGXMyo3QvSibWurlyATrzrO/2f7dlJnBVquHBEk1r4XaMDVFRIQzryUQ8ZyEQMcWQhGznIY9xmg6F+nZ9Wd4t4df6FlqN9T+Mpq/4uduTW9VfxfMddAgvZ8PdNRseFS5tsM45GKEADJmwuq9Q//Y6owz2eQB0XeC5sWr/27oowUvOoMcAutbIy/s+3ru21ljVtj9A6CeRjw7MagXy9Zr9eQ79jeNdZoE10L5Ka6tY2qKzHuYylkd+vLKrZMBsKnbp+irv3YmCvG/XW/SAa/Q4WlGsT714YjhzvygYtrKnOpt0x8hfZwd4iZWcapXaP6s2LhR6T4uNfgTWV0t2N42liYqxk939yzPSvtL1mW/qwl1kTidEVGPN5Rbq4X02nVa6Ns/9PSnsXyoH4TmTGXPnzftaPv+p6eXa48f6wxz6U8f7PsAEB2t4121oKG1+ux28MkzkAeO8T3wkAPofWfvPXin81i9B5ARgTDGACZrf/zwJgsSEa/+UeA6A3nQx1XRyU5iGn34G+pU7mS+5ZwL3v5d4cBOUU99EXC3qSwvzo1v1ZR06VOs/WL+Zkvc1CfvGAPAINoXk10XjaM87CpgdZxzczMJ/at08vr9N9jewuqp5UYvV9fFNZQ/0wcc9S2ZfCMldgttaneK8i8/jkSo7JBWWZxy43Kmi1tqekzsUgz/xRUubVs1wuXB48OA1VpZ/MXsa7F4kYchlZZU3OlzlsZLT5Mwqqse+tX5tDne0Kkm5Uqh7AstUSYaD2dg2FexYHSYmjFsg2WSa7ZIlwECbCU49Kj1UPghnCppTsPiAIcJ3dDEnQQABWAA28BZ2Xc/h8CCiZALgS4PpCWBIALs7pizC1aXy0L42D3ZJuF3ffKwehD/jIs16RfNkyZVEQWWKRxaqHSIA8wTxX+sBB5FI5SW8DclNri50CVqbXYbp8m6JO42ToPCkaFDJIdLLcyWTqcFK0dCQ6sqA3NY/cEjgtW8qVu8Gka5xgIZFI4XpunBUWSieoYr1knc7J9c2XyXlqOrl5WWDIUCn04SdcVOUsNPGDFkGA+hWoW9OcAA==) + format('woff2'); + unicode-range: U+0370-03FF; +} +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAA8YAA4AAAAAIAwAAA7AAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGjQbhlocNgZgAIEAEQwKqgSlAAuCFgABNgIkA4QoBCAFgwoHIBt7G6OilpNWKhD8VYINh9o6+IoibkckFlELYovEnhpqEw5rTn/e1suwBSjaNcu4suz9n3jcWQcRrZXVPXCMsw+MIR+FMuwj40/HiI9xLIFVlPzc/Dy/zT/3XR5pAGb8ja8LKxcWukgzwYhaYGNU/ZQFxqLUVbuKhLd+MV/4m+w5Zhh/TqIcXmFFha2pbQiiNXT2bz+xUcQ2ClBzETSjEUCShW9ljKqw9VUk7wy62bj2txdropFFKSzBta/GGt+Y27eGWiiWyt7ti0gzFst8qOChQ0ge4e4Xlam50l6yu9/9571CniizBRTuQZii8rm9Jr3MJgXO5YHQ3fG/aiWhUC9UCdG2QoIRVa66XrCQtr6N6d8LoO2fUBohjoNU0/lfEUIVAcAkglGnCGlSg8wqhwgFeZAnQEDWpEUo2+9j5/Cu5Dy+i3cj9dodvLthT+/jQXc+j+9jQ4rqABCgQFVZgfgbAXENFhRCfbAhSLvJmn6RxTicVSDHB8Ca+Dznc0Prx37oR1d4uq/bnwjmW1rxklSRuTn+CMHl/qVl73Pmgos3js84a3+7n77Iq+1vE+1Fe3EhBXNMmbNkzZa9pZZz5IzPDdJur1AZsxYCloY5KVb4Id2f00SQWKZSyXIZxEFWb0ciZZweIg8biEPPNMhI8ZFLF97yWrRtwsAfKm+mqTSkjNRXIJrSEARYZDpddprdgvERSxcFBLCwysSIBqbLTaXhv2f1A0M8oA30gf5m+sC+2Pj79CaTVAsJ99HmgMzkreYnj7uutWi3UZCfeEK3Tp7cg4LQ/QaGwOPB9geMQt8AsFuWoEsXXiiY1jpMckLx8uE3sWE+MOLIUDHqk+R+m7xPvo7+098gHWLLQNHq1djde79LPpSvKM6AiH99Hmb+irlbd3fp3ZrbtzYPEtmzFO10pFtaeULsgC6LMEdY/2D3Brv7XjMJlrmHZcjjUJMYXcIDQaKhRP2xtyjW4vtCx/AR2IYtAaVikUCEbFqOgZggNHw9TiTV0zivDoHumy5YOohObF03tTrQ4VJlsBoLVDxVP/tDiqGrWr4E+6dyMcgcXBHwjcvr/Wio6T8/k2j3OHZ7eEDLUvDYK0qwnHYVzdyxP6a+hhg6UzcgxO0qdGIquQ71IHGYGYFAgyY689cq3+BFK+UiisgwhzE80guq+evJ7BabrUvK89hDJ6GjaKnXnHitv5Kiv71suv9EU0JXyUb011Rpa9fDLWF9SPrArCFyfg46z168k3t2zuGwtbZT1/xVsaOxlwjJ7KV+eFNfSxJie1oCtpsVqnixnwdz5u2z4oToO5UhpzRdZZMnPr1WRb0EyaYInb9lcHiuauG7pwjRQ8pZyD+89BCy7roasB0G/tFty5j8x3YGm069vWUZqwXisRsa+XTgOhfV/vxvhS0czgPe3oieIlQz2Spt5ypuqKo4fvp2+SIadwu6N9UfWxL75NKakCgf59Aidg4vWB9lT4ud57P8FGjmUT8XYDza6guZC2dpxRBWBi89oRP77VGElIrA6MCemtZEzOKmnqPApyu9WSAF3ksWM8OYQDxnfYS2X+7t9b9Ys+Bp6vl409pkS8dxps+CulHTNUbAluhid+nMSJBU6dB07+5VxIcfL+sJyb2PfcTKD8qEwLQYzAApmcHCQOhpnK38zNesrPt9GAWVoSAMu+fy1x3OO2aaIRnikpKp5Wq3s4dhKdEn8MNHNTpF8nOSHI2uvRsuCCB3X/1Hvhs2KFQQJzdlfCHbyWzHiD6tNK/OtKP4Iv6oTf+Ao82ctyoJgsYG2PdbyJmmKw24GJ9vKTHiPCYcyOmWm7V4D+WLusFvhQI4Q0qYoqt695xlHuBq4nxuxC12FVN0bYqZdp3dWv6/GLeQZyXqPUzRDQife3X1jsGFjkDF3SGGih4lJ+Fbc656cy7M77xWfXL+KZDGaxo0lg/jarRdQiti/KN64OEeYHkxQoOTg1Egqg6WXysFevCW+hMb4tEo3j0j1++jQlmjPMe+IPZG7d7Wa3i3yuAfaRwrnL7aVwBntBUGqxhnRPnEThy6KcpCyh6GIW7aJvFu3IS33aPuWyBVIqrjuqJQJzVn0Ou9fUMXjiX6SzzfwTuFY/i+HufuKnZvJ+NuyVZiGO+do48TDlQHpvs0p77olAj34NKGKB/nsEuJSOFUEjHcZdIhCyfyBcnDcH8na8ZuJ6/i3HETuX+C8BQK6oI/i9aVooM1gT/kmpS4XU2/XlZV4RJ0qMbvs0yj3EgL61X9bbdEqjMjI1ssIPyIluCo/XLptIB1rOwcsQCLiem7yuNwKrZw6zRux41z3Mm0XdL0vasNKW6rNzoTB8mYfrpIUcqasfsH+tmqCoZHDea9KqaeIxzc2PJND7xwvqdxsEMea+cfe0HjEzw2nd8D69PPTch6nhvipm2unCIr8P/T3G1GPJoPt7uacVpUcHxDzUmk3vw7apHGZ5xwVNhG1CV0RKIenNnv9c62liKv93C/g58BKSxXqCDObE39QHZQ4tWH9U7POCj2DBMPcHFrBCO1iLupF/RXajiqRVOiyZY11ZMG8j1Kzs3kdOPlRryX8pM3H3ELYY/c13SvAU9Tvhvp/eRsBYN566dxdtkq2Y3h3Pxa+YbsgQwdziq8inG4ypu1ZxCX4n1VPp/lG+fp/TS3HOmpzOpNwJWUo/fUjyZiF3p2RqUQJ+D/qv0/g7tQonUlUTZTzK1pBeVT5+b2M5PylRq67/zKbiGu4vdyapef4ZT2iv++xUZ85i+NTuaOh+D5oE52pK9rkGRE8P9Rjs3fOoM7cPNlxfFHkXaAFjv4Se9UKfanensobAYrlzdy9Sh5dGyklWArycbCyuxlVv7f9ZtwLqqvQ9n1QK3bjF3htCfLAbYe3mQl5hQHzT8tvWniSWjH51BZCfniQKRxJ8YB9XrrJMPszqtKraJYBsOR6dohF7OFEIcQG6hb+jRZbrCy4Ytc190n72O+u+0K/KiIVW+OhdVZCSOsM74QyW8m6hNRCKpDOHUrOuBrc137WvmqWW+Ykz5pekYdK+3a33Xesm7n2TdEM9hanBkr79zfedaVbEz2zG9C42AreNDYM3lzQgqW5MRIHnfroBdTNiaUcpcZmElNWU84zXd2WSnfKb8fDYOdVzsn1r3f/Owhkx/ou9QweWXoBT3+Oi7TJTDQgZexYsNbNmSFH7zNtT44OJ0MNr22MYW98XkoB9UmhYoRmbIJFamn7uNw8u6F0sJtv7mz3EPfs3A+Edau0g0Ws2N04UBKIcpFdemhNQin5yORRsaEDH19UKSr4ZZ1oS6EludGhdkfmsB5XhbfVteJ0POCy6ltu9WbdycW5sB32JZko3yQsWLh0qZc86629z4/JuEij7bwof4Ec7Nc+9j/DfgWeNz5AAQPAJCCHjJC1gRJGrSAAJ/X/10iV+QSC2CgmAY/shNMh18hpAxcEuTlkDmyMizaBN5AU5pQbgAoAIYAdiARDIJGShoMSeQxWJFRp4cxwdeBjsONlkrjsTQ6ARvSkCaEj+gkTIg6cTLs3NhmIIIHWendyzREcarpFFJBk7mYTilvX0aPuuKjdDq0tZROq0WjM6Ejvjyjjrwx87gCKTRmHpvvLyAVlnTBRHIj0yU05Bm505C+sHEfcu30+pcoAx1zQHbS2MFXOu6wVkrjJ2l0wkH9KU0ceUQn7Q2uc3L3nPoYNj8ip524AU+BdEC1QyneD1RqLObISfKS4gHDlGeJFUyTZgp4a7IBigCtM/T6WuFoyDDY8lgoyKTGGztjBKSlhZqWQ7Z4CdLSQlFakC2ehbS0YIsO2eJJSNs91GWj141Rl1UD5bxaJ49MgcqmtYiUzJ2L4rlz/tHQa8mRhkyHjfuBLDu9/lPKICd5HxhLMvsZ0flRQhzJBKAhf4irAiKEbaruhDCQE1KrDO0LmjsXm+bO+UtDryJ3GjKxP3A/oCtD7P03SJXc7RekRgQAYoAWxCXXGoEY4ATiiotU4D5ox5qmLCZw2ceZpxNf1W141usmAJD7RO/XO4hjwL5cedhoT84LX+UOMCu7GA7QX37Kk/bYuqtHQHsy2n7OFXBLa9WhyscvAnGs9ozYEsxRf87Mxm3FKYWPiyjd/d7peoekWgb2j//py51391nW3IoUXC377AfbJKxVYgBMbMPDbKX4y2H83DKdHy7F+qFQb20L5Nm+hx/Ut7PNEviUcmc2YoB3FrdniRGJi9OHSj5Pd4d7pt4uqZaJJzLOvZQ7t/ZT1kxHaj50xmDbhHWaI8AdoIfHXwZ6K1uQq1cPREr6Vj6Z7vsIr2osSx5dVjU6487j9hjTduP2JC6i9MjRZuu9NtUydJCXY3zVvig/GSnQdWOwTQLN5osL8KQ9jcaa4tQez29CO5EIamI/x7UHxxrXZjwSF/J0LSGgXHvsXis4xbZR8snSvk7474vX+QUPZxOTBBdjX8a1BYfAtad66hjFkcws6VAl8Iuxe23RlCkiqPde+TkMTzlOAAG68Hqx6cZAyHPJX1rtAoBPvxwjAH/k/vPN5uefzJorDUKGAhCk7v7LAJlhUeyvl7uB/CCaYVCaEfjA5D+48Y5lGvYdj5V9KFk9l6jcwWip6JYumbPjjHnGsjp58OMFK5kFPzcSUMY71OUwN/+yOj6y3AcvV5zl1CflL/sy98o2qRx/0fAObsL/j7jefYpoKPXinOv8PLcZL1/5eu7w5VSJcyrFPfVS8HI42lh7hvT4SIW1ZvqY02TfZc5sceQG4UPVry+jRS5e9K29zL7IkmpteFBt0qA9irCg2RoYb6YMQMBALWXeSAKgCKXjUAlIewyTZAA8Apws8h4Jip7LRldmUSs702p1X0bjN1p011kuJEmWI1WMKNHS6TJjwjTJ0+UmSQGJJ5x8pUQRjFZwLAjxy9wX8zRWF+bNQqkyh+ECRtwlCR+EdH0lrDDxC0dHlEfrjtx7GytNDHiiJsGo05w1e4WjrV3xxYy6p0tmxzgBWbqRaHyyMEvIiORUUYxtoUT1elpBX0OHcsa3jge+xSo+kwmM+AFiLIEIAAAA) + format('woff2'); + unicode-range: U+0102-0103, U+0110-0111, U+0128-0129, U+0168-0169, U+01A0-01A1, + U+01AF-01B0, U+1EA0-1EF9, U+20AB; +} +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAACI0AA4AAAAARUwAACHdAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGkAbjgwcgTAGYACDFBEMCuRQ1QQLg3oAATYCJAOHcAQgBYMKByAbkzqjoqTVgkfwlwk8kKE3XiIhIgKsVW3TdG3TuIGqASL+pV+AIzTjRTyFY3CirY+QZJZAWiOq0pPuOSAAB8KfMIQSSZFifPIIO/l5fm5/7rsLNmCMjRxIlGCMKgMcKRVKKZKKSCugKKmiCCqxUa3NEIYxUKGtQPsrZSV+bUCHM3spV9aR/gYPF58gHiGHOqvswcOM4QCgaB6oBCxHGn/sW4V2OQeoZB7buGiesCgBQbK8myPw+9aGzNnsXzlx3FqwaJHXPTUqsdLw6XWWreQvZbQ0s1rNxXZYO+NRiGucHouWi8p++v6W/PV3ec5wG+uI7d0ckfbAIeCiOaYuAFQh1ZlU6dKlaNOlTlOlqgFL4KLs2Ja0nIUzI0aIvLW+7FXLEx0r09XFKqaYYAqyTbK/7sgCgWHj3twHgcySFcSGHWQFZ0gUPqTKbwhCAGvAQGDxq9GxCOmEk9z9Qe/6zJT4OXJzSvTGyB3r0hJWCN1+Y0oCMCEMcsCaNxrBog8q0djtfyRgTNMGqn0Qk9Te3tOHXdJFZqWIsdGacrp7tNfbZseM4689XgPSt+aaPbDset2PZtscIfhjErts/Mycfp9stNX7Rqsfm9flBWADy+P62fmx+7oXbmbc2amrN4LiF0742hlps8f8QJq54BQnvGU/tNnTvrMRWawacTJR7rrxUqg6py2jZTfZ6X7PANbBrH0OSfW1iwkmSdOZ0VZfIPce6bzOjAwcm6mciHfRnREsG0iC3dDvwi7a5uV7PwcmIcneBDkexrjPTmYtG2saKJytFydegg/I7tdXb6T8Wf4qf/t/8YhDfQAJYydKjPU2iLNRvE0SJEqSLEWqNJttkS7DVttk2W6HbDly5cm3T7ESB5Qqx1elRp0GTVq0aXfIYUccdcxxJ5zUQahTF5HTBgwZMeayq6676ba77rnvgYceeeyJp/4zZcZLr73xznsffPTJZ198NesbxE4PBCBiwp61odB+ZcgeXgR01O5wKpLRVqWt5ujWozBpkSA4DNbpFuVrYJ+sKq+vr04izCDNINYHE4N4pgEs20Yl7+hGpGKWb5x1oJr9EtA+gGD59NGBsq7GiSyMQJoGZ78WKYTp4IBXRW5kJl2WYQCOrmWVgU9pmAbslKiaEC4xISYlFog77o7U7IZphWDUaGOWOJ15trsGu7PsAzVYneflEUsmEgZbaKp6XOcEyhlIYOjXrZNDICgg+eGnX35DCL36IKS6gcqwfJyJcQAZ9Ie6KYitTb/pC2KO0myj/xNgizTauJ9OPtvLGVCA5voU+AdumqsbaECPA/KwLqRBA+4KzfoNYCiKFDkvjZPYIaOEDJIN3ZgfRmEZbuETayM2dkR27I/SaAphfIo5QqVZtqCtQu1otZ19VfupoaHR6qhjOp3TN3tujoDWCVbohX6YhFW4h3+Ex3p3emN0GL+a0k6pHaWW0xe1WaNFe91ZvXOs24BaD1SM0UdduGtW7y7+67yOa76K+w3AsvbfP06KdT35yH2f+PPcFOA3L+TmiGZN3KMVJyzzHGfIDSrwe07oXmpfjsnR76U69Ro0atKsRStbS6r2uiy1zEX9hgwbMSpG7Gnio/fMcxMmnXfBgEHf+UMIEoiaszbA/wHxb+BJsOrjYN0fAebXQT4Aqgebvt1tHROxXyVYM4VgOQPHW8EuAxwFfk1rx8nRuTOrJCaSMEN5bRwUDVFw8GlWYPF9YlCR+DkugTVgKgS4BzKwNYdGe1M3DD0m6opugMxtISSWkNQN/UCO00gaBoiUqRfMS8GFyyUiIqkQNVTJrdykumzInD1PAjAJEaCASYOoXu96HSKyLEvLwhunbDdTr+m61ucWu1qXpp3VN6I5djsDX71TK7PzdywU6fzEQiJJBoIDOBtPiruuq6rSFfP4VtsvKVjW91Q1ETmvfGCUdnlliai+HolV5S0Ouqq0JEVKa2QtJVkaE/DS5i67LBqPrynvhwTHIWXyi+NxHnG6no9WDnbJGoz9vKC1bWP0mjtHmajkHJ4eQPdNCaM7mDNgjGweFh16r4eX5URS9D02cRidpbWkrslJmNtcfQiJjOZzUeWS2t6Tc3RkA9zaZeBcp2Mv1frJqxxCi4SJ65/HJ0c9aq+QQyzLZeX8lSCRBYl4vdhkufzdtMcRmSFuHijHtDDUlMFzC7FMAWYp5bW0jiWZmvpraDyBJqafib57n8M1rKV+PQpjLaigt/duufjArEeOnO9+x/rj7W/tNoKwbd7yNrImjLVByqAFO1rk31VuoNG2i2tXy7z7KaHliZI2jtLdYZv+/c2hehKcgVbNT+gw6LmNpJ+9wby3K56m9Lsob03z438br//j/gv/i3VO/6T5w7tLlvyt/+8V9L2r+7+Zv7Oz5RnszYFtq1BY03acdowIHtCSSdi/kKOGLQPSO4xD8S+g15HAYZ8daIseWbjcpKR85FTQ+oA7+tc20x8jWADGf9GjR3GGBMXLW2NN5WMGF6YuBhjzY22HGCxe3/lrdn5dcaC70NCdCXaq9Uea7x62eKofp7Tmz+aSgModOeVdLpHVNRXsAW6UuEAOHPQ9LGvypDdy4rKoSIex6Z85Ao41PtIctZFXtjPtu3LaGm/RdunnYVApOdepDjmlKUmzNNu553sHLHGXDfXlit1Pt3/3bY6cGVbkDHqHXO3I16QZi3l3/+b/rcKphd8erepj8ezsr4/0OCIIqK3Xrne5hPw8YhRnJrTqcyTeBnaUI6kZzFLZx6acFEHLDKhCy1A63Ue61Koh4xtiNihMS8pBVdJI+xUFT/ZkeSQF8o9MJyguKaxDqeije0aObL+qlpkHm8OEoQOD+jUbV1/WPrDd4ZDzAg6rfnoSPfa4q8xPMKqglQXZcK9NTqjNc91a88v1ZcM6c1zauXhAZte+Lrw93CpeHHznPdChcSlbZl7osHx5FnFFxfAGlh4sy6WvdCqkd2QLUXak7+17up1sfeDOlrf3ei8NrYkmZlCYN/agOaGk7LnzWfbS+CyWELD0jTwNRk2v/xuLhP0N1TiuTY7eVh9UokUudEXY77e/frurwDqXn/pfDxdxSbtN2UovOSMvai9/Gfl/d8NX4/8z5HsDB+CRd2YiOy8k59PSOMcsPhWZBh2jNawOh4dW5Gyc6Jqqxz7FFEkUlkuIZNCM2nKw8A0eifFubKyhjRx1UA8YZFITna8jXf8T41icY4ZWhYejqUVLgabcaytZbso628RnLIMtMvSl3Lp7epsh2h7b/HCDJu/dfCDxnjLI39pV6Y4FGRgs2iXP/ZzTC8VvR7RFu/QKF7dnx4HIRTP7F6nfCkzj5ccqHQn5PszGOZrbAFdWZUYtp1XfDq+Vgi2ttGkxs9xajtSlVqYI4zD0MKzxIhEch4cUYJxjb2J8ixlPDZR93NveZehQPM375c23VyLP1Mn0lpNl89uNOTcZxq7nQUoHZtzzOzd7HQ1lO+2ftJrv8qJcb1rR+GQXCAUD2bOvM5RwcFX3oHbEfcoV5RGvp6hEOjfNnMwOh+XrZNbHJdrGzQuYxHC0a9ucLrt2n2jti5ijBTcNydnMydDTLTDOg0+sYvIN4zaow2nHfHB/u5n8n5/WStYfArJwCEeHApkqm+e45aNk+lQTRmGFKAyD1a0sz5Ftl4w3C9tYZOHZ5crPMtrBVfamwYQDdZK8i7i0I/ED+QD2oXsw07nOCVsppKv4I1CmxFLGk4qol/RHS+e3PJ+8iny65ME+LCCN1JgeB1uZcWEmnILORCuFfprLwqUVW01RBUsqavMZuKtHXTijdZqew6juOFmGYSnRFBWEx1Rq83+8BJW6Pu87UWCbku+dmNerSPFPKWHAZx9wFl50iVFIOIVKiPHszA8SAsoWlwrRfGZNB3EZf3rFvH2Ovmd/2Q4spvxRmc9kFRFuw033DqLbpG3xtk4uKjUAw960xtEnOvd745NH0LsPSOKgLwarGeXeoM9SVa+xZ6/hC/jWM8lBMT09sSQRbcVHmlg5oN5897zflIM12DY0M/SltUjVT+cWsGrrVWqD1bn2gVaAUGa22WCo+bvjpUUu3+Jq4LD3ANOhKSg1fFEHc4CtPRoFcVIOcX3B+PSMLE+U8k8Ugzd7L3E1e/MPcjU5wz6yaV5qQG3qGL6Lv6lJzOL1Jrw8+aiwjhbmlIA8VPGgDO/EtwW7uLIvCTvyoODpAdxL+sHRnwu3w3F372h3D891EUzDxxnWML1QeKPUbCJGagxes+HAcCUzm5GVW1yAtQDuuZUu3yB2Pb6sUruA9YmWcfDsp6jdRD5xPXHjGHl7L9B2FpXmokJ0Ol86mV1+2b3cbKW6cq7cHA/3n/p/XTFRCJMpm0cpO8QgkVtfqYnFueA5zhpmyLPE8s8Gwyp1juBLFtLzH2pO8qSmcQlxe2vkf8xiev6js/TUx8zKPSeLsIB8U8hpoOc/gb6LuIN3TMX0awPVDGhty8YUeU/7tduEx6jTi3GkQeo80rxjVF3haYgY//Dwuf6dmlA58VoDOb9dV+F1rZZKLZlTtSQqY1al7pEyH37xt3L4W0Gr+1HJVd1rIIpX1S/f045L0CkhtYB2TOniTC9IBtDC1yStQaGoZI2Mhwgk1uSWXvGOR4exeIjRvEqR5K4wzrxTFIiqAy3d9f4rhGOijZIREm6ro+BlbjiqSVNccxQY0QWHLoVtIHahc4WrZqUr7Vk1+7+9LCzCR/CVx0cOA9qQnBeO9xHn7iv0G6zFPEra5t3gq8ZuLabdyM8iunF4dqyZiNkObazU7CIxrsCdk5TzC0TyRMnGulhUS8lsDfhqW1aH44jmXf5f4Av7Ep7SlJ1YyWyspU3syiPacd+4RA9hR7Gj+w7KlhZcy8cNeHdZ7CreunsJiH0tkWivM6qRhuUy25PawU9NUVhCupqVSYjx2j3aGe2SDtqq1+V/XCFvQmOR1oExCesONOIcfEqgWsRem58vxFFEeYzPAE7n9LCJkvW1G3ATTmv2/2RbVksuxb3fmbdBkd1TXH0GC1DpVdaZzUOiLaPersyiMqINp3dKRJJEzB4QwVS35JBNt97eW5eNGMfC8FkUVgfKUTZSd8XsytaGAmRvLytT5nIrV7lKalaspsIo/nzrKpchnugXQ/OX4h3LU7v7OKRjfkJi9tq3n64GxI/AVDezHUSg5GCrkLF7/0Ucg0qCOD6Czuu4CVfdYgu3jHRvHvMLZu2uJyJQ4w6FmK3Xe9JHpRJC09ehwziyTqJMUSQ5ZANKUbbKhQcbzuJKfPDKoUSbia1CW/yMm1/guRv17w/9w6iQZ9VV/HtfXIx3oYH9Qd+lyhmHBJIfSp85J1B4tM0ZRVFEECFYE3uBkUYN8ZTMyCyKwkXE4IRCDyzCFf4SJyNrJfxQ559vJ4GzPYVfgzU9oVeHkbhnsdjivQ+1j1Lyf087akFXz+GKLkDeG6JXoTDEM3xHc5EKy14QrHTWsKaKnEyOSq8Y9UwijqFnQ7i6G0JSN0VHoP2BoD5ut5g8rFQylNRoIE/x8NTcIM23k+VtRBurJfM21V1QKrmwmAzX4nbkDeJqXD7OOpN6TpTW52ZAcnbz4RH95A3NEvlyPf2h7hgsawL5Mhux2l2bMio2UYo0KaP625wgaespYb1SaGYqsQ3G9HU+7KTcIuycmTIV0wE4y99wjd02yW7tPnjND+fwVygdWOTHNFepVFUsAum2IOnazzcvM7jiiedHGhdJ1018OidjeG7i5iWwclQoVigpBpX/4aWxbgMccspRxTuJ6BPJFQTe2EaWiZJ0ipUcX1wAG5MgiBuuSgp/5agrbOYI6pfdW8bhWzqxTnhqZnSvvQUecm04zWtbtaD35YajpBkIN1q4heg8MxG+g7iGczLzWvk35oxSaZnShwPEE8vq7RO5Df/QRjXfRZH73GNrSCLSb/bCr5oXTA46Yw+6x0LTLa7Wyfg86Y/ufGn5UnAGuQx0JtTE//BpNj6IDh+n7aM1/O16OAGSAZKxARlBOBbtj2MEnGLJ8H93nEXxqDlQ073pcD/egU5sd33C3CO7+bwEb79UXE5WLAShWltXrlnhnvRlwgpHVO9ib7Xg/WXIaEuSDJZwDQq07TLfRBypNaujr921ju4VHQLzp71jUPCC6PJ82H99Uy5lWIEawKqpp3zcXYxWo1CtFs+ufVc3b6NcVQ1R16aYm3SU0/JNgi+fjf9ci2+yAlmEq5rDaJdCbhEx9ljtnNQa8Eq7dVra/1YbKzVn31nyXnxykNXJ1aOuYtWX0K7nb5+xbo8pGXH4cxyBiCM4bc/uJA5uqolBDXhLc8CXSuUU3IsDv+mSfKXiPEkd6E1rHHm6fRE3L1FkrNlnojlCc+ld9iVlWKt/BKYKbRwRNF5N8LraE1rrHu9L3jcvveLIp2rfBaUWL2lfxXwp3/DFp1g/ed8e/ejTvlA/tb4PlNlxrbaKec1LcmZ60uoqzBXyyi2yn4ogUF7I3IKVjl0U87H5Cva8yiSDAp1eZpi6Q4pUVIpYZlgoUi9IkvJPAiU5W/nqos7zuBlXTsr1Uu9g+bbzZytQ9Vqq1Xhx96kPbfsRYCjd0EKqx0mFElOL+/kLBphKdR+TPzo8WIcMI+Q1SsSdq9ISmNFSd4+DJ/sEencogqvcx962FPBCuQiJtYya3jMCoo24FKB1gMe9Y55DnEZwKsleeVg6Qm30mrPGkdqGVtKvWafPxjkogrGa5iWT03IA9E2PDdHuktjt587ykf1tlYNeCwrVr9Hu/GuXL2mXTpI7OXxBgExD5FTLN+p3qz6RihiG5ey9xI28lFlyDSme0655fchOrqGdmMY7KyNpKQWs7EbQclWxV15PWk8WuJec0ZdpkOfxyYPl98txH+mvni5i7QBn8vmKyTI8SPrN1fwrmwf6Ol6DOKNwpbRPBCvrgExZRstmddmVeCVtpDhQsrcV78bni1d9lynX0fxran6oYV964ya8jzQ2yRlLwA4SGZv3ReNN+ERJ8HfwjRbOe5AgvaWItb8SFK7dGr9AT8ySL6t//i9DQDzEXxnK988Maqv3nvgwluMbR1Rq6V0z4D99UPpQU10rmRbpeEwhLitvCNdg/n25nlkrepEa1/rF2a24M5gS6MfOAc6sjVRUqXxbn1iAfG7PO+i1YK/2bamoQtBJ89yJxEUB3xjlpsyKcpg+kIsvki9Qle/IZnRlraXFp+asJQ6TSxOWbN+65TadNHU5kmitsuD/gZC0JLrH+jCwcPjEKEVJhzsOVRJMeek40CYHCg/VE1LzmAnXZBgVCMyG70tmHS3NxltR6UGUUQqUgznYCXz8Je2AOeNvWPf5SPiNPdH5AJjmGSg4Z3uQb0pqAFqdsy3IPyV5nf/SNQu5nk4+YZb2C7heLiBP2HEzgyRWJ9ihTyuUcQZvgZ/nmijkQwjlc8Fm5qlkQubOMN3roqdG/oRafCZFclNWUShSeb7BDjUGqicBN3qutuZ2mXKvSXAbQOGHa2y0k0PQGp5zRISTY9hqP8dlOzTUG2OM1qrpVoJG90P5yvw4Gs2e7lTD2JBLFK0lvCm5TaqSzmDm/YNRN3EQs+flN+2maTeJaOymAsXajM3mnudDvwdejK+Q4CmW+UVcRqq1b1VrVqD1ujo36E5HQT6rib27Xj6rSu6k0lX5bxfIh/CFm1ThOaDERWZE4ARc1c7IsizGVz7Lg717JQS2HH+gLEC67H1L/i9PP3/Jd3rh3+EIbidBWwrCone4sEhsr21kybNnJsuuZHy/0N8lyAzs0x40UG2Pg/CuY4PJDQYKFHcvDVe6wF6WB3FoY7nk7k11uQlb9g1BhJlIZly4DtKJrpDgdlLifuCSRYvJw26dCR2Qjqo3rBiUjGMdFlOHAB7qujt56HF/1+McZUGja/8ljuBlz0T35NNDE12yEy85gjFyfxNHkMN4fJr0+HXb4w7tFouNDv2nlvTHOvQft+4/DP2RzOg1ZjS5O1tvu2lIylw52/+cQ283PwLcbqtKUslV1gUzF5G521oVWvlB0jJEZzdVyS98KTmb7CeiKAcDNDF/NvWkKLldaezytaMYyqwjrMUSd4wuKvMvMsP6OfyLBl/fQdvEdr20Dxz+aSh9ehFx+HdA8C1085n8fJAJy4LIj40oOcgRyaz2mzZHlp7lpCBYUcGaAb0wHHPDpW6/aefcyeuUbZbSD2uT2akT6Fv0ZWtwqUPk0G2RsVgdXOr2gD0P0zw4dy+6c46cQK4ombXODzZpiv8lKBfDJg3xXIKNX++iX9RkDTElWamk+RfVlHC186QvcjofpePAmJe4WaG91P9dkRvNed5ZkcoR9jZyDL1ovSBUJeeqKOcKX2d4Tu+B5jWR2hnuAvMNr7Xmj4ngOMvBkCU2ZF1SqRtTKrysUju248EfuE15/ZbZJ3trwZdPwaBY6Cir6wBVAzXMvTKZuyq24yAAkssjHypj50h5MlaZRnLiEbsjCm3UCNNQFJ0YyyeScOZJ2i4ua2QuZSSJGZFmgvx91nmR4tdsT9hHI7fg+BWkTWSlaXBsjHAN3iqfwfA5XjLvNvzZG8fhx4GuRfLYN1F29VOnqFhn3upQB8fwaCfHkGAfHslrmWZpzDK2lgOoUpbGBK7cxI5WzO9mJqtehKCUKjGHL07YcX189XVVX1f9eXrT/wd+z2dhYfntb2YqZ9vF0lG3hzj8weecRar8WbDlWT6TmLIUS+dmKnfDindVFmdnOHBLnkNY0HNLr/PDjLn7vYped9XOniV63ZeR8fClmYBok7noylWjSfZxjw74j6dj5/Czz8zlZEPDq7HUnYNj5fbbFz5wdP3OuwpvhJVQ7LulwOxoWiDN5q2UnBi6jdZVGPCSvvcW62QGW66uWnx3Xu2+jgr1vV8rzMtjJNb6eJPgmACfB+RPDKXxa+Bj5X8g15E/mMTed1dcrC8WYCcsYGaQZqBFCcmMiLzQUlQGmq33kphRkNCykYPRPRIv9SuDG5aUohohQjaNYw6tUlULCwCFXYLsDJTtY8Ju8Rgoo1hvj2sox+oo1xOQR6Et3AoePg9meAo6m1BNI7djpacWRehyhdrkD2CSRHZSirlFXawAW9ADy7Crx85A+gbj0eKr8ldRl85ngtjKMInV8EkKVZq4YyiIAV1a4VG8CMzIMLFa0JPJNUMVGiHo/mHPJWF61q7nJKzZghmExDKqPW+lZVSWUGIrq+vxgPw6AIhL9/gNzdPker4LtqO58YsVlqZU0wNEM68V7xwJqcD19jBXnKJl4gMhHbEevPz0tE3Ug+UFYZjGosNY1SlsCL6kPjx0l6MUVXUxCatV5wCbt0WdbbmF+8qw6ebSSo/H9BRt88NC6GmYhAqmX7JL0dN8SJl617APS6oQ+Z6UXHfs8kJ2YtXqhl21+aEbVFndK6zV+aSEGssr+GGV9zIOwQqV9wSu6FfpVVlknqJfVb0Kq8pNRT/0nWA75gNehQFbcAaSsIsxZ6DszK+YSZQCoBBSP4wVHouWRivct0VQ7+pJWNNwQtcKOWuipi7geYYayyQKgGXiFUBtkCyZfbTt6HuJvOnpT9jwhSh43kgSWEbm0LKw0S0SsZVhEJbIECmlS8s9MsPecjdJMu8VSQCQPfKQKBgu8UQsYrkKiGLexaCRF0ujbIcXw9BfoZQh3suq3IIOMGG3qAQEgKZJugfQxIeOEqaTgH+vL8Kc1VMh1UzXjxzF4sRhHdW+Oc39zJwokoSN2z1QuTz2bdgUDMMIIIoGJ0zJYoOjnDiZruXkQyHjmo9YCF3DW0FIee9Ig6JyYv2eYr4pAEDhkZGSmE9eeU5AYREmNE+KDbTUvkeehpa0s3XxszmjUpZdUUYuYTdyXTlcdmD79ohYw0O3oEp0fXRV7cRzsLG7AP+vuaOt+Mx1/zObev2/qbA6gHx0LmNar0aGsoY3Hh9Thmw/UXf/LPO+knd9SFq9mJ/zKk71Oi8WFopqTYdFkGxFBNiC/OZ34Fav2o75vTQ+4lhv8n8/saiaVXo870OVqg4Th0EzS0Cmv8BSqKuQlrNHfwAUo5r+UFWVhrWV/6vJoy2jwu0S+r3zCupg+sNvz5XmdcC8mCxov+9rMncYH+HWfdljG7eiqsz+uf7Aklv9IbKwkqjvm+qorOWgWXOZF5ukb4Xh4pR+hx7fUulU86I1ffx6DVut3uPRWByHMyCcrUwvzcYMs2tT+bZaGu7cXrUcDX2o6p3e4ekDwLe2Z4F4QhYt2UhbaAly1P3+eGp8EbLqN/1rEHGvx5IgvV5WmjKDY70a9X6Cr6HKkoeG/2w5cVmfg8NAvuevYrpOOkwjDWjV0J+4O/6GQr5k8Px6PS182Nx6nfcLoR5tcdP6qLbwtPSuXpmrWvmf2hGbQZNLwGEuItPIQjzfJ8q7HVcvbnFQaECjWq1nvU/xyBRbL6sxawqpV6PW3y5qxpQ4IVNlxEMopVUj1ODO5usi6HPwPpiPnS3kgL4M8Ovsh+1V2znm3Tjjb70F8lN9i/fA9ClF9f5u77BMtfrgE3MFwHzfvAK7Xu26gUCjWls757CurbNggP/uKQ6Kk+2j4dn6qx3tIx+MN6BRqxi3jd1xcVPUhUx9PzfGp15bGiq6UCLax8adelbk84rmOH0LLJ+QZTH4PpDPcEfHebklXlvYLkHT2cyR5ecPPQLa9uslK3yqt1ZmyT8klFcBwAd/luUC8E34/uaX1d9xmvsqqQg0BECA+Y5FCmDVjUwV/+IvAugVG9v5/8QXZQ3in6BvVh1VlNY12WaqlPzXoPvJ7KVsmx7X9EXPl7pk2TRuAnhG9XDpeQubbDM/jzncWWLHOwazy+HsqLfZW7lfkpvJY5ocThnHLfU4ZjRSelOPdxjGtHL5SYNbwriPWvpSz3SO7aj/fY4O3FaGlz5C+jNypp5qy5Tv4+LRVOl7yzQe/9fY71YFDacxBNiZyDqPc+uZzOMbboZYnFa0mhbtHsc8E+nEd6Y9lk87Wa5dIzYzreiJYvM+wfGvaCRNy6bOUJyyYv4UHFT07jGI5kCEdnWky9P2kYHmW6+BlX8A/P+d8ZGe++rr4KKP9axXWc6mj0EbFFDvp/FSClwzFL0b1JduVDMRc4t/NZUCZe1oSKIf/vTlZDPB0jzmcCur2bwgfdNFyBlSO12EfPbtAKfn9DzpcSTkHPmZLkLekTtoon98I2v2wO1UJe+dSfx4I4PrdBND7SCt0A9yDQ0h37RZacvGLY+hNGb7knwDgW1oDvoINNAhNEOpZzXw0OZ5ogOXaNpPigdJDE1DfzOFoH9oFVMAemVTAboNbALQLLQLYi5YM9AlUomph2nCdMAkwc3RC0FeUPflzDwOEPB/BygIRIYA1gINsRkKBKwiBoaSBuAqwMUQKWtkQo2LYRxb9kiKkek54FJ0tacrg7+beP+TJWcuaYNY66XRYMKIsTA1OEuMkx4vequuEkTiuvaKHN/oa81TWTfaHxwtxZZp3ChcvhJFTHKa64rsOvGVR43cf1SNVx7oJptqA3hCSDJ3pClLtgEe1dLseTGoNE0SG4aCpLtck5FkXTYal2IpYhnmoyUE76YqrjuV8jjy5OfxxUGUGsGgZqWIq9RBAAA=) + format('woff2'); + unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, + U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF; +} +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAADGMAA4AAAAAWyAAADEzAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGmQbmWQchV4GYACDIBEMCv886AILhAoAATYCJAOIEAQgBYMKByAbZ0wT7jBjHICxQe4g+S8SbPeQiQpRInToLKePPxGOhTMcUcL4M/miSRWxMQ1YOUKSWZ7/z7+e/7mrdp3u+0Bm/MjoDGRGpt8pxZHLvYbn7fbefze2G8ZKqC3aMhrEztjZK2etnazVJaeMJkVbQykpO+2tYW0Bl62mU0VMX3dfTn359t+MKSV06g8AV6TZHSVSI1PjNC6wZc8luVqHS8uBw/Hzu5fIXWkNH8JtcACzp/+/qe3bub47rGWvz9mHSGnIPlQuOlILR8vZpqKo3tw3Y8+bN+MwtkFCjrLPQSOTJBFsESXSmJRyaS1xN3tJ0VDFXKVYNOSip4OOugw/xgp/7TP3oeLulUYIYjlSvjK53y+tgxrbOz0opcYAAuIoRA5NXr/2b3etYBjuX453h6HY4CBIiyMoShQoSRIoRQooXTooSxYoRx6oVQfMqB8gCAMcBzgJBJQaYp6YY6y3De62tzewABsf1gr2BxsfdcrDD2x8fDk0AGwEH/eI4ADBjTIIAqjxuRNbN5CoJlyv4AB3NEWIJ6fzFBJSCeVkQbIsWYW8g1BLdCS6k1WIvsRQYjaxlnieOElWIy4QV8nRJAyaM8EYUj6plpxIGsBaN8nppBUTiSpkweVlyTumqyg1BRUBEmvSPxkEhe0/wQFHTzxmgCRRdf0p1slilsyuk3XnNd27nKl2+Vd56VTXBiD3FcgXykTj23mfhDT6x/WAzEsfBtKhp+0j438AFan7oDkeUyp53luqM+9buYIj6jSF8LFCe9jPiUS+CrcgfFg/kkP+zIVPlXtZavZfmTrxAGUV4fC/cnKXK5nPyyyLqA7rdG91sQovZDHT6v4+TmPO5E0asLBzNQv5gA6Ql1iR9+XNcT5IXZZSQos/kVMpyFnASZjJzdgih6cJZGMaEQ0TaO1qC7JqXmfl+n2LDmTZZfVCRL2GzTfPTsi9/VVy2Bd1RN5QW5Cj5q3gVk9jw0knlbSQsMkeEp6vBEA4NCMrdYdPNkTpwAdtA+pCxR7gFMbk+uHtfxbYyuV7WQuaEdMgVxyIZbQ/M7efkbd/wdmdeWs5xafyfPwJxAJIOyxjVp/acq51+Ku0eoBPeC9L4avD8lXN9boWyIzjLLHy81104RBQ0XBssMlmW2y13Q677bGXIiUqVB1w0CF69BkwZsqMOSvWbNlx4KRCpWo1Ro254qpxE6657oabbrntgSkPPTJt1rIVL6x66533Pvjok+9++OmX3yClTMNRIUgV2wHCZgmDOJG2AzPC2DK5DbGicPhBiSCtPKOT13Q30IMjYA6W1a2ywiav2GaVwybzfFmVoFbWkzEWK1fgKozDBFwznuWZ5zAH87AAi8ZSXluGFXgBq/AO3sMH+AifjM955Qt8hW/G96z6MQLZ5VJ7f5thrDEk5Tg8pUxRyRLVvHEgs2YhcQPgybcuTHKaShJcplmFzy7jjh3Ois1mSTGUnnxZOQGHTpA61uLIAhccAgJAg9eKYcHYZQQKeUc5wWN4AjPwtLEIAiaqpS6fTSerdAF6cAQsSb3M02EFpkqCaqgxlrJqGVbgBawaPzH9gt+NqXTyhi7owRGwhDxYgmVYgRewOndEnwBru9hhITD35TvAe/gAH+FTYzxmUrGhCmqhntyENxzwGJ7ADDxtTGVAmjGYVDdPoqMpZIfqnZXvAR/gI3yaPLIuo6zznl2eQ+hZoZ4vXNwQo593o/AVKGlhhIGSBfTSjNxBUOqPQ6tMs9aEXP6x9IrNrcCDaZCeS7JyUV3ugyrDA+mjg/aEGEGEJwOOZRCTYdhzRzbYAmebPciUHPTztegQowcmyaDpGqYsSLFismybrmPP0XrZTTepUGuz+jurYNSq7d76xNJ3v9nBKOpHERRBCZDgYJiNTMwmxrKZQVsYngKj2M6odjBhuxm0hwlSYnTKjEKFiVNlovYzpgOM5iAToMUItBmRjhJyD0mAk2ZKmhNDLFyiq/U4QOZgbA6MzFEx3AZiWElEFZRE0uKW1aolJECCp6bQmGsw1yfHcsNteA9Mgx57imJ2a0rzzCKCpaZClq0ieVuM884nKKUxsp9tIlgiC1kpQSxiwthKEFFFICmMHDGMghJBLoXZC4bZpxj4IQXJKIQcFEAqMomEeqAjpCBmiBCXQizBoKOMxsbF45eABEmKfnOSwuQSw+QVQ2XKCSOKLBREFgqmBF2GEgYkKAxLxJCMVCCmV0EUEXGs89k3eCS1sW5zdFcMwAAMuOlglIc/kXsMpP/POnsCuY/38XIB5RTWVm9/fEDYMcB7PNfNHwx8zgSDkSdzg8tPJ3OfQFGoUoN2PGddRP6kadcBVCHe6r5a0lD4Nj9bbKNv/7O6NHhztxlgEDO6lRWY2T0MZ1rc+0hjYUAhFU8ERORnwFTTFmuDyYhHgGREJAAg3Q9HpvdtEuoT+rP4EoK/wPPfwI7/gPzvLsYjIiFzcTce1+IeUJTQTt9VhOlYKdQNgrWNMRnWPz2dMO1ohcBFf/z1z38IwGcKQgyIk4SpRnPOeRKECBMhSqyzdA1BmEo4uYJbDJXLhyoO1gq8HIE9TCmKXj26ncRzSp/T+vFholEMiBYi1BlnDRoybAQEFcO484fxFwqDEbQGsGiEAqJpHnfBejq40AqF6yZCyhRHATvhRO878ZfbUqjeWspCQ60wpTo4zESbYQKCC0bNrUJ4YL1+7QbqQnp4fo+nzzQfn6XnAlcC7gK4COAO9zDWARDI3w38Ax65qx5AGnwLQN9y8UiThuTAVKchSDTDVe6PqztSg0cCHC9eg249LrjqjhXv/Yc7y3yMjKvjyXh6ESZ9JH2s9GnS4tJS0rLSG6V3S6tIaxZCC93bnSz73////89/cDxpDU7o0euicZNe+FA7y0zZOqdKi0pLbvUuaeV5V75liUwuE8olwHTUlLnZRuVw6O/EX/7/+39bMJfFX5LkuQTxYkQadw4Unn9/nvysBHbpBdW1t1R7W1vmE5Xvby+aZNT9ve0XnyzFY0/MeGpWqjTPPDdn3oJF6TL2vK+JTFk+++Krb77L9gOEIcHy34kA1QAw9gD4F3DCC4Fzb+uAvg4YfwSwVGo0Wx/CQ2AUowEbRLBQC5cqH3H2B3Rs80LAWiiLqaRi80HAKlijMPt0XGURP0cBAJspRFHokF1BLLBFI5DXrL9FyFuaKmFW+SjEJdHGT5jEvo/ZBL7rFnjILzyWll2tkQYWJenZ1WM1TnpCTpMG9JT/wfyJtRvv6XZEooquJm8nOdqrqbrSOgOjga2v3BZOzHjFChcYsK25VGaG87jpwORWWE7g95tVGgM/IReSV06lNLMgickRjRQtMmX648w5sc+nd0vC+5lxhRjLPjtLjszdi0+0xikYjDG94I4pgIkWHj0W1esh2UTHmEUuSC6UqelnGn5uOtXI1kEwvPbkgz8fOzOPTFdc8pRywVOnQaWAkdbOeOhiPUEHTAzuSGyS6IStZUaK4yJtKzRk4mVOGkPXLCcJYx5UsZXDLFKngaK1LrTPupjPipztRt6YCo9oUZ4jdLlKNc8dY5YzpECflyvHPPnhwC8zMeo1tryYQMeICx4GdviUlen9o2b6ipKBZ7lpemuknwZWDzTH/T4ZkgqXPXSrqjRG466WDKVd8NJOK+1ch2k4c+Gbj80j0521CgTLN7PfPXxq1EhvTaw2OeMa1XegWg6kxMdxJM/NZWs825J14iK1nKioS63WHES5S1Oh1D3VnVqmfJJelgXDTPBqEOQo61oV98mszcc1xkJe4bdCYJZIkx+fUpDw8GlmCrahmd43nUgIkuURGZYWkigyxwtts5aujBXLBAlpcVQZ21srAaNd1f8ZL5jMdS5+LW4cpVMsJHke8WWMnOKTFHI9lU2IVZuHcj1Q25N997duK5lRxiY5vGaVbxxzHRx6dlDCpZ5r+nWSrAwkK4NUMny6quLlvjPTM6fMaGnf2e7d+TzpkWRdEGzBucwESjkaSrg6DBN+eepbK7SSqaLGLBOV476CgX4/6dHDmgdSESz357kkLaGKnrJFtqpk/RzlZYSybs76cCA0SV0wHL4GCtiOnvvnk+GFXppzmyEQcPAbUgFmNK8qFLMvlAw3ye1R0MQzLahq4UuyVXnQCaSj7YcHN0M7ZLPjH9Xmcjjwo73XK9ZyeT3zza5svCUQOMoSuHxRRdqAuJhNXiITxGqCZrqxQnP7g1vg3NuOVuuvV8KAZ1+HyFpKqWWiRvjwLpatpEOQYd4s4TSTF1uOBnLarcE21slPtxRzAk2PE0sDzxyG6SloTmPTDoQ+BNccj9Am9tpSEgiR0pKZYa6yYZpRamENGngQjnrbrmEccxdTey86pVVUq6/Ap7nRHRWP7dKduCF784Em3IVfd84XXArItTWw1d7NbnlFNV2O9vWOHXMNL/DUXIAhcM8hvaDMfNNrkSknA95fi2lW2d8dtcv2V5Qe3W4TFGC8KHapIkV/fN4Z7EhIEEr22T86Ndeko1LTRTKyDASL+wwn75Aod3r8z8fO5Uema59IaIy+ofn39yIWb6XVOZdVPdQKQ65j7TCIdQqZWi7VNYxvldNJlQZ0JQT8HRjRmnV9XGjyeMM7gJQ9yZrfwLQd8GxT4ysZawcEoJDk6PRpjDVBSnTnl8TZO0efnba6CFjz5N4Lu/o4pnpgJsYYlKGS/vmdtj36YiiB3aCEqeOn5QL0L+81UnhdvCoovhKjtao36jh1GMZr0JjAeregp//Q/N4C8JlhzlHeE91DpYqQEGVg5aoy7lxjdWUP0c5YjYEgWW/Mp2qv7jdnKccNze2NVb5QpURarH9OIKE9idBRRwYjy4HkShZWqdkSHmhnUjFBdqGNOzDr7ClOg/PoOOVZ9YU/ta1OkXlOZ0g8PNAsI8OalT6u2ikutT3apm1mTNT7NtLAKaQ0ZUHJctsT6AqGAgGKoXwRYWFthZx1+YfxahuQUcsVnRqc+0ZEj6hE+miVbZPsv58RdJmdS5U8Eq+r3OpQJ4MMkCY7jPk5Mr0lnQVyTW2goz+Lqnhp1z58wxS0rIncwuW9lYgZjDHBfcmhRxsJZJhZcfwjDfxBT11lN+W5czM6h4LZOboDru7nYhnOKmuLi5oyZ1dOtFiWu3OLFxSvbTvKNg+LbeV5pJnluuVr3fcTU8h4Qz9SRiRmu9Ah2GvQp6d0Cmca12b+ohqIb0Y91kowe+loFyQXfF6C54/lMFi0X/z52Jl79OlvCb6ZqimivF/1+9yAgLiKsrXqbJria/OtE0WBVt7MWH64o+S9bK28cVkKP9fOBF59kg/VVe0QTdaOJk+XVz8vwr8ARTZyJrWUq8hLaR3GWbxb3BW7O6i4IGPZ2EHbvDWi/QN/uAWDKPJpkVzkjuLiile0XGwQaiptNr1rujl5iUirRsPTvEfbqd5cHcjtXjwQHpK+S2nJGxQxX10kLq+OiL/dcXn/0n1qFuXtTddf/O7LhaTmpdkqSheK24dPfaMaexDnuBdM3d7jttkU2JJlovQoom8yT3RJDtj7in6l1HQXhTFLAptK892ojBLnzCwip5V+Sb8Nw7ybZ2tTvLLbox2tiVJ1lDyCUeyYlXOUy4/9l7jDdx7ceRfRPUd/x7dfiFhUBOq2shM+JJfWlRcoVnuau5pqjMH47jrK2I4a1MdZi5K0UWaLqXcoRhErGD4tfOLVzUSeAXE/Ha97CXDMQx8mrz7czExQoQQmDMRZFnFz+NEIrJ8UlFMrofJGKzat17Orm4FyKTmQdLi5aFr9FTcNN8CWdlJJ4GWUtMJ2a/bXT66dqdnhJ4eLTzB67MyQMY4Cx/vouLYcltz69zIXZ6Sc8sywCsxyC+R4sxchSk4jAQGnC3gOvRc9bxJ772LUe0irmNdP8HnnlkAmWfwu9jGZVXST/OFGUS3bnIJGunjNgcx5O53TQbm3UqoQ5Zh3rav2BI2qe5A1gtEFswTPc2T1Pli8tOvqTpexfYXhYvFtCzbQ/QG4zQtBu7i34eYxgOeNIQ97gCeykrXC31MjFk8g6JAJHRDYUd1MKRU6LyFkxaj9eHdYYfuQA+oAomUBZnbHgPG3DNK7QpMMMP6alxxcrvpVVlVYWrUikvk/ofxDJJtdcbyo8vhvpRU7Yy3nWceZ7jsfp37ei3fL/kp0+QV2seLJlj4Jf5z195dE0kcpTQ8f8oQ3PineNFsiWfiBceE0sdiz1g0LhMXJ1ACSpX0Myz8vXK2K4ErrXLo7wpE5XyR7sUmk7SVlkE9JDq0Jg/GwMxVIT12NRPntxES8ASOtvyMWRcKiLmKcE61goPtwPM5E0/GjBnR3p5iQDAlH1D0OQ03o4UExeYKPQXmdxDj8YVpuf28CioDFHcREvAYt+1TPgXic8WFndagFXT2iyxoR9GdqQ7c/oYxpX1x19gl6u2oD7QTG4O2ioCNbDXRSiIHU5kcTTSgdnuwkxpO6buQXu/yItU0Xrj4h/q+qq/bLdd3AnoxJNAKX59oN0rCyEEZbT18MO5nhF5dHRE+J5kruvZWevsYUbydTc01zbiQQ8cg+4p1o8KwYpOpLr/Tx0Z7jRuIxtaFzkVEE+PuOr4q77TZuawjvCnE9dKJaAVld2c9n+sDWGkOJYCsYrCK/DB/guq8PKnC5htWYrhU6gzlTLYEomhG00SgQCtxlV651VMGPXa9iW8xOOJosMysS5AK2NtGzpXqzjG8MvOjbb6712gcASdZLPyRfIles/JRg+rpF8FlqRrx8BjTdBX+hyx8n9MT1gBrYFdusSJBvAo84Z9CZP8S3UI+ks+7TdkX6zqe4QTTwjfAK0yfpyL7ao0vdTjVPo0eCw7i/Fwg5uO5pmRdbZeghQBdHOk9IxXffWT8P7Afo7jeTM6ROSlyWBgPHhXJFyS7O7e2sfNoxbrYHSkYnG9g5fYCWln17ISAV60cP7jHamBdu3Lezvz9yAYijXREgtT+bFk4L4ab6wiBYn8kK6QPM08y5ETiAJp/S+0meOR0x+1w3uXQTQwTGRN9PoCE0+5zI6wd4bkRmEEpAHVXUREp4UmoiygZgb9HLMfHyURXTARXTVMHwXejF1R33x3lJN66BJ0/P3nso3qnCzTumlgD74SUa6w77uYjAJOqBUzP4gQ5CRFSKF0xAvecEqujpUb1hSBcGbo8Fqvw+gdp140jiveHLjAw+CoZN0QbT1GTOU0Gpa/gT6M4y4yLRW7pPM7Q8S0W5wBl2hMjbEA5DE7OdVS7G6iAS132OWU222VLmbAV0Wg7uDDt4dede0R8iFSPgcOoBkn9mb5iSw17bfqIv4+Ka1WtoBM3MM3opsVVDqcqGe/WbiA70s/jF86gH3XjMSjGhBkaUB6EYeLKBHk8NicwJgHHoZDVhnQzF3TvLGXFhVTEthOLlm+YM/WF1IdgdnKhn2GJgCoNhY5z+DDWJVpDx/klyCupBVz4Tb2K+EvXqYanRO/DyAjUbHiL26tQPW9QWsNeBqIuZoGrfNjcUg+udoJf7s+JO7nUGhIQ9f6SHHkeLFe29G73uJji4TmGrRIOc+6GtEsflwI57+ZaYNP93tFihEoxdNwHUKmnBTif9nEy0YwMEoqgOlmG2yAMmBzKtTwN285erPNiGzt6gNzP5Q21RXi7WwuXfDzFqP05eZygMz813AP0PgtbQ35pmkNGVj4VALp9aQ26oMJrhJcFsLNUjVZ6sLoFLd8aK8XxLCp1w2oe1ktOOPUVRf78sU4WJ/ccknheeAO2ow1Q8NNtq+TwQa61Suwen6y+LW3nzxrFLmHBbsfrN+WSnp/2nDuA6QzFfnH3pF0rqT1XnbNxFEZk3QOlurNHVmGs7w3gtbDxv8JDY88hWoCowxesEz2fH6X2syS8+Lhucz5ACGGNrVhbH222pm0HmmSJGDD3sWEoYkqtmgITeJEYQzcffLw63BgA91uSWeU3iAj4duxbPfYcvRKYUQ2aEgk5ANAF3E70HhMVh2s4FETiC+yO7/rdQOf4o/kz+dC6qwF2t2d1twFMQBfrAKa6S8CWyrtyBsujdsIxNcw87Cx5sJMoty56hJDKqT/aWIHAAO+FugyYkalPOnItE3TmT++5ANTjFhJs84mr+Lyie5UdToMO7qOspHNAH87GphKh3pApCuG4ZfxOz5iR2HX1YZd4bomQVlMSjYcIfiU1Mdg525MqJh0XwHi7GX1VbV6IGgOiR0IbxF0keGPEPuorBcwA33BgYBkrL7hNB+UKUvMX5cgtdQHefU0eHKRHcfC6MRh0n2IlgbeOD8+aLwpOIGVse+9ScI2m+/i5g19ZL1NoO5ngOyFryBL40bhlr/K50Xm6HwvW2aGYXMjVP2IQ4bzu7CogekE71pWn6nmtwfimWcmkW3GFgwsnGbiaE/cBX4yPV3U6sCbGsDZlAD9BXKdIX5L1LI1nI3eFkE3OxAj9WNl2C0tC9inQF1gtMDT9aMVuIRnA/xDf/r3HARtlVWdOLYRnMf37HvMKa3Pz+88E6DVA1WsXMFIhOq0xA1gAo8QymJ7MD/37SE9DPBHeSg7/ha/BxavZ1olzL41G3UC52JynI/7iYOdmManGg1zuWMF4xVTT0UqLgA+PpXi7YGcIvkS3/BONBt4GJh8G43ux8sATeL7OvUDJ5d4r3zHvSJsBLDii8UslMYMQm5aUiWQAU70YIHR/W6z5YuS6V/YEcWTT4wT0DS8Fuc/0m8HEjgJyWU5wEM+GZFHoQp/S6Qeke/bViSYL/XXRB3zeXPCwTLASHjRPihwEpqb5SBg0nAaMp9hWGEHtYfmt2RaJOC5jheZSUxzILGrQllI/di3Z7xsyjpDwZpITMMCuzenNQBX6SJ36ckvIUHADrv5x8sB3Pa2WH8a6AcxfRSY0uid2fjxP3AHLLwQkRjdlL61p4XcQleeS2JWQNbk0XcQPvDNjSlNK+bVXxidmD+1CRr7h6eEVvYhK4Tr17PLf5fo294LDTFkHz9JvgZa2sRC1evGq/e+QXibonYuVgc8vqINMqc0ikgsvRORsIqF95zZwB+SZA+ZYYyDl6NlCkYphplTkCpMcGqc9PNTyMbXxYD36VR4uXRwPZ/if5NzfcAnx/yc2lWa0oH/bxiKnkLtGLyyOAakl2dgx0hPYw31HAkA9IjknFN0z8YTsaHmM0HhXBGQhPMe/nWMFqq30GG59lgi6+H9WVdMTaHRwyE+W05JGvJURjo8gxf31cG3MA8P0PJBUMohrUM4u7LODXY44VeVX7onYU2mPyULW5Gfmg+jTTD+BFkjOsCRVx7AQMj9S2aw4+WDocyjz6hV6pzq4p+PoiMwd1oBszHe0A+gQlO6NcbOiR8KUtTkiDEBqWAcykOM155DspsVg/ck7w2sNntoIWdkhCzjAqQ6cWCOe38oWwfL86L1hLiGq2/KxaUod8scZ0i0/gE+caWpRhzeszG2rJ8+nJWCs6N0UawNQIahSzUVZx6q0UdBxllHgd1XB5GAA5t7hYa92OGjo4JBAX2AoiKBpdbaL5rawEsUY3O2+nRrjbkClU/hM6hobSnQV850Tz5yi7u4C5lAgvH3czNgobRk5Z6yJbqZrrJG8L/biBPwYn3JStPANcChtQIuqrkMzhOKWk8JA7VuppehlFiA9wsHzvWh90AoU2WnxQLanFF6OR78x7QIQzkFd9FlXA4pvss2Fj/PBxEz1mTgnWgiJOkdxwfOYA4IPFfuqYSv/G7LvXdzC6HNAgdKgDYu4qtAfDnMrm46lQXZ0lUKJ7N0msivZlWEqCkffx7k0FxvD8pWHQ+Ckv/lCIrB9CCioP4CY4vf5w09L/KljsZ7YCPhDVVBWOzCi4iDxhvo24acWp2+gEqrrL4YVf7Q+bMLdlZ9RjrrAhXtgz+vZAxDgtwD7CBbYjtzpSiQifOqYCRN1VxTKLjg+iSlR0YxwrN2LRPNHztb8p1SgDXiqw/8MoE2LXlf17m5eH0uHlApvvtFJGWwX1XfFznQCCBjksMscds8EqHL0uMEKJdkbUyKgcd5SDjc4LD4BDu0Q5zVnEG8kx2DByi3Ym85laT5oAJzKtYMhHp8COjzMvDqj2RrUoqNKWsL+gDqVjI9NgfanxAHKKlz7WFnvq+l1QUkwXqoD8ecIFfIwWO/vmOY/bOjhzrDCgwQtWorAyB456dhnKxIYfgW2ozILU61ZLMofu/LL1AvG44PIaJGMERtYzuFnyw4pvTYnnCPnfBlphE7w5hMpOA2ji43EUOkCN7W/IujSHhK22ooPba6rwQXj3iLJxo0CsCz4fQ9X9wC7kmIcrLLACa6fU5PFXRPPHAhu2CBEMjWR86OVqLA0/6FdNTT5Wd0E0/4I8HtzyjU8eRdWodIp9NmSIH3ruyBaczhFTDewS3qeRlCJo5L/Qu0DbH1G3AxdkBVWy6ZoqfeDgCSBUojIs9UClhIh2ibrtKiFaqPTg1m0URRuLwfuTG7KenVpLFLvSV7KjZPa83P9wFTQyRTlbJjavf5dGuIup6TAFypYsUazFdke1GGr/unPgZbmzePlh0cJt5sy9EpWSIjlg1r9uT8k7dpfEbRM9ZkYxUaBwmrz2ldSiipmju3jofa1tFJn30uOnHDwNyHlyKlKfoLYUsz5tD+ijFzNXzheDkF/T2luZUvNSdy7bB2rSipUNpL5CbexMqfK2wJo9Be/YneJ3THUF0ouJjMLH5LVvJW7vcvHxAob3KfTGy9M5MA6L5g7qHD6cgcm1htZgAicuT+aicMzP3tpMY/+hI97HWB6gr6uFUip4Xvyr8fY6J9QjL9A5P3kNrCY5w9pgcecuIJg2OXJ8jfwqX+F1+JrCYXouNUCOEnl3MDVccNs8f9tc8tri62WdvtwUZ1SBv/KfvkjG8kJqwZljEvc5lUc9r2OSta8law7DwM2ST8VvNYjX1kr9Eb0h9PUCvg1dmCTyhgDBxyXKHR1DVU0CiWt/KYrXgoNqAUNp59BVlBFXm+FfUJ+2xoJsxS6zlvYKDa3NjQ8q6Yvio2GYGd5bEVDUXbzWimrNKjARc40ILsuP37kQzAjSu1Mf7YdC0cO4wlmBaHqw7q26SD8Uhh7FFcwA2RTx2rInc3d+CMWqSDarCsWo7FM/p6S+Vyhmj2SzqhqLW7kzAUh0UpPIAP9eoaRMDKR8HQAaH8+wzt9z8vSktdN71t6YhdPo4zLlaj/AWxyMS9I8CsxgyV47V5Im1cA3QNDaeMPHYM5r+pm7nq4+tBaiX1p3uEL09lx4G80tUa/0E+NSymJQOhwIZXhTTJz8GebaUrSQ14Sq3a0KQuV0N/39otBETbRnt1AxRdeRG74F0Fts6HvrOc/PdTRso9fNfxgS2D40Z28+TTNLevlgaykqRMcf0VvJLpyR209qYR6qbsSX5AO8haaLDXSE8YWS/+hsgoGRjQbWQZA9f09M6DYinINDyODZQCznnNDN//AibgQZPOdH2G4Qurro5nD9EjoFJUbzbAVHha8vuhwdHwaUASTSfK2BsPNIz84y2CciGjnjggdj2gJA2lYRgpEFFmi140UNheJ/Mj4ZRqPUUnLMXltlWpxm1BFbDYl8h6OY16FwfQew71TEgAIxRLJhEwi7q/GOe6H4+WJboQnhG8uuttcuoL7MvTtySJGnJifO3AyLw4aQ3sxpFPsyPTXx0fUQaGf/3T01EjsSsMc0m2RuCkA2rjSRELRFw8lE3kCO5EyjWEltZ2ZbcAg6lgT17ZoaqCQxH+hAd82serUD1lguUNISzhPOzwOMsTMooKHBEzrD+FLojrj1NR7QBSYXxnqa7NfdqWhhfNRpn9EeRSsLsGXRykWk3FmtrlmtLly0PEyttoko+FlOpEIOnKjW5oS4bnE1p+pxtT6oA2P92SpACe0pTYARMDsO50GMLo/9NFoYA4RCPQ2BOrTf72EyuStQ0r6W4l4fGReH5YXhnAnhFephW1EiLqA/MRWGw9IY/4pd6ooqaraH3GkeuTgrACS+gRc7NxwHYksqnlyy+RbyQBE2gHeuJZ2WGaCOqTSygwOyTsAMY33rqX6m1hMgaEv8cA+b+8eZoOeVPH4fWigIBK7wQPMU2K/G+vh3F/gHL6mpgDbtREmUhnn0BJVhyK8FL+BO1faiTsmngtfV1V4WM/tE0t0ChcD6qSu5qGGMVknQZrZMTpShPNQwTisjaDHb7o3rnyE76QQbQCOMG8TwIpkQPfT8daAp5IbQ3YBOO9XfrMHbzdk2PJgWTHNxCLGHLjA1kOVwGrBbP1/noW507hqjhTFwvjfEw9ZCtPTroe098x975BlDdycngF8gsFFwlsQ5r2pt4DWKV9QffHhQvHyfNrvHSCay3+ku2GQabYQzTgjCG0YauidHGOPt/wEJxtHGwFCwBYUax1RXjLzw6cQtA+cdcuHYqbPzzvHYLZQYldxcfuf/jhByFL3dcnj+YL06V+H4P+gnZbbNLdfAqwbHx/3myH2WubCrSAcZUgzldofrKQeh87g/GzbRhYqBFJ+3a/1bcAe8XmAMU5Jyx976FgkDRaUBgSme94ijDAA5lyqZ8fSIxLwwBO7zqUtHWWlhtwZ9ImE96jlFKyE5nvhMPZK+16+oRDlQjtz0YqgbnYJBuiqVPvqB0CPblWLprehbXLY/3FF/n7OarZJjFNn0iJ8J8sYyygULgQ4QjIRn7XdZtJ/hoCLY3k3OJR//e/rxPKBaUr0sI22QFyzwZVj2sQXKf58chP6w0UrG4ET7JRQPe+L0njKzWGHnSRoFNN/EWC9gA2tV9RT2ZGZFHOSVacF6XXWlrW+vg8iWQKotSc/GSvX03mNYR+2eOopTugvF2MMOKC9zeBt3BtNsRVpryXOpSdgwes5mT9ALsj7NZqSgKhQQgPg+le9KVPxux3lYntqtVTuzryxjMknZf2ViX1wHrgCNXme3M7IThrhYPI7/ROoCUFuwvi595pqI4k5P3e1bFzST+x9wtL+Pw02wacnEE9pu9ShNAQW3jyURrggTLdk19YT3GXnQGtrL/voWyr0ZFkO4KWm3dh1h766TpeSUXbbXB/0/1qJJthUb05PSHD8tnJSDTcxIDdEcwaHLopyWHPL1xBhsELnHOJP5Qvsa+n0UkzP7UR3qXsRGaIMHcOZF3BoveBxxK2wI+/NrcZnYyBOwuOF4qHzgJQ22TbM0QQV6UufMEqxX2LqVZa33CerBe2zl6/g/0SVq3WzQhDYQPYJl0eiChX5Mp174+pP0fQU5siHBkJycVw42LRlFwnMhW11PPZ3GYuHJOL0ZZgY7qj/WiewXmuiEdeELAvbHa6iNqwfDGDgSKOfYOf0ZnwqH8yx+CJSuXYfbtrtW9xjSwIUG57tjGbjLM2JDQjirguAmf5SDu7gi3K8lU+GONVcplv8FR0KdaUaetkBR8wOjGAa2n2yrxJhCdF/A3BsJbRPjbMyCQyyhdWKMjUVwkIvFAUc5BSNtU4d96lsVjHWByvIsNSAqzWHDbf7sDgtMyj+KQD0Wm2MPJeZ81GCD1dpAIC7McdPj5oiniaT1s7jrZgHjgbCbXlixSJZwch87ct0cwIm76gcXiGSzfPgMJ9kZgOS99EPKxcvXdPaL1mz84FHu2ZpZJVYC/MfqPWj4g3cIDbQy9fa3FsPbBB6zNfP0sQQUiVPJcXPJHNvUSsBy4xsQLNGp4KUCE67LH8v8w88Z2LWwJpikR9CmRqSlBWGOWIwMriFIMhzOo7d71349DYRiukUze4RiWw7QVMRfQJuSNTJNPutcYQO8d03+UrRQbKhIZhjQaGFfjtqpVahdYOMg6quZezc3yEHUumw833jcxmi8gG4SCQ645siJl8sBO8rurlbR/BZAdxMfiHALduyF2jBVVktEri5wVwBcQjKLNKtHovkPV12lFL7AAaD81SNRSNUtIoDhyAqev+Zq5d+YLT5erPXRYAv0h2e2OHEElqf5V21PDTNSuO3+hePQVF9AqOIntAn1YTqwI1Po7mK8lYl+qAMzN2iIKFQH7wqAi1BmnmY1LZr/SL4pkOJxg1hFGE3aSiX5UQ4ehnlQXepS12y2Cz0m4Mn0S2X4ip6eutgBLWGg0PlNZiQF9rqnt7v/JpRZoDvOi+U/l1wI1NPNVD/f+XgKRu+offio8nif3ka7dP3E1vKywuPZMP4Gu0ROOWGPk72qrZqCncE12+ud1/VP43A4sLWeOkK2F9ZoVKa6o7XUJJR4mlpJi2L3dJ/JtLxq/d/Z6Insjs7Tu3egGFcsFZMc5fQRULw7loKXnGDzweL1zDyastVbOMlrTXv16xfYj8Y9/7v5/MtJZVkHoJUWln9fJMVEpfP34WOJqSgYH9NTnQxDYWECzrUEkNwDoLqlKVHDTk2Lp/ESrBtdS0um/sUs50wNPaBvWDHeDx91sv43Kuqi5OgI3SC9fXC1yB7uN9lJ0FZ2ireysvdW1QMNvDFez1hxn3CSLQjWJwRm6PqpoDDMuzEhFmPGYQXhOBdCUo2urSLyRr6NsREwBGaGj55TU1dUPGhxyM2U/v5rqaaQpWexQ1FX1dE2VGGX4X5w6ZDBIVu/qDx8ID66ty0JxsNUHqVgl9BdMPdgBy0+o9rh6AkTtF8/bts2Iy/5AxZ2BHU7lSNAw+PATssDF3ZuEL0sXhEHbIKrhsXLhwPi//i85LqqEPX56P/qST5j/tsvAFyB/Q8AdtgKZohNBJEZAuZx3ez4f/6Fx0sl/xzWcDyo3lBOgCv1MBqVFJ4oFtKI8cZF04tZoT6gx2m57kmor1yDN8WAeZ3UNGpoa/k5MPiWWkzupcDzkWq6WcUeGBWlDNRVHjdUWXvZrLV2Zbq62Z6dB4GhDZ6QUQO9UKnz9FN6n35a70d+SADi/wG8kiQgEHovq7GGxhU2aNpZs3xKkZMYVp8T8/3coLAgVDmpb+3uNgoqvtRxkxFVl/Pd36Klf18dJolhdSkx33jctyDKJ2rmXWKYiMT8xMd9c9bfZSvu9Xdb0J9dSiQxbAgm5pf4BoUlW/vTvmXR7Ssr6ncvRZIYVu8S832J+5aCf6A3nvO0yLAZgAho8wBnQ+RxbLzwaTih8qhaxIwCH1B9HazxoK+nAS/qeqg/TS9yz864r2zM6dd8Y9iGsMsFyt3bQgQoT45nZmPNY31zzXhNN/fNiQD/PiyJ4UNsK7DEt1GCt3QbPDrNxn9AJQSxwnfoi1LoUOv7wMwGqCgkYCUKowiKamKaOvHTULJuDSmYGNM63nITALbrLgLo8J7cxf5k6q7Np2pu7dQcZmFea7NRMfPnaQIqp9XkGwTW9atHv4bnQP3Er1zntI2cLpuyqrfYejg1A71zHtw4ylp4Cm0A3CKf2tx9bqNmrCyewpE5vkS5B5XJHlnomFgaXTSyx8w6q3EUmxufrviRO16vYR2jYLxaQ3yzMj+tPupZbcU1oQOYjT9DbKwdAthATgL9ip0i6K/TXxF/z06m9xXbX/j8FAs9HO6f6xpVoN+3Owy7JAM9YJwNgtg8n3j67+XRyudFFVjP2smIyItFJyqRaetWJvwHj5oN6Z3imO2vdmBdh8LdWZ13NgAzmtrCi8us173f1njX/O1pHw7PlTajlVdzbgNE/7DMnBkpVADqK+s/NIxv6K+t9pF11Vqgz1qvcRlWe+0GgPoIYOPsZkNqAxwbSstBa76xwIwYnS1TWXP8arNG60YCWS1cNhpnAn2t2uMiTxLvjT1/8QTnRftibGpWmobvY7kyVn9NKM2/5kDG4oVxaF0DAePSUw79mNjvlNv/d5LYHgB88U8sBQD4UZn95pfS3ymywT4EhgwDUMDu8QcaAEdncOyf/1kB/IDjHqpROXeO94/PJ3UcAY2RZqLvMmtP+mvQcM9SKXed45Rj41wKpiu/DmRQhSkYCsSGkL3zQAoi0hvwE0RgD+AhGAKhDtSrldZrctWbmvnHkwbj+ydKZfZr2WFAc4nnZD+nukSELhmqHULSgtYyF7WKKS3mtRlKv0javtptkrqKlrOIfk9PLbfvUukWm7pL+2Lz6l+atzdG+0Ue9GntfTKvh1j+T2UXtqmJnrqMZ3aSRqDJ1rC7Paxtcdrt60hvpDVGhPrzxrWJtfXG9lqK4PxJms3bHpFqs8hURtBqjzzqEHqj09qmAIVRQqNN2c2bAtZziXMxY3MgLUm+Xcsq1TsySCZ3wfGxf5PmY+sy69x8XsXYvYZGreR738zs1PVkW8d1JhudvWzaStK2nsus9H18sNrbbRgL7MeCgBFlqrlZnlNiBlNLfcvEWPBsFrk4ewisQYObAOjfOOrnQO7vjiS15W1ezqS7gVK3kdoqcLqcfUfSbC7lTslcfaWwC2SxE6YzT5XIaCyITpud/4F6C1ADAFiXaNvEVFWF3qqQVWWpHBMGxh1lYyClo03DUqU8HDkNR9gsyvuxwK09mfayVx2lq61Yd7DQrfOzAGB/o4vteYkYP21NLL+1DzHCIAXbgQqKUAhukAVF0AjxIx3tyTcUCynAdXrrCHsK48w6hBV++/tJ4ShCsYVYUAbNYVgZZmHzohCkMNtfQmFHIVdGCPsyaAm3ijCLKTsKNQJau7SmaTkqr838aKmdz1JD6bMRCwLVoJAwK3gQwAnAgJ2DAAL2PCGwyQB4IMCuB9E4Aqb7roeIC984bj28jQolYaQP3F8GC5M0cAWKEsyHF2+hpO2yw86nIU0Hl4P582isJ4AbBanugn+bmaAK4UgPHXoIFs4pdwpuistVIFTq0dW78OfDrWu8dKusVKRC+EAF2AMKO++2j6p14/dVm5Qnkh8qkIrtT4yQCgvxQC4pDwq0XjAv29MeAiyXIa40oHwNWoyYKyVvgdrxD7Dw5dx8uTsCAAAA) + format('woff2'); + unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, + U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, + U+FEFF, U+FFFD; +} +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAC6UAA4AAAAAVOgAAC47AAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGoFOG5JCHDYGYACCWBEMCoGAEOheC4NaAAE2AiQDhzAEIAWDMgcgG2NGs6Ks7ponijIxGo+oHN0g+C8TOLkK6xAJI1V1fGp1NOoKtBcNQ+jK0/er5q85h4SzDEe8WLZfkSCOKOEITU4Rnwd6/3g7TyHQ0ahSi1ij2km3cPl5j2i//ezdvQweIILwKJNIxSZSouqRPuABEiJISCk2KYoooFKC/ZUwC/MrBigqYIMNz/939Pm7u86tem1ZIQhQMCsagWEmDYB/wBl/nXv9mXnbGcl/vRQgh+vj1yfc3Xsjzc9+r81LDpG/Dlu7aO44XHSHWLKkMYSgi4w036noBt5siPv/4ttPlSYdky5YSNTTjNX9XX/aofghnitDBSjj/2ya7Y53NtFmjxRiBbFofF2Imi5Fs/tHHu/saAUr3T2BQTK8M11Ox3pySFbgALAMVUCV5ZAOAeoAlemSorqmTdvlHOKi7UKQu3lApxxKe2sPD5glEhX1Wqo4k044REC6Hp9eYy39Z057lYxgww1R3lPsIWJzuLs4REiDPBFxfKciGLYzdk/6O6hkCTOIDQeII0eIK3eIJy84fwGQMOGQSJEQiThIshSITDpknWxInjxIgWJIuQpIlSrINtsgu+yCVKuF1KuH7LEH0uwgpE07pNMw5JVXkFFvIGM+QBAMKAVUgUE8+QAREAElaFiI6PN+yBhaH3urltD6en7uYlq/GmuW0YIWf161DBfCJgSIgBiI8WWDsDjTyQME0C6z4pPLw05/Sd2ws88bKytSlWk5PDBBmTZYN0qHIz7JTyHX37xFzmVhjGbRrNLkx30Twb6A67BsPwIUiYt2I4/vjJASwuuO4AEKuZpbdZRKxD9k9R3qUN+D8BKMlKy0t/vt4LjZkkoA7qb8Hu2VDuczdfMZesyFT876DROd0XtDyNa7n/NuvrPcffgyasLXYQqQKrBpeEjwErXxUVKPHwGJTcFzfe3RWJWk/R1XYTlW+H2RKEPoYEforOi1pD5tx8UF4WivNZdgZotEb8UP+GXe0jI29OyOJOh1mkFzHPXzeEbhWhqvU4AV7iszFu62l/bud2h3rxmll4VW9j09wq+Q3JeVEwue/Y9miqphgxuKggLVkm4th2AwU80Zetd2FmluxzKQujRc7ekuLM67R/QstYIdB8HhqjJClJj+blIpChQqVhaW/ggedFiHTl26HdWj1zHHndPnksuuu+mW2+646577nnhu2IhRb1GY9THXPhVbFZmdsLWfbO8XdfWCZHcCWUZHZHZUVkdU9bVtfaW2I+hiu0FGI2W2UFajZPeZ4n5R1S7belVtW9X1MjKzfubar2L72dZ+tb1f1fUzmtg+lNl7svpAdi8o7ltVWLZhqusD9f0Cqe0LJGb9xLWfxfaDrf2uruMwsR0nZKJx7E3BfSY6xJLogmb2new+Udn/7O6wWjyIYz/jM+v6HIri6lOjaENljtgejaPGymxZrXnHosUr7huVjbO1W23vEbubpRZHXaswAmxoEiVnuymjb2V1WFXv2JZVv9xGfkeowJPvW3QYySE2kiA7xBRWyvez0CffkT4KRnREQnqTHkJn1m6Ovcu1l8ViBtWxkSC6zq4DuoY+mkvMqPfsa36gHtkR7eb0+pxy2n/OmpX5qq7EGFpKGgIrYOzg7PE5oAlGEYYlHEcEuih0MeikWFJwFEPK8JRjqcBxAN9BNIexHcHVjqEDTReWbhw9ML3IjsEcR3YKyemkyjupY2QsfTguQS7DXYe7ieIWkdto7hC5i+YekftonmB6Ts4wnlcII4RGyXmb9CXbB2H+OpkzRmCjwEiFus/sT7JVAmOgFaukCoigi2Flca+zVQqL6YJ2WCkZNoJaN7SpIPkp4CfIKXUxDQVlJEO+dOY8Sp0Iu4XsDAwBXeeq46FcOqUYNoFk8iSRlKQlqohiUczFmVTMLsxMPkl3Pn1DAtmRMQRR3W5Z8o2oicdQF2kF0P/D8P5QOmMEG/4BzDs1z6AKnQSkPaaz2VXhZiwbr4QVunYi6sMa+H68CFg6K0nJTFE2Z09a05FTuZmHeZnvg7JyI+gM6YyEJznrUpKtaUxbunM6t/IorzI1WFa+M+Q9Anl3AXmXQV4fyBsBeS9BXgUQEQONgE7MgUnALGAfcAC4AnRnZsR+zWyDCQkXHbdq4csvju74tUBBgmPbSIjQUDOpNodEiBQl2ltj4WXKTzzVrsMrWbK98PKwZDlyrZdng3wFNvrfM4WKFPvPmdDTcb8BJTalbR96pDR0vfs771V67IMGewwkiQoLQVln8l++5Ohn4EdQ5jyo+Rukm0D83tGA3YMuKEnETKySUHc4Rdr8WbUUNF2GcEgpKY2oa1JRQ2gpjRnOKGUKCQ6EnDqcApAKRAcpMb2kacV9d8NZnXhjIUQsgRVEJNeGodi+QwZaXvo8hu86hsMNxZEPBiUiU0kT0jIsVbQxz3U5Wk2YftM1DfI5mqH3Mc+GbKiBHKiFfEXd/O2Y4AOepjlu6AXOF+INaaCesiyIF2qakUvq/PqwzchNojC0bcvKksNeuOOkkdfxkmXxevpzVhQmUgz2vi3D0Nd11+TZoZjF5kONqtaN5Hmu9SflxmnRK+fTVC+SgVphRvKuKAq4hkkPzj+1MUYbJ5MnJowMkDJ4IvIhmEdZoL2Epl2JeOZryGIAMJLE05SAntMFXqOdzZUUcIqfl6Xpz3DFcEjeSYSvdlFvenBEnSqgq4lnXVd/ralhVf2u69+urgpkrs83u72NkeUJGv58+3h0QQtiQqCUrr20sRnkANu+Jx9aQZi9j2nNtePuSAHeP8WGNZm0DkwNC5iyxN7YbXBYnLW88Sg5lY6IineotgSfx7Sx5fPtnbsnRyqQY6mhqwDkrKkBPxSsTQ2DBJ6sU5lZ3830uATWVr2KravL2z8tv0aZJUcMQuE9f7Af35cGdh8hvocrcoLpTImaZLiMzjp7jh5bZYi2W4OcS5lhwGy9p2vBmX36/kbmR3Pzsooqx8zJ4VeBU3wvZGq7LeyQyYufMh4HsvseegOjjhlMv8ejWICSuzbIGYp/Sil4HJMqru0MwUCsdbG0DnJ04b+wwvQLFkGJN4ZmiV8bpwtTr7ta9QnX7bOdGZGvw4p+0g4CEkaFdb3CxED9eAEGwmIE2gvgqtOHdDA+ZjMNGcW+btlhAa7CHYqJqaDhkIDfEGGuXZkPtQl9+x/7B0xbeSoYxuENj5x+Z8BrQREYaUOe7lqZ4eI667EYLwwA9Fp/ePU/t4a8MAlAwOFN9UWt6CjY9Lik4D3x5v55OnYDJYpay6aX8s0IfHMEXkDOi9FYAWlOTsIaSMPklvdnZRcsrSJXYaj0an0Jrh4q1I4WxUpawINs1ifbDLqwhv2Uo7DxuEnVmmujMTsVmpDVWR+iu7oJFgPDoNzAJ9vUkdLXxlW8p42vYdB74VAFAqSkKXBKRiFYC3iC1J4/lmHN5EWYCbZIDSjcHIYsphDj76hdnFyapW7b307jGyEm67ZBqnDOBPVmAbvQnwMdfqBZ6uo+06id6tPX9+IV7Lcpo/FZMfev0RZJEq2dq0AihXaCT1p7q7MXV9Qxi/Biqe2uIOCb25vv9Tmf9/U+VFA3U+enn+sBUi/tuVZ5quaUxutWADFKByJJq8CWuoDRDDT55m/Zw05mkHcoEDxE2aBlx1xog009drVNUMBiENsdAXJesywU4qY8fw1WTFOW36dw5vPdEq8G4ZOfFN4LgY9qTWzMOzpd9/p0xrQl8YLhrog5RPv6VDBjk2tlExwcozt7ygo+RZa3VTrByYsWGwojE2j41EW7bs8P00IwtfRJJu6uatron9KDVbxbJj29IQ/Ay6gXCGq8YipggFDG5AmTyawYKLgA7QvWPp+yxzKC/1Ef9P8pb7Q7RMwXNTmc/e23HWzIL7jauiWdDmbCxEUrHzG31kia/aqz3RIPr/ANyO7i2VpQRc4lUqV32ZLoIyXnwKPHJLYTITsxJVZ+MOPQKt/wb6uHnOetIG3ggiGbQrNsLkMZt2VvTlVPuo/yyMxutVvEfukfEvFARHJGMpRbufW81GMGoWAFInWk8zAE06JPgs0DI63mPkshgC33W+7KN+nkphTcbc5QOhsa1Lw61+SG29Iy9asb67ZV27fIJ3p7T9CiUxFGrmIkXZPtVgCNwSPyZMh6WHEXb6p52LK7pdu5ZvUzPb/qenmrXzR3L6VTNijMxKKuKOhJHtHwKbFksiQMdmtKTtGhVT5A1sqMNNTXXl1TgyVgcHBA5cW+PH9J2etIRLGaowwqTgb/Xcc0D/RT795ZkiUqVgzVedeekCqf3lPggrW4YtaZ8OyKfH5pqDXa7NmDSkuYJy8O1tDnNYMj+4ytVzdytExD4vqypL/5FrV1PvW+3ad07UicjWg+K0RC+BCdLpk8tlXV/9j3eVMZ1zA5pZlzUAmwMMBnHHBCEJpcMe3Sa9vi4QxFn2GdBe8GJ710o32qySr7e7UaOwbGF6nPTYpU6cXHY76/xtB75hCJxgJRvusKG7Sa/MwOsWsHBDDCYit7KMimKD+OC3gqeXfmyKzQST5NJuPZKyGolq7ABja2dNMgIFkwm0vhpgRk5sIuPBqn4WMCiLKM3hjhgP6OChdvbtr9hUUuUXtDoKrUe9dF05KprmGdjo3awku1picsCubMAGvYrEMyq7CpKnoKTcqnbXuTP9h0/d/XwiSTpjwMH9pNZcTeuDCRfON2rjQwX3gyN/8RBU1uTI/GhqVrAYYgPfdM4fohVek21nmbG8LlVKPXpPxVjBTEHYM0xwDuVUU/2g23POPRbRxBG/Pp1q3UpIo4FTGdeKQnJQnB73YHW6ZAEn7c3H2v6NNzcPPbjOdCXMXCj0K//D4IPxWKiXEGDHlcZ0OUAqD6mVmQLdaUHQmw2KAP9gnvPKWkqoylP95SOm0MxAf+PcQZPCBQ8CtvOtiIDy1pWb4h2m8+8v6kMOhtoptfs09aUwqJryku13H9LXZA8a4ztLbGMep9xjQAznIJXswSVBhzETIf6bhTKJvMFECHFMWm35YPNBCy32N9rj6FFRufhu6YWIOooWabJ3M0Gs49D6TO83hkAJAovHwr2UdG+uu9OAosQYE4UGxyndPqZ8k0bgwpNmpPgekdd7UjbnR9zc7nvObOH59Vdof5gv3epxqvndmf8FLsdk7aJ/Iu0lqLkj5ThfpD2CP8D5Uy9p2ozSiVYfuIp181xwQbqZGUqIU9a4O8MRHdaSEsNyi1dDx3QHylnnOhc5f6tT1WVVZQOpVUJEsqmuYMdU7HBspiAqdhwRRnqHMKNEc7WR5+mql+ln2iUx7jeUGaG9d0s74l+FW73L33v3bwElRgDzakT1HqyNlmjjv5MV6HK17hD3FQY0yRshavKmVG+XbVspoUqLGkeP0TshA/LAcf2JGhT3tDO1ZwpwA/TLxgib+B88jICdb2kSnW/pFe9WthMN+wKZM5X+P/5Xf5T4UFwgV6YyYXuSCdOX1TZa56sx/9R7CGIKWMBNuOzy7MrsHL0YlOUjGlTX5wvBqx7LxcBXHrMAckdWFajCNy+Pqd99zTUCd+4Tp3n9sviu98efT8iD1ab3tF43oyFO2JoHtTzO3XwNtrHig/iuc2DHTJxo5boclYKRos851i7xJz67b/+7BpM96B33nR8zzQL80TL8X3fCU9IzPBQllwoIx2Iz8H248HyKIXTHKPwf2ySTklrfhO1DNC/m+R35gNOcuvyheV4OElLrd1sovwYrx5Gn4KyrGbxWEfGFvm8vbXkd8Vl2BX8auaCh9Y0a3UvMx6CdpN5G1Kz7EIeSZBX/edJgVy+sAowZ9u7esKiimDRRWH8Gq0fYh/JuX4RNopew1mZj5WgKILqCnkCe4BmGSrym3YjX+sqMJL0ZXNAT9ZuzmHaiifyrfim9DlysAfzB0fUoiYiFxfLBPb3y88SArNi6wKwXfh3ruNAlgZFHf49/BfqFz9nE+KP3Ym05KFbbpjtB9wPND9KXmu8HvhzJPY1ZInON3kiSVZa9ovTmJ4aE+B8MINEytzfUMry9WLLSxCLGzSM4ytzdUkrjf0+9bcHJaMMusV6+sgLhmiF7gPT7jPNY/svCY+LzXZJSc+z1x6ZaP9hugoj0ywbhSknHYzcjjU9AevRkfbKVtpjUTXm7OIaeepz02VYV5I5s60HeeTQ9ftfuK2Dj0gfNfXFJ/A+0kXWYpDwvJ6VrGsToo80E4jO60lB1ctvrvcqPGEdFOk9p0WkGBbAhlOlY42i+++DcaqihYVHXOJX8IqB84E47zZBGh4ON3AX82XG40R7qz+/To/HztPusRQvC9XuYWRH9sYg+0kaoNW7TFffm01pDQdJEXRW5i2PhRzDycwufCWtvFkdRFegBp253UAUZZh4eB4BnS+z/x6fdFdz0VfGYsugOjbyLNvNP5L2s1zNAJsN46UucN8cS505oMRf2XhrLbzCtUeU9Oef+f9WDH/u8hGNoV/Xz9VebJq9lu3T1Pun3MWEKFhRT7ytNcJ3+By75jf/8RCFcczE27PGPjfcdCZSzs26tbnFI9siGrmkRt4F/Gka8sYmEfYOPmgQmeaBT+jk3QbVA4fhcQCD6pdbpSjP+aLKjxYdpNUyYba/51z0AD+oRWWjJjRDYuq1M4es2Ax2qg54vRnaH4aLVfl9OSLlgaGgteNCa87L9QeWcyZch2bcP1AXa2LSaIqgpTo6gXgZJ7alJAylZBSfzHFXLNAsKhOaSy4PjZ4Kja49FjwEo1ukz/qoJ1il9uYzohlBGYnxaMotDeJG/INqLKKk9MxZWiYmH7IOsG9iaWHLfI/RI5jnNJ6P8JYdQfBmyJnvwAeviEjEuXgfXmshFnnbysY9ID4EtgMdc74t04Z6v/03f/963PM4Audm3qKtX2kPZmuXGVh9JszgHzkrvByyI335n2U27BpJ+w83jCtvMDokHtNf34u0l1FFl0yeZFoHmeRxd8uwsCrmdfKlSyvXnAYH0Ufvyg8dbg85XCFsz54A4l0Y17WQVAKL/gLr/yZ5A5ybi3++019HDt1wbTnBA/loSOb2TJWTFKGBAfzx+SanOIsbBtxY2jJh1+gfm2SEo415Pfm4Jvwjmrxtm+gPWoveI9XYPdyMj5Rd5HSrcvP6AjqDmDPcIygjIBJuOwSrUlmuIm9sPLz0QKH7gmcLWV5t/6lFe9/CZpaUu1aJtLOHr24Re8wZ3qeAiwNn0XYBaZFGtioWmbjTkRM1s4HLtlYB3pyBt/5DlmGerp4Z3jQbYRF+4njoNJeCx4oypZqkehkbWmPpGvYq8aBse1Hz3EkRR12/iVgbGn2zW3Ks/pZ/T0dwcOrufaHnGmj2HcExXeYvOAZaquD5XYzRo/ZJK1JphU2aDR67XoDuMldNvCjSHeqtLNdg29A+0Kleywd9uTMk9tO7mt+vP4xWLwmlE069OzEbHK600w6DexyHJiEFeGZHrSjmRO0pkxXtb5tEDFhJfGTC+1HN5/yTxs5TBqvCbZiZFSR3LC1ohDmBFS+HIIO/GY/tZHegt++NizspBAwa1nAQ/BHWYFMN/qaNT72OIgHy91RdgzH5TlQ4/I7boSshWL8TJnXNHvHfF7DDjRRXoG34beGSd3PgfDzSnPBL5L857mC8kELSk7AVpCOdtK/4bNvcadu4HFoj5eGQ0XLY/wUfvOncJA+QkzTv5Hs5hM29l7mWDheki9IX7DfdAJr7Mn2zi6WWBCWlytcB8sdQkfMpEeUBj+/PIb7oQo7tdUbtpzEW/CuUX6vtH1ibQdubWHqInUjUqT8JGnHZKrfWA6Zr3ZsdMKi0ziSNt+gY2SmaGxyEU7A/c8YLcxexuN+/CXjvFmrcluLscEEXjOzKvab5zxCwSgrie5Jc7CKdCJAycK5GZz1A+x+Eg/xXyT6h+3FzGwn7txc+uIlqA0M0cKZrdn9uXg5099B67Ur6yNegt3OSX9HqsJdWK49kFzmz3aBaZAmV1qOK30bINrxW8Oo51mwT4onfpvkqZYBym2S1avpcXa6Nlu8UV4M32UY6HHFHXdDk7Dz+Asu72IjOF5Y9gQwetmWY9f6P95YsfdbabrGnR85Vp1TTdG29t+gQRSuKzqrJ3LbIfqtudHsJdvI7NWawU/GfMJ9UTw0RPkoqdt9eixuZWuOXeszqB1zv5X+rE3Ovm27kzBb3dbW4TtIglZgGsRjb41FgfqwwRpR+8SYMNzWqWnAh6zNNo1H+L1J0e3FwVOLQzgZntlZRDR2Ns55KsY/Dm2EBqlc4ZLIqcXBc17PegUIvhf3PU1ZcGAARIrts6+9eXCL1fn4YdxwE6fhleA/hZZJxVZ3Jqm8mqnvvaZh3LHZRVogFeYo9f4v6Z+jCjZmQaIGT4kPJolE/ZSkjcp/Nw6MlyHJvCQkPpC3qYsUhR2Oc01nJKCCWTKLnIubzW8ZBAWlFsX6NeGrMbuDTpnF9dHOE48eSoYbOXteCs7ehIkbRiiRt1RT1eIXSCEvTbBRdTaN6SwLx5wmKSuW7hkRJiHUQHxxGorgzuTYFkoK9wUtPnJBdBs5iX15/uQTtKqM4MZwoouW+21PmbfxBCmZKLiws01P2pLHjmNJ0jPWE7tBfFHRorF19y2cayDYNibkDuJQkPCaJNrCS+0ni1VPTMINY4fJ5bS62/6HrPBqop7Z/kBzK8GN5YTkrvapjF60oROPJ3LPVu79FFPuzLQSFI6S9yq3CL8KwFuAIb+FgDfw1XYWVGJD+ZnTlDqy1NTcsij4lMHlMzHqHxnUzNxNPH62/PNBSCKwAwUnhZZG1cT9J8snD0Kw4cHCXrCaw6uvIb5UbsVL8YsVfr85O+QEDbXoS1kVfol4oUB7rH0g8A45RP0zUPIjdow8vU4On/MJKNnRu2DeejxMP81r3L7r6LY0xFV4AP7L89RG4ifZaZ3/oCUBBasHn+2Xqd1anK7Vl8lzMElUcOffpKeavQFoYijl9oHS+k71S8r4S3DgJawZ4GgqrO0DhZR29YsqxChKV9phqLDEk+a+l/hYu1IY2g9y4fuNuhzZZuaMV7uW3cgWyvZavk2+F9Q9rBUSjwL9f79Zq1lDeFNOaZikcUlJPu4oyCfs19onFl4NET/+x2NZJCYuzP5A6saPJywVhhwFubB43Yw35E5yb9wKUcxRAM/CrjPUi4Tougdf+SkXLidRaJ/bXNuqfbdIWag7w/UxO9+Dr/KM+/M+LroWgtaXCTd4COxYyM02yAKPJEoKBetW5H5cUeDkQLH1cLHGArGsTXLFnsIAHbx5E61zlFqssjdZK1knXt3UcDqPnw9ylLgNyXHok6+oxzZUgZ/WmJDKC9wPzEhuYr0fWPfYJpPqE20HmVmqE7PvfhjvInxQub3YYv22DvwgfuST4D91TPVhWaIssB0TDrSQtUbU/+A2uI1JkKszkSjjxqlcfDP7orEmttrSudEaC83kpmoyViBLM48d2DtqsVpVvEa6vkRsajCdxy8Y1WyeXeMj5KTbe0xyA5uBGcFJ3OMP0qHw/4XwflzHY9BeL03HytZH+FnSlV+C/uSR2Nl7XCsAy88RZtW7WO+tXOZyYaazKLcL560GF134Mtx7en7ViQeN8Y8+GkyaxJek9O7U+i/+yK1T468zF+V2yeVCZsp3y+hsxcMtdohfNY+xUCXA/TPxGp+iMka/A2/ONLkSu/pyzqWFKrrYlpSWWPwAgLpswjKuRqt2jtw1+mzS7vrdtUPEIfzmK1LXSniS9JS54snEvn65fbRYcpbnVm+8DoHu8V+H3FP/tI6tOqm581ebe+rfNrr0T5un7E/buPUxmF8/0zYh5UcLaEaqyuUcgfkTPH7cYdB6CmxrQTiSxuFR2htAQArwxKvcOMzQVYQ50Ivsvfi314SIQNnzrVzGSeUmzThnM5CPlHd0dForKjmpUAlaRl8p3omRfuAdH+MlASLSxQPNiqyTo3gtO/QBSSTyjisr3GaH834EchK8EAuKl+R4kXJkIZXikxzphUrkars1258UwZQ7qkBpVLGhYl+Gs8fs8GQBgtal3omRvoAkp8RlA6Uld9uco7KD6ZZ7b7e6TDIHtUxWL17P8V1pYcNd1qaD67vCYtnLdjW7XSscdf9b0pQiTl+zlU76Z+NfQ5DbKrMdugsEsyDI1XzZNl3QiyQp+qB//tNZ30nvfE7XhEqXopIguazOmh04e3r3r7/JhyT/Gn9gW15QebJv1I4NxodmmS+woJvzEpI3xeOG4P1b0Ro5iryL1/qA8ap8l/XJPo7pYcaRaD8KlYagSa7Vk0fAS8oqOoTX4p1PSYNz4i3Ek335SOKf44E24qG5Hq8WpRegpbZqLvlSH4to0xBeMs12D7RabPfubsEnKiUYt2UWoW/4m8Q7NUmyFs1Zz0xmJhRmyPCe+PR3pFVi/FV2UXvkUyX2KCNmiFnM3vcFP6q7uvu9i/I9VkbqllTcH5wiiFnsBR/jzuku4d/5vfGrYNG7PXPHPOPiP3ossCTSY+HfRoOZDrnRsOa+2Q72yHzVwkMv1Lt3z+lytz80/pYT7Lh9h5v6xd1zL4vlusAsLLkjLmmKtX/8mniwLzY8hx6+IuZ84XsF0OcdzrU7NEFrkpWqDaY7dATHd5i85BtqiUFJ4CaLCXRWG/Bh9Ux8cGkA4mS7HAdWiwfdNvCFDj274ttXAK7hqxJVES6NT9vDmPHviyvXF1aGbQ+BiYiJ8++xm7/OdLdd3ZUxr2AXI4ydnrs1Fy8H5ysTtG2yXbQmmahfLSng0Sh/h9y0qs12L74ZjeVufsfZQfVieCq2LZpv6jpMyN9LRNU3VqRT0/0ZFbsP5GL68vs/asjNuS3fVEW5kJ2GbcF7bvN7TGB1vNpjPc0n/U6sGDTTFPtaVj86XL5gpv5LmpvBzVxyG8V4ifpkOVjeFnbjRYYlS/JQBbpVHUzh7pIoPv1CP0OSu7KTr/mXle5IJEZt9MPkXYNa5C7wK3iZ8YPV/r7YOryqj1QvcOLmqN6v31EagnZWcA8EJUkiRE3sPJJXtT2WSJr9HeYYjXuJB5twkhdjoziBtf3NNG3GQ9L5r5cHcUFokT6pNtApHrif3rOLdjRjgtaUsTkee2S6SgRqmp32V2MdGeUtXLP5e0w1AulJ8usOmsgmXOYil8tY9KFR581Dxt3vopv2lyFz0jI2lT+7tFGlvE5U84TXZOwwbuq4EpP4qBnRG414KYJg5gTI8ylZsWtB+/th3DeFxw6Xps9ETm5gfj5Wjp2vP64HwCRP1AHUphRV5XamTb5S3l3q/g5AFqmB2hpHT6vSdzfgt/AxOeIduNJd5EqMQtBxthvNjpVaU7weq8MGbGZfSnFT/RrpR4TQV2OriaS0vGisiBi8YHIT4gWl2K3ikHFBScyc6FPkbU1gigWtXmh7V3Gsm7hCXNZSfseObiW7LMyLXmOLqon1JenZ5iEvJfB1XyBWnm20uQ9ZJTjQrL1dYftaqnTt18F9wj+C5b/MNvOSyiVD+VezqIuNf+P8gWS8tsQGmDJmfEHGWvwPgmP+lfN2jLLq2Ps+T3UtWt2VqlG4hRHKil9blEDqBctaSbb5HaYgJnUmZEsSs6e5mu/kjw9dbkamjnzxxcB5eaqDiVskkhgdjwelHjOngV046wTTKFP+6PULTUtteMp9t9TNhf2uY7bT6IPO98EziH1kWfWKPQpXOAmzL1yxmNd+CO/GP7eG6yqel6s0+4TYfjQ3XlHrzlKsCbttq3z5R998uJBuwR5fNb99OpTlSDPnxG2RgbHRiJv6tfTZR061HVTomGS10wt3XP4l2Ypfwt9+oJz6hofHZ/iiRPxwLieRm5dSmofvhDnHQG+bzF48KFVqPtW7X6HnPbuDvnHHpWlJFXYBf/OecvID4OGSnCC0Fu/M5yRx89M2bcCrYU4vmFnUBggVvXLIUIrfkUZdoxfQy3bf/yet7rjjS+Kh9ehwJVvGTUwsi8GBQnt6SuTVlV499Gdt9SIIEE6xtr/Zm4uqR4cDhd6jwPMh+XHmqUb8nHvFlyRA2ehIOTednZQA09g5kYUdm4RXC/OwWtxHFm8xwbzfvUhHK+lVBbV9PpmJwnnhz4EVjoeRn5QG0s+0YLIGXyWfwuNn8d14113y8fm3E0zCZHgWqrsp7FR3o6BIX6krysEjUkmWEL6OGuGxzot4gdSvV8KOpnRWisLZUWoYqF/XgUnfhtjnKIlb2nYvD1ULaqLmkK2sFtr0b6BW65IBhXPD3wJzBL9f/y/x/3fmANqJ6jsoNXBkTE0cZkusjVt2n8jAnQSOz4DrSHXkVSfNG9mzHXZiW7KIFKoDPTmf/BGpnNkPNzJBibCgjcYApYHvcIa41kypJJzCUiU6TopW6SRXqPJXG+iBygMZLCkrPiFZgmuCysA0jPj8jH2O+4yUaq3snk5xN4iQky24iSvu0Z66WJvvEl60IHE7OOLWC2gOvGxWfMD6QBzKalS678BQJtpMM3d3dkeaoNzHhDPE/Q7aZsI5Yl2UXoIhc52xt8t/oNCo+elSY76LZId28m5YSHJkr6c6rnF0wMBq++uqzfvNF/xgniOCRFfEKYyaobljgrWlzWmM/TYLddSd75ZQWzUIxizhsRP/84oAypkD+GG8/SbvCBjiqf9C+0ze3bi+B3cUXjb3o0irVTpYjsE3rmfco7gsjbiTgBeOMZ8qQSAv8DmwAolA2kCG3XjvbuwQ6r7Gawfvwk5Gqt3CRcY6fSWUNjWCJVIYnhT5VAt2ALXfYHVq/YuVxOxFg4nZsbgjePN435qTO0uv4xlhts5MZNzT0bUyW/VJRirno8kgbuCz5176X7rjxPHvmxbUeYXRBa7CffjnpmQluea5JKXus8pqNYfgWlLp7dybaVmD9qJ3E8r/af+hWVHtmBnlWxOxrejILXjJm+n1HphHaEOlXNYOINp9UGgM2kEkDFPiSfVxA9cicrBy/GpF0DfWNjve7t1/PpdtgYMo3mLVqYBlGzJaz4rq6EFB1Oi4TNDweN2rfj24TKKHFp5FV3e+W0Q6wKX/e330VsBu96gkiHKuDTvYKMGsr+nL1Aak4gFbb66OrnUHyPDiD7QOwl5g9z/MPcqSKVyn/upHLajrGqsdBnY1nspiy5hhNbIibAM6m8ON+Ab0jY399MgarBb9TJCdomVyf+lGOS/QM1/uQYqkFDec44Q3Y/cJygu85yvgAYWJCagc68tgR7Ei8iUFcAbUL4H+q+Iy5dYyWJ7UHpcUImtNxYbn0MJXRMch3wp7IicDZ03CiuvzGPJHb13ciyzQZ7XzlVq5c9rnM2CB0Oax2uA3yY+SMWJzWrn1tOrZabWzT5Yu/jj53LPGFTV8TGmYwvoBc/ZmSVS++rUy65qP4HkbXG5PgN6gTrve8WyvePDSgl8IFmqsvDnviyTc/PWijPMrL7mjF8UXp/D83IL5lqfPBqoEOtVrHvslvwJ/9kjq+miCpXH65SP6clbNODzuLCyT7igVb/9VFPy0PcMwO6ncZO4QM5M5/16yFAyqHu68++D3RTDqQT7mWhEbz5/4URb6L1TO+cRGAC3QBgBtUEb2aAVQgCDcZy6qWO982DLzVcHDBE1NdOwj5wNgHYW0DO9VCC7WV3BfTFWIWGyk4HESSzyG5RRsAM9XiGXYRMGXormQLbq6DFIFD8dUhQjCRgoegukKqR4bKkSPpeoy7Y3t885oQgtti9w61obGmU1h3WAxNvMP/QOb8APDNmHdCK9sItYAwAMhsBQjg1oHaag30b5iDuGN2GITcLgUH5h5RRQ6REQaAGb4SVHsopZjH0qbaTR1U/ucmdMS2X5iZr/ERWYRMrAxcHEH0eiy3kQZc0HLsXbKqHDmKyUmnYf0kAnm9AslNA+UR3Pt8pAXIYNizmfRmxRm/kMY4gtkY+2GWcxqn0YcPpuJz6YrlpcinA+Ux2zt8iiHKuNKeXgdOWhh2RtEbYcCUkOruR7FGQpR004g7gyL9RTYjhl+tFIqlzA1cqZoK9qZttR2R2SG7YysYS6ksKuhNXhxTphrHi4FhrFIViGkeYhF03Pk18A5KihAE8+DWgBzPrNoh01aJHwF2wJGW22gETsoz51GK8AyhduzlAgtLl1mkWcy3Y4vJWJjBT3C8xXsFDZRUFGcxKqKGWmROGpmsdsvtVXK7vhhDz+TCVTan7qz96r2tl3HqOEtvGxIrD9ehSfcbZN9NCnyLJHNkzbfzovp7JF0jS2NGR3vZMk2YjkbkDYqRopCrNxBwUbuSUEguyBIZMlVS7K0V89oPnYOeDoM3qbJOFXeNwWxPJcdhrdf/lTTCt+tp5lkLagBuorK0DlWVxxpIPtp/lfeBlOaZVpANm3/kQ7SPnPbktv3URw3cXw+XzLmMpXbIy1zgej2XGfiIvKuGFb2kcXJtyb9bG9uMXQ6l/EGRy9mjEHcbDrbDIq+Pxo9AoqsmifDU9oP0htHmbhj69u8Jefg1wiefdHiaxTdMJ0407mT40YbpE+OhqV9Hyz7lS3Ejen+nwmUram4dFvNTbESffH7qHQiLUeBqO/Wk7lBG2Rb9geKIB0we7Mmh67FMsf17agd3JKORTuxMKiYNZeZ8LJoxS1tciiaL9G57zJ9FKnH5DWKat/LfX9o7yX8ac+aHrp0Q1y2YBtnxgcgW3TokkFab/rogCLPD4NYZ/+DvrRkSckGOHYb8XRy5wMK1WwEVbCTc1hQkNemmQ+7FtM/l/vtWqcg7lggydkAzb5xu0hHQkDc8PWNZ4otpifL/ium+ADAuz95bwA/PLn9+Wv1/0MvGY8UGBoMIAJFl1wmQPGuLvmGjQforrMb/bV2irCAUQ6IXnbTGHX/KIlMAu2poP28lPEekhYsSlz61OVrB3PB3iwnziyLE2dpjGgj5IuVrrVkfe7Jdae9K9WddekJFR3b4r0LJ65EHE0mK84/nOcwyD+XQDqzSdr6KT225s5BK8/aNuc0lSmmPSW9mgm1E+NC3lMffc7LnsJ26pEgoqynGC/ibOi5GSZOLsX1knucJMfF2Z1H/SgJ2fNYxpna/m3BPKOYj22PbeuO0IrNpbcHCGeQ6PGd8blIHHq4sv5v7/gJSxKT/NWSqsko6qmLj7ywrcJBxHT/5RVDVnltMch/AwrYAIULUGGZnLs6OWmTaOcfxRxfpqQDN6GX8oBO6HhnrM27tUemlU6eEw+beqqo7Xj7p0D8xmnnE8XTQHs24T14dPZVvE0SmdccRqmD0e3JQ6gfF17zwIX0Sx4PJ+OvcKLIz4xZaem3IQoKaYzw8OnAzLmpoJMkvM2hnb8UjxPt7UI8MWxTTjfl/ZTDDFc9Wjaggwnoybynty+y2t1s9kJtQxeacFujrfxU9PlO7fNzlfZOw0h/tSYiy2eTLQOwekx4bfVeHdWeWwdsGzqdp852P9NDUQlQoGpPelhb8mIqzgL+HTxBDwxhD0TBBizgCoTBk3apCYI0qMLbQBFWyk5FgB1Y0S7YgzU1BZqDIniBJ7jX2QVZMEzaN+hsW+JOoB/wpDTgD850aaAhMIdV9dj6J6HXRoVpdDJ0B21BJ5OAgL9sJuKFRORismpYN+TDlIqJgkNpcWAaIF2JzBJ0JYYp40rcXBtzE1eSaDmMyNLdBWXz8AMsJEmWSSpWtBipVBnQo08cqmwkqbo9XuS17SQKp8NWKyje48bMU4gskldGkpJ1FhFgbm9hYRSlRlQ5Dn5yY6VJYCdVqHixwqm7V625l4hQiljgiXiRTjtDppai794UtJcWiYZ0rVQmM6NLxHSm4zojWeitI+lIIhXtZIxESpSSpUCmNexYsOLEnfFFiD4mPTgI30CQiHAGAAA=) + format('woff2'); + unicode-range: U+0460-052F, U+1C80-1C88, U+20B4, U+2DE0-2DFF, U+A640-A69F, + U+FE2E-FE2F; +} +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAB0wAA4AAAAAN9AAABzZAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGmobmnocNgZgAIIEEQwKw1i2CQuCEAABNgIkA4QcBCAFgzIHIBv6LhXc9d0OQlLmtmQkQtg4gChsLYqSwfiU/X+9wI0hUv/ESljasdKOLTGMi44Ndgq6GqWg9LAyZSaQ1p2jO4gS3GO52RdM1zk/kVej1lvvb916njBD4+ETR2hyip0e/N39agQ2E4uSVEGghOwN6WYXpPWQqgRRjyha0wCtB/EaOgzLb9Pfu/Z2gDPJbgFAHz8PpANbQIyq/SvsAQrZCnUkaTL5UDx0hBQuWtrOtqcReJzBYjAGoQxOv0HSnf+5Fg+TUohWeR0q3kQ9Xiap+ObpzxX5eZrb+/dvcVuzkW1i0QoGPSIFiZZMqRKkVCpMjGZmYBZmYCEg1jDBJrQZ7OWgjSirppuMh67lD7df+KNVl3LJKjTepvzfWpntSoeoAgjCbWLjo3T1r05N/66uAe7XIZoFwNkwKiChowYCfEDgLutynkDoGHfenroNPE9TZ/PasmSEjKyMd5djvg7F/LDlMaaaXgSHm8Ya4L+51R3vQjmWFlJe/PwkCLK2ZIrao1UIT8JdOgs824sX1UVVRHw3Xqt23FhdSz4iQYIXwkPStQfxtJicUREbHtUNErA+XstdorxXhhhYQOwU4mZQLz8NoimLpbwszcvTK/f00Rv9MAVWD5hHoyHg/hM1M9mJs0WgvXv1d53w1MtvE76H5udu0FuuqwYoqA48EAPIkMRoo5z23dR7BEQaIAEAVZTcQn6kRdCesSro1vQjrGf0cVbFR8pNZlYwpjHK3tsuxjHGKNOAac5cyeYw1zNllJg1TkmoWGotdWCWP0W9omQsyZkZz0Hy2iDHMg8yr2S1szaynrEG2UqsHxJkyzkrwXcDIFjt7g8ZEAZmHbOmP2gzIzaOXD+slZWIT+mkOqGroajYAWm/ra+8xcyPglVJPHNXew50oO5nsx6bFd1Xn1ybYF0feLpL2M+nnkqOI256UcjrotQawk89RYYtoDPxnjgioWbbyctYjKeoqus0jPMfLCe7mjK6GPfaEguW1wYE0h7Qbq/1DexBJhQjoq4WpHG9Lg76FngorPD9NMndQbWkG59P0aJ3oPoW/emn6fuKrU5LX8A1xfdc12PaN2Daeic32Tp53hfEBkd25/b3slLKr9Cs2aqBqhosGijCdXnIbTxH821ua0erQbGbl06BWv7/hiiUipqGlo6egZGJmYWNnYOTi5uHl49fQFBIWBwGR6AxOLyMgqIz567duvPgkaCk4sWrNx9EVTV1TS0dPX0DYwg0iCaIIY8lnT2aJ0QkE9Yzrm9COjFINU8nQTfTIME02CG0cap8msYZspjzWVLY43m6FgoSCxIPkgySCpIOgvWOAAoajoxF6xdSiI2rZmlAi75/MDmatlr0YIKGdww5LGmyr26E+pRuzI0bSVKkC9YDAimg4chQ7BfSiE2o5mhEW2Sd9t0/YdI3bck2tAsaa3t6FooWI06SFOmCBRAiBTQcGYqKPRtii2mHHTrhYDHJuhAWBAwkBAYz/2EYhmE+wTAMwzB/Fn7BMP9hGK5/a9tW+ijKJCoIDY3eOvMq2C42YWsSktIUIEq+Vf00Rd5PAxah2YbAXvDC5YkKjpitlIq1ZaMStsFqD/TWysvgZfCuRQuFwDs+D1uVoIAlIpNw3i5QECwqrarrOk7l4QK0SRpbswXC9M5wJ1xonZ0sxTrpkVs+A7HcechSxdN40ccwLM3WtiRLpCgooJhZPR1N4zJg4GCg4YacYVILdUGFSYIsVBpDfD7NtSGUWX1oiGSJLeNCkhRpsbOEQEkDR4aiDWjZ7dHnj4myxpGH23bDN7BcojIurIu5cSFJinTB0hFAQklTmL5wmIEiDVr0+WMyPgvPkqdemj1qYw/Gz5eFe5IIL3CVsLCmNSJXMMmbjkU9BoynswKz2cRKkgZ3lLVpvPmyHYCPWLjc5A3TEc58tHC2LraxB2PlxXoAmXkmnUKdKTlYtT19MCecCf8okavYgh918qA6QHkiVS1tyG5GwLpRqVICNE6SCoR7fH0sm6dvg8eq4BbU27poGDYgW/V0vzqPIbN+eLrv8FJ/gSkucoHOe1X6yn+NTx9WYIvCuXz8YraAHLvTopyXSkJvA5ONt+3AlpvdVZxwGZxsooCrplZqYYAdetlhgE709NZDpK42lEtTHNhaPZTgUQiGdGKInZxNdZCsmJAniuVL/xHv4lqGI11JSAR+XBM9deUC929Y1sDT2/6fb9hW1X3DocK5fkpFsHH3A2qZ9TsItY/6IRthOn9VIHQddHGHEN5mAyiQQ3Lq4FLAulOKCBDtOvlRARAACPCAA1ygAQMAMNBBiAl8YOSbXjLphIFsXVhbFCYQECUAPVMREXYpmADBkjObjYEHmAIgJVgRIEBAonQafVPWJUI0cIqYFDGBDXROQhYhYAAnCLAkbGAAFA1QV139DHQNXUfXOVcHqKQw0VZMlo6tsDnQOmsOQJqzW8V3RE8AIP6TL/M9O3xlCIBI0H6nwzhA9OmcoAWtAwCkZUn/qBasCAhSLB9mlIRRKQfqyyBI/cyIXdwTmobs/VhPTAASSIPMjH08sjrSZugfZfkQwN9Lf/3LFCBs8wMAlN2pVCBtQXQEG9w8I0SxH/OqAq0SndVRr+b5YcmzB2bjq/c3z8Jqf3GO+MbqIqJiGuISklKa0lsGYoq44lgxp03zvnz78but5TvxZ2Lg1ONGHTfMiaxEqiggnlb9CEYfvBugRJBPux9NErA6DMgUC+F8jXRo+8/ovis1ZsGEVYfsNKnpcG4JjInf2oImukkG3hA5lR8mTwN8MaP0XJSCjW66AZlb18JeVmpEPvD+tscCG3PkbP2Xee8h1lYOBSluu0ocK8FDDtm9vN2Y72q2SJe7bivwfL4PXuBgwhQh/j9lNpchGJubnL707o1fp98RIwhiCy+ZkUPeK1Kd3MfQnwylwQY2w3rG3rsd/TD8Y9aoUPiufU7DihXZsOibVZ/0uAixK2Kx8+wb0SgBMcWKM2fqGh0PRsxhNWkf7IZK3tzHTshyS3DLSYM4AEJd7zM1Rz5oQ9/6udmdzSpyF87GmLCZ5V9WnukFDqUnAvqHe+/LCQMKKeWMLKdEnhTNtCQEXDxtJabVw3fU9lmDtK85hKC9V4l6fqVq2Ifb1mRIkR+ab7GNU6G3NadUxKih1UTbnAzVotmsxScIO+H+B39qgO68ZbdJZN4bu4upZc9TL8MD+GBCzDI2+sYV6Jy0OzxnT9hQumEV0wu0CqpQv1AS3tjJpNpK+PaIrYBonpXLUBOd6EuYiBTvvYE0zPTIRx+EUfHux/uMNDHsGxx2bCPTSXInDG3892+2OXkBV3Aa1unZgpiGVheZV7yBw7ZSCrCsRsfKhiCP7LVqOq53R5QYgmZG4ED/Pj8gciKpbFaB3JrG1exAceodolPsYsVEmkGY/hGrkteC680JxFcNIxctBiie7RSMgLjRFRvSF7UFsQigOhR6BooNbcEJqKyDBAoPwWm5R8WEXiHpKx08IEqDmhbf4W9WK5ElmJs769CAG7aHXSfK2BumZn0tQ991pkTauqMt1ccOiI+Y4bwNhe+6XdDI63ZCTwub+A8Fw2y0GYipqISboN2Z7EFAVTixA25TvgaQ2HYXDmfcqthuYF1/FZsB98gghDlwzcFdvnImQnDToJUWsH/7HqSYdXyb/GW2gHe2UeL2lHFKv8qxiod4c4CmAg5tbr8I6Z7ldudzykvuZ2sLKfy2NljsiY77yaD5wOZOM3+rdgSlxq/7C5DqTnTQXmmG73k627EPRnpi9T+HCKBDIwMCWQeACBfx7pYeIwLv8tEnSHREjGzD3mPRihpLVIKyfQJ07CBdddMElCETWZsCNyNm6yYje1ZcftBJyL1AuZIovkzKiBcumSouOeyw3ese9F7veVMd9/ImgfgRMk34ZWtG+afXQgubvTtpF9Plvt7rN/d1Dzjp3GDRCkQJPAEff7T8/JCxrzYGmvAkTpYzmn4zfUQB3eWrgIsCo+9UFSozAe7SM2jlxDM4fX/tqDzG8/a5z+fNxYz1Im6zI5x7lo0kzz1Bo4hwdf5eImBj32Fq9Vlaa5uNQFDQyTMFsBX3FzYA2Dj88grrOS7ebdJwJ7KkOsVZk7+WmZERoZbZNf7Ki3y8DwwswY6ioGx1sI0gi0TsSJSHokjiOtRxRQbhuuqB9bD7qgRbh02kyKawhIOBE8Z0zDRMmoZOot9RY6fxa+fUVOStpGDXK5qRht8wN6411LC30jfdpPNAk57HUUFAYwjL7LK/sJe93YBR8AoUjMHsjrf2bi/WLH3pC+Fm6a+vh+0R/mDIvy89BZ9h6Cp3v7B/NN5fM3w7PYt7Se/D6K7VbhcJyOrJ5yVwo/0zYjDj2BvI68jgRigdu08HAPSGp3pv3XmjuIa4XZg1Sm+jpdmsOGOmtGYn8Qj/YzI+/iS7cmqyiY3k0+/6H0UVzChG9LQDaSF+hALLbRpYza6xdT29RefKGv4FaZvutXV2DXZQI0upzE6pHOPfl47FBWfHBo/BVNngC5OB6UGpjPX2v0a/2thtfA0/+ERd/AncgdM4Eq9cLs6F2emXDrkcR/o8M7vb1/78H65ardykKQb9d1KuT4B+ZoAt/4JU5jNUEqJf4bKP+yMpoMPjLt2eBb6ieuJB6TIZo5teYOnaKhfru6v+DX6IQZsto+WbL6jhRPvv7eL2KDHjaImzjmSHBRCF+GxLzizqPXWo/E453kW+4ur8gHy1YDXm/y9hAP8SXBf2m/z6i1xTQZU7qgS53OTkyhRyDkBmYOAIt3lAxt00cFD3WgRMmdOTy5mi98zqrtxTcbl46syPphcFoL/0zsEHRuPQdFhteUEnrkNHpLQqxg7Fc0MdiOvk6ylKyCOcUboHx2YI0SOLW/u9s5AUX7gu2Oj1h+E/RRG92C1BxY5X9K6nQuW6pSw/xiKJC/yOryNuVkV8Zq+eJNzUTf9UtYK4iq/qK33mxmxnluSuiUftZEn1skKbsOfx6PvG47Rg/hkwTgpk2ft7AmeYfd5y+KrYzMG1r8FFYmohcWoodXUENWNLTmaH/Nbj+1rRV3uB6PQTg2LlZk5zi5rY0kGy97vBjua91XlO9uCoJVjbjr/UN+AadGVV0G9uO39nJ2O0rhFXo8srg39xWj5nkLFLi/yJXGJTn3grLbwkqiEMt2G/duMgbg7DGxZ4KYs2VDCuVxYR23BYRhgxIrB78giEKfmVO3A0tEV7nCOWcb5ak45ESUB9AFqOw4u830zLqcZZxPqT0DpVEKHjYn/Dj76fbBg/tRftRI9Ooo5BQJLFPhLknuq6khugam+jfsGXfoSMLmi/45FFSNHHK2jNACDfSH9fWJLpCOP4eLj8Gs1R5V+tqVSqeMeMj9QvOBzs/ZQ+Sfxz+USe8LQVio73LCZS7PUl5ilsH0MZiC/cMLVbNGuOne1CcxubMBuHZTkm9ou0L3LmY95Fi0DVF9TnGt0EvpXfH5he+EBVHO2oxOVobXtJL5C1OTbOrifAsWKgNngq8i9Iy6BSdlaJ15+tP7j+GHjhUldnkIxeoJ/fkCvCR2aj/yG5UzV44wpeLicprSQHJxENmll1Y/D5c3WvuYGk4anWGw/+lxReIHuE3kFLzdhnrrpmG/EQ/2WwBqvnfE1eTRbRQvbfnTf4HXSvfGCG03oKj+TjGtrBVt1G8MIbBFCN+7OirrFKBXctyR/a3OaBPaks9YZFM/8I+shA+Sszi5gbXkySySVXtzYUPQ5gC1ER6m0SFvCSUqtiMah62yUkxMvCpv+F1/Dfgs/yb1j8/4Em5SYk5Wq1W/Z8zOdD8zmXoN21vHRuTGp+PAY38cAru6hS1eXoEx78ofhAcmnM+XJxirj+JC2S2KNasN8s2RN0ry0EOX3pGHfT+0QA0bl5q3XM2OZ1ngCHewM188L+wxv4ZwjO8W+Z//+hMmjRzDe/Fg8zWngVL5sbm5LzLbi/jv5sFbXeOmokYMZSIt1rzWxTbpVPIbf5/YEF68kQzM5U6Ux6J1joYwNuizJ7kjJkzX3XXMxYpF8umt6t+jF0TVyorHr2aw6FWujtM/2nC4YZTkXrl7Hj2MEFKYkoGm1IEYT9AGZ2/dGx2Fr0khx7yD0iuEksi5geuJOewD5mMDjAXnAHwXv6qW+AI0tzolAhPlPCTVI5f1tp9gHQuQQO96UTuac6W3d8lvf4+HnmBLkg9cs6Y0Eb47/8s2jJisJC+vr+yV/kS/+VoPXw2jH1qcY7vTv7yorQjAV0hUumr5IXJdjkyzUrELDggt76wYa5pfNrBdv5PXt4NW7dSw4Qqw1PDRue3j7Uls7lrxFsP6Jk2LUDpJMvvjfCeqJtNVcaGGeoOUKFrejts1XPKZFQWHmzIRQLq3jJtUVJeAxhmGdnxpS380L44LtZ1M8i3qpj6i78Dn35pvTU+bLM+Qq/OLSURrsxOX8raP+Ucpvf7waATHZACbcihxflX5C+ycc9MLI5TfPxvODQBe9fLKyD0qzQaf/gFYyrvAv82+b/ZSj3wHCJyHjxsBBK9qzmZXOiE/MSMaiJyn0DDHrC8rFJ9MehH6jTV438tqfBosf0zsKqfKKJvHHf4vMf0L02wogk1pYdLMTVuLdDp+kHGL6TiAZxPdFfmDPKbKMts687YSTq3kI8xwTJGIBFo+I3JJ5L0Y/EBvH9aU5bucvg9Yj3bpvkqfnE79ZLw8sQTSpFU16aHL3A7zyVzaprvf4/fu1H4N+X6ka+5qXGV6bjUVgywahyVw1Mfjt+FN8UCR/Iy4xmvcQ1+GJ9wC9+ixhTkpnuOvXvZwULG9XEUX2MSM/iDq9J5qd6FrSuaSs+54YKXFxqWQF0Jwt6ZHi6H5FJrOsVrxNzaqLXgQ77vOUaaMLhU3ocmdupdbc8vJXCctFisunj5mvEtetGnO8QRiQ7MRe02y/yJL7uOQj35EurXawjiasA3sjsS1RPdtF8tQdh5qm4sJIRje2uJU+pnpwGfzxktnDd5lV+DSBiiGactYVhwrJmw/yv+8ud9w1X98uw2jfrkvXgH1HPtkynbcPVsx5jvm3mLv7YZCWYG6lCOgVnRc120LItwG5kbH7rA48Cohc9OYFbPyHb8MUefjk+LAdx5SbyMGjs6QIfFO3ItEl2s7eVoHQX3oIhYDf9OnAYpaNep8AVYGJr+aOw78jv4/Ydq8DDnUWSneX+e5H0hiT2mr4SzjHUBdtmS/YByxGqJ9sg4pzxu2vX14KX/OXZAYz0Vo09PM/QG7Bnmmo/1wince7RpqMbNz8ufkyhvD7UjjgfaN3gyFXjEbezba5nR6COCLYBePI8Z4B1ZK4PtT93mOrJ9dQ+0wTaFR42yFbN7+aw/107LQfUhtaOwm2+n43CxvIvx9NSCTdw0PTcMey55ZF94/pHxGG2b4Dy/hJ8qvCIFTOAST5aRddml12ON3j/157pO4PaX0VPjSm/Zqn9AFtGA9fHcoTan9NO9eQcPq/VicRjswUKsHTYLj5APrwP3Xwqd9zYecTEJdSOndNA8yLSFMI4w/8qDEi0BziMhQ41qOYu9oCdC6oH3vAnvDYuZCjDgUTisfkCz9vAnr/QwOP1fejFN/uY61nb8O1rL6me7Bna59SCVOYFPYRAlB/M8WK5OC9xxrASCuzZyaKKyxIJ7ld30J6A/PGAzrk6b1QQy/d4AcyEst4bYWlQhU/U+o7xWqYI17ag4bp6vAPfeknb9wLIAN8sD3yRFjjZE9S32jAKgxqhpPK4/ROt0dO4Bp+rDfrHb5OX371fUGcdOS2XKCTOF0Q8YJReBbdzAr0LFyPfqURseLE/kU1uP6O0kx5WEbYyFOcQW65Se2DhUssv/puHbOv69etI16Pu01xayABqPaPvwmBsr6urDfoGJmZXIRAVhcC087uJ2Z8q63fgdtR6V+50rkzxwOXzmxehhXyNM+5TizX78kckxpzcMqICRZUzM+jDnB+7O9R3dKhtHVHfSsLArsWoLFrk9QJY8eV77kWmErX4VPViGb9NpIZmmDyn9eIbr9D+5+GBaV44hmisndbhB+pbnTjFIY1gQ1ouyLkPe8mbh5jtrE0T76532DfNl/iYTrk8uplcKr68KJCR3KLeLVwaeiPP0tT6ISxBBYEcN2HVRgry1rbZd44sRK7P7IGLN156PWvd8DRwtSzNvv48glBeCMt5nZOLBwlG4oNq079W1u/EHaj5vtyJjMPDWcckenxlo8tRzJ255MEq9e1VqutHNNYr2xFMDGwVF1pFjVhH2c0c4DgwzGA2c5sHzi5arpkX+h7MbLKfbmw9/pmp+RBk3On2VGn2UJ0uWHv3Yiuux5vOsjroTvyt/eeb8Srcc45q3YkYobax9siFiEvkRVA+jBCbeAfkjmJTucGaZNhEqVvMXioe4d+Xjot8FNmZikNglbInIeX0qFcTF1lIRVrHnF8+qATGfUXyq/bZeai/djv5kLmSkd9+4ndUHVFF9KemXMYlP4Gell6YQWSi9WncMFHRSUeJyoDnwWesViqv/tCfyFa0Ej5m5d8mK2TAyK9eXoKWofVx8GGXDyqLFnq9BFZ8Re+t8FSiBp2r9Zfx2nQE3c3jn6tX4V5859WBF8EBWYtxDV73nfaczgGLRvKWP/7lj8+rby8UlBO0673HezW0dYkCeAH3HdcNO6y7rL59I9XfMBT1N/bv+EF5w2Yg0nUDDABggKpRZBUm0Sy1cXTTgYJkUkdvbwZr0SEgajbx2jxMA9OXxpCnQIrmpTkRg+6pBPzgwIQrLQ8POnwEyEnEkvOH7nZRQBEVKfsQbTqo/qw0l9zVXERJYm91fRXSv+SbXqCsbNsJlUZ/fOPqwqHrqQFlKTp1y5vufenFp/+qPfG/XwDAEJDHDguMALnrWDEBxKSSzj7gaYcFeEJMeEkZAVr+KwzvtGOq66S8QHkfvd40mNxjQE5wjnWhOka1Cirgh9FvYhVVE1os7brM2a8cSW8Y1VJxaZd0i6YT6ls0B3gF5TNYz+Jhbg+GID0pA9KxnrDojzGMVz/ewXBpuH/tIhfLPppZIkxqmHYDc17cXt+p9ad1Ph5mSFG0R3RG89d1sTn3c4yH28nS+sYRrQ8ahh0rx4orSofSBt8+AgBC9+1R/P4N5c/7Y+UHAADOv4qtAAD3h9frT+L/PpXzZCCAAgIAABAAI/FyACizZNCNuATQfv2lqlarpV4D+g1oxr0pXxiWqqgk+YPrGc65TOIPkyMM9/39ZSZaQgEY5ozufO9zs8bVWNGJsbmTBprjX3OSxSKx/Rg2qK2vfXTd6YMr053Z4PIU01kJxslgRrWKUT3RUJZiHo9+efwYbWPrq5p+PtOtN11x0no+x2lUFcNa0S8Z1rXN+dZ9+hXrwkkw9Vw0tX6q3jcYZZBuzeJ+DMzO05Ymik2y6SwJpTzp5dut14NAIcWU40snpX1ZL+mkiHIry3rNu6SsciQ+2E3qjqa8+8jlD/ftWEEPe5A+3R1EL0v6IP64UnHu3trn+2gdUwFezSvnWkV4ftMtFhihBL1bc5QeToGUx7UR0CTQA4U7VYVb1SMHVA7URqAX2Hk5gdxTYY7bGBAH3VAHqA2gh/qAbkiLEr78N3bBhvWbDwQAVVZR4IsWSNhbMSXmEDZkQjQMiKTW2BAwF4GKkLkEcCBnLoZJKgqSc2lgYBeh97PLv6qwov9Sr1iQXr4XT541HXO+uIGOiUSC4om+Ky9M+SSwYmIj74F8hmwEWHZmbl1bsVTCfBMfjTS9Y1yElVMtHyh1H7yHQxUI+x+/yVNebCwm8lMisZa5+IQE7+9jOiRLOZBrjFRVkO3WO2hNRlc9rFxmJap7Msle2acybJCNRUnB8AqPtIj4neykQB5QlZI+AAA=) + format('woff2'); + unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAANUAA4AAAAABbwAAAMBAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGiYbIBw2BmAANBEMCoI0ghgLEAABNgIkAxwEIAWDMgcgG5sECK4GbGM62A+KOMNGmZWUwcdhKI9l4Sh/WwYP/3af9w0W4ERa2bOg405uoSptTooGKkF8HniO5b+Iojvye4dReBbNtVHwcLQTG2gBzQfYOqjJ/XYU/jItwgxa4I3czM4Fj9LAAnlHz+dzgSO71Jqn2QML8H66dROj0qAFLYnRhtm0b89/erW/v8l/LA6we9gCizDBtQzSf4EtkcwDT6RtmgYEQXnDKGQslZyX/CkQSFgBAE4ERggEAgmwACwQgADMsONAJKVkFWEBgAJgwMz1NlLWec3G+jtZu+rXO1i7rx/sZi0AEwB5WVY28FUE1CORQAjvtSPftAwCQQjGAbTUfm4qwrvbNmDEf5pjR4JoxElAiYiMWjQyIAEy4EBGAA4UNKCgIMC7a5Cej2sCAA+SMEEyYA2AMQBWgCmQAObACrAAQAUAJCSDMEDmo7CztfXoRGu7SUeVdbvosOq6N6PHnZ2yf9l3eXPj/q2qXdkjBL+qrix1cYsqzItOvXfRPaMXkUvPeFWoxr7tZB8gfxIhMauBapmSUhO8d3O8wUt0MoI7UAxLzt0/zhCwJnVHrsPYXenm8suPeLYORWqn/3wwK6Qp+frDiYGvxHSXFzoXfpihfmlODl9oFbOqKa8nXbZgd6axNivh4JS8xEZKChij/nuDBPx/MrxQA/WBACCtK44947xa66g/k0YcALjxaesDuBuQP/7x/3bTwmQACVMkAAQYd/7HYBqK1H97hriqWIzlN7cD8Qu1mY6Ql7eR9v8qAcCY/apKqAgArEBCCmOEAExoJiOUENTgBAI3NSBhwSjIbLboV0Blo3PIiN06hxVFfmrr0WtMvzYtWg3SBPDjz58mVY8eLTrpNOm6NfKhidepk6ZAbgbym+oG6PoN0zXxUaBHgx6Demiy6Zq0GdIl3aB6ndo04r7WvSV0/Qa0Nd2+yKcNFCrSvh/6dNKO3xV33aBeEXxNZKTyQUaverfOR49+LZno1XUboBt4oSzpEiXLUSjZDgF8+JHBMIY0KQAA) + format('woff2'); + unicode-range: U+1F00-1FFF; +} +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAABU0AA4AAAAAJLgAABTeAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGmQbi3YcNgZgAIFkEQwKrkSlZwuBSAABNgIkA4MMBCAFgzIHIBueHrOiVpNataT4nwk2nboHhRIwDgpKyhjHLyLzQxmFwTYyDE5esZ3+2EabADRB2gAnegV3sg2h4vmn/cH/ujNn5kEfUoTVzJCo7tDcxAh1qBL7aK6c2RAfYY5oH5jywGzfVxj2dQKMqiNV1SGa2/3fsqgYgzZIg4jcRiiRIlUD6TaSLHVGBGIUGIlSIiAWaB/Nlf92N3lGYYsKSKjZnfSTB8DmMi27e2FKIBTaKlRVsztJrgQ/v1ar83g3J/7Bm3pohA6p0P68Qebt32Vvzv+J+e5iNnizRruQrw0imsSTJfEmoUCohFIvESLYkJkG86bdWhrvEfNUcXTtnhaEruXzgVaEu0VRWgYqCFQSqCJQjUANMogmzaJVj+izItbskHExWMtGIeDVV4+zjD3+RFc+yF6RlRIHstekRMaC7I2haQkgC2+4KiUBmJDOA0pVozaXNfBR9QCXV2CAnZZ/Pa939bym2tY015bSKkq/1bW5rl2W3bLb9zSVW4Drhr5Xrw/3s6jw6wK1JMm+D+n/woA6vO4yKdplbgIyweLmY2gZzWw+oG+f+/mW70DuJgYtfT7LzTxPyqddT+nC3/NdfLWlUjfjXEzmQ/hpKLyQ98ii2GeJyRwXTdK9mWCse91WkQMY68rJFB88T8t35mpaolV7x53YfELcGYe/k5e+Q8OkBTnHYqOSF4OEEujtXNjCIqJi4hKSUjJyiiqq1KhTr1m7bj36DRk1YdKUaTPmrFizRZJMikLoKiGpjpWa4NUnWmPomkLTHApWNF+toulu2I0Yi3nKgC9LYMKUrGeVRDIh1kjzTns2qSeP9MP0pJk8NMecFu5MvKMmX6zA/fX9Q5TOL5OXchlXyJRSLinno0o+qMoi3UyrVXFduLL6vNeQVxpzV1Mea84LjsgLhbwUIlcyZi3jNgFs8XbW2ZDJIg2tfzlzKEN1ZtUKbMD8DXNXQz5pzDQnsB/gtQLeJN4m5izUdKksg2nSRk5D9WyKQs/IZRNpGuhaSpjhGY1WObToSmatUWx1JnL5ZiO7F4xkJqXyAGWpz01EMiOaMnHN14SjHwXF8xU3i1ZZWLxpN73ceAqTchLyIBv2QRYchjzI1TkEbetj5cxPxG81MA2TYoHqf182swq5rkjT+39QyZjqzKjJ6TL4ACPwvPgGZpVcE6wV0i7YziJlYTFgz06wSoJTcyZeux6CfnM0C5WIWhExayJu64faUNggA4GImLpCRlmSyTJArnQhQdaTUlJopaw1sgZU7ypr6OEVYGgoYhCPTOddtBvLdjIHMufBjQi9q30D8MqGOGCoW0HhivaBxX30m1mMYRKTOyZX24T8t6yqO5dvKWY8MQzAsmM2BOifOGgAttxzR98dn3SWhwPAfk8fm+A/AFev2NuADZ8FqEOHuBI2prgBmrIZBgrWtzvfgonB94d6Td/a27u4n+rD/W5/2MfyH/R7xOPX9W29sx/qp/ut/qDq9O/Rf48AgdPYjW7/N/rfSMgHsINW4FzQnGsrQe1COnTqEn7aIocMixoxWnLsMePiJtgmJT7+OJkeb0rarDmOeQsWLVlGrVpTZUW1GrXq1GvQaP2LmZ7EKSRh4BXwgf9FYOwMVr0KLHcx4+QVV2Bww8AOyAZgR0TFTAKBMZhV3EvUu2AsNqQDS9LuB4/kVg9nIEAakUChYKh0Etsk91wOkcQ08QqFo2oYDIWCw0AMCzosvVYEqoQgyKYVaV4v0TbyETaLINHkqBSblnAxWVLyxFhZiRT0Sioxaa/G0+vRiXi6Zpzgqf6qMzwKSFfUSjihado5YLh79B8qKJo+FF/xdsZkMlr6To3QREwg/1Z5syFRpJPGSR1WRZchQqfBxXCvElCFwlTFk8zNkqOywH1Jozx2tXrde299rYZi3F/j8hyYUCJzj+MouoariaLpw5/zWB0WCylI6bQBtlJsuLccTCwFl1fCy8BJ66uZzMLZRmjB7AZshWCpiXFLqMjZ+pax70kYJ4g3vdADAy+STlWm6dCBArat+kIJvSkOqDI74f6iAA6NRLZV66doUoUfq975RbXQxEgnLi0r3ZerpoaNaNtv8/mYTGpIneZ0iko225hRgGG6ATv8jFaUUQFVCVL6ZPgE2AwMokMDZTmtsllFK0U39mkUrSheCG2eXAF9/PgHgEJfotR+I+o9dmaSuSLeJiIkgrGO+A9EKvYluMiT4dFRQ3pTajHWl9veBQLEMja6I+NcAZBPIQSUPOluNyL7529e9N4yW178bFRuj4sN7tkVOYyfugKg5w2paeMcad1xefLsQSWpM09kB4uLqzoNTXGmScx8wUOVlR8LTv706zKwnzRrdE29H0sexg7yeBbE9/nzNc3zNHXCm5409hjYGLDVoJ4MDuqTFBLMiY5L9ryuwp4SXqdQ+CuWGi42IIFQY6ro8cALgu77TvsSb6Jv7b9xxbjOkP/JQkGGdIzmAxbccBfRMaV17ab6OH+KR4NEzlTuvmgg55yjyo/ZiaWA7KO3jerpxRvkVdVjPk97M9g1R7fFn8Gek9FO5zVe6ONDwK8lVlcLslVyp3v09KACk89xQwUmt85+2eYA7GhJolY3o2BkbMODdnNr+lhgpjFOnbr1/OBYib21aZpysKN9OmVax6cxd/D5qSIpSPpukN+4CIbSDC6CzbQR2F1wtTFvzdtHjnInQ2MDSg0NJmd5k/L2KvwzFd3KPmtoB3g3lJ0pTcCObzcF8NQLDplpnvYEQRGUjJ/cURmn3HTKPmjU7Tj7EwD/mL8sMJCeAvsFbj96Z4hwh008elN4nYEWhV/w3sBFhqVETU68vNhzRDiiRwVkDedsHC0ISHPeZnOxPwqyNFzQ6a9AyDljFvXSpX5nd/S4c/VY4TBr5xSNeX+M7yuGg+ZVgBVfhZEbARbPLLLL+EQWvW+HSGAFEgjB2gc+3P3eJD018Wtmt/jHZ8XdYf5Agz4qPg8+grlb1CPMR4sx/kqh/bh06g3V6cWhBvfrKEjvzKbFUqP8UzdB/Ol3YMueVGqY9OlRHADQoV9l63ahR2W4mX5NvIs30mrXaAeqlhLLMhLLlumj4uXNgRnRgctAZ4k+Kl4C+ik3jrueOf4g05p2t3z/a1reILNNiQPUJsVUfoBaWoAt/Zp4iT9XEKRW4nqY+i0+YI/nQ4NoUPlJPo1N5rMPVs8bKEWOkFoCQnYtOlYoWsI34XKM3XayooVDte/gEwi45CVs9jrLKkqU/6F91E5pwmZsnN7JjJAANBde3pGpR5wiHi9+UAyHMG+pKt9AtnygvLe/DTABfzBuMx8Z/fjNGJFFygbKGVnUhISyRIwBAFMTEyep2yeWqF0Tx3gjYUDboDOLoq360uwh6wWnmKOjO7PmOgOk/D9zUFGT1x1A+hGsyk6txoL1w3O8YQXFg+seG97ljQCFQeCozGjZDT/VNsIqZLh+40/qbvrgXvxizVZYidysC/xB2fExFRMdkeePZqFdlzi92NCCyMYQuAv67jbcSM3E+4BTayTC4V8u3/guJcJ4AXCu3VljZ61nYGdrtc7GJsTGQZRpZG/NBUpX+DitrYH8Y+PIeDxfCtNUgu6C/tmETvY8+ajxE5pgU3w1Eue1TnB5jmH3HDRfM3N1a7/k5r7OxM31ULubE7g1mOo8OEe+ajznfNCx4eCaH9K2ynJANsrq3RXfnUBr7ODMYa1d3nq6Ng6hTCcrQ2hnw2U6W9no3xzdUNfWwUvPwQY4lkxU7+IfiX5NXARWHRPPsyXEgkWQNTxMTj0F1qNZx1QuHZUM96hDR4uylvFNuJT1ni3Kqf69hQfxT2viFZmz4s4U3SyCBzDjLO4c0R4fXd33EtiFG/+f+wtWTlhxj1oxVx0Tf6IbiQFIDfeoDPfSbdzGVa6Nw2KtfJWRAlC2dBaKm9m/P/5A7/CD+7gWleEPcu1K1r5m0jXXeSNV2v+A2dU/90j/OJiHq2mt/b8la/sxvP5l3sAb8v+S9z2tfQhI1/VCtcPLvTOsxpzBUkrhoT3EK+cMdWuZO7MGS2gF4iby2dPAkGVRKjtwVXoPf2lZ8Ffrh7n2d0mHjCWHjBeKzy3lp70Xl3w+5+pgQsPK/KSI7+O/gfw7deoD+sprsO4GJNpdfD3m3HOzYjQdU+95wFNa6d6c6q37SBtVlUnZKHPiiBqzpRM2wTedkVxOL0VoGEq8fx/ybr0HNobG+T/DZdihtMvY466f3ZBAH4qzifM2v3BkD3LkOe7oig2qnMEq1khpPjoE+dt1SwwcvPFIuF+qF1KMhlZ53FxVkQczMc0PJY6BlceunoBPHlP6qJdfpAWuDDyFTyOWlN5/nlCMNsFUL+HwHD29j57ReGU8TjI2GilMJUUTfH3jPWEw0pDPjCQcUXHyaECSO+roydQIv2pfTDGQOQFumkX//qfCUXQ7O+/9igz/zgEO5x1u++yQGIlFdutyrhSv3Yy4xljupLkmrjlSOqhexWM37f65UF4PK+GVsg2L1G3Mc8//NcvRHdRdS3E1fG10U1iOEM1AO8/KnaHmRZ4OVshCu05J9YNVmsTjk94X3eMQB8weyv478BDm+aGGGWAd4eDuh5R6EG1YmWLsfaA4dAQkFPMJTnlRbhtQf6SWT3VaIMQU7nvpkYtchh/7gR1WLLfvw9L4V9xTNHAj76Cpn7JjCHQkdr3qzIo5YO7Qv9NNLo3HCJCjUCv7tcSH2DQV7mUgyzdhl1TuOwrb4PZHrAvko4J58lW+izo1vxQthxE5hG2sBfJVYzDNPgGvYJBZF4K94oiulYLja8xJeAmCKeBMsOe+NDCWtuF0eg1zirwwCy24p3jnwBZ9NIwD5yyfQjd0lOwWDhSPGhMMyCtXO6MaN+nnnCSckWxkSwelgmAgCWR2/DwBV3fRSkzzRg1ZgHJ5l3YQkhwpHxMNN1+n8DgKKy/0NrW3tVFPvAbmE8+3qPnl7Aogu8keoCElQOVaLhh6uJtZS9oYUhQsV6z6us8EX4/xEvXFuuZvfmvlUBM609Kqb6XyLJkDiDUnbg2s9dEIroC++P2K117UlK8ELtty9oW5aLKxlk6o+gzjnC3H02FEZaivJfFIzjz7P6yXe24DSDOjJwTcdHCs33YPcxDemCFcR21xthRvnddLy2JMHwxJD8EsxJw3SCiCaWjzYU4LKW0FPokf64bGILXnpduBhqH7EXjzLf7IK4AJ58f7wBS07YJEh77c3LwwTr3VFFeHem4ZiHXNjKm2dqrTdWi9bXYesq6w5RFdQ+DEy0DQogHGdTV6w465hZJKWIVcqff7Td+uxP2lq/zaGKxDVwvkYXxwthBJQJsG5boSfGQwkYEZfFSEth4DluyswAhPKWcLcJVzxEs7CMlGsgaoO0IcnbgXtwG5b8Zx2zEuiItxUOF27OVUKg9boJwzDtb3kcZov/auX27bDfvQE2PEC2rxDeCnnldJ7t+0T/oNq3UvoTSgfEfSpngyOYcYllQaLJNUQk3r3roFKUPu10d+o9bIfPVcRZER3p0PbBjiDS8iA2hBVL0A63MMrJ8wJhmUNXLPH7ehkgcIuSqiV4h2OjFP8czC274WsrTwzrzwwVvuUxulJa+Zea+PBKvVaExUbZAciVcMVErWe+1y3243jRahGdZbLgdgc1pZuw3tvhvYEZyVZem7klEBzOyT629lFJILyQUrssdRAxG5kPUyuWfycSfcjOwSSUWUTD7EtcPBGWQs+JU2cFQRFjmTWGmqb6V/38DmomcyA8Zo+atUppDValRReG0IOowzUGInHNe5xaGeZp1/cb8F7oJtT5lDBobJUjRl5ttTLmvXrknyQQqdfEiuQDWVyJoyz6wMFiLtntKGl9UsUR3bXR1+cClQsafCLQXYMq6csDwAzW+ByM5iEUA7kUoTVdELcVwCGoPsE0lFl84+w+2CbbPYl/D/471khHss2BIU+gNPnJe+LupQYTKGzSZ9T8QG4HJ3SDXxZr5x3+EdVYmHCtCt0EhTdiegTziEIqVZmg2GI5ojf15NJok75AT9RUXrr+vo+WJFNZpN6187/P1vu2UCU6TcbSw34otto71ytIVMPtD2wAJT4G0AvLEi539dOSQgXGeK402BSFU3E7Mg1bwStUPpa/WtGCt+wfDyseGwgCOHPFoooIgSyqigihrqaO5o+Gv0pH8xQ3HmBL9wDWYmBRZ7YBaQYZZQFirGdFd/bLBBB7f5SuhHF3rD7iKaer/sXCd6bi9V57pCqtkg0PwS15zTpP/Xh53uZEOSf74EPNOsl0NdkC6gnptWCcrgFSMqadxvxPi0vaaNQKaHEWQ/0XjRFSVY01PJr91+7jWZMMQ0Qq8F45WkTAZ+gGRqUcAorIBw2zQNMD+E++aMzfTgjptQ3ESwC7QbZyTlSvAks5q+3wqS6LsC6sxsGUwreQJ0kvV/aOHuz0W+ta1zhcVMltnswAX1aBlryUxplHde/b9VfMh7BOt4vGjkv3HS6XXwojp3WsGXahpyMjEZUx8CbddNNpTrsksM098IMisB4L3fFgXAF+j946+e/0ZXZa5MRUgIwAJW3Pg/BcCqgzRJ/4cdAfBl7TxX9J0inGb5Cxj7p6s+yVU8Sxy1HZqJhlqok+Yo14TGKKcDqO70ovf1NVfqmi91PJOVrqWP2+tpvrPteVV87I+VL9EEy6pS8xMOB4HoaM7ACLAxZHO4RGA8blWJ8nKMmB2V0ocpqW7QWYOZ7D+JKlFzOcoX1kElsqpcXGuTUN7p6/+Y1xPrlZiR4morkeaSclGOFsd++qOXxYzl1B6eFe58Oltc5e+IT9CoTVQzSczYIjC04jc8RVsb8i7Q6rZqJ4hoN0hJgFZArskxuSVHtBu0S7Q79k7pzzmlQFdLpIzcToRA93ckLeCQ8oHQjByMh+dd6QADaxVwMQCmoZCNaYTqaRoj721xdhon6yvw5o871Tn+ARuXrjy7cezQkTu2WtVquom2IZeWKM7szzriwi7KPRjOwrOl6hbxfiaZvvGQ9B6K9aUdgrti24TU+di9cyON3naGdndX67WTWpiAb4EkdeEWaHudJm3evU2Wu1eZmJx3vnOlVVWHj0w1o65s632U9I3DYJdZWF2skW+D37gRfQZMmuOq4ucnVWNAvgGJsacFAA==) + format('woff2'); + unicode-range: U+0370-03FF; +} +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAA9MAA4AAAAAIFwAAA72AAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGjQbhlocNgZgAIEAEQwKqiylBguCFgABNgIkA4QoBCAFgzIHIBupGwPuMGwckGFhtxH8MyEbMsSab4QwqaKI5gOnPv8mF8P+xTyVHcbb5D/Pr61z3/vv/5mhhlDCwrGwajAac1aMRiyiyobexbESjDUKI3sjjYx5BK2t2ePAUgRLEzGL1RLeoK0rV4zZVi3+ry715RzSN4Z5LeAENJW/pADAeO6pPAXXIk0EK+HU9yQrhHO3WHh6KWVg8D9jA9WohGXbCoM7tWba29vd/w3NdFO4SQp4swVUtYCSXZW4bO9CmyvwPVOoRPmU2BEI06lQAOwA2FeRUxWmuta9rNAVztY3f+o9z3bjghCqcYziKvP++18RCOMIAID6GM6NG1KdJ+KjGCEMYA+wRwACGNTXjDKMA0eg4ZyVHIuGe3JYDBqeQanxaIiONTkeRsSRGwAgAAMwLswgJQhAvlMADuGVJoNJ46glGwMyQV1AhbxPLkTy2TzyO1ks38vPd7gsX8loF2C+ceEXpSYjgEM+TC9P5ca9mxs+jXhj+ZSyjsh75ZP8W0bLY/K5rMDKBXHQWGttteero8666q4nP330Qzz+lxI9H00BzVOvipYCCIG9tjJetNaSaXdptIeM5J5mKNLrKoqgRAUk6gB6Gr38ypFXqP7J9hGOVBi0qXP9g6Kn/QSkuhQMARQuV1B7CKWFj15+5agABDGyDM+gALgu7vqH1JGNJww3hLWhCZq2MIF9NinPzvM0ek+AKKItQM18cf7aEoB9Sd6r2K88oH7T4H6gYN4bVdggvCoM3ugBAKUXVfDmjVdy384NRx6K2LtfnRGnBidnakxRYbiSqmq/qf2u9hfvjVICxMhIPhRJFbS1dkXtt7Xf89ckGwGS207Z0m1Rd6x3ut4pv3WzeZpJtg/c7JRksZRw8gBUQkDXAnQF9oG4ALEAr+8GiByGrodRZLAADQlRAP1kf/Y/2BR+m3T8q7DMdC891TRLIR2yU03L9zI8M9828/1cN78g1c50LRNycoybnGGbtr+ITM/1HeEGorc/ZaDR7Y8MpEM4tZaAs6Tfbn6Jc9ETPs5jbCJgKJzMycK5Oa6p2sgV09MoBcW5kHwLKkYTVIhArjO048UCAklfXmzADhpJS9we8rgvSD24d8ulNFGvAeX3ivapQNRax5MqrMX7W3LalT7I2bjEbLXoOT6BtkBA+K+L2MNy2n4ib/ic2BaecszW4hlEZ4O2bQ4ZD2vb8u8VJX74o9Zf1kd/KmOqPPQtbFqhFMrpwFv4FrnW6fxy+KmtahmNVLVA4+3CXecQEJCeATtA0Q/Gd1QsFAdhdxJBdPlihB81yFPvwAEhuF96qV7zNMyuNYfpVmWiL2ghWOL0AxkH1cQSt6TEOB2n14XjZg8MtC9YAvWiz4vGv32IkIcEaxwy9Yx45eGEMYoh5vWAkLL4CJUwoctxs2T8wx9/KiQyrel7taNS8zjfpcsfMTPfsYIyrxyYWSIc7u4ksbmo4u1AiSg7YkgEreULCR3QSuohSyxMW4J7NqXMko1hfvqi8EPFt7A/mFDvq3/y/YPfK7Wfm0GyUsR36eJ2lCojRctCDXLfJxwPt+9a8L6j2hUtaCHlQdomVmYQ5fQyWU6opRNrXFf/y8JqoeabIV59i3Y1GiLZv3I4/T/E1h5EI02jkaaosevfmdLnpw1bKl8t+k9efX7j7/YAo+vW8UP+H5+aft9xv7+6Vu/vvcPWw2i66apXm2DpUwnh5dhH7XbSub3Hrqb1smdTd6M6apTCphC7941b++HhAduWOKzy0EWJ2NZ70yeNZXn8+LzM1vqH+t0zrs3gm5TbDqb3GPahyjD8Ut3HFten/G/+XepLDQzDL380DL/iXJK2JJsX8B2LPMoNKb8hWR7YWtun3pqxhs8T67umlAo8h3PqHs5Bg9Bru/5oYcOcPTXzcxfzMtpbJQq1De4nni8ihwGjhrrGZLOfKHmIvd9zUkOmzL8xPI2q+KmLxpXDvmoBTdzp5mYLTel/rv7FRBSsCDWM1npZBsKvluuvpfpL0/PYaj4uPaLpS+Nu/OaUkFe0ns+nnffVQ83HPu6n5oy1BlARDykacrVFbgEv5Gs+4YtrGbtcGPzMbpaP8+ql6pPCInaen2/g8cwhYr1uatayaFqoTC3OyPOb9H80vVt5QIx3Oop2cYGGvgFDYf/C7mSnF+fdfPv5H7MOtJg7WgZYp/n3R39v4/KF/NXPVl5C58rHfXFY6LRxsfa6bDYvprO/jP9sP+9ZihIZOjmAZbHVx9zWiqCpYdZJfAEfvbDdOIdMbTg2RWdP38sjqSSk03a7zNQDL9IOtzPpc5KVpWLSDN0Mwwu7nZ1uYs/44f+qPm4f8uU/bGhvZ9cDq0ayhL4NLB0S7EY0+ogao1Crc4vLGLzz7HqHEWd/c0qYXLiOB2N+5IhTPKORNtq1skx/eVouW8XHp7V5+6HW+neeP7/w+HlDtx1RwwxRAVOGUxEPLR5ytUVOIU9jy/fB6cwbOvRz/YXdmJr9UatQ87oNXugcM2pD0f88nU6O7jV4qGPoFJeZu+oMdejrFq6EKvldglfWTx29OtvJz0MXpd85/Uo+36jcdza9L9ciRWy7A+mTxrDV6h3Z6C2G1HFesVS8LplDQbSlf9eB4T5eOQ4/VTqUJ6+La+jYj/Wlvlr/+o7t2/6n3BC32rnff5LMIoMnj+FZbO0x93VqEMsNnhtEPsQ1xz02akMwvEFVo5tRhvQityWb4PL7b3cu2sUE1n3U1/kVn8v+zQu/Z5x1H3uKU5flStvlWd9wlNtcx82r1q2207dtfdPtooDULtWcNGWZmPCXULtkqP3QQOdsdHz/0nkvS128adFRTs2ci2A+9Ug/c9+iAj6Dli+cuhVKaabfT/4H0WXeE7v0qaUTPC5Fd2lzdBDzCp2r6ZOmzZ9Ir+eNcZ06hNUIg2n1Qwfr/QmG4iXR3GjMSbKrxipY7opa+j4w44PZ0t8aNNjPt+OA3pXWgX3Q+m5haa31pfBds02L2JlRykrYigwKWU88fgrlk1dyi4sr/Y/EwdTgzrJXX/ZNK9tW9tBsXf8IUr8BnWb+c2Aq88vzoM+XZZmBJZWGM+i0+tHaWRVnK66iw+fda1MMuS4B+uD4gcLqGJXOpg5DPxZd6FGGTnMfrZlbdrLshuV5+YObOr8RYzvXi+vSwdlUp1eAu77fsIAudZO7asYZNXrDd02VwgZ91hjzP90vHcepQ+UwP9imi65KKaTpVJlGYWuIx+TRrNHt/r7ioU97M0qUl0zgs+wn9eN/umSycfPdS+FbrUqL3pZRQjOpIpvC1hKPy6WZ5JV00Kgfvu16H/Ip8k9eWXt4mJdu8PjovtVjn/RpmLy99jD0SSzdU2v97risYuxWd6Z1q37EMKjW2Ytmv43Hl5f+73/MitPK1/r/eS5QE3Wz5q/K53th2XwTrCEUABqIWpGZRPYeFAFQbctyGnXD1ahZfkU6D16RL3CW1AljKQm9INuQqbFwATVTAJWoVx6B94x6pS60T+ZENerCnBIHVU14RnWjKpLfc8cy3lJTJVs+soLn5KqU3jdZxTMSTavf1QNrBC+8JbPefTSEl0W12qgmtYqqaKnfXN+xzwh6plnpqWCDvKlL/shUlQ2/BrUSja5WyqcpSLoOBuyYnw5ImFP+Jz/mlFFQVcZZ6hZVwT0psYQd5KOkZs9Zxn5qo+S2H1nBTvJSSvObrGIH2btrs6uG/Vvsp66D6Fil7ThIdfB5qFo5t0gpaev5RKimE0l7w2BqpsCPphF0prSZ2h0Im2EjjEaagxgyyj2Q5iA9Msr9kOYgjoxyT6Q5iCGj3ANpDtIH9OpYpZ9qWL2tZSq1he5RS2MBydCGYoY2uJkTDagjc0oWVJXJSO2iKjiUkuqV2wAnaZr8hHX0IoCdocnUdRWKtdgZJpgeg1AH6oU96Uj5HHusnCxRDDb9eoH+2DM7Vb6F7qk7+SFP28QX2EO81o49YQzW09UwRlzgEZrMQXqH8h92kTsavh3jDPnqXRvVJwiH69m2Dv3PeiVorDIOkyGmyA/xKCBXA8oWrRZM8jF/Lx6hPcAtWhu4AUyKlwiUD0VLrSks8rHSWnxAJSD8NbPcZeujuKj4V9vmKltEFUy2hfw/ZUhb+YBG29V8r+qhbSsViWquDG5xv1WzvGKqdrOl8pe6Hv6e81yt6OPQfLd8olIb8DK9d+i6Nb2r6aB77lf1TltYi499ska2Jcp+UYXONqvClKGOAEQ7TuRTl5oP27gN4oNX3Nb2looANVdm7qoTWXD31x60VI6p6/F/kYq+Tq1bLyphBtj1k5sAVqhOltK2gPmIKnlf3hHTi78Qc1BRV5xFR1u50kgZRhP5iGgHiHxsV/O9akttW6mIU3M93iKy0HiBdjP3d3U98O+Rij5OzbdAJSz8V6M21NrCLB8KocLjvTgf+RDxgdisRG1BbEV2ZV2MaCmqYEGp0lrpdF+hA0abrM1aLz86Ikg8R2dcahLyJeIOsRURlRGb9RqUuai0VQp/USV32ewVF6XTfYsPmPlATV8r8UG+ti3CUwUIAKvncistaMtEpy4fdJ46AMDJ184tAOB3Gvb6a88fv+szdSlgUJgAAARosTZ7QO8rstmC94DYgUk3JXw+QvFF0xdAtJOrlTg0Yp3RXoQjRngiUDmFSl4is1gJzitdYVJi0Flph85MIChp6KiMhYVfk7uYFWeVa+jM3GASUQhU8mEWMxCo/AELv06Mx8DGT+Im8OMP4HsF/xVzeDkp/CP+K4Er+Ev8yWkAoloRSTtJqc3dFSZvcoMb78318f5+2W8557bwsVeI0/XzMRKkZEKu28vtW75zw9plg2FTAMa1WBYEbK0fL6ZYvkeAEuWqG0UgAOAIDOugIoBOOI6yHsAEoFTiZYLK2MtUOR8z+1RUoaFNQMXXb9XRCJ/5SZAoS7IoESKl8tZGK62Ltt76SdB4Gius0wHihWgR6smA2HHDqkUKaYVJKa1k6dkK1YKxEgQ7kJrtzZ+Nj5ImzoBkBYkl1zZEvKp3FqN6WCmiIOL1ghbRtnx1Vr+qb9O1a96ba49PlaiTlgXMCLUQNU4UZIVp4axkEdArs8PEDxlKQfZAA/7rSR5kuD6aK/pOrXCQ70FGCzUBAA==) + format('woff2'); + unicode-range: U+0102-0103, U+0110-0111, U+0128-0129, U+0168-0169, U+01A0-01A1, + U+01AF-01B0, U+1EA0-1EF9, U+20AB; +} +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAACJEAA4AAAAARTQAACHrAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGkAbjgwcgTAGYACDFBEMCuQQ1CoLg3oAATYCJAOHcAQgBYMyByAbYTpFB2LYOAAQ8m8bRbBxQATaNIqSwUgH/5cJ3BwwO1YiloiAQlXt2uraW609q+MVEUfLxD9oI//kf3GY/Ix2rMRHhFjiGgI7QmOf5MJ/tbf9mQ6zKUo02CQc2SgUhdXrBMKCTQrFD/pt35/n5/bnvrdIWNFhgFQqkSNqgKAgSGUpUooIRmMmYGM2oWIw/UpY3xFEa1WRNZVVK+/RATsCUm+ZHZFQQPIdu7dICskhTKdF7AoTVu0FXk/4jzYzb5dIAyG2l/oA9bnj9ktvzjPZMS3y2P+wtYvmjoNFcwBUkTQyhGBwXull9AEGgM//XG/2ZaAnUwTHIFTrKmVyMy//vcCHoRMofKTML2GmyA5dT22FAWbJilDx7iq1Rq9RqywfDyikXftae7PZ7TcBntDWqmS2MjXCRaOkSUWo2Ag5H3BCQJ7wSF1OASpD9irSHAknzjh3Nk3N4axFgWKM8u/wnW/aJ+06HIwImitSkxkhPKf310yladsxhdi+kH6/EjQYMQDAOQyRKTOIBRuIHWdIpE5Itz8gCAaYA+YQoAGm1C1HOPZ4dwFonp+XngiaF6dHJYDmFeGZyaAJXX5hejKwIGJ4AGgAAxgObTCIJm4LEAB9NTaS3w9sxQAC8DfSCi83P4CKnTSl6cxI6nM+aq8ePc/3UdNAdzVX81Kft/VVtYrX51jUM8vgf3hee98kCc1mor52Ar1f/T2oS86+dvF+zMJmzs1WT58ULd9rIqF3bVu1nmqtC5oiWRz8meJ1SV+0FTZOXdFko/jGrgDt1DTneuGD1Wq1DgCsseqoRp/afFXad//W3KhrqffZ2CzM+i7CgbtMeZJ6yTdMBusi3cXFn/qOC1SlGRlWxFKDTBP7NKtHesM3LflHGhJnseIlSiZE9GRKfOLOf84PZ/7/4hGHEoKEsBEpWqw48RIkSpIsRao06TJkypINk5ObX1BYVFxSWlZe0djU3Nq+obO7d3P/wOD2HTt37d6zd9/+AweHDx05duIyQIQJZVxIWV6UVd2007Id5/283//f9x9z84UGsXEcAk+2dexDQ6K24tidRYBEPg0ZcTonJnCmN23Zg1AECK4D6/qpPW/MxNnxGYonhhmF3SGijlQ1jiGJUTaDfPIorBWXnjzsyNwWgxoBJ+vPSE3a6HZSOAzhGF69xIBHA+1PELtZTXfEozC4yVyNoqMjIUePicwAujCAwS4T2BVXR3ihTJjB6HVbsBP366ed4a7M5nTbAGVmZ3t5WLSRYEyQhzXT1YFEgKAB0Y+L48FgJBH85Be/+QOCOeschDA2MBgOjfeymIMI8uE0BG07Lvb3RW/SatL5AE40m7pND2d4OQMKUNmCBP+Al9nTQBl6AkAcnMOUKcP3Be66h0OdEKL0+bhng4gU4ogdGqEVemEabuET6yImiqMkWqI9BmI4vjURJtdMW9C2oXiEYtWJH4q/lJWVh0p7SntLh0qnS+eGuSIRaNCm4IRmaIdBmIV7CCIsYu1abY2DbX6b9JAUD1csPfFdca7NYGlH61OlsydQlwGKBRStKEBhCs3uSF2sQ3WwttXG+gOgVv//fgsnD4wRX4sTw9sr4OPp3u1jd7etG+jcQYDbJxeuEXwOA3n45Mxa5XxMiPombbZFv60GbDNoiCWrof3tbW2liy4ZNeaKq6LFiBXnjbcmTDrvgstGLCKAYCiwEhEHwABA+xvgACYPgM2jBRg9A+JBMDxo/2aaLAqbD2NqnoUMegodn/hb+hj5fsxaphNXx0llYYQKBZxi/kpAS1LA53dZ4XvliAjkIccTWucnFeWrwq107oPTt+6NGLjIoZeZDk0PNTVc+zY0j3mwwKKAh3xh/jPtxNEGwBod9ibyMbarx92mmshENYyAqqu+diDPL3RGnu8WCzws2ynOFLkGROrgMZyWXG2dksfHdg6P7Q44zHhmbsd8Es4NzQccRB7LppjzJ9g80nme63wweKhsTwkp1xC2a6xV92PJ1c79nrm97j3Bmeo8hNPBSTmIQtrFu0lKVjIRTylzz3IoOGWt0n3BSOZkiD2Ee0Va5JFJmEpfuiyz0h1AGWUdtinaJpSOaX+j6dU9TSy5yX4m4pTntRJiey+e1bLmMv+iR/Z4Ke92ybClZKF3HXsG2PYScTBL9Qxd3ufNDcRJY2GNnfYdcy5Y25L28MIUQYWbCALjdrDYy1DlYS9n5YqhGDgEbDBrCCrQutjteT9LRNry6yHtAQfYS4u7sJtFWYZbRo3XBg+lwkcn7g0KYccU0ZVTh2rWXYJuV4vVtRQQiVEUdgviLd2CbuoGQ65KS0xAslhfG1UFxrNRVcVbUY8oEJDqJjKtPKoe/ejESK0koArfWsNSg2W4Mmxv4sQxuolIo9ao7qDsKspvuef/sIU3zTO/5pwZo3/X+Ex2wLGA286niRQytzHrEa0TED6mFzjkBJJ+fqNBg5Rw17AvKAmwKuDPRZ7MYzyR1nl23T14qa2muu3cNiVzX7mmRrbTcRxJEsnbh62CC2RE8aQCMl6uxaVQJu8fLwXIzeP5l3oTM6IlLxtF0/N+lrN2LpBYS/JzGmwH2E3cSd56y1Xv2c//eGkcIGS/IXDyN1syhuBwXT8H3hV7kdcx+Jjf8tPFw0MaOfAPgiJHkmV09b05o5ibletOZ/++WGi2iz9OQT2/ol53N9vpANoYumK5Os8vpopT54ABo8O4Wl8EocBUfuXU/NfPzWlm+frpmc/SHelYsA03JgDam4CEJJldGX4TGYslJaKjjaJaMgp5YRYiACA2LTghRpLMHIRBlIS0KyUglT+a4hacIm3hN7PY5So35EAoVxEBWMTt6zdFn59vG8oW8wd6JD/FpsOlRDvfrq0da+sQHDPKWhaZRfISOYeADZja/HfRJpooCmMncJDdip0sci/1vERKkcFQRZrANoYGi7qPgjl9ptKZ4jK5gY5Tsj5GzCG7KLIv/6CJmoSFh9n2qPQpw00MoQPQfjFNG3vmuLVc0JroyLRkoNAQ5SHF0OcPKSN7a5TfaqEjK2u6RJQIC+9bq6MrfvSfZaoX4b3y7M2XldEVjqtzDEWfv/89htd21Wf23LgDy4Yo8wXImPj2d1/X/8X3Pj5t/9PCBTd6XZ/HuftkiLJVEV2hJ+nHMvLZO2ZomXZBOYwSJJphPOxcZTFaPnkcvOKEjpEoe1osrPAr8oovW69SkVqs4uzUBc09HdRO19NTH9ODoYlFU0y5nUU0+Ent24lIOZ+AoHnZlyBs8MUiVsBnNAeCF3RMxODxWu9tpjKpWogic0/PA78tBYKMqx2rZLHfP4bxpt4T08WAwqX6z7o2WTlZdywsgYQxNFvw5qA6WICf6xp2M6SShjHg4HmxbNDonJa4AcCcconEXUUiUhNZkwye4iDkstfT6hSm1c599zU18qeqGw6cluLK7DHiuXhix8wjoiuFUjXhUCy+9VxOx5SGOE5mXY1RFd1iudfsdcuPfhYOKxOL62TqM+swMCYV0U2+jiTr/kucTgxJRn+qF3vYS14L2Z5lCVOSs0hayd79WCbg7w4+rLDsfqFskbWjiHar8o9loTRD2WIHl5UI3AVW+vj5Ns0OvUeXLkSg5TPg/uFm6PYf0FztUSAOj+JRa4FIZpc7Zn+l50wN4CikFoXgYHrPT2W/L01fY/g1e/vwz/8Uu9YHAX/ghfqUl9g3vB67W5T1jbSJmGZfe9FUevNe7Cn+l0KemSf05tZnY9sIL35ozHArKVHk6OVH00IDMUma53LQEh8broPjpKNZKyUv0DwVrt0ysd97GRuapkfKtsEVwm/1lzKbSKmU1s7BKhysDeodPC7sUL2+uX1/m9Ru9ju2OYIVJ84sPnbRIZX3WSN/2Bxc4ZxXjFr8EdQCL4pLv1N6SDmrMoaUs3z6k8fx5/jCD/EXQpCASdJuwvOfWp8ka1EA8XDzeC06gKcGG8urq1yQgvqFlOrs+34WxR8NL8aFZMeGLMKyBTV/AUyOHTeBNvW/4gP5xbv4TfzxR+qVeWBOX8Aj8OYqXh4YpF897n7GwAll9nVtmf/fqqZVpkOJBzbXy9Wu5/59gaDxbpgpCNbIDHYQHxteEHwpDdWodD/MnEsK7va+725yqPsqn8mlC7j2ZO1hlKJHSi1AALcJe1yWs0DuIxVaeHRyYgP2NU3iT3BQoS8QC8xs6hnRQYd6mYPSlDhiov7J7LBgrAi/vDFXn/qeerziXgW+j/CWqToHG/Ukw/U8/DfnBsz+mWLdoDVuv73R4nGQGGn/HyEq21ctliGWmpSbgpMBjC4VS7QcdvRWmPA894TSTC7oOvsrqhGrwR6kplzDS+eBlJZelIFloq1pzDBu8TkXvuy0z7GXtE5qftPx3xGdqBlmsgruEioXgFxQV1WKctDWOPCanj7J3DC9wByaPqZ2cz34zg/T/MZVZvjcT/gz/K+INq5B87u9QPO7w67P6s3Hq/Ej3dIttIyH4HYoXtrB6Y/q9uEvJIG6XKW6kKQx/BUn2Mpl2t6BdNGZpxW11bYH036uU+dmNBDB/PoXtesKigfNHhrdVrsJCnvhx/kClfMFoBF579hj3X/QcUK+qrAHb0Qnh4k15D1SI1+6EdM1wIebkI+5oXRvhv0XRIoo6Xzgl4WG8bFbrG2+v8lBS6XQ6/18VOJyXf1WKlT3R9ICyXZ8d/iwT4DKo9m+b4AWX3nwTngqVo9GGoIWxDapsvo2/Ptc14IfxO+9Pfo6JDjLH6/H+38QX5EYYK/A3dFAHS8vwobwtdkxy4Ss4/BQPKWodjfeiY5Ok87pBM84kwqC24JQLR5R631Xt7Aar8G3L8IvbiN2u2b9Z3qrNnuoj/Sxpha7gd/QkP7MjNlNKc3bHI+6CKV1OUX2Ya/i0Y9tZ4gh4hfBKGkNzSnIBxwVOAO1xDv1VegQHlysnvwE6EbyCg+0fz8kpqGbEdY+Rc2h5V14Br6jWq6Q5VaYuwXfhI5PUM4v+27tK4vi1hQIsGpCZJnglWF2JZ6DDV6Q3gcyGSPVTXvxbrThEedsxonZrNN8dUZeOVaBYiooGaRZ1g4QAmOWPmoxe4Nn6uxxqc2db2LOd20r83ABeSMLRma3xM4zhzvRf04s7oXnmiUyGxgbNsrzLJz5h9rcXcxUdmDl6gTnx6uyLQLM7nOWWhHr6x/otuLNuGUCAoYNjxy/5iC7wZKXXlV3Co9C1UFSrht3X8I34113OWcyz85mnXczEs+swNpxwZBGwV1h1hm+TXLPrRKtzqV0sGfpRy1ANtNSqrh+4zF8E9Z2n3M283SanQvvjJFdilWjqGpKBr57uFyUWVu68K9NbXg9ut6y9hezS3xvD/lbYzteh641h/xkbPycQYiNLA7C8rChS7ydxPDSqLYwfBMe2GW0lplL9gMd+7XPVvTiayrLpo1/vN6CVH5yeyumsgU6l7HWq7o7jQeSjhDa/p0/hPaip+dQ9ydAfH8BH3mlejQzg+Wc7BXGAkgnCdGFXfe8s7BhNHMdbZ4GFBARFACrM11A1dhWh3RK8cjpqBBtLtHGFdOYET/nynMrQPlDjJrIuP1KR/bpkGBffH75STwW1UdYHKbnZp6ZzTpvpEotSCf0EcMqKBW0g3wMXsNKto/2jFBhyGIkdCpkapRkZPFW+5X/qyNwIsTvBUmbN18l6puPA5t7ZtAfS3HS4Jul0AVaC2B6SVPlkr/CnpobuOqIqfwQ8MbGTRzt9A0dHWzN7O3D7J1zco2d7FQsXW/uD0I7OzB/x9gss7kP5AJAwVL3NoziS1+tFIihxEPZO4iosZYoHtTgw8haXgsJqRCzzO/NrJ+2XdTwTdXRdJNNEqqjDMvrlfyymGhBHgTwevF8l6zOo3Dpa8JBNIF5cugXi4yun0Pn8JL1Kc1HRn6Y5jJLWLtde66ZyvVsUcEEXF+tB6usPUoJ2wkTIu0fmQ13xAmORCfNB0sn1qGDhElJtV+sXHDays0442vktnfwL96Njhwgt1O3Eg69P48Yrv76rMxsLABl+zFcvnBI4fldz33z0WNCUElPzUn8EvEKU+YRr3Ezsya7Lx0JUKeRq6b5Thuz+9ZGW0+m10Vp3dsF8VhrCN2z2cPZ7P6HdVhbtU71ce9Ec2Yj2CuJZYXc9/Do7XuNh6BQ1bCWHmi7l1JBuixD9uVu6UE/6juQPwpWjOzogba7WWXkK8sT3haIWXVE+9pGQGep1zfxcrpcS2hRWy6255zCAbofeB29tpspuPZQPKW4Zhe+HjpjBWN4jhY5kDvQSL1dVogN4iFZBt/nFXb/kGmalW7as/JInC8tLqjED9XikXXed3ULavAsbMsp8J87UCg/UEA3YmynfME4yVy5gdzlaFEHZS9HC9a+odnKp7JB/O/ACzf2ZvD3ftEe7i/8gy6tB01+Sjsoy4G8X+JXR7keoVMQsVz1el5KWaWGbE+lZlrbIsirlXQZyvVuMiqZEKbVN+jK9dbpFj+dhcCqYZbEjNSxxzeHkKUbV3UsZEmZykiMXKUSPVNpg80Xyh1VxF9XiiArsJTcVHXgNL4V2/hOYiTrjdTRO2PbkA3Yc1RHm7XKFE9n3XeXJjXUE8rxyDjKAxUhfdQCFBkb+iWHn13fjYbDJZedOHPJO2a92GrGUA+4cO/jhE8yD/QJfvQgiWaLb0gsmOrLrt7dWY8NYnddFK5V+Smdw2gHs62kR8RiFG7dsF+yv+9xK/bsht3dM+FMD6qdeEJrNizlVo9Q7W9x9l8dG0B26D+lc0n6ufK7qBkPBuSPbKVH8g49ubob2URLLDmdoDUkO0rzGQFnbjP2oDR/gbyVVLTSq4udELCn9hWejUYD7bx8xCJLOJXHlHyYTrxoQiShymr9NvXMwKF8cXtpShz1aPmdKnwvYZqtOtdCjiUmGp3JDluNDZEmRFr/wVuJ3d9H/FbfgcLRARdr92ht2QKm2wCzJX1XkqaYM+aEnMgu6mLGhi8JD4hvjKSmP6ZjseuLV+N52M5LUrtI4Vjh+g3heB62/bL0XrI3+GkMa72Oo2XX8nr3AefRw4lb9IQ1Kh+c2F/xDdiLougpVuvm36kuc3MhORxofY8BvA1i+wd3DdGphvqveeNKyOyXVJBF2EwM/U1Rsd6H4bOGnQ8KoxYMo1ypozdHB60dWYoXvZaWKF9iqCeDusBzHJ9cKvEultfZ/WeqvBwbJV6lyzyUaG6ll8dtjcU6Cb2hNv121jdtIWNwJzGatovhsppsJ/AE8zkh+ySW2bOv+yKOlrNrQV0jZlfXXZxlyG2f4bFGcDAZ+0CtPNVdjVegLV2lB4HQkGvv5nEWWBr+Zk5OSbirg4m5k324D98BxLf7BlcWh/jmZQqCKgpDArMy4v0C9W2XGbg4hwSLLzNwdQE1TFjuT/J3Sd96hd7isFSAAmMTkR92mJwFVhs/0rNLG0Klx+OtDC56YrKRG8jUtLLOdejbxtXcUm9MLgp050W/z+vc99f5QdcZA/acR1y0m2tYuAM/NsqFHxES5riSr6Di6+1+95taFagOvWe2TYfS6nrjcRarII0ugW3FCvsVqI5gAvMmfJe2cC97U3NXh4E2d0ewO5KeSBlMF1KOpMcpXY2xyBJaZCWBnv5DpURuaXDoTkzt+l+1aw4QoaY4vGknyLT2snO7pFs6OP1SY7y5K8Qj+I2n5GNCoIzuxoNQUSUzlt1vItOix8rVgdUPxu7L9d+T7cx685/9+mTWiy3MbFxnt96Ce/P/JHz0ya98XiVCdeN+ut/7O4W2nW0ryjkekz8ftss6QkRH9anojW9izRnWOT7PFfKHltsYtY9UXFlCaw+EyM6Jjw2nQwF2fk3MTjw5F3RIszqkU25lfmXoOma7V3UNbS2nqZ/cA7DKYemtkqo/rVVlcv1brQYuyfW/feI8R3POuez8nen8Vr7/AjYwINdfSqn6Rqq6V1z1Uu9qkvFAv+JAbLmhPdiQPdC2s2Nwh0tW0idsT1iA4QbzQULnTd6IwSqhka0bj5pTTvBB1MHszfaHlcmzKH40u5Zjhq4izZHM48LUIdkR2sNxHM7Lh8gvUo4oHZHv34d4bieQfP9hXcofOPqxQb3go3z/MMqdOocp9I+DdzkqPu4+UmvAddMjf5jEZ7JgKdYxMgk0WZQNYO/w65GsPx58F7yONZns/LLnDjdKXpzTvEaqaQbdjNzHQd7HHjI3XCLIwuqbveCQLiK7yd4f5avvP4gyUDkvPGDaX/3uVIBEkST3LGPjRT3342qtYiZIsugTSdb/Tdai/YRXJMXPZHcwHIzt0zr9i3WGksxMkD8wqzxOjiWUuh/31crtFOZtWgxzDNJ4Oat6w1B6WdAz7UNL787C8/em2u8XtN5fVbtxhRN/VfXG1YKrC/AeFlnX2U/NF+eNgBNvjhlLoqqD1axiZlJ6ZTxuBBAlUU46ne51XaJ4FZ+VReCeCUZRPL/XMldvvNpAKMGbTtIaLLnHiV6jUWIe6bpdfbT4lVeOyN934PkLfAkyXQng2pXvGVrJyxHzHWX4q42C/mRNg8LuBtCU3DgH4he3Q/c7r6R4D/fwGAePhJiuyPAwJ8zbRr3Tz1BPUTMC5AJ0SgO8CyWyJPJus7IVH4NjasMJhd3Hk/Kudre8peGVx6WHd/4k8Pe/huVHr07r46fT58B0uHpBYfd56WahXPMkWE5xrlMqOAuUDs6469wy1Lq8khZ2Utm6G5Bocm+52BmgpSN7p2XkuOzQeaAhPFfcarmh+5BmN3o233Ak1tjmVoDx8eG8M/zoX9l4NNZsyQVW7B7AWQ7y9YaN67zvDvw2i7DjgpxGfUh0I/t8/MUocZ3guPRNOdb4ldMLrgVeMvX5aVyp/kbJwXPzG0zzvKiBe/9bAq2cW8j3Kta9ZjVcwd5l7S/2gcPR7KAz8O8CaAIHAMiwhOANgJkgiPWoEsmT3DK8FH3QSD34jSy2SaDnS3gK+EgPmYTJh1oAEIU++oncmPxVFfJcYC5OwhUFDtzQIyQIYxn+AZVfdkX04lxXozSJq6AXWUNKASKMcIHw15JXUXwZ2eaDomtJ5B74iRh7/DSQbqgXORlxmgdU0l3hXq4r31JXh/9I6cpK1vlohccvBOmG7iOB4WkloPJ2GNrwr1EjIpARFIM27oI41aSV2QdfFAK68BSVxUpmPm2i36T0RAVhq/REevpf8UWHwjrgi6LrV6h27vF+a4uUVpGG34HSI278wokoGM0SQGVctRG9J0Z/tEcm7UR+aes1mCIs1i2vSM0nXK5BbFxffLlVx3RCtGlUWGgsfeNh9QARqHa971XZQvtf5RZr1w+Fm+/Hp8Ea12+Ky5LmcggAgrBoXbrCyPY7hmnX0C//vHO9GPTcpv8P9phesLsqn5Z7BmPDmWmhKsy6VzSXerkFTql+7IK2ru+oDAvNpc80CuNpTuV5zpC2+5rlGmOUliyHPmDPxcXXOpfdnqRBtAIjTtvVIqmwWLm0yzDf6j5TD57QEvdYyyvmOstGtjRZYRVhZRAlcGngETDGGde7lfvtcBZBQnj6GqbOso3O8zykMA7l+UjL3HOZBJTYMtSHP5V7FES8dPeekXEP0WwZ7kGy1CUu2OViCoOVajVOkc6VrRWlK3y10g6F9VZXnFYCGuUWnbFKufkLddrVrfK5znXvJ2vYBfxT2JGx3xIga8RcOUrJZDkM69+qdNmmXSobCWHo+m1E128kb0XMG/GqWTN02VDNlb0VTuOutWqIpMWR186TRl7rAkF4Rwo8LcfLdiMvE/j2IawwlpMsKtAon/4yrKRPN0cyQcJV0ineOcBR2H0mPF41u6CQUVBJKUrZdnjpVVxlukcklXrYackarovGFJ/9S1KjgUGiI5Tzrh7/M636OOblcA0B8fE8RLVmwmAUyqXPjulSKvFAyVNTYYfP5QdR8ovJJLsxq4/+owPgXi4ciJYX5AS8H/OtE0ELxJfTjmV9yEcD2/EXxufqT4ERDxRMdfaBKbIJ2K2QSERIwBdTcrrX4nJG2A0EMijID2y5NpkQ1z+a5rXY2Gt7UXnvXIkJ/J9RKGPgJ08DPGBFFKLL3uMz1TY/5M4220z14/sg31ZzBZp2Dld2+RiV+JSxP/i5U5Fxfeh9fVBanAJnOI4j9adpif97tKv5htbikGmx42UvKwj8AXAG/MVpQgn4YbOta4njIwPUtsIxqTZf5CHjhvYBYM38wHpa3zNNYrEriWuRHBuQuTj+O3yDlnynMiQT+L8dh4Sdqoxp5jUTWnkANZsKwQ9tcqaxeyxFPuzow2mCBfyeAfVGCE+FvlFfu58uaFl+1yCCOuXFmVwX+foYeFQOmHb0WwOJi7WYV3tbjPDR7t10/avx+itFwHIfAaSEvvXfVM1hlvH8diBtqeli03SxFoFMp2pZs35tVFhT73PFXIZfM6Gf82g2pkMHmk2F8IfQxiZjXRuvaXx8p1MEJ8Do4GkqB+TfHcGAZKdhkDpWjsE5PC56B8QP06Q+AP5Lh11Qqt23ORG0vB0/DqKoBhjdMu2I10xPHQgkaiC7ZqmllROG+W/5sMniAEJ4MsfrMU3q0yF+Lf/kVDHo7/go9kt6Ew1VYhyYiOqS6i+7d15cBiI5TBjJbmEXPmNWyaFl5TmvueURLkOVI0A8OVaSJbANrq7SWtbEaZ/uF5/ACD4QwHba3Oey6SF1qz8oMhsAwOvPbF0AeAvfn38fdXw0yd3IgKHCANDA6IqFATA5IBSp9ZsAel4ywOCdIh1H+wfIfWso5USlPK2etBCP40hfCdlEq1ky7kHwLvSJde54hEg2VkRL6JPe+Z6i3i/qSxlrxmsn+piBfrzeeX3lWb0b2e2pdllmPYFlN6ITSa3FHoTZiKAUf8UgSGFL+xk3sfoazJ7FvI12FXSQb/30eATj5205q3t1zP/TB890b3U1ENbmWqOJHoz8qyYjSYxNxHuKpf0ey2ym23hUewmV7k6lOVPKdGo9BbuRQDFjebbR4mecNb2KSVbIH5PH+E25xAkaTFb3A8O3BBNP8M+ICMN2+m2OtctHvV6x7WsRJQSO78BwCEdxvbcWhivmaLZsYw2tgYP8iMTKe+y6Istei5WrajpD6r3fph9f6o7v0NF2BgmJ4HNalKjnWNYv6mv9NekL2jdbBM/Q2tki+FmUCCw9XTwjyraS4Tn8mS1GHOAdIlHSeHg8jGpaNRtRlC1PNjYw7giUooO2Ij7wGhGC39G8iWib2SuzCSBaiIEvYYrIIR6+jBgiMlFKVZ+sRHPd6CBPSttlmoXIVUQa8ZsrhPgjqugBxFXtBcTWNwcQWUQXpFqoua8lWoneQ5+oMVA1/vn4dTXXPWpEr/JBIMBAC0kBiOLOYAkMdiCSfLixaDjUqQA8AakHIiu0B4YhtwdOW+WwhB5EmvYJpPD9hmIEfmL/zykhb39xYsTKpMyAHn3WRZmzFMlvlSiqT1fJIuhyW0dIzPEt1jNEHiUroqTLHnlkosJXivVcyHSVecx+vHGyJHGVKVyiOBHqBZWf9YAl7Axx0JPrFXTrDJmyrH5BU9PF01katXszpbKwggVzuG6oTapwO4ouWeliQAvdKMmr5BnYnjtX9hx58hO6TkUfSA8ONAcUT6QEAAAA) + format('woff2'); + unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, + U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF; +} +@font-face { + font-family: Roboto; + font-style: italic; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAADG8AA4AAAAAW2AAADFlAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGmQbmh4chV4GYACDIBEMCv8Y51ULhAoAATYCJAOIEAQgBYMyByAbnEwF020+cjtA0f4jC0RROjjDgv+LBNuY9sOFiWKgQPLJXw1FMxltslhMMMlrEEKRdTC2ze1PrI3xwuZPnDh7wCXj42fgOB81l4fe/r7/naRybr8PWCOAXvPvGdX18/zc/tx3F0mNSGkxARVJUaI2KnJESbSAoFIlYaGOj4E2tJGo3wpUVDDTSpvSCu60gn8ZCPqMqzLY1K5ChVxV8c2bBcEDhSOavv/aMuZavxuJGWRNtf6vhu5MY7tMhojTUJfh7Q0Ol/iQzOG4JqeY7xdmWImJ//+qZi2u3uCMSDn9yaXglFl0TlXmuOjcunQFPAAkPj4gZZ8DcqLCsSE5kZID6Uw5QHKIoQupJJ3pTKescY671bbrbsvNTb/d1l0KVeq2KNtdqK1/5mjYZ8l2LHLEM2eoObtrOAhhjCKEMEerjvnrs4t11riU82tehlOjczsaNIVA5ZMVBCHDl3EzBAZ1GyGWAiBZsiCFCiHFiiFlyiCVKiFb1EAG7EEY9x2CEMAkwBQQULxYeXMmomYVksoWVnZusDQ0KyUOlkamhMfC0rjgtARYCig2PCXBvEUhEAdA1eODxGAQ4N2qLvk1kABsQMmnn+1Zp5RQGulmdCd6FD2A0k4NoIbRo6gx1DRqFbWdepp6lZ5AfUqdp++mEbQgWgT9QFQeou2gDdCP0ybovEs/S/tssTiKbsa+YQDmRi1IoO9mrzxwvO3sjwcEfRWQACbsZpj7HiaknXW8NuxZc3btY7A3cvm+bl4ufN0rr+zdbX1CV/vcF2z2cu+qKCY87mXFxJ1THo7q/qCE7yF3P39SDWeXQA8WRX/vpHzB6fW5zvxhcurf2RJfHPKUT+2HNvOnycwfF/OuUzuq6wLeNXHaX2965Bc9AT3vVaPbU6Mjv/hMz7otL/ZOMY22UDdRYk31tPcioFdEk3EyahNDu5qbUvuyWUVeHQBuIh1qounlvocJ76+y9y0DU0fsNrh06gXu2EVs0PO98XL+m97stCfiLGxKp1P/LOY0LfCcuqbq/sXFPyV20XafXa61kJ/Yq0Nf5AWXup/e77xmk2PmL5PwbB21OrHS5lu3irgB8p9a71qt7Wty91T9iyq6vHZ92brnkmcxqcVu9oh47S6UTBNTrFzS885Nw3mpbjCKrzfXYTk1X7zu0DVbEOTehqXGv4bf34UNEgomFg51GpZZbgUt2tbRsZ4ufYaMGNtoEy4eO46cuXDlwYsPX/4CNWnWqs24CZOmTJtxznkXXHTJZTfcdMv/bnvguRdemrforXfe++Cjb7774adfEP2cQGJInJGljEl6QBLCSRptGSSyt8Rma+qZ0EybPnGWPWTdGzYBLmzhCvfGHr3g3Ws+zfMPWeNkS6FddqYxkYlJTGEaMzhnPOyhR3iMJ3iKZ8ZcbzzHC7zEPN7iHd7jAz4an3rtM77gq/Gted/HEd9GL1/sRQQvQgrnkOn3iGFzjFpg3AMPkCSLy3LR4OrsXkVDaoJHZ/h2TXxxcktQmLmyBlXWg4RNnCnR9fhTwTiAMFh4o4RSVD5HodlbBhN3cBf3cH/TUihEMF3PUjHWzbMBXNjCnSNkjcqmvWwutKJNzoHneIGXch7jh+InfjVGmmvGZN0CmwAXtnBHDebwHC/wEvP3TsIjzstavkRDYyrXnh4iaW9bviu8xwd83CyZSCXE0IJ2dPLmWMACFrCABZPNcljXzAZc2MauJXGvSs+k+WKqOcm5xHO8wEvMG29L8g7v8QEfW8dUO8ird3x7BGP3gmmf/ZmYwOutj19DClfjQhg95V0U6gpzydvEHt3mpcy6NL4Dcrt0de/dyhpV2VkdzfJUZwVVoE7wuhObc8cEcZQhwMQCEREEseaYuuVIVtFBp2+jK7VkTQYXIc8uU4EzN0t4CBU+mar8BFBTlamhSbtlOp+ypnHztCz6yN03v/gi6MpAUiRFcpAzEYSlQoaGELVMIMsFmaZg0BJM2kLSOoHoCHH6gs1AMBgKWUZC2gYhwliwbBTCLAWFlaCy9iV27EADSbqIdE2BuQkqD8HhI+j8hBh/QRcghFQp6ntdJKUFX+49zzqJdu1MA3JmZSITziGcb03UBZeR3XAbcsd9DA8ik+WhZyjmMiU8N49mcSLJWx/hd0RB96NbiieJkqgU14IoSaodxBWlRYSVQxEklRS9iLA+BUHPF2LYgUF0kiAOCROTRLjFXIhtKsSNMJEizB2BeAoWb5/MMAsN0RT7t01EqE5BqJmINGgkSZVESZxESTwSN4aSBFEUwZMIohMT1OI8RJKwyQaffEUmWrforyQ9hIAJlEAJd58CjLCExHgo+8c7R4LquOjIYGgU1N54d1wCPx4EcYmhcXDk11AKnEya9I2lteYzwIC67Nes224CI85SetVt5wENqGvu9G6hSK7tgtFsPZc3CxY2dfykUIjN1lQhttr802ibrT5ePSJQ0ICGgoqug1AhHc2F1UQmIDphNgGMQ0ig+7+2faTP6A/nz6GET/VwAQf+BZkrE8moaOgTGk0nXdIY8MwUA3BNzCWqkUEIKosoVmOeD2cvwm6s0pz12x9//SvgpYJKJUseoRXLKafJkSBJijSZhWoF4gjNSKe2JxORRrVwX44MMGx1DGEHhgP2G3SQwJD/DIc8vEC2PCIvLlWao0Ycc9wJJyHINoQwcYiWafA7b1EBpJIMFCt82pkN+MIvSRRphRs7Ko6L6NGz/H6Hn3LHtdHdMB57AwhRe1ThZJfhBEGPjuOU8hkZ9Gv7OlBmlyPtExHPm9zwMZ0M5gc2BuYArL/55++nEMj/B/gL9hu1VlCCbgLESl1AiRJ8KjQ1DUWWglTO/81qAybIaMCk8nUbtN8ZU6544Z1/ZcniWk/WqXq33p+jKk1QmlhpGiVZpSVKKkpLldYpGSpZKB2udL/ySkXsb/77k/8AJqWkW4/9Djhr2lUvvS9riovjBlMrSSvJ7/laJYP7LvlHzlHOMRI5ukVv/j+b7ZSGQ930Z+bP4T+HHm99XNk/I0WPNz/Of5zzOPPx9OOIx/6PNR99e1T0cDvaBwcAwVn7StC+Duyeh8Hxvx3fuBDGYfab8U+/CIrhDtxN7J77HihR6qFHHnviqWfKlH9jfiUVKn3y2RdffVPlO4RAQ2T+jkqXWF3HwOaRYLKjwczzA8RioH6DuV3Vo72PkGEoSUgQEj9lfeUnfBtgdSroxE5FIFyRV2r47DQEokYiRWTUSbVtYQ42gHKCcBJt5XakA9eeQHouQ94Y9LBa3GoPtof00epvcUuRWkZM3PuvMcElvSDMlaYtmR5Em93wHDAbJNcnhzKrgBvyQf+exM8ZqCsiR5u1liD9kuXkq4sU9fAvWHqxy9DGaQ196U1TBSMjVrUplTWlbb+j3teiE0z7CKvltPSBewicpGamtpShgCQGW3QCs8tpyPLOgWqU20VlzrH3ZyLaEoO0zCpk13svkpzDPnr0MDzgjCGAgUvcBky70XVJuqZKbtIzJ8+oGFrzU3jytZkayiH5d9bTwoWZ0u8cshxALCqsZyvg1SGQEOv7oQhEB0IvjHfrbXXWKkvOEYnYGAR33LJGbcynBrVGBLKWpDbSOJ6ziFTKWtxWMDDvHnZE7e8dmWHzO9vT8TrFMgRN7N3NlkljJMhiZ2yI0lMfl1WM+7z0gvpVrOWjcQLNWOhpOKXx6A7Jq9HMpmYl2rnwhQXK/R/Sd4qMmcXhP1e5SpVQBDVZLmKJV7GPXgChB7y/qAD26haoyE8q1cUSWFRomaNwdEMaZrLx4VV2Y154RoFePSVNmAEu00aRy1LLkX960CXOZ7f6i3qGZf/5sTUamdIXlfUev9mv2PEthmlikfjxI3GcwXTghJlFfXVnhRKGHf2IfoVxkb2IHmPfcqSGRjf8iQANrpz6QzUnHqcpxzp8tuICudqFf4VDkJhnG5KM742TuULaSMdwq1eKw6seUGMmIKusdsPmetxCjJylXJRXtDZQGxNq7JY97tRB+x50l0lMu+ou1mC8ba3SRvmjF6tlVBiYZ40bqbDkQ14cDlHPGmlIarCX5zqbHt24Is2l2UZDvUXLw47C357zTTgdeCzaMOmPC65c0QU8AuNBxf+qGgez9NmX7KyjjkZXpJmVYGPDaI7kpfAsUf/SLOgNXQ8nu7hiTVZyOshglnNYm9BgBAv2qCNSEYw+Nfft/FZR6FFmPsR/KhFRJhZ+bUqZ7NphZ1ZoYfBSOTX8bW2vpqix4Db7CYRxAp0Ie/NLmYx67TS5XqF3DbOHPIZsK9RQ8tiImhFs2f6uKjsKS1T6OXudhxtMkweln75hAJ8NUp4IOzkPWrPAm5THCzmlcDCICiWazKVdvucf2UuAPZrPiaf7KG+zraKPt0KLOj53GFZbZ01x09+21huf8FqTfqvpJxHEHb+WwXnEaZqPDIlAj/3gWmdZ5ZHg+tEDaIo1sD5LOYaSyOy/O4Vu8YqQNL2qj91ngIMnl1SNe5tUr2DI4U6fQq/bEYsOqO7iAAZ54tdwnYMV5EUVU9Dl3T+MMdojY6ogK0bUwbtloPm9oPIpH4dnEdMvvASpdccGleXTq6wVDCTIOXlY4k+g66hASEQPkEyLeYqMK2c/Gqw2XT8ysGIEMVSJL4WNqGSpUD0BJ1qrI4p+FH3i8IVizzZwhqRYX+vhUKEXavCetkQKv1lLraM1B14fBmbPjmLUu17WohQhdyuRXHcc0IMQOjIQhSZ8G+roT2BRSFn/3a3u8kfIC+Wis6cL+pLNXC28vuHmFEU7l0Le8xMShB9XMLlxlO8NiWjvSlcy8lQj/SxjlaaxorbmEZuhP7EGSnWvOS4aTT9xo/+sbeYY52M5tdKUw28qFbtDkhsf1aQO6IWLRpksAgtsXh6Nte/PF7qK3mD5dpsYKHNajVmwCEsrGRJ9R+k0gae0tmPxshHo1lCLr1juRi0W3cbD1JRposaNmCUZnZTKe4iPBR85BiYM6hlRGUif+0iFZhV08jx0hHFszU1/QqCH9e+JySMxLgIWCUMsWKPDU0IzdZqJvPy43ONcDezoc2zUhpLgP/vyIPexd5iuq3Td+3cDFjmNtC/q1Eqc++vorOfKqOPPEf4wupGj+Bj18KKKZa39yzX0EDEm5N17likPVZbXKexdWe0TgdZA32mumT25+DTHZ5KeR1ZiUjVXUVZUAqgQdeUuvXT1Etifn6YZ9ChKOnf3zAWlOE0ZluRo7+8NnLp7kHG84YLfbnU/Spoajqb/eq6nCy3ufrHC4qjLO3WfxafegLt8+8akW7W8B+6gOnCkE5XJpaqnAuBM/F5Zu/ENUUniLK+iJw6bgtY44Fml3qOmuCpSTYyzLM55xd/21m8hK1fNQ9H2GbOqIdhJwUmcDb3Aa2h8/qgdPw4bJSo2ZL2Ipfr65Ool+mPyQRPcfA64OKklV4OxrU4l5/cjxIGsuwynWAwk7nqUD+WcUaL1ioExlDHrk385BJ4tpPOO6T3tXlmb1kklZZFVrlvVJ1J0NQ4MD/f6+S3Jk/lC5fzZzQ6f+kVyYnTDA5bkFkcno3t+DIFhQ6oDnB1+TP77D55s/vYeLtMbZ56a+JE0Eo4Aub3U3NjE+wRZRGvnKHSjK0JKr48mhngcae27pXYm2Uy4aDqWLRO4MtA0ZsPH8nqWU0ohLmsIJmnRH4ReCs/LT1+QujP8kz1xj1ePLH80z97riGXpGXQ89J2peL2vlp0X73qCFlIrtPhnONYsQml5Q3BxSR0aJVIs2dNNK5Aaeyi5XPGAuV+iyev56A1x8E5poD6pGIoIvp1v+H5AuE22Sd/8rQcsBvkZDy637/TqpoRhomuQMoHa2l3hRIr/eAteMh9Y/IWOdNfEFdmCJPeze+V20ml3v3/ZubHuG62Jmb9F/3xqCrVOSUiFSKS0k5+aTBEI/AxNVGjPOkMhvLtrWt+Kqcp+okniWW8lBATyqEF1QQ+EoY9VPEnugzIl951+/ihxFd7rfTIJ0PSg6G9Z/WQKel+s2LmUwu7uQmsCmh5lWgqdkg5XGUyfgZ5esff8SjGc/uue9mff342Qu5Y0LeiLcB8J49Thr2nPMjtcVhgYTmBa4YvWm4gHzitjCLqvhArEPS0umwCyYAKH+wGZKlpkmf6OmfGsByP/CuSPwX3wIn0C/1zSYGrEs60vtOem8Hj1wY5WIM2P882ocmHuZW2/PiQ0tMzWtexN6z+U6/iZoP9KrpO8o2sPWnJje9ceb/p41Vy8/o0R78Pgkj00vdn/DpyFP0U0W6ek18HWunsK2JcZe57dHhbXuNOx7MH2JY0f6KcXaPlu1R6EL8pNZAXTbB1jX4YvHC0UusMYXLhxQkx1rF1tfJfMwQ+00wtAyQ8vC0ZRqC4FlL5MFeH6PdTNZDuhipH+QpyHmvdQ8ylcVsWRPar5iXoe9UOeHgxLmj3FRM+zZ9Tbj8o9+acQb9tDzSPbs8uO7S7EOailn1xMMmHUjAwq55EsDFyCR91cmDy6A8nawDH4g6cf1VpoMcNB93NkhgPoFTAPT25J5m1I1KjeyNzzbHYf9iManB3rSB4k76h2vnOm401zlxzxredBSrhrsPsHsSHgIH8KH0dvHhxRMIeMdSkfkyQqAkXSmYGRGVTcTbfQ8o0OMS5wZkZ7Wdvo2YRGgbREhmt2hxM+DJttdeIc9L/Fq251p4avU7sEp9H5UM1gD72SvdFHzlCXo0CmO1hdVauc7XunKZOPc/rH9+mXplju/O3giw/RJP9jKEeB1KdrUp4O3ZLpq/wEPM/ViVLDGz0bhXYE5yjd45TGw8pZ5eSlD5J4gpe2gjSNBymWO14C1Trfkd8hm6526aZMt8ZX0KH9W43/g3uasZ3dUI8Dz8jQ1m60x4ELZrkT616snoSHnJN49DfxDLg07lKsvUZq9QPSCTz2jXgGPJrN0t9r9cXX0orrWMnapCddlCzS9hMKF1dvYEYwX/dSnrBM4qFwgdVXnZildmvTBTUYOyon8LPY3SdSygrwzvfGCbhpm3D+G6CX1t5cSK8kTuH7s6whkQvPnt7v21IOsti6APhteYwoRoh/kh/yR5XJbL8FoKWVH70bkg9j+PFd1lFKaOlAvtGgI2NSmzW+9NNNnA3jEVHHccYbwIERaSFEHG4uZ8YzE1JSY4lmgOV3UgXKYwf1zRf1zEPEu7RVL/7R2r4nOikkGY7dOH33p9K1NRF+4QaZI2iKKXpD9K6qxC18GD99Qh55RgkPS/FBCUTjLqEtzJzo5ij0IWzVN9gwOcI5d/YMkrnueLN4826chnrzbe8zC5k1NQtzBeXEIP5/UWiUFqP4n0nY7gYb2yOOaIuXljMjjFHg3+CJYsX+I1zOyg/sARt3Ba1JBay1Y/HWkrEbYD6hL3p7Md1L3+MgNZp1RnHhBh7Fcw9Zh0Q/iuTy1lt3k33ZJ5hzUzidOBTqPSw+TGOEhRb5o2jUUMuMY0SEZ/uhWLStMvAnzduN74J8UMFmRjjN3z3ZCfmigkL4OjqL6FdNr5YXN6Ek1J/u/IhZzqqr/fCsuAynEYNJgVcpBaQYua5Nyb3lFpJi57h3uKjYTYvHCsKWRKFnsyfOxV3fhHZRvLxjYU2yxKNlLxfSlM/qfkhb9Qc2cVhWqucs45ItVWas4G6B9lONOe1kvvJZ/cK0lT9g415mrt/B8/ue+ceK8lOtNxQ4o6QQEbc3IDL079opLMDnLrH3CAlO7swK93fnVC83pDAteX8DYwcb3fpfE1bAC5KwQ3wux76orYpIRlmHaF2U7k6HJ/uLkRsq0TfTKtXNSdCweeKFK7a6i1H24VLDm0ZWufUf8AChXvdaqSSNcoo6GMW8W9UJ/WiQJ7ul0v35GKj0tunh6/h+xxlF7wTBDHGGkOlp0cXT+HpB/IvxdltSTzSRkh4jb1vw/mxhIUnwU3UO9K65Ku93YaxRFzwU7Rd8/zBrDvEGDeGbgtPwBhbOs4dFZ9/HeCsG76Hw2dNqL98P1jlMEcDvzRGKZUd4p0Zi6vGnkN2Syg6RPn6TAmCjnntqzxyF3uMq4moe/z2liZxsXnFWT7pjH3Eb/6ZR57+Q2jKr0omdpHuf1Oc5JbRwasSqQ8kBnoQkw2EVaAhPCirhCOUQf6PkGYaDwsxFXfN9Y0TfHDNMth6mSD/V7ss0UZJodY29pRiM11ZZ2J8ZUDnXsd6sSfVCl2W9JWwQi9aPifrW0Uo+Y9U8gQFw4ZRjpGrMMNoK9/ILPtJaKRmbUvuU+M5dCZfwXfz1U773FiTgKWUP6e53jdeSFciD/F/tpQp0ACf5rJdXUz4jBVVfE8vS0ybfhG8KvkX7p0f5f4OVXw9XfQXdw/5NYDz7s2RW/ttVfAHfekWf+gLsuTM4FNeWimfB2pTpI3YnODyltPbmzi9/HuV1MtsVxcHkXJHqucznLxHUnwvYbj7qaT4WwpOCr24LBQHqJXb/sT/H+7Q4XZdXDZXv5NM4TDeOOOvoSyjFDJP6Ch6cGuJWYcZXajsl19C+USzKY7DmKf4fgzLzKzlH36SKFeE91MbulaZFk+PWjKQH+RB5eKwhcw39Bf1I8bViPEh6zFb5DDny/vKa/vDBHP4uclF0dv33X+WCLCrbWy6SxU5IKEskrQNYSeBxZXp/5b9PjszHNxChyvxCzjW0aVdI8dpV+D/eStwszPpJacPudHemh3H94AItmhy/9mhGoA8xTn4fxbYmJ6w7lh7kRfRRnvzT+AgN2pLB2sr/Xj8Pi7+eiZxnVPdfbjC85S1E2f/rLSocLBNKFUqKz0zEVIBlRvMltv5n6aTwxOHU/7Raak7zyR/h1UQ5MZuUOIMLvgAlOSUvlUhD3cnsIE7+KRue7Jzz4fuMRnp2zZGfoY2oFub5OVdJJV+BmlNZWoAyUHc0OM7NjbB3zH1l980dVr0QAi5fBAzXS8rzPM5rfAf//qeX1Bmul78yXK+IVvHbsnEZHm6R3spIvQFOG5VLkqU1yYJ3onwBBWyHYqQtrH6p9AsWKG5qciVqbynqgneYZCqXZnoFVqzrzWKtULtvfF3snnix+Erted0pEUj5d+LgkmWq/T6M74FqnNQtZDA4t6B6TmHJQf0bOpdVL4DCPljOv9ol/MKzW+FkDafpeg0wJgWPOVOrHwPTqnZrx6sbkDvn/lnTC8oWfb/Pz3bd2rXz1in4dDpH+XQOqIddO3xL8y9sPypfmtuKq9GIgFxO3Ss1vtCC2FwPZ05sNmGLUpxY5guIErq5cdaVjwR48qLITpefVO8VUujhfh7abHNO7WISlHWFMTypZjw7MEmR5vRVMM5vzicOYd8ydf4dkQF4G6uZWdCP27HgAeks841mvHe2G6rFITX2Z1aW15EyiNZTEoNUN3g56IaKIkRdHgEjpuTgleAkogqNb/H+KtSkItK+4++byq34IL72+NBDfx++O67CXZ/IDygsMFfgDGyhXyrKI/qwX3rkyrciR+CGcGJexR7ciA7NUU6t9pm3puT41HujChxa4XRVM7cMl+P+b/CDU01cLg95w6xbJtrXTnlVXkGcx+fVpd+wI/fQCrI6YlAzqaAyI8886EEM+rTzBNlf+CzoxPsyrLydIZQ+W9ajONwtnCqz6+74IBp1FJU5dWy1G8T6C7kIhd/y8qb/IQVLBbGeCvKVqlI0hH3y1RL+B6aOvMLssp83yMnoQqixc15tQFEzTsUDZXK5Ira5mZ24CR15Qju98qOxiyyK9s1xI8pIYYVuD9all+AMoveM9CDIpI6X1ezDLWjHTbGTqUcX+cd5aqysIqIYRRbTUimLzn/PgLXInDBcPC+uZ20/Wm/H0zXgcesL7W1AXseQldYisevEf43og5UI58zdpZtldrB2NMiLG1rzhlbSNvr3sIFrBacvlaYbevB9yEV6cZSLu6et1qNLRrEIWD3tyBsOsjuMxFNKK4/hcFTmLcVt2DOKO3DzVbETaScX+adtdYTTiolt2K1PPefqW/4JHqxlvrAS5JVJ2y66yDxkCLJpRlL5VQ2HcRNRf13sZNrxbe/U9L2x0guIMhReRkvFX787bJREOpvxu5p6XIXObfX7wW4W3tdKfV+9DVeimVr/76yGN6mkqLB8byKL6BsV30UOLgivD8JN2LNZx4+dSXUFExcZTk8J9WJZPrEbB6UGEW9FLO/eBtHEnLK9OAKaIpzGiQzWh40kG6LAp8YHleLgfNenqzIrMZ/oPgXmSzh7a2iX8s9SsQ/75i6Nuwn8g1kM/p2Z1oZb0fBTyilN37cka6LMp8oT8YgEi2nPxXXJhTiZ6ByS64XV5n53tNqwb0nhnF1/uB6DVHbCtjpCuRMaV4qEqNhZXfKkDJPq/54eQvvQ7VOo5TUgnrsbDzkm2deyfeSszBUmPSgjpIjc5mtOfEKA5s+hjjlAHqHeHuCVZgMq601XU44tGT4e7r+MQzbhEurzwqe44rY5KLuPVR4WvV9xeHA1BQZjsotGcBSqCjX8j5mZdmKRf1pHhZ6TQmonBxXTihla/mv2IRzTlQjFf5TdDC+zwgzfwkZR52XzbxX6DMcDnvk/m6DoGD5e9sD9wTD8/f9vsESH4nuZ741J9CTxvVrz9O9w1N/1HmWZ+JfSf3cJZwtRzoledyLRSp2nn8h00/gKeqNLlUfdFfaWn8cq43ryfXAxomNt2zux/XIX7HRZWaUMkaEp+pL7Sx7pO4ZEqtSetVQhy99RmhgJtNFd30PzVHhOWBF7igxgnN0n8uJ0H0TcPbpp2TflTypjp3wSueytPDuF59h6b4G+bsXO9Vvfi+6Su2C/npVTxhAdmqYr3F3yUN81JBzsesWZ+8dfbsdOKI+bmmqmqlxGKJ85wT4wda8OO6NC28Rkc1VFC78oYV840HCR3kf8WlJqZMC142Nbrr4B17an3o4HXwY90eZIjvNDYFffnOqS13w1ofUmRrZim8FDdjFHeu6L8lnl1Y/HVz8tVtp2DbU+CPZNcsG15N309zG+ubDoLrFfpNArYBeheu636owFClWVG5Ia6VCZalryUzi/aup2VD4exudvUw+/BVKAc4QL9kb5pexE+VeaKlNgbBJ9uOAEHsNlWU3FGa0tm2Xd6O5i2zzlwtNSWhtL4msPpA7hEVSevGd7ZtvuGuMRzoDMTFFHwo6mUu2iFKF485mWzCichK9m1t4WTofXm2rJeKHJ+HrWlllQDXWOCOBMnXsg26QuXakh26ius+rrulUrD7wVxlvV/L337eq5v8Bh04blHtF65RjFM4+LvzwGS+Ur7EPTUUGRrF20zNp977zqiEfo5xPSxHtyTF5mBspsD2a5iGeMmNRreamIp4t/Zh+djAiMY/WyDy6/8hTdxK+f0SbfADk2NTsKJSP71S7abG+J0pwk1xVzqfWKmbocvkT54Q1jm/ILDDnJEgWj5iA+eUnX0mzNOksLU31z8yBz64zM9VZmypDSfvb/BszMwGKtG7NhZFczrse9/7MH6GFiJ67c60A7cMtuXNsEJG9rLyfkh7Jr5L/JyZF4PE9TYoCyZGRMSuwCkE6go9jm7pF00bNi537BGdIItrkzkh6sIdJQIfnoNithKzGEFCZqvcXHJWaeh/tMn8aHscz4Vl+IP22t4OccH5OZjYNQyvHc3ZHQp0+m8GyJdCwbsY/NSBDkFqIstKWBnrvex4BVyyu09DaWrXR1JsKN08KZoPchfWI1jl6ydyWkXJOYfBDkf3kCS30JlSuYRXm3Zvh5RBte2juzSnKveGeUwqP+Jqz3d/Zo6tFEHacdNFcXDLWk7aWkJEpqha3NakroElYm0xg1WHCAGRCw0twUby0vAC4KM2vYO+hFVAKs+JzVIdPRDkJhB1FC7+4EFIJKm1EUTu7aGYvCUXlDZYzveps1eo4Ork46Nlq6rq6wsrjYXnHKbkPxbOr5Hvxh8jbKnKWI/zJYMm4Au1tdpcrcpYNcmGZRBwoMzayGDwM980BTIcpH9UWkSFJeQ7qDUXt8AAKJHfGuo3Z68TQzLivYD8nZHgNaVH9WLiogmtNJwStsPJzV+ctwAZFworAK5aLmongBYK9opOuil8DyyiD5gZwHKBhpXgb5G4bh8VQ3KVJ7CdGEvXNovRyyWwP/C7lHxm9Bcc767mMLIpZ3QcybmnSdePaXMyN2fQX9yUoYXP9l7Zg0trPvGbV30DeytxvqsefCBF7xYKObEIobSh8go+oKsrD3FmcWf1UF/Gk9HLL+gqZsc3yKFKj1T27FO6cYzWRTod5rl5pxNR4YZ7SSTenxEbv7fZKOUIMsYi2RA4pNY0ZQLamhFlGWyBHF8hmhENPASPXYG+DhzM2IYycwnLmB9sgFpYSJeCyK/Ievn8BH8MwF1m6h/8b2xvkHuHO2rDQ04vLqewjKrJ8cxCZB5ErXR4uuy8zCBRdUJlJ0myTEM2cZnSvhFUZGuGWBSnqMyU+zjqofJtEm+d33/gX5c1PUJvAQb8PZNvzGQzD6LvYgekI4iDHP5umcO4VO4c0hibXD45/0MtmbRfZwW2f05Fo7lQk3jovG7CZj+wJSP+nJv2XzMjuuCJMsyVZLZ1c8CUQHSU8lVX+IZIKyhEBb6jw8gO+vhEaFz6/99OYX6KxcFL4paL3r9vwx2oz2VQglsWMSc6Ix0BaZN5zlrv37Oo0H8KmTrDZtVY/AFjnT8KTV4eXNOvFStMFvEyfxXpRkYn42wjTOi+/FsEldE27JyyulJeiv8TPyWucbQbO18LXE3kRaEacMrLo5qSdcdGz39f7GLWj4AHUbvZs09OI0YnHd14ikpRMeKN2VZbMgRgnObr7rko1ukbw3t5aP4FHyFFvmpnh1B7s8vT0FuaFGHe5Sg10m+teNdbpHUirDNa7thhiizp/pUGtvrX/9ZSBRX7a67IhTnAG7GgzdxX1aTcwl/2O6Sw7s4rypqCDy8cTmwHvMAtbW8nePSktwJY7xws2BlY/KN2YejfWx6dPyGX2wfnvRTJZxJnVqfdA2Uj7ae1h4Gzsjqi+Y4JN2XpEeBFMzq//VZm8bLzO259WP2tvqG/Dsr/U4WNd8MbB1HC10stlgZMsjs2sN5opCfP/r9vZt7Q+xPwpQCdraCvXXEospYzJUF05nK/pUtR25I58lYdsHPvmr/ELq1KrYxzlCG7ZHuJiGQmOB43vhIqbc1oC8+kxi7ymFA0xXMBmT5vSW0y4W5xK7cHBaEPFWQq97MXp5Vs7Owf4z+WhC4hL53tV+uAQH57s91cysGFIp4cHpK4VoEzAaF/GADvyiPUqY071mg9zuQyyx+n4uuizmMmX/D7bqtLn9mQFrkHEgspmsMKMUti3qQnduK4xqrqJZky2pqQXl4KrI6W7Ci1u2o2R0xF/bqX/4Eh7DMyyZWxK1daySmM5IooXUEmDSZWZ8wSQb8dEhX237fsEcrkSjNZ7fhRsWSDw2++E+SjbROyneRwlSoH4YpiYTXQK53k1Drs5QkrV+yy7bOBuqmYsdGHx+KzpCpLUOtpzFaJVoBQj3u/iU5Pu7ZKW5eRfn+nvyU2NcPdeYrlxrY+3vI7xyLdcGNjS8YqYXbAmQvhSzYe1ZB0I2bAeVnlzYGIjeN3hxCpwIuXCQPSKb7hBTLZcv33mVk6P+AkTEId0hukquQKHvqkS52hOQWc53DK+QLZBruSGWrfIIZI2zHBO6ZLYrjtyQPyyalH35oVWWY+pO6TrFkZsKR0RT82ag8xc5NDcnyAcl8gNkKaG5KYE+iam+oM7sL9xxtwS7lg6DWOiee8XiLqWHNrb2FYN3QqaDHikywwF0zITdaea5jJCspCjCB6UoUy5nyaagZuJ+Zdh3TusBkK4ekNy8W7q625RiLfEOhaAtCtoXA1QC0HY0un/1QLB0tbfkZh8wn/u6P2jIKM8sNyFArkg/ayyr3F8uvu5kmd3xVLvjlSIBRWDsEm+gMm4AjvTxsm7F4SZgO6mc+nVtDNvDDnWupP503tqkWaRxjmV6CxSHL9Nny9zfptKjGHwxixM28c8IEPJne/8/6woW52Z1O4EdJnP47dhxFIdmD3dHUfjL84V52z5hBUofeTizHw39pANBJEj98LeZM8geNahzJQ2ms7RT0XUD4kX6eFlkHexJ5rzgzADpo0/ODWIRz1S08tEChJyFwyOAZcwzD4dQ9msVEfLzRaGbpqXCyr6ZvsI+7MBbS7R3hZeDaZmL0acrpx/A+BWT9x8+7uhxl/qW8QoGGhvquqpQ/gWx7SsNNusE+hn5mGj62p3zOb/3PG+YRCLBis6r00e30U7bUrUeilmMKw8yGoRrxXYNHSzHYHvF0K+nQrWi/YKD8h8lE90JPiF5SOKgYqIXwadIjsHza036f2Ik9ENBrtFPbueIwk5fVsnBN8fQ4L29az9LgV5RRv0T2QYr0G3MNENxqKgYp+K8ox2FKAO1FuLwg7BR9bHA2iYzLMDE1ArUzNXYrUGpRJ+PVoyjhX9E1hacgrMPdxWhcrRdQK+mWEif/fNohrZvl32H+YrldG+Pdc72bsErYKDzSOelo/k9sg0RkGuzbJOnpUa4MU7CiQfyS1E+akgnQomcFgd3AxyKYwbyshAf1aY+OG6tqb3WVi8m0llTy2GdZo7VnqUrTLSjPc4vXfEBhnR5+nbx2VU4hVww0r8ZFeCqg7Q6c4kb+MEdE9Y2VjqqcTXfN9rAtNKQZrjb69i6RjutNAOLUnmtBvmfWmmLO5XHGsEyactRhT1H4rP+77z5zi0P7EdZiyPA2/8QYD4Q+wUwAjGowc6gAVFkDVFARHQl3bUw1IVsQE1300U3Si2dH/aDHdGccQ8SB5qfLyAERg+8BpqxHyyItgWDmOhAHYYAqwNEB2HnrtoK+p+A3SUTUMYqISLCJJCahpqQI6jpZvb8ZuRcEMOQtxedAaNVsQBVDQGkEm04gGZdoA/p/+nD+iFaYDkcU8j+o5fIA30ST2ia6LI6n8wHWxTfoqtm88vX7FofN6krgJa/cExZtmJsLdUlhjSMrHI8f4XLg4RqMdaXJ0+37FrH58d4T6uzLfJ+Nl96dm2mzo/JPeHavLSM1gmLkpJDNr+yF9cWOtt1KWdP2hQauCV5PZtfni+u9YQ7SYXGBjoVWPYhw6C76HaAN5DYSJtft0Nx2CQLrMZWc3RCa960IeSGULvOJb053MTSWjrmQNqy2OKSHx38hV3O+y5LZagABC4p23YLXaNJoLuS7RzXxPra4rpti4g5IRV6+9Bh3Zuc5nirTeDSoKLQf51kyR8xpqSZiELNJElSJK3JaNKy05B8WoEUL0FzhvsOwmBYag7A4w/lIfVe6wvnx3I13LJ1fKScDDdcVW1/24NQ8DOPgb5Q32fIOLkf0Fj/pn5Ge42PvrZGcaT6s9k6GkoteZDVFIA3HwCWzo9xoGBhta0u9iFVtaL+6y+c0VzvgLxa1Uj9AZU0qC/6SY21uWmCnMpP/YSBWlO/kOmf88HuTzNqybLP6ANt0X6YbqXXHeqlZDgeHOmC3maQ3sJ3RitDjO+vQfi4fmf3t2iAeHZkfNA3ljKsB3Upb7F220BOtWPIRfi+NEA/c7RSbL7syiNd6Ho5bBrzzRddqxZ0PROjB/RNy1Vyvt0fAKlQYn3+qwEVlfsXLMf9g/VHDqQ/vkJ7Gy6M8nUQAxCde1DAtjJQvu8/sHb9f/5b/Wfnl30Ke1sxf//CIOd3bgBCvOZAXMLbszUDzEEmm8rD45YkMQfWnVHXfpdG45b2uY7F5wagcSonBrF6n7b0vrlBn0QHsVAX8MmXkYrKiBUjHCu9+4za/BFayLTdh+PQz0FAnXsqa86dc7Hwht/HZMYA8PpPzWIAfFFcfvpp+ucmPXMsFYGOOKtXwOiQcRbAhOVfqb8hVwb0mOFwJdqVwtTg78f3tc5Or9bqiWlGkcqsn3K4AyxafNTVM6LqVO5omSLDn3E5k5W1kW5dT7vJ5+Y7GQTegYmloMMHoSiD0WzXVhkry9Nsbb+tjRAhIU6rXdUw/LK262RfvKPR5YR3eRoRH9L+3Okittc0qEbWhzccP3jNuHe4uZHVJSN2CmQUFk9rto5Ri7PauwzfLqxteOhofMrxmNQTR/J5XZHvmo1BPrjs5suiVWVWrXI+jKlEFJGQpR+xjEKHUT0vMJLyW3hj106x/E5WTE9U6x0u3DT3xY4jGERUTkcKozrhXgyTfO1iFD547YmwfllG+5DH2rU8XNt+Wftolz+UPqRs6Wv5Vul8EeHsoi2/9ly0WNDa8i0X4n7eb2muDUsEtAKn22XccFegN5suqP5vLtaRq694zNYia72Z6MkH7Y68aqSzMvIzX3zcGjz+1BL9AccGiqFBW2O7mtdH7lkeq6n2MBJxkEZcIDc0EY4LWEUm40i0IvLzUhWnMirmNGIza9cLUe/ys0142P5RbgKlAugTax8YisopB8oxVeV89jWKo42tqf7KnnpWZy+1rkbzr0H5o1Xlk/pKWKRyiAWLEaM9atnGToHD11YXMLYsv/oqn0VKvCaVys/ahxQGJKEKGtahCmHIQyUakTM+EKn861iuwL1t01d9rvJQN8x/FZzymCtp1zHfHBwP+SrWxFIyfLmGXLWpG1ePdPJg/sdDvnI1sZQPHteNwa9ffl3zU1L79VlaLiPaOCpqX24aBErYSpIHMgQwGaiIFVD0xxoTAUMxAdgNaBshsgI2IrBkboQtU7Jd0kZkSw2Col9/sULcfGcuUZIsKaJFipJGyVra1oxOJdYSLS/ihG+WK0EoTWlqENftYlapqgzXOFyK9JZhF9LlLzJkIq2oxH5aGo0vHrejYHHHUxu6PF3pUnlERKmiUQl5oXnwOnqM0k/Xcz1Vq6M5u1VxEkNagzKk5mp+kuDMcJoSpYh0jMVwCVvKVBrZ4TJnyYGrqNWJlPYfYPHbNR0kzAAA) + format('woff2'); + unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, + U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, + U+FEFF, U+FFFD; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAChwAA4AAAAATiAAACgaAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGoFOG5JCHDYGYACCWBEMCvMI3BYLg1oAATYCJAOHMAQgBYJ0ByAb3T9FB2LYOAAglrxtJELYOABUw9YoSngMI/i/TLCNmT9WC4twiJLUlJ4ZsavRKHQioGS7EZWN5R0c4mDd73UtXuPfCFPxnHBrr4UHwI2QxsTy0Gf39Lenq3r2Q86ISI4AhQAjOSZ0cuLtTh/wc/t7G2OAVAlKlE0IH3UWWEikEtkDRouAlCM2cpISggx6Q2QjxQDpEPWDYmA0qnA54AllfYjT7acZJE5FHIaeqe7u0+U7KziYWUlWALgDrKmPdvfAwLqzjB9PmkZnd5LdhuqkDxdVXiog6TaEdf5+bmNxo2RClesqX45FKA16JYo9+TLH/k9n2c4Y3lp3F2AoSuyuqfJSpehmvrRjzcgyyAuiIzkkH0o+AsOSd4NduAcgewNeCDBXTK9PmzJVmbbeqwJY1G14eDsxfr34S6EKQ/v5y+DSHC+Fk2Vg812FqjCRwf9/+/3q3DX76fmYDMlXJzRqNLmIaiISCpUYxXQMtQS1Z5fhw6w/x/JH7TplkV6YVG8o/eNPqQKFG4BHoIg7AwehRRdCnz6EsRsQpsygWbOBcOIM4coVwos3RIBgiDDhEJEIEHHiIBIlQ6TLgCAiQuTIgSAjQxQogihRAnHPPYgq1RB1HkJQrUCsW4d4ZQvijW0IBApYEFgaCsKUBVCAAsxPznEs2+2gdxMUjogI8gGFY4JcvUHhRMcQP1CAnHBUkB/wQnATBCjAAAz4EUBavNv1MSzA+iEWFvEkueO7KE7ufGdnxAUecRR2b9pRuqubK6unpJbwDFz1pVukeILeMDozl8wEPpcurwfwHCqvwgLaMG5OhGX4PSi8Jm20iQ94SuTkvVLk26b+q6b6f99gDZRJoS/59q47jBRbOcAdHn+1DZcl7wZ8hD7z+uDhxL1jztgWQbXj+rEY8EVl6n3aQJ9r1ycB6j+SgTPX0q3WetsrMvgsULTC7GkjQl2xvI52fHg0rt6OkqLgl7RZjgabyqoTrymFWnpWDEcn6My8HrXMGtnh8eEeasyRoTfc03eYvn3oPVylP7Zoss/WeG32uH6B1pfYpMpUmlthX2roQ8MY1Z94JwhdqTtVN/aFjhcECwvyKjsejuCkNGi9rVCdqojjoISJ87Quduy3wFF21gXadNmnK9+FG48yXJBgiZIkS0tLvwWr1WtE1aRZi1Zt2nXowTDkiedGjHppzLgJk+YtW7HpldewcI0yboFnRiIqkd0HuX1SnB4EoXdY4dsU0StRbSK2Iad1RW3i4Nk9+IxFFCWqpwgtSe4TYqFyeqooQ8WlY4XrI+M+8+yj7D7L7a3iJrDzbEZEE6KaRmhAcq8RccnBqbhpJX2CKGoVBq4PjPvIs23ZfVHcDhTPdjiN2Ok3wr4l7hT3t3c9orcIzcusW34rivBB6PdRLVyxauUzjhEWx/vRPGvhcalPEFXhHY/MR3JbMvOWXbbcGuQXpQiP4og2Aqz1HhatRuB7LaoVxMbkgMSlSrUxrZgPn8P1WAhzYy+sjTnRRWkfEUPaLlbB9pgDY7Dy2FM44Gqm3zjjnvC0GXzHN0mcXs/5c8HP8K5+BkfHTWev3d+fVoOHeLps6Lp0e4wrfX3vo6g6awIJuABFG5oOfrrY2cNywsUZDxcc3HDwwCEIl2A8kiHS8EnHJQOP+/hVY1ePWwNeD+3TiF0TLs14tEJpw6odSgdWdBhdjc3dJ5sewYWBxxDEE2jPoY3AGiXsJXZjhI1jN0HYJHbzOC0TsoLPOhabBL0i5HXjGLN3NZTTjfQ5YMENu8x3hD2lWwVjfvtqypy97hIi5KLeIninh7EgLqUJutZrgVw6XCaQBwn70/L7frDDWnkk1ueke9GRMl+Wrygsweai07HP6cS1QlzqdSVVFYpEkSkyTYbWOfR/v2tcUu7CgLw5VUFZhX3VD7n1/AJnvD+w456GWqARDinQ4C/A0WPhAFKQOwCxZVIzKehjAEVb0tYgWMp2nmevTsrVtVQcHv4REbcjK+5FbTQGPUZiJtbiSyK5aAr0DuLQcI6AiIyUyI7SqIvm6IrRmI31+JqoXKx3MJsFs3HA7AmYMcBsE8zWwCzjgEIGWBPY2CVgf+Bw4BLgeuAuYAs4mypVuZ5M5HRRWquGJat1dOkGW3bs17aOA8dUM1adB1y4cuPutTfpxZm3kGJWXReFYNVasnls0WLEihMvQaJbFi1Jcluybo9STylTrxSpZO6MWXdS18/3rf9lmrON4h4EChtU73gAfgSUL4DPwMJbgaXuBHEeGH4INFDPIE+MFz3kKkwZvw6Jmk+9ujDQWhQDhPFq6FJXeYmAyehRJlnBgyvjl5NygEqgwUJubUdr6vvl9lDVXoKc4Cki/G+1BscWNfWy8ypD9lp7IvD/t0JI0cB2l0VJW5WdkjlWNIhsl8YbjaF6p8eeaV/1v46S/yTqoIEZJrjocQz/fl7k/XOSJPwm9DQesceqSjARwlghaR0bPQgmZxKX5WnqnLVFedpVJb7IuSNNzPOJBQpsakWu9aCPYxqXqWvnviwvMCYRE2HJDW9/ZjEQLEcznuz1suVoT2ThUFsjCErgcIBMOV4LVrn5E89/rpj7f6j+KlwQVgagtFSz4dCLYIljCJ2I0Q89ZPIinwJk4hwo4K/NsFgZz+TS/Am3/lkDBqqfQJ+5HE2QN2WOtpW4kTOaTHFvgtkeXW895TMP/YLid1WDFYn5m0jMCSsAnLOlGpVTStis2Qg8D0o8KhY1sASmy5IKwTAT1+b+LEqfcmx3eSdUiVRrd6seLMZEyDoQtuikqZpiYvgkEgtiSxdbD33AXNKBtqZS+AKUnSptpthGIxt/yqTRIJFy4Ed8TotXnrdsCuL5q36U9+q5VRHmUES8NPL8uDGEwwjClagIVvNz1bjexkhDKVsbA0m/TF7rvyHQgxLZcErNDbBPbGZIVyRE9AkzhbY5Y5jwQCbU85Ii6xszbeOIBljgLu007iqHOXLM1gqfvBKaxEF38dPnsi2qLl1mmg3cgtJ2Oqg0OK8XVh9RI+D+npQxATbHjmWxSKgNTz/rgFu6LjkljB76mDjkn2pKPnmU0SRHHmi/ghKSl6NLrMju8NkOBVnGmdpPs5h6TGeGyz/+uEIm0POl1qxdZ5rhIdTSqtZPjwCJar5nhbYC+tD0OfDDQFkmIZPnBcNo6FQk7E0oorkbdAftH7UpwPEommUH+xGjgy5uO7D7HXLJofQAU1pGEF4oYSUVA0qwfg+7a/Spk6KDfRBam5cDV9Br08z4SD5XdI6FG9GVWztwyZTtu1LEcdItKPOUkc0BZT/uaGxYctKWX1Y0UgQL4l7ZmtJHbp96JpdVGOwJamoHSJAJrVCgRvFZOkGLp5DIPoo+6Q4mJuTJfvPt0ePIJILwqFN0ERg5eCZeFq5eEoDUxcI577SvlJ5PJqeBl6vDu8FIJ1lQpY/e22PpiJD4KdIgo3KbYqomWDO9kVdY41Me+neYQPl3xjLR3o1XKA1JWDa78XYbXx9QWIi3FeIWsiBkNJaRO6fJyKfGi0NP2g0wpWEkxOURHCpqNd4AglwpgmkvT84VEJuglA8noTXNkEV/g4uDIRjgSFBTrMsmXNVTVn/jqxTVU3FOXTscEy9+ntXUtKX2p+i2jro/nIctXvBeagks6LIyLNb42aS6JzMsKFVmrTC74s3DON9V4/HpJ3Gy+BuJs/+MMlz7dfTcaUDRzB1c1ZVYL9bmXkr+umTFghMndupAE0hn9HQWrhE8jK7sz5mgAvAOrktOherzNo4hTahf/LgBYCoiX862fXBWE68DRpz2Mu7GHDBJJm3uIfisdyFznRQiVhJQhA4T53lUhPkH+4o51lJ0IoFdHcdVIgiHubyRbA5wvGk2nnM04C9bgDaRVlCogPnkYXREPEH1mLYQBCoptNEExZxB0dO5w46TjNs2pGX9RKTuWLmyrbrt04FXnsv1mwc4Lm4Z0+Dk1g3YnN20KTb41i21PrttXW+tPjIyw/zhYTJi6cURzLsKgmBWzDzkKDBKhUp0g+lb2mxurbVhYlQqEDU1fwvtLVN4beseLLRRlkOHLr7OqUFd87cnvNnNkE5CBNKhbWIWTlqHtYeLgIlJ82K7lLG2+1YOY7DSppQlbSmiWStx5SqV4d1qlsoXifwYwjwnWjQL3AhkJ4YPwWbBcmvcyNcD3yW6s00+zpHUUf+MFFdVkH9lBghRviSrpWsnempfLSjNoyTjPQJum1xc02raNLtbJm5KkooJSxEMQFOQvYgppwG6NzgaBuwEXerwc0u8cELvENbwaTmF4IUrzEVyICt3XYrOJybPxkYYHZHHfWUh58op6JM8LBlYotWXTRG5IMxqTBY+ibQ5WXmpBcO0xHW60v4HPjW1vD6vjC2UGb24Cs5KRR6Szth8GoowPoJn01Sv1n6/9/AWBorzTl7swWQjFqvUPYjX9aM2BxLiUMRqu8NkVpKc3WvLKLE7zD7lYVWn5sLUl1WSExHfeptAZBRjrbGaVJs0DW4K0rJj7SxjLfQaJCKZlhapJoPVLg+47EXvgTVB+HGaUqwCbNEOBcrAvR/xz6R3Oo+at3aL9wGSNxnaEepWYBbSNd05pWAPdGYTlH3sGfxeqfDxMr0DBFNSteyMvz5lxHJNpsVxMvk5S/6YPFOR4JyHBidHHjNdSbOCyypeIN20+1sjw3nRIN5ng7Q4mO2ibqdMkquGNKmJH1XRHEodfwO0N4oA/CRxQHa6qPvFEDqB4qhX6dWyrJjkxHkd2SfeQdnWQLUVsPLXr0ccOZosvIM+bUEzMReP64ZghBw11Y+Pm9Cy12MZ/7r00O9CNPKc4LLMfwxBhDRBM2voAjoWyJlo8u3KHqW0PUXGH2JUyQdNixNi3Pldw9PBhLVLwzFt02Ofg//Byd1ZBr8bn/au/U/XnS82ytCIbQpii4YkaQ8t2wT0neo2oqvTMJwbIzilRA3KDFBrZKaoA837d7/VgH78iNiWxM/3KPVA9fRnd1XZKxvfiKCEN5miDfeLSJ0veX5lvBsQaS6tuyveAhdQZeEsSyUlgKHmUCYmw8EoDphly2UMwFAZQctBTAivCoKYEPVgf+W3+FHd/BSf88HNopyDk/n8DqcE3xVglF07nXUBW02tZ6/JPo288BwnanLU1Tdy1GRpTD1G0KOCXe0vBVFfvH+NS9Doz7hRv0E7lH8SMPw9gOGfoLjB4csJNifWn41NL226nnI/tTGz9HxsDVwmo+bnJZ2JkgxJ92/CIhz+x24cl9RS+rw1rRbob1tNHYODAp2TnLXoxkGkfvOwrgk6uuJTnrw57166eZGljNYy8eaQebAjnE9wzgnHWjay2IRW9zv7LbEogCQl+Mtscm77hzlsQyPWI/O2Z0bhU4ZsV8Ew2Mn/2FbseewXr0YDVqhjC/ZLHny0o/q9k7WTPHqbalTy0SS/PoU8BnoCiwJSn2TKIn8vZsZPvBVC6y+h7zX333FKNjypGWCe/JI/+GkAuZwvW4Ibm55cCII3OiJJA+aohGe05xDi4e9vlWwvr4+mASvQwErhHuHPcmrWEq/KXy4K/udqWvYir8pvGlvr/bn0jKrFoeaaxfTU6jn4+nD3zqyjsI/M9I/cH7kzPjKOwtPwjpun79iguNqaC9eizBVOkoCdh660y2FfUTnFp8Bqan3Cx4dgFeXj3XD0hK9PNOc/VTj5Srg0qxRCAyCY20HtucP6KQy1I79FYNqAfF2In2nKh38isQgGq4KY5BYN0zXbjOquenLJesPSiqm3b6SHZ5qvcQd/1sfWruBGExWTCwYNZp7jr+Ft8CxrY8PjvFy87vuLySX4iwGk6yXaQu82Q5A03xv6njb/odWCc+t474hJ3krKBlM6jg6Se4aLXMd+yOVFfZtJj4CXb/68DXnBWl06lEKP9L5OSEvi3XjmRKoQTOESi07JgxNJMxGV2ZxVOXjyNV0D7WsG+logP/VvlFOx1kdxYE6RBJKbm7Uq7Gt/2Ulf2EfgMob/MWD4mYChxoKK074i4YbpOi4m772YvZ1sCrcX02tLmPcIakeUwQflldO5opVMYBfgS1ToFmlF5uirIn0/u+Ggkn62Y1hgoa8xrehv5+Dzb9Qc+nNNc1nHCO3craqn9O/NmbRrmS7eAbetdEr3+nNX32JApR/XXCfSu9nM8jpCrDd0WwR9QIldcIg2/Hc/y38CW/RPCLNqo0y0CXQS8ovzGflVReQPb//1NW4khFfhGXhKQvh630OJCmQXzlw5ElKTUhBXn+7BCInp2HC7s8c13+caVeWnBKb/+mVf7RF33BK7ExnBbfnpJXQiHs6xtFJaiKi8aLj8hfo9e07HJ518EWI6gaEr9f5yA4afY78Gt7SF7IOULORiSaANq7OX6luOTweZUOwk+Fl/RUqtWzXY0gF/0trQAkO2QnuedEmUt5BkUZ8BvSSop41p7XHwgbDfj48zqOUJ5giQU5IqHvf/1w7CqnZeG6h/7/4B5O0y+kS3/yJ/kLXPopDjovIz0hG48UK8pe5uacMTLmT3POX8uxEBOul+kWgDU3hTBPWGynE/U22YOJyhiqqseS/xU2wL1ILLPpfRcQ1woWk6YZo2naA49X+Cki37qnBPLIPGiBHtWbXjSFD8H0585tcLtnB1SnC92pmx3dL0eKKcrG0eYST76OKjvFcNjK5P7cWdhukBnl7xjgbWPgbBtOLhRyygdgtHw9GEJFWFaDiaMCw+T35Bx9GfRngPrz7Ajqpsg4YaDkcvCxDK5RMm7Vaw6FRctmTX7+L4IzACP/dE0Fdf42gCQhsCccI35ORouA8AtJGPI3QcferjFA3Ooiu9K2mVLqQU6KanREjGPZscRXou07RZPm7GRUiK0cG0f38HMtVVVr7QR3+Ko3GSBTwCvWyt/IKcEZBKbHe+G21GtQ2t7XPxmmBR/iqZH/ZzOuVO6+5KNdUt445beEHHvlJSfi4XMY8K7qZUmcHVhT7fOjNlC1WLJrPA7ul56FVgykYFpjoFxacQZIdko6OSPb0iUqJlwGoSN0cdHng4aJFjlzNS3dMLjYu0JXC1Crnh5BfuPkefc3cJt7F0CQHXJTjigtM0EqUjE8M6Ey/bUdO4HnLPVfpVTY2YLn7PgDAXRz+CMwIiiRpDLIxseUxJ/ZboP5E/Q/TB/RJy6wgLZk2CLCG2FC1RUZMt3sRYtBzBodpJuiKYuPXwLP/FjiXoCHUMj1tkKntJG7mN/V5+fWJCH43KYhte3efkN/YHw7PEeBlNXsnTxPa69kftFHLbgNQU9YHUVeqAg2XO4HXYORx6hHaEEHa4W7wSd098Evd4i6EUixOxELGAVItkgRvmjbry2toplHTod9pky90wu84OZfCg8C1kItpcHX9o7DAdR3+CL983VwSOiu9tT6BmYph4yIqKL0CSLnkywwZSKPGR6PRbjBjUzPbE56PJSc0OSbz7X18FUjv6+fDYGEZiuUdy+QVH/zgy2kBvQohBcen/lTfRuiwupIdEI7lNZdZs7VdDYQAPzQYelFwDj7lleTuxBVU73ttNd0bodLIjfeNodz+U241I/VX3iH46jr48JrGkcxXdW4hfLJLduP3QnKg86lccm3wy/9gyZqbZPa4i6Hj84ZT6hH62zVW1dJSvZ7zme21ChFp6tXNkZUIZqCUBJSeCTZOlIP/2xX0tVaTaUo4/fEE/+DhK4Ggw++UYE3/kVMGhp+9q07Rdw6xkpzUbcz89fHKyzb3qEKLUU6sdb0Q9ELmk9O56uQgqHypFgCvn4NUzLK+dyjyPrW3KOB4utvouDhnR5mwf5Ud/FER/e8G5z+Vu+/A/7GdB7PY4dol9r0T+Xr2TNcl1kGOTnRL1ZyXl7jL3yV8qjCuOnIUVHahSmiw+uqyVO9uOj1ROhUuhUvEycbyJF0+SksLdX0Kdxi+JG6JXkusk86gvYf6ssLOoc7GE3sd6rUOCOUMHJXt+8+foZYhM4rpNndBkEb91mXha7KYEdwDIOMhxhW5JhNHwa3Io/0OPWVfz2dJlHGku2RLlfCu2yxUCRAk3mkumNIljHawUxieOdEoH0PxpkrOHlnhnFw+1HfCm+bRIzCosXr3tJBH6/AExeNRF0onm6CgVOFqVHfDUSdqNBvptjV2zu9O4ydndroCmm6rmquaNNwNoM6/Rz3UmZz50U5wDilPPpQcWJoF3ej2zPjL+TrCzf1E6LsWP4uLOjD1mFC/dYXhWNDCAJ07OL8bb77AW72NjT7Eef03DY54lbietQhrhityVmp75Xmlmz1zNS7tcRZ0ibacKxiiafpLZM1+Tb2KTTJCJsk5JHktv096Dm3+Io3HXjJYm/IxjXDsYe9wwWrLH+KdokH9n4/kf0eZrN/QRfxyhoa/oQdn0YRT7qju7+sb7OHjpRtdEpzNTfWwf/6sJ5aUfVxsHKpqEHp8Zcazpv72mDMl/lNJvklhkhYmUtD4oK32Ontx72s9SjCZAWTQtgHpwQn5OtiDs+3RqWsvuak2ja2aa662iuTbJmrz5eJQvmHdLPbgcKVPbplGzmiFVdzlSru65j3TdVYJMXZdO1RZZrk4rQrIWlP6Tja4CeCMO3pUwC6L3hfxjvP3k4rgDgo4y/RRTzoQi52J8PMUYJtd44UjVYlRLOi5YTwOkvgjraeCCIa0tCpRufb4Z5P442P1mgKKCsqKc8pLgzWB3W/sQN9NAlcuKx+WUtb6ahrjZ2kuSjm+joKjGerFTVvEETkIVByKwjv0n9ihve3DpAgrWFTrRCl6ebYgwcbjqgK4s744wrtyk/YH3z/SinCyvXaee3bQ4w3woeTH/8mW5IeWJIN784165Ij90dAPJuapxZeCoOvogknNF81rfUTjiKqqpOMd8OsCI9uT3MOlMTUEBu6PtcQYXD9/h+3f4Pz6ju/lHp/q43ckPVa8RFZPTsE6oLL6LOJy1cLpywBfv6wqa63zvPUl+BF9X30iLU8EDAQR2GmDma9nCA9KG+9blWTvRHUUTKTU3cjEmOQ9M2l2DfN0s3VQc88d7O9Z84KwyL9ue6CaSTczqfQZPn02MtN3LKR+m6kbZ5wM+uyLoGSfHodqkEEElYqxUeH4Esak6P2AjZxlTX56a1fToz0fbDKO93D2PzCh+j+M9IBf0L8XB1UqcMRJ2alvw+cne3F7XvKOp61Tu1FHUMJxBZVKbPaWiC/nFCaRf8bvHGKbvd0Cl6UXKC3pZUYHp00iv4bV67EuVbRDOubAcdD4/OhUYZctlna0KOi4fp04UhJRlI+cEhp81w1yKROT4RyysFX/rGcJFp6TS79LoGXmB8per+WJKxCjJyLzo7K77pZUbtLJPZXScK1hJHZhpvp6hWd8s3kTR7K9vCpEeK78FlWE5f+bu72wf7rlGwDskCtZtFLr/fpQe1v5K9c82xY/d1c59f0SCan74Toi2o5b7VsaPJvwLZ8eIsWbQZnA2p50O1cxKX82N4avGvejnKqJo29Rnn2bW7KYq0hllfHaM+v+z0pu+jzhtxBYbCDp+qJmmBLsGoWihCddL8FfTIQLE2kTDyeEIE4knx0eNAEaACRiefL5/9fZHQUCggp/cT/7B+amCXhHHN1OlqQhCodQRKEhJLFXPU8Rzhku1e/Cptw6UjuF8n/fm+/tZ9NwMzNFTrvKbsCWTkho56c+Q1ss0XZbxh/tFScI32K/witEhtYQYNp1qz76vhTcaZ7x4uR8NqbfChbvCEnpGR6zz+av6y/OtDAlmAq0ZEr/LSChxm0s+MbaLS1+ft1SZKGb+HlOTQVs9lp5r3nxAYaLg0Q/Mb/4z/EBYw+2cHBclgfjEJ0O+Ab80T+uhH3GnuXzIKxWYBAHr2PBvQpwnfrJ9F99CyHezGMPI8ODYIAhCjHOvxIu1Vlvn/gdR/vxKxG+nt+7UEyuR5mn4sK1Th1dBRJ6a/TybAazomjpa8TljrgL985pabjZTz+M78kCwFbe2HT2nrq4p/5wKdzZrq/IlLXebQxPuf+LAYUy/ojPe8OZAkYZQW/XBCxZXQ/ewqM/iS1V3zgwrZtqUmPML4WqXWLjnVWTmxzdAZYr/DsUbCLlrs1xvtgb7OF+v3p73CO1OYAQVFUSllhPxJVUZlAwyKPeV4QtcITTj/QTP69WBvn1by7emXSMeJ9IDSyjRGRW5ETLq2FIy4FSDz/cChiq9yfbx2dDf/1fQPlOn7dNL8+ISKJRUAK1XbJ+HB2FnHeV1ngkYIXPwQwKJqEh02cX7dKHLiiSUL7p383Ufb/Fph8wS0l8y5RYanNnY1s71d3gm6NN6EDu7cIMUhDSKfoSmacw0g7jr4UHEFanBf59NTP2I1qd5ty0wNsT2BpWNk8qSc5aXG+4+Tqk2ydaHP3hKEQXJjkz89Z8Dxfs9/Ho5/GbHcf4KC9rI0MRKMxhJeoHuRNM1ZujC5kp0VCz695fDQ5ew3Hoa+NtZIQBbk4i5vT8SWohKQedrVrUeTxKJZUM/39rtvI1K8WdN0CqZfYHkMSLA10zHlGATisHkifahFu7nl3Rpt6mim+AhnlxbAYWEJIw6D1n6Nerz2PD6pvPSVTS2tjbX0WFI76KnllEQl693C6ouK4aYHg7MDiAtvEHKmr+IkA4torzdTE1ulXVff6QGw3qFuY6Ow3rnPbRuBHMS3KWQW3at83AplH/rx+X49jcdLIINE0jP0V1Iz4UxGnjwfYfafiPfyzfW0k5rBVWBsqvCVQKCRRuViGbFjZvsevc5x4W5G1ccLPGGPpHt6Dp0k8bTFiFDJSoqCinwftWNxz9s7gAqGORRb7ra+OkkITnP0TR0u+Y8HcQcjw4jbkh15M+ZhDt16NYOLP3Q4/hgmZCzH2eDmsqLny9oONr0z2naiot1iL43EtWKrkM/0HjZLGyiREXh0W9fcXfdRze3Y+nQKViJLcwVQep5G3MOshdXLd42x6UmXS6vn0bG/yY6TjaGBKYjefmoJFSB2ghdvpnfCqyQ5MgnSz5gFG+PWBoiFpECgc3ieWCKzu+raVjkUfkmQQ79PpWWRrPXPJbldOZOYuFCi+SDqnmQfMW/QImjbHY6WAfqJSE5o1hfzXmaWwilIO59W4tub8d2gVhfpRspjeSt62wbrB+AhBWjUtCkiw3NRwhiafvQo6/f02rRzZ3YTjAn4keI1KJn5BBmYnr3H7cSzNnNgX8CMlwpqcq1X26eNWfPJY0WynRnZGZXM5PDQusJ5Ug/pZ+KtEaDcnMagUwAmYymzD8VfjIJpN/xu8eYN99tg5QbHejgRv4C1bWN5LMqXMWLl1N734I8i9G7T/8FfAqjUfLoMGP43Y7CHwJ9If7wYx5w1TPrH5If+sZSHo9yQfiy3Ap9hUKm9DcUfD4mB+oW8lP/uLB1xvo78jt2Ox/1yl7cFzrzNfl1Db1mgbygGoN7sBCx06C3sCRzbhvKew0l/zze+MOSUjIxN3Lt4NfmxLpfiQSqL661aKz+10bkxu4iU44wp3fu7Faz212uBljbIWAdB4tKuQSLJc7t3cMHUe5T1ndUzw/yE82B8uYIUFQeoCyFbJ9QSdUBwKZIQU01PuOKMwhpeMVRxTXUVS/Y4Um740lLJ4nqhbApLkVN9Tw4lK+iqvh4Q2q7S1vp3RodFT5sntizTvdkvl2zvaeiVk+ohjYOK65ysqw3L4dGmjG58UDUuZeMM34C3f462SdEwQHhuAvYt5lx6lFhoLwU985lJdJ2udMyVn8lk/EumMghK24bXIYx9tlRvT9YvpfLmime2vd3kmCSPeQUPLcKIDIjIn4g6pPUKXp8P+NiUBnWe7Qt85OYmiXvTxRBLh5YPlDnyQXyqfwpl1C8LS59xyMjIjqK+X0jcjBIPDQgWljKLq4s0SF68t40kKvDoizV7EtFvJxeFpTxfJf8OuPalnI9lUPlPNpJClR2vI2r7GunQ1s8S3npiG3SgHC1BhtHZGVJ+DJmryOJoiQxzU2qwNJRZRV21FuP3FEeW+R5HezxpGSYCOzUzTrE4/rSt+8MrPgglzmDzy9y+U9lkKMa/qKu8gUp2c1OxCmiUmXtz0B4NSD9hYGVgFffyXr4btmtlVURytaAXqRv/vlhUeDBqaiWcb9i/49t2Ud8KngJSSW0fTDnA6d5InelHYor4+drZbtaYuXhTOV3O2KsgVTlbu6j7eMspamomvnjsmEHzASsy4ppreZHKKkGO4CbdA2ZP4tNSHo6dONu0/WAPlcCrsfHcdcOViBX28F+OpyXkXCL+La96b9ALJAvso4vsBphIEwbfOXsZzQZ67UtazGZUB/6woFnVRvJsaMeDwg7d1CcHFjZoQOUUxuLg3GTUYwQaMGx+vEOgFxp5Obbd+r/Octfp/0KDvRPYNxHVQMJNEIYqBV/h1GMbcz+nLPs7pK/zXHaur4Nw84c1BvHmg8ywqMKr/EAi/6u1ueAJhC97SoGUfIm/joj1nxQGALJ3uax5rkax929+zP7+VPCoHNEyW0wJGf7vfEgl1xd1fH0+3Y8a7uEJ12o2UDXGbHxgajmsmP5DwnEG2jsDuqz2aQZtPUFlUh5bmv7vlM/NIANpgLJSXXYd0DFzRSfSHTzJmBlXMi15M1/cTKtO/v68jTUOQykg/p9Azii79Sd0IcAwxqLM6u4xQ7hOfcX2/45AHjl13hdAD4tJn/+rOdNzac8JxiYDwqggPHEiRNgvp1DiUkHaiof9vFjTefiN3GZgXK1g3nagfxPeKSrzVa1wwkd7bfajBMWg1SSxZkYwRP78w1lNpHIPs6zDQ/pcZd1/eZIHSZcLbjWOpljZP/UmAzKT0VxilP1Ej/8ZgfmHopgTZnKKlAUw4hzFrIfLxOPHkbZqilrKSWWfkYiJUZFusip1gqbFKHgZREUxWGiOEodz10lUaK4zjocltzDQknocxnZFLdj4sOsL47HdOR3BTHucFzDMy5guO3zqI3JyTWk+Vi0j2OKQpZRXaCXgdwjjXVyEA40xQtKWW1EFDc5MTpGzJNCQ4tL/BEC5rpbFCjNc0OV0v/iyx9v7JrinWJ73kUpriZSpceCpsAgjuXEmyOhLNQcnYqTXUXEKGzprmSiC/lPbcwpHkfVZCviHBXUtoeY7wXGBN8UdSaOOjIep5Y2JPMRUpC4p7/fwEviiqlNycXo7ssFslqr5V9Kset4NmuKFMTGrzZ2FI+GatsFJZnMNmp4RA3P6ICrD5xNRWdCw5H4yrzlsmybXJoZ9TxGJbSZBFbEyHSlhbo4/lLbytyNr8LiINdsIJtSrqULUkNRik+OV5KslNNciNzL795eKqssZO/3Jn02x5L1fNrCflzAuAM+AXuAQ8AOYBRwA7gAHmAY8MlYhkHANGAVXAMswjNTZzoAd4ArxgLuAdcMC6wALAK+AJ+A96osYBZwuFzb1tzUlYQJhA/gk8kA/gHPbGwghLzE9E+eqQxCN+m/83T/Jw7158MOQgvCZAwI8KMswm7CCFzN2mw21JpYr+PO4QYNifmAgwHeLghOdrugcPMaiK4fyEJ2wVCA34XVAZSHyu0musv8BYgQxJM7DyGknKRMxewgRYs/wQY+XPeozY8zRa45wD4ZE2UtmMtdve8qSFixXCgOLH9OTxwCUpa7UJ47BrHZDkGCeWp+urHifFWnnLWk/hTMYCf2oD0YIgCOkomGc8UAD3gFnXlwpag8qGAly5NzwX5ga2MlerRddpWBG047YUdBGdrDYXUvLgA=) + format('woff2'); + unicode-range: U+0460-052F, U+1C80-1C88, U+20B4, U+2DE0-2DFF, U+A640-A69F, + U+FE2E-FE2F; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAABk8AA4AAAAAMeQAABjlAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGmobllYcNgZgAIIEEQwKvFCudguCEAABNgIkA4QcBCAFgnQHIBsFKRPuMGMcANsgD4qiYjAY/JcJ3BiCt0FdjAhHwWJRoioVqofQRAWsbcdwTFm4VHx7x170Z4aVJ4CJpSM09kkuD19r5euZ7pndAJE+GUSbimK0DOUJdFSEZVYuUQf/gOZ2v2AbOQatAoIgKJWjyqKqDZxgUqXQG2UOxPhRwwaUKqMwkjYw4J/4e2Ln75t5u0CpFnBBkkJAtNf/mqa7Uv9vV3uFpwBcAcoEEDXXqrQi6RPJxyQfIOEBsBN8zYds5+hm/L1wwAuo56ZGGuaybvxqbFuxZTAnS/sRUWKK/v/rLFvd+eNzxruVdjcECkLRJR12VNX6X7Klp28ZB/StIdKy7fAgVGHsCSpDCOn0KalpkqJqs1U2p09R1lEH4kj3W0SBhy50MQwQBdH3fCHt3Pp1dCIqInIRT9TM2ddeo9VlfSrbhII1+69FgsELwGYY3KRJQyhQglClCqFJE0KbLgTVAYhDDkHYsodw5AjhxR8iUBREjFwIBAYYAgyBAAkYZBdFuNVrDzmD3J+MxGiQ+5sYEgVy/wKSY0EOcmRfYiyQIXgJAiSgAioUVSC2IEDK8+CApWOshcOMwwwvT4zHW+EPE9n4O8R4YjyRc+wfj1/mMOPm8z/EQeO4zTFEkCJ+JCgTTAi+xBeEMsJVwiZxIZ9R18jhLPQE1MVJVGWrZxJziAVENnGEuE6cqhzx+/Q+kvMBhpgMOIC6I1IXiGI/AVN8lDHxtkVg5NXlVx29kzHyC9HfNU2febXXfdMGiHXGGOlYTZLlwZQGK5yhW7HicNFYFiz/Rm7fe4KmMxsrLhYbutMQq/FYm+9xKbHieyoxe9njc6TN73vdJ9SXHHMin96D/t6Cj01N3eor0kMf4IlPSjRwVNtipfVWOirsNjJyeSCuN9xREIdBkJ0zH8p0KrRL58eljZtOP966SHwllwdsk9dKbQMfCLBXDDZ/u4WuY/7Oly3mtNfrXYMVX2I835JLjXnLOgMbcQXEcoPy6UAji3rTGLWMUiwRASF2lxFZSXwp7s5d9akLR6PmioFRKE2stwzVDWr9J5AY2UnGLrLk7CZPwR57KVKiQpUadRo0adGmQ5ceKn0GTFiyYu2Ag2zYsuPEmRt33nz5CRAoSLBQESJFiREnXoJEyVKkyZAp2wlSdjZBtgkKrVPqG9Ve02qKfuMMW2LcOJPGmTXOvHEWjbNskHXj9jfuAGADO3Lm2kF9E9eE+NYlASkXTOu99JZkKjpWlK0pp2rlNolgZ31k6/xaDbLspTjwUF+STTwW3j/RewqtUuo71T7S0sqwlUiNCdoorijeo/SKcvuAP1avSAeRDDJZtb88QYp2Sq4NAwJMaV8ZTsiCKSqjWKY4PFFuL3HZ2QqZNshOgYkUlVJqDWpF0EQc/7k80pcJau8LeEMH8gTCFrwteCtwUe1deNI+3pIBClN8LPtgXx854ROESzA+iXhKuZMwn3TXlqMwSt+S6R3ZGcn3hoIiRT6+Up+Y9pkTBYHiPIrfw9wW1XiDRbzBayyyRTKAeQO+xL7gjVnAqS9kGXEXzG2NEP2WstLvDFtmrMikYAZzWJClQ9aF/XQAsIEdnCkJSKH0O5CJY8ghbFy6Lq0N2RzhGBBc1Df7UHqwNwisQnIEEqPkvkidlAGcuCAPgy4y7ZoNpmJyUjJBBSZmzGmk4ZKBbJyQHG6ifrIMaB+H9rj3gLgMUCEavWWF21r/k6MSlTiNVNwycGITgUFLUCLT1jhxmNZ6UsqetRCWsWDoNdv1USTyXaWFgrqBT9gVRs041Ev2TXDdNrn3BnZ3lFb3U30INxwjPL16c21//PufBCwKv0PxslWGfQSutdwzgCFPiAETpuTLbRdMVxsDWzSDD4taQ7xkZKMTR5CNDBzRq2CJEtEnU85mw7Ju0G35mcF3nQmRgwSPdMs2pO7Ddu1yFB60LfoMWT1fydP3ahn/QSGdCRsrYweltp8+6HhHuRAyMQlRDPyhNDYe/LHXGIzC8BNDw7AxM3gxDmQcCmXBQHVxUiQCQ2BjuLdKAkbgxY0HHgGoceBHxIdgleyyo0VLg/vwO4UgwggBQJx2OvDPGR5QyyH0QCxeWB0kn8wBACCTdB6THVEfCZ/R/IpsIuLCYQ/cJgQBN5vhjNNFAAEypNd1TI5JMGkmfVVpkFgXW09f5+upCB6UB0UDpOn0odY/hb4AVH/PMXnD637aWYPJwM4fDfwH2P++UIEU5CkgLyzMU10KNqzAceAYWIiOsyxHQfs4MHluVsmW2S775eLcMVM4tkCGm5dVs1W2z0WZucr1kVhDxvQ+/DN/aS4QhIduBi4/0iVedvImzWfb7X9+CnQrg8gJtnvvSb7td8CWcAEUb4EfPUIlynch+RZ4aYkMGTGWxIQpM+aSWdwSsmyyajrR5NBjHWU57Iij966Ri2NyZHOFVNqFia29wg1dGvbaboH2LBh8DqTjIG0CbIWswM24AJNgnOYs5qNZiREsx8okttlWK7DnvHVz2/fhIPFyVkLickBEfZBc4/N+CY/JOJtRWS5CwUZX2TDBpaz0awUQeeP9bY8lNubIafOXxWIP2PLD1G9ZQYrbLhwnT24t2+YrXm7MR1WbpXHCl7rWwPO2xRIHEyYP8a8wPDBmGLEp+fwyKLbNpSwijnJiVPRV74J1j6KBeE7q0KWje5YT6ecLbIkUz27p+rNl6/6jfxNaEHVaiMag54wjx4jioQjLMLmRQwzHuNDT7CBoIDmAJBosfost0e7f8LnyqhAl7l5J9U7ay42+DTqvdepWct6IdGKfLFYuK9xR05+i6UQ8LX0LqiJWcswFzi/o8pyKSzCdYvg9de9vb+CByFvsQFDLS/SYWE0p9JxJug4afNN9UgI2GUvEHGuQzOrsDcRGLkhTiM126adm7GYOrmQlf1zNyXBN4Sj3Rmn0CtHAjLpPJoTtyQNu9PCqsMhkJi915gvHU+PgfrG4LrAVBPVyxQ109zdYYePPpnm+2CK4ZjN/9jNGuaLnqXzZc5bVYISZo6UWcUzYh7mBa+l3lxxV4ZDppzseWWu5RufVQakjF7gsKeeO9XBsRFyLjp5HoXoccbS9Ws1iki+WL0PZXuWoMsLGhbdtBwciprdUuCjZL36RDJNaSZnmHQy7efi5/1uqyB5ZtIuly/aGFUYmVPlsxeSQS6qf/wIuHBQ4D1ZwxL0zqcWS+K/qSDI66UjCEvZzw8ddYgRcESv325ovZ4qWRVnS10/kHsX8vBFwb92iEJmoNHkbgEQeuy2AD0/5BK8W5GUjrsidxbQ/tWEdo9rlSlvia0fNf1m9uB4yju7D3KG+yOdIcxI4JuZ0F8/m83xpGEnTWuogpuVfTClRXpm0zCRl6qVjWWyvfeiqcyru7faGruoGE+2qDrg3Rt9fTly2dHEexPGMs8vkWrsQ5r84woqy5tT6YFoB0z4lVh6FJsuWW1vGg0V2ZNGW1q7KV0zneTpW9rAnsGHh7IQXPkbPiKaSkF5E1sRjB+SXFMI7I4vCUfhaULnG9OrRtvUOnqu994Ex2eqY07byfIQ0/J5cNJLDvYlDn9uwstcq5TEW2TPRWYlMxd7fT6/GUsz8f+Wu4Ol/g1A0Oxiyo7445MEQ8TUM6vAvpw/XKW3+owMpX51Y6cLlhYa9NJTutLOTHCanFs1oueVK6gUV2g6db/JYRZmSH75ocFqrKgOyVU5nLSmf5ZFvssuVtQynrXfvVdnPIZL+sXrsUUgSEsLf9U+JnBHNw6qyYiu8z6GFzZEpIp6mxkX2vrDqsBGE87jKoRCQxDJuySF3MbvkgFqNoz9kEq0tNDYSjPScGEnzteUpCsOwxM/Wgv6S6iBbu0J8y4bKAp+/0LfFinGJPTZkUTZJWS9jS8RJfNFuTYFE/dhUoERlbPF7vOId7q4H+XuAZ97DhngDnsBPs0xd4kp724hFfE4jPlgwGD8ceDrrgfR9Zpv0NPN+p9jSzzZoBzzz2bfvd9mhSTVBe1KkTt/Ovvfv5UfdNm7DkxfOZhIkjM9LH604Ep1+LrpwO9gcHxF/L7H5HaOdoJ03XKRBYlz7KIIRXhwQvdJSXXF7jO9P/rf7Ip0NF4u2XQcjTGMa7nltLeCZpXWTU2lgnw0DjS8a2YBnshNfJA5A2m9vEVRvMAcI45tfxudXnj9iHzl9jpZWUg4nQZzRcfur7xOPnRz9aECToyu9B3Eh5o57jFfvt0d9Hf6gHYvVpTumqij+Ol2+LLAvaZ8pNCK0Mi+T2kp0kScRE8WmnBcvX+NsKzSZ7kOwo4LdN8cEMRtRfyYkUNYwL+YvhOtRh3ijYku8a4NTxMWfrjUeF+hFZ2j06gJMMOxPoUwBntLPf7uTdaEgb07zVnozPD7zfDFEJ0zn7ezzx+OvYQdjoR6RfQnyWySH7NzrDY+7zrUD61OXS0BSYkJQbpA1yyGx4p5bavckC0tfLZd1I6/nuVV7SFu/KHZ+6JYUAIcEnglIrUo3Zv59VnB88pMQ1uY5tr7z3tnAU3bqpvFup8YoSUPxlU38JRK8hLxTF8AFpaIPJZRioo94ZkVHgWAX9ZbuNkO1sp+aRiZmTt0UCcVYLW3IToQXeMrVH/734kzhc7Laf5669M1X50qekdX+osSulvm8/OZnDzvbnuWdaZ0H0zf8P18rDdyPP0xCAb/QTkyLPzd4940sx23srerJ021OZXjH0ku5NROgulPyYLyjqD7DyTbJPvfVrWu3F3vLWIeyYwJDEtyszSPMBQ0vuTimuxV/uIrSHnrFM/xRnPfZ6MSIo87w4+rS2bkA4Wjpmd9lv8tmo6UDhGfgGy/f3b0Ptmm+DuZ5Jm3BXSHgG35wZ7B8jOgu5SHgcPFSio4+TLjjyh7q75PAA3jFJVsOLiwqC5RyZzMYJdzNpemVVgdt91vZ2liDOZ7SB6wNlDCPgT0ZTnKUEQjN37Qd7LekcD6sUclZ51/uxL75hpRXVxaVIflN5U0VZ5Ra+txBfV0k2AwY/8jnBgs0OVuYv4YteqmlthJ9wot8otZSMeb/0dm+Y2pFPMfgl4YfIKvPsUqAp4CYCe9Od5lLpwsR49oEb46gSI1PnKs7BnQSJ0388hprc7Jrqs8gICKjN5LGDox8jYHXvf3w8QVWqWakhsUXMKD7ZovLr6A+PzO58twZDBwIoZCZ9buvba7MY55NDoxA5elcRnuzwh024ClVdeHAlfYBXmCErTwKwgbC1JObCVH6uiLfYrbue/eRTy+wyuHZ8fQuyfgV1lVmZ1Xl5yHgnRDSHyIUygZMmk9EbDDPlGRsGOAF+iwfpHwTvMS9GRkAB2hVNVXsqubqyuVPW3evvaWlNaez0+toaW/uXpWgI0ugZ6GQ3Hb6fPblvHB28tFbb0PPrvMs3A3Jao5VAZetNzLv1ou/hp7oPcFOulGVV8sqTgcDXFfd9WJM+REw32DiHghUnAoUoDwQ7EKYgHdeFgqnnJ8n1AQKrtm8lNLs1Ujy8E9X97Jzx1d6YiPUg0/IukvitGdBJ1dCkgF8lRWczS2VPFwVdETmHuve9lby8pfgsq3gIle2bh9hTQf3LLx/MjK/2C8exgrb3j/zeejRzKe7wLkR0np85/m3ruwpwKFcJs5H8grfcUk49vfKLOaFHhek993TugkiQsyMNhj9/upOBcbDmIfXGLFS/o1mP39VoIvwy/Ry9FzCLj64j3x+jdkDeNELnm4yfgWKeedMs9w3plC6KHv5EGolsgW97iCsAf9GwOnJtusXixquPOJBlgzrDL+NCLAqWqpFrwwIL4pgPjI5Wwo0B4sH8zUwjLbvEpvi7yGmqc6ObeGoL1MgPBg/MuG9UTOGeVKoTWq3/9HSdewVtZ84RInFSoyR36+NAp6ppvE7h1FfAuJG/DWMUpBL+vt4nfyS/3zK8rOcogWS9Iany9/iH3vPiQZYG1cdiT+Xtf2MBEOOcVv0fEn71crT9TebyFcbhs6crR++d77hNtRSW+beV5Qc9Eh3kwwQTs31KV+ofaSyYKWenOhi2/R9T+kSTnUD9w80kxrXGlnUK0CrMLaNOscrQr6G0s9No0ZrRihMqaz8suFEyGZg1DFDm0FnaMrTn2kqPqRXwv3H2Cj7qGj/K19OmvJnUFqjHEpyDwmkhVjezv9yvaNvsqlyv1uGvUyPcU/5uyvs7tWbNbft8uIjIo8H2HpF2yahNYM9ONDMoaJUVEhSQwilosLw7PGpJywqaygjavDVJcKo2hcw0aRSWY3xQmX8whVLdNwBurkHyaab85/ACGyui2AtP1BRAaG3AtnCTrt2odRlAHRkZYRFZU2vTKOAoI2rjSxqCOhjGVEMlBFccRqCiHzjWrdc/o6i05bSvrfHtXYtjYndCrCQvIS2mW53uTkmtmHB5nt87lWW8Vs+tvnh0/16qp03j3dnUl/zFxlmnpgH0j0qi75KR+nH+WdbTJWhl3U6QzJ7eGoU6TdH9+NWFrMzJMVZIBRMpefRUfo5OovqbAJUEOz6J0+vGsJzdP4JkUXqZorYLWS6u7Hp6V3WUJPp76RKgfCESB/P2MQgBFzueW1HRc3KqCy6rmYl3NCZkP/XpU7cDCo64sr0SWm/Gxw5iVP9IVmVujlz+mzX0stWZmj+2dC087e4GiqqyniKy5ngEosTnCVyDE3x7OBcJNVl/Xt5umicROabx86iVBSV72qZF2c8f9DR+jzvbOs8GCRTqaxmkf+MR3zsMNnYusiy510oPD9oF+XvDnJhnGEZwSCniUpgMivuu2Fouy62d1QZOvCWKNKsw7yl0sMT4j1P+cnaYFGUUcW4hl6TAGtaUGkawYOJ80lrvRsY+wKzGyTqk3/M5pbdXJ4nXGESwgtOhtPOM0k1ZVVlpPqqy2C4Tq2RuIGZ6Cornei+iZltdBBuFhCsfstATOlOzqRDLdwTwrzdGgkCIcnhrg4JfoEALg0r59Fa6evYMWZF5Ryrd4hzhZNFZbXfN+8u69Mk4O8dRh/D3hYXt+gxfYWVhZfQS5paa6vPQHUKRoM9qGCmJYrl6FtfP5dH9ihoyjT+bGRRfxmgkGlaE1YQdtagGu3VZbHoPrW30Zo6lNXYhAv0jXR19o4Av5AAkXVx5pccJGgR8lhWMDYWBTxzWNYiIeEWSOd3FNSZnwmt4u/xpb0Dzt++gMvpH1avRqouU149q/iclD2cMZDTWnG+oO5wnEdFZmTI48xAelyHwNSHCmxi3sNjAzl3quhVjVkz5clgKPbLuIbzTmm9FxT7HCcHknVJGzE0d2rT9PyNRUwvDL2Q6b4/iPqb9LrL7j69Wya+Rn6Wseb1+uQDvEDz/+D3t1nlz+72C61d7eVfk+O/Mq937OTVRzDzEIDWNvcQM7Bkkvr2p6ifA4mwmVQofgXOsOEp8LlUKiupSqYUSVhAzE2Jk0v8ISWJJGhTe8VrHzXGzYiMR0p1xss4GB8jM4oUMGw23kNT35gwE2HiUqz7Ajn1AtCsv4cnW1+l6C8T9Hek1V3bkkI9ZqLrxxeIa03HLwTeen5/UnvZtU9Ms0CH+2FFW/niM/6DmtxWf78Az0Be2xJ0gNzTmrkF0onCjGlQbd9ra/X1PC5MnaBMnWj/ZaXtYdOXGW7FbW+5fBOWXYKPraXwD2wHzUYdSqcyta9LKm/s/aTDCzdtj88cqWncJT3gmxZTcj5nWz4Ta1SD/VN5wys+mkbe1z9L1Bb+HqyZmUoB1J9g6fr2rQvaWFe+8qNu1M4H6WC5F92gWj337/8eTB6Wfeey8sWurcxhYmYIy7btimHi80eAavaoIVx7fuwZg//EiR0AvFkeKgP+Io7/Nif/myapdpKALgxAAu3RAW7Q3WC1/D8gFjOno904eYKdP/WCMt/2mYdvXy1pk/fEXdpfSm5NJK3Fab9/t9FsqcuNvnlADYHeK4N3GsZTzBjyeVbkP5+if4p4zRF5I8Xv/KRwBgkfdyEvmqxnU/WJdHySdOwNnbsFezZY1qeY2oeh49IYbRfmcmm6OOpvc9umn/126dh2KktgcxU57bxrm6nifQrzzca8FOT7Refi0TdY6Xu3WyvKY6IFTIna4+XCTFG+UoSGzH3q1IyjmmmguEtqp1ZNq3HmyO8TwdOrn9hD2E1Xc+sUz08SV9sn9yOyEXxPzdJgKhMeHw/ziAbtvotpeCb+eTxZkKZTpPhD1bS7dGIV2UUmgdbkfEzjFRKBWOSza7DliSY70Ptd+AU2n7smuwanAuHt4A9VeaPnh5AIBKISq6Zws+6q+CGkST/H6qWN4MsVZQhwQyFhzvCs9HSZjTmCf6aOUFhI7gLbAXcwgpvvwRi8Ipdj18tx7WA8OekHc9iurpKXMxbzr11kNIoQJlwyKeofxqQmyNqiuF2PFnL4/WIFUSbTBdEZR7VMYlWIJFaJUlsFU15UnMBCshCpMCk5BZhwNRIliZCx3lDepkGHfpCVOjarKA3hzjuKR6VCLI2UDYpnCrIoRKo4iSFUKGILQ8TGpKSqPGQ/c5af4KElpRh/kCosgIgUbAIAAA==) + format('woff2'); + unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAALsAA4AAAAABWAAAAKbAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGiYbIBw2BmAANBEMCoIYgXsLEAABNgIkAxwEIAWCdAcgG0AEAB6HcYyyEjO2Dy0eKLv4XvfsrGs+wIhEBOHOERRRTI2158fc/aln0WYmSJq8uTRSIgUyIVMqpfa/7uYHCqzWDuHREj0f5UuuL+ZAokTaYgiIs5sF5aUutjO7QhBlgMaYvCAIIqqoCggoq0+HjRlX70MGclDLyR3Z8fb0q/ectzCv30obmLesvO5hBhRhcp7kToaLpaRXpL0htKmb5C3rIgzUIwA1fnqrhHSbqXhA3v+sK1wRtcWuhdyg9E5tGXERkaAhroCGeNqCnJxAm6m1Sb58SICvFhXFWnVAAWQoYRjYADJUQQqIYm0uSZKkfpYv1sv21dm9b7kWbV6i3BQ2Z/sOf/hl+ezXH88LRz75pnLuq4/MO/Zx+eyHc3x9VDn3yfx9n1ILyusq3ps75y90fVZ657PJ2iXgF+odHbvzv7Lrm+uTsPR0WJqYcelN7180rHDDnbeWbrx0QHht49uXjCzffOsd5RsvGvHe4yF5o+Ej97/ZMP62+Z+3Wz/08CtZ/FezhpdvG/nb6PMhC9vNvHFx3Du9X47etewROuONg4L0v2eI+L9X7dt0evq+gNihfvWttiuWK4f8VmxWBM/+WK8b8F6Y9evfLf57r9SjuA2URBAobPm/Smni3y3+n1TqgQEACsl5awAI/5AetjNp65A+/38vDAUXaayPL4CMKHYkEFC0DlfIlbAMegyqlmGU2eSTO58TTHX2xLyWvlczc/wY7eDo5WxlYenKyMvNg9Go5MAatqis2Jty2oytLaPupFxOlsgFObsjM05dBxMHVwcMbeFma4xFh8jZxUr2e62Th09I7Bd96I2RI3gzYzqKcsHjqZzGjsamlojTwdmCy9bKFNm7IBcudRU5BU09BQ5eTm5coMaMAw==) + format('woff2'); + unicode-range: U+1F00-1FFF; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAABMAAA4AAAAAIkQAABKpAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGmQbjEocNgZgAIFkEQwKqTygfguBSAABNgIkA4MMBCAFgnQHIBtLHFWHQtg4AAgt+xD8f52gxWG1uR5EatWEsKGGtrrROAfbhgbsqkcTXk+8cSb2t2LbKz7fybPEC/ukeYa3NyHy/D9ptl4bLoAhSAAYADqGVSx0WQHh8fA07v9/zew9c855UgO/QqKTM9GVxCaWLiSi/R+i08U+4Of29xZE90hzRJVRRI2MqR/4UtI5wcAcNqPDApToUSUYjSpcT+QXXn5a+zaz/t9buUVDpmsnSVyZE7W9V3YRW6gkIqFwHZOEz8yZNyAkBtwZfVEjWAD/BrYL002IehYA///at/ruuWv2EJXQqGQIjZBoM3fW3rxv6/Pmr9n8VURk8MZm0uZNVBEb8CpidRMVQqs0Ks39/d7Xgqlu7zjk2DtDHDX28bUfHg0KCwA3QGEkSBBCijSEPHkIRYoQODgINWoQxx2HOOkUBJ4+hKFzEBe4QyBQwDZgGwRowBZSlGAuvdzKCWRuiw0LAJm7wrz8QeZ+t4ggkIHcd0dYELBBsOACaEAHOg5XQDmgtY9ggGOdJj4KarR21W7Qz/TrvSATe1mvCVRcGIQsiPhIjudoTloJ9TammqzPCWpOKuQ6axSCCp8HA/KFIYINo9VM94B67NppH7YAxm/eIPgij8SuR9/C0+8g3w7F39v8Khj8omzm0JiaZ7l444qvMsAnstouq7pYcvKt26TYqlOZOp/mJ234mjCY7oC4/Q72ir1cq9LY7kUvhugtCr+ZRfcFBtgx2lKDfxZa1hkGB1THTUvPyMzKyc0rKCpWonSZsuUrVqpWq56+kamFtY2tnb2jh5cfistNTLY41vTWc0Tlt1JiorKd6v7UNokwHGZi9R6uH6IMq1ydMgn1rlpfRdJRmagylrRQ9X8wSrX7wf57xx+gdCNMI/I+t4wYHQHKxAGV7JALzIgsitkVtyrpMGVL2oas/Zw1BTOKZpQsK5tVMapqTM200xmXh7ezHie8Lvqe9TvhfxYvsB+ZkbItEy9nU8F+0X5Jt7I9FWtO92/3vM743vO/hxLpkbIrk1DOthIxZQe3B689vg/+D1CBNZl4BWuKtouuAZWi0czWdTk4ZkdOQ2FdrEOKceLJHzd+0wWMrsyKIltHLuRXgyFRKyTrHWXsjlU/FIkacrKon6Kntufn0ETrkHjtUzZx0OTqC6s5ahb0BMBjGGDX48uHpcSXF6uKK0JchdfXpeg0wFjTPqXa6SsWQFiDFb6Luektmdq8Z4N7KWCGjUUnqNY6taI0wwYMwVS4D8YXV8Vobo5NszGGXZSBIBHg1IxjKHIstSPR0KKPlhFHzFwyLuwcF3GBi7rSqWIQgkywQkGgLEkLqWlaJt0CsSUNvS5YEjCWsAQUMwYImNwr842jowi8Y0JM0ECRu8FuAChFDxQ923Z0unuLcwCxjCQA8YcZJC5aBgzsP0q0DIqgBEpsLDHu+aMk8qmWAwvGG0MDtMOyI/ED7w5w6K5Hip6vuNrWFPTiRkxM+Atw56KsgxjkXUCePcgnLgYd7oDlvukRcYy33g9gg0YTz0VG5AUpyNEYAzEa72Oi/hVP1PefFflRGw1BicF4d5pl/fn6M0AiIr/QgnXf9XgDCB4AABE8gAPE94GPX0tAW0dXUMjE1EzY3ELE0krUWsxG3NZOwl5SysHRydnF9cxZ5fMXVM6pqqlrHDt+4uL/Pd3HoagcekDvhbgCTP6+eLs90q6MoH0XWoC+krZxS+EoCYJFlnB3fDNhsjLv3F6rHRznZNCbKlonoDXRTkarIDSk1xxI0hACMNKSaDkhRJiO8/HtVemw6+9IFsLMf/H6jjqkCdNzYE55UXgcEqNlGh71xtqjUT4WUtgMhAUsBp1IQS1Z/FgqgwWjVjmi+W3f/f3MKgU+hVbE2IjswKEiAju0NnCsyMZA2kupofZawvnCLDaexe5ahpUONJt+mt5el9lAKtf24NHBRs6rzUOs99eZy/8b8GgtZY9MltWmGGuqj+p9Fg9n7M5yyy8gvzv8NNEfh0dgdBjGRnFpDJctsFewLwYJITYh7PBN0BrrYwbxY7/h0QnPSolGWtH63Ue/y4Z4EKp+1e/Kt4/e9xUUWRKeRdCiB3lzJEcBdb2ZjENDUI400MCh/mHC5jzQvUVwyqpzwwIoJjIWK31xHDHkUc/VTp2lebQ898VFDAKRlbHESclgpk5H+xb3iviP8hg4P5KLcqj6lG1B1KtVaZGdLcf5Umbu77GiUrmjP5L+yG204DQDTJEXhbzQG07pacEr9XiMQfxkxrYhqKY4rzY11lJf+JFPKTImoiOXyHnnZrg5BR0L3d4MduY6f4S5Ar246Lkw5lRVaT1wuCWp83bSKgdeEHPftgFmimisMyfUZvGLuxp3hlw0i3MTEx03iOW+Ic3EXcoVrwRk8k2qJWNISIsyMjKGMSK7fUxrNZ5lcpxFlebvufLghpowjgyFnLLWmsyDxh/UChbdWgt5G61X1rjeMh5x2yMGsrD48ScfBTnlD6yvOH8rk5YsyosXLxnL7PnxlMo7l4Hy1a9w0eUVuQFmw0navrwA8XHJL1Ot6PaQyD4MlRkRrLHSt/9yWN8BF/hpYvp6lpVr8CjHgFtpvfx47sCIA9uQ6DYk1JjXevTO1RRv0eRL1EHqelsRLT/g5eRbJefedI6L5bbPYyLm1kVzqnMoUbeOqubEM+Rsiuy3UzTtY6a7GqJ2x+yuJZ6rOkak0a2y+3nqY5po5NDaJxkb+kp70Fj05xbbMG8L4hcnpjUqbgqjiZ5bo6PDUH2us5/S/GLntZp13empNkvqa4E9+m6fcRm6h9UEEjanZT+VYOA0rFyaxlzEiIWozs524XDLVyWK9Pl1fl9ah4FaFUOaa7luwJI/mAPtbNDGicZR/xiXDklopOMBv2gyrXdXex9Qr0QP+Z7EOLlnlX/v2716wJK3/vx9/2Zw7lmfQqRY6uv47v/z61fvMWl7dsllN+NoRXRLJa4XXQuISQ/IFgIdFCkaM1tZCVhyftWHsWiwi4cO0hypHbDk9rC5sA6ILo0FAnUNr7eP/Db5zbpWokwtbhUEuMnC3XVr88cFez/J7iFMLc8XHivhuHLyN8amDm7M3b3jrBXu5JGPTxvY5dVPZOvQ3iU/pL+XdwoZ8Xufq89w/+EThnvZeuOtCPoNV9PLt1yoL/6/3os0UoZYUL/B9zSevPLvsRwOjNFRv7lUnC2rzUlLrC3PQnmCeSTHGGA52vLb86HKG+QMEy/globeTcxSvU76nFz+ODv8bhE8x4hTU6IeuaLtoumWzMCpCv1KqRw1aiJ71bdMOCdTffXPXFr2LJvaX+aqmJ8L6XkzpTvxu5Hu+Z3JjMzbM31P781kpN2dhP2fbF26LXxG+Ey+G/gWoHE+jwsIuHqOGOD/SAEXGHBtecGA+xg+Fm55l0f0aReLUfB36cIuJN/PtzMbbwTsFOR9Us0Oe6Kq8jgsC1qH/UcoeMrg+YyB+S6mNaUNYJnQfRxuFwIiPKnNnrQpulJ9pjhRb4jlaIWcZvvt/QdyXuT7UsfJznqArbDiL5ADLVQ+tgR7OmE8S5u2vuGwd0N7NwePjLYynPv9fCvaVC5fl8a/9jwqLk1+KH6c/AaiK+or67Hhup8rP2M1WAqqCsCODTpIjOZ0X54mWzgYaVZlrfyXvWC+YJIzWjVDUYRjUt9qUJCW/aOiKuvH39Ra9JPOJz/RJ5X3C67uhJvddHmJauw8Pvu6o68BTf8M3TaAz3nxon2g+J9F6yCouTOW8zyauM/cwVZ9/Wg7r4qF0EFY5WGTR23ztbPDrbqJAr66DlggpQmUCqI2ktc6vji0/VgJ3a+QzRG8tV056+cVrX4rmJIh+aeKVPO7PFMQ9SyxJlrdz2umkgo6VLwwkm7DSeVJPbDIl64j1L1rXxY4YqVb1OoeItSwZWgYP8ntTHlk39jq1HQvuWAJpMe7OzanHp93K3bFxSkldiaOfN8deRF9aYgC2IaA2KZRgvcN75Rk/4DCTCBoP8vWuZRcWp0QlV4XgCoqcY65FgX0nOz/y7TwPkcmKQu8XT9bgHnsS+pg1ZP0pBNIdRH+qounqU4ApWSUCdMlWxr5eepG7hyNzGfm20202RIYdxlCunYFuWYwLbV6oDf13tRVvtTaYRBWsc5ziwotC7RvLP/7unf4GzmfMqzvKukWa16wenuQ8v1pVqNJlqd/SPI5i5qj7oKFDSxoHSfHXLyfVuNFTTpncMWe76upHa+Jqw1i5P/A4LibI1XdCWekYe3qrXSuJCExV/d6oZDBtRLgvIFnSIku72991A1DFxrtU/2J8RcSXMSt2Sl40JeI199ymJ/esURrjGhvWc/PbRqi1ecUpU8u39xPTU7fX5YalZZdyf2BydhDloC3Gy+vG6yn6g9FxhzmP2TEgM151z3aVuySwHNn9V5JB2yxpoK1tZS2s5Dtih37MuMoXx328qaPNW4RMsvhpDTd/5JumdXeztPWSSVFL5De8tqQ7AoWPaLUoY2qn57PHVMtgmM2o46sJW5F/Z5+lK9eSXBu7WAhLlI+sfhKNfKamhssA6acpIosveN6+n5+EUjJJTWS6kvNQBpj8+aQn+EP6O/P87Z1hRLpKNSqkK3h/+gMTznkPUgp7OwayZlPisz+WA+SYzYtq2PPnwQlJQbfKJt6JobRdU+SdhOyvWwn4n7HXNvNaYXRRNFYwZljS+MbfFAoifo5kQqmz0hCffns7BmxmzMpGVP0yv9MSeTBp5R00DvBIf+qeuJmetWnoYc1I+lpVUOgnV8XXpzkp0gvn2CpQbgWkQe5+eeLUoGrAJ+iNpBQ/+MlZjVSrCtkn5cWdKY6++aRiWLwZ/vXZfVf9+Jprrt43qhJpz969Jx6m3/YL+1qaOJCRsK3wkNxOQzXSONrr3rurtk6zL26j4kGDqDWjX96n7eT+hSzFivQGbnFixZSoefqaxz4y485zrlK+Yx03F4m8TWAkBE+TYBmdyh0iRAQ8vAOrkkdakPq/Qmhi8M0u2kCXcmHPJyjqs37TjtyEbUx0c2jqpyiyZtgmhf+0oHuDvKeutM/9PXrR9NGxC47vexqREJuyZ1PIkz8kzWvKEXVDd1PL1NNOfztk0jNacK+mJ78gm6QMKRZ+KngTnB1NcNLFvXJmkjayKXi27Rkk2VsDGX7JAs1Tc8QHOUvgNszUqrugx72JvUHBw67Drv795tVuNp0GyJKL7IBQo+uN+81tuhD3xu6vHTGL+QOQqJtokVIIXcILpcXgUnK/LFrW4HDX3TT5beTB1r/GaIETDHKldelz0df1E4ihfLpdfNpsN1NNHvpb/gsMZB/CQcw8YB+CgyN8yUADVvYm2FSNC2Ph4qm65UMkci0r3epgES22xM3L/qlEKluhrjZ+UuhtjtNV00kwiINsiMt0iE9MiAjMiEzsiAbY81y6HBVyBmoUWy9dbYTKD2Yr0XWr2h5rlg/oxWlCQI4NnPOWI3yuJbLf9Q58iIHcjPOrLZuXI9sE8MD1GCYo6H/uJorUZ++UzRZd6xl4Ii1s+Ae/gS82P1bbJgTAuPg1C15kJdLdvKYYzkvKm3QHph6tVrbmOBiOAwb8Mfc5Y/6oxlh03uQ1fufCXA5uPge1uPHcvgr0B7wDdpxXofNGVXbg358YQOfgBq8KlgZ3ofT7Nu4Gq/uNy5o62c8f/GsrYyeeB61HdvztNxNt9jXF+2qo245pWWT83VGKGurvyDxznOvPJY2vTevxG69OIj3OKdWuFvQaNClgedPvN5rSot7RCb/lIAA/fgek3NTiS5Wrf/p+JcA+OKvoAzAL83hv5/zn/GV6jIcWEEBNLC4f5MJYHUVFPfXgj5XXY13W2TwtHBbA+NMQilHrc8M9eP5KB3n1cDkz9/6LCNe1GDCVC+1utfTOYo1v+SSOc7HAvE4wytTlXUe+RkelmT2KhmFdt5wZg2jjugI5TN0qGeumPHCU7q7xqOJ9UhzbjgIzSSe2aImUZQz1ZW045HSAjNVbmaJ68W6Moh0bPPKbvJBWGvUcrVK7POi7FHLdZS5PIvFJUlsGtTUNGMx5tfIKPnxvE52XGmPglod6sU1vGujF1f5HGi8dZoFMc1DQ3NrXKMRyDd5I7/kieZBc6L5GLOyvpFHEmqF6iTJ732AALfJxsMJFgKwA3SoE2ggwJI3NCRXwI1AG45gcmk4CgvCxuiwMYaGY8mIGU4Ti1CVVxZOFMPgkNgwPx/fCDF1VbVssJhpsMY8wGt08yAPZaFfgYCgQ7MMV5VXeK7CopLyVK6oYHeGCIKUT2S7cAOlC67C/UgG9QblFo2Tmk7cJ202gUvUXU9OCF4lw2ihDIiQXHhAwktVwWGNoCL8amGvIJ8inPdkZW5obOMoJM5HlSraakb/CJ4AAA==) + format('woff2'); + unicode-range: U+0370-03FF; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAA2oAA4AAAAAHqAAAA1TAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGjQbhlocNgZgAIEAEQwKpzCiKguCFgABNgIkA4QoBCAFgnQHIBsPGqOiVnFWWRD8RUImd2GxGAljk2gcqPUJjX6sRnWJIw3uCR6ILv03uzO7gQrfXeBCSq30KiEFfa2TEv5Mbw7wtEszkukgZUI6op2o/++etP84lubf8X9FzbJCVahWuCRlnD6ISTaXVKgpMU2KIFDiUma3cM5CAO9TYmtx0+R5cq20u5dkNv+cR87kv6onZPvCFF2VuMve8aZED8QKiF2Fq6okYMcadRWgdLWuFVrja5ge0Jp+eZyjhlmj1Dj6/FaEwCAIAIiChEl6BEDIiCgIcdQhEBhAABCAAATgRxQaMFSs7OYHSm0HE6mg1LEPngJK3Vpnp4MSSNf2RDrwgBBEegAQgAEYpMUI0BoBCFKRQKDI6pIgIa0gCov/+IGCT1qA6lfABv0x1N1O17/1r1GluCv6q17tAeI7Oj6jQYbBQ79pLm8ttupnyKl18VD9gdtyVL/0H+V9vVrv15/0StKCEEg8uuhjiDGmmGOJNbbY4wgZhMz6Cwa+xKEOkMvpM5CHYBhprq9DOMnoQhBrcogNeVVtqWIS5U10RjuioKoP4IvNd5i/7BJL4OYmMKEbYOaFDyZGoC/2OyDICAUSApCchNKV5IPMwfkO85cHBGBZDUxFmIHrUjERmrVs/cKQEpACckBumhzQPxetj27KCaIVBWqx0gdEaNjYvE4HAzAmKaxbwJ17lFDbkww2wgjbYoEXOtiLDQgDWQEgi6tVwpABTeTkTG8rB8JAt9ufER5QLGGKNEJVJIlVYtX13fXT9W/YFq1BGCJEqIhEsVKsuFa6frh+xc9JxwLa9J72DvB2fj7reannM54+yd7KIikOgX5KPllaE0zyFIy4cKAUYNwF2QBQPQDTAQDKLE3YYfYUw8ID0ZOAhRo/dr1wkebt8zGRjuUoNGOLCbZWTAeXBdla1qLxQ+/rW9IMTMKvlWQJBkIZgjL86fO/PdTzpEf8xB+r+duvefnrH4yiETPKkEGeJxsYe37P/vFSk7t6Qni4EPrdJftzKewFwtWCacRnOedfdRMNmxAKNTsn6Na43kdvRIwa3sfoex3ZZ3JPALnMPgp2pSAkVbFKbIeyQHwmbNpwVwiqjh7/ceslqcxrF6rXojf+leic8KIihlLCGavY91EOU86D3May+x/+2j/+38b6ii9C2Bh5VLNppQKHqegUdR01i7DQRIsPDLrnPKtp/rSPhT4MdtlwqxInVbaj6gANEgS6jm/c0h69hiqF8HYzKblTWlWVadWIMlVnPjrEOoNgs6zF9O5yV+0mOkODdf1rRElraARrybSCtdlnmXA1YhT7b/lD/h+hXTls/Zq+xnfW16W4zAshCUiV8nTXsswQDadaM1XchmKDvU2MP7cushlqHGCTlzHUULp8J/fIdXPT0aQdLDzMcNZ+bG+cR/hNG3hryBYiabqUjJJsvkqsPFj5WPCFUGd/94Ph4UIJe34vN7jyMmaQu9TMz3HmRZ9CeU6ZeAtgtNOMqTTgg3/ey1UmkjgJCTcpeX1Ym9qiMxGnPRvlbntO78ry9e+NlDbGBsrHy5aB8swZvnJrIHnHUJ5j1Jk9d31GaXvGs8g6O9tEnOt8Y1Y5v81bV9hmZ9jcPiLQq+kP7ruY3vjW9f8bruSUM0GkVKqtW73PZdTDYNmv2QTy/NmRB8u3LY9NLC4N36HdraEPHoS2nSV9LDQod5dioxZ0ev+nwLn2wQqh+JQ47Vt3FG1j9OyeqXOQ8n5Pw9YUIiuWFptA9+7TfbTxgJ0rKebEj3nRjUN+JTVeEhyR8GRWg7ON+0ZDRPS/H3MfPZI+2iAZi80+lB41xw99KvDPAWv3ggsTPF7LPtVbuFjbc4ka6R6lC/sRsWpI6qPpo6+8z2C6PzZHdh2d0maiZ/5yvQJrLqbte6HXgnHe2a4g5qSJ/dAw2Sz5rCtX924lIUWpKRASs2LYnyeTZ9wLyecNXD7ov2dTZ98NyZea7LO5/lbStKm7Z3dtvJs0eeYW+Ud17Vp6aduek5w6lnzw+7lblZbxJxf38DmI+2SOM9kKPm8X+CiiYsD8dC07ucq2i+ueOSr3BdKd4Zm/4jyqnbp+6PrTiKAW3xQjywKf3uTevaYVGjdXs2GKWQq1x1g23wLrzFxLzrf7AmX9tmz9uHhxpNViDHXG3SrZagv8PmySrmQ4bF7m0dNZRHuXPST12ZQZFyZOxuwybUd1y1/JX2XynNDyoX+eTpp5P0jv/wPPurNpU6dvJ4fs3Xhr6pQjN/z9uNbHr9WkjpHLnmvH/Ss589O8kaGK+f+/lTq/Zu5pbx9BHT1o8v68RGPtRYUIR0I30Gn3xa9v3lznXB/Ht+BeaI6/O3htO8fUnPwFWHUPZ8zDnQz6rx91G0ILi9/dqtRWR/zyfEOtroMawiP7uk3DQ3MUrZALlVP3WVhNVnLWaqZU3eo8ry++oWXN2m5sVObELzsPprNravGCYrTUqntD1sRa/2Ldvca1SlZN8LAq1PT+4p6n2yMa/W5huHVs4/K54eP5w2En54wmCra7enrTMm8XR8NVb68GjSfEiXvprzafSoaz38TNeOhwEZVlzU3hFaYxhI6iBVY1r1pum11oWwbf+SaNn2NPvCrtTrQ16l5ZxZnorJG2jLu1jdrQSkqhJR01PUz3/UVrjnVAY50nYmXWWOookdhuWLVU1UquFoXPhVBUFS2XyVlipeU9s8O9vF6d4hWsQHJFb3evzJlQM8Z3dxtVLVMl4SQLJ/m6uBMxswHVNCJ+xNRLX92d7Kgz6lcp8uCcWHxswbGRS/bLb1huyMnEK+Mtill3UqgsSv3z9clfafiZ+M+7tLfFw+epGDEwADbZ+CqKsIiD9CEAU7RDlxQYEiQRkCBLMAeFmcwrWWtaSOdkFUT7868oLPiQJAFg8HUpEuQYKl1G5pTvBcacsoMQGs4RoVVmEd7pX2QRnBCWgRHdbBbJSSEeGNn9DYvihGDyj+p2fftiEeOUMNK7jRjEeqhm0bwWmiyaFv1P9zBaMCwthvcjZ4d0MNpjSXGUY1GwFmtXSwq1WNuajoKxv+QgfoKL7dooYU65R/gwp6wihDpoFViZhaOZdCycZmEWGN7kXxZBu3AOjGhhs0g6hHJgZOIbFkW74POPanGd2zC9U9g1ogJsCRoBU5LTjGtHCLJpLnBJol1mCqyCG4g7bJA5WIkAkAfLISswp+IRTswpmwih4TwTOpkW4W06gZjJK2ENeXQdEDN5LSQhj64jZDamQhYOug6IefobYaJXBdgJDAGh6HTintAVwmxXXLKov6i1qD93mFNxiHLMKTsJoQ6eCMMyC0dX6ahLsQJXRAb034KFyHtAvMBbsJQhrwQmeIHQCBEi2slVYSdEIS1WlyzqLyot6s8t5lSoqMecsl2nUge3BVZm4ej8zVGXYtX/cAI1iBXsCL6ENAndlphT7hIYc0oXeITj+wB8QY5wCU5OO6OlxZhBfiU/Vuh2ADBSL/AxXjQHoJw2F91187W6qfeDMcTOrZeB0Up9IEl/kvO2HLX6k3lXvSUY5EHbCCFvddNjAQ7vaiWpVunuXW2+lh55IX2DReV1R8LlQas56YC+IEN14LV/sLVX3M6jTZVxt408LEC7+lBJ7j42HjabECTxIC/k2qW6ySbvVokpD4no/UXWwoDtM1j3sMbB3G7qk88b+0IVuWo162+YdFGnpIHJPiPtv7Kls7WXPOw32rqy7nZ5PQv2g/jn4EtAPLEqWePdIkqVh/HyeCJRnWLAGsUaSs3TpYH04LGO7UNYd7Oovpb2sSK61UyCzPe4PiXq0sCnFF9rL4pHebSpMu520WALaO87ZOv2jY5oC1GhJFZvsXc1toyxd1GQXCVps5xXoTQpx7wrzd4rSF9rUTHEkrTtVkRxq0/wuIfVC2phdQ97F2OLhL2r0+VMgnGfcketktGrTI80e28RXVARyj1W6i1u72W5aAECMCLTflw7uEUkd8nfPll8AODUtzS5AbgtfH79N/bntq+ODwXAFwMAAXY3bwD4VhVhbzU+Nl+UTjEbaQdY/P9LUkWRkI1sMjTZpcoZoPLSKM8TbC5FGoMxlSGkybG4ZSnCxXemyVaay87UmqfIaFQyVJ7FLf5jiSoFl7NprmaSJL8wyTzKJjOZCvM4Q4E/LYE/Rc1uZpiTjDY/0MP8qVvKIDqbv+hsrmC0Ocxoc5KxKhxmbby8AebR+8VvvYyX5vo4WWRtCIdq0PHA+8LbbiNi/W1MOkXGe8p7Y6TCCfGJ8f3l/WsNpYSx6VMytbftRXOfrKBa0T6w9rVl2NkYbhBgCjPYUPxgvFYIAgMjCiYE4EMHUIT0BVoCjgoCaEkNgujS1Yx3lUAVMeRTCwfDlxpEA+hUIINMCiBIIoFEspFBDx10vWgZyGQYkKSCJ3QmnVi07LYROXWVT7KTwtrxsACHINc1jEMLHzKIcXI2F1VMIIdUooVyQDQBhSRnemlZq0wfY8yVdDfO04PmwIsbh4JMzND2QJ5dS2DPHO2xIn0cLTIgSNiSSlIsCSdd55lQ0MYNZ+xxxANfHNHUkaUDyoLpLsShAA==) + format('woff2'); + unicode-range: U+0102-0103, U+0110-0111, U+0128-0129, U+0168-0169, U+01A0-01A1, + U+01AF-01B0, U+1EA0-1EF9, U+20AB; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAB44AA4AAAAAQKAAAB3hAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGkAbjgwcgTAGYACDFBEMCts8zA4Lg3oAATYCJAOHcAQgBYJ0ByAbBzazETFsHAB5cO4TRclghIL/MhHmoW/sii3JkCwIpmm2o8EQIDh8squu9JqOff+iQjf1biM+8RcrvTvece45JKlkeYjs6P9P9XT17F44fIAcwUEi6lMpFJE7/QM/t95fEYcIjIqRJjGQGgZRKYMR5URGpCKegjKkN0A2mNCCDHoYMKLNwKrDoCz0CH8K3PbrMABNLZi8I53ljHbl084I7Aei8kMtYPer3WN+IMvTyAlb90UTgh6oaMK1IYR1ivIDcHO5B9xTY1F62qQ9HEIjhNkz61vW+HudZavvL020NBMd6YD+zjgKcU/T8/TARaV9smT4+xfkBdsXj3TH3j2yfeQ9lg+03qBvQ9wBwB37GMoQVkRFd6mSKiXg9FinbYGrFHUTCLeqqGT3nsNGZAhuEBGRzNzvNV2uwkxa9CB7bxEPBPBXjjr+TggoogBsBgXLmAkEiTmEJTuICAyIahsQCBSwAFgAAQKYR8NumL32cfYGrTMzkhJA69ykyHjQuigsmQpakAvPTqKCGIQoSYAAClBI2A5uRIss/4QB2tCGlT7mCjUsgAHDt3LvJ0jCj14kSvTam+zU+y+Pv3Xvs/qjhVs3rWUVmnzdV8ecFzzauuRZvVwQvh3vqs7nLOxrfnPeVW/lOV12b9eqk+Az827t88kw5jsvffR2bnP20BoZ8VoqomU/ct6gJfWdrimvJhU8+eSwvFEuy+boVmyo2m10E1ZpqUNBlxlcaNg77hmfm/F2Ae143UrY0nAXzy0JG8mkuz3jZ5n7PxO34COVLwnYdbzneR5KWCRZ04BjJ0acBFRfYD3oqz5taBmtovX/F4+w7l8gQpiLECVGrDjxEhxCdViiI5LQJEuRKk26TFmy5TjqmFzH5TmBrshZJcpUYKh2DksdjgZNmrVo1abdBR06XdSFq1uvfoPGTJgyY86C62667a77HnjokceeeGrRM6+99d5Hnyz57Iuvvlm2YtWadQhzAxAAiwv20gVOjr6V+JlFgCSQjXZUKs4S58m1TGSqgoFAy2BJVtwLODKzaLk0n6AsaosBW45u1ruKoeCKfoUbebwPahazPbl0I6BHR0GODBweasY4TpaqHlDQUDDTcdmLiCALg2Ofha0WmzraagDkKks1OOEAR8B4JAr6WAfrY/0kI6iLLqXUtIyYQNGrJmnB4eBDnQnMD7HwJTA5ws0lp09SIkJIXkYrVQP0TT7AAqLvtk0SCoo0jJ9++W0DAuWyKxCY2wbcGJaPrrdHCSzI+9MAxKo6aPihqLu0kfR9FKykbJ7Had9D3ezAPEB1OQ7+B+eMNQUIkEcAdYfkIiBA/xVo+QpoyFsKJm4E9mEOCxeLY2loxrbQC+NwCo8Ijeg4GseiOMqCE9z4FptFoRiXgFVCeVflk8qryv8hrEZoJLQTLhC6CcOEK6r4zU0CsiQkQiu2h36YhHN4Bzli/KT66Or4u8gekPIuyrnKK8p/79hAaO7AI1yea78A9BjQo3rk2YHcD67eNPp/d9f5yg0ApsV///hqs2MXX1Fe/nj554UB+PkrL5yetz0//5zz3BkQYK/Pfuwh+CwBlA9LzW7VXsdQ5M7EwlanHsd5DRqZ2XvT/vbeZ79RfBMmTZkWJVqMWM+98NIrV40YM+4HbwgUQajeLQb4PyD+DTwGZrcFC78DxrdBvRfcPPTLN9umLdRpAWXkfrLYdejNrDbOng5Ojrvp62g4XHBUQRsmpHTc95NTokBwHxx+zu6jj/fToaiqf3GROhhTTEdiXY9rGW1LM3M62r7dkNaH6VCdd0X7eJs2CSX60LZ6nJ7e1UjqZIzWWV3tMeY8R7sis4d3aJ2k8Y79yZ7o8J50d7J/X7ozMiYxxI09WsecmfjcAa2VOmKOaK3DMEzTfWEY7j+8Z7fZQ0brODb1dF/90G51iQ6cio4eaaSSNWV5NVobz1ZxLZV0mIQLupNMSvdP2vopbKd/uPrm1BfqGEDBlXqWpHr+lENpf9pWxFVCbEcnqc6gLg1Ig0xSTQX4Y7Gm84Ki+Py/W5Wan13gh+0rKkbMpNAkiXUWchLPUzgqiTqCXHLI2F0bKKXc5VsFzYWJsRSpJoVTTWpNfDBAqBUlP8KwlBZSu0x6/gTu+Thhm5L83VjTozrvn+wK0J2k0gxx8d1+H9udNveA8ionCEr+6w6VTo2I1AZb4oLsMnC71Lof+2jn54a49toCh5ZyL1w8kya1nI3w3bVcQU1hi+casA2ljg0oOFVokRuvuUIhdB3jw2pRWwdccR6UCLOVeqSt7OGu9vfcpS4YiKbou0Rk81Q7bU0YckF2YxHzqMygngMbnTw2FwGkvYouIO+2OmQz7IsF5isedr6UELpy+ZuJZMD3OppCv1thaySckOHR9rk6lofOSaLnXKeFH9oImmol39KloaXX/BLPr1Bf7XzAldWt4jb8oMY21MhATsHCZir5gV+A/H3ZVWqz6uQLY8SRqia10N8d5NTxhiMknl6KBAyknZl1+Hc6hoSspAF2yLrktDDEEUkP4S5QZIJL2zx/pMsOH6vU+xbjb1yUFBsgbaia+6GinJ4Jz1NyJIKQi3qinfNSH02HqTDpSAbpRNZKJmGa5i35vnqEUbSwvZFmidKHa1PR9s3e/aBiy3eRsotyDm600fJQFB5Rr12vIA2EkqXPqA3/rYWgQTM1301jJa79AJEBbb/8fW3jQhGAKOLivlWMCTJwEwsDGSjiachUryUHmeJmhikioksURIEgbsHLKyRzMC0CmaFFH7J4+Gv9t1AxlEjLf77WlZCwMHzIyVVTAID4ekxNCTX2C41l0YYQmQ3kckt40p0e8L1vMHsCbjV9PfM6imxpaIRYq9FJPgBZADAOQ36u22ubThyoapr+X+rjiD/9NgT/pwIRq7vjre0EMKWEbw4Hq1oYjLWWKJlgO+DwGGIGexvcoABMn2a0cUDOEo6xeIZhGkWWkrYmUCMK5jSEN7e14mkFLcrJk2e7UFardo4c6pUjq/4XrvKAnvCy13lAa9MoD1P+L50tGb7cVv1oj0ZiLTewTP3/WNaue9+2uEZDMSaKg0TivITMbkP+Uj06Qv48PRftPIGYiTAQdA1oMSaKkLFryCvJipqJow3GeJZdgSQsFfKBXbI0r03OoXcWN/lpLiQ8xsMMZG3HYRr1RRId5REk0WRPGxKcrqUM76ad+dXnlFXe5axIrElK9DNqZIqQdcIVXj1G2DVNQ3GamHnfQqCjBxio65aOpZDZFJKql/XzWKiHbI8QLSIZjgfqU59tzb4h0OU4YD+Ido+KAw8WPiI9SAql918AhP3oNIVds0D4y98j36xRKFug9vWwMSSL4kYnrZtjFcI1IAFgdo3z5AChfSF3Ax+AySdHl7ZkuzzoyNX4NiZ5138FFAq9TrOOR6comDy+InOZQsFkhjRrGQBaa1eSinE7xANVwaCnnbFGVtehpCB40iCLN72ZTMpbi6CTfrVfE7VdhqP1qnSvkc+yQhv9hZCt3kWk1k04GLU+we1cDZdOLP87E535CsKPJmphHMKhxnOP3fmf7/7zbgUnXilNKOiL2XsrO7wga0ptktuqdo872SP39UcruBy/Lv9O+fcXlNERI/p8iYFQY9cHGZT0G75sZ/M5xtDNrRtFnydleurbSxR6oQ2w3HNX1VvYhjATcp1tqNU0jmwxlEiZe/Ydv5l/HyTuIbAfxUnDLLJYgOWWs+/cTYO9YycoJ0YByz3FnlqhgMvoiEOsYAy3B9/MMEDmjjnox0q/kfqgfG/UkKDGnxIFSFt/ThhJ4Oja23nUioF7LvA5zziW0keTniXxIe2nbQS9fi5f4Nbv/249Wl6cGc0pKMxLK6uEUyDf2D209L8Fb5668WFvnlaD9juIre1h0WoZfJCX4ipNNL5Dv67mbSxOUXpzrlzpbpUE2Vhb89ukfTc8nG/0zGqvRUePgHtZ2/3i/QIt3A6h1jIT5Frs7VIL4faOLuHWYvN7VxH0DclLAzclUevxG7eVecPzoqg/cNXZ18XRy/zVd8Hn9wvKZvOIPrEi10s/bituLc/Ory9mghb4FHy3fXG9qkPixVPGJ1rufAb/3xZG9Vl29uEARmZc5EJmeMPhbvzd9wx0En36GP/fsaqGKk7W/cpkcEiRuAtYiRH78rzDjgLHJu4zuAbYJ1tVvyogyMsXVx+zOy9yGjo62U/g1ZzCyPYOCfTP8+LlP7d1KY+Lqr/hS0txuyQmNKWp0lR8smaXNJY7ChF3sx4/VqGUqoyqLP9ZPAWTWguWRgnxTZ44+0cRmOYyK5gVoNT4uA7RfA7bN41H7sne+oW+wjYY/tjnE0ZLOkI5SbEb9khiTPilXrozjG5YqdT0E1uj+50LULN7Vuo97UcLg315lPI0gYAuTHBKywSFuojRAhU2bf1hfsXAt0cCnV0CMWdPxRbVzI2qX6qehYOav/7TGblKPb6HBzhoF6RR86cuLxn8HMINMW+c4rqzlj2rOgqYt8AZ/xRPWFHjZP55evb4nY9SaJdFdF3PxJnwfDd9i0S//JsStLlE5nnxMmVRAXp+DYRq/v24kz9FLRRMayPc/rl8SnlOIfmGUlPLOvIZzDMh1GOjVz8ReSuDlTfzuzzYX7xr2vOZt0DSazCTMemHypvnLUByzOHDgfmhmi5oHuCABz48Em9aWftQQk5gVkI8SPaRBk0U9hErfuzZb27pdUlCeTfV0EglPQh4a7T0bOMFc8JT3SkvG8fvpTwCH3dfBPhGEiYttXDutUenoUtHaGoENv0eby45NiknOj9TOPr68OTS+wHLGmkeCfB9JGx+1rmZxP7ukSBQqy7777PTxYtixP+3sNN/vygseypG/MMT7Gt+RC9qejrd0/qUfrrlEeygVTCIA+Y1wCP1obIDS1qMroCeqopToqesWaOXK8395IvBrqE3VyqGnXMPhUce8bOzirWS3HfBxzPdr/T9RV7edFBiI5mHCT6TkBR71BtkU8xxc8VzdRaG5haELIY93iY7p/JM3WTxJA70c+Pjj97q7JuBiVHepe8zd21YeB6JC9b1mwnajIfvIzHEaHvE0HsY+EbS0BavnVvHd1bCZ9Gt47umFPa8jNjyVM1ahIE/GOOkGrH9kKyGzhyYMjKYQQWaXnLO1XtOAM4nSDshIXsQjZ07R/JtoP9Wur64HvBT8OIfzUpQ6q2SLwurSyzGxbn5Guju/hUmqHISUhKBJkres0B+ZYzlDlb14u+7Mu2lJPg+4ukzyk+nwQIv5HmQa84Wv7syEuM1Edb5fnl2VGMR+/+CYURznzllLYyublUQSW2eDgskum8ZMM5T8zoSeCBDJF7hri8ksfm95j4vQ4paLnUwWa86F5/7xB/KjIktPOQxKFG83HeJ1uVJ9Nzv2ukbe/s9fKQ9xHV1Xq2sSHf6ciCflX4gkWHPcpD6/CYZKTzk5RIbbIjeQ6toFzsjr/LvyTIAfNoy/7w4U0wN2WFfnh25MFZtzs76+7ygJMZHzaEimzK3UDFkNEam+vY/tz/T8iiyb8CX6tUVY1nY/JgHjhO3Lt8iHBPl4fuFFWQKVvGqLpta+THQdtc4e8okA5+zyOFDxlbjqy1eBU1fJS2OLYLPMGkYri7EX4uXPBdEn30+LvJ+90eQLnfCeeXs+yP2sGilJ3fk7P88H6THI1l7s3b3abih2ChrG14Ng5sUF3Do1nZe7T6PLdUu+wpu2u2+Gxcn8mpizWJiAJ9MEqmmdc73Dt5A5kQamwfPdby9a3dbnh77UUg9ltPl/u/uYRLUX4TWrivnzbwkpYsyDQYX62EIr7Tf3yZlTQC1qrDYdMZ0VudsMMvvgw4l3c178py5VH8zq20RI/qYqPb49mvQQl+YR7W0DNTsE99S9tTKwjY6GHOh+EI60nzxEsfMS1KqLGDvBfRY5jy45WHlkyDUUrEPrkfcLjUXvtDxraYmFBec92+LC24v+QKsX0GjrktdWTuGjszJIf1b7o3807YCByi5DPXr+van26RH2PRMVH9jiMKhon4lxPpbHxUKLAEfjntJwuSC8rrb3Jv8f/JgahV9W8oevR58IO5rJX1lZXVoGy46jorrcsIKsVJTtEsAaW9SeXtbd5UZMWfO7h1SDiprbk+37PqlUZn14wE9A25++Psx+RqupX66YDgz3j678KTY6/lwRoNkwRb5nIJK0Iv4Ilxd2VbRVi2yvjURFKV8Ktvqhf+KH/ktLswC7ZMPMhrLRJrK05m2Tq4Otq4udiB4z4+yf4RqKbl+WclBwZkpHZkZQ5kZjj66llZEPSuLcEtror6FDRytTQz0tXfVMxVJt9kVGBAV7RtwsjrTGAzePk3IPBm8o5e8r0NxB5uYhYtPLwxRp4WaqqrsMrHSBs17m/uh05agM/lIhwE5y7YUsqNdWKidbWiwg3NYiK+1+gHbTfW1ltU18bB94hFUOWJslFwDtZxwsZXVUT77XNychcEWptdSfvlZWnEqOMOckuqS1OHUCiB63HdDWdXsC1yEWkGWSzoxDwkVRFm35zSj88/nsLAD02ufZ64u3ukeiT+adTj2eHUOdiA4xw+d7wU+tI7nVc8r7Fw/jO1/z/4w+uFR1aMK2n7MqDu6GDNiuqpnRi5/jC9fqNjdy0xL7ddBy9XFQOjrC/PWVjeDygnbPtXF+IF3l6eQWUMeYLkZc0sj+P5i3DBuzuEldbTwDJ1ZdaroBDIPJNrdT35P+BFP8qtat/NvVS1HvhzyefnWLxoW9XKpaqEUaajKa1qt0cAnyz5PehVOGCWq8YcS+Qnq/N73y+yiKj/mHkXOGCt9K+IW1lBafu7AuD5OpkOGC7saSV0to+irITznYxFpVLDi8EiyFaRFns3+I1HJkNPF60H4jeMdCDSakkb1pphTB6dXx5pc96cThoeXmOOqCmPMt3HryVYDBuUHK/czfAMCOjBvHL182P6wt0li6YC7WPKsNqtKvHu998mSmchr8RjI/pUN5+Ikg6y0WXjdK+sCcjosFlg0oCOQW8Umgk1d7vHigavUHqbVj6MFjCK/k3qYVl/+4qtdQWa2CvmD7uqRdwRMktYgbwZ5xsKUqSzw5s4S2MLIgyneJEoRl/BMdZYHGxJu+BH8DfaN0zdYNx7JfRL/PH8P924ZQk67uWoGnuOU0o+11J4FMsxLjt36+F+YApV75KCaBnTXTp5MZ3SUa/KvJbbHhdfE0RMfh/t7R61lbfPUddKKRt2EifoYO7sE5Ghwt3OQaw/o9RRmM7NBQTrpypPBpOP3bSlke+vwEAc7cpCtPSVki/S2Vl9dQ/2bxjq43Ukl3jaL8ySdgaLeyctz8eqA6ftHmaPHtux9t9/35+/sQHE/T7598C9++Qc0f3N7Q2FzE/nRDNNsJI+5AaQnjN8bf2J8n3nf+g47in3X+v1afwPDH5kfXdf7ZtfHzMfDa/4d103uGve4WrQdUdIafyrpQBITNrj7MHIP0N9N4G2z3li2sbrlC+Z/3WvqJ5HcDhpDztTENBxP1PvMH3bF9lCSYTwUCWEBj9DCq/1JdVd5/n2PbihBiN/jcyi/62UeqeYI2d71hLl6ustx7tt+b6y4KRYdsTlaIsA6JIDRjuoDiqIixpDwCAw1XmGozc0/WLx6pmP/qEbvIsEPr6O1MAaRqiEYS4gxFX6ComUARLZ3M9Bw7ayyU3QCljzQUQ7ehn+15HAEwnDalR1WqBKEPNxNPBYgesrCsVJ5CM9JgkBgBFBd8Gkm0IF1JCwtilOYgbiDtnqtH8+VTGg8PMOrNB4NBq+j1fCH4vlyVctO0QRY+mCvkOPxxCSU2MWfCTely70ygkpKYYH/Ia59b9gKppYalEXR6/vDUdHrGnCKY48PK69j9wCJxuV3QlqpWmr8JuzGcaIYlvZEpGwMsGpCLZYBYxFiH9lhiG2JfTfoD/EWQo6K6RdTRxKf3mFRQqQVREHDkg2GRSFHwtTej9w3MOhzr47pE76JV5zi8twkcQqTuQEmFlppPYyYllhBQPqR42YjQStkILp4HUIyjAON892A2Lt1ckphcaLnY5jjbZbeOYKGcseQDlOfDFUO2StuER8mxM0HwCR6pbmd89sbDQiAKfz2kv6DlyhRx2/3/IzhnWlRU7ajaHkAi2yPGWi4Ttx59aMOAFZI/6kKOVKmephgNZNyBx1h6sNzGS8Zjqhqfqdpsqiroh8lQNH3FezLASeMEXJU5hkslXA1GiRGu7jWeBJmp+gZi/2y3imCXkdfwxiwCiGqOIdTWCjO3vtHcQvrMCJuXgAs3dE+JtluqAa8TIkypM0119ofHXWNMdkF0XwVdCxVoLJTUAG3IOUOmsNYayM57IZgA0Iss2HJDMXMJGyPSB8jlxmJ23ioo8qX3ZeUj0KVieUSiFseWTfWAbf3NGR5LPwCKF2xLXHYtPeIbfWm1RVMU2knGBNzR45RCgrnh+lGiifmEsAoT6zi5pzF64EZRGxB4o4gBkQJn+W161Uxj6FC2yAM4aDsQADkoG5zHqSCdaPCNk8c6+yoLkh2RxeYYAIWiQTCvPIlERwkh0IA/mw60ItuWJ1vWjdZfGlGLLkUQa48VjhU7jl8aqGl7XVpdpaNopGH0vKk+nD0E8zHZakBL5c/x2z7fw7Ur42WQgfmroai7z7tq5Cew2p2lo3ywkMBI4zxlnYDuEEXU5+OfsiT77ACr1uWDwU5bkyc+16aE2Yr9y3KmcJ0MPx8tOiDoNww6nSWkNPyU18gF7WvvYcckRf6EtlzlO+312b9fEB28o/05PaNyS1icoLVjFtHjMG+lL+Sq2hyGhxzgqHuruaNhr3PLKbjqfXhxNqSbapIA4/J3FYaicpB2WpksCSEWYn4TULI0Z7numW3WvbS/AAo00eBcfhtQMRJSMxXxUkob3WV8OblfPkYqX0phdpvBfWluic7pWxcIjwUth1z07OgftNPLD9SESchO7m8dCjqnupqQxT03eBh2jdpNBE6x+GSipOLmBPiZCNW19K5zdK57051wc11GDO5hHIb5ZvmWjq5qJilGhGIo9EE/fdlqWWgs7vaPqopGDQ8zSXK2mvWaRNE2UP40rIW5DHcgiqS3c6g/WE0sgvkjxvAYlA/oN2kJ6eBm9E2+IJ6Q534g+ENjdL2M2+O6cd+cwWMx46WXPtSy26I1N6QSmOuoJ5Z9zRon11UfOTNyf60+HkO9AftCCaFoF034UpTfCol16HcHj5V13pxerwouRy2vpL8hGH2b5lXy8glodM1TAeTZaBuGlec3HyxG2mbAqptMETQ6lOPAGXNZd9zDn8VunXvPwTlZgDw5Z/FNwHgp+H5998Kc/eE9GZowCwUQIDxokkEYHZ/kzg5gk6f7OP/A12ENYj/gdyOYhpKywPaKn3jEtYgaTKzT1vRNljjGCamzrl2b3+0/W3KXKn1s9Y6wr1OIaYe+ihnX71ua/0W36EWplzPtAY6VPUE1xNC6z4hNQe5xqDHsqL42EeqqKJYVjuiFdY49FoiqPSjV4LQwiJUz1fQ0HYNs6SHH/wHf5FDu7MlT1ZsSB4z+0rmSm18rrVAUJ0WmjWU4rdzlaamulErO6hlofO1QGn8UZ/5Qgqvv8mjImuZoCxBr6sKCrq/WY2FDxPahiJFQ5zj/X5nVTpllJ30hylZ5Y+DJdBRMHcKmNuuxrKtzYKaD5VWomUmVWv+R6XtQs/HVKqanTUZIe2FpBuV4bqYghY8MBSXfuz4qy5DCNTb+6s6hVhYfS1NKNZAh3JYGcx2hgTWOTDlhK70Su0TIrByWM8MCawdVpdRtPtg/O4sQQuoBy1xt/dANpb7Rsu2xjQ4PFYUHZgrxAdWnVFdcWJZeYzaPH49Sr5a7prWiotzRN2a/fKaIR6OCjGEyOgieFFKNK8cQSja3C9ICG4SIg3xmyUC8YeowiUAcTUuBYitYw5AZGEUEMPDyB09YZZw6cFlYsTAsDjn43KE1gQSdkOfBwjwf8WkecNCABaBArUWHASYEQUNqbPAKaDkRYg46EURFedGn3Zj8GJpSffiKGKni/I2zOrfESijUKxoMZIR6NNDNITAzmFVpQSRe3RARaETtKighGrPakorRiPRbGaSVJEi6Gj0sHBGyWBKjpYiQRiIfEkSmlhKbY10RhkwZtZJa2OfXNqf0FzdkEQkujgtoSNM4pJMESOSjgSTZqQbjUWZERV6nbsuZw6s2HDlFVHtPgbqQUtOqseJAAA=) + format('woff2'); + unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, + U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 400; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAACsUAA4AAAAAVCgAACq8AAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGmQbmWQchV4GYACDIBEMCvFc2nILhAoAATYCJAOIEAQgBYJ0ByAbwUVFRu7K4K3wKGrW3tQT/F8ncHL9WA+iQ7QIGY3GJUkUrj3IFSM3ZkP06sjHedMv9NTQeo+XL8dkXEi5mtV3TvoRkswS1PvHfz0HFx/cDSFHRgih8nVOR2BOZIAi8s0Bze1+xYgaYRSgYBIplRJS0iE1alRIjsGAkWlAy6A3VCpULDBpSTv97/drdv6+K7ZiUqElpjOECsXjxTtJXu4LVKFU0JqVsai3DQ7w9TQAjnRaM7JkmNFKD0Q1t3fVA612ZfvuEjbogAXTSEknJUXzBEV7339HpWwH/vn+57TgkghdV1mju01/GJHwqPb8nJpRBHc8Cvv/r7NsdYe9QYdwFHaZot2zZbhOUaWopCdptP9/eYwL9iyRRkvyzJysPYtywAvYBYgqHHuB0F2QK+SSoUuZk6JJ22XLEMM/tXSWzctS+qfbUuUJiXDr5OWSvtk0VCuqF4cKwiExEhsJjkEBMcoZw0pFCaWE6vdk2S/fBtHu1o3yLALSFKLEmx0fP/sRJaBwAXAYFDai1CH0uEDEiIFIlgyRKhWCjAyRKROCKgeiQTOUMT8gEChgCbACAgREDARY5JgzMPvsZ2wFYqfEkIggdgbJOwDEznUPDwIxyDmnkYKAB4ILP0AABSgI2kD+hwCiv4IBDngSZ/JMHtKGkpl/FpmVZ6mhanQZvWbl0X8MH7PGqvHWeH/WHNfHnTl2QonkRk3alDtVzUlTH9V3ZvK0pbKz8sxPfoNSUKksNL14ApJKyC8MavoEA+bzF/U5aC+5xSr75cs2HNKVts/XeudmC5odX7XbtmKzFbC/gvziCALnet+lLgeXGIFyyYMgm0OFPmqCH0BEh58gOkfOMvF8q8R6r16HW8AahDeurRj3m3Y5Xz2YJI/rRzHmzz1j/mRoes3uUSxvUOwJ4/8q0uZbrbXbZrtiXJ9aiGFhD/Wyp27pnnW5/t5UhxchJ1vvA05DexdvimfsTsUNWd1Gha1hfZ3RGliNg3gyu/GZtrtxp1jm7I0H3A3lULJ7vm4r+RYnR49v3GLbTryGNls7Ncvyoadxfxkm541y/OPIfWt91E8RSlZMKdN5wT7PAyP7iluLasu2YgtPVuWKx5+5WyGGFP88viuLa/Z9m7xQtfB4kwwFeaHhE1H4Gtue0hxBCT0LQwmrgdh520IrovXL/DJ9XMaRn9JmM73BHVXMU2Q/bKNeNy5ffV2nR0C+0DlS2th8BwMYOOw48BF13AknnSJJiiw58hQoUqZCjToNhowYM3OBBUs27Dhw5MxVqTIVKo0ZN2HSlGkzZt12x11z5i147Imnlmzasm3HW++898FHn3z3w0+//IZQzKcwlPFTQaBG0BJBCL4UIoUnBRF2iyeaNiQWfoAifnot0+81A4EhzsMS1vlt2mLfKw7tcBaWk7HyhipWo/J42pjAJKYwjRl5OZetYBVrWMdLeSNf28QWtrGDd3iPD/iIT/LnfOULvuKb/D13/HAQjo3cV/cqFDtckrMWlmIuUM4NKvmGWi5ZgmFS0NnbBPeLex8eJp+yqZdjUwLfAfGdkJwmyJkrM+thcOKnhbfsrHPHB+AGB14LLhTpm3Ak8h0li2d4jhdYDNwDhwe77tNNoN8OA2CI87CmECzH26V4lCkqUClv5I5NbGEbO/JPPH7hdyA7/d4wgCHOwxo52MAmtrCNndmjGeFmR4YjXjiWGXsH3uMDPuJTIBZPpiGgHFWooVjxBm/wBm/wRiGQnTEhZjDPb1kS2/I4YvcuYu/BB3zEp8VHO5pj7HrPsRVonLlFqy/cExvFqHe5/QoiueRwYct1Auu48h6JzKhi2/SUnSfy3IFdF9/dp9amDjlHZOaw6nwEUZZ0CCOcEEw2Cj+caRRYLASPUAj/QRN1EsYZclgpUkegR98+hqKDjKOHXGDlMBuJcIge5cTFMVnR40pVOaHmrxLG7JD01ifWvvvNEYoCBvawhwPmQIxQxLTPcfE6IcRJYUmIjaTYSUmQrBBy4qcoTkpio6z9VLSXqnioiYO6uOkJ55xY6FcEYhyAN5hjCxiWCM2qwhLvAD7DGiMCZ7FyEZcsz7JjbexRTuXAzpWJVKUqIcMciFsUMW4GyuzveN02B2veU4hnFrFZkiiHZS/hbEQFbNqB9/Y2xjufoPc1sfpZ30MnvPBu8OPViiCpA/g9TmygnFaPItLvIW8DRV6FcrbCReEANlgRgA9u2OFJxLEhxHn1CG2gwWygWSOErTjYV7AUOvDAb3BKRSjZQsm5jShWQpBUeOGHF/4NfqN4QQDnUXSCghV2w5LskAmRoGOd/+wbLPg675861oMgggj6moTt1PODA4H8f+u8guxz/XzcoUShqnPTuUERgUA/N9iTCH23Dklw48Ke1uil4vtpbPKUqdOEbsAw1+97ahbQgWXPo/WEEMG9Lazk6X4WWkLw5tAZc4Ay3dMGWRxuMmp11PnVgkDA365wWLB+Myjf1JwuD5kJFoAVdGJlYLYHBtS7xFrETtvl8Q24sK4Pb+D8H8j/JrexWOCx9jC+x9yZDLodd+8e34YelAkzEW0QSJzRqBPHbp8WKE04Ag3D/vjrn/8IwDOBICjY7yCUChxuuuUAAYL22GufQeYh/FDKYFxrPQ0RJXKhKwV/A7g/gglKETbXtWvTga5Tl249eqHEYtMnVphw/QYwMA26AYEogOKFCIUoHAoKv0MAlcMGwRF8tKEIqOEIEoExIUEeBZ8Xf736Tg/rnXPDq7j/PLNNNEA50az1m2uUzSGQeaMbOfJgQb+ty4JYR82ob7i4AfxcSrqsahM4GOsWw/7fZvqgCfLvA//A6Z+KAkKQuwFt904nNINoV6hiDRJJ9WMi+9vVATRh4YGlEtVp027IpHu2vPcfkQ7LcqNMludlcV2U0Cy0WGgNof1Ch4VEhMSEZIWUhXSFwoXahA8ihH/////tP8BSQurUa3fdsCn3bfsQ0mHhcd/VQnuFDh61jJBSsSK/tUE4RwnkCFBB/gXpkPKr8Xf6/97/ez6nrWaat0jK6iWJ4kSbWr3ImcTK95UrlguRVtchZNXuqvZxWJ5v1BL3wsnGPCpv3/wUqZ557oVFS9KkW7Zi1Zp1L5FllL0PCYpMn33x1TffZfkBgYKHyv+wHBANgDIB+Ass/Q6seSRA2x6UrwG6SpT6mCOw0JBclApUdzRUqtlDlYXWZoNyVJsiQI2kjIbYHS8vBF6IBApjOcZbBLOjAZAapRSdi0RlVEgdDPsQojfJMC2tHsyLNu+O5oPz+n1O4bMCZxOAu26FV7gFtmzdYJDGEES02VWxGbvvKDKbmzmgzfnb6TOJ1yYmO0NZL2UQyhNPvtKwDY2FQA3YSuqmdEKThQ7ALo7NoKy0NK6TfnMrmWM+Ax8Oq5wCX8W8ylxJL2vCMDVMrxiqZPOYS33ajDn4+VTaBEQmxKWY2d6IRSuMd6veGk5OmGB6wx1zANMWclWsRtZGKkMtTkU//jP7//2j5CfnWIBJMKGCs+qr+Sjf60+JacwbPcE3fGxCNfZnK463Z6AIXUhnLRWZJWHFFhkWCBS7qQYo8d+tqwQNhOvasubhhqVibhDuO1QTRp/CiA+qvWde8aFB7oHUPPZbNxKNS9yORm7IeULvrOYcQkSmBaqbjSbvvhm6UVFGu2IH2rvc/muVn9qolVjv7SyiXqaTi1KOtFn5GCs7MXahx7JpN0Ycb0XrQz2KjSjwHer4qDo8NO+XKCG9zW2SONSzjkhY9oRqG+G+c6N1beyYdiKYoQ1psI5X+N67MEHVE6hqW/t8OxROxb40I9OSFj9oEka2i2tIGMihToDCmfJeW1sLIYifk7SpUE2GF0NmQnV4T4Ba0EYzGhD3x61zNWhwHJZs9LwL75ZRjakYOb08mw7NRhTTqHj1USJZe5JGWJADe906Ia94s2GL852aXIICBVruhhniOuaQ4WS1D1kKtljxoKDbSZxrTitUp0BJu/Ink9G5lsQ8p4Nf/x/pVv8Nkx9Gv8/01E7Gp/4/N/Vx1hKdfHD869fHH8QknNNtdYFFJbQ7zV217bVfbSqiCvjS/tPB0MHKXb8+oiVd6gWgVK/kZDXr4whK+UcXfW4csTIjgRvCXXI3BE4YWdSoLyRc1Qb3R6UQPql6WZzxacfHUMizcbEbeqy8srH6lFvMkWSqHSNXyjdz2vqOWuR5LC5vLaPi/Bt6CBX96AYMWEoJqaF31cdg9m2U6oTb5KmmYVND+U/xSkZ59lLpDb3Z2suHblNfUkRanxnQ7ZanM64+572Y6WWMb5QdHf2c7DzwXum2nT5TD6bHXa51610RHmkFTyIrnC9IGzX6o5Yl4emM5lNK5pweC2UueQVv3Q33IH8yQShn8EUl5KCich9ZUmNKeEY5txrRLt/9WcrdLi1zK6raiZwyQm5G6GAblVJwneyeqzt1VqjSSfIrU85b5lFGaD50ABTCtcq5iR7nNKJlu1E0dxp26X9lLgYRLL+52qi9rkGHuCTuEfJiqtvUd5z2YqDuPWhZEDd2a6MAOVY2k1V5uOOS9zIz0V0SVjTg0VJJ7e9V9Rb+6IINUotrMcmlhl074e0Zca1btCobazgtreiB0ruHLg1KHsFig7WYevYAZVKMjVeXehrhkvOaryWu8W6UtSMTVeLF5U5IbXB4KT3037btwSl9Y9G3sBRxGMh1Fl1Df0P0CLkjtHXz2C1plHvcpy12CfmVPkt5NBnzqtUorppIwaPidYNnG7a24NW1BCgB3g3XloRYFdhMcTVzU5lBGRYTOI4779l9D6u8suB+sguMoCyhnqwNIZXOD6FjSV2cfb5hXMtSmgeaJoNT2jHnGGLlx+AovHoDk6gMob4H+Se2aAh5REtyqCDibkkbS7jKTptLBa73SwWnKHHRHCJU83Yd9VXgwxnF0E5/zsMed3vksZRhwYbJjFIr8ICmEMb6zqklQXhxuWa1D8VbI9ZK/tVuPdAJGQNOqAVBCl4u9d/D9hQr+4+27aaV/39YH8PW1Sn9arFqS5ikZZype7VLr9Ir8JtTbgp3r7mI2vIAGCmAs+FQT50iNFnTWAF9dbt/mQyfsANIAgzLC03WRhk9WYknOm0n3dMAJ6uCn3uIODyZBmkl3PSa57Lh1QSSTbZJ3AWyk5tJ7OeQhJ7nDc1dVb52UYipp/xw42Eqr8Ym5Gnc4tfNftlJ6LS9iuvH+uLcUkgHKR+75TiCI3eNgvgwWrJhCMH5sFAXxpNduzOJtnf07vahQXklEZ+39E3i+p2sjHLmpei8Stni+OgljmpY09h3SIauarooGpBA2WG0O7ydf9FySk/xhWf5QWqnOYdqEW2WZeDL7yjvsD6d9CjKvkl8O8vxDMoCIxaXq0HZssU2mT3zs1+DbXRKhK6nN9TV0E5mRCpmrZYAe6+Mya9751KVpr+4MTe11rq04UblLjT1J6ZTea2d88NB4IZZkwdlnRbQeMMKFNFelWUTNd91KCCjCce8kpSpdLH+vC7pw0aPyztF/Z6++MMCtYj2FSURcv3sCi2UoeaDisijpF6pZId2ccKyA9s02bVGIvERR4fRQaXa8Omo0ail0JvKkBLTyCGPhyRd2r10JglV6s2jjYaZwMPUqbd1KcgUq1M4yeksHLNycz2p53fvpQHbGO60IOag4STPiry6Vymld9H8/Zf0kR5agIiAz51ZYcchXOCWWn7WjZPYwkzl5nSMQKkTYLL+l+8GAwGhbxLe5s5L47ECXw/TruOmJJn7zzPKfpeKbVz2ktKbp1NKfAzTcjx+8CP4rpTiIJXfhUb1O5QfzVf1OQEDfz/YOz6DOolp7lTYSwHn4zPHK2QTa+SMEqsGd6RHx4lxwNLH0d5OgGXhTdGLfM8e9bIejThTEGc0OFQ0wrzAKEexpTiRGO8QS/QHXuvoQ97B8DabM6MZHP6U483Kadctvc9k1XVHUQ9dqKWJhJfyOt6hbt/ruJb5e1W3vGoR/HiU4kE+OcopKaFMZl5z9H791VsPGvheFC82CjJf3x3ISb9GikqIDbqYFi3l0RJpXu3fPHu3jzBUNMTgebg1yaDmF5NTixMAV1SW2tCcmn61haKf1tCQnNLcQM3Emdp6GenbuFsbmlp7F1l7WxztlkxtaMI1NlL1PceY+rBmP4IMrD2sjcxsPA317Tysfnzy1ToTTvLVAi+yX3jH1XC3CC2afsPYYFPJ2PV0O7uioAv+pjopOsm1jf+Lxns/lt1IhlqTuj4LyNpjo8KYYI8mlobYlMiyHNTRTbcIWoSFjqS0jbqOp52xhWsQcC/k8wcnw3IxpJmuR9e+t0zSE43JD2bexh8Eq5TsA1bN4a6iIWmG0e2vLUFBdyW87IN9qoFYSHkE8wMiIfTQ1rfqkLuZWEiqwTvryErgv/JE3F68RDwYb1vO6nQiULxUxmGCK86ZcaR7b7wDnHzJWdJRcod5x/0P3cyEdGFffecUdFZjb763xwxwHN4p3QGamxSN1CEl0U7KAXp8rRhOvAY0LwfqLam82V2RQ8t811o6+/b10hmU0gDH69THtNzkBWTpxBvKKjUz7RHqJTxjPginNPFOHgJZZvp3yeBEqxprUmZ+WFZZVTZjBvX92e3X851PeE+kN7yAvZ4y1BSkOJ0E/7NcSiij/c/G2Nzus1HX2E6/01GiKR2Xxv/3FbDUxwwrzkwk51BTL1VmFCBUUHTfnS2dtWBalAaeGPs4cfzz1MSsLdx9ZrjwqtXkdLa/OmVqF7e69gn1fOTzAs+NDp54WmJkckFHZUENPS1GV44F5L52Vos8Qf//PlwlpU7dWmefX/vCOfcArflXv8CmyQLzgOZaG3rYWren/kVMQm5/cUneAGhbG4j2GoyKFu/lL3sK6uNygaRmd8lQqbTBqJv/Vu4//LN6IzLpZqiUm2RwM3Hg9ZOR4TdPWMNcYyvKf5WU/ijISU0pzOX12h9IJocHp1GW0yjLmVSQXU9S0q2zdEtkxnmvUgqCdm/HUZ7+0N6j0GxGtsAcqzq+gf66xfvTuSr0qKVRX/XLmNhCZnlx7jCwpIb+GZcVjiuQFY4dB7UrEtr12praddog3ZVVhLol7x5bIO8eNwxe5UikdKaxZQrZ0iXQLzDS72JcgCMDqV+f7Lv5cLazo76ZGGBgXjasuo5/9hDrv7F/fLKnd1CuUd4qy8IoN3+bcIfrajTqVqHfhUunzNRlTxK2CkOpK9huQtq5UtOZs5PdUWxf2b/TiGLDDxx6TncdIz2+I+33y2e1q4F9PzthqS/u3fufnivt1zTXQjhzzEvtVIO8j7rgxb/Fa0aUvQXVB/EelLhJkQl6k8gCfaJr3/vvTdAMWPri23djwxfDqjxPRQhRBpLG/67sKDZxqJErsmJZDmuUiySWJBCjqUTaQTBJntu/dfjXO5RCqEL27TxZ1qsdO3tQghsje9sbKksG7nP/znk7saerriXvQPcYLVTeOtpYIw/TznP6WBK7NoZwyhMiZpe/8f23/rFDWEBAHVUfhVmqrgYsvbDm0XwUqI6meqYOA5ZOrpn85Akmw0OGfnhfehdfQ4ksMnvJUMZPcENg5/DCsLyQyMgkF0DU1xWhIWK9pIH+hSoeME+CkfrlekcNh0nLpBGIerSWINVLH2F58Ov1g2cfl6aHEyjUlKiCYiDD/qudA2+ene198r0d1RSxK+Jb4FfVVR2WpY3AfgH6ofGr1/ynKHyW1/PQRmXhofkygtvZwdq49eLzHh4jVrep+BcfnyEwL2h+TFNnaaS3sTYVKCJ3/R7ma7G1tHWwNdE0F24h6Hv8g333+VFfA34/PMxg3uZC/QFfJWWvHxn73nN9npnHb3y3qbKvuJKXmXKlMhflBeaE5kfpUtHW6Nsp0TKf9XnNR+hIZ2tuzRaGALkjeKsXev66fyRc9rhlbGOC8MfM+jf8ymNKwUyKtLUfx1z+7nFaU2F8Rh2tFMTAmvLt3OpcWRthdbHkVVjS7ZiRtMaS8tya+GD7klh/7zuxHleCO/nmt0vQpOypSyNpo2VXyurjHheHg2EEYR6whCHAEh7VXASja/RluAvYF9zC7w8gyNrqrec17dfrr7S117yArH/7MZ0PhSfoLcK99AewPntg6EQbAf3jMm/hj+Mdh8e4jm6MCArQOwjjooJBgkF84aIdglj6MJzQSXESX7/94PHShvdZn7MvnyzdebAGXvNxz58f8cw/MnzEFXURFKu0qo/lSW+k8NZ8zwGh3p0hwFGGymKAZSAGUOl0uhhOnA5QkhSbJGLLRkp/YY3A/quDN9faTj2+dPJxKygllRaVFsGhq89rEdEVOPGf9cik9O66Oz3UZmDu9li7h5FCPdM99ZkXSCXjtpGDj5joK5+KRW15vmTbVtqL6C/nW03ZhrmDNor3x8szw3eD8/DxLYADhlpwVtbqSfQA5mb+3cx+s+Z5q+ae9MK7oJbiWRjFYt+BcYpoHPcMWsKIwZGasK9PM4r6Pjxjae9g8c0l++VUzA4fHSyfARfRn68lhm4FJcsxAAct+LCgjMkbb2R/DOAGSu+R6ebVHy3K2iilD8CYb5FP6JNIfeyfxdzkR7sCaJMldG3XeJZHhpmMVohtxn1C2GxI6WXegsNcLNkZFbDd2kprDb7OuNmiucpavCPv4O7rQdqmbbeCq+jf3VMjk0FUfFSz0MMfHx9GrHgq27gGRRa0ZZSUZjkHXRq+9Uqa8am/+H5Gx4Wad1YVLRmlD4Dfsj+2ZMIWlXKbcQfCfYODHTJcRU3QDMABA6wZyoypw+KBxASHOGIA8Pco9yseUJMu+i6nrqltOUg4fCZIXqFp6AiML2HR8dZTr/eINPdcuzq2EPEMrKuvBeC7qoyJiqTOvrzQLm/S5hrphY1eYMyG+5ESfDJi2XzmmBNvtvu0KwQZysDXo4zNiKucRvY/rDI4iNXG/13OpC3xSP/jrIn+tUotWOSR/sPA9zQ8y865tjjV1bSYndn4DLTWeb+viY9MhMSzMgD7vBkfFUKdGVsXxQ2g+ysfUZosi7AWha3pVQ/BRfT/7omJ4aAkFmILYJ8zMMFRzPEdqT8DLMyqR+nXbPIJtrmXydXzcDKsqES6T7MCGMo9qHiHvEaFmyAlfOR8iMVelauWpmHm6av9HQMbN4uYxkmBHt6htvo6fjr8aq3WFtG2+dvXGSlTjiFX3RgYpywiyS/RCvZGaOJmabO1WvKaWkJxJQZ8evEJxVm1E7QJHMgkBQQkPmjvmYbxYcbgt+l5vWo+hjIdPvziGdO4uVdXOWdvmvJN0K37r6oKg69HuYQnTI4HLVfCd1V5gNPyFPfYqWL4dv191lN3QaLI459FP4ueEEXcBR/DWy7usdOTB+TWvDgXRXQ5SvhcfM8Le50I3HtMYhaUSmJKHSmilvuMy+VSISqQLt21cWPq83z+/Kf7SN/11S4ZUdJ97f2zLxvsGuw351CEu1qgw1kMuFvFQPg1q4ljXdzusey5sHt7/31tURJdunMVBh6+n8+f/zx7o2ftujSYfmatYT7NNLgk11RoePSUqaW/Sx1S13+XakzV6Kj7OWLsEuYKza1NMM8/ylFsnIEfDsMUr8JoFrsObMLENG3fLuNVl/DUgcWj8zMH6ULrjJViwaFH2OKlKFU82oYDWV5UqDksQRW+2iRaOgVxxbMsXquuw6OnvrydvrX0qHMoIDEu2C+5PAGP1qgG3Q8hNakP7tUkp2ckk7OyfSpn54IvF5QkZxQUV0eNjddEF5WmUkrKAy/fHveuyaWlZiij4uJIj8Zi1sdiQx7G2cHGo0NCx6LurQIId++TLVkIuodN0L2mG6+rPaKtHq9+TT2BRR7jT6GAcw9zzzTzGxP08ztuMqx0pfQzvJrQkxsh02f1FLNC7jKQlO6SKsq1cDf7HN/7ar2SQ0FOFcHMXlstqXMZXg1sU8s76LW7jITGCmpuHclD76wZWfOwWZN+iJtS0uEW+z1G+80IRl565+TN0rQOXKCb8Fl66dllEQFn7XilocR2aD+V4lXV+2Rd3lZXU33jYV8Q/dbDyrrWK8UFni5Wji4BmXGh0YtZuTg5WXr/S22rPUa4psl7bfOdQFtLtTChob6O72rNUVLzLNPeaDLJcJJpPzvRbWt0f3LCaK7XFvyGO63PWydFJcf5BDdEtRHlMuL1TOVl69h9WpMz08tzyaru+8wdY0/bHmfmhliAnbqsC6isRTHx6fUaYP/Ue4w0iWZ6dfV8TVXCba1VQnz1T6ChLxY5F/jLm1IS4i5pxkhDuZoNlif/EUOI25WE7rhUpY/YaikYmqh6ZYHMpmAdrQ7wx4Z9iyr9fQsq/PwLin39iov/CSgYnlNSNjRSOGtkSjQyhBOFNsRSYk1jTXJpcnUjP/9nnTIdaKmwJZ7eR/TWk/6jev7ceaVqUkMhvjwxyNff39K0I48GPEUXrYz0VaXEd88pGcmcrPa4HBufWRnte1bPQWtv0Qmaf3M8Je1aQkCNuKmKzjkDFdnQSsQO+CZhlV20GATklGPg8sXK8Cm1UiGmciOe5ERuKTQ3WNjOlgbIeKst/N/HC6z/tjgBS4eCp3+aPFYlr5Ny4VB32f4C99oQGs7fzEZW8sxPd/yRdHhXUW3/RDHJI5wALFc9awZHKyoHhxuMapkjcjdHrl3GermFWlm6kLxNPd1CLS+4BiJucL4R/E4kukb0D7N58AeGkQK94kMcGUjd6u3+8YXp7vba68QQLZOCYdVcioqfqYsYEQJhXG5yd9zWz2Lp/WXdfI9NSw0ECCPWvNHThxfBzsDQTN80MtbA1MApgRIqGjYyNyMVYNNsTbngVpFL27o55Gt5WVrqx4XxF6/m1PyjMBFRNU3PL+7ZR3Uo3kENBdk0pc05+86miFiGOmjEXMx+aQpi6aJ7Cl/4Ro4kjrJsvSQoMQFLZ9wQEcitLYmOqy3JANBl2N6fe8XsGe+qTbg0qydr5DJIs84wrp3t7LvQc9rxVAU3+bR8QIizhZyh640Cm8wL9llzVi4+/nbPRcF0lR+b0a1pveac0zjYVlq93r60Yh0QGOvrRw280E+gfewZDOuwkLZQN2238Xu4DbthT3Ed7beKi6LPv9PIqI7WCCkxqDYUeLsRjlADLU38nOTRcmFFLTxZ+4+kpReArJ7AD5Zy55rwP09o5IwXSdEr5MLgnbnk5CvRoZKj2dnPCg08hlJSHfqkFGveyV/PupFk4IlL5dzDkWXglF9/qzG7YSwpoWxtALQf2m0NbLkq5UfPdlIOSsMkfih0iH6hY/+sZtGCnE8aFMZ73xkt16yJ+7tCyfO1FjEsivecvVM0oDDqFmTTu2KQ1fjMu6fPJsiyw1eb2vCcAdqkg/Was9QxFEJSR+UaWjOVmRCSB+ad/KTLf4upXNAi35bF87fkcnwz37nfHH7NVUdhlvQ1D4R6c+YSuYjtIxvInNKj0VfgJlYX/fc5JTdzOlzVU9N7jBRyb/fv6/A5XPOVcfKNqADDBErq14w7weqeah6TIeRFFsl/A/j+2ifUzNrHc311T7My6he07z/2LL4skMm1P4FSDFJe79jKi5uLmss5vnKHgEhEkm1cuKNTbERbbMxAbIyRtaS2jrSUjpaHtq60jJYeyG4uEmPTnU52u6m1HTxZIx2HC4imOh8Nc1USPnJaUUcceLb4/PSdElEFlIHwi25TwFok6KvvlIyi5fWngKfbJGTv9zVwSETlRzK8vD1mIPuMr74DBVXGYFwlejxc1NBuQubVALf7gL+CsQ0KdnIMJTqL2gYGujgHBdnBIVEkO0cslU8sLQe4wnqX6i4zF8lBcuFyoM+/XSSf+7A84VASerT7wbVwb2G+2qhD0T8OHsOyd8V3ZXYldLFiDx7+7E8+zFdPFAm6Sp/FDl5KSMpMArVNYWqmHJWS6bAvhJZLyw3Z5/BlqnDacbroQgqod1F1SnVgtsRcUqfeuZmbIS2qhyvjpUOjfP0DXJZoS62G05spi/WM4zOefhhQdnLGoKdHJLQN9Xd6n1IF7FNGiTpanmOJ5PIjuizTll9zqfJaCxjKgz1GGDm85iAVtMgWKp/vdTft2D3NDx+Vn501FHMkGyU1lBTn1WYhibcJhaeVLsm5Oqk4aEo4Gs84zLbMGnVjZhJO1bTj07qZh97vnp9NV+leLm3PoVa2Qm3ulYp2ak5pK1JVhRvOSkd3d49S09A9gJ/d+H8IzE4FpAQ0VzdHYb2jsfVxuyvC7BCcIp2/nOYs0Kx50CgplxITX5tHjmlIwHpVsnoka+kb6aqbGBsZtoBI6uFUXnZE8Lm+MSmSnBcVXlOeRm24Vip7f+nlHUxCvqzxaW4RKwsrDTUT0/hz5+Eq04nZ4FQwkRIAWdqRkQpZyqn+tdE81y37axu6/YpUiPQpiUhIHLOgTMiZKKlrGCnJyZ9XSuSbJfX92Q0pie2Qbadv8FVDV9M7MjszMeZybXJm5VVUoVpVNp/bpZJU99hql5PnVC1NQ4uZqsp5Sx0tQxNQ28jgmKgBc8Nu70dlpVO3DZcOX/r3QvWJW//8nenJCz+Oqxdr9Ys/ABsj/AEwIuT3E+a4x0oPHJ4lJv7af/7ZtaGb/0J/3VKw68IfPGG354td1uz62Auf++nlsRr7vCEzPA6KdaKtHh6I0ll6lQE/dZAulc659gEY/2umObnq4q9meJVOMFsaOqC/bMlRWWjA3WqAdysY8HesdqCMQAfldm+um1ss3XbaLttte1K91+Ds/wdm/0EzAo8AqpfX1sZEg13qLqlQ0LoRa8jNNbOcZyKUP/r7aTJLC/PQ4vhszHqY3zl5qet3aIMbsbLcXEXj/sYRd3VrdCPIu7mpOe5fSJDBy+8gG6csQtHKtq8JN9frxTzboZphfR0wCUre9k6HQuVGLKaba3zc35egZgGlqieOLACRg7oXfBrknt+M552Nyfltr7GdpfmKPejTjYY19BMiGELNSpsEaTveYNxfLtQ93b/UDUR85YleF0vkwdtoqxY4UycFy+Dcs5a4pC3DmbrEllPzSCgL9p6YsvbYpO39iVXemrzgbM4BnHv9fw4HYKeAowxB9rC3a1+yNlgjC/2HaDD+yE/VO9NuuMGw/bqAXngsb74P8l+TX1dg03VyYTmsfeBFpdWrds+urEbXXtagX9vbmQteQ3DL3/dBVwq15VQR+eLrM8XyHekyOPBRbYKFPADckF9nzgMKpbIMdjrznVOq+0CMMn87R9YIbOzW3kc5xzWYsdq6bbjzS7EePLE3I9g7hbyTcGHH2YJyTe8nWo4UTlSfg6CvNSrcykQ6Db/Byydf1KuLp31cM2j7jdrgZvm/CuLyuB8dlCPx5S72w0Ly+JGletr0iUVEZG8uK4silB3bBfdX9tGYllEhbfiNG7QnmhR4Ls6rAWCr/iY4UeVz5PTqfr5pppwFn7OD8twschLEGf0/3ATKLvj+38OWGGx5nz4uG9TP+huOnIuRGwBqzHbpEyi+s5gdVGTBhfOfdA3UuN5nhP0V3RuhHFV52yYY+unHgbZDH+fyPPsJk4+rj+h0FZERB2WyVO+UxkRqtlf/0T9gGbDD3PIIUDZYxb3wuum5VX/H75sA8OJPvBIAvBMWv/068HdhlprCgBkKIMB47gIHwHzgseqf0UkhOseKhs7mpbX+bW/VshzqCg2lvRU1iYLuIr/5yXt589k3pJdpYpXkYMtkugocKvJEywF51RjhORYGWuAMF8ijAmkwQUixvdYH5Oh0svEyGC9lTQK5Tjn/keR/FR1svzV3eVFXQ3PLFkaMq8PE3p48RVx/8yffMblkusvwR7OqTpLIy6EWN3DeampDzGeSdJeS3fc4OO6j1jGg1OZwt1k2+4iCauCE5GOtdjRPFUyJqRXPQeAkyG5SnCaV66hx3lNUWwK38ZUdH+XEbg4NF+kfVY1ooDb/5+ryONrb2Vx3r0JocauxNj+Uukp4QMPp+t3JOkNQmF3V1lyfdWDz9VCpUT5qc+M3DRxvD6svizteK2w7HI4d78eQ4ylUWEdcnCCXHqN8di1yy18p7Rz3/Z62XTz1kiJuKCrqLp0tqDB+CycRe66wJsMu3kXWjzzzR0nwmaH7ic1Po8uexltxmBraKOowwnToEief/lA4TpXi+KVyrOf70eV+xjWXdjFnUtzwg7gPCeTte7g8aMiLcm4yO6kodazM890vqJaRKF+XrO6gqFxEZF3tzxUq5T2Flsj1IuAzBZpakCONSnWYvw0DmHbiFCuLBeZQhwIcYQNlmMFwnMxNus8liWSGjBCVGsOW+8TlHt0ZCwezVsRJjY+mIAjnKlXovtytXeCiNxxJSjbxkLiWVRD3iHejiF3Wr5ysUuLLe7WDnPOGI/mhEN8IaP3SuqY58V6f7gJlrUGah9edkQEB0YBGkBUsBGAZKFAbwkGAyUVoSGMFcDzQ7Y/g4LI/Chf/XHR/Lgb2xxITvT/OQTWry8UKk447wSExJD8f33AhGSlpUy2kH6yqn+gdaBjkKcG0EhBDFtYiTMu8ve1NipwJL4kkEexhEU5Gbp8IonsRNjIpzE8EhYbEINmzKkhGP+tnTOJ3Cu4OD1GWNKVRTKLAQqzb09dbojHShGTCz3MiiLDmlzQ21NEztXRCHEetVJlzSc29OgAA) + format('woff2'); + unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, + U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, + U+FEFF, U+FFFD; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAChwAA4AAAAATeAAACgaAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGoFOG5JCHDYGYACCWBEMCvI82x4Lg1oAATYCJAOHMAQgBYMAByAbcT9FB2LYOAAQlrxDFMHGgYhg7wv+LxPMMdTZwdcAokVZdtu6RLW2UUDAMvAbzZ4j0u2S99aGde5X9nYZLo8RBVE8cz/ziI9IIx2hsU9yf6C5/bvdgpElUiKlIGkMA6ENkDRIGSmVI0aPDP0gFj1qoiBp0GVi0dYXJuYUHnju5981VVmCjIc7w3k0B1KTz2Y/Cgf0o2mPp/+Wsb87U/V613FQAqHQIQuFClkirPwW+afv362q6gMtVf/DsOf2cg0vvM3O4NPdzA4j3mvSUAnMZjCdnkUeRGKpRucwnAmqcD3gCWVZxcs/tQMPwPr2Toq7D0ZhBA+fWm5pLolxQRiTsrNzhdLu/v/ZTNsd76xPmzX9ECsMPVdARctFOfu1b6TZ0Qr2zs9a7YHAJCkso86kM+kMVIWLhlmS7ehCzFWK3kWXdCna1C1wmaJt0sbWSrOImtKwHO4R5x9/Su4Fx+oN7ec3pBJ8N1JXHSbD5btBxdL64RmbEBAY3Hq/9fdh7HIECcLYaYizzkJYsIKwYQtlxx7CBRnCjRvEFd4QAYIhwoRDRIqGiBMHkSgFIlMWRJ48iAIFEFddhfhPKUSZMoibbkJUqoaga4RgeAPx3nuIFasQ6z5CIDAAOAEIw0DYuAAAoZeanZz9sN0XZ6xB/jMlyAfkvwe5eYP8n8shfiAPWX0N8gNeCG6CIFtiqJtf9GvxXgISaYUFoBbxXMhQubGvc726uLHg5rjExJR0Tx3ZrOKw5Wn/QhIIl5GeLXqGlHXOU+EEm1DHutZHMAYTy4QF+DDhMBH8epbUgFiWLMcX9MywrBWln49cqDPvQ4V3wayqvCnfluUTUl0J7HbL755hb8JZNZvW55+vesv6HJ231QTzFndzWbOdc8i2zl2YaW7Qf5NqnzZydd7kCi/4mZFannpkiTG74hVPfJrDMXEFG0XiGV61ZftA1KS6oDHeeAP3jKIKTrQnWVM/au+s0gpuLGx6JGRpNknnE/R87HG7/X3q08E1N5tZM1rsYm4z4/l9NPux8A3c1CCHpdjQ7GTZ6Lb13GlycjkCAkpX5OMRbE4ySW9DY+dXaipDaJs3ojPG4jQ/aul0PNNO51SvCq6551maBRVcYsmllFGX/glWV19TjO7W3L3u11JrD3rUY4OGjJkwacq0GbPmvPDaG8tWrCEgeZ6Fl3mRjOJz+b4qtOU62xDRPocXYTmKlaIsl2epAu8rtRw7L/FFcIsiuSjuRVssxZY8dyswUqnarhsKj2STBSYvm/IxFWK6bhORl6dRzBZloWj9pVgrLy4FcbpuoTJbEKXehkPylYVNXj6Wb9t1n8Lw8kmoR3TWRE4W8wgJf3vfKTaK9qJs3V3zptL4Qpy1mTyS2OS5Z8GxKIkvxOTlXpzcKkQXpWTHE/MpxWrZvMuXX6GGromqNB7X5SGirfclgrSaKMJaUd6UZ7oCYbzulpx2Vfj0rZF6IkS4yRViSjiVE/o2lcf6/ifqxImwExxRu+P52JE0d9ZMFobyQsa5E8tBMibGQEbJ/86R+2jx8unUVlZtz6lB4/101XTo1O3hfeW83xYwNOkYEHAcMEwBdQr4nQYiJyBwAS5k4OEK7NyBnSewCwIuwcAjBRAZwCcTuGQBjyrgVw1E9cCtAXg1AocmILoLXJqBx33AaAG8VsB4AHgdgNMp2cYr2CoT4PIYeAwCYghQY4CaAIJJEDYFRNMgbAaIZkHYHBC9AE6vQcgb4PMesJZB0AoIWZPsJRtbDaN3CDgTY2BxI3zm40jcJ2+Agh52HAmVLY5u0AJ1mAYevFW9Hk5cWVXWGnpmBBLiEKpMwhTCt8CtbQ8RAdLHwZ9a7CAeIc2s4OtgYDG2Pjpxwqk1ijOjkDHF0R8pTV6VVGVVWSnLGhvATnDnaPTa7RscwG2qCZBqXEJvuR+HcK9aeg4AjD+aG4NunCsw8A/AfZUcIA05AgBsu4wM0lAHMzYpiIoxYEMGQpb77cLCRF3iH0poycnN1KYpHZnI07zLdhEcbwX2DsAuQk5AIpOa/NwKPc3pzGSe5X2+F4Pj2zvgzzPwZwYA/BkCfx6DP8vgzzvwJwsAQhaAHAAtegAuAXABQANQDIAO4AiSZRUqmVQTrBfltWpcdOk3unyJA0dOv7a+s8u15o7o6rhy487DmvX64r/wssZM/16UaG+9qzZPLQZVrDjxEiRK8sqiZDQpunXVnvIneqRKo5Ofeia9dv1wN3yQ7bmPbrgJgcEGEwR4AAB8AgDIC4AFwF0EQp8Azk0kx9snDfPj2QmX1DwUzSr3I4rZnsxV4KazY0KQuDQbrywA7HwxcI2zw1xZJWHD5VmoyqDaKJyscpqjkz68f7LUJy6TZMjXsyGBTFpTFyxonNXoVAXBK+0RqSefAlovCIp7zRt82uqT0UeNC68eabzREGvrdZ4TXocmmhWkYD1RsgYezAYhPBKxSIn4L5uSmEH33PYFeM6NZWmoZWzp0TlTuLIqS+esrdvL7Nr7to4j9KKuj2+9hmHQ2OKiv3OXFts0bnPXvEqCGte/dZxZlK2+x2IMVoKF7B+O5qvBIc79qe2ZIEetij/Rwrm+btakPVN9/M1ilf/npsR0YlRrBCW4YSK+CmBFQujrC3m+S8Ju4LHpH4nkYnJysgUVZxSJlOEfwx0uD7/GUZVIIPF5RdEjGmu8ReZm/0Af7uv5obkxNwuXvMKEb9rW1YbViRmrKxkPVLHPjRCrUuB8wyfx31SJC6Nswq2GEtXJdqucBTyVVflWFI9zuqybkrG4M4ci584piF0xKvC7dDZutTg/3uCJCYrLhUseQJkfkHC2z5f4odJxAoxLNLxC90Y6jrVmk8BeFvnl7t3h02X1SWGkYoNSa9v6o4H4GMjKTE/0XLrT4JTxJ63l9bQdeBsVy3Qi6aWJAGq/sGaSew6pnQIp0OzUgzA0ZmkKQKmtrRNiMBEVtmfeMNGBreSPDRm+vvA2zXhCBe2aS5P7KP6IJJSe6LBqz5Ei56TaOnWHeMhXMl445QWnFZOTK803ANrivZFmoBgL63JZ9voy6IknS+56R+f1DWvsvzpzWB19DIVc8mhfy6E5YI9dnpv9XEuRKw5QatQBLigNO8rTPRAhL1ec03hBwiMZFPTqL6H1E8/2X26SPWgBVUSts8n7TTMBJnmS17rjY3dML++JaWooj3xhV5mDb/e6xR3zRy5FfTvPH36NYQnfQbWiBzQOhBQ5NNFlU3ZY8czbQpnpgWi8Bxd3AwmPyNunMbt7pGj8G3WPuemhnnQlaZ/XfHpFTPbEoXsrmVvI0fu0cbgtWw41hmEIFPMty575POf9RhrpscIm4jKmFha8ldjdERqNKyPqlpb5Yx5lYIPBpkfcNt06HruzrseKVty0SzgorGALbNwvz73l6DSgh9lhy2KT0YjMaVMpauc79mWKtENlDTy3TB2zK78JVdAuz2w0NxmcWeZ0qlUa9vL2OCOdWSGZlmkf3HPSIYY7a0S3/otI0hwP2NMc3nI11Yw9k91we3kEECrWpHCdgDlKgVPNtLWLhKGF7ZcohA1gH5q3RQuqQ9w7NZqlbv+7Q/1JSsRXVky4J1YD2CPfs4lhm3aRb+QksBZc9Vpr2pq+7e74y7VGwdNegL6iDqZspLMjt1Jnr8RJxqWejmg8fkGF2cv10t+bZuJfdfXPvbXIcnSO+jdgneHNNkGGrihbmX3tuFWAEnFZT8yqnElEyFDQS3jJ53msXUKaLu4COb31KjLUCrih9oZ+oCV2U1jMFR+7uoOwQr9Bt92PkKHU0+XtBzRHBaRjrQ8Ozo1y3CQFhrEGQiXh6c+Yk3OS0PGjp1kWoJsDDYDyY76UIooOLWxMbUjT5MpGtDmhdDPZeE/yZN6kAJsENoaioZ5z9T6yMnd4KpCjOCpsYhmKimZZ+fN/YMfwcGHb1NT++2n6XSxcXVa/7cv+z7yc67dNKC1uT3ly6Y4N2FzcuokbcsdWvL64c91urT0+S6b5Y9NoJtq1FUS2QwazKM5dkkAXKnwc2dalH0j3pZVp7m0ibj1VOxm7aGk9cUJ1swGfbRL3K1/xsqijM9l37rdPcj1YUsMhGj22xTLFtjLevfZzfUhAaH1sl06a5+KxUWpZ5NA6lwq5AYkMHJNyzWTEcMzt9QSBF4I/CnlM8mQnAD0w0wsUUvbYpS5zi9z53h46FDv09lxT+YJVojc2chBiJIEjP9H1EnHf9yVWXllTdsCXgLOYk7njJJRI7JaqdR+PaAxBj4Ixj3iVnFNCGAC5ZsgD8e2siOrkW3FY9TOPfWXUmyzb8TLyQhRynZg28M31dCzs9s3yYP161d7Nj6uDvmW1UuX/42VRsAIlj+oMsGJZnUf7cGq0+lWhln14YqScT09o6NNdhLFMLPs6Rt/oMIJoYsJ+05ZQ0851tewu+ahpupMSENXDo1YamhshBb24benKkLp/2j7Bhwb5F8LHMN5mGnOeJedx7kuL1Sk58BTb1HRQH8Xjjccj/qw26c1yh6jVaDNjR3aTh/qjFmumg2K/pX94qWuvDJo1ip02Q2eQ02g6RRnbLeCtwrRLt2ZpjZJWHntwl3JkNfTJtiRwpF2S2XLbrM26mbBffNrpp+pyqeXm21xNN9Lt9yvk83Yn4ZYadaZZaBh5yyzmagub0aLuwO0yDo5dK/mrhwGp878QcWE8cXe0tM5dntMa6UQkrkSHFYGqUlwYKhXuHOL24SIK3ADReAvoQTmilsrUuhnkg3XH9oLaiObS8RGrr9mvNYY7Ww4Zegzpa24s529xTe+Qx1uq9GD2CEH4GR3bxE15VZk5T4U1CO8QjVBO8RXNKNgUNy6YLDxnJxCQCAWZYem0Lu+Z7QMtFGGZPvsoB8V9FtqJWcSe87O7a6ap2WYfFcU+wDH6UDd7wBH4EgzD/ucIX7qNIg6piAMKN4wTzh65pEwDw+6X0AhennNwVN1KK9SSIOvGWJINZbCRJatm7MDs7guh9X3YX41sFTkHMEOpE3lHeGvvbe7FiXxh8V3PT8+uZHxF1uM/1fwoLypKFiiF40Hpto87R9oAx7g7dj/fFizigJWSkfIXcIy/jhmOLLjJAhyDBbv7GeIG9uJa9sanxm9F48WXXVrE5y6Lxr1N+X8ZsHjfvFCgx19/765gffEJmLKcLzbkr3flpxfpwhwLu9WK1FS0AfLB+msHrqrm/s53p7HLA8t/lnvGEkGx4I46l9yD6SeLCoeFjgjJ9yy2TcuB31+zu6KSiddE/4lKFlwTA/Qfh2FwRE35eHtaA7T9X2Rs7eDqbOVlqcu8GFoycj7m4buHmPr1fEVbPkyjCdXw91hiSoqDrZG9JRxusAv3Qs+uoK6hjcNuoUvEvajYD4Li8pOtt7jWFdQ+LNw+LJYODQoMaj2Yyf1eU+2t9wpXZgIeXnH4+yS2PvygvrVZSW0LLTJImtCLLwqL7YALAmuSsluSd6L/vcvKWPwqhnHpZU++Xhpe7UlLiNZ1fnaFXf+ma2QGb/QkP4ESGA3CvX1haa2XsOm9zI4AZ3vHfON4HBPwwAQz+Zsx/5ZSC1/yirGvs92K/LOcVrzCr/Zvi606ret76qP2isxHlPCMLoD5cTL3KUEbOc6ngQuB3DZypoKc8N3u5SIqvvzahfez9mbXjL29nriZrL1InzYecPO2Gnr6Yfr6rvr6YXr6Q2rCf1dBq5Kz6UYThAZAArfV9wdWslrajLf9NN6rcv0SAsNXLdQ9KOIpYOYs+Dfjlu6ZeSsaY7Dp+o3PdRuPjO0c3S/YBV3Q2+TPZ7X1v/FLSqANInOfMR/THrClXy2jpV058sSk0vDQ1ImDcW2kFNLIdJ8HEu5odNLeTKN5jUxN46H2SQb6UCCBSWKCNNZ8WWDfd6mSyN/PM5Nh/gt8TqWzp2TfCrdNlz+rZVZmeGxajyhwyzY8iz+4Rcw/gAIHWlapTaXyTaXUVr1TJkmmJnogn7zz5aHSn6OysajSDlKFy1PKRLwMsfcb8TfohyzfWmYBjnEdtHr0E4Rzuqs3//7GbAurbYuGsUL/FxY5gH7bYf2D69lPYkV8WMBF+vjvj4gg7yhzSkSQ4w84qdt7Ui9L2e5xjjAp/lEx8+jf/bytoxSzi46BZ04cdTrlNdgwPY0pOBFt6+4Sf0FvqxRtH50n3AVtOVJivnjVeAX2nb/Al4j3AlhJbU6xCeYUuptdA4ifmeuOEjoJYL4VUh7CCqG7BuvstiK01GjYOZU5s5yLLzip363aLUAkwcG+PS4FwbG+eUF2rPDE9g33rN+Cz/vI4ZXeByhKcfTYvn2rv0t++kZ3R7EcS+MiaHdi3KKy/dLrhu5wwkkcQ6/zXArfuH4EueHcPOONYy0/FNPgJrjIdibf0B0JsiU4eqktEKd2DcHN1j0/xaTut6lcIt9964FDBoOP+eyz04yUkpMTBLOVUp6nY7cVGTiOFVibYE1Bekzo1cZypWoQnU1UvvXZN2o4eUzwxxdEpdmf059flOKy04P9MmKjEPB4JlBWnFxwnb6EW8CMYQhPGUu3Mgsz+MpYIp/lCFv3eKrzD8FY1GT2YY5qxs99WKE10JoNWwjbIg2BvsW9+HvMe3E/m5XdNazwSt9qgmqZtcHbNUqWqKe2Kuig/Ca2EWZ72nU7ijYZo9GjloHXvLb0Qi9cuuhpqW9uZ+jc2HT/DpKk52Bqec7X7OhWzv+t7cNvykEDS9oibc1UT3/91QRWXVQ9k8RkeCs37afhqjWPwkkDEokZpiEQwc9D/8Q4DcOC5uwm9cRlgXH4pyyI8qiRmGNKo5XKk1NMkgbwMVsqW5gkZm9lLxOOoRQnCpNi96QB3jK9HIQ8X2/MDZ5hngnzvOzjQhbmZEL8uy/J/XbulX7VH4d7YYnE3OXw+aL7hQpXRxsAaYEMm1BP8xXX4MZhj6BX7CossdKIPy9T8qIG3X3bQ1ccQsNs3WOucaRa11hxJcZkg48QA1n4+XlmxacioGJjcuvLPPIXG+oe7+gVGBeOItgQnwTyZV8qBQXHOVIzPH7+snvQKcsta7Rt7lVvE7MpyMrbyMrNO6jpW1OQnbf5qUuj7yMoa5FkD/3oxSyPNzYszzxCv5Aa6xo1mZqyMhXUz3aurhdtXDxtERDTN29h7y6SYCupcz7Nb9NfsY9u9H5A3lZv3jnfGUtofT/2Zz3hVr4mZvh+pqv54kUElAksov9mnnx7h7Ys451CQ+xeiolF10UR06Kz/C6Ge+DMlzFu4U3D5JBZzF+BlzcGmCQmHFanU+nv6MHZtXhpN8a2NI6Bl/Kwqv4BS8IOIr0idh7CP8QLSWvi90k/ynt/knGiZFEyVLt78t8zzZXIqv0NvKcH5a/S99a1qKn8HhOrmp+Q0/vvR2gJca8yZ/QR7hBhkpifQndfAONyxb/o12fYp8EsHyQu1C/H85IFy56aE+KLiQlg+WDe/nrBE5myHBi6XjMNCc3IeN/0KKfgi29CL/t5u2eQgXvMu0B1CAxEDmBub1WoUJx8MVEdSZ6FMsrQ73yb5HrZndrlS1aLSFqJSqkzYGL1gsXmBQVgovylE4+s185AEQMKtMimNUwS83mlwLNvQi/7eLtnkf57W/UdfRCi+huk5CrjmOQVuWtQ6DP7REtA9B3ffRy2//rZ1ta1KRiy91Vdi2uJCrdbESqNkV6OnAiE1Gg3pnraYBovUf9mfskku5DwVUER4gQE/z0aZOQl0S7y6kdFlrlzmO2eZyfri7cbpw7GoC7eObrncuMPFLUg/jE1tFug7RNmfqKQkFdb9J4d5c8rmeIQFioWFGYfB4sgRrFqBl/tNR3MmMN8kb5A4+r5svtyq+V/wrMuwot7n9mxB282LxMXu4jPHmyAmfztaNZSauELflH2DWf6Pl5NK1oSUEG++3gn5fGkIjwpiflXXl1JKuSJB574pEJwThcPFPdb+q5VV1oc+RhZELVC5KOEk3y+Se1lcMF7XwFnAWdK90WZSX034Uct0rKVw7zlkrPCy6Q/VO+FPGfIuix1gLomyxuEkbCR46OMH13gQNCGLCdFgYWbiP8WLus8cDlCNunb5JnBRFaknCpOjy52exLM5F+82tsl6dfm+1DylcIi38vX8g8lvNt8Oi7vj72L5hcsdl+8fzXh4l1zSec2ZzPp83eLEm0azKQ928DckDGx+QteCS9+/T21FFgWWLY08f82Oie9uMWaHHNyy4oTiHPLclL3a0nYToGggFhP6bv0PU3GKk324alfgp6evDTZVx/3GnIPmfmJLUToWuzzrPVQdwpvBP0K446XyzD6c2x2taXfOdclt6d55g3ah46/XO3sNb0UEr0dbRmif87BH7xGPo2A1yBtoWeVyFbu1LRrlSZnlSb7+HSbkKcnb0pdJ9J31l98MnIeWanvqqMBa5E2QLkU2xJrsCoOqrGiDqORZoUfpebJkD/uM1I7Rr/4mjJFoKQcJNk2WPJ7Mmtedwm0Nj/faXAT5sKYV5qlZmRfSZRG/HmRmh/d7+7XEbZiF0y5EBjfVbPrdkyHP3INLj2WrjOOla29f7zpbZY03ShWjj7sIUM3iZeltxnWLxXK0U9TpWpBtUiaygD4LAveDHgFosJCX17JpvJ6Xjm4OywdlGgKESASBoo2r5K6oYjkb6EP0kXCFvokfyjqTgLVb0zrII+HwR7WAaryaqpyaouC1sEeDk4h7jaB6vqq++XUjL/bhLg7OGVkByV7eVUt/MUSJ1RVZDnGroqYpPZpi5NVZS9YZotbXpei0gqadBools6GzmjFnW6KxWClThJfRs9EuVw0MmHorFocedIodeKavr7coNpsEG9eMwYGeweVl5ACQ12DfuWD6G6kwOCkUa8yKGvjZDG+wwMcrl5WM7NZln9PwD6dK7Gbn3ygVb5J/p1+EhJGofmQU4oiDtJ/6t0/FZaTGYMcYqmZFwXF+pJBH8P/zbfYi+Ln4hF+QTug+UoIwgTci7dE3yvxbQNv5fGbuDtx3RFFupFvT8YUG/F6RfqSL7jLnA8FH+LtGlkdDUFOohIT2hNTmnuQSGu2Lgo/fJzksPkVU0QKt+js8ISeGSRh3bBoOhdfUpxtNsAkDTGnO0isEJ/lOLHf5+RG+cZFX0b1iXW/+K/83yFxNzA1IOkgNoe0n9YdaC5tPl+/RdpinB8sHVSYaAIdl4CGANan533zrhn15IPMNsnvaqCF1EfVb4UV96UyfJSaVFLw1Ro6ICZgmeHo0ev9ORabHgLCKnvP9TmEhRYXABb6J2N6U8oLZy3HM92BKKB7pzCGsA/7+rL9Q3rW659MfYiCZ7ZHQkVxSewIM6wqjEnKBIcAoTfNRgVGDzr3NdRoYx4ON0Xvfnsrc8495m1329MX+GZ12rsRg9Gvn7TaerZ08QPyHcN2AlcCRZNc51yMb2cT5xud6BesHRpvw5lc/o58bcrh3JV9J7F6ky846CPMUwVRplX/jcaczC58H9nZslFY3PVvPHw2ruAM74XNbHq4t4tLbZT3UZq6Bin8CojOfXLue9h3WTZ+lbXMEFBeczoAfPfCt3t7e1+2VEUwIwoEMIsnVUFknjGHXDU7bOSL3Vcu500ki1YP1fN91EnEn/ixfGUb92sDXo/DNtPLgAubXp7Rwt89CYxzW+egLl6So5yvsoGTCUl5Gx6/qdiMJ64iy5N/J0NYUvzjWwXHHouo2ljtO1oiUjVLb2nNVGos2EW4WQZsMmTjJE/tkZGF7rt1hmp9egpPVaTu+fhItf33qDC76RU8FZgT+y0wJRMvkfy4oLbI44BkH36rMzbcqMadljj6+ZX8oqiw1wglAwoD2AI78obYB96101gMXZfcUfzFxbP/Gzwh+iMUCxwbjDk3Kna+b3B2aK9NCdplXf/GCBkOy0xKZ2tcaI/TRrdJBcRCGTGxMX8Bt/6gu7/WkME1oHM8quNarBcUORARJLHR24uC5vbHVYa53A99dKIfry2pnw1QEOrT9Qk+5f3k5jEJRg3I6TmZpk1h37z+f6y6WFNDrb++0pS/CFvc/Zyva1qqvf0hHPi27DeWB3cojEGR5xs9/eJrHzLeucc8TGQ50WI9KTlU18JrSXmZ9XBAP8ytLxNKwrtGRBfWH/UIbXxMW/KIfBjPdE5N8oksiPUq/i+hIKcODpNLhYbi512+7HNw7GzqmOCfDxjNKbxSdF5qaEh6bgQGgj7tZs1OCP76gNESYq2edkC807DRiKn0M4nT25IOe0cRA3R2688oxmwYrxyTkxYSmpVHAXDgYl/S7i13Dddj3kXMznrqByPxrWgN2n1i7pPwBdVWTAJSHf3zXVImoNatV5pH299g2Rcbzhl5JAZTH4/foNSGZRkE4vRh5fJ4dT4k+oROc9mNu/4C3MzY6j/y9nEscpZNx0TTFQlsQe9U/p/Rtthl5WHEHamh/HielF6F3q0i1B73i4rxADXej8h5s4uIUzaGihbp1nzanywSy4aOrm92lWFuBhASTGLvrCJdPW1oYvHoDq5HcARZqjzYZNp2AFcHxXbQM5ELcUH+H4WEMT2qXzCYl8NvltzeG2GItPF6MvnpxVMJZw4fCiOYlDMwjKTAmKQQaC6B5ncz2aeuWJKl0MfSS+Fkrwv5N+rNGDpIj1xnvZvHc2ujhDP2h2JwZlUNkGBd1Qu6IUs3RaS4iM7729JKkVMjQRQ2j9fcu3a9zjawPE0+4Ue9h1ahHbpPv+9yUxxA3JAq6u83iZm9/Y+7QT04hMjvxitczazHWCHx0Rvwbh4szpENL7jfRK+h908MfhIyP8DARCEl/isDUTE9A93QBucqGQa2Z5yO+yMxzWhlTXyWmkd9f0fL7kB7HrH17FCX9IvGiqHGgPrtDkYHk8TsZnQzZxELCzcjB4RciclFG0+MfxSzV36IODf0JaaGEvgToUOwXrC0RASp52n6T0K4rOFNyoXjD5L175T1rXZBa+/6jWgkIQkTjCnUGt2WZ/Cfh/NIetzYhi9cbDyHGOghRuH87h8lMhAL9OZ0U8vabrWfklejfr1Lz+90OqnS5XIkPSi9q0K6pOAhSGot9YzHjfdQrPtl/h+4Tm6LQ8FY0Fmb5wVEC8INezN6rXitLciGDohLIiYYzT9R9nFflGgMHh39utkT1okPBPWqW2vMf7SGOEdWQmY3xvMWl+56318u21C1+EqXftUXxKu/PNPbw/9evBMSnVsbRH6u2Tr0qOyOP2jMpJTRy0DPvz5gANOuGXXeh0itYTM35i4mZI0Rh/wvXzIrMgrg6tc5Ft2MA/k547d9f+C/pfFj+uNHfx+9fXM4ip832R9/5o3vN1k36+h1HtfHbpV+B+oU2/TWdDm9/NFQ38IfNrAl+W1OjNHHBlmD8/R5JtUnvf3M//lW5xp9rXSrtI/eJ+XFXSbh/CX7lDgcay5KKSz8r/BWigrj6cExAXLqXGZlctEBFNAOfFq0d+EfsudKbiGdnsDbxjlMHidz87VlAsiDAgAowG5EAjkOBMBi43YGxC5VC8LVHSYDTSF72TR4B98KQFUNnBu9bWDVqLqBBlM2A5tJtQyUpnGps1TIwDyjygbWkR40UBuiiNgqNapBBppK2QxsBtUy0GTKbuDmqKaBXXalLQPcqlBapxzRDqjYlCvArZ0ykckejp0LfoNytNdMgBmEIaBoYP2oRgCNyGPwIBMROUaopwpSWFOEW+jpLdGVnfdUwaAwNhuAcrTjaPmqfPAOkr9zyzlAcGTntoaHhZ0KjZec8vHAjSBlI0LkZd3Nbsxu5BiGzXpSdphKitsIviMHKc+yEKfZQAS+5PAgEuEixbxUcUowoJPwK3g7JDgpNl4PwhNSJaISZqO8EMgji2CEQASJ5XOxrQiUI6fNsG4GqkJQFFaQk1JNsY6o0w/LyLKlagbkUI52BDcmR1DjxkOjmqimjokeBBCSNCUQCQZtv7eEnEH0sGLQRUcJTL1NhXV+LFXSYZrTBiJ6sIEkcsCcbgS3AKLK2QbCQw+O8GBCYB/HyQorBMRou3LDnttx7iHJ9XbFWIaUWeVzOJ87eVak2sZtlSobxyQ9aNwGNGmVQFUMn2jURsfnXUuje922d73Cg8CcLrdHb2Wiz9U0kRvPoemdRYvLEwCFF7WLSw6tb5HlPid8ldxxOAbJfgdzPySlycbOlRw9PaSQvCQ0Mk+UiCyRIgokmzQQp/KK6FC5qHlBmYuaFfQV60CKvpf1pa7k6HMyqHWdThqL+6bnHZ91TtcCTsdGqAhhKTJ68UEDgJsEzS/ZUhXeFtivYe1NgK10irns4O4aM+736WHfPqYXKbHtdfbSOfty1ofj+ch4OH5uC4Kc/qkM0pfTfARJuY4c70kYELZrD0mAn/T5UuFfJa6zJFzan84/XSUNM2Jsf98BoV8Gkx1MUs4p3AG2t/awSoYjtmeL/bGS89LFzp8xj0d23Fcj1nvEdH9O7BJxlkv3dcxupbgk/iMawOZ6Wx5CIJqxPbrvT5VcGDDXc0w4YV2R9g2J2aiF1yneO8jmEmWRPNdxZ0f2xyzOR5zXt+dCGxdDF1EbU49O/b07sgH2Fa2dAHrpI6UAP1jskAMdd0a/W0fxACpXSRhl2NN3nFP3zZB80c+3ojSRQyRZnMW7X/jSb1f79uhllIyYoQD0fwCc96dwYs9CAGCaT8+yPv3NeI7+YxO7AwBA3zvfMwCA+ZDlf7/l/p9/2N+DARBhAAAggLC+OAGIKypwncREdW9XnyKZXD1G5AqQE4la4e8R7qEpbJPCQ0/5QmaC5t23l1TKSylvEaLWLkWNeZLs1KdZJRAl2WLjP0CfSZyRZA7nS6UreX+fJ0wOcTk56uIZLfSUYgpYnNhQpaUzCDdIx5lzh5mvO4SzwLQ1CltLpexwpGmyS4DcnuN9XpI8YSQj7GyuocVPTkrIDNo3v4p2btsTd07x9L3vFstU6pgLiMd+uxRdGwRo5QSJy/PLntBTPweVzWdxXZXw0FC+fsmJNMXzK81Gckoq84rjReXyDMtQ6hgI8TC5+u45xT47fAHL3SrB+t8opVL/LVd5dpQVdhcazmOogMLQRGdLaaRR7xKEZ5Zkx+b37bec7pebOtlTRKsVjo3iDoUruaZ6QY99loyVzjbqKPPIjss9QilGpJY6lQaQ72/ZecWpIeISLKQ0SSNHOL17tDJyEyF7FKl0N5k2KU0q6mgrrDjaoiqcCDlNZZEqdvb0DhmkdTbh/e5BKSGkSgDL2eQ5ixzHytEqOpAoJjkuZD2kN2V011+Fc0N4seCQ/WxKJ9PdDGojfkyp9DiZs11uFZXe7rE/eDejhQSiYI17g52PezDzhzd3LHDeEU9EDzHEeUFEERvEAkWIMOLJvzmCiDSiin1DFPGdF+dNIHaIFf9G7BFrPvd8iygiXogn4t7nNyKLGFbML6XjL0dPUH8QT54F8Uec+dygDuVK2Ll5Z0xgf22w3/foXorBbtQ71C3UkzuAAPgkhzAzOKEETlaCacHf74qNOxQSJQKAI4ClbRHiHLfF4BZRi6ZrsbQtjjyawEOrf6zcrA3Q5y8ARRAvHjyFkKZBjboJSjPmzwA+3HZsyg+ZqjjpEJ+4ZbYMFoVbX3ATJKx4rlQdz5/Lk4T40s4mS15C+eYIj4nn43KM2AaDBPOSfiBE9VRNh+hg9T9kun8VZFYLAUgOGDW8oOqygCrI1J7dqPIXxEP4REtkbvyQRfCz3hmm9BkyY9VJFYi8GlTvmHaWXAE=) + format('woff2'); + unicode-range: U+0460-052F, U+1C80-1C88, U+20B4, U+2DE0-2DFF, U+A640-A69F, + U+FE2E-FE2F; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAABnoAA4AAAAANCAAABmTAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGmobmnocNgZgAIIEEQwKvFyuQwuCEAABNgIkA4QcBCAFgwAHIBsCKxNuLDxsHADb+BwnipK9GMj+6wROh0BumfMiQUaoWDWaO4tGa4WtoMBMtavqtY9jb+C3vkgTR9zAS1e/IWxxDF8nN8NnIySZbQnEMfLSJu0/j0DNGWDPYAygn5QTdsbNTj30B5rbv1uyEcI2asaoFhtnA2LT5ogc1WNUbGR+OkdahUGpWImfEQbGTnvg5bSUZNmnbZKdUhrPBMAA8r0bfrNviW+exRNAwgNgAnCj14Z0y0NEpndEJQYcwb5mQTQJojV027rMxWjbnm5QEFNrXv7Xrv7PmovbEC2FaJXXoeJN1OMyScVP/kE693vn3tyqdjdUGoXedOBNAVFUJpNf7wKFUdmHn6u0efc3V8CUeEo8Qp4+X2FqTP7/2fTe/MlCFv9mMVvKzdGU56aUhTJbVhXyMlOCA3YFBSyBjai9ugrjSG1PWFVbm5WaYS8hpY9WXEMXvMakfb2MWbr52d5cqHmLkIcY4+hYuy0CMCADAO7DgBSoUYOALkMIGDOGwEYbIbCZCQSYDkLgsMMQsGQNAVu2EGBxgYAbPwgE4EEAAQyAHQA7gAAIAFugwQDO/GqtA7Re7BdToPVm0ZsArY/fVzTQgvi9WtBAFgIyQAMIAA1AA4pysAgAgdOCA4B0J64Ft4B3w78kpxJ2Es6QXxKWyankVDJFlVKJBsTkHesiniN+kdCSMJHIlZSSqJP4QaKRl0kHSd6kGtLgsuYl0jTpB/lg7DfdhLjnMQrZ5GrdueRycgP5Jfm9pBL5m/RIUiyWlNo2AIZcDj7xgbZnYUhn4TmaYuMAe71aExdfJRh1662Hv6ACRMfT/eQdS1+FqzHMnKLtNTIHvZ1t9L5Z2tvq26cn0FsoM/MF3NaHPhWQE8Odm1Y1m8XWUiIUPXPFURGoC+h94P4qovl0+DoWstdquk2j8bQnimSrGXrLcRuWXLiCtqipOwDa772Bxj6YJGsQoeZ5U0xLwe8sCO8Ki/x2Gub5UHV2t3o+1Q36BGpsOXn4GRbKWrjNx3NH8LTie+X1fh0KcI7+Ht10m3i9LRJtbpfc9IrSKqyYiKhaoJqGiwWKimls5bZ6stj2WEu0IbqVb50DXC78RtajZy8srGzsHJxc3Dx8/AKCQsIiomLiEpJS0vIQKExFFVRHaut4651Pvvjqux8oXX0jYxMzDNbcwsra1t7B0YXaYwhLCEceTzp/tEiYTCakV7BfVDomBJtnm2CX6ZjgFurOY5Oe81ma5MjizudJ4Y8X6VYqRC5EPkQxRClEOQTSJwwgUAEEyQ6LqRRMk9gsS2CNA/8C1+TWulU7xYKrO3J40nDX7qT6xs6cMU8UUUI5Q3qCgQRQAQSJTjGVhmkKm2PpuYbykwfjX8G16NYKs8euWFge6VUqWg55FFFCOUMiYUICqACCRIdMjUvhGmZrHLQPHjdclV8QXAEGJAgA2AAAAADADwAAAAAAMFwBAIANAAA8kaaI8pTkmZoFJTs9tyZW+lKaToG4sG3sgpMsaZLBDW+RZB6zBQHb9awr4kkZGHktyaRnMTjCXpRvLbDTcVByU/KQSUhGjMrrp2kVqCCJ8CTQyttUKDJd7d0UpRvqpR6bZmEgCwjmQXBjMJxnTqfsJl6Ie3xbjKJSz3qOZ7HMHsOx0c1yT7JCijYpkBmRjZJbXAMw4MCABic4puGXoLoqGF/AtyoLwTTechmkMrP1hkyW3Ma8oIgSykRiYgKCFQCCRIdLYM1dDQf8xZX8gvVAlrb5jsqGY0zRyxnzgiJKKGdIOgzAQbCCrNoPCJJAB0usccBfXM8ogmZpYZGterYB98ClUSHdi0JEAjc+2N7MHIgbML6VtmT2OOJiRAiV2IikiBMwaTAKL1LIAcoRFopXWqnaCciWZzvmQrgB98CFgqQ3BFdmKltLkuQGrDlc+YlYOpP8pJDrMduWbPNI5REUDEhlsw54d82idp48RRmQM/7jSUTw9Lm1TMLelgit5AgqbFM2UIvUyPLNsfYuBl/6NtJjBW/eDyVKM4FElzUnc69/zMRhfZVaMaCx7tezUUCT35tivCsdl50BKgYVR45cHdcSpMsyiW2owDkze9WGIeyhH3sYQjfs6PdG8KgtUE4ZgrCAD3LBE2cZvAUGIfJ0HFO1xYuH5Jv4vR94T27l+EG3MiUD/bEWFtHHuPubYk+7B+r2tOJGo53iSbMbjucCDR8uiNbefRDdtQs2cAr7S8IQxJnctVIncQ6FuQgo2gQykEERBqgvAvfbEwBOkAEpkAY8EAF0IIAcCVgBRKDYMxtwTG7rGVV5kgCM0gJUEXgEuVkRA7rZ2Z+EBRnAeiAi2TMAACaq57AIcD3+JLxGNDYkkkAwCVwNASJIXXWTMYwRAax2k/7ocrXEGqEm1B6rBrz0LG/dceXxDR6gKmoDCMZ+VZ/Cbm6ELuUbfkzX7pEY2J2geo4AywCvZ0UDFUgtIJkloEIFFkAD0AGcgQUk9XDwxZwi6sPA4DRzbe5Nq3TOguy7cu/fPxJwWmmcFmmd+Sm47z0ksR0CcHDr76M3JQhtp90HPr/cJyyqHKhxFHjwCyHdxld2p8WDttSpo8Gvhyu9uTIQfuSvEkNG8g9/Rdy0UDvstEuY3fYwZSac+cjgXqWFMkVpo822YsSKEz/W2h2VIFWiYxAexzD/SAk/PCGzpb/AjAXbh0H4g7AHqJTt+fbIEhiBuJjc3Rxgt8dob4utMtg4aH47bDFn6Owmp3CA/Hu/oMS/eYKV2V4cVr6MJ1bIUoBnzL6UVEWCwP453QseBUsq6T2XAN5zER6+eAR34B5HSMW9T3irfATAt7iMwB4YXjyIAo85DQbFqN0HlFI4hMdI1U74qgUOL+9ShFfP7sNteMgYPEeUD09TqqKmRk/OQr2RzmwdNa6wUstXskUqfcM6zyeBdf946aRPYOQe7dYzIuq4R9tW0o7qjtwgcBq9n7TmGIYFSqNLptTKWLFiHj0q+ZSTmK/DRfefOzgCpfC24Co2YPlYLlrWVqXFbLvB4eZXl2lX/Ldx+rwpxcKoQoFyLbjyqKlvnDOH2c5GycoBge1treXklM9OuD4TxSOpfsixxdR0ROg3yHqGJiVyQbhOGLpPa3Ejp9rNtxHg8XtZzrEYAjm1OPaf3zwXO42LCHQ0Si6wztuoQ+fR7thfZwzB2iPuXaoIsS87f2p4BPHkS2BxWHdFr8hgmEXjFamJuQtDw9MoRjkFE3mBoXal0pCv3E4j0KRO/Lbu1d5rK8uPt6WZt77W5z6p5aGoUlnX0SHVcoB4l+nOzOiW04E6hrRShH3hbWU3I9d8/aOMK9EV48M3F34vFsNB9clEGFvEI/DGvPCI9sssJbVded8VU5py2oIeVF3qBaOtk1i3+uJ5wxxmo6d6Cgmo5cCyxlyn+Uu0unAGd6kWs9LhFs1qtV0FupWAV+YaPeZ4wnomp5STp1pOWtZuvnlv1qFEF7z5W+F3TS1Cg0pB5xk+TdvrWpqFMcrln9SHuDX1Tcm64p+jQQiQzqbJ0gFfK4kGVJgNfDkw0AZvPTfnY5y1MiPXq6ZyDXJCcqId6lnXlH4oec8PA77s1gfK3SdVah52+aR6zNNotIm5EZxNjvcJM6yGRjm8DA7QmGY8zzzK3mA15xOup5nplLTDT1fJZbyBfclM16MdM7ip1SwBdd7zz/6ZoEDbT2hexkSVi3jy1EkfWNyj3iBRuUBItU1W66kgj1l0uC2S88Jco8MMJX6lVcrIUa+nfovKZum+7tmYVlmRpoD5CQL540a4VBz7wciAV3iNl762mJyrQHrO/ENNbmPG+aRkdFuUW6z+nVxa2mr7pia3nZH7P2T1CG50mP1BW0m9O8Ku5y8VltRt1W9lqZArQHVjT1lRTzyyaLouj0lL1HoiDOFsCs4TuKZiHZ7zgG3yjiCn7lpDAGAWXQjr1v7eO7DbHE0/UrGVabyiWTc5GUnObU9nqEogfQTXp1NRrFY6e1F2ZTYzyneLCQ/LfZCPWqdoj5YsGbnrk6Lxa5rBaJpabzZlXFJqRzg1/S6PL10HKj8mJKPyoBtCfYR2H9Bje0aHUM8VKSia+SxJGUmKYm2iTVejlAdmZr+qEEtnP7END8+tSQt0LX09Yyy6rLSzMLoZczVSwkDO0VOZDCajYUvDqVZLQ62Q5f4I2tym3ZUPXRQjgBeMYD0dAE+US97L+SwZOVOPRRzTEUcsbF9ntzHClqjmKZhRixBIuK9puc+CYsAL0J/IjREPv1ov/QhGoiB2kvDiu3z+LeVIXoTPzDzO8OwvTqqvm3+0c/IPsOx7Lr+gj/vdI9GUtxZzO/1OwVbZ9oGvmnjFT2K5qsLM3GbBF2Qh6WPbz8aSEh61EnaGZh67cn7sDOAFfRODhcfAJhHEaVlpS4AXLDllOYmhVgx4gRiMeALx0hTu+2Phz9lJcXhoeACby4+ETeFNPTdrbmxnVlf70vpVqerX9Q1g9Q0B3dyBvtFh3wdbTysl0YVuQ/SHrkqJ099q/cDm//7HRaaUroE+WlfpLrhn+6h0r9tZD0pHyW54KMaJhpG2pjOAvLf/cg7f0jb474f8Vavb+N+R4bc1S1OPlRaXDMaM03LiuZy87DhkCxzCCW8K/wqvTaSATlHDOmmN01NXX2mbyG+V17r26syUBqgUT41JG8kDdllybxi3rXHybEY3nPlcss/e0cPFzsd2N3oyomLseNylt5cwXQuFOsfkMD374/f+mUhJS3M8ZuFgCyeo82vURGsaYpff5mS9+qKMcbtO5lVVRrZ685Njd7s89SWb1XpEZ8nG3qUQo0JiIQFlooiSicWB1H0HTLbs259qsR8Um5gVLU09tWb3rpwwjsKkNNJK/9wstWrjlmfSi1/IKpMXJOqi/wozSmcpxssiidaMCz/SL59tyr4cFZl1AcwwlL8zelf6fcMRFPDPp0kBvklnbk5rEb7iGxIvckt2R0/viSsNTz4HzzX3+Jr93GCrPXS8NfvD+eFrny7/h1p4ORyz9jiw08Rxx+qdDccso44Xfh0c4d11Dmt1/Yg7Gung7uK+H+DRpLvMQdpRDaknIY9DZGyXO0CTgh+sF6+wdOFrN9nFTV8v3HdwMKVbqjkojmwiAP7RsfWmZhwzMw8zM46p2W3jdP2AuhnkaUbXIRllorB2aC6+t1Lr843ih00P7k89sN8UzMKFdUJhNFWBzW4QC5MuPqooOIATLmYXaYb+VfwskPuwDJcysripwMnl5/EjGdlLwtSJQLB8+0x+Xh/3q5fclL8J7sTclfzpBlENkuKHb0RlUU5ufa+QOPV3TEx42SGsLirhU6vA+kH9unJ4Hx7/IO0OTSzEbRZeUl4vQ3RTO8+r2T0Weozo5GP8mHRv5e3O51K68fmFEWG5uVEIKIftTfQTG+lXLQbEj/EmV/1AVaITowfI5JZrvxZSX5kCXnBQUXIsHNAQfvZMpudJET7MjorHsmKjKrJ5KwfEQs6EK5A0BUtzSXNLgBcMeS95j4LpiLDWVa9uMSBmlDdB+/kJMSRhWc38T6KbmJsZFpiVEIOAw1f2F/Zl9jfi2ohjdl67ZcY0eaVzZzWD6e2K/9ErwEoU3hguDu/wCNu22o441Lae5VztInYpPeG8rq9lNZXEhM0j6m5FYQkBBaEscWTK2XfsnD+0ZyPukc1+a6N0EzsSRvTn/lT8Coi9GCN2qkzk8hviPGNyAzM7bzdIwR68YIxPS2t/k45LMmD9SHCXxJR9UaF2WP2XMmPwjOEp975pLzxyK2yHvz5rQzRDQ4MGzFkthTZKablcZ0e5jExJK9AvoZeU2qmlpdLtnWVycuUdSjdRcn7bhamzg+fvdMnLoDJKbeemBk6zuzN0bYQCqt6C81qwnEWx0zvqdQR4yVmYvyO+B5lxEWU9jbqtoOwpmLswJ547O8eQZQug5x40feqgMl47uRnrliM8QZohBz8t9jZ/UuHHImKwmMXfWDyhckoKRz1Lh6nZf9xhzK96S1F6kC/9dLyeUqtLeUVVHTP4x5gJDPGJYKYuuzhLrlqsuKhBFA2saC3cAhMxd3NNJFsFv/Rx8vMQHDptNrcSy6pXSl8YdrT6K80bwN/+b6NMU3f/BPpv002FrsRYYe67FCk3RVn4jnwGvGDt9XcxGRmZH+BDdhoPtBuXJ77Lvpd6T1adfSOnDRZOP8u+r89Yab1z84jnnrg0y2a1MkZNIz0/v7jwGodX01yV0h0dldojyE5tgDzm6dfzFQWHHDinGD7yMTxW2evqKeKENPk8P+0Sofv23ejE69gHsPEB5zFHxLwNiVc9gs3HCNXS1Z+5pTiR6bDpD8ByalvlCHekdcHMZiBpAB1I/NWvx15vR9D91hbajraHfW/TtcV6bzKCbVjK/mNcS/Wzu8+VfBWMx47bhpT7iEwjTpw66W1rZsXa69LTO9iApJo6HrC1DrDcLsr7PHx29E0jrMcxRUzR/dap7cICxJ0xXSgTFfjp9Rrw8a0btsMecyYT5ayncikrOj4KDsEozYq8v4skpE7Csh4Nu8KYiU7ojjfr3b2HMteDHDrUPIQy0evN11GgoJwWDsrMhh3YKOcoNIp1tRvspEn3Np8//OKO6P4/ee7+RhX0gfJpO/PVHaKWUaveexiJ/82Ctw+H3fQ1PHyTtOHlRtdDDX5tvoakUWU976ArIOHBRLktXJRbRMW82mME06iPo7z363cPbx1GD3O8Xf3d3BWkUFAsZnJtE69mxxUxj98DJijSbmLu2Y/9PthbAxMOvP3Eu8FiNwe2fhi9DjMckxH9lY6LJ9knmjycjgIklU0yUfNwSr3roTVyJX8cFWrW0Qhvq1mPsJ5Rr9CXZEOxciX374u0gphb7ICzEbOOEZxj7LhyyXT7NjvplLhcSOFP0O+Qfo5/v2t5XwpLezA2gjLRM9rf9Zy0o1qzL3D/m+/4xmSKcmbmssXLg+66vpWeZQtXbiDnnc097K0+m0yf9DkJ2uHdku84GcOncJmY/jPXWyzyZS75b4u5vBjs4uBUuC8Jj3bXdNa0oW2SsKP7ZKQX3kqI8YzsHXUPFxK1MMo/iTrCK9/eYoeEBOeIcFZgbBEpm9V2SokKu5qYUb+uYYTna+sWrlxD5jl0Gpci3brYA5bIKM2GbNFD+p86KWLuWjzhdfzIfnfrowDcmuZKtEH9q+ZXKBMtS7zFKc+Thyzc7VigMzjE+Ip24jp6zsWmoayOrHq0ntGxTssbMQ+xUbYlE8zMFyVIdcIZ+GvX74LCpgHOew7K/LBVBFEhVa4lrhlGtRevmFy63GJZdfbqzgtXG3rwLiw/G6tTfu42zix/ayuWvxu12FGKsZFM/gZ4gSTDQ1paBKZBXcHzyNfZI6vTfTN6hvHDGEymIl34Xs4+Xrtvxo4K1szMli8Gpd2JF4fmJvJi032crYt87TwmE51bgocVHn+ukQgvnMxYim1M+y811RdMulmRPtgjs1iPiJ5Rz4gZkiaW2Muviqbxw8GwAyfyc/0TOqBbWxDfBdvX4x7hlnFjHdHKRRhly76JSvMO82EzIC/r0Lo7HQ00u4K/ouUPy39pZgW9bhwwWogAZGYrDcQOJxjeqkhOCUCCyg5S33K7BzkhwCltJAm0gbHZCcNkjWcQgTP4xDC2hgiv6gP2idVCSkgIaaOSCBlBECuErKAYqpGOXUcqW65QEIqCbpQTUNMBKz+ezTbwwatcE0qGlkSr/fMs/Tby99FuzzzzJQLdGbe5SdfBchaq+lf7xMEO6n3V4ztQzki3RZnL699Rv7y3v0EeniSoBLll7tAIorYE6xo03iSB4frYhSVQCcrYUFysNDfbuj7kq6mO4o2pzkI2ijbRmUaHoZTOSNlv+FIJV2Svj7WmRtL9ilZ9qNsrP9CwQUBd4J1zqq7/TUt2I0oa+cgo9YyVx44s9ngnjVEstXyrP04mBugLTUOn8BN47YQjhTrU28ewfnEg8uvRCrSQurE+rgYPzfJAepaIif6a82G/uaO6w9QAAWx/EVAIgKZ+6namtHNO2/9LKG8A4M8XOSMA/iK2//5oLD0iOWyEAZuAAUAATP9jBtj0G+y5vEfd5RerfvRsHvEGxDIoO5SSguLaip18e/1exc1UY4YwLEkonshLOR+7VivOFwsHWbqt2Lq0dyoPsWuSENeQf2cuq0wSm6oOJQEYfZYUlsexVQpudHk9VkRGqKw+lbVMrU7y3khnuJGncrCsqw6FJQH5gwAas4FCPnag2hRXO8Miw9bhzKp+K6wMubNS+fytfNApjd8qiwj5Zc1v2qvLn1QyDivz5PVTePmD9uBYkwqOZDl+BsrLCqoDC5Z5KQX9O/V6wD4f4PXZnEcu/vgovhQxRlCG3ny97WxGqoIMpp0h64XU248pa4Ywn2Qsw6zj27LXi98wkl86KqlU/qb50EE6fcbrMqVKr2hVPoXUK4iOoza6o17KFVXV1dyE1Ie0a3sh5SPGrOhWqdIrvxUPmpuEvjr5kU1VhzYuar5p04g4GVCBAPghjwJL+CtjtvIVxuq6cQPYsIDgSNuhj8EpCNA5nYIBGeDeFqu7LS4+BQ9a+CTAnc+/Kyt1/Ff67yz27UYGhlYeBP/ny8BCbEAm8qZ6ZyTQKF4WDph2txqY5ZXtWdIubJTdFFtF/iBWyQOoqY2szWAcLHbqexZvSgtLI0Nbh3d1SEwKy+1jhpbwqERqxkryfYht5vUdq6QG5T1ejIUBp3lSB0Pj5BJFNYQSRF27G4/laT+exYVVows=) + format('woff2'); + unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAAMAAA4AAAAABWwAAAKuAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGiYbIBw2BmAANBEMCoIYgXkLEAABNgIkAxwEIAWDAAcgG0oEAB6D426JQgSiDJGrY+EepR5ejwf4/fWd+/C1EBKYZDS7sRFxHTf9uCJn/m9Of4qsOwRQBbqEex0QSbKziM9Pj42dA85/tYTLU84Cj+f+PIAlq3AtV5GCrQWUqr11TNFedSEUjKs7rSju46fX7RWCSHFAeYQcQRBEKIqiAgIKlGZBdO5a3w4akEBWj6orkgSzThrq5iF0WjfiKGe7e/0dAHkwOR8nW+GblHR72hyEGmzEl02NcDPu9oBKt35NVVBcoyEuIJNhau72SE3EHkhapkdqCiZGhBhliQWUJVETSCQCNfr8o/boWoBjI3miLHqQC4ojH22AaUBxFAUpIBJlJeIVGIvLFI6PlFi4hGYVs0brZ4ZZlT0rbz1SLT+50xlW3X269vh2x+CpO/n7bw02ebvIys0wMkpteMHUIq4PGfxCRBdKjxXGaDRIc42rK+a/qgeebsfBvjGMiQ14cnJjW8fSe6fHlr2NIrgbeH2jS+k9X+md9WJP/5IvZ8LRg1cQ3gz+dJMePnr2/6ZSiy3c9rHc87Zj4tqOx0WLe1U0VR2OOEt9kq4gV/r/NBEyVbPvpL70poCoTunu3LVVZ4nW3xWV8gAKP5VqBMD10Pruq+7/52x5c4B8EQjkzs5oyJ/1JzxT0mgEACA3XjUZACFDut7UuAEqPZepikCuTcprJBVAcSJREzIBeaYSC4kSGAs2BJU5IFLcQjt+sxNAqr55kwOx947iBrvVCRYwpBuDQusVLFWyFCmCVcEwCg8JVsPPK1GwEjxesNZJv6dyHtID6dYP8UnUCvPAemHBGiA+jD6CVgilD8+tWyfSPRiYXwVJDNNkydPUzvrRmeBZvFdArqSTDSCJ3ALcvDp0JBHWjTK8pb0Qvx7N35CkXo0yFRq1qZAgVaJkYiA7H3AA) + format('woff2'); + unicode-range: U+1F00-1FFF; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAABK8AA4AAAAAIgAAABJmAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGmQbi3YcNgZgAIFkEQwKqUCgdAuBSAABNgIkA4MMBCAFgwAHIBv5G7MREWwcAAjqiQT/ZYJtzPyxTqRrsF1IYVrRiFiApETA1++dMFq11kZtOhdxHMTvna14XthLn3dGSDLLg/3yf+feJLvv07tDOZClulqMQCikLU04jMMxKJjN/62Zf2Zn6Q/sAXIBXSvkMaRJCZJ8M3t1ycm+ClNhKzzhQnWV6OBa295MdqJv5linkmiJxg/83P7PZUGHMCpH9J/UqI7hqE/HyFAf5qgQjBlEGRlMe0AB/E+trYhYqhYSodDoJpHmFSLRpl9DxF99b+bPbd/9Mul3vXfutinJdmq2SYcgiepGYMWE4fI/gv9/7tXmntsM+A1QMfsJvRlBau7lFt/Ph5aTlIjyh6Qqqytc/ghL4MaOQM7h8RPOAfrZ2RbDVNs3+l+IXHLYYLCHNa0644xAgqSirxU1gIOBlbiLdAndYX0II8IgTDII0wzCLIOwyCBc4cKu4dlNFXaHP9sWTtyR4MD5NAYg9s17mSKyvOboCQrPyOmJoPAqPSoBFN6HZSaDApjwIj0ZeEAw0AKQ1TnJabIHH6vLIPPQAK6M/SiIkW0IU27qT8eZPitTe9bPj6GSZmEW1pHZLyhh6Y3R1dDHYxFqzxOMK4/vhwnFgAZIozS6RzpKqz0eAxqnF9ScZH1kM+i7/1xvAP04Y7L9rQhtAYwt7Zvs6TSmx2iNmchBkcSIjOt7rG1iUNHKPzN5BupWHYpP4V451W06ZyFJ0F6gTvCrVCv5dke0eIM5HaA9+0OgHG/SdfBq/gtKLPcNkwIYfJxc3Dy8/AKCwqIS0jAECo2XV1ZR19I1MDQyNjGztXcmF5gV75JuhfcjmtBT2C5cJ76diLsGUSvXDGrE3EmBe4hOOWmQJOeK88ShqHxc5Zt63PibyVezb8RcH3g+IKryH9Q/gBANq3AgGhFPSt5J5aQzsDI8hQxQATqGCWM/4r7j/5kHlnfWYduf9hGnsPNPlzCtcFk0kMpDtPAssowqoz9iStiUedm6ZB84lVxKxMIpcjqZQgnM80M0HyWj06J5PlqDcxZobuk0lbmuv83aUzqnCUTrUNHOiAQSgl8gevQrQZF5h4sj4rQ8Dwl5a/xliEVJmXXEy02EKZShAC3IQR/KUNKLpHSRd6mCXOKfAgoIJlJ1/lkkK/4sQS2Vkf4JTy+BmPkmvIM1uB95FcqnWBTlH6kO3trKI3TzAK4GJoJpJobFK0ngtgpmuMsDJ6xuTMKW4eyZpPMHlQKhWxM3cGDAYTZhhckJ27QA/wa60QNCXJgBMppdD10DUqDc99jNkVEE37EeTVjgY/exq9/DeykXkpfTJwS4+z7lAGL3IgDMEWyQuIpCLvfjL0cQhzIoY5bxm4E+YE1Ad4zvyyrVVTrAkIQdiR3REyB08wfsXrl+w8UGzKI0bi/wH+Dl2jVhAOwHJKGopPgIU9F04QlCYEwEPwd/io4QPFR11EZzDAY15mIlNuN63O4gSuvz10dLDMdYzMdq7Izy/Z9kDABEZEYPFEaKEQcE2qy2uCQLuO1aZ9jlORQUlThvXPdt2JLQYQ+nx5GkASlD0h9AITPurayQKQ+evHjz4cuPup1AGrY0EUgUGoN1+DXTbVzID1qEz+Bnbx6A3AJrFxjFYNiCBWg/wQF2BrwOZmbLSOegl+CA4wfcef99OCx1J6eWH5zMwg7GZgyMBXX0URAqJXSEjUaGgQqxQfph2Cy1EGecJxxRB/pCn+5At/p+x1i7bG0JB9REf5MJA9012xqp4QbV2Nwddg4Oht3NLb2NhqIyFYpBaTsqspIhs65IVtRLvStJ1ztgrUod2LYscl0PGPOhnFh6iWR4BA3UCNma0DUCSYrIlTobr5Y52om1M/28oqhCuoLOXhmrO/e8E1QN/HYroSQb27LWzczisvfRSbQcZ5wRFdgkFlgSHhD9ChWhHs5u27MiFWCoWDOVdOGeKhZUqahfoYCyjtit6qNGaGJkWDPsxSFU6gMatNbK2hBXrFOv1ezB1MpY3TkZ+OaomFe/80ecEanr5tO+DHB1z2COtNcnCCzU/AGOjFByeZY/geQ6njv3OVyHyQLM+gyokWSlehRVSTF94DWEyrFXXGuEBorAVGEwhskefTMVImhipSJrBHOP0o67tW0FyLKuxzj0NJPPrSM3sdexZ5EHkwd0JE/6iqOTDRkFpFwRXz7KSx2BRwCbCBSTWcayAiv1XQOwRx4JirxUMiboo6yFoHCBr0tPoLWCrY3NYVFNJN4PhW9M3EPDngAloTrnZWSyfro3Ijk6S26GI5gXBUtpIrgtNYs46LbMr9nhnBMrd9xVJIYCskvWkICQugdLG2iCgeOkJZJW0rKuvZrjO17NOMPXB2uG0Yq0EWCYKlB5WaPzuIfkZV/Jaem+jsQ4UPBopGny7O+n3CQk8qLw6YmeVtL50fGV97LmeXdb0WrGOLL6wRQmqj7mQlyz46YdJFat/gkYf3XZgbcPqdeGCEXyHrvKQx9ZM9WTABtljQX68egqAu+9iazbIEeMIztTXLCkBKPSGgawR9roqGzXnNGE/YSBCytXxYtlV7FGEueLgtmyTMV535FH98G/IcalXkmsunu84y7nwPY3Oe5dgZmnU4C8fDC1BzhTW3Ykytry6a+S9b63/CTC7uMjU/BB00cFtsgkdNb4KpllmW9qHM8nTw473U1BW3ml0fJbzacKAt3iadT4y63LIUzhnPt8RayRUSHjhkTDPM0k0K36YW5sycJGSh5JPQPPSevb3tr+vmy5/rfZPL3vKNEAQ6WhogIBw8xbbEX6wp79YhCFBFUiQSiY0/LQzXJnlomivpDJorJE4I5dDwAKYKj0X8hlWmRCf4xqlmQhNW8D++CHYONV0eyyrLgXb9D4ud+k0vjwxJyQ4p9gkl7tfX5hdRYw1LH1yWZvcCsERkVNxR5gqHvBNcEM6GcAhsoAvcyRM1dau3qy5tTonrZ4qewlVTWQuEwVswwU0w206e35qUiR2MvwKbGbYSKFT+mVwS0V9pQorKzLAShNcnL+A7fn47dbzPlOTYwJnGozhW33W21WcKiRfCdazeAmA707jfw3MgvIe8+v85hj/00e/IRGcQmerxf+O25v57bIpz21Vc2KuoIjpIbafMQAHNAvr7z89/LiegkotQxpccrN7Fx4pGgo+D9BhYuPZnfkIHnPeUwEV9Ihsi+Ca+kQhaIVtlWjEQ0Bs4/rkgPgrNCfv/+ikvKAR5TtLctAzr+XVW2v+DT3d1mOVy3+rFyeG6ldJmfXLMIfHS4P7D/hTMIN4RECAzC3vLXNLUgWFpEWib+PuKY5fSZBxJKQh9T6FsX/RzjCRyc8wXoFxLeQHfUv7gLmPtStEOycyu2dCIed7MyIDnbw+WTKqV3CLtXL5axaH8esmh7w6BOf1Pg0Au712VdFys0+6toCaqTYXrxEMywyXw68jH0kPaDwg0qXfUX1TQXPladCJQtA0Cafv3g+pTL6C1N5RzsOM60H3Wq14D8z2sE/9Jdp9CiM3jlQLrUUolhyS76i/pD8QeWBhJWLqxexFk4/r/zEZCh3rneCmxkwXhbJ/79DBq2L29WYxVVs+zXiNZOO5+utFQCTtP0hFKq++q9JzU+kdhg9ujd6HIXUVP/sH6jbQ2pHUON7/3va03+2B3OmCz04ZWDW3zcw2YE53Y3tpYLuRYtioYZzx7/t/WX6IaT5Q4TEyPoiJKyB+n7A+AE99Rf+L5zIgMebGZI53DBMWu2511jfdXcj8kOBAEli68/a3fjobFxf+HSdOLpv5Cimt0FiKqqdJBsffXPtK5jeJGCZcqx5W4Qn8I5DukNRgxcuPRf/zcn2Qo82Fd3GV/zCrI98ilRrVXHVqq46o4AGCq20rW93xkPCu3w0jqgWLRZvfPuwc5Tsfm0XMKMZuefvpjg0+6dmBYUW5sce8nHrTausTE4iN0ZD7pztTeAkfNj/JyzAs0bfFhZg/wec6PdNN0Zm7FIFncUutenGOfsZ6QYtEJ84PxJE1sS7yT+elrc+55VBHZ3Zr5QW8FeMqcwqHqpcIGeXL0wfaVxNFCJXnoMQrcDYgjBJb9nQI7Ztv0auL+9PNu0akZ39gtMcTY1C7OOunt7ZYWoxzfOODi/yNd/tRs2t3WIeA6Oj1Kb+H16JVnMJnkZ+9sIPiaE45zA3G/Kcm3FeZGC0tXiSVIzYJS27WEOXGik51wcMo0sgSCOwF5PaLkyfusREi6R7JAfFxrZZkXnpBDC/mG70y+7Fkz9maLV3ej8cXj//cRitdlnmpuYmeTUthby6eePzTZXtnO2npBVkBURpBDZjQROV0UU7IW8RPV7glf+XmO2JcxGbJMp6Yb8CarlTNynTRyV5hf/HNVYRAW7/e9L2tkwyg0xTZ8FQ936VrE9OhZfDrHjVldpwifDCChFispyiq0ESYpMz70IojrDFuyjLfmSycJAs0M2apjQNXWpQS1LMrQs7htBedOapgn1LXr+9CdZU4Z2Wv38Pxzx63smlPJCPdH76V5eXe/eJ2IWJOBKK/mCXSQpBqZpntpLyTk3M5tLSo0nnB0C21Jn28eHCy7DEjNC04oUTYiUtXXivEENNdyDaFiw5GBREKig7qSnNmXF90v+4B9uKvdl/HlSCzQsS+1zTv3ryh0fFTc+5VVEcn9llHiNEnWal0dL5nKzChXM9xeNZpPKzYHKJHOt6+ISOYpQ81UU1UQBt6Ol+4TQIyxGqUYNpjW8HmF4niX9Lf4XjQJm8Wdt+BndaIZITdUhc/2AkH53u3t5kY+WwgMQMdq63SBRm9zbltXyoLf/bTJdWYhPdou+2UERGzrcjbbVLmQYmoCdHKGkWO7Yxgn6Wwv/5yHN+NE6PQ3STvo2SYNMG1k/0t8Hih4sB50koE8J+PBe66hsQ0kOx/ueG1AW3+/viy53Dfi4V+Fb7xvAmfu1twKOQ9nrtFt5QXlewK/ZpsWDLuv+HcesGgr4p8QGRyS+qTw5PLCvJ25Y/4JvLh0Zpa0ePL2wtaNuzd3nJJOYNxktaoTqTdM1tQZbOvPNLJYIcEmpNFJW/QFMi4iwVKHwMHrk2KUszVYrs+Xn7mLwI1QSIsigp1O89i1tRXfwc8Ezews/nruLFx/S6U2bCeYCAQvUbnSIcpqK6l9xXHAKj2oDy9u9npD68LcjBfQU4BOyja2O0MtKQpxs/Qu9cvqCb48BcmK54ud+zE+s/cTwf9+vgt/AljqP5xPZUczQyR2wdDCDAQhswFYgALNDxCQOJtBqbNCxlKarIstl4EMAElQB7BibonuMhR6iP+pGOaavOlvphYkEAJHTRw0b0McAQESUq1GiwwRwpTG/p8GEMvXRz/A99DM/vGK5AjqOonERZSEtL0OEPCBm98yJdsR2bsNXVTKPsh6X0fkzL+2gFhh3KyAzjPPjjxYdMtX9Z4cpgDx90/2sDPk6rMRru+IAyX4gbBdIxCxmDiKRZjP7FoqHmSxsLpJYIY7oflN+saKV1cX/p4plTVBTH8BgcwVWtnTIoEdswb118MQUs8SBcOLr5whWNB24CHqiCWeA2KEvvxvQmaZatrO1XXJlgtbkkL0ShzSdHnl+whdHY8qOti7BFzQ9nzYIdUg8yIQlGfHnjdNa8hdCSOM0CxH0L6vXe9OaaCcUsT8MWIo9NV+djsuAXbRDAlD22UUcm5LDRXxbRHQC+f21UB8AvxP3335G9W3uBuwxgDzgABsCauNkB9hKoMfvEs0DgZLVnUSvSIMc+KA98xQFvshylzqJMc8PFDm9WBEtnlqly0SUx6HwAXzzi+RQzeodr1nOJH4SiTFAuaO6fuz471M8gV9BGXuPOZumuZaKVI6AM+bJRYo3pzp21qS/s6wTLCpCQpbzzirbkYq0qeWao0BRzQZ0ryEEZ84TRjCeU/O5Jh5f8hWlgmo1Rxyv1ul5Y2yxrhctCEZ0TSJnbyJJGx+cXyfKNqrObPM03rboaKssNqZTuzxNdqQP5a1YtaEL14GxwbzDyQLpJM+klTVQPqhPVh2oVl1joZ8b1PbUTJL3XgAB4poGQIQyq+iRkAtckwcWOvhAKGJoVwEOALWbQ5biYg4Gy2Wk3i/FiF8b8Ck/kv8EaWHYFLKRIRZYuToxYmaSQcESY79OSwoUlilq+I1kEdVEpINE1JasZqIjKVlHSkUSJpG56ivAImYaUQavSjMySRMkfI0uisAne89NliFOTlQDKpXByutw51q3xNOEjPRUBFvBbV3cpyoeJECuKui2bLoaGL74UVZM1iwyx6rNjwYozj6TiVSTghHCyWzpeJAA=) + format('woff2'); + unicode-range: U+0370-03FF; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAA2QAA4AAAAAHpwAAA05AAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGjQbhlocNgZgAIEAEQwKpyCiAguCFgABNgIkA4QoBCAFgwAHIBvzGSMD9YOxSif4qwPz0HjxoHC9VRNbrMu/12kLLcb/5dFJkAyh0DCYQABqQVD7hmAGzfIo/4k/8899o8ALZ4VCytZgim8X1vbXSKk3P7+/99yvLGmCnpXn1FfyhvB+f5FagPgStyR8kP87bfntzf9vCnc4PA/hUOgM9tZ3O7ENQqEEaozVJgy1CWz36yYeaBRQZEFQSKmFVAH8X01TKv3d/p/dz00uqGnOCfsA5ILCOgsLIdKmyIp0bqWzlFZZCAmvpUEHN4DDYAAgAZDElqjeg6N0eSgukSleVCbzvyIQgwsAAGlsmHB+SKQIJMsvQgyAA+BAAALYpKlzDK29MyjOWJmF4grDGCgeV5WHIrQ9ZR7cEJdwAIAABsDgMwRaIwD5JAVwBn0qhE3bhzqZED5wH9ChbwNV0I/Gbp7Y8MvXnHL8+34hgHxO8x7nho4BIfruwvrFlXJejpEXr95QP5TKdnycP82rfo+/2cIHccrW0TMwMjEzb9GyVes2IdH/CXRWWWoABZK/QyHXnNr4t92jdch8kcaXGAOXvZup6l10nhMX0N8CsFLyssunnZMSac8IgwZAgqUFmUGzUj8AiaSwIQA3qBLkFg5fAuVllk8PQATTamBesoC+kDLBQjVbbxgUSZJkSXanLIgvQOsTs6yhL9IgrpAAUB3Pzx6vAjA6hXjSSo4rD6lWA2NtUJnQk/6SwASgu6ozQBLoOwDgZQWMJCSBGZHt8OQQOEffex8JDxgkMfISH/kSimD/c/9L//ukv/R/gAzyEC/5UAsN+b/3v/C/Kl+UzgQ0M/eZw//1erjoYYUbC+5fXXwxAzuriHEqlgb9H270mw0AZLrcCoBxDOCVAdEVYPEAAHG3XLofczKvYcmEVkXI0Pi76yaAs3tnYQ7udZFZMXmincQeacG0eexkHk5jx4xx0drpYq2EkW487uIKpW4VLtxFl9sZ7nGRueLdMWN8/HD925L4kb8r3mXjiLfHOqKcTmOI0d3wjPEifTtO2xh7/MTL67a8mxebU+qlW/MeXmjWNPXalne+KSZesOf/T/Ey5bYt7y7h2OXEPHshwxnRh1axnsJ0s9ioQLWFS8XqjowxcmB+iMA4jGKGxnuyiQi0YFvWD9DVVp1Mm89Tu0hTA40TfCidkFVhx2b0D/DZ/h6wUlKuFXHcPJ0XL4JzRczTkvE2YTqO3LS+9k/0aSU6zBKp0PodOK0dPYA0pTRZlaUcLk8X628YDcOg9Uo1i63iArYw58MJ97UvQCAgRvUGt134eMzpzPt+OuaJ4Btax4S7MlXeW5ftLl0o2RKrSgVqt0q7yKD0fhTmvVIthpIjLNPUhm0HNKspGd+lN273ov6JSROz8bmfV2hK78GgOqRwzjYMAcNqaJWgbJw1D+657xwJbNHsBuZl1kiO7ZB5msExOrcIeXk7Z9FQreio2YzPnL3VN3FIK4RL4osobCD9ggo3q7E0cnxZ31HbKVAa835F+/XOWPzl0xj8BWM0hX9+/Wc6SrFyL/NsC4TyTq4x/L09+tYPGGjtZqI5MlC+SJPiwxrjsHdb+Thl2Epcd/+vp9ug4uDZVju3bG8EYuWq3bVlVvjuE8Ba+QmY3lx9vgTy/b0Gofx7mQpONs5bpun7u6vvz6WqOPuJv1hP3T9PAnrY9Nlm0fn76P9v9PNW7t3Pcn3/wGV7e/TT8cXltSWcxfej/+f6CK1/ygpaM9q/ZAUdykzcUblQCZKCpw47hSPATHuNITHdbXubcgfAxqdLtZs6eriY+5qpfm4VWbfdYtz8w+3o/fcX8zb3GoOB8Zq/jk7JznZsruVgBuqnfbhXcM/fviP4XwIbl+3BfdPH518VefG8Y/zGyKUaU/erTqqMmjANWobd86e88P841rwxL//uWYzhtseW+XV99G8+09MSKrtc9rapf+cxOp907Amfih2UACa8LPuSokvXzM3QzpUtVSuQoRUA9TO+G2femllx44mxvbC0jP54e1bVU19h8wXub7Nmv+XsmGovWIgdkT8LCu/s3TtxbeXo3p5tn6eP/4Uojbd+LnsHb+xvrjD621c7ex6XeL71dNu2EH39lLZRe0tIEFYSEeEF96BO2sH/NquRqsax+vSx92PRy6L/ZJjb/xs8+aX8S5gad2uitfBFr/qP+s3IoT85baY95uSYlOa/Ytz75H2z4fOdSwptxOv+49EYZfww9tOtmRUPZ1VAhXoN7sqyXu2VVnEsNSZ8P/rj3VmVj8MK0MdKI7oKZvF2f7/bvlbHSaixJ5vP9lrsb/2YN55aPlzUjsIXuyN8Q7nimbWkahVMfdJH8eKP7CtL6yvql5zEYQtQaN3d8f/Vcw+vKGk9VFsnQzcAgRLDHvQfX+qSObFnub9iMwIFg+r3b6rSucz3rYpntCyEnFd3ZWmAq8alBpZhx/3R691SsV49bTxN3HpWombNDO2aftqaGVo1QNHTMxp7G0FhgXT6N35ZJRzbBZGsUy63lr5C8T5HN4TuSAExeTd+YH9/9tvCpsKzYkX+uPq/rREl9l7MO2edTuj7w8g2jee2u/YG7+1ajUJQSxHvt2wMlwm3RyRUnCR9ZuXb1JEJVI7Cn/hnLkQKl7JDS6buVWzZXqnI6CqccXPiWkVVbumsmDO+Mnfs1ngUFrCjuK7H1nePKtRtpdu/MYvK8jvWeUCyQenqNQzkil2NVpG10J7Fllwsnb9tMq4uUq9MNYWHQsNWev4Xl9IYn2+rVJ0yNQO6CsUWuPTb+2nLTqyZk7govUdsvY7+miIzaub3r0rD6rkzvTNx/y7l/PWTwtHcEz/LFf5jX8U5d3b/tHP20zOtt8fe7101+BRGBjgAhTi8QSspgoNPBIhMjNdypAwRnEv/opY4rCEZ1avIvEaUVGuHgh33F3Z8Cm4fAcJ7/IIIbMseP1eFakWCwKLyIoEXQ+rJ2EFsPRLJuSESKdhLAlpK/TciFXuIQkutd9VOs/qwotPqn+SZiF2VtN+9ZCC2nms9HU9JtEcifdRHTp+UNklk4AlJaxkjITLxHK18TeYY6cy8S4sGFjeaiFYKke/ABq6aYkAjEvg2qYsEng6px2M2KfdIxFejJJIxlXi15AohkYJZJK6lVH0jUjGT6LXUKlftNKuPMDqt6kmeidhVKFWC8a9UpR4qg1iMjBBrPLTWKP4ASOkGd4CNqjjBBFBPE2/U/4BPIGEED6kBRc5Rj6cxKHKJejwtQJGL1ONpDopcoh5PC1Bw0fKLWKm5axKZGEYnJCGjxBobQDOpnYpPascmkSCoSU4k8HpIPR7nSLJHIr4NJd0vsAF0xOv0d2lh/gkAvASSlm2cz9GCl5TKaO/8giAZwzXWOqSZ1E6lNTs2YiWcnnQghtfpTxDNL5I6jQlo/RiiHTqGGFIEVr4Oj/QZarT0GMY3R1UEH7H1WVUZ6guPIaA6f1MmEinTgKBgwxc6EABM0AO2Ex+bDxBVFSNa6xD7Le7qEcBYqCR0M2CMFe8xTof4nBLECB1i38Ub4AD8nJKGw6yDcS4BfOZyAQkYrc2v2G9ef1k6UyCnyRG1FTKAn8oEeHSRg7pOjrI591BlLXtYPUe4P2wTrGRCJMHgGoyiYItyiLJIWpI3l6WMZyDuImg2cQMBo4kZ5AS8PjGAqWWmQyFyGpXg4g0ShFtt7NiUCTqPKsZ0kY2Milysnlbpyx6GO/eHbYOVsp8k/AQY3r4LAPosx3PvOuoSMEbqU1GJOEP3IwpmsYoG5mKuxI3QXYdkpmaYDgXJzEhXhXTcyQRkUuSgbpOxNnKvykX2kHqO5KK2CVYycRINLSN7lcSezEhAMAmZlI+Jb8wMMinMzDmxvBvjevE5AWPEuIl952WfKzqTL6dRvFRS0IwIXvGGboTIUCrLxCNmzmESjZnBi+DlUObP/FzAcJhudo7LP7cwIzNBBd8o8Q3G5r98WAIQACPV93vL+zZnt+JrS4wFAMDeZ96CAJBHZqEPaZ/zrA6WcABWGAAAAlRf0wFY+6iYWQXbhQfds1kBuoKR+c2LJvDxLAQNCD+JLHQXMhjHH0Cxr8GMIIpwC7TmGWjA9dHEIMA4XoQGPAwj2FM4jK8wkL9FA4MeC0QeWvImNBDtGMc/IZo9Q5AlYBi7xGjgszLwmZFNYSFDYRgnwGhOoA2SAMNys7VQL2z0W2+4vYHx9BqDXjfj1ugPea5ucWPFs6H+EsseGAvWvYTE9NkW6fk6jBSjMbk9aBBgZLwY3+JIydwi3aazol0qmhOThVn3YulgxbpovJwf0WAQBJhtgUgHnAgAuMBgNLgQwKI7O0o8ALQHkk5iPegGl5ErsvKKHLqQ4cuWgL+rdWnqnzqByCKjEEiqtK62TpaYtkkwwFnYuNt4r5r2ckFlc07MjiLa2LgNI9NT2Ztmoa/ghUClirT9YgdFw1lsQihjPdvUi0SZgnJ4J2qzp2dk5mvl0aLpGkhmliiaahGjremZmNuvKn9Mk0BG2Cx3vMLwns9H0bJn26p1B06ta7hoaLMbzEz39gYAAA==) + format('woff2'); + unicode-range: U+0102-0103, U+0110-0111, U+0128-0129, U+0168-0169, U+01A0-01A1, + U+01AF-01B0, U+1EA0-1EF9, U+20AB; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAAB38AA4AAAAAQFAAAB2lAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGkAbjgwcgTAGYACDFBEMCtpgyyoLg3oAATYCJAOHcAQgBYMAByAbrzVFB2LYOABo7N+XKCoG0eD/OoEbQ/R9SCk6Co0tw5CRuS8arZIo5VZbrrY7musceT/cbsXfaJajqVAAOHS7rE8Nn8E0r4xcj9HQSGLyENo9/J/JJtkHuhJYwShF1IA6foB35wd+br2/gj4YtEodZQCDdvSQBQNGiaBUW0hECBYl9qgQBtJtn2AVZZEzThmyRLewajg+hAIAdLoB5bmyit47tW/GLfGMZG+h//8rgFZ49FiVpWy2tGZniPyORbvwKuEd0KOOc6348XObtI1W8dDIX5AUyVXE7t+boXK2LbWT3F8dhkf+XpfZ6vt/TbSGQreO4Vg3o8h3IegPpt+bpGiAi2r11tJK+v4m2tzISLthXVAO6JBCXDGsfcBcB6Ho0lRpytRpey7aMh2wOd/POiNw2t4rRgif8IlggjHafX/fcy1BZNpqHogH+uw11Nr+nq4NgppcfiAEFEEA1oaCpc8AgsgMgoQC4acE4ootCAQKmAeYBwIEMBdFB2C233H3/SkfGXvGSZSPDTv6RMoneZ91CmXIiUefcQohCEGiAAEUoMBTBXeihZZ/wgB96MMypQZqmKdZPXzQjEIQPkzdzMx5F7pHSX7VYxqc2zyfPbE+8nv+gzX0A9fMMYTOgwm9iCQbTxy5blecK0pwLZNcmpRFOid1I3yi2E2ImXRhM5dfHFde8kMgF+c243zuLR90nqpa9gtDHPabzAjD54QfJ2UuaDdD1rhQmwT3snJ0sSlgAULZ5lgR50/VSVufLiyNLqnKlQiMN+nZzUzOr4S+lsfmY/BYlEMQN4k8Raaf1L6M0QqQD7GuOOe7yOjzgTUNOBRBQpxwyiqsZ8n2pUYbiI1+/LN4xKFcDcKdGVmhjHU+xJRLbX3Mte3Hed3P+6WmpeefO3+xoKjkyrUbt8oqqqprauvqGxpvNzWzWu60d44MRpPZYrXZESMIozg5HG+P1+f7L0krVq1Zt2ET23c/IMx0QABYXLHzFjiO/g/hy4oADVd3mIlKhDkJcxnfQkynKhgIdDpYoFt458GozIkWFufGnS5IQAdbGJpbGyqCgjN1gTv5mDaoWdzhu3k7LhkdBRkVGBHq1uEcWVDeAAUNBXML3Pl8+JHOC85+Ttg8oamjf3QAxleWquPcAxwu/ZnIa2F1rIW1ovSgTjr1yFZISQZQCB7iSZe0x167r8Bsz20OXIHBvow9LG2SImEhOoUyVXyCMs9RhhAc2yYKBUUcxv9++2MLAqVPPwTmvrFuKVKh6+3xHRa0O5s2iOXphOFzAQVAjXH3s2XmaMEB2mmvvXZiFiC/MA7+gmPGqwXkIPcB6qaNRY4c9L9CQ+si0BAtYuKyT8aOzGDhYv5YMJRCJQihH/SwD88IjKRIjgtREGXBivXYQZVFv7guFzJbyWQCW+a3nJxcJdVTA7VQD/WzyM4OAVkg8KEcqqEVBmEdTuEVQXEiM5r9f4rkqclsKZMCmzLf/RVU3aeb+qLyhEAGiTNA/0B66bGt3g39bbnmK7/i2wowzb/9x4/VjjVdfS+/PnDea8P3z53pp7pT+ansZG0hwPaMsC3xUTywhz/VvTf0Pob8v0433HQLU5lyFSoZMrprr4sxE0OGjRk3YVKAwOfEN/+d9z74aMCgEaN+cYJA4YbKHfMD/B8Q/wbuB3MuAua9EYzPg3o7uHto12931YRQbR6l6zDc/ToounKPdAly+el2BMWezuzCY3QXQmvw5u7CKFAJAd9lCe183x74zk/iw4zvRrHiVoHTX8veWNrQa2KAVmorCRbigTVraLwTs8ZeOyYCsO6d6S04BBPEVCIAbVRU6hTb3GSSF9vaEylmcQmAUpbUVgG83+2vA1QZU37EUbZZShnT3x5eciZ3dfr+SzVh13mjxaSs5ehkeLpWnuBpIcVICTfqQW9Id6fp9TeLbfw/h0dFPdtNZMCbcko4Fh0uv0JL8A9Nhr/iY8skRVTCgiyCDlolCZXi7hxY8Nnr2lxb0W+pZy506FhhKZTKRHFSpqxltXDmjRFGtlmDjyYSinWH+q5Ru27iszSiG4o3a5qsP4a05nC1pslZwtKDz/p8+bUybYQCGuoUVGKUOcinJnMM6kEHlFsluef/bG+3Nw5mBtQmrJL5b9fyV3pIayJqSLnCZcn8naZPHHA2j3p2ByIMato33Ag/nuo6oXSidxdhCaXAZWgWcFHoQC9+ozpv6rCY8X751GLOwVSRl3AR8BaGYF1m2+gK1dfE2L4Eb9aI8s02Ti0y5Yb05kduAiWFi3Fu4xDeWsIIitnf1VVHE3udxp5vIo6HmS6y7np8qMshc/+5klDq5+JFRsKacj5oEQx4OjbkCkcVJfz2rCwf/04Pm4WyyN6xqmdrNfeDjFHT2kZmnVLtd5JL5awo3/S+9lG94VOvxcqbKoFn5nerXGKx0fz0bbT6lnFwveYIMZ6tXcRAid9yyEJHT25KyLEIDsaUE79YPeAhySbXtLFGE15XWg43df1LjLHvBDg30ZiLxccCF0Hihevc3W96kQJL0Xu0+7r7HAuoWCcLYzVS8C9cKT9ePtEb0IxRhlzvPoQq4TCzSu2l9BitPW9VXZG6Zqo6lBwDzkIx62UIoa7WhzcxAe8jdRmgUmPUlmBuw3T+UnPcUvPy9Cd41LTq6MfiFNMQOjRGxEsjISMD1ygoYNgFYlp54ZwclTHXJRZgqDikSBiRXAd9dKzEgUlKWEgNupR/ZHRLG6QgV2IjQZkg4mYCYQQUcZ5qvvkOndY/f3rGuNjfOD6w7835+RGNGtNGq0i6mDJDBZ+bYA3iCGuZjgAegPI5gezJzKSxGuYDrWS5PwvlAPaGixmYGG9CeHV2JxlZQKmmTudk2EXZkkt4gP4r2WmEWHawYbfzm5Aslc46A1lDeMjiGPboAFk8PTFyIB7puqAMoTuzhfHgZZAsDYA6PxQr0BRq+W/5rP8uk4160NsehfdozCOq/qCgr9z5JnNto6WN3ZjYObD1nIht4AzhW6cyGijUMUda1EsvSrOE/D3wTUK2H+0WzwSsqjQokISBICOiA2XF9QmByLevVc3cumBct9zNeISa8ToylJDoYCqbGfESgtsqEl7lEQOZ2r9GG9leVIx5Zaf5iB2do2lm5lEvSJYM0iVQ3DKpjPIm5UST2qrYcJrQwLe4ZbhUDPTyBQOtrMbhqwLKC90rta9AhzrNkmleWBKVJ5bRZzh/RU+5RYGOzgB1E+thYgYHZs2SORBl9lgBwp5tQmlHoEX//nLIoljzgqYL6CRno0Af9HI+Zew8DDpeBjBZQ7PW2tD+lm2PpqKyc40MFOKeB7IhU1luS/sSTRupOrGF0Eqt3mxNV2xSFBJQVe5MKOJgjQ0iQlm5omKFy6AMuVFzb9a4cI3vTBpCozXeQhh1nITLWecm76kuvtAmwtV4brGVGJ/4x531T7vu2Ml9uWS+Mx6f0j0lbz6Rxyds0I3Sv2i4VccA+/wY2t8NsKNwmmXUGl/0fBkacc9B3NFgpOmoE+nApeDPmleIZHH7ylT/dwxsW16KfdqP+f0sd+UFDdRUzoNLB4Xq7mwoYSVWOcLXC86er2KtI59Sv9X+qiguzhS5BkWAfb5peF9DheE92sPKg4S6cV6/Bemqydn/kU/2K/d/j4FJ2Fnnod6ZLsA+33KvrcAZjFuDrYK3Afv8jXvMFitgQL9tgERwa6dUVakO6n6YlWHYLvaetd0f/t+L46pnfUd9C/02gWkZsT+y58CQKtinACc7L9vMvtv2yPPgwC0OYJ/ngHomi7P9GPPjm4Vfi/c5EWERJwNisqJBN6KyaUJqLRryGuu2tXZn/Du6/wBcnC6eKfizJ9gzzpI+5Cat40bR1/N7yVTpBZ926VlvyZT3FsYG+1DYVi3i4TF1VFXbBAS22H9sfVpIwjfeaRFtLDGFRw5zJZb4Rj98fbEZzHIwm68itZVdgPzWab0HW13btvOzniCtef+/bsAR/vC0IH8sUYfsIfCP8RYm5UJKaGRGcjrCBwaPo72yAj2DA80mEqZZMvOLpSunsx8kccLOp2Qm5AR72hWGOPrdT/GsDu0Qf7p2kzui4H7udkJF9pWMjBCgYxYmFrYWRu6lA32Odf+TquCv/yrxrtzjPCgovHJRUWcC7MqCBDHULTEsa1PYSUW4TYUthmVtCSqShf3Is3Bq27ZFUia9VPKvpExhqRSkTvPOGFVqiJp9uyfLhIMpg8WDxSBX9HhGQF0M0NPcluExtRX3u3NvQ9daMcXJ3c/LMdjBjO0aeXXmSOLAhwFU46cCVWdhVBM1yfLPvfTsbHdnspsDGNw+Fh2MtllE+0U2TftHzvMooaV+cakuDG++x3Ysot2iot2ikuvhtgorqRFsFf8sq482BkfvYwPOa77TJ9I7Br5obm5UJXVFFh/KeEBKLY5K7gEXkWUZhU2Z8oS/H87lvVmXQvmM8mZevxZdE5SVlmDm9TyE1+KWX1yeUMJDPFfsmQSwV+R8OzDWHZzCe+KV1Bz3jx+jP/oQGWGXTmdUxualJdOCIpoH1tU2flRk9EQVkhNfH4orjMnoB/HRsajcjqOYs6PsnlAvN48CSiqWDYcNyWwiG5E0INMyKDQDfQo1g0wFiUri1erKplsWj4ZcCLGo9ArRf7a+enj8lPdj71F0j312ipdG+qKkIPmP3/5AXJSICz2TMfGCURVZ9fRO0zgyNMkeCnT1DHIMchGlwCJ7CjMwUGAUJcQmgtgCEZcQfXHUAZt2l90f6OLjX0jJQLE3BVvlW4l/53OKXglJ8X7iZsZtLeSWLOIJfze5a3L7fuYMdlfmD8ZG5/XBfm23X9o1B5MX2MRP2Jgj+dd19sBLJfMQi1/aDirtR2ryv/Z2jKwOXmGTA92c7fxoJgbuxntMyp1tY48UbLSNZT70DK/x/oY5HO3m6+VLBek5c67BtkE3E5zpvro+B3EbSV3/1rZWLiAMhYQkjrPa7o/2s3seNLQYJ/GwN10EC01Gw5cVfARxanlpfmkKn0Fcafr45mMn/Dz26g1aeuGtj9CK7kbff25uJGlbBTeJMV0cJA+bjZy6pfh01xjjKmC/dtYiWURZWPhZWESRLKYIP759QKeKv/lmM4jogZio+igYo6qKpQuCGyKv4XJIZPV9amQFBkb2LESGQpqg489ORwUdXdb78Syhy4rju0WmL9trBsZKZ4ODQvfvy7bKdKujxXUXV0ZGAi3mii1EmlrHz/s5n68p2Lw+BEaGQ/SH5GRZX6KzUzYb9DjAVb3/jEyhoo1ucB0nvLdtvUS385hm1nOOWazJ5us3Vxo+D1KOeQS4HAtzIW3gCzhd4+9OZaRlTSKzK6ivuZ3cZy/fyMoNOThMrbLUf2Sql9JFzCbOPB4LRKI9yOZutlqty75Juf8kjcmcORFb+/mFHJEnn7/k/3C01Kz9Te6ueygFg7gP7hdv6l439d7ntXjw2wTu6qKDbiouTO34nEGgK041T/Ub4+rCL2tzq37rPPt8sz7ah36x9gtNyeXJ/EP52hz+hPIEFKfk1btl4zCPvJ48SGMT2bDacLpxk7jJOsxoPnCTv+uALkiLBH4mF9IpeItnCrJTlQtPWbINUhWxhToFWZbZFzPVC7bhLRvsilmA/XVn/3gdmSUwEU+M79JU+S4mxvnBzveRqCiIjRH5i8Pqxlhtc/B4sa1nuNryosB4vGEC60WM2+ngS1YBcmwi5F3vGB5hmbqISnZd1aroKYVOEUWSJy33Eebd27V7NSXaWoRxwWbKS2JIBO34aJmRdFPtk5L+F8J9j2W7uwdA1SJr+i6rbbCSaic44GPBg49pmqlqq/LpGB5pMT4qKtnrangDGgOnwR4FknFYi2GDW3bKamz56WlpvZUxj+IVnKvRbznCPzu3l0Tdty6eWmgcFOWyBM58TtGH3CKSRnBYTdaR1gBFkwTkxh5m3NZSbvG8iBqyQd0+Nfl9wPdf3esTPO6pZe0LPXNj3Me4/0t3yChsPV9Zxqu5iA2m3/vzcgrOzBxDR+ggpUOMh5bO4RpyqODACWLC0AmQwzAWRPb/lL0a9+dFfibMrcJKTj1v9nlmtPNZZRsd2xuWxo9JPCJM5+hz+PB2qdOhsaCj85VvtPha0bVhAUGRC7BHKeDS1Ue84uIlohI8D0CjfSmp+ZpyufikDpIVNYNGJQH3oq66FuQkN1hXx8Iy6S1BLGCfe3JcfUK0l3dYfH1SnNBDDXMzdQ0zU4K6CckHfq5AvrM+zV3zEOXAU9Fz1P1unuEnj7Wzj4Nu5OdTSZe8VFKCDBuklanqRVynkoo9DzJddZRdNEA5c2c1Vxu/oPb5jVo3pK7QgnxsacFedKtgd5ptkKcfRX5bQf6eguJDeYUdOL4v4S5RMWa7/qWW4OLq6gNdjGxsKDyWML+uSyZnUMghFMsMsiWYz4fFhLHDwqfCo9hRMaAtP0vYk23q1AXTUjMOQftOHROvusREx1y/eBnDnPn9uWT5RdcPz6AgT5eA1CAs0/QiEROjC0fCx58zn1+GuKvbeiuOq5zVJ8wnl92B+srR+XLk65YkW6HoMru0ZNWj5EJeKl3D7en+fRbgq5016GYsYar8ecAezphdjeyeadTNXX8A+3z+LGdEojWSa3MctBJ2LPgOvxaxTDBS3PfEOJPDyMxh1sqVTTO/RFJ+u1MSPEVTFGWeOTpavXJmqm3mlknmC6PMDyOTYVJl1TZlJyGj7FsZ9ciKCOBkxkztenb3GAJhjNh7exCZobNJJ119gh2i2ESpIuJTtohdiIsXBDZ9r4Pe1dnXMLd7z7ZsF7OLyu8XHrXbkG2YssDsF0P6mB90E35n9IsOq5CoFqTldUviGcSAPfZdXzMejIt+v9SyEvSb0Wy/LFb5qmlK6LGcgCzHDkq3Q9PcxOjSWu3zhKvPBXTvNoElfmcFHxcb4etbj+eJuL9yniQul5vKYsh59t51ysq9HEEXbB3SsvW/DWilh7xTRZ1Eiwyyu2AsZfXM3hJ2ceje1M3JFnYPSgR9+u2+x2zQJiyTljnL9+/eP46/fkypbcj+eTQrvM5GGR0nmeuq5VxITAzNPxePMoKXoh++fVn0wnv1entKfEYNtMxdzWm4c0359lPnlgCb84GxJ55YWFs53w3Ya9os54xqgbHSZGtqGCrOb5oBbg7doPVf9o36G7Bronjp+3Bx6hvbk7621sf9bKyCfBj2Id4+VkoEJcV1JZVNRSUtwAfsT3MwOYHEQ+aTTFendmjN763vjduA92CStzhScXeWs06+fjUtTYugIjq5jN687My7o/WjF9gXlsGwEP8Qv4V/Uv9EdeRe+r0J1Ycr/PFVz+ufC6zxVvH/6v+rWuXPRrOdpRDJMunJ9nNF3mHUg0Ul7t9Lh4on4C+ulv/QjnEC+zTfSX4k1y5SO1BM4LRMY1aWx8ljxrMxZXZRg0O1hL/CAIb9A34MHvuUuGecmnh4swg8+wUflGbMJxpN2broa4W9xGHdQ6DI9/X+/XZCH8/wEJe8MN7vPIvd2ANYDR4Y7a1hoJgYI/mER+wmuxp9ymWPTDAQxM6OsDOmyFZ+hh5QTAEYK2nGUND53d69TKcaNjo8a4lMj5pwAthCeGRumufdibRtGE4yAsMY3QPJqyL1/5hLIkgPcyxjEzbHQLHSG8bpVmeR6XEqyGDaKngYSHMrkXYw4zkdHiCynq0l0MpGutWZZHpUhhOI2g57FK+Yn/Il31CRxHiPpB+HYXKmKBHumE+yzYNlwh+0lfwjCiG1ylwhpIzbslWGlDEg4uxvwOiizR9xOfJW2bfQezW63UFmSvxlW4DlIwqFb/WEvyiCMoPJEjVVfcsETizemN6wf0VUm6awYETT3n6mCFs6LnkUrzg5XY94EYIGpfDWpwyKc5Wj0GNmNivRw2/WzIQSS78eS5TrwwEQIL6eSomyEOZh2LRA9z+uo53An5lebGNhiWAuiFjFJuyDcQyxCoHYMNtslAs8gYzw9TO8w3i/ZpzBqumabsOo+FSOKgW8Ydo0uf01He2dwkSC8Xmyd64gklSqC8AA1M0UrbgBFK04lL9kr8idCsC0CVMO56apDk6k7ctERYyeism+AlNRuihakQcta3kNQLjSPP2Zcb8lYjHJ1p3QR/tbOtt9wqEtCDeS/Qm7ErEkC/x+Ow14FOsgR4hibYHO3Iwgip/hORO/LnAtOVAUvCQSSXKQGtc9ixe/hjtMckE03eTV7V1AFHqEhKlCDxQem+Zaf01HW69gbUmz9AaJ6Yp4BkJ0MuN9pPB6NiH/nipQunCL0hGie9I1Sw3Qy4N0jXgC8OpOI1Dap0TpczFZoqWpb8k/SeUiU4KH+Xwbhl3EQWej0W1cxwxxqBOEstHYyBnvUezrTBjJ9tUVDpKEzxK1kiXjCRS9Ou/ILKTSLOVKnnRS7r5O7wy74MECbSJNtNGui2wTZnjBnBpjd5YA/8/cSt+nrs6fFeW3b9RY8KBtO7Y4avefrZ6Q3BeSW1PKuLt8SYCO4utIx8CxPzrw1jxC9k6/vfUNWwTqF6NJ7R7rKAzevX/l2B++9mzK+C//S34X/x0xqe4hRG66PlpzmJzhB9FMab/k93LfCTN2chsr7E/E+toSS44Fw79Hj7wTKNeP2nmLQy5qa3k/s3/Nbum4VpPvpKPHf/Pulu/T3pGYXOpWY4Fp37rY5twA8dC4S0V+e8rtvokTfQw1yULDqJ/tBX28v7VoOrSSvlYNjF6H88VbbdRzFpQjxksQ0ZjVjjs8oZFLM1uLfPar+QHANn8HOE/q4qMeUJjtCI0lTOiSakteP4JklbbQa5JWpi+ow7g1Scq4m1/idekOHN+NehJAyQGMi77jGPWol6utT9RnYP5XkJV5tk+i57eZybaJPogwmQttTJgMhGpbPPuNxNmau1xbbcaB1Vi4/VUd1syZPB3qO23TVQJQibibVHq6RB1F/3hANFN/tZ8pfYE1+fjdbAmkKKV7JOhuAeptB9YG/RejPnnQPuoILlC/+VD4p93maQWKnQy+etTjUD+81gFENKW9Zfqy40j+BONBIwk1v72MjgjOslUYUzAyGuP293heb2KABBXctHGY3njlsNOiCzs8f3Wgn7BGXz9fWmg6uSTp6HRmtsq5pof7fY3FzV9SiXF8L8u0yYHrtJ8YUxOtkAqo64zBT4djsatUNLlh3ew4OcDHw48AZeWFbvw/jDbnN/oHt9QcAHjrz8LqAHwdDr//o7g9x+M2RzgwJxRAgPGkiR9gzhNdwl/zO4HYnej/Qz4/axATaPvBt4MCGlFRzao5/zVoYUJas6JCUlHPUGt8bc6pYEQ8ZhONrD5f/ds8y6q+8m25vsSRF6G+x1U/Zzdchy4306xOjlYCRs3gmtE51lwO9YzYwiexINmOml4yn/z+U0INF1vPY5RH1p9ByaOXOtz1DNFtk/ywiL92DkMm9+GVa+Wa0CLk5JiZP1uG4D6MWnMw6gpGY5Et0i7UUuerH4XCIN8KXaw5kgq/vJbDvjzKhT3Lpd7EaJUS66boopztGHEdlhQNLGFDgsjCJ7W0iik29g7PxQ2yaOWENDDbEmC2DMadWW3n2UPJ9y6lcxQq6qrke76E9oN81aFay8k3D4yWSHX4yDo2WA7dLpZWJQWrqLnkr3ohZ3lFrdTlp3WEr06OAlYGs711HExU1KRDK71HdI6AlcN6bhUhD6HVRZPyTkvnLaL7qBu94+4ORaLwAeeNfkdF5ZeYHZgr5AdWDRlSveysxof9ZfK5ZcgW5MCVwbowqzIH+XAVyCFkRqNuU4Ns3jN5dIbmPi1ucI8h05C/24WQf8gqXAOQV/1agNy6agBkFrIL1CN07RpZU1bLlmsPrhM9B7rHXV/9QYzqD+XXZRkQ4P8uEGcLa+4o84ECtTYcBJhDADSkzgkcAoqMkOYhowiK8aLbXgxkLGVZJg58o0OQkwkW/nMBxS4pWKAgEeRoIdCsJDkUp4MUT/AfmuYUX+qmeQOdyHPopuGm6a+b/YWJKtf1o87BaT4FRUTk2DRbg0U62RMdKNIJ3n3IWQoTLpieGgSpd2rTZzjWuPqhw6sBoyOEItKocHSzOm+hm+nrOrU/daeFCTRPiOnboKdGNsMRzxqNBUu2HBVVG6KWAG13fhkSPwA=) + format('woff2'); + unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, + U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF; +} +@font-face { + font-family: Roboto; + font-style: normal; + font-weight: 500; + font-display: swap; + src: url(data:font/woff2;base64,d09GMgABAAAAACtAAA4AAAAAVDQAACrqAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAGmQbmh4chV4GYACDIBEMCvEg2jgLhAoAATYCJAOIEAQgBYMAByAbzUVFB3LGOAA2hoZ6FOV6NB5F6aCsCf6vE7gxBPND66LCKDAU4igzi9aJiBMRT1JycnUrasRHaHnjqSMIxc/03DZoXwLEnmJ7dL/z6jNwnI+ay8P3es//OkpuHj5Ywub0gGpWVvYP/Nx6fwUtFQZGnlIxBEeOyJyUuFE5RktLtFQ4EBSbLPMUC5BS6YGRRzqtHYFhZteKH6gCpKLEXcmUOGw6YME0ktNJl6J5wKIhqK/6/1KWjiDBnwD4h7y9bcsxsjDhALi7QAL7VpoT8D4XdZIIKXcuWw9F68sxDbi0zu52vm43+Z8U1IwC1rspzcJOAT8EShAAVzbLdPtGWycw6TnUmhVekD2FBr3LQeLUQbTbI91qdnbFD9q7J93TSk+Ch9OZtDJIDxRRZiDev3fVvfkBIwNwChTZoZ1xkDhz5jhEChIHYeLQmYk+75Ezh6ElfGQ1/I01gXIKFuwUhIqdQm0Uc1zOPj0SExGJ/M0vm2d6HRlEgqQSJEixe1wff2trjULXjJuxQk0EXrcMJ15gLi0qIdDLLy4JCicAW0JhdZIqhBYniHDhEPHiIRIlQtDQIFKlQqTLhKjXBGXAdwgECpgGzAQBEkQ4BJjihPMw629oYAGn9gsP9oNTBwV7XoZTh7uSA+AU5LADggOAC4ITH0ACMpDxaAXxTwJS+wYG2LiLGXqH3o7aXR/UB5PBZ3Dqynqn3mPw6Uk9uU/ry/pH/ewQ0C/2a0PjBDXZe+I1tEf3rkn+pH64NxkkMDf0TvYUBvsM6mhrOKHVZ0DA0IhWKuBeS++7gxoWhwHDw1O2HSRk45vF/vGxJYd0Zv3ji6nR0gth4Oc+RWmvOH1Zs+3FPoKn2yolkjHtylIyvF78rVHxHcHYRqxx/NKrVhV0Wd9g6bb4hbUCzGa66J3Gkm/1Ne8bII7sx3YWzSiL3VWGreob8hl3YGuLpf88ac+VFkAs94nIq/rwhYP1uI+9Krv6OlJ9rVeFG08Mt9g2DkB8wh3CE/PZWBANLWUmeSykZFP7m9Hiiq4G3wR6v+XAOOIatzsDmhF26MDU8RWYGzjmOalz89U+/gUjt7CuGcKjSZ/sIQVLtR5n/Zzyt7u1L+LZwUxrE+a5YAyOatS+A/qUncR42TN0Tnpy1YvRm0eB92oiqbVkxk9Iji9CjS+kTTE0u6e6QSlN7xm1oeJNJHhkFW30og+B2xe/uEIG62jWtdxY01jj/HlE1tOW6i5Lsm91hZ4F4a4aZfx8cyc6MHDYsON10mlnnHWOBEkyZMmRpwhPmQpVl+jSY8CYKTPmrNiwY8+Rs0JFSpQaMGjIsBGjxoybMGnKtOdeeOl/r7yzbMWqNRs2bdm2Y9c33/3w0y8IxRiEgcdH2SkqBLwjAMEbzCRxjZt48qadDALxkKSIj1a8R4wvdAx0QR/MwdLZKlbYxmd2scbRWObEigVlrMKlwQiGYBhGYBTGpPe99wHmYQEW4aO01BfLsAKrsAabsAXbsAO7EqPP9mAfvkrfWvO9gLCPPrark1BscIof/4elGB/gY4lyrFOJd97BMCNMs40BZu/dWcwwMcgqHrOPJ/zDT1QEiA8NtGiVGtUwOPBRw70uLHLFCzgA7PCFc7rovgxHPDYpZXgNc/AG3gYLwuHCFrYs5kGMNTqALuiDJY5gmZUV7lmRoARK2RKwDCuwytaQfuDyE345I4qiCBtirNMx0AV9sIRMWIJlWIFVWOsdQw8fG9LscQ+1mJjHYpMVshlsS7ANO7AbjMUVVDxQDGVQgZPDOqzDOqzDukwwL2IU0QFd0LfMI4iluluHEHtsMju25LAMK7AKa9JmQbZgG3Zgd9PRjsdNNrHFPj5A44gVarHHdbBQ9GJztj5DxK8KnFhjMe4OzpiJnOltLKt4xaZi1MX+0S4qpk69V6FFn9ToVR7P4uS9jKRAdkAPx/B9UPjgEjAVggsKz3e0k87COE8WC0Wq07sWImG6OMigHmLKwmFWjrGrxzlwckJaPa1QmTMq/hU3YI2EDbssffOLPRR5DxGMYESb6AWUU4Sdxu0MxFlY4lhJYCNJgAyELD6KOChhhSdCmZCLuKhgp+oALTjamBAn/4wdc8McMxjmQLPAxAovOywc8HDEwgmntMX0UbcFFTNFP/LunTJlI4wmeqkiBo1BGf+N24RpWM+9gnjtLVbvrLJ77yOcpcpv2RpmG58Ym3ahPxCx+PEUjDPc4X7w1Rc3gVA7voWjjfJfgiJOkAwUOSgKkzPCjjUs4Q9vDoQtXCO8owuh7wuJLehgNpolENbY2U5shDeYhXlzSARKBpRMGyxHFLhOIFTCTfgIN+HL8umHC4DgOCpOgiIshA2YOtYgQRK0zH4MX2EJc5z7T5LoRgJIAAm4+mCs+x8Z6A+0f7zTAzIOn3m7wnVGypwbDz9G8Qf64cfd/eD2t1wwPDi6keq/aeOjWGUrUqURXY9eime9Mg5wYFpnVy0xRGA9MwtbeEMzNTFYPzdgMmrLdazwb7uV4T7bb6sfLAAkzOUFDhOWC6B45VRSIQfBEiAsBI1dAFIXDIh30rCIOCq+778EZyzKxjpm/QXxT1OOxYQZS4P0zZg9mQC6Ebdv7W3RiqpGtEIgaXFBCZj/8WmG0og9Fb1+++Ovfwh4PiEpE3EQSgl2Dz0iip8AQUKEFdWH8EEpgnk0bZQjrrsGXWT89eD5CCZQ8rFq16bVTXQdOt3SpRtKBFa3RbiK7I4ed91z3wMIRC4UD35Q/JChoPA5BFwVWCHYhzc9ngB3WnLCMRokNOS8Jv5q1Z2P637mEVOnh6HpMVQPVXiT6DfRIJlAILePrjenPVjQbm0yIM3Fq8qHvDKANRE4GywENoO5HywbbWVMBAKIPx38BQf2JRnEIHcB6qqNTowY9KOQ+GwhIvyYdPlXq40RYDED08Wo0qrNY8NmrNjyD1kmmecHeTjP5bdzo8QGsalis4mJiB0WOyZ2SkxGDC+mKUYWaz366DGev//+/R//wHRiqlRr067XiFmrtodUMjPcb1YxIbGDRywtpnRvpfgaS45GP/7oAwqIPyDswo+X/h/9v/v/rs+z5lPTRyRhPlaMSGFG5r04Ev/w7cO57/OQFu0QG/eq3Os7LI9U++P47PEGPPth/OEnSPTanDfeeocqyXsfzFuw6COa5B/ML4kUqRj27PvqmzTfIVCYoeKfGQGpAvIE+AtMfwPMvjpAXRzkrwGawvP26COw0JBGFAcUQ/9LkdrAlYEW60BEjSwCKJWpAqWTZkI1tY40lMc9Yez7jKgoAGlnBN2ITBUpEGFE+uOIrIahduptmF1s9hW1YLKQv8bkqeUVYwO0aRZ4RkqBpXhT+9kVhgia3QyrodFEdeQE0NR+nX8yy8rVde0oqZu1hskosly4UnJRBhOwtuLLbCMezqxC0xPAqhaTJzPOw44ZRSeYfn5L+XazSGPgEyLziLl2I0YCVcfkiL5ZphQzLT8+EUn8vBmvAuoj5mKY+NpZ1EYiohJEOCTGBOMrLpgCmFDo0TAfGA2EB04lavx7Ef99eTHKc4yARWeCiYoyLViklAv30KWtfeI0Pl1DBLXrRz3yCdxF3KAhciaVX9lMAyCxYoGZYE4i5Q+07FMLhEqAUqZCOVMlWfy5LmAuYDYJgKCCePxJ03mCPHvb9NkMMw0qgY+R+2bovdrSEoz0y7vlVpH2n5ZdkaQYPPc/nZryHBhn7UpgytzTy2J0VS+Hab6o/brZcFD9Z9OqXDK8HWwNqLdjNvt60PNZCWmhLUHZ1Pdr+6p0SWEHvB0V0II+MzXIxMuMeR3AQUO0BKjwtLZ+30HgYXsTjtPda7Co1ZwoPu30NHc9pvfouehcM5Yn/HATkUmghXbHZ4qU+/R43DWd3j25iDR7/D6tIjwrP2GBJemvhPUHt7XhYKdGOWmRcqEHwhFyB7os84Qe5lFIcEp840mCy22oiu1mN5ZYrjcRqNYBjw6AOi6OigRY8JrtOrJbeAxiEcHEO+all22NkAToavSCiek2qcyY3+hbM6jba9OMSj86XNnKfH5Rl+XWZ+5j8z9ZPKMaXWl3am5xKSpN9wfDf98Rd3qSKZbn1AaxKhbuNOeW8s/YuH2uLteYLy/7kLHr2hisQucSlEv1JSHSfBOT1huc3J07lifWuGvGqdxxcJ0p5xyTB7vcZfBy9yCUqmRL8BjdKUXkeC6p0WRquDwm4fWH2qpygok6E8sdOc7EMasY7XGEyfrWZMaktTs5bhP/l6r9wQ8Xl4zOKmQoSVg8Ua+h3XybZMWX3rNro7cvHOj8oWVMKOkCpGdCntuamdwuayVac4jdyhr11FO2sC3hbm7k22RoUkN3PvTN06wiTBQz9Qq7Kb55XqjpTM6ncjFXYX2MIgfdRO10zV3AHbhbMMYkJCumGFnFEoiRe7igGcZrtsu4r7pf+MmC+i2CymcuY6UojqXMa0njFKepxXTWnHLgVn3KoEQ7Hm6tTDtpa0O2O2EujBtnjfPoUowiEzVQMKr4K3rUJwBXtqborN5PNiUl/p4KKqEmApXRhlD/EXIjSGCDaUdArfin/YAsCvhHOVo4HDjoanp1DWRS2Kb9Vqy1QCd7AL/HxrYHr/kkiaDRsTuTWaYZHahPkCm1q3MdXeasbaqVlmmPS7rDPHLjEGy57TAS9iE4wzXthq01Rtsa9odVJt6eO2bvOFyQyTaNBAIhq82zSKCT/lKxrwznvYtANn8ZAJectCw1qYWTZJITG/fJjREL66lwmFPeQc89GWsXXVX6RlEHQaJKqm8IO9AVJ28PIQtQWKgNmolzKayMWOGejVjhuVRZiA92nlxH5KYedFY1kmVIwhDbNaZYfhOxL5JOtMMlKjS9YWD4nOhr2qGFScHTd1n6U8FHID/TQ6+YRgmDZ0TtB1WKpoGGUSZNw6RMcycprwqtI0KllQU0nYQU2HTnIIHmqt+kRhNd4hTAPBYgh+lXwl6varl5QcxjVXxiGvPGDI1TC0ls5wFnFLYJoi4EyNYN19uYzy8uy63D1ZWkJelLiDLCGm1RJLrPSflFtyE8B+Uln6Pdge6YQTMzLxyzsKnQomrFKT8Iv8lOwzcP+9dUjwtGYtZXEYdk1PRtLf6V7cDEEv+LJsWfcVrxafsWk1OF50n/kEXMq3aRnRUnIhpYFi1kz0XMwIpUPDaK+emdhx/ovqLVQYiuhh3ioNuMOkYAXfOEJWldejZDpfdKUlCnx0Zh0EBECa8NZU/iTarvXd9aojaGk/1gb2J29/T+Li5gEgmo+TMeBCoMohS5zXcdzWIkp5Mt6g8WWsj9KdM8QWG7C2NwYlyfne/u9Hce0VUYFtIQY7Qa4bjQebDGoghI1D6mhUI/SshZY3jELMtfciLNbJDiZF6lvnyx1WWOHrpnG3EJLiDi+yE2Ik3xKYJWxFTuztQD1ijFxT+UP5rF6d9NRW1fw3UQWjt4jTCR2Bw7OV5Pi4rUHt7Mcbaz74QU2wcKRrAEO0ZUtfRqBPoaYULZGdOfK8BXFW/VHyH/cR5NtTQb+MjXyn5N5G29/6C1nAAlflM7Nuf9RR/3pd7intjF4SDw2bBEpVw4vx10IxzRtN2ZmrcbSkihuIcDC13qD8nBfbTQRlCOD/cvvUZTOjGMYZrnOWUeJhy/RrL2oxgxb3GKz3XGpmzcjW2aRNlRKeqc43AcJXH2stqyeJKmH/8h/HaHkoRBQaMAS+SSeAWue/Wnn648Hb5I+FlOgUCUpZ7U/w6eJoECQfoT2iV4YDhUQur/0jHpk4OqWXHIIifNT5Vb1svpAWkGXM3xFBcSvFAYYg5V4H2YFv+Z5B/p7zC7lX4W3xNs0UwfOg5CoX7Rg8YdGdo1QskGd0jNjtEqLaB83P2nL7g/vdp7I+E2u0uq0wrZYgv9WI1GHFPefaIhuvUJQkYDF0VFSVcv7ggoKRB1qb0Bt1zosYR09vbzKae5Ybp4Xr+4kW5utQKrpMio5DasbDj4wt242crN1bh3Fb+2JjVQFObLPz7nQUYqyvJywC8brZNrUfv1Yy9aeeeq3rYJPdwb3I0JynZ1ueztak3y+beeY+zuJZdk1zT9pIdnoLJ/iP/51jAjJiaVHBziDzjZImpTY1pGY2OqTmJjQ1pye21GE1bLwOKSqr6Frq6WgWWMnhXx6HFJWltdckprXSYxob5RqLk+tQmjaWSlStAx09fXNjRXUTUw1/vDiCKeJwdHEcEyxdO/sfqqBUm9QLtlZpheOX4vzd6+yEffjSikfzE07xlHdMuL3yKmLqVkOmpp4VgkyVQlZDnUjuIZH43kNVt4xQTor720UrI0USeaOwNXd6IwrRJzF2KNVyMrtrST1CQyM0jtt5lEwFKiea44UoKWpLatE1EGJpfeh5d9M6MRJGgFV9vfSgsKFI5mpn6RSI5V2VKOpTHNAN/ApKS1fOMFMqf1LU7HM8FyLXLWIyzZvreOdAjkeMK5j0ej3kd1rHfEvI8pWIcKYoKhkt05Gmg9fAPt4OvzHMyZOQY5gPefpq4BXklXT1NNX5esawC9UY+Pv7zwGNSPeeI/q26vb8qjJH/jPyvtbH2WQknu8k4FPooIDexCPdabvDISQQnsQQ3Cv91rPMKnFGaPAOFZwxKXD9mmzNiHHOseEp8VzUgKez5PyXu+9/yBf8RmeqF7VC0IuRPzAyHhip+PX3CQW3SQPSMo5M5zL+rc97kBt6hWt/9Cz0TdjBhkX33zlO3DPYZLXKj/lfjQ4KvJkbQswEszdQ90azI0Kbi80xqvfp1GN0W7HIG2J0bvOJ9qnrb3UIqdXWFZeP+v+zCKW2S9+4XDNzLIIyiqMi0ptSRc3f6YGcjz3xk7PIFivBYYIUfc7nt/4P/3GJ7nc5xqWPNYcofTl9smVNvDeno3kh+9iq5mjq0DDc+zJzzP/juhN3YGdoBwQvKyf72TxBXZiDvkXvT8q9eYhceUyLuBUo4SfvWX7229npzaes0hY+oXR30ek+h/OSr2bUTk4d/O/hH3LpM9Pfwo9/woILXoGh5X0/uR/U321U8v4jPfIkRezTT3chfUobHjL1HLo284dWPNj+k6VycOPI1qpaZGN4BciOEHhqwppU/WlMwAVQa707hTsNOYE3yK9F3ckkfIffIIeQscW5LUyvsfFEYRnRzc7Kx8XMwZCH19amBsfuJOTWF5RJiaHpLFkFfW1blEKGZB+zeS31Mc2493Yo+6LxZL69P09XKvb3GPHrgRg+2/FmARd9ZKTUaaZyjJK2EO28YVpJpMGBQf6AhmXmfbTnM43D1jcfv0zsmUkWlJ37+XX9pNOD5lPcnG/a4rbufrD6+5jpJLT8jsyboZpvLOTofMzq/zSASmz8JFKXNZihnTMU/6x2MUOrP74fqn9pAPWDrjGzI06HG50vs/ypE4etQU7s0+f/aIcGgSxffjKubC3e8hVJKbX4Rzwlcw6pjjX/sP86OduTZLAjWaMp2jxNV0a+ckVnDzN3dZbtq1Ovo2sha/3vitpqAgibdUzmuyve9cS43ypO5MrZJk0xCrx5JI3cjz78ia6cbUj0FQDU6z6r0/3gNYesdkV64VqHT66vn+ASy9fLKqQw+M4aGRl6Bv5x3huiJZ1FSwnnKwKOPQ1sGF72dxTM30PdR60PowpqPf1PrQ+d4zYBoHv5PTk/l0++OU7vQbKn/PZJkQTypb/OcJZv/l0rflqd/kYLK/VxgtFOTIte3DkzajJb216Y/0Qerxgf/OQ/ZYwXju2/XBoSG6iKaDiKwDkd3654XiRZbcukWeuwrFzQvoCaZB8OdMPgvLaSfOdHFw/ALTxc6Xeeo8rbc6+FqvX4JZsxfXtT5314OnuYAAz39jdm8jjbU9gHy22L6HrW/s+vdV9sFDfD42F/YO/3nyUmjjz/lxyeTMmLCQrIxoRAFMcztnEsQpNj/6a/Lk9ia16ewzHV00+A/m650/jTXBnyzXe1gamvKaJUWk6Dca/OZeeJmbMRgtq+3EcUDlFyYuKy6IQo1NRNhA8UmoC83b2debMBw1Rj/8cbloIzB5OuZ38LW4pKgUX2eTPJK5x1Scc33QbYGXWxXM5Nyp1D9RNcnFVCoJ9DFLw0u/lvonE0H/BX1q7Qznt58nWTcmf0/n5hVnn5AdhvyLgieuCogN0ffF6uj8YFLtw4nR+cWPpe9yW5zm7jrNmP2X2y/OE9rcHtrP4UzeDSmOE3ee9L07rcivxH+q/13PkxMQ8MeoQ+hwYpHQX6HDeUXCED/GOn6xVoKPsD55pGopOPrqbB3gdnrgYREwfXQzIBs8vX2qu/ATwGtPCTB9dOvDBsDt9BCIbl/fMTl97mXL2WoKlM5+XPC4AMSufzLOIT47oMepWseFNdZM3U1tg54fC4i6X8zRw8Xc14zAsKWUjFtHP1p4hGpdyz1jxY1q14nR+jmZmJzsaKXtYAYax3h+z58deuSbwkZ+CzhgiPtEdg4vnGTexdEjb4ZUXEp9RMioDI5sQlpAsc0+1BdtuIz2oLSPeVI+spxEC39jOrPUtzuPvb2MdggJdQiJbYa20/SYVjA68XNVfKDVN/QcA3Dwli3QL/H2o89Suzt1MT2UAk3qtHp8QUjsPbDhXT18bPfwjai/C5np77aFUW4DrEllpaENPrSEKILLKxKrRqVHRDpX1AwPU/iVKHhKq+uqc+8aGegiELmxD0Pl2m+5vO16SwPTE7/Xzw/e9Y1j9Xsj/IJ5fyF00Q1vHJwTSK0NT0+I1fUh33y0fWFnv4Z6LyRPO/qtZkReGPUhCAwMhqTetsOkDTDuBbk4OOUS47EMwAEDYhl4BiKkqK1LJeoqKhB1qNo6IFiLL6mvba/UmO21kQxHJdbwfVh4M3M5wJVP7yH6TudMTuT0PwgRhtg3/+sEAnx4XNAV6vBr4zpK3ctb7UNI7wij19vW2cfcx4aPCMuMUcyjR7kXQ7gYeOBfwuOiQrMHzLAJE4yH3jZunnlEKoqBB6NTldF/P6bkv+ESZl1jror4tZR6fZlH8u8uc0Pqg68pj+/WZjwOD01/ABoonl8fz/V2ksgIA7Bz8yz+pPie4flTuB3sjbiHYQWEiHm16OvkhHtgdPLv6tnhbt8YDtIrwM4xfvsGNvd/Et/dr094QM7WiljXolwjU+/CfzIO32QalGKXGPg1bJh1RpnsIZg7qUbS+CZjdrrbuiHjy/3b/ZuPixna3g5WJh66qoqOKodUb1gZhVvn7nQNJs04X21wXcdYhjq4u7jrgMgLNabHXY8dVHGXzjU9MBMwFJLz7OzqZALJXhIpeojeNTXwkHFvuqVDJYaFgV+GHzKc5rhfgmT8M8Fa/G/QkDJu+bzBQ8aPrq58XBnloeI32hffLd4BeDHlzqnHZ3mC/f8rL69wWp7Q5WOHr/Zv3qFFlt67cW3I7Tx46uCgLmJ0zEFwUA4HsX2E/oDKEy9FB41LwMXbxQ3n/GKhr7Nv8TnqVte7m1IS6a0K2B+vFlrtWu0/vsD+aFUAC44GwD1qAJG5m4rov7Or3Zbdlp9n0H9vKkqkd0t3LN0dXejv7F8Yut+51CUNhgM89Ifvr+lFKRSnqIud0jDwtuhr6Z7L16PisxPVj57WMA+0gKaCJwgVhXBRFBSJemrqRD1FBaKeuhpRD4zabEO9scZL6OTByRzRz6Ofbx+dOPz24IuJI7ePLozOl4v2/I8uXcI5U8j2KwcUgEiPaYXflribyZcsemBMeNzM51yAPa6neqSUaWf8x6frq6979p19fJxsveJ9mHcURkBj9nJFzMR4eXRcYkYWLcW9dGjUrzYrNyMrM7skuLe/hJydl5mdd51UMd7nWpqWkZmtmBAZ5j/1kPz2IcVvatNv4gH5/UOy3wQc4zXGunBYjH0ukkiTKJS48PuCbKFsmmzRd6sxbkjmEF0WHV3+ugw6fSM9zTY097ttHEOfvx55NbMDAaWhKeEZTsaGSXb35O9LP/R3KPbvabQlSGkkezTzTKxss81PMkjZsWGRaU5mFqFWCd59QbZF0v4mfPqil09HmbpZ5ot3yn4IFqeYJrsA9oWVtLpGiIaGh4ZGiLrGqOTTZwxoLVoUtVcTHjzvutL+6HlFTWttQZmLvZmNg1dyCCXEO8ne1tbErY5aX3CQu7mmkqum9IhFyRGuegJPU+ERU66G8Xu2esNxusN9NJ+/NBNH+/t0Ru7bgnMvl4aBaVRIQoRvQENYm5dMLFlNR1qylcOnPS4ltTibetFV2MQ5/oz58cZUkj5YKkvZwMWjIaOYyBYNsHrFfN2mXBPK/C0wZ2daaCZc3EKLpoSqEg7KBNTgNK5zlfZVGaipG5YnZWk5qMhra+MdIBNk69hvVtwEIcogqbj8bWGJn39JyduyclKynKa2nKymPomo76NDhLMDidYj1tRXVM8Rz/BXvCd+mQ6aQkeJR/RBTJCXxjkLWbyamvw9cmNRclZp7NXLvp6uVulBV4Fr0N+U6nrcQlWScOr4PffayISsG2G+oTTp/DPXSPTorOTmmCv3TmnKXrw0fM4zCRyAVx74+cQHQEgTH4Vk2MSTGvFhPAz8B5ylPSkv3EC+fxewc0BlNllh/vPyBcvflaOApUPmGF7XkKZniFc21CWo6euCCqquQCTXt4VSiktR1xY/d0H7mDHmSBogJXfxoxK5ASG8wER2rXrUL/+4r16n8n5/ecXDgZp2jJuDv4mR3WVwMXFNu2Fs5ODnBZR8JFI2W8fIy9fWheTk6mBr4+s+CG/t5kz/9MJoT13JDXsHQyJLMN9XeUVtPWp5ynQ/6gElCBI4zb/eMT8mK0efH6JxFZ4YOsg7Vmgq5R0ukgwGl5XVlNXyCvB3LuUKAp4AZscWWfdnV22inl1BU/ZGf7+3xosCDd72zqFrHlbXGnJ3y3rhonKv/ox27BF3vJVF8qKrt0dM9f9dOZx3wlDOd4n0c1WIQhfa2ePeGB3h3mTsnmcAlr47t/I1Ojv+fXpiOAIRu6Yvlzam77+816Qq4qoZxE84fZ5g3pFnkqLf8qpn2KT5lI1k/0TMCXlXW0sNKS27tmSTZBOb6FFDU3sXkx70VzBy4fuTXkUweGFOo4/cLKvYaPn0mGjv5GVjH2yjvsOT+7tn6EMANYE2gjzfQH1JvcOcVlhOSyUp9enUaSnMXpKP68En48efDHojoU7aag5G0p2r7jGpB2IGD1/xCwfZk4J/mHPM6qNxSzkZaQvR0QspBUErU1HU3CA7ycbo8AmaoV/LlWjT6rN6/RtSdNqtUEO/ayvIv0TBKCatoSAmoyEgMGWkDTSCtfee733t0NTVD9bV09SQMs/Qx9TcxoNpaJPxSrq6Ja6LnxsiWR/VvpbjOTNQROihMxxtDxFzF47TUwW7cmWXXM+5LCu1rWKuz1dyOG1TJROZ8hg0gnm+LYr3d9R3zlTFOOsbQh9aPInbxdQn3A0hO5PAwDMgeBbc63nDG5hz89iRJnxrNjdrQWOkojn8lfDKH7Xqva8jedDdm13xCod9dfs03Jfv65gFu1PfOcXnfyTRCea3Hf3g5QZqPaWZNS27nGJ77ay2lFG5tuokIexbeltS29ePHOdRO8zNSXfDQ5N6eutpD8MoyXdVue5ZhqbwhnULBwaFg6zsF7aBgtL80j4OTt4s4Pc65xgb0RwV6uIq+26OieCakVAjiEsQLkmKq6q74e6AHOVTQEyOy+k4H+UWkVM64vlM850scFaqspU9ZSMB3PUikQZ2VFRW0Ys0cPaaBdY9qAHbBFROxd319pmF1rMRhhYxqLy8uSRw8JwBukoM+khBlY3N3YPL8lck3b8R6J6zzkQXTMzddvd8C8yJaOewMA/v0DC3k04hId7uYcGIAygLfb3WcCSJ9z2zAQ7canoir2Z/zYImv/+17IT8jQMe2LYbLUUBTmKiE6EH4+DkESakNbM1Tj52bex//xP5Q6IeFp30POpZWN3CXOOe6RHnAapJLJFk1cir5MCDqXFR1Kikg4GbD9LuU+5nOmeA6q4/6GkPB8zd0oMY3+4++xST3KNGwidGUyWCA91dXDVfdL2geYe4WqbgkieH3mCP/eipMWa+/q5w+2X/YISGBGCXGYvUZjLzg06OJktczTNoZNq0gPoMbM6NWBVwfimo0cyUGTOX9+zADGF7B/9aQfeUPU0vrv56QXZlGhIzwZP3n1KsrLODsh1B3N5gzG68eVzvFuY04VzF3VJ1Nvk4ClS/CGxSqSxvys6taKooKi9vy8mubK24x9ZECUZV9DSFBqKLge1JP/hXhJOSc6Fzzf0aL+Ywv+8PyXP3dl+Aa4xMwfp1C968OWJielJE2I2ijPjWRMTtLsY0mBKtqK6hrkGE48ePFeekOLG7amteptAyI0Ibimh5zfWlUk+3Vt8XNF5QO75yIidWTkNLngxtLWYtg2YxXdfD4DqBHCSfeDGOVBV+LaMm7HJc4sUgebJvCSU+oYQiekRu144gQfo32L3ebDVodVrC5QCsyKkp2sXQUqPDmmqo6dV1yHXl/9+8+gC8eVlhpm4tRse1dNQIsjIEQyUFZQ1QrTt7bOjs3rHBjQcDdOjMuN98P+LfB+tRTV/ur5l4/ntbm2xSR/sywCng+QXABDz/fhVTOM2psJLDARePxlv5JVeJmIHorWLxVyExxafjhbZ4PYvcqk6imGc/PQ8pvds21WVnZ6kPaC0ivtQo0YsqyN4kSbW2us/B4F1CQv4C8DqQMJAU5gqTLdFbNL1/UbI3eQr4TaYpoJ9EA7lKdJBvg3a4WaSLHWKneEvsIt0Wjsg/EEMOAin+56RybpAXdHLYHM10PMlfQympP/SagYOyDQ2F1Uk2NVJWskkkcloKT2Pxi5ydo2ltqCCUkpJDr0npT3KLXAjVjMJQCrnQa6HQnxRuhrRfsmnIzEnwogx5LcqQOVGGvHXJ+BLWUDIj3KISoYtKjR2FkUDEVaZGEK0DNLUBLHEDRDsatrgMzt4KViCd3CllWSRrEMMmKqKuvxqIugZBpCMa1rl4SYeT9MGa5/3wUeaJhDzmeBQEN4Ju5rFlB8N8NLktmhNLl7mxo4S9Q+3cnyTesDUiN0VbYuSybdiKvKRTDUc1ESCObtK6cvGyIThSRASIIBEShAVekdnIQe8hjM+nUVQbrg6Abtm5AT0+FYvnJ87nxn4qr6bEx56UUttaSytJpYkjFLe1Be281sJEeqe18775/9p9Fdm/FhUpCeZps/eWXxXLW50IQgXUCx3ApbHfziSAFXJpftTo9HNmbm49PRT52xizdsDQutvukZ8VV/WWds7KNWobGOtbqt3h81E61gbZg/xs60bMLHn7PIUHtHV7+UVUEM+LqPcun9d4sX5pg/JB3bxXWUTVYpYYBeluzagB+Qw8MRE9deeOx+58wXsmH7Q5+/O8Yv043MvDpaBiH5Ro935oB1FBRmIC9TPB7tTWrw7gQvZsX41J3JwT4/Fi2a9GzO3UNlsHriTf+ogukC5vP2SBfAieuCMd2H5Gi/MxbUg4KH+1r4xZm0oHcCHtuiFtUqh7fbODC1GQ2MfNyksKpZfMyu/EZh1Q9jIBabkKyAHl24C6dhu0Z/wwWUk7N7p4hgdSJf12RxST31mO8bPyYESXRx4B8nyz4N8eNnI+cPF3ZuEJAF75uZcE4NNh9t3PE/+/GBwmV4EBCiCB/vCRHWA4bOUe1fBaUy2Qarmch6iPa+e8gKxcxLMucqm7e7XNc2+HWCU7ZnlcXH7qTEklWik0U7+DuQoxX5RczkHdmK9DI5iCMchCPFBAC3zubcd8REJaJV65XaoRcuo5cWXJxf4M+2aOp7HLb0q8Gl5+pRnz7APBSO2mQ1ZXU6+40NhmwSLZIxvWLka78UM861L/ynpOr77Z76qC6HYBT89KsnE5W+cx1Q+ZZCnUYoPPd4W9HEaulEHn60lVC3Y1XlSVZFypedP1meeXLtRUZvWK8MwmOiPRvS9gscnovl6kq8LrNewX0pN51nflKP3chLkeK7TsE2i7jlacI2UZu7U1yzcpZpT2x0e0maLkw2g1mkft5tTKOVYCtvSflPqdXUni2GmyLjkyyyLr6i9W3tgbpYVVbNXjnL+6mDdNIZcKqvfllg1aWd21zMV/tuJKg9BffN86tlm23X9MOmveZYl6nxRfqybDRuVbx+XXVSldH53awLvm0KgpjGuhhCwiq+/i0ePZlxX5uVNYeSWi8oF0L0gAtEWUd5LiUy/39IBMmiZd+PgVUYTCTDpPSGn10nIwv+zLopS5kL+SqxmcGgv/mqiiNhKqD1zoj9OxAJMVOMzK4gB9UAA5MAZDQ75taPP6mq6aITCPpTLwpZZ99jHLuWYT3zJYd42ZpHlUCZGK0aJUNqH44yzaYhQF0TSH696eHXTJ3NVgSBaJLrcsT9yJt2TOFqMEC8W8IfDti29rfCb2b8/iKqm1S1QFxycjGgJSlUWAESwEYAaQoZaGgwATXtCQOgB7AukAhAinA1A4hTWi240YHIB1Co3hEFt3lZOFYS/sBQaFB/t6+5DFpCWlUkCMGKjg9/MM1g1wF2dqA/jFzbr5VZF5VsszOCSYx8EyC3TLQO4QM2wWfCn+Pcy7yfq53sBKCr7qywOcgPgcGQVlX80KpsNeQComB+ElEgm1xF2DMnNftfUUDwz2Zn5i7gMP8Myu4mSgq6FlZF74BRcxyZ8859XXowI=) + format('woff2'); + unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, + U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, + U+FEFF, U+FFFD; +} + +/*!************************************************************************************************!*\ + !*** css ../../../node_modules/css-loader/dist/cjs.js!../../graphiql-react/font/fira-code.css ***! + \************************************************************************************************/ +@font-face { + font-family: Fira Code; + font-style: normal; + font-weight: 400; + font-display: swap; + src: url(data:font/woff;base64,d09GRgABAAAAADhUAA8AAAAAVfwAAQABAAAAAAAAAAAAAAAAAAAAAAAAAABHREVGAAABWAAAAHIAAACmCwIKakdQT1MAAAHMAAAAIAAAACBEdkx1R1NVQgAAAewAAABAAAAAQodMa01PUy8yAAACLAAAAFQAAABgc+SqD1NUQVQAAAKAAAAAKgAAAC55kWzdY21hcAAAAqwAAAFAAAABxDJPUwdnYXNwAAAD7AAAAAgAAAAIAAAAEGdseWYAAAP0AAAvawAASRaIk5X9aGVhZAAAM2AAAAA2AAAANhL1JvtoaGVhAAAzmAAAAB8AAAAkAzn+dWhtdHgAADO4AAABdwAAA7RA9GIebG9jYQAANTAAAAHhAAAB5vJU4EVtYXhwAAA3FAAAABwAAAAgAWACg25hbWUAADcwAAABCwAAAkgzWFNlcG9zdAAAODwAAAAWAAAAIP+fADN42h3DsTFFUQAFwD0vhQwyKQCQAgARNAENKEAMAHQAEEEPQANK+Xf+7KyoNAPOVFq1F9GhS/QYFCNFjJkQU+bEQhFLRaxYExu2xI5dsedAHDkWp87FVRE37sRDEU9FvHgTH77ETxF//qWo0FgfaprNFW0AAAABAAAACgAcAB4AAURGTFQACAAEAAAAAP//AAAAAAAAeNpjYGRgYOBisGNwYGBzcfMJYVBLrizKYTBIL0rNZjDISSzJYzCoyszLAJKVlZUMBgwsDEDw/z8DHAAAwqUNgnjaY2Bh2ck4gYGVgYHlC8skBgaGSRCaaTWDEVMFkObm4GQFUgwsIAIZOIe4ODEcYElg1Wff87eGgYGjhPlFAgPD/PvXgWbJsiYClSgwsAIA3zcQA3jaY2AEQg4gZmAQAZMyDEzl6RklICYDEwMziGRkYpwApPYwMAAAOVADUwAAeNpiYGBgAmJmIBYBkoxgmoVxA5DmYuAAyjGxVLL0s6xn1f//n4GBJYGli2USyyYgGwYYgeoABcEDchgAAACwPGOn2TY7b51t27Zt2zZq27btnzQJEOgqurqlm9u6u6OHu3q6p5f7enugj4f6eqSfx/p7YoCnBnqmiytOaXZai0GeG+yFIV4a6pVhXhvujRHeGumdUd4b7YMxPhnns/G+mOCrib6Z5LsAP0z20xS/TPXbdH/N8M9MswSZLVigEHOEmivMPOHmi/DfApEWirJItMViLBFrqTjLxFsuwQqJVkqySrLVUqyRaq0066RbL8MGmTbKskm2zXJskWurPNvk267ADoV2KrJLsd1K7FFqrzL7lNuvwgGVDqpySLXDahxR66g6x9Q7rsEJjU5qMtZH0/xxRquz2pzT7ryOTicvZ3UAAQAB//8AD3jahVsHXBPJ98/MbhKxoAECCoLGCIgNJYRYAOkg0pEmioIgiiBNxa5I71KsKBZaQEDOw16venrdcnpe88rPcr3rCRn+bydF4PB/HwkmQ/a977x5/e3yWF5Q7z52Gf9tHsMT8ibx7Hm8UIlIYimSiJCRQDrBSi53cJDbW0knCIT0o72Dg8zO2FhsJBAy9txbMf1aEDuq+1emoecGUo43MByX7Gu7YJyt6chhxqZO4dbhsdZRCRsmWVhM4l78t/+5uZIf8/wYZo1NTY2VAs/AuYHDhgnMDM2ko1xXOa5aO5L8zX113JQpPMyz4fHYAn4soBvK47lKGCmSISmSMMxy1VdrjqOrX6Krp1V16No3aCk5yo99fhj9gh/wcO9juO4KXDeSZ6C5TiKUGErE9AXX42qyavkrqAb/KiY2K9Ba0pyIIog58UcLqtWkysi0MjKmDP2GH/EQrxvomQG9YUBNBCTULyFqQYRgnNHzgNE3Ym+RGRXEpIQfWw5XRPc+YeX8LJ6Ux/OcYIXl9gZUdiZCKxCnPhYbGRvL7BwUIom1RCQQ4Mz633KX1n+YWnAyeNW8kvAFpamuofUbfLKdyG9i9NGSmyZ1yPHnk2joyUh/35S5s+bk3Dty7fm6CeNRwy5Vmp0XDzh+wOMx32gwqhHK4bec+YZ8gOx6fkR25AN+bEn3qZISdkEJyHYJIAwFhCN5ZnCFERZINTgBpoFwFJZOwKJRBjI7AzY0/Rtl87fp6d82K79JP723o2PvwZaOvfjER+TKqVeQ852PkduZk+TqJ8gQTST3yU/w72sk4QGPaNLEHgUeo3kTOR4CgdACmwin45ezctiaFFu0dMIZm1WHsuo+S8v8BnhmdO0/0XHgcEvHAXyi6s/zcwz9chJ8kqoWnECOL3gbISn5jPyo5Y14enBmzSCP4cCZkTLwIzM0hB+2+eZ3dYefvN5R3XjnUCOnNOzI7t/4sd0xLO4m7DHuWme4NkMty1AZQvAj5X6WX0PTke1FshGdvkZaSOMF1MmPVf2CRap81Ri8RlWFv+SutoWrs+HqIZy2SEWIo4A7O4ntVZSC0ruwoeonLGKCVAH4JMioCM5BxMp443iTebwEI6oi1gKNvclkGvuzpuojRpzOwGfQH+bC5Kk2HitMZrcm1p0mv9bmrbcvDZka2+r/1lvEP6B8+r6OioSH8+bor9fz9Jq/4GR1fUdkxtIx5tsnWpw5pCoO9EIjNyTEJYDS9P4JCC4Bgmm8OTxXwGxnIDYSStQKakKRvAyPiYMDomjod62sEPxFYmXFJHQ1sKqH+klJc6PsAhxzw5OqFfNy4kua7t9atDRCvsh1unuJS+Ym83F55NnCXWuC3d2XzxymjxKiokegTUwgKyM//qqwflVpY5VpOycmblXEyeqGE+GpsYB+3MSlQcExqvvrYuNXLl0sX4s+3XuxqZ3TtcLeJ8wj/n2w+PGwBxORVA0aUGssD3BqrQ4gzlNWj5q7P6LoZHjcuZ3RxfKfc8vnpIcs2j55yib+ffHzuSULA4qf1tf9UzHPadgHHxeeXbzCBeu7eHOcDoG8xCAvU54EOFngF3Lq5yI1wkD+/IXFwcE5noG+l5bvv5ee8UFp3tVEjMmidYeGYUumHN3aVDt/hm3qHDdgeORZ+dZHR8xsDdAnTR0tx0GbNsC+fuG/xRNx2mTU51DkYN14eaz/jPAp06ZsDyrtIJf4b3XPC3A1Em0WS2qLWFkeh7Ya0JqzMo2dq7HpsJpoDw+OFS/afT1h5fWamhuJK9+tKSwpKiwsKmRlBX83H31WVvi0sf5ZSdH12x/duHHz5nWOLolkHgFdtbxBwAqZyFo0kLRW3nji0koH/Qrl7P3hZcf9orvacnIdVodE7pxis5WVeblnPp8rxqODFwAbEHkBCPz0oji1wBHnQ9ky1pyz5Ng+hixj7vxcWPP4alu+8trh/AaG39PNmvcsYGx7PmZOcXa4mUSxcrhuJOBD+lho7YwVXARBrJyUW6afKjFN2TZ/7CyyqwvMejJr3v356pPr9PMNfNcGA6HlzKHeXq3nFwggRnI0R8PnfWDbYqApZaSGgEUmgn+AxhA+i6R42JYPlX/daz616cCmM433/mp7f9MBXKbKxJ/iQtV57EVfG1TW3BrQ84LTmQ0e0lZ7NtRHao7IWmGsORsrqVQB7+hbjfnhmdW3MwOyA8L3xmz/oaHqn0Wrgy+mHn0lrHLxn0Y3/QvDAvPDMtv841b8j5+16FhS2Ob5w4TBlas3v5m+ImaZl9/e7CWZDtW28YG+cTO8nVeGhQGWZtibHuxtFI+XCXvioCAZODB7AwVqbhPo66E/v2ozHEb0wen5bOra7c++8/wwPleHhsR0u4N8msl99pKQ5fF5xjwr8GUgHqmCP5CSIeiHZmMKE33MXqot8LBEPT/2ZXDDb0fokHXG4V7eS4wzhyzcWUyCkFVx8WB8BXr28b5jXBUK1zG+8fZwYpq4BicmoCcmh8+FdFecFjB9tKCQRE8MTTuYYrpyZ7i1J5nThYrRCn5sjzA8Z8lc/ZKRs1ZFMA97ipn1oO0JGtmIeOI+dqjPRTLOEDk3b1iWveGovdhjw/bgjafimYZ2gNtdnBM6q8jBY3zC6c3Y6PlhoMDoostQsB1jiDAimkmxUki7pCLuvEchoPfztu6/CfkBordrZXXZXvQ+xBrCu//eg8+A7hZVR1EjmohzKUnY5UJNvmHO6RFPZIT76I8hZAJYpzam/6AJhf+0Fj4IWOVdu+zU68NVx3CM/uWGtbXzlgV8ws8iStLwKznfEBsY7+L+DOlVIf69IFmiRwJwkfR+z1YCQzvgYmwMYQLrosN0GtAVMoFAm9zIuZOHN87wF2xlzeIxHnYhu5YtW28xPi1+7tqY2TKPMcopLtIZCx1kfq0LZ0udZ5hZukzix3p+Su688R35NWt1QnzyvIqfT7yBpnzqmfaY/FV/+uaimM3oBpmVFW+ZcGlvIxrxJBVOxwgkmga4jDkfFwt8NbYilcplWo+H5BKJGNm3ly6tCe+o7uo88HB78W+HVBfRePQAov9U++y1B7cWR58tPfhGNGuZnc35ziCQaiNIFbJjek5iKXfQAl2qpMvoQMEh4VKHgt6vvjrBhskLkvc92LT9f/uWbpwdNjXIMbIkSh9dJ3Z6YWXRfkut4Qw796jyIP14YjOrATk9eowcj9lMyjAzXfxRZ9Wpr1fajOYxuvxXALqiD1ZJ018kgQ0ihcTEhibA50kBKUBWDWTnVMxMo/nMte7ZOFVViT2qq4EAzxd+naBZtL5a41y5bYCQGDU9mYYeuvXl8eP3qpDf58ivjfxMfr5eRYqnYTwNPNYF/jJVmsqWkv+s2xInq2qwV0kJYFwA1BNormTEecdMQwl1hPCPQUjO5T5ihKwl4gUPcNJHx+ozWjKakIC8nYVskV0aOU/m8fHn+C/VMC5/oq8inJAJ1JMzVbV40bZt3A4s4dcjugND3lgu3mQBZImJRGTSh5thX26Wx7FUoLqruIddr9XvX9y+5MBj8n0WGopGpJMvyXI+3o1gRzUFqmo0gHn8Wo75WtVBHLV9O/BuJGHsMKEI9jYBMrSZID11fFOAXiuMIKzQbN4ECe2pk3YwtpQjMDiAYcKXWipM0JVtO3yqM1ZWBZxyXbsvIj5l8gIvrH/qwN7be5Z+9VDlhZpUHYyUDEPLfMkf6eQ3v+ckTJ4X5rZk1tBhrllRKKYmyVlvqKm1hbW3FB9CVZt24ruhO9C3lbtU99kVYXfvhh0Frwd6z+6mceobHq+fF4ygXnAW/L2en0XrIXUIQZwTNFTnRuxq0Tgjq2ki8t5lkngBze22SFsy1WMc+51ATz67ezOYx0rmTkaioQgoU0rCdwVWnE3AiTzsLUAeoAcGEG0bNPXEZF3Vw5GnfsLazkCkzfSRNYhPHcYZfYzmZxY6OhZmZnC/M6Lmzo1a5OiKro2OSBR7N+3ZlH6g0TA810SJHB98jlzbW8hrD74mrzfnISM0DeK2MXlMbsK/X1Q/7DDNL1AH7u7PNzQngv3mAtZtoDd8TVUkAQ0Rcs6akZO3SdF1ZqahqqKdicvLQ737uhXwTZbXCvtYQP20IWQe1nCdUGKNXgRjuQzcCQMeG8ioc2GFgwPD0TxurHq9GC8OSJ3oOtFNNte1/fD3r37SvnXLhnof5HP2R4gHu3Y9e2Zrlik2ne+ft3nfHv7kb68TG3Qnf1dsxLHQaPSl2ptj3miIpG9Q3HCuCaDbUgUaNNtg39hpZqNH+P/OOSrJfGRViXoGzzzgHL2IlMs84BzBI4CH+eUPjvMl4LyHcjbQcdZ4C1oGsXuKzacMJ3MOd3QcQ00XyQz0900Nq+eqdeDVLmIPjgmnc5dA+nuBlhEXMTVEdISAKroe19oat9oehZ4mO1DT66RKBkcaoyaDwkmrmhQuIcd4mHqxXfSEROCL5TKJmOkLzHcfqvA4wqHafpFEog9usuNyckjyQEwmGl+or/GCUrlEQwC7F7/yGzpWigoukWB05zYuUa1jr+9TXcLu9GLMawXZ5FHZiLSyEdLQD74IXmxesfnUEctUz9rb8ZB2tVAqOWEDAhD988OcfAuA/zmqXVxWCl0Jpg8FxgtlGpA/jhOvjg50ntOXbltcrsrQEWB4CtDOY9QTmnC6GctdDS/DAfpoOEBfsR75vAPveDf/QLufm1uWl1C+g9NTd6krp6dN7NvdczjXzuS3lau6cGCI3/yQcr9Fz2/Zmq3llDU3a/9+QE8zvFwqgRH9JAAvNpdTjDjYPROn2Tt7o9sBqNJ9e/casqXgHcbw5vw/HRE0nXlRQUFypeCSX1pgQt8AZzZ3F0ftey1pc0PwYrdcX/ftiXNjWtOQfcC+Tb6h1TGrdvl6FlzPHXL81Qo/P6ekXE/jeuT8qAOaJtHurmvlM2fn3Dv8zrN0UrXiQlfXsvgjMZG18bFX62L2fnj2ekbcsqO7Dy/lkG4nE9hUQGrI+foEDkj/VNzaUBf0AVefKnkit6eJODu3oSDTI2b81NEustlzFi1eXXA6JNa1MjD96rrUy+vW7lYsmnejupn8VncUjZg59WBS3ObxBiuGj3G2d8+R8bM83NIVtquf3nr/2RqvaRlOUdrUgGYjIP2l/aVvyMleLhEy1pzu+baTEHakgVr87Nxue/a93bshGmg7EgIuj+AoOQOlbf01GfXpc7DbOGo9x//d7tCQ/mhA0wNqI6CYqPG0hpzPlEolckQp8zXajbsMf32ll8cmlptP0VfFnkSHT0KvrLx7hlpb+Jbdq9mPQVuAWoJOz0z6eMBBsm6N2qnCBubeWqCDZ+DabJ4F32eq9k4iZjDyeOu6vwaSZuU951Ec+g5NHYQ4tRKg7sN1H6kkBokU+ErXnfYtNC54Q1xgcgYJA5p66hUNnTGDU1JLGLdcvt2xozhlvxNy7vi0nR3KyaQv1Ta/SDVVjbA5GSPIENbws2D/UprPG0EK27eXoYveiGa30zGyp38SG8lkYvg7uwYzqiAmJC9oSYZtqOJoVvm99RkfFG45n0hiA7J89LCB0HV1zxO7sRmi0Yk1ufmF+IZIbtb12fLZkpW2wfuR/PG3yOvEPvIhck768sSZz+NJrNuKSfaW7lYrygpAZxGRAz4uPrnS+PTDItBkbZcTNJlP8xxajwtZ+JaYfus3Ho9KLoqdSissI67zmEmjBA39Ek5+Ck6SA0N6c/tbaNE5kmJLvsfWZR2iZ1+RL/25UE5dZB0/lquTVMuCVBUotKq06sEH5DiJ6hPMuZO3hhMrAr4GgItqlYQRYNp5YBSGiNbDzJ02cn2myUyF50IHP4nTLLlZADP9QKGnJaK59Xtk5RXS3ZKywDJ7rEf2r9dwTLcNLX6p942iWqvu5AyA3zeO4Efg292k6hxEXxOQ+oFFzf0CE+ZVAvJsmsWLaFTR0VKoUY8n5m1t6Nv2rloOat+gpK7NNVarq5HNXlIlMzIT0Nh/18olb4+Yal48WMUMOgvgOOlaAv1ztMobC9QhAYJowUgZI669AChlhmoRy5nbAc2TWT5G73bcRQw7sSHg9zfOoXsHSz0tORnjD+fvK14h7nFjLpskl+524aqanmDmhFbQoFW07qJahTRapVsVfKJb/RHBqnbWABqJeTxtx4hea6S+djKHPQqsLZB2wsdB9gKW9KIil+nqdYy4Yt3AOIphGGe9rtqEKs+owGu5PUhv83d1td9uRj2VypGqhOFNeK+BgynS/5+bLNE9nDSS5v+Rcx370Uzy5q8Ik9+/43BQjhRtoBrtHzp7oaviF3tQd6HoqrF6VcVhLoNqX8qPhWvG05itUzha6WgLa6SudoTYfvmeLEXk/Op1Bw7vzvu9IKHlgyUbvyR70UXVMWaS6q/NxlJ32+SZzgfzsrOK405kZr+RwkxD5yp3EezMYaDdJ8EZwGBCMfyMdKsUmUkfvLS6oatjtKs8ps9Ew5hn/u+ZBrIzUEiMDQzVbdn+Uw3Cb9rLV20UHKyv2zcc7xy251/TjZ6/kfCfZ+QZu/rpL7887Ychog8y2ocR3IVVc/XqDwhWaQ+K7s1UvTcxT7f6iW71xxerwvW61Z9SudUEnRzM1N/9EU4IjQKLcNVEXW2UpPUNtudCAL5loCrXhUJa4HC0aP+J0hqrkx4LeU8UW66pe8ZwWpoAbp4Z4GXU1JG6knr9ypXlGg/p6NJeh49z3NAT8hYpfqeysp+/EQ6h3AnKy+NOyhx4ZWt4AadYoD3QHffNR5i7rZwvttS4tLqepVxmMuNCv8xkIMP+KYpu32CpVtxsiOfN+1+vH68xVOaYDLoeC7D+oP5PDHhoC3uijKtWLGWaeYsxXlr5KB+Z/vxFO0l5+PWBzvDq6PPlH3yHhz8/XIady2pXbpRzezPo/Y6tBkpc5iJT2w3NaUGalI4mwhoCbS5Lh//oGk0tZRqTguw7YvnbuzOzNlfFefksnjpnRvXWjjXr947smDPLxmsKn9/BCqL2jI0+VVhzO72g4UTVhuWxa9IzmN9RCVnXM7JuFyNQjV0W76Gsmb9h3pzN3uefpMAe7UCztlFk6vrcGoKS8b94y7UWDm9YWBEKmTHZja5tp3ZPj3KTh9rx+W0sf/HRnp8qahoOd3ad6UXCO/fMTYrKULIB6UyI8G474A5Mt7pf+iEFryjcVJ67tvitSx2XJCxPE2fCAAONEKESyoH2IsCJqPlK1DlNJYoAylH7lqL9H5EC8gWyq2nYf4TsZt4sgtyUH/vGlcQD8SaqQziwcGNFXmb3earlwGFo7//Y3X12KR9MwpY0Ikto30ifZRZkNXbM1kqWH7mn550E08nS8aNm4OEdlyYOH2c5Y66Z8gT+YqBQ+RvHeuX/cQNHqeZgB2LY8nh/vA+3yzjAUMtpE517yrXRlJ744IDwbHIHAuyUtpTAHb5tsxWTvSbz+e2AZTeeG0qD7WXs1nNf1eq7f+2/cYB2ayfOEIdYmuOPg8+pXKVIp1S0SpBQ/tS++vPXxyiX1DLHDcmmA5F7FnWE+TulevH5rXz+gi01eD7esW+faofqSEj9hj/u5W/w7Kh1WT9vzia38vd2OEEszAJOSZoZxoDaSCakb7Vaz2qHQ4rpmPsPby/8ZkWcf2vmwsKghQWBj42+ia4Ke6V+zaXQxCjSW33k8baYfWH+Of4b7/CzwsJWOnvPjFsQsNy22mFtzI49fl7LYlakXN2UXBM6dPj8DUFrGqK5fVvosqQJ/86SDAfkZP0ypcPtpGzG6BmzPMIc/CY4znIwDRjgUgbNzzieehApX+POm2YmXF8LIW5ShZBEyCkYZYaOdt7+sJn8iOacfPpjC3IgJiiBf1UK2jVz7sR4qm9wzH/i4SDqcTgBup8PcPYBYk61aqJa04BXCnixA1S/LWhmq62VpXJd01skQbSeS/m98OoKt/UHF62OX7DFtyIrEF8np22QbRs5iuL4sasvb0uoXzuvTJGTUVnWPRlXJOGVqjiVE+fFRgGXNq5PAnykwAdpvZi61ap1ioYi0CrNHRGjIE3ZmPnpgT9Plj0hG8Kzq/O/w/5isgkpyHXUjoMdru7YemYF5F82qrv4DB5XlF+Wo5rPj60gMyvgVgvQYe39AqDDQppLaWb48HkI1emT8BmSRDU+V4h1/L4tIHTNDwf4qX440qc3xb6SRnakNfVrAzG9f4COVNA8Xcr56Ih+3mBgJBIY6mouOoMXRXCHNY46h4sTR1hYzZiLfwlIl3rQZkqnf65k3lynNW5C+bqobRXGWg8BuvOxxkOQBdBWMQKtyslaUeiBmnX9lqatqkOwNzmgq6caPI43Bfb5H70d1LeDtDO/tuPfHZ6OJqJPPgH/Mrnt/2vxAJRyra+hVYEjjZiauUrmy+Yq0Irrbr+2dHd4R80vP9Q+3Fb0W53qmyuo619TFSuum8/wHgHVRfQUR9C6Vga2QkecHHkFR5M7VYgN2KkObakzC6ta8tblpsaLhb8e6uxAy/5G5sxliOnL12xXqLryGiveiCdQPH3Iw70hJOJFhRT6/8jJjstbNNkEbtJWSBFg7cZjfPzzt+zdg1r6VUiC3kcQua5pcq2RgHsCpznuIvBwjISRWoPsrWViiUKtSZYSTpUYJO/frhWNuSm0tUDPLGzZW3uM7qrMsMHECRYjJKicRCKTVCO9MRNt0aqCKkVO5YHXm/bbV5H7qDkbflllkyj4lZ09c82R319FPc8PZ7OLSE7TD03r0Se7sK/qNLzWqqbgAtVGXAAYkwBtAr0HRQRaZMnpUSbojoEOnABDrJdRJy0R87nkXlOa0ej7Cp62PHq8DE9VeWL9ry1MnLz9ya9dDjmZSE5eq/soEY18a8QUiyKmu8hiyogq2zdRgApVPj9cyTqSnvfJkzNr2WaSXORSjqLePNpjD0EfndHGZyEg835pjUy5M++1k1cH1MjDOU4vK5E1XQ3wGJp7M8Bj6NO5hzXoWhFrTrM60WAtdDwi7aOmPx+0nk3bk3ap8cGfxz9MRj8RQyxHj8lC1EZfo1XvcmscvWSgP5SVUbukiZKuiqP2MOjwXipF2y8nbdq5IbDdJyjo8zXrLqVtXOyzxW/r3eLaz3yDfLuyKisLc2/j1ZFeC4NmTE+Y6zFv+7KoVDOh40q/1L1+EY7J8nlJURELOf7XwYAe0XsaqOygkEScTgNjxDxSDh9KXN5TDtdDF+Buhm/RT4lXfHoaWXNitOKaMxPB2d55kH6cYAhvFJ3RD6ABRNRNCtR/Rs9cqx8uJAHv1guHC9EZtDK32NNbQL7rP6TPUbMsvWPfs41jGXJo+0RmW08iCUdWuWzRgCk9vSuFntMo6uk192rAZ0N6bq0A9ibs01CNkUpUlzgpRMxNpWPb8v0HlVExfo0zKOfLDq711egIWbsq2mUWugd73QJnbw80IKenfkY9Z6fuxVCqdWUIqKOx3h//knq94PEvgf4LN7hkY5djsIPW+jM7jvrBm2lktk3C4g0J6Fb3t0AO0J0B9HqgBRZ976jRSQxSrRd3aUw9dmtl6r0jcVfnh7gW++crhxN99OvIuuwF5a5BPq+zsvw/Ghu7S12cUmfMaLmQd7x+mt2auU7aOnAzlch3NPatg90o+BY8I8pVDImFWOeDwaDlMjl6sakbaKj4r7Lqu+u3fVpC3m9vRz5HDgdtX7Cbb/FL/jfe+7cVHHZnWvLvq+YQD2nc4g3Lgf5e4LcL9iSkeqGZdVtq8zk634bt9b/VCbleudKK7y4sdQubGeectVGESkimoDzZOWbqIudan5wribGvgQDdS8lU1tx41uxV1jYnDuada548aYWzc95fzXXdu+CcfGBnSay5dsrtqi76oMiUm0CegS+gE6+SI+RQG3oFLSZ6HRUV3Hkz1T0pQBrn508iepxmrwQqDUCFgfM2AGvXeHqATdMDIIjPFqomNeLfVCMXIscP0Ox6QogK/UFGAB1hCUmkZPf1ACGGs282F6j9x1RbOOVz3PDpgZY9TTXNSEbeX8VVMgnkBskZidNZHKY6jj4mtvT1B/pgMZmF3llM7FDrjh2QpXsBj2vAQ8gbBVzGAxcNXo6DoaGGA+rD2qsReZCL6AL5NaXn7xXkd/KqEJvpqSZ9jP65cbh6/sH5NbCVWSXEoR+39q1be5ZRLDeIA/eC0z4KU+3hgilQn0zRTrRhoE3rL834WmMsmvG2dpj9Su5O5fm0au+YINKMjqo6mZlkXk39m8lXt6ZkTg3xRW5+5E8YYgc9I2GzCsMSUgyGW/m5RS/YgRZV7CT7yvYnFvjqDzObZG7jYyVcsfCnnxae5nQ9lESy6VTXv+Xx+nmHy9QbZICkWtjN9Fx1U2utYiL0Nak8gyz+mbB06QQPqcOo8aMmWI0i4D16tjHD05cbGqQJBZNn9CRylCklQQH0ACpo7+PhQe4OyF7wPhdYmS7jsnbGfebT/e/rE1hr3T7IBZuPTixcaLzg8sn8nW3nR2++RkpTC52ci9esyXdyKUgOVigCg+fOJlFbxe7rlmhm07/mn1uJctQ31Klvriu4ceeTGzfu3bpBJ7CAMAK0guUNpXYOqiDlsmzGTHXsolKJvxSrvsKL8/JUoOxl8K33SRTzNXx/FNXUSZzm9w9K1AxEoEkDmznM7CV+S3NnTZCf3BheFNjzIxDPNd7mT8fXdo7eyqMofXVUnOeK4PW+pfFkOzWPvfn5z1+3NUsxGuMVVLR5zz4O8QyIKa/SGGv2sihrSeM6xNp3Gn+419YBsbar6d73rW8n41GbzL35L4u4RSQYWRVx55ZMpFzchXPbSs/te8RxvsVNq4Fzn2k1v++Emd1TYuHFV1krb6EZl0gd2v8uafhITRSSAohMrZTTD0TMadktLtsFakaaXBeEpKUklsqloluti2JmIYtOch5tPUtenRWzCGhEPnyIlMRM9Q56/PQpGc2h8gc6y+FO1OGAinozzngVHCpLCdc5w9fRgfdIg1KpbANYPVfQTfIJOY/laiT8t8Q9+1Hrvfx8jtZIboZO730cxclW8WJvDIyu0VDlFWR3mRxAB98jxy4ou1E9q2fUd19M7U6g0gZyAm/50sl1SgkcQiyxUyrRB0qNfNAdMgX254Yud3+rrb1OAQ315BrUqV/dsVuJ3hGR+SQFSFQrmeri4p6UgRQuAoqtQGGw6fFWOCiKgLHQ8Fc7eLgSOM4C+1TClZqpd6bmKjRQoftpvlg0C1d2kBu4NhDqoImuM+d5Hz+m5zYvKFkxRJa/OqOSKnRVzxquyk8FhQ7J27gXaiC0f0FgoFdKSMx+SEo43Jkwu/and2g7QEeJdi6Avm5C/cIbgJu00r6VCfvce8zsrewM8syNyT04v/BKlnDTfu95c+e5uu7LIfctg+22V3vkLBHuupmefKPEc4Pip9onlyODixYezYtq3OlXHF4d5Ru+2C/g8I0KdrSh+L2PS7siinf83qrsKTYdD+jOkAk0FzHkzRh8Xq3oH7N1npPCxMk5jTCuXjqOjqtnRy2OCiyaE+L5+pJDX6xd90Vdwiu+Ie4FXoWdwWUDZ9Wb7CetmetR8FcjBHEnpzRbW0D2SignL9gVO7v/OSMhPTE5E1hq7sVHt41IgZJsV580U1Pak8pUloIFZkIccIIr6Z3z6g6wCAtIykmun9FBUqBKus709DQwi3tY4sfxSuXy2f6azZcipGnBIDaO02zVmasojxy/9ufTq6QN5X5AHmh0DE9Fv5ENqJAYq95Hb/I0c+wwDXY6x56C5RJNJsGn5HGjwc+t3YysVWXRisrRhFJzb8ya5+ZyuSHsgxLmkO0BSrGU0hjdtH6QTJaN5RB6901ntWIZJKnlYV1mzPBMNM8XDEIVx6WgL/rSZPRU7TgUGQ1O812g+Zh/h06a+8cPGj4g33aJDYnLdZjgcGLzrpaeb5V4adbSlQtXxG1sr1EV8N8weD4F8LzGzRCBCp/m21oLH4Qam039TWxwXJ5cqgCSSiCpOZJBKYshHwij8dmG0/JQ7STaWD2K5g9yD75Bn1vwxTPNkw1G28v2bissRJ1M4I4Av5WzQuY0La14L2Xl5ZzLNzEi61aXDEO/MFm4yzl2KjeFtnPYvmX7hgO+Uyck2brDnfmHnlXCYwncnfn3lB0t7RCTxETOoYKYpFRPqMMgUmnv1xcIAC33mVaggiHwrS30W78STs8+gah9hzX/14SaM5KXTag/URYgs1Okc8Zd1Bq/bkLTOfKFf5q6ewnBGjytI3pT1buA2D7fGFNcryS/kqgBkToUTmgRcBVpdUcCTYp+0+krSnJytL61c4ynj+Xc6dIR4xkbWu1RX1lJvu/8ojDMOtlkdvLrh1GrprjjKF8nUbQu/e/Z9JsvMB8Zogk5/YCi5n6BA/PeA9TLgPbLZtPmJAKotChr84o8vfl9L87V4YN7tzT15JhBK0rNYBrqyrkdcVqjKfue721eQqvL9x1cwGh2kdykaBcFutGTXKSeSa8CbK1AV93NgFzHygpQMcb9JtLWzF2/YzZClu1qfpfP8i2O+H55sRW9mlfg6Ys56pgJO7tRNQnfi78RpnrOmqtm4g+1sgUNok8IUQ0aptagn3Sr/Ee61Ue/wqr2WR7QvuE8XT+EXrtZfS3tYnD5tRnY08S+9SvmagBIUIyMxPTsrOUvqlifxvdj0z7a9d6PmME/qbpQxc7SSsSW7wrM8wjwPglV7NPm43/nIYM/TKeJs/lD+PCA2KcWty9OmZU5xw1QUH4U62k11l6dZdDVLepViph2WPiPdZneoz8QyHkziYT8z1w9i3b9z1n09Pi6rfYrPfcmlx6qP9SR51V1O3PTXdKOTqnqGClBWSTSJsgx2nPegZryjdlRJ3Nz3kxmXNHf5TmqC46AgXZZ+O8Ahm0UwxMeT7f6SLf66EWtQld3aFd5jLaC0c6iBz53g9S1NEP9U/8nb9Bh1cPh+Zs35/duLdLDpkMK+j+Cozp2trUVlyqbmpT9uV9Wc8fcKu1P0NVc9epfuh4L3ZVhn13RVfrdbA1+3aqgQLf6OJBbpbGHfnen+rsPuSm0I9jAGNa87xTahJYsOJ/z8z5K/IWR6itd2k07/bQ3Qynl6KTG8iqAK9Q+mhm0xeAzaHU5ZMhVRujBq6+mwWBY60+mq8uj51ApFRUNcCrAmLyXlwe0o4GLv4bLy+bcfXIIZunPPzv0cVqq1H9lEwN5DcwrIE+B7blSHwZRIbYPdUtOYW0pxXd+f6ah+JDMZ1ZSIgmolhK5NyEzE+SmfcoN7HsE1TMDOmn8DOzCQXNn5eAjZctBsz9Nf89QZCJiAgO2Bw5pcZ81Y74NnfyF7VE1J1X6Bu1NjE6aZGAZ5ha23MrHziVl7rSpsfFHWsy89m/En6ts4lM8W/Z4ZcE40OPS9yls4d/Hjj6viJ6XP2fx+x+WnFqUVrg4PdseDWUfG3f7gecRA95skMMksIkXjTNrad+pM+2jmryYTLNZfH5868q8Zp9lt99evTk75+9/Pn6QtW6FXYKTItqBz8e/qZnn5pzYGZm0PGrnsUNrdlmeiXL0bN0LyEBK+0FDp9G4p54762bN8IZyM0QKpKCa+z80bfWWnTtJA4r5+Ot3ThPy+VHk6sXpMdqfq6FeWTuGJKJ3xWS8pkDFvGHcOVAOkwfMkxg+nfma/PtMQrzHT59gOnw81j9+zWSklUMQPuuXE3R8juN0v+kwiObzl9Qap5o6p712CNWRIWg1+efkNyWR0zwr05HvUNLmGddX8oAhGjDUA4bBp87yQRDgKeR+ayuyalvvlxfcNsd5qp8tn22H8X4tKvKjYdQFXVUlk8XAUzWU/DOAJY0kPzDf0NpowOyXBlWptYQGWizihr2bNzQsiHXaGBRQFrU3zzHJ7oYB2un9xvq7Twu+ZGXuc5Ntp4V0ln932cQETconfBsXZIIMW37P4WYGsDMv2NkYbpbtObg89THSDLlxy7L9UcpYf8cUD5Zpw3zvrGoSRzqZICNy0Sz0UCq2Hqr6OTPFU1m9IGPurKyAwje3OmIBaiotJYu4PTWB9/TQ9PiF/W7a0I2vBzEmGeM67P3cwl1Va89AT/+b/UV3Nodtc1q8MfXS2tQvgoJ82oOydm5KwquLFkZEJc2TJ8+N9N+TEpQymxm7JmLJDnePuQnTZwQt9IrkvMVCyKZ6aDYledkMW5u34U/7uKYjSrJ+9Ahr56Ve3pZzbKXDJf38Ev/NQXI44DYBptdtnN7Q/g1S9724+TVfrcdiOso6g0yfnmg7efQfZH7yw4+IvrfZVEuL4eNQ8U8m+laKoP4ujzgap5rMTnmrAdUVkD84tQUrjIQYrgS5CnhjqP1zPOSGln0a6CKhSGZCHx0VinT2b8WW/Y5GnPv0BhmRmjcnvCIqINb6xF79yemznWKnTomU2YbIxoNyEKT6Bn26A71pXPR3Y8vTfGc5EUEzZbtbaGGIl+pHF5+Arr01p0IgygzjnuqiFbMJVBMKQKI5QQgE1pqTlSBDEwZRDC+vK/Du75LXpyQnnEyKXZVwaj1q6ul4WHMbvS/ctsw/0c1Pdjxlc+fi6JZ1bccxJp2LkoeifCaKORa/Ojpm55hJFavja0IgtfzMmvihWxeUU6bF2SyseFZ35Gm5ptC4r+xs7QCvr33WFry+iEZnzROx8NmAzgbgrlja39HNxVG/5yx6fdCXPj2/9euCMZnJ5Ppq1RsD2mBM70+aXosIdG/mQF/2Xx0Xe2/TaRPHgUuzbP/cGNQimDEISJO6S91mOvtA88XdOXi1YohdQVJGlU4/QCd3qT0b8X55H6ZPF4jq6ZT+lYDhf+DC5uTt48fRnLYzL+kFoTtad9f97X/1g0pA2ta0Tzim79OG2tilmYkL0WzlNr9tvs/Pnr95P/3OPuLWgVqNoUeQNGFx+NWctr0ZtQGMSTG9c/Z9sIwJoJEMxKeJmom4zixeYhXoL244/l5ps29UV1F7knKX/pyjioi8qZO3+izPnGm/Ep1WVbE/QNJ4+J/yTWQomEJ1cGTBKhfV307ePq8eKT7D3S3Tm0wiaN32nxNz/4BUXamJ07R1W0TftKelX93G7/2Be4pJnRfSqZUtnZeb0Hm5QiZCMNwRghuTqxWMGTgrF3/NuI9FH5t6sF+qvv1nxSg9sblNu4l0rLGeKarKuHXQrnZf1/3mrhkHYbp8qoIbkleQBegUJt9VnVnj2V5h4pzUVYbKwcKelCIliYQXp+VPiAl6ApgSuQk57TWJtRPyBAlF1OcmKcjN4NYWDiHqizwR3fh9lJ6l3DWu4HiQcl0qSiIu2KXnprmb47Sh5Jvvh/iMxd+Yewt+LGWYh9u6toagyKCjm06258WUYaj3Sg2c086W9CxAJ0s52KUkALRqPuBZPXhtrpmKX1eSutEjrZ2gNgfvPmGEhPHg8pLBS/NkdWaCtE8G8kZzujodq0teE/jt4EDfY6EI85rvregs6uhoLen88SnaMSL7/R1YQNiajlFMQE/XqLYa1KN6/hpRick2HtJOa+gcUkSf7oUIzPlF0E9hHxa4ZePmKaZmx0ebLb1+pK729Whl1n7Q/1j9OGXWGjSqKoeoDtY8yNcnm8Sodnh6RzyuVa3dmidiDkMU1s4/edOBC0cda580BoYGChkdS6mNQa4Adjq7sGaNLV0O7EvcOtJkS9z+akfr3dKJw8a4Ozq6jD46xsXR0c1U38qSNY8nDy4+Jn+uW5u6CTG/XUSS5RmXO5clNSyOq1vUY0x+SjgYubghaekrV9IByzVswzzBF3gMzR3F15gJ2KaqCjwxMmT/ZA4JClhv3mO2k8e7ynPhKiIzvoip5j8CvTeh8RtCh9o1SPq8R0UznJ1nTJs3D6VOd3aebjtvHl/kON3Wycl2uqP2fx7WcgDeQqAFUUkBL2RYu/v1+51V9/hTUbQXOStD0f7kPA8hX74PE89/h0PqCtkQE696iE35PlCaIrSWSJnZvPH0CWCuxyQTDxxd45YlwQaZy8M9Ul0d11g7jPWVyN3JI4fx31YNWe7oFjHF1CR2pMiSo1VN5IyU58QTg9VABaFJkYQcMRooGT3TxNVWds7jFZYGFrOtM3YGNDo5TQvwlk6TCYX5giEZoV5Zy0B+pgIeUyX4hBXyHkFc+wVWDPjfMgeF62HlsWZlvkDBLBecgZUnmhXNTgQwB+JxaGz5I5gcwRA6meh/6wIO98sOGbLWONzbK0a8dkjYTv6I/ncioKkCPWaHkAXqv/YSXs//AaUcDTsAAAEAAAAFAIMbFkmEXw889QADB9AAAAAA2wktdwAAAADdVa6+8iv8GAlQCWAAAAAGAAIAAAAAAAB42mNgZGBg3/O3hoGBM+GT9rcNnAFAEVTwAgCTpQasAHjaXdMzYOhQGIbhnGvbtm1v17Zt27Ztq7bNpbb2qe7UTvU7fOXwxPl1kmYe1hqMbuZRlcu+DNuRhJ06bo0FmIinPFfC/gl+4grey1BcV4xeWAR72YnpOKhYGzAY3WryYxmWYzhs0VfvzZIueACnevFDZRl66t5jzFTexbitHBOV28JBsRcjSYptj5Hav9WzwzG60ay2Sk09Lxv0LOp3umgOppPquY3+Ot6rPqcobxvsw3YMxGUMQGucRKd6a+RFXcWKPw85nK8De+sYWuKn+jqBWAThPa5rdjfgrxgX8RlLcARj1eNfrNd754CqKq1DIiYpfrqsREe4wAshmIXzynVfx6dh4ZNqiUckussV1Z6l/LFI0LNH8bTe9/kT76Wm3+uIlff1+OO6aA5mnmbxWvM9jSfoolq+oq3uvdds7bABQ7BF92v+iyTqKlLfz5HI+QkUcHwYS9FXfU1HtGWZrtTR13Q1y8wF8970MV3MUo4mmnHV0dcStgB42gXBAwDjQAAAsNq2t/X6tm3btm3btm3btm3bto0EgqDyUGtoMrQGegr9hdPDbeHR8Cr4IIIiTZFZyEXkIxqgldB26AR0BnoAI7FkWEusIzYF24U9wS28MT4eP49/IkKiMjGReEK8Ib6QDpmUbE+OJE+TfymaSkdVpXpQ06gd1A3aorPQI+lr9Gf6N5OEKc30ZlYx55i/bFm2BtuAbc0uZ69xOJeMq8aN5qZxC7mV3BbuLfeDx3iRL8pX4Gvzzfi5/Ap+M7+PP8lf4e/zvwRCyC10E4YIK4VvYg6xpbhafCq+lYDUUlos3ZR5ubhcXq4u95ZPKZKSS2muTFXeqDnVFmoHdYZ6Q/2h5dGKaGW0dtps7ax2VSf0QnpTfYy+T/9jFDZKG5WNHsZg46Tx0ARmFbO+OcxcZV4wP1uGlc2qbE2yHtqp7OJ2A3uEvda+6WBOMqeyM89Z6Wx09jjf3SRuJbeLu8C95N51X7gf3N9eZi+fV9Kr4o32pnkLvTXeA++1981HfN63fODn8Yv7vfwt/g3/QZAj6BwsCZ7FErHKsVGx03E0ni3eK345fjv+OMEkqiVmJQ6HcJgu7BseDT8CF5QFk8ECsBpcBC/At8iPCkQlo0pR7ahxNDAa9R/zOY7nAAAAeNpjYGRgYPjExMaQwFDBwAXmIQAzAwsALeMB5njalJDFWYQxEEAf7lxxyA13d+eC63Xd5XccCqCWrYECqIBukHyD60ZfMj5AJdcUUVBcAeRAuIBWcsKF1HInXMQC98LF9BXUC5fQWLAmXEpXgV+4lpGCGzQXQHXBrbD2yTIGJmfYJIgRx0UxxACDjNDLE+mtOCBOBMUaCWwCKG0Z1n872Bgknzik7RfxcIljYOOg6NB+XUwcpuinnxgJreERpI8QBhn6cTHI4pDijH4k0muczm9jb7zmvUfkiTzSBLAZpY8Bnf00yxywwtITffb5Zt37yf73WOqT9hERbBwSugL1Fj2PiNIj6ZBDCJsEJi4Ofdp3mj4MbGL0s80aGzwunCEVZh4AkbdX7QB42mNgZgCD/3MYjIAUIwMaAAAqlAHSAAA=) + format('woff'); + unicode-range: U+0460-052F, U+1C80-1C88, U+20B4, U+2DE0-2DFF, U+A640-A69F, + U+FE2E-FE2F; +} +@font-face { + font-family: Fira Code; + font-style: normal; + font-weight: 400; + font-display: swap; + src: url(data:font/woff;base64,d09GRgABAAAAAB4cAA8AAAAAKSgAAQABAAAAAAAAAAAAAAAAAAAAAAAAAABHREVGAAABWAAAADYAAABAAdsBp0dQT1MAAAGQAAAAIAAAACBEdkx1R1NVQgAAAbAAAABAAAAAQodMa01PUy8yAAAB8AAAAFYAAABgc4zF9lNUQVQAAAJIAAAAKgAAAC55kWzdY21hcAAAAnQAAAC/AAABEGjeCRlnYXNwAAADNAAAAAgAAAAIAAAAEGdseWYAAAM8AAAXagAAINJZlxASaGVhZAAAGqgAAAA2AAAANhL1JvtoaGVhAAAa4AAAAB8AAAAkAzn9jmhtdHgAABsAAAAAxwAAARIsXijQbG9jYQAAG8gAAAESAAABElQQS61tYXhwAAAc3AAAABwAAAAgAPYCg25hbWUAABz4AAABCwAAAkgzWFNlcG9zdAAAHgQAAAAWAAAAIP+fADN42mNgZGBi4GOAAAMgm5VBisEGKGrH4AYkPRh8gaQ/Qx6QLGCoBZJA9UCVPCAMZDMAAGrQA4MAAAABAAAACgAcAB4AAURGTFQACAAEAAAAAP//AAAAAAAAeNpjYGRgYOBisGNwYGBzcfMJYVBLrizKYTBIL0rNZjDISSzJYzCoyszLAJKVlZUMBgwsDEDw/z8DHAAAwqUNgnjaY2Bh2ck4gYGVgYHlC8skBgaGSRCaaTWDEVMFkObm4GQFUgwsIAIIOBigwDnExYnhAAuDohj7nr81QIkS5hcJDAzz718HmiXLmghUosDACgDVgg+uAAB42mNgBEIOIGZgEAGTMgxM5ekZJSAmAxMDM4hkZGKcAKT2MDAAADlQA1MAAHjaHchDQgVQFAbgr7rzbBvTbL1su0bZ9h5qDWFcK2ohuc75jWjEIOlXo/49+ECCuN8lOmSEwtAQOsNKuA+v+Snf3wQhMxSFxhAJd+Hlf/MR98sC4G1DlAREsOfRMyhQqF+ODu0iunRr1aZHhTJVGmXIlCVbnnxFipUoVa5ajTq16jVo1qJJp159Bg0ZNmLchGkzZs1ZsG7Dlk3bduw7sOfUlWuTptwYdeLYmXMXDh25tGjeml25xgy4/QFZryhCAAABAAH//wAPeNp9WQdck0naf+ctiRUMVURwYwQsSAshqHQp0jtSBI2KDRCRjiAi0rFgd7HRsWH5LHv23ns/D/vd7a6eu+7ZhQzf805CxGs/JclM3uf/1HnmPxOKpUK61rNTuPMUQwmp4ZQ9RYWLRWIzkViE9ASSoeYymYODzN5cMlQgJEN7BwepnYGBvp5AyNjzH/XJYyHsgI63TGPnZdT6g47ukGQ/a/8h1oO0+xoMco6yiFJYxCTmDDc1Hc7/cee/3J7FJXytp1mDQYMMWgVeweOC+/YVGOsaSwa4z3aanaGNP/KPDhk1iqKpERTFlnEKsK4PRbmLGQmSIgkSM8w05dO5O9DJJ+jkQeVmdOEFmozrOMXXLeh3+hl4cwrk5CDXl9LjMdztzc0lEpHUzoVm7FWfHHT1tGgJeGtnSoMXAqEpzSwKLQ15/VI6J04urym49iSv+LeYNYcm42UoPG5XVYRvpkdgTQIqnpVmiYV69pPpC5nTsEcK5uatj7XgFOLg0sSYBX7a/byqKApRhV2/sqlcNmUC2u0MDIXmfBQF+noGBqBbbiiAuA2jZfY6w+irZQfDFO41wWknM1OPZ2askce6Xl7Vgv/YXIf6c9meHmly66RPd659nus9er5zTCNy/vkX5FTP6+gAL415L0GHSKwvVv0J0TaEMU3P73zGaOmxd7DNcmxYxSmWgUQLSPRWSSggyxAIkRj+mEnKz7t20b120UuV6ZxCeZj2/rqF13CdopgXag0qfBm8ypgX+Dqy6/wHssPXOUVVx4GqKta/Cp6v6fqVeQ7P6/IWQYChOCzkxGUZL/Z8dNLB8sQzYYGxq51X1OJZnKJzVtSOqgg353RHi5/qGIq30RlsBCMoA8DQlTBWtL2MkTCmNNScRFeqq8uaBbWMYgT0L21fEI0Yxqwh6J9P7/HJp2/4rq1MNu2UMVdM0patcVNag4JQZjcFlRQP+QiHfGhTxoCrR/N1y8efr2Id4QCwlBYN0JHa6bDhaS9aW16mpb1saX2RdnBdW9u6jdva1tG7b+ITB/Yil3u3kMehffjkfaSLhuFH+A38e47EvI6fwfJYsLwPZdCj5hwc5FBf8FECxcYyWyNWJlw4qVgddbji7cY9bWjKR2TC/JRUIFfulxVn152OxohT3IA4TASLbcHi0YAFAJpQkiVpbmFFk+X4fW0ZmtKsbdazunUfJs6ccLggYmWs/ZKs8gsp8y8VL78TNcNve7R/gb/b+uKkQ/NQQdahmZMiMsYHy9Mmjk/wlQxPXJ0yc2tcaECax7jRMV7jonwshsSTKggBvyaTVQhZBS9kYiG9YxcOY7V12Ksd9uzVNWvgKRd4ar6qVsKlCMF/Cf9/2gVkhayP4lx08ALehpuOoD1QYb/TImWp0oieq1xJP+FjVwHeilgpNYQaSVGJesQrC4G660il6i5kQTzWR7CERDAGl5kjIy1HeM4wHLN95uaD+G1tSZZ9dZilYnvguXM4MGiZ1fq25Yl/dx2rldXby9vXf9+qhrbo+ZONTAqHmR7apKwM9kbaOYlTE3kvD4EFvcGCwaC/e4mam38XZBJjuim4YmyY1+n4TY8zMh9vTtzrFza+zLt8T+jSPPvhc8d5ln1o2tyxwtl5nrX11VvVe8N57zYBtj5gD6LEEENTWqpR8F1TReCi2NwcBXIRlaGhxV7BfsembXiYNv96dcnJmTSNYzM39aXNmGXoTl6tr4116liPyk8NWz8vK/h5q7G1Drrf3LZtB2izgFX7K3eP4kAfv27FMqlcpIocpI9EUiCET/QZ3IYP1re6HIj/cVlrdIJTctTgVs62tLRR+VN4eONKJUN/mTzRIWSkEnFnAPcPyLBQ0IfqTekDrqYboO59AFyhn6ARna+QFz6H4h3Hj3eUeXqyJp2zSkoY3RL0xtNW6uUltfWkkAqLNQGsHkjfpDVCfPRO4GgmD/T2p4xIXxGwQgsXWvYvqpm8zfjuvcEb35ZhP3TK0dPT0cHDA3Cq97xZMWzxoFkHltJfe9pAU6sgKyasVN0TVDnQ5MSQZBsSBaVHx665lDjr0urVl2fOurK6vKqivLyinJWWfWyp+7y0/FNTw+eqikt3b16+fPv2JcC9hKMJroga0hPXQiQUSQ0JslBkoIY2p7dWt/jF7K/YNbt1udbYOvnEklEjCvyLl9jPYaUAveXLsjzcR587tyo0umy2m/Kjs8/FO5WH4viKBfuZ16BnFKnY/9gV1E1B/1sDoa1zl0qS56XUxSTuzy485uHntGJG/ixpXtLMDVGLrqQtv+Q5xaUuIy7AxttxsLHP/LiYIq/xtvNHyAKdrZxtTYwD8qfOq3INH5cqdQULUiGL7qwJ2U9gtUN3Vi1765OoBO+48P7TSbwTLbmOn9GW6A+cg8qxgfIaOguSC3AMKwNJbYgQ0qL5hMr53R2xMrzMLO1A1aCUhb6DHfGK/dA+RrImHe1J+zK1SnX8MkIhp9OYTV1d3exAIAA8io87jJ05BdTJQEAViqH5ssRz4DOkE5MYMVdEymOwdwyp+GMjrkcZ589PWR0VuZpTrMA5px9tOhoB7SlBed0qP2NGrgy0EC5BtNCgBaEBvM+ghVPpkIhYdx3lsl2cYn0HTzm6ulRPCPUE5vzuTwmoJTPBOtWsoIRiVDUvFOmqpbdv5+UFJbhdDznidhUMS1H4ETub7Ca6UPdDiIwYwqQj1+XEsP8JoFcAACORi6WG8MYyXp1vokZKzS1M7WkarzUdaDZirBUdhQwqTUb164w/39/SpJJTdNjU1IxI3ofE7ah6Fe64iX85kDYS+yLzmhr8CKzvZhXgL0tpxkJj8EZMvCkepZkV3IdZlswuhiJEfNzZ9ZyC9AcwSZeR6kqBX8ArowtjkYTum3+j9cPDlgN5P+Ydanr4Yee1vB950kH/mS7naQf5y1Fa8HOA5w0rdAzsgdbf1pGwRzVrFpFEIu9Or3qboG1X3U0PKgqKWpdQ+Lpx5ZfYpNCjqXV7I2smvde7HVgeGVwamb4zcOqMv3HZsfVzIhf49hWG1iQtOJs2I2GKd8C6ovh0h1XW04P9ptr4uMyKjOzBnSCP6eATbwqS8v1UR45adgq0eqP3T3fq9sVaUD8T8vavCWQvAiX502bUK6FjPESMyAtZiJg5iVgZRWlmjTWzxYiP4zGYXQO6+vFxJDRNSjZUus+WtrZ61HwU26CPt+kqZSYoO0p78iHj0YgcqbwRqsqz5NFMu14Ry3XU+zcUD1lxjFyX7b0LL7UZaOPoGekQMNTJ0WFQEM+k2Kt41gncsS3F36xosGfR2wt0AqATZkYqo9c328mYI2M1x4IxVHiPiAm72aZYxTSZqezlDgdeDy9FWBNB6UNQ1MwZxgwZq9kHjPsRVBl8X87ngXQOpkfnKMdxw8LnbUwZNGtxlIUXHrsfVaIZQAGFUcXx47SqtB1nT2T+3lnJZAEqQRF8gEhJSaRKIDgMNajrPLuWq4XObUR2an0DHdEAWqgvkZnz9FAuM9Si9YGc6IpUxUbv+vIWv97+D+XbL3RSteea5ubmNZ7VXG2GDr6IH+Ib+EK/3NzeaCyYNxw56mR8YKY92K98rcX83Gmk9Vq5/8E03kPCnIiH/UkfS1THTaTaZ8kuJAfNZGsigUS6S4ty6uz1PXMKQ3MPTGcaof0oOyqLwx0rHDx/SDy4gNb7ugUQaKoFusgSkgPATlfzfTlpGy0841/ANwfoCtbsra9bakgfgBjHgwXhat5PJFR/bHhnnwbUZyPqwyeP7yXsTf6P59eg5wbpiiLYjQi+bk/JG5Umlv39usVVitib34GorCWeM7zmRCkjQWoEmtpjsATX8BaH4zJk3m0xRZOaDya28qz7P/d8NOfGF2RS8bYWL0arf/77pFVRkTWcAtOXnm49Ew2hy1Hut12cm7RQDngI8Ko0u0gPPImsJ2L93c/IpPyPWpz/T7rm7btJKyIiVmog2UvrldnKgzaAWSCnGA037kPp8FaGi8jZmdUYKRuAIKu/Lez4iPFrOFu516xaug5d2wOA1KOrz/4CJuYr2yqa0DB6CUks2MnAqoYHKENSqSIekJwyGC1Gtba/WUuf//Chq/3wUSttMzsPy1hDC/Hgfk70kCGmMQXuS3mjr7b/do29raw99LzQb+h8I/fUw6vo35ULlHvsFuduLea1AY0l2nSowbw2BxWnkWgOkbrwZqBSdu7T+4y7Ncfwy+3bkcmVH36IzvcAJcpH6NTtjUfC6MNKb35EmyujlTeRZX52bTasAXLaIau+L1nl6TCeDp3/h+/Oz0Jgiqb0v56gT5UcDonxXhsya392f3qKcmOv9J/S0tfbTXK9tnonfr+hnj9He7klSW3ib+6tOfhitt/otLHxmoM0oiJAl6z7rE6J9Ogeu4suMFNas6kM+oKGln/ZXv4saLZP7ZQDp/sp6+kEreONGbWuU4Luc9m4FTe+xYcbFcHT3cZ/Rr1XIu5hiHSmZyJ4qD5Lg4cCiuoekx1UoNpBET9LTtDkKSEfh65PEPcUkmXCNr5n8UJyGmPG6uAT8qUJB3a3Tc+Nz7Zow8d5MjNO5nHjAtZFz5cX+AxTLmRvreg+B5eCr3rUMBJZHX3+7GtOW6i3GR0dQ/VZUsOXeq9o9tl7dXmTD1Pa2lreb+dZv9jhI2L8vGMsR8Vy2XX47Gs419W0oFEXlAshs3vQCOS8bM6Xe/e+JsHr/S9JvN7x6p7Wn6xS3m4kQTzTHgbkRUW1pfxmdA23n0aeObmoT9ex21tql5V9Iif7EcoHdKj8zMJTDyoXV1eXksjgP0hkCDNSxwVqkhwNeoZHLEQ/y2tiD+wOq02xjI6XdMeIGa/D3sLjbL0hSrer9qaYVUtCMmPRUE24SLyswe4i0te0us9ShgCL+BMusxd34eCzb/Zg4LspKG0/XVBaOkf5hhYxIcogeh/ks/tcC/nUInW9DsaGXDtlC2jQ0oWwWA3BeXWwSY1baA6EmksKuQvNKPwksZlBbtN8R/cRLsv1zfYtSPRckiKhLU+Vp++cMv/KksLLWe6tGwJTJ3Htxfq29iaGTlO35vV+ffyaa9OGkxudK9J35demP1i37XVeAepzqx1Zn5YZW9qCj0/BxxGsFNa2hYZnCdUGiEXqA0s304IAkE+0V/HJ2bF55UvyLuXi+eH/N9UpwuZFaWlInhvu/DIrfyErdcuNCcsc0r8wZ26FG6utrV8qEHT+HBEbGGi8xCs+ypvn0k6g2Yg14fmDAnIlFKO/ttKP9ZRPWZOlED3V94KxsEaCyRopCoWcqGY5i24mLRUhIsuk7FReUYsL0Q/4Y8dLHoal7GFXsSJnTR3o6aYaJs0TaT4BYhWBRmTXYp5HKf3jbFxH9h+IlLi2X2/jEa5W9KhO/ErgY1LNfK0y9ebgBJJcUTEy78lxFFFxouZcUfjQCvwI7cahyLwC7O4+70PWB1CascAM/AgnfizS18xyP8PsADJbqA8x4XPAVoC1MFCI/hOJpvvPu9n8/tn2n+atnXes6dn7HTeS0RusS8vQLzgC7SR/A5VX+DkeLxm09FGdEt1J6qDKehTZfyTUEgkqPD4nb3FO8K4JISHtczOPzcudNCE/oOBBZe1f/EL89mfX1JQvuUsnRXtHhNhYJY7zdC2cEpNqLHSaFZC6LmCiU7LMdU7MxAjQz5/KmJ/VJz2+cTnIEd9pQDFifm7t1we7XW3t1xsdgTPeS/Rm5okJnU2sCdabccGFmchHicgLekGUokmUSvG3WTPN7CKyuu7w+yzoAqaYriHNoO5O6x1kcwxvRhuu4MabAB+FtpMYvcYkE0SO1Fmcqs6GU2RfeMV0AppI3bE0OyvT2YqzBva3cJns7WM21lrST8wbz9TgV3sel0daJBuOST69BW3nMSIBOQ4w9FS3mebmcgkD/ww0t5naAXUjBBzd61brL71YljPd4vf4xS0ejmYi989RjqPPRZ2LVH5lTZS29I2e8fzXO1xXbNfaiq63ont4FHjogY53vOR9I7ccpBb1qZ7yPVg5kWVMmVWdKbxmEl8crZYyIBVMbsfIWJugFINfYwiK+hQslrFj9HBZKy5kTao7U5maapBSn/JByoigkDHJpVF3LmEVjwFd2dwj4DFW1Di+L4q+64D8vcm/XMZ1383IRebm4p7XKXS/9ZbTZLMzbT2K4q0nDV8/XGEVX+gmy5ttP2nUGp8JE3ws3UYMd0GbbL2HD3Oz9A1y4x7pY1YuLf/Y1PypUj4G6+nTaIy88lNz08dya7npiWfPTtnb0flWNjY2ylJb2emnz06AH+Teg/g1kEQDUs3chmjoqiqFWCuDpKiNZG63Ou2ctmFja0xCQJMNKfTjDu4Nq9BWnDE7zs0RPeR5LHSpAhLR/oCiJs6cqidJWztfQG6RX5WJD8fLsyYQYlW7QZSCZ8Ag+a9sPbhTZzPquxH11UjU8H+gSwG6noDEf2PrT3g9cd3iFUQRs/o7EHLP9YivpB5sXQ1A2DoaoTIa+Do3XiUKMp1g6yiyQsnZhqS5J12HHKLGG42nwjN+momno4yrz+eUp0I574+pS15YFwCfbPBYxeK0+YDlAVjjAUsLsvA9Vk+qjv6Wv+ZBVsGfq3F7By1dsTxkkd8agDngs3FRRZ0XU7sY2+IxZtMnL5jO12I+YNqTWOpTRmpUNdXV/QbJM4DBPrd+T71U9svvwYEROW5FtFs9oG5vOLSIWDkajxmROCknEd3hXeejJQS+vhU+DqTEBPe/EHZSxfeNr/z1l3Mn7vYXmrlPcXcZLLMU9zKkHYYNz1yYBeA7mg4c3s+sw693Pq2Ks0gb6DT3RC1qxlbYUVGRMwN0QXrYZtJ1TNW6/hNfVx8O2o1LTs1OOlF4Gnc2NyP2rMTMf65TDqjJcF+WnVfjRusrX/MjVK38iOcZRUVnRqj7CvOadARDquf9uWkPxk4IO1mbPa+76Zbp+wJCvIv983bro+fYpN//FQUVewX5norc8jQz4wkrdXRKth7Z0lJyZNto62QXF9WN+r/rMPh+35ID1/t2/2NZf2dW6sOtU0/6hrlXBpa29sNa6K325iL/Ze4hE06z0tJ3TU0d1W7OqTY2246U7GgYbTd3nDP41X3LDX7pUJox2aV1Vbs0w8+SO2nylB55Sn3nDmMROcOngqXzwFIDatj3d8vdRNuFNhzak2czqKAhOLB+Uc6PQYLS5uZSYdiP6ckBpiF+AeGm4ay0+OOOxs+VRU+qsSXkYvyK22mVl28X/jRt2p8W3bwM+maD/isk4wMJb1B1SIi+BYm5VAyE25BhJE/ScpNzEYObE1OTn55CizthiTf9k1k7cWpiXInRyA1Jm7dCd/qLBQ4gXATH8V5RZjz3BTANz9aie/BsQrQlMqkMpaEw3Oa6H35OsAhKD3T1jrWcOJn8qlBfz91rLMW/BvA/K8jnrpvpPzTvhwmFGfSZqbHkBwZ2R+lKPm7psBc4gx8s3wUT9YFu6qrINhIx+bdxxR2csg/JkbQNp6woK1NeRJeYzs5GZlInCxaDlCO8LOfySBzIL9rufHczZfgzEzAoe/4GBekD6v+67o9/9KgXEvYSFLY/6NW3L92ADd4r0m3t5isUGXbSjClOo0Y5OY+0JBdlG3pPqqwPVfrChYSib+WDAvpgx6jqava3uefLFl+cl3KhdPHFtPSmhqYG+N9E0ciYEzGruJ+pvuRER364UHUCcY/PqMLGxcVmtKsrSrVycbGydnXlRE5W1s7O1lZO3e8UQmlsO+MkMKMYQDKTcwyHk2P5ycPL/wHfZnMUEygYS7415CzoriCcYC8Yu2J7LM+sBwkoZqXgPiukCqF6f4fnU7mfGRehMXmeE5qhayhNiqcLjR/FNsK3SfDteKGeBu1TAI4cLdRbsSmW5/HW3BumWPCB0iY+aRYkHHDoqICisF4Z+hN9vBP0M3pFFnNvnJImGI3z8xtnNCHJicj2B9le/13WIEotu5jrbz/dz8hdLnc38ptuD15YCnozi4QseFHahanO/wexyY1KAAAAAQAAAAUAg4V762hfDzz1AAMH0AAAAADbCS13AAAAAN1Vrr7yK/wYCVAJYAAAAAYAAgAAAAAAAHjaY2BkYGDf87eGgYEz4ZP2tw2cAUARVMAIAJK+BcUAeNpi2QAoeQ4gGgqjKAB/vxBAgCwCmBGDomhDEYDRMjCEkOLJEBZDYIDnITAAjwDggckADwYBIMAABMKi7sznHFwXjp6WhYm10lKuY2hloKdrqjLT9B0+FOpIZqyltkh7G1gL9l0pBfNwqKM0jKxM9JyEhq47cQ3xJenacW1gpG8Z8r8fQ5fRbVNvvtL5hmMzQdOjWvAZ+m7UCnWovBqHM5l3c7eh9uvCi125QhW2O5oy99Ejp+kgPaXn1EhZekjtcPQPfPVGPwAAAABQAGwArQDfAPgBEAEoAUoBdQGnAc4CEwImAkUChgK0AusDFwM9A1MDfwOrA98EIAQ9BF8EZwSSBJoEqwS2BM4FCgUSBR0FKAVQBZYFtgXBBcwF6AXzBhcGHwYnBi8GQgZKBlIGWgZ9BogGwwbLBvEHDAclB0gHYgeKB7QH3ggVCEUITQiDCLYIvgjJCNEI+Qk1CV4JkQmxCbkKAwpAClAKWwpzCqwKtAq/CsoK8gsyC1ILXQtoC4QLjwuxC9oL8gv6DA0MFQwdDDAMOAxDDJwMpAzGDOMM/A0fDTkNXw2JDbYN7A4eDiYOWA6KDpIOnQ6lDq0O5Q8QD0kPaQ+5D98P7g/9EAYQFRAkEEIQYBBpAAB42mNgZGBg6GBiY0hgqGDgAvMQgJmBBQAitQF8eNqUkMVZhDEQQB/uXHHIDXd354Lrdd3ldxwKoJatgQKogG6QfIPrRl8yPkAl1xRRUFwB5EC4gFZywoXUcidcxAL3wsX0FdQLl9BYsCZcSleBX7iWkYIbNBdAdcGtsPbJMgYmZ9gkiBHHRTHEAIOM0MsT6a04IE4ExRoJbAIobRnWfzvYGCSfOKTtF/FwiWNg46Do0H5dTBym6KefGAmt4RGkjxAGGfpxMcjikOKMfiTSa5zOb2NvvOa9R+SJPNIEsBmljwGd/TTLHLDC0hN99vlm3fvJ/vdY6pP2ERFsHBK6AvUWPY+I0iPpkEMImwQmLg592neaPgxsYvSzzRobPC6cIRVmHgCRt1ftAHjaY2BmAIP/cxiMgBQjAxoAACqUAdIAAA==) + format('woff'); + unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} +@font-face { + font-family: Fira Code; + font-style: normal; + font-weight: 400; + font-display: swap; + src: url(data:font/woff;base64,d09GRgABAAAAABi0AA8AAAAANBwAAQABAAAAAAAAAAAAAAAAAAAAAAAAAABHREVGAAABWAAAADcAAABGBYUFO0dQT1MAAAGQAAAAIAAAACBEdkx1R1NVQgAAAbAAAADBAAAB4vpb18RPUy8yAAACdAAAAFQAAABgjIUE3lNUQVQAAALIAAAAKgAAAC55kWzdY21hcAAAAvQAAAGLAAACIBAyEFBnYXNwAAAEgAAAAAgAAAAIAAAAEGdseWYAAASIAAAPfAAAJNCqXJsiaGVhZAAAFAQAAAA2AAAANhL1JvtoaGVhAAAUPAAAACAAAAAkAzn+kmhtdHgAABRcAAABDwAABDa4CRTXbG9jYQAAFWwAAAIFAAACLqxBo89tYXhwAAAXdAAAABwAAAAgAYQCg25hbWUAABeQAAABCwAAAkgzWFNlcG9zdAAAGJwAAAAWAAAAIP+fADN42h3EAQaAQBQFwHnLlqhYe5cOFkDH7gJ9YUY0J+DSLDa3eLySnl6vOeqRUc9MEQ37L3x1RALJAAABAAAACgAcAB4AAURGTFQACAAEAAAAAP//AAAAAAAAeNqNzQFHA3EYx/HP878123W12gAKUicggBAggREkATWTSmc4g+sF9LIC9GJ6DbEGZo44Hx7w9XsEclem+tc30zvlvKkr5Uv9/K6sZsuF8uNt8bq+TdMo9WC1Eoj5rFoaICHZUah8+lrrI8ldyoSxcI5ASDITF7h179iDR2dCKDb1yVadbNchjATCQJJLDo2FpDDafD6SIfwKpwLZZv0HgZ4kDNVsLX57Muwsb9ntpPjHXsu+UctBJ0mYqPkD7fYe1wAAAHjaY2Bh2ck4gYGVgYHlC8skBgaGSRCaaTWDEVMFkObm4GQFUgwsDgyowDnExYnhgDyD/D/2PX9rGBg4SphfJDAwzL9/HWiWLGsiUIkCAysA/o4Q5XjaY2AEQg4gZmAQAZMyDEzl6RklICYDEwMziGRkYpwApPYwMAAAOVADUwAAeNpVyjMAkGsUBuDnu7atc21n27ZtY8zW2lZrtm1ryq4/2zVl1+ErvIAX8ZEXpQf/pRfewp++9ZK34tV4Nz6Or+OXKBKlolLUiXrRIBpF7xgac2JNbIt9cTGuxe07dwjxWrwXn8W38WsUjbJR9VG6SfSLYTEv1sXOOBBX4sadO1nP7M1sUPZe1otsYPZq1vvwncO3D98ie9PzlTyt7z1bJdHHTlfSW+mTlD8Vxr/+878ccsoltzxmm2OueeZbYKFFSiiplNLKKKuc8ho44KBDDssccdQxTTXTXAsttdJaGwMNMspoY4y12BIbbbLDTsed8K3vfO8HP/rJz34xyWRTTDXNdDPMVEBBhRRWRFHFFHfWOeddcNEll13RQUeddNZFV910N8RQww0zwmAjfe0bX/pKpFdcSy+nj9N7JhhvonFm+ds/8sonf3otvZHessxyK6y01CqVVFZBxfR6ejO9bbc99tpnsy122a+xJhpqpE56J72b3nfaKWecdFUttbXVTvv0YXr1LvqUgCwAAAEAAf//AA942kRSA5TkQBTs7mCN4RqZnH3R2bZt27Zt27Zt27ZtMz33g3sbV95nVSEWVfTPZBtyxxGDAlA6pCBURXAIqR2CA7t50ZdGVTVNVdKIPj7AhIqmyZLX63HzAYxifHrMsIps5J+PzNK/p/HKZKcrqW3prGWSssZGhHhj81VPW71R2lrNeqZLTExn3NzxX5dbcvV/LyasNzbWu5IvViFPhZAQPs4VJ0YWapW3VdcI+t0ITcqYERGUHiF2BNcIpgtGqJDAiFjGIhYYpon+oP0afPA+Prhdn49PPMYN6CKu0e8F+AN5iDD6A3lxkBcCWQ7BI1h3AF6FKSWk89+HTLibvUKzTaBRY7hG4yFjBWQEWRmNYH/RITsEuJm6+s9160jgOjJO78I10neT4r8XIIg/jxDz2O5g1VfhqTKP6Xks/X2LJXqeazTmz7YxY9gyY2CTev5XbBWuB4pAcZDhJgZvRFWcBovOgEgi+ogj0ilLTrZKp8crVzzp1OnJipWPO22fsX79jLmr1s8gGy7SA9s24fzXLuHCOzbTg9exC6eit+k7OB9hAUGPF7BDba4RcOWFHkqaNCKsIWlaDjfPw6foECSWWVh1cv0TBxtNrb571Me5G9fjht9xArOzTb8c+lZ1SI9Fh2tSzDW6ABtmhWqDoFog1IJcYB7LZONGmvUgboc7bSUu/R1xMBX18mQz9J4C+yWwsr2fZRJjR9M0UT7e4/bCKGAmUnvaqWYtT02derpFyzNTR44ZNXLkqJGsPOL7ikU/x438sWzJzzGjTl29ePr05cun/P7/DuB5mAgBtpUFTExs6waYMbGtC2DWxDbvgDkT2xwB5k1sbwk4ABm61gNs6CTCFj4exnZGgbRyilYeNwmQ4ZfmhGXSkJqtJ5ca3pfW/zBgeL+ns+c86Te63yfasO/Q0pPZ5x2/nnxPP+cbNLYwjrj3COdasuQfV/UAezkTRQG8/euxH9a2bdu2bdu2GawdrW0Ga4Vr27Y60+09be5rJ87voefe08zIc4/uyS81FkytpBvvz38dwomTriflosR2KkvnXNCAo0GNtzHd1pCtAT1RLrLKsM9gD8ghVlnLsjLD+7IHxUOroO0ZFA+Jm/CmiodlMngXeH/2iMwMj8KHskfFb3nMdgM+nN2QGrmWHj7Ndh2eTNbVMJfiKeTQmCd9c/8nSddkTA+x6jpUzqY3hTV+Eis2llxV7CsFq70tKE2f0qMZWFN5tClrao92gdKe0ng0CqUtpfWoAaUdpfPoZbzflDfsNCxeUcPWDsUD4jy5nAPvyx4UdakZuVDxkOubFA+LPvBD8P7sETEKDe8mRzNx8GTivkY5TymeQnyBj7E9hJwRN/9S5G+neECMRP6S8L7sQfM78pRVPOR6c8XDIgW8O7w/e0Rkg+vwYexR8wO9iVKDj2A3zM/kVgdyzBXvzjsPcw1WPIXY4Jw/cjadP/w/8do0Zw/kmLeIz9uxF/W6LEmOuYr5vCx7cZ83Zy/h8+7k2ENJn+vk2EMpn2vk2ENpX871dCohZxSeKE6gxy3wGewBcZpOGnkc3pc9KCZi//sUD4kh8HGKh0V5+Dx4f/aIqAvPAx/GHhWp0GNu+Ah2Q6RFjzvI0VeC2+MdzLVM8RTiXOzewEkTjZ00rh5ixUljHcadQrsx3N1cw26GwmewB8QC7KYYfDR70PyCmUopHnK9n+JhkR8+TvGIKEtuNSTHTInurOMx62zFU4hD8FV0ByL/P27OA8hfke4c5P/X9TbInxvelz1kPqXnit/w/uwR8wh8BXw4u2HORydFyZEn4ObsjDwRxVOICrG7GZ3863SSGNNDrHqQ/uOgrU4n/7mdXMVMI2xvkTgjwXbdmWkxZiru3PP8/aD5FTsuo3jI9X6Kcyc+505kZcWjoiDe10qKG6IodtMQPg3u7XCWz7lDraOc7fufeG2Ghj2QYw9dfD7C9hbotqvrM8llcf6fbvx98jLs3X3ej72Hz8ex9/R5ZfZePv9bmVnAJ65lYTwe6qWU6liFMvID2tdS9tGQMFaj4+4+s9N23N1dn7u7e8u67z53d3f3Vwl7kpATBsL4DPT/hXO/e7nn8pERkS9BrmTYdZFPmCDkyCJikJYj823VtA0e+IoKpzNTzckxiVKkfG6KlKftnWb3XbmkJmWQsy40NyOneNL26Q89MfXek+3rlrc5RodGFBaPWcJUB05uI2t6n5G/GezKOp4+c/KqcYcmkOlk9k09Jw689vRz/yqZduu+G+8foeTAW6F3RoCPweCiTI+vvnzMtL4K/euQ4ix6RTWd+fD+DZfuXdPRNKPl+yt2Pb3x0I7lK9b8fe3CN8dNGnHjmE0Htrb+lXx//LSpbcHqlf6JLRe2btxszd88edZW6bzzlw4uHzuxcbIy+oXyVPpTxhvN0nYrb61RB+F4axk8dfr6Ufm1tdTfrzx+e/7o8XXLJve5vdR2TWpuNjXi70z1zRd2r7Qzg9r3BWrHDu4lqX+3PhDMywmOLJo8DWpvg5nlMn0JK9Qu8ZVYY2fmJd+Tr84lf53fMnjGEFfZicbjd9Enjvd8MmpYrnWLrey6E5GInvQhMVvUd+xP8lSmUE3+fRW3OVYt+DvBdHaO8j5Z86LRv4Ja9NEz0zuPTDlWe/trTx1fOXhHaPch32qmWn5f7rq46/KAIKfZ6f+QPJm1752n5F+kkS/+70h4hvJtC8YsBs8FMIISwTWz1mrVvAjZnHLSnxT0OfLaxuufu335vNqlU7z5fZi+e+XIlX/6YsXd91Bv9NasXF4x8/qNK8jUy5QV9kLFLVDRHa1IKZaVskrQ91VnUvZc1Xat1+uz6k9hCk4mzxG88vIl27Lyt86/4iLBeUlZeVrhcEEIFtxQGBSEYUWZFQ6m70L53T9/Kv+4bu2KzST93Z/JkgWr/3r/3NabZ86/dnpPnvzVoqunzry5dc4Df1sViWh7ngtBL6xRTzQ2mzCh/EGDCkgt/zajKdea0dQ+BhWRpn1j0A6k6V8bNIw04zWDOnRKdD1nUD/S7hjKYwV7DLXjtT0GZR9FKmtUPqCcCFiB3oIUR6sgrc8l12wJWgg1Nju5xh+M1wTUYN2TabD6ybXUPvGaiFraN/FaB2rwfsRpYdQyXovXeNQoY+7amabOb622z+aaUf4VgwpILblmNOUrM5rablARaZpoUIdOia4BBvUj7VapegqqztZpfgNmlH/YoAJSy3dmNOVxM5raZFARaVqxQTuQpsfQMNIMzqAOnRJdvQb1I+2OoTxWsBuU8UYpT9KQyRJrwG7vPZ1qM1FDqLKB06mwmgmqgCqsanIVVvd0KqxygiqimlacqHagmm6ihlHN4BJVHlUqdjW0Tz91vuu1PVViRvnLDSogtbxkRlPuNaOpLoOKSNMiBu1Ami4bNIw043ODOnRKdL1nUD/S7hjKYwV7DLXjtT0GZR9FKr8HQTN67VdEGpEP2cOlpY/c6L3fkpjnNhvvsCWkB5qtlKRKtyjKl7gkyeUJBqd9Vi//9FB8pmD/JrldwaDLLemPpFv+cNivvZbYrHFOfvJZJ52YZtqjNshH4R8P/GBZKv/UkHc2fhb/Oqz3r6fYQT8/qH5chAR+YBT9TnhJzHO6VM1rvLNWAbonMtHhGo8keWDFyOUuUXTB8h3xjhrmKK0saC1tbfpdKOjoV1Xc6myXv4z3zLwScHkCAY8roD+S51dWedy1DfMrq4a4vBPH9e4wS27qLt+g7X2JMKF8p0EFpJYfzGjKU2Y0NWRQEWlaP4M6dEp0EQb1I+1WqZosVWcbNb8tZpT/N1AtIap0E84tkcLckApIYW6JFOZmRmFuSEWkMDekHUjT+xo0jDTDYlCHTmEdDOpH2h1Deaxgj6F2vLbHoOyjSNUbXRrFPqo5fV+TyRJ2udrdkiRfrDQKbNzpnzXIP1NXxgfvpO19abJAfi4OodOTOSQPR42Rjyn9Dj+k/F7+uYF87vQOseHllmQG0aHe+/Xn2vu2ZJ4vBL/K0USuUA6rSlHUT4C2stgT4IX4OZz5AJAzkkwnEtG+/6idsRn7JZHynQYVkEK/JFLoFzMK/YJURAr9grQDKfQL0jBS6BekDp1CvxjUj7Q7hvJYwa5R+YDyjU+j6h2HnQbHGpCtTqvaTNQQqqx0OpXvTFQFVGFVk6uwuqdTU0OJqogqrHaC2oEqrHqCGkY1w5Ko8qhSsatBHpYP0AMjDzEcSQMnyVaWoIdyfoKGXmHhXOkkD3vl2Zz/3el3groB1FFRFXqaioyWZ9dw/pN3Tldq5bAO+iaOZziil1JqfdD7b+qJyBrljuVItct4vky7B0PNcUmZ2QsX+20F0rGAu6iq7OXPsz3F7gBBkcWslb6I/UTt2aT9Sh6CpqtUO9AtisrxwVoFt9JSbkF/BAermDdpgXOofh0+lmbl9ukK/OOJL08/G1BdzJf0Ls5OZKku4P5N9FjIpKgJ07fXW9bap9Q3zbSvtTTtZL6ctC1QFJo1K1QU2DYJXpsFK3EDxxN2eK3pyUI9ZXpgsA7tNJhXWTnEVTthnOKjmW2kF7KPqi5LvCX0wt6PqSK2caey4kUcQV/IvczwxG/wTn8DV3vYr+g93E9mrie37BqvuG6onw2uJ+1hvxLaGgvrmpvrChvbBKjWxPnoBVwnVJOVakCi84B39BcZvOi7hcjU3hlvtT1Xn9CiJWsvnVReVTy8/2z5wKqZc2ZOzMmeWuBWXvUM/Rr1HrtbW2faSRU+emIPu7tE3mhX5vABcxX1BBeCUX+Fxn9VJdcAaYmS16DCR3DNU1xIHVfbSfllTm0njXNLBTb/4oXZmRIXCriLPdlfvFJWVQRbCfaSxGyj53ACjJwDr7TxtPPUfUgTc1YdvEvZiwuW1OUWSFyV3NafPHaesSW1OiMS66ALrNMBTnLrliwAJ0Yd8PP5y6f4GY91YC3ouL4IX3lw1bWxfpzymv7k9fF+hqp1xNg66Afr3OUKan6y9Do3BjxFsD4vl51X6FHr5DC76Ju5DiJD/b9zn9FfPG8z37esMyB5KsW88oGLa6I7uLS12dcS3cHLmF1bHQGl//KlYfXkBHU718/XtzNFZjB76Ou4cHREsItj8j7zEe9Y5CzPEz2eoNhkPuKe+mFSgTsQcAcqXokbjyaLmY/oCzGjnDZD0eVqrsesFAyqWSlZMiKgej+ofsnpq2P+OWqac5KkGqhtZ16hb8Psco7J5WwTypkDSSSifybAKfCT+hnxPPTzB9F+hl6grmjefYLdLbfbyYORiH6qwtU/K58weveDJ4Yg4s+U/wPnoep6AAEAAAAFAIOtEGX+Xw889QADB9AAAAAA2wktdwAAAADdVa6+8iv8GAlQCWAAAAAGAAIAAAAAAAB42mNgZGBg3/O3hoGBM+GT9rcNnAFAERTAyAoAksQFynjatc8BR0NRGAbgewiojAhaClBDprIUKhEUUQLSiIBBoiwRQGUEG0kQsAljRMUCAsiivzDpP5RaDxsAFzPXw7nf+36c01eLNknxQ4UGWb5IU4rJszRIk4LWOKNssccAg7IkKYC4Hd6o9tX+LrmiwpNZjVdO2DHLsMA2+wQi2S4H7bvHdu+4d37hgVMKTDIhq3LdeS+tZw5lM8yRw05rgwtuWWzv/n5z43+afvtpaD1ypDPLPDlOWWZJtsG5bja+Gx1TpsgZJeo0yCDvuXKMYg+ddakUo97R6FKmd0IhikKOPEM0zZIckmeKBOuMkGZNL0HB+T00fZ9hOayyEobCYEiGsTAccuEj5OWJfyvlf0EAeNoFwQMAHDEQAMCL8XtJHrVt27Zt27Zt27Zt27Zt253xPK+819ob4s3xtnjPkEFJUAVUAzVALVAH1AMNQCPQQXQGXUeP0Xv0G0scwfFxapwdF8blcS3cFHfAvfEwPBHPwcvxJrwXn8BX8AP8Bv8gjARJHJKCZCEFSBlSgzQhHUgfMoJMIQvIGrKDHCEXyB3ygnyhiPo0Bk1CM9A8tAStQhvQNrQHHULH01l0Gd1E99FT9Bp9RN/RX0ywMIvHUrFsrBArx2qyJqwD68NGsClsAVvDdrAj7AK7w16wLxxxn8fgSXgGnoeX4GP4af5TxBQJRWXRRxwSZ8UN8Vi8Ez8lk07GkkllBplbFpMVZR3ZSvaQw+QUuUhukPvkGXlLvpDfFFa+iq4SqbQqhyqsyqmaqolqr3qpoWqCmq2WqY1qjzquLqtH6qNG2ul4Oq3Oo0vrWrql7qEH63F6pl6i1+td+qi+oG/rZ/qj/hOQgfKB6YFvgMGH6JAI0kIOKAzloCY0gfbQC4bCBJgNy2Aj7IHjcAnuwgv47Bfxp/p/jDRhE9ekMJlNPlPSVDH1TSvT1Qw0E8x8s87sNWfMbfPK/LTKRrfJbDqb15axVWx7O9UusZvtRfvdcWddGpfV5XU1XHPXwfV0U91OdzeIg0mD9YLTgkeDn0M5QgVC5UPVQ/VDzf8Deh+O1wAAAHjaY2BkYGAUY2JjSGCoYOAC8pABMwMLABbLAQt42pSQxVmEMRBAH+5cccgNd3fngut13eV3HAqglq2BAqiAbpB8g+tGXzI+QCXXFFFQXAHkQLiAVnLChdRyJ1zEAvfCxfQV1AuX0FiwJlxKV4FfuJaRghs0F0B1wa2w9skyBiZn2CSIEcdFMcQAg4zQyxPprTggTgTFGglsAihtGdZ/O9gYJJ84pO0X8XCJY2DjoOjQfl1MHKbop58YCa3hEaSPEAYZ+nExyOKQ4ox+JNJrnM5vY2+85r1H5Ik80gSwGaWPAZ39NMscsMLSE332+Wbd+8n+91jqk/YREWwcEroC9RY9j4jSI+mQQwibBCYuDn3ad5o+DGxi9LPNGhs8LpwhFWYeAJG3V+0AeNpjYGYAg/9zGIyAFCMDGgAAKpQB0gAA) + format('woff'); + unicode-range: U+1F00-1FFF; +} +@font-face { + font-family: Fira Code; + font-style: normal; + font-weight: 400; + font-display: swap; + src: url(data:font/woff;base64,d09GRgABAAAAACNoAA8AAAAAMZAAAQABAAAAAAAAAAAAAAAAAAAAAAAAAABHREVGAAABWAAAADMAAABAAiECUEdQT1MAAAGMAAAAIAAAACBEdkx1R1NVQgAAAawAAACuAAABIPeB00hPUy8yAAACXAAAAFYAAABgcXSo31NUQVQAAAK0AAAAKgAAAC55kWzdY21hcAAAAuAAAADFAAABEjB9MLtnYXNwAAADqAAAAAgAAAAIAAAAEGdseWYAAAOwAAAb2AAAJs7kVKgLaGVhZAAAH4gAAAA2AAAANhL1JvtoaGVhAAAfwAAAAB8AAAAkAzn+KGhtdHgAAB/gAAABBwAAAnLQ1V1sbG9jYQAAIOgAAAE+AAABPvRh6ottYXhwAAAiKAAAABwAAAAgAQwCg25hbWUAACJEAAABCwAAAkgzWFNlcG9zdAAAI1AAAAAWAAAAIP+fADN42h3DMQqAMBQFsLwPbuLuLO5eUMSxY2/cUkJEOQCPsjld4vaKb4pfE32KKOxrGIPTBHIAAAEAAAAKABwAHgABREZMVAAIAAQAAAAA//8AAAAAAAB42k3Ng25FURRF0XFRNyiC2rYZ1ogb1rb5+lH9xddTNytzB3tBhELTVuXOzq+uad3P3F1oPb47PNd6sftwpfX19Ook3Ewmo1UK2awI0f7uxYN8xARyFNvw5C0oF7FCvRKR0kAtIoGg1KAho8ZEQY2/nup/nuTbEwX1BATyhc7AhEmRWKOe36VqCSLLgeYAyW/vOCKkYpFKk/xrLJenUq16jdr1GBBcBo3zDtcUF4EAAHjaY2Bh2ck4gYGVgYHlC8skBgaGSRCaaTWDEVMFkObm4GQFUgwsQLkGBiTgHOLixHCAuYD5P/uevzUMDBwlzC8SGBjm378ONEuWNRGoRIGBFQARghFeAAB42mNgBEIOIGZgEAGTMgxM5ekZJSAmAxMDM4hkZGKcAKT2MDAAADlQA1MAAHjaLcm1QRgAEAXQRy7WxW2BtPHg7jYH7u7uDhVuFVQwBmzBBvS4nXzFMwQ+Cgn37LlrfPVWeB0dMRDTMRuLsRsHcRQncRY3NzdEY3TH6F0zH0uxH4dxHKdxft/A5SGXU5eTXG6CBF999xMpPGGeZqTeYZoWy1akazWtTbsOC75Zs+G3eX/89U+iJFWSpWjQqEmFWpVq1KlWL1e/AXnyFRg0pE+GTpm6ZOmWrUeOXsNGjBpTaNySIhOKlZg0pVSZ8luXDDdmAAAAAAEAAf//AA942p1aB1hTSde+M/cmsVAMEIIgIlKisoASIBZ6syFBUCAoVbGBFAUpyiqgIB2RZsUOqCC6frq7+u1i77p9V7dYtuj23iQZ/zOTLPL15/mfNZs7586cOXPOe8qcwAlc5LM2IVl0meM5CTeO8+S4aHupvZPUXoosxA5jnb28vL29PJ0dxoolbOjp7a30sLSUWYglvCd9lLFpkcKI/h/4A9rrqHOMmbldxiz32Xbu1qbDLa19YxQxKQpNWsG40aPH0Y/o8p9vLRMlPt2HBUtra8tOcah6mnr4cLGNuY3DiMDlPstzTclvdKqdiwuHufEcJ1SIUkC6YRwXaM87ICVyQPY8v0h3P/MI6vsE9Z3S7UZXHqEksleU8rQdfY8fwGnOwToVrBvOWVAegZ7Ozg4OUqWHH+Y99U/e5hYm2AFO6zEawynEktGY3zC3PPLrT5UrFqhUW4pvfVJU9p2m+XQSqUPRC7qr583MC5qzJRGVLct5gUgsPJPwlbxFJGglEWW3xStEKfbq8jTN2lmmRqHVHIe4fpDAhknABUrtZfb6jwR1IUIwXqV9wJtYCG+TifVEXi1KqYMVHbBiqH5FClgAhJTaw4dfqPujuxsP6ca1utWiFN2rOOxpO93hNsfxjww76Pl7wf+9+EfkNvLQfoM8yG1RSnX/36qrhdnVMH/Lsy/5hzDfnEoEhwfDKVSWlqAKL7rsoWv6qc1pF6LmxDf5Nuwgy0Qp2mUxR6rnBfiunqx4eS/P1YE93gIZm4EHzw0FKUFEczAIWGR9d/cwPPqq7gsc8AHI+CIu1VXqLKmUvrACxOZgEGjuwLthTy/egR+NAUEO5kpzc8EposOFF+MnPX8ijHjeaX/ET/ffpabEd2a2VGWM1nrxN2xz6poDdO4g0lz+GDdIV2YgBRrNy6i2kBv2ovqyJDZIMlS892v0LTIatlc4I0/feiBSFyFK6Q+w3fHRWnyc6g9zCc++FKJF+ZwpZwOyWWCKZOzlaUZxbSYZAfrB0hFmSg8zITrnUWfHpzk5n3Z0Pso51drT07qzq6cVH3uDvP6348jv3TdR0OkTpO89ZI4cyT3yLfz3ENnTPR6DnPEg5zDOchAKvb1VgDh4dAD4CfyeeY2JV/pSmmJerfxhZ28PSv4N2fIvpxerdCe9yvL3no8jSJRyB7i9D9xigZsxJ6c2V3oIsr/4IMaXOisqu/wnklV8u+PSUVTx4UdJW6JeEqV8+fb9PVcTyDNRCqnT7fLeXLC3BrQYCfySmHdxgcAD8CPBR7pJlGBqJtzs9xRuNjfDLD+YtUqPs2glYvam/xZdQW7I/SwpRKeukC5y8AzqBct/j6W6ct1InKlrxJ9QS7nD6hJYPUS/B6IccG8vce9DK1HOSWyu+xZLeTAPPgGz62G2PcwGdKXZS+y9EMgkQxH4TZl2E/5Al83PammpFQKaKBZfJ3F8kXgYaGMkQ7RYkCj8MMUyMgQmGrD4ot3knXdH7fyhgsxC5yaHhEz2DgoSbLU1vd82OJZaL/tbLX66CX0bMkkZGqqcFAJ8twIubAWlARf6cEeZsfAnHyuWWYDPUE3j+OZracuuNTVdX7rsRtPm6srNmys3C8qK3zr2/lG7+feD+/+orrz2zhvXr7/11jXge43ECbaie5yUs6PyslBq4K2QSqQIgqzU0sDaGeVM3RFf0zFLc7Kye3knOha7yWV88eyyjZ4rRPd052ZFAPv2P+uKyDCZZKXu8fIA3W++06++XXV6AegcjQAtBoIWRbCPhEYSIdBMV9ctSmnrh6A42H9g5mrwGRr/kBImepqpUMdRsclQ9Mv9o+bDiQmYdEbRyeY5wlVwyFd2oyGJ/cGD1ksMsQo+LE7xqcL1fm/qvXSX06DJoaDJ0UyPcokzyyQQqNgxVfLnasUdi0+ER4aVzS46JkMPia3RSyURZaERM8/Nb7+fl/uJoJzsk+E+oaNj05kuV/cMP7+KXw/u7m/41z2YPp8HNhXAR7+pAvZ4Yd/by7I+2JPaNzMqsGpOeacRMUE/mO4umV0XGDnjvKAs//ngwf6aAN+siRO7zmw6st/VI3OaL/fs2V+RUyzmxBwds6zExoiNWbZhY0zHBv3TsQXHDcpiPF0fiOyRHNnjK6ivfx/qSyfHMMtcopTW/kuUG8scbDXPuDOfYOMRbMx0z8YCcOcH4hjPmTNkwZlF/yWa8Y5kCdqO3AfHtNMtPT0tO7p6WnBBg+Y/RrXvyAM0lkrAMg+TQMQkYlmBjSUctckkGBfDedlpWbCA0546RWpJVTd6mR5W6OsPgAmwluUHtnbIP51uKDvdNhjLme4kNAKlQZZD9APBQZBrS3mxLpEXj9Qe279/P162dy+OaW8HLgadAJdh/8TVko1ZXGbj4UziRhiPhl2MmH0of+QFX4gfR7zwOW0u0hGer9H5ols4n1hvacR2eFRTI3GgvFgUZbyMGW8W8djYlJ1ABuMdwFsKccqexm1LM9kILJE5eDlz1OG8zE0wxBS5udSbuT7u1v707PvD35JnP+pwen1YW+ehzrbpdaKU3Ubk9z+fceTXIfv2DUHDEfcbMjLaDakm/GjT7TNDeTvtw6F/v9ncPYtKwaI2k8KEndDGkLmtqMfqMyXsKVXCpuwZS6SY6/hgSW9lT8/h6t5vfkcbjEtubcBiIjT1jOAjtCdHHG1CWt3Tc0QnIy8CxwSOY7hzgDONFUNYNJOD4pTPUScDpkogeZuxY8WtaJxZvo4kfr++vPiz7Ts+La4q/pEkr9s4q1H4IvuXq9+Rn3xLaoKQ6ccP0ZT9+8mVhx+Tn0NqSvyQ8XdXf8l+7nelYmfqd4CHHaSNavzZBeoxjM7r6bqfGT2LWp3RBQN9D6O3UPwyushAv8LoxyhqGH2YgX6f0Yczi1K6qYHuw+g9HGeYP8lA/4Qb8A/xewb+Yq4NDeCCUU311CHULp/B3JuGHGwo+vibuktQ8U0zFHxn4FQzYO0KNms4rKYxl8JTimC6E3wwT0KFsSRM17YN/7BNuNYGgZ6fg3pIFEa9JPIfPUCmjxok8x+iBnBB/yVqYOEIOvBvyyCSiRqBV+D/KIYQ10zmCXPgDGNhN4Ue6go32MwPKyHVMwRZWspZNY7vTI/Ndi9IbzwbH7ZNewopRpFv2m8vCtlZmts6q4nMy3VOjHjB19fFZ//Xh4qfnEpvKr6/te6VYk9XTbY6YxtEXB2c1o3VEaawG6QA0JcHuBjLhvyaseoAcgClz4x3q6SJEUcZmTZaWOIaQ37kuVpY7/Q86qQgOUIKe7mTAinRDvRbE/Ehagfgo9U1owuXcXeQrhmnt7bGBOIkWKM0xD8BYpoRXc0rWdBXITnP3yCrijqwef8p9F0F8XsFjX3xqTAZjYeY+K5t/wyBnzZO+yWsvEY0lAeTwJizhcinlDnYD1Tc/PPi3UsJGuP3fvSR7l2owtGPt4kJtro7KSLLMdAxyMMnsLt9y5bnNTnRuNusllnPnLNpbVsLWGU2yNoBOJAxPdFUifRlmjnYBVQmbDCyNR831ZY86CUxfWjGu4rwBP+x3lbCI17k4afbZijfwtETTapi+HDwClvKkXlFCPOKXbo5zCvYTgz/IXr8S/5D9pL/t1rcVNvFx4b8P5MXSMFqaOYHRiwurof9s2B/28E1CkBxUIniSCVxxDcrTkWlBG5R5/TlZb2Wl9usive/vrWD/Lh7LzIW5YcE5ajc039/+9YfmWGuq3w1B5Dv4yfIZ9+/5DjYMxD2nDSwJ42TwvOahTmGoWRBf/SS6t3kp86t1/3jVS2r817LWnRyXcS+6Kj486L8feTik8fkwgGN7yrXsMw/br39e7q7KicwFHY0nAp0PRN2NOWauQJdWeAdeMP2Zm9m6988K6JvwGfynj0WAqCSsubGM7nAXZS8uSXTiUJhwmwwqAL2wyo3jIhmo0am2r7Uc+h4xbTZycZmNvNfjH/pRlxPQ0ZeZrpTxOyQkTbqpYLSt6EYeerukO8nuJrWGS2MyZlbGY2M0Ij92vqKu7ffvGCvObRpX28I1c4pEiuEie5yHs8rOslonn79o5IcHFR/PYFIUgkVDk9feTozqjJqemPBzBev5yb0zrJRNS5Sl6lfObbSYnnoquDqZbkFnSkvie7Oa89aXhthJHlB05yzsW/p9LBc/ymBpYn7DpWo8hLX5tRseTpZLnpY9upikCgGJIoXvGg1FyhHYjHViLfKGWMqjpmZnD92hKhdjOwqxliZ2donrV7reyS0LHuc4OWsNV90o8IyoP1geA1yRibvTvGNJFpy6u+0KqwAS3jBfcCJ8xiMvYEoCBo3VMcq/Zc5w6XhgoDXrdgROj8kPzR2qfuy2M0n4/wLj2U1v50ds0WTEbPosLKucNvmytapm0X3/KYs9nSaGeTu4+kwufpaW9rphqiqJ9VFZzeNnVw4V7M2UHci8I2Wo5dfO5XfvJTq/xDIFQI4mABSMXn+qVg3SKMcLLFSyZucLM9v2bj61MwF4T9tK7ldULk+M2t1X+7ij+bOD9mnLqxYt+I19ChKE5ceoMyeOi+8cUVBkVReFJOwzt9jyvIJjpHzZsTQ3T8mwRB5L3HOVNdiblBSkAxOGmacirZvVIKx1fvko6aAqqxljRE79oTGrnJJnVf1amIDcvnSOmPNOPKOTHRp1SvkQX9p6ppw5zEBCeqco9MLXkgNd3Ybb+u+sqO8GkmQ3dFhRkIVrQNJHP9E8DLc/Bio9AFBQi9HYO7RWA4o69te1ymPiJq2MmZU51jzXcMsRuCQPkF5oLE/WyaMz9jk6x05QYfwxRXHAyzNAkKtYzQcr79Xgr1NoQazN3j+oEiH7EdjimdEd7N3w/9wu0QHdR+I/As08Wv8yC8LCv0FPIH3yxfdO0l6vnlMDr32Kor95gmKfkV749IfeXl/8Ctzfjh37occOFEx7Goh2HJSGltV9tLB1vRCD8lOC/RHaviEBS6uDvUz6o7w9XXax3OCLKRrzR3a6wGl3bA+RfCEaGnJ0I9oQHDDCsSDa+qVwm+pI37IOTDZd+rUePU4kus71rzTxkrwTCVLyfVgP9OqoeODJqAe9CT5XrwuH3ctPakByVIg3iSI7jO+SjcMuuXl1JskzhjYK9DnIaMiyzNH5XblR42amrF+bvfM4hWupHefYJu4YY603Gx6fm/RN6SW/BoVsBBCydJPteGONNoeBxs+E2wh2jawaOsP0TdMUNLqPOW5z9KMftc+fsUa/8MRpenjUWQXSalFSmT7yWQ/DfmI7DrL73bu/xnWXwJEqsFuU5jNBmNeAg//AFA/rAco7+XJwiO72l7LvBQdFbpnzoaakqyfLH7QlE5Xd5bnN4bs2hUWED9xzNzZ2X31av9Fma6+WaGFV0X3pvikubosXZy2om1W0cz0wvAJzmHJ4RS0doERkxxecJI7RmbsytFsmO8+RB68fE56K6vvDF0LOLUZq++MYbwQ7M4b+iNgKpHUgonvJXWSQb3F5FWi2i78pqu376oEFKlt9pzmZu9sMy0xkj+uVfPHkS5FHWRcZftiIT6ZUSMMHV5ibCqhsesMiRNGsh4Jy2FmUkN0lkogTdMM8byTgdM+vxN/ujq21rvz7q267AnrZ5dWqlYJSvKIPG162ubrQ4bL+EvghKab7t8iv/uHvnOl+uUFoPcbZL5gB3s4Ddb7v48HTM8vZ++bP98/L27+Fo2ycsPihvDW9llxOYr0peuPxJTcF5Qevtku4zQ9JYvyo92dZi5WZ24PLXCImT3eY6Kje/6JisPfFgNamB4ThfHsVuMhyGVOCmcTPBB2FfJ/bAfhilWITyUPIxN2rPKrLt+0OS5407w1y682bLmxfM19YbxEqLXA2DbmwMY3r9946/AlDzz+1qHDf1ZU/n5w308VVJMR0Fv4E+w0jLOGHQ12gegq/0dPlfK/6gomhasn24S1xn+VTB3WzbF+en2XYFsjMh1RbmWWoYse8Fu8nfaH4SQ2wNkK+NJQY2CkZIwpUrGCf2w1qvpuwZ43OzNTvJfHeslHCbYbybPtZ77OOtqNP9R5Zmc6L9xTkIWGtVJZg8HqK8EiozjFgNUlYHKqCzOVUoyZcQxFAmCA2Yd3OrIr962G9ofvTB/XOVnlnrd88sas0KnGh0uCAQQ/kZ9e+abQiJRYomZz8uBlZJNx6BmXXXg0zRgbV11ctjFxxwJiZnHn6vt9VIIMskCYLkziTFjUgGAsB+CAvymc2ANSIan/ypW+i9G6g+RiWuCSBQtVvLSTHEojZw+ijUuESf4777Uv0Ukc8M78hsvVmZOn2ehSN+iW2+Cfs6j1o+GEOaCz0dRj9DpSMt2xcz6/NuOuwrUu1jZHrGySru3ZveP8gs78bdBUTDFJ7czPRCMay4huZ9ODchNSJEM7jHJ6FuMdutziTVKe9cW8wDJrYRc3g2VYK56aBzM9UrwZqhwvldTwyJAuWDoFbG9bWmwqX5e6bauPotnBcfjIYB+fAKu9IwN8fIKsTZydBNvF5MHZJ+SXvNysIsT/eBbZL1r1Wm/yigMLU3fHay3Jt2k74xYeWJF0/PUciBssP4jVUA/GsKp8+1juL6ro8QC15eEAVeIwQN3JqAxnjEOqnkPgAJVyMFBbuAEq5WCg7uQGYhfjYDaIA9MSoy4ZRGVVKqNG6KlmlMpqFkaN0lNTKJVlc0adp6f6Uwx9CPnAUvBikZHdN9BAJhMsdVl4iy7BekKnnQy924hue5/o1C3AFwvaaWfYCdCRzWIqvVUCIEQ0gtrLRIB23N1J/O3GTg714vO1Zc5KD/7S006ZaGV4hZGRqAbzQ2nHmlZ8zNetDH1X2naVIJGzM0sY1Njy1zuGDUPnLlcTX5ydlyAeZiKpdpkk2BKLtL/P5GOvao/IxzSXupZu2xt+VfuLOliu74Hy/cwvudDBJbLhGjHQaMbGy/aFzwnMik6uV29viC/0j4rbu6ztg9VFn8inTMlwVkQfr3n3qkKR7uuxuf/I4Z82UB0a+qugw42Gm4RG+2HwLnjDdmVv8gw3iUb6hlY6JI510A13ulDQlPl/66N3H479N510RDJlqEPw/Pf9dMRVk3n850Ipu63IqYea4H+XHHhWQfvx/LSuxPYlS+pn+2+rSG6Mbm2fkbTcb3VUVEteSHJ3blxeyGih1Dh7Q7BcPi1rSWpuhItdUFpUeltY7vjYEKXK2Wpk0JKdq9YeWmZt6eASTHHUT2LglLaGyoi1MAy3EDTQcMAz0TtyMnPB3M5waBTYRwSRUHRjZpyLYFsdubB/s5VQkt0QpjMxMt0sAyY81wPaxqKHrMtjA5oDfKnM5bwJRhDhRApzGMpNsATvahpiN23ik/W3PH3tyGR33t5DN2b1OW8fOwl7IR8V+mJ1LDqiIktXNKzEI2s+rzqsRqUr6ld6jworrqLVqD+Jh50+hicJQyOSIyV8kMDpw7oCunYjMKfwx24riOXXaM4S8oREIiuUfVruJNtp49BCLj4V8oq1Q3g+XbdM9HEVaSW25LUVj+5EyoqQWw+yQUdQRB04G7eOaARPVi3IOEdOCdoa1L2Qg7WQQoXkEnPmBrzeDRDFiwkvkbAKUxqx0inEwX/itLCje4jRlQp0/HJ5V16CxMhoKCp/YZK2LG+hZDg8V7h4EM3EUekWI8OifhR/3LIdtU3bymdMbdLuHlO60bF4a80KsybdmMhQOX/brmmTw7qm2uXmW/ED6keY2wXaNxPdA82rBt09De5jgg2VOgMvg9rg27pEpWID3AU/3CVti/OyS9o6b0r2wfT952PjW1+NjWpLVa3WzM/zc0xN8FkRslhYcvnVANG9iDW+C9oybIzmnd0Z11mh7kKB968j9+tppTXk7lcfP8uAnwYXtUaPsfdocok+Ue7vB7jfRm/wIOU45u0DGZ12WQdKU2gODvxcT7vN2CJue1JXQpSmyN9/fdLCrKZV6AtiffduSseKQ28v/kKu3p6N8smuVTkVyF175rfCXE1WctWFrcm7E46RK7dJOomn6NSAX8eK3gU72nEuLP9SBRlcTaGQs+pMLtHXYwh8QQ4flVQhxXVNN5evvlUuaqiurVkt1G2urEWN15evvomkgrBPEAQ5X/bF9kNfrkUlkqtnTt7EGzcI18+cgm+h9PGOg0B/jViFaM+HkRkydCuM9wtB74G9pKCJdhZPoTaPHojFTv8rpw62ncJ99NhZ+an8TG2gfyC/dXJ4y9aUdabytQsb62dMzrSzGzrST6Xysdpn5eM9xc/a2H4Mv7HYaLioBA9Zmkp+OvyVIc8KP3Uho9Rlxw/F6/PsO/Jv9Gl2QceJZVR3a0FW6gMizoLWlqH/A/GoHUB+4nLFYQA5AzaAvDQvYcgwo6EYQG5qQHXNmKbnqFYHW/LX/xXVZ8hcVquPoB3oQDdM62UVDZTwDzEvHNRDGWE2CO08MhmfmLCqbVana1FObYmlrkfkXDlvY9WGdVtzOu/e2XIh1XP5jiXJO8ncUWPkpmbh9bmiqDgXc4sIPzy7LX7xe6ePnX1wh1iL8FA0FBmvu9+y5PU2zbzBv9pBxkobKHL/ta1giQ+qK6dGhZ5P2PVxbt7Hu9OOz4oKrgjb3Du3tshzXOa0EP3vgL6+2e7uN9+sOR5NM5bhd2G4CUm5QRkMxnI2NvwOC2Nzdj8cB+NEQJEFYMhcaQ7/HHjQEu/AU3Dz49Y/uHjvs/kHJwgiAX1x4D0sFs0icaJL2qe8uP9TPNwrvXSe9kd+aHBR7jRtssFLNHA2AThCrzsWfNEB/dcrkgbXEMt9ePYX9KIUVwMXpZu12eM3zCqDi1JZucjnv1+V4EyoilTw4569JIi5bfRMqANyswTNpHVKGlPq8+yLOtzUHspIN7dIpYfabfsktbu7etKkue7uczmMWkkb/pMnnDG7jXjAIvZ3GtQy5oN+VPfGMWEJUvm+tuSghJCwhISwkIQJs9DspECnWRNJDap1iw1OxC8lBgelpAS5zXChEnagp7yEjxdLuGqOw2ZAOQyUYXw8yFyL6YxO0gZjAuMaMBzS3+MNtbjh5qrQq9CSdWaUhtJYJeWvOFq0j7ARue9UR2qcJcM7Oy3D1UmVroKtzmPpEV+59XLnOQtdVV6aMeQ2tIN0J5a3zU3x5/8JHVZ0jA7yGn4469U26cfkN344RwRTrknoFWL7qHYNczgeJIMeKTp4+OznvAYP0f1BV9wXjuO3Re1wjlbcDDq1EUn5raLHkNPlMJ/pT8l0aT/oGVVO9POb6Orvj7Lc/Pzc3P39RVIfN3dfX3c3n7++YeePRbb4TfEw9jc/g+yBY1QhISrv4GDxsIE/ZABJrMUc3yh+T5BwLXDS72G9ASecCZOE/XRguGTitKW5LfMdJ9kE2yWSipyFSQvnmY2Is3Kj5/1Q6MTvi9XsvHJegZ1OlBWK1WNIoYy+vcPfxQ9FpQNvR16tLxOV2pMCeMuj0cLnfIPEgdXMNvoZkkGS2w8+RfTJgjU1oANX94AAdGGivz9ViMTBkfRaCP5urgEBrm7+f33T8xl2Blvt4Lj/A+xlbMkAAQAAAAUAg3o9v/hfDzz1AAMH0AAAAADbCS13AAAAAN1Vrr7yK/wYCVAJYAAAAAYAAgAAAAAAAHjaY2BkYGDf87eGgYEz4ZP2tw2cAUARVDAbAJNYBl8AeNpNzwFHQ1EYBuBdBiQKQSkgCkwSoJIgIiMiDAEQgUAlQJTMdlWGAO0mWgsahknCxMZgmAliP2JSD+64eLyO8533c9LVVJZF3hkS0aJAh1UicgzokmWNDHkahDTT1WBCRrFarDDaEd8vMiSf6G7RYSmxs0SOiAFFsmSYYo0Zcuj8++CIW14YoxJ3Z/hhK7Hzhl+uWabJtjezaUmOLuesssF5nMe8sccFZfoUCTnjmQNeWeeTkHHqfBGyQ4tNDtllhbOEVkLICseUKdJjnga1hJArhlRY55R7SuwzyQl1aomOJguYCS6JuCPiicf4b2aDh5FUKviWM/SZdr6UvaAdzAXtf9Y0xqwAAAAAUABsAK0AxgDeAPYBGAExAVwBfgGwAdcB/wISAjECSAJeAooCtgLrAvwDHAMvA2EDkwObA6MDqwOzA8oD0gPaA+IEGwQjBCsEQQRJBFEEbAR0BHwEhASiBKoEsgTtBPUFHgVXBWMFbwV7BYcFkwWfBasFtgXBBdQF9QX9BjYGbAaMBqsGzQcBByoHNgdBB3kHgQezB7sH7Af5CAYISgiTCL4JCglJCYgJtgnxChEKPgpqCnIKkgrlCu0LHAtOC4kLwQvuDBcMWAyIDLsNAQ0MDRcNIg0tDTgNQw1ODVkNZA1vDXoNlw23DeMOEQ4eDisOXg6eDsgO/Q8zD4cP2hAXEF8QtRDyETwRahFyEXoRghGqEeQR7BIIEjUSPhJGEk4SgRKJEpESmxKqErIS2BLvEvgTExMiEzETXxNnAAB42mNgZGBgmMfExpDAUMHABeYhADMDCwAlBwGSeNqUkMVZhDEQQB/uXHHIDXd354Lrdd3ldxwKoJatgQKogG6QfIPrRl8yPkAl1xRRUFwB5EC4gFZywoXUcidcxAL3wsX0FdQLl9BYsCZcSleBX7iWkYIbNBdAdcGtsPbJMgYmZ9gkiBHHRTHEAIOM0MsT6a04IE4ExRoJbAIobRnWfzvYGCSfOKTtF/FwiWNg46Do0H5dTBym6KefGAmt4RGkjxAGGfpxMcjikOKMfiTSa5zOb2NvvOa9R+SJPNIEsBmljwGd/TTLHLDC0hN99vlm3fvJ/vdY6pP2ERFsHBK6AvUWPY+I0iPpkEMImwQmLg592neaPgxsYvSzzRobPC6cIRVmHgCRt1ftAHjaY2BmAIP/cxiMgBQjAxoAACqUAdIAAA==) + format('woff'); + unicode-range: U+0370-03FF; +} +@font-face { + font-family: Fira Code; + font-style: normal; + font-weight: 400; + font-display: swap; + src: url(data:font/woff;base64,d09GRgABAAAAACF0AA8AAAAANPgAAQABAAAAAAAAAAAAAAAAAAAAAAAAAABHREVGAAABWAAAALcAAAEeENMPgUdQT1MAAAIQAAAAIAAAACBEdkx1R1NVQgAAAjAAAACqAAAA7qtPmPVPUy8yAAAC3AAAAFoAAABgbptl81NUQVQAAAM4AAAAKgAAAC55kWzdY21hcAAAA2QAAAE6AAABwMYS7sJnYXNwAAAEoAAAAAgAAAAIAAAAEGdseWYAAASoAAAYlQAAJ2AKUboxaGVhZAAAHUAAAAA2AAAANhL1JvtoaGVhAAAdeAAAAB8AAAAkAzn+V2htdHgAAB2YAAAA4QAAA2DBYoWjbG9jYQAAHnwAAAG3AAABzmtRYgJtYXhwAAAgNAAAABwAAAAgAVQCg25hbWUAACBQAAABCwAAAkgzWFNlcG9zdAAAIVwAAAAWAAAAIP+fADN42mJgZGBi4GMAA0Y+IFsLiFmAomyAhuVBtwIAisFwz4LZthHMtm0rmG3btm3bjvZot/nTLywTqECdakGb6sKQGsOMWjKBDRyoExO4MOHbjXrAm/rCnwYyQTBCaTiiaRwSaTIyaBZyaT4KaTFKaTkqaTUT1KKBNqGZtqKTdqOPDmCQDjPBKCbpNGboHJboCtbpFnboHhMc4Iie4IJe4Zbe44W+4ZN+44f+4Z8KlABoAJwACngyH1YAAAEAAAAKABwAHgABREZMVAAIAAQAAAAA//8AAAAAAAB42k3KgUZDUQCA4e9sV64QyBBywRDYGyQlpTtLAuLUTGo6FhPcPUV6giTUK0S1N9s4Lgb/j/8XsC15s3VyWl/rT5p5Eh/m909iGr/MDBbT2aO4aJpGVMBqBbrDUV3pXdYXlf2r0bDSzy3QOrTuyH96niS7mXuZFQK0TxB0lUoHAoJSx47CsXOfvgWFI2c+fG0cPaXo1p2xX3/+LXMpDRy6MfXq3c8aobUpZQAAeNpjYGHZyTiBgZWBgeULyyQGBoZJEJppNYMRUwWQ5ubgZAVSDCwLGBh4gPJcDFDgHOLixHCAkUFRmH3P3xoGBo4S5hcJDAzz718HmiXLmghUosDACgD45RBUAAB42mNgBEIOIGZgEAGTMgxM5ekZJSAmAxMDM4hkZGKcAKT2MDAAADlQA1MAAHjaNcrDopVhAADA+f5sW0fZtm27Ntm2bdu2beM1wivUMlzfWQ8i5EFZeQSUlTfcQUxMXkKTMDSsC4dCWlQlal19a/Vz1X/HYrH7sVext/EyaWkEoVkYkTH+RhUzxoaM8StrvMwdkNYE/g/k5zV+XP9Rmh8Fvj8WxGzwjlAylCdUJiQgxAB5TBGZLK+pCpqpsNmKmKOQWYqbp4T5ylqilIXKWKycpUpbpKIVKliuslUqWamatapaI2WzhI1i1kvaJK6GDWrZqo7tdqhnlwb2qG+3hvZqZJ8mDmjmsKYOOai5I1o7oaVjWjmuvTM6OqeDszq7oJvLurqki4v6uKG363q5ZogHBrqrv9sGu2+AOwa5Z7jHRntujPFemeiNCV7Lb7q2Tunuir5uGumpYR4Z4YmxXvjqczrSAlY6AAAAAQAB//8AD3jajZkHXBTXt8fvnbITMQILLGtA1HWFVZG6LEtbsKHSmxSpwR5BkWoPNppUxfq3K0Y0kX/sPfGlYu81XdPtaSqwwztzZxkgL+V9lPadO+f8zr3nnlsWMSi6fR3zOvsJohGHBiEvhOJUcpWjXCXHNjL1ACedzttb5+WkHiDjyJ9e3t5aT1tbhY2Mo72EXxWkWTRj2fqUbmg7ixv7W1n3yw51C+vnZmfR09bOkKBJyNSMnzxnUN++g4Qv9pOXV6ex6S3bKcbWzs62URYc5R/Vs6fM3tpebTn8jYA3Ciz4P4Sm/ZydEYUGI8SUsZmgzgyh4SpajbVYjVU0PdH41cy38ekv8enDxs3403s4g9/GZrZswU+or9vbxfdkv8ucEEYIydBXPJLoEYnew4TyOsGHiXLoBraCn1T7j9D6ffBtgaxMvlWcylqlIF+ggarn35i4D6+inir4wVNwAb9rKk7kHfgIHFYvyqnmXar516rxM+qH9nbRHmcDflji5zO0CH5iVNz+E5PDzkYO4MXTVsk5Cf0tU9jY2mo9vfVKGfTwQErnZTWQOl92ODZz+Iqo3NOFOe8VFqzWJwedrd/FP9u8DfdiZ48akat3y3p+7cKLmaNd8gzjG7Dhhx9xwHaIUfRBfHMm3xWok8sl/iVa2oU7SPyLrlzWIvE7aJnQV2gXxBYDffUqsoMovFwptVqu9Qyk9DbmtBpSCpLGil4XvqB+zPaG0Pp5IcdC3ty2L57/CDvN/e7YDOrIwdvZA1uPus298/Y7v25OVLOZ3iv43xBNRmwS2KWRJeoLlhUqHfvX1qkdxlJ6ieghbOWfPdBsaWnkXzuBqIh60guvkrz48iugHb5lMtSLjFMr/G0PWnqCDjmkgPjF4d2Y5ykqr+1r2tyGuca71/LKSjazBiyQN0gWWopZOAh1UE4u0S+HSFTWItE7zp30iETviZTXCUoIJRmLSojCFBgdHWSSGqHgAU5CzpD5KqaUOdWRUnKVRiWXyaj8Hc+WZey4lFO2P+aNoMqEsKqc4XE75oxdbOCfKfDltKvKzTjg8X5stj8pInSGv4/f0ttbP20pHNAfN9QZZ3mOBiWiRxKhrRihn0Q5B4l+EUCo8SNBnUSbDZ0WWiR6xwCRkBHpIfZ1JlQjGG65Cr7oVOOLvXupV/ZS1cZ8NtN4nBrdskXIPwbav0PaWwijo5beYSFjmJ5Nxj+amigzHNWaJBQJ09snqVH3SkpM49+D6LUX9ZLevIgQfc803uJo6+C7jr7HX8SebQ+xJ3+RzaxsPVRZyYRVQnsl/5QZDO0hjuBASicIhle0cjW8ZiOTMRwuOXcnhlduNX7f3MxY+da2o+Yam/KvV9ORre/V1jIj6tqUhbf3z7YCRcQ36de+Uv3qoC0SvYM76RGJ3hMprxPUS/RGdWfb5xL9BguRrmj/if4GlFsLfWdjTkFJ1+hJruiEgL9xyTpcPvnD2IjkVYa6Dfw0NrNtWsLbleOGGfJ9NEe30UjIdbDBUKQPHcU+nCiMy1Xo2dVk/vaAkYQhscZajNW4eO9eM6pvs/F7athtGIk3qSXGCqOtoPAqZMlqoltD7NxyAYXYAux4gB0WrAjjymGLJqrAhs1s9dtA6pLwnNS3wWJ9a1cg4Kb38kxchm76tgsUfIA1id4KktpKlENn8Xjj6xBDDHDXjhjiNFiJiYL1Y6l3w4zvN1GFNvhKLn57VttSUU5n9lqBWtyXVgi5iF0pnZDBtrw95nrItj3Aj/CrZtuYE8qs+oZoYyS8O8xhw+fzqX2Q0VJOChG5EY2f0Z1ULtEvjYRCPOBPorfEmswnEhUWaACMa+eQ6rSwatN/0kX9EJkzcIR6hNZ/+N4t47pr5BPd7PMVdiERJfPXrcG7/1oyhdIgA+LY2eDPHvzZUDK1qQZBCbLiLCGrKLmlldbTionLvde4635u7v1djfdyD69talq7cXfTWuq/l/n3D+3DgTeu4BFH9vOnb2JrPJC/yz+Cf99gFUQq+iDzwss0LyTKFUn085TOtkckCvMC0UAHAh1NVA4GnaBN0UWro5LjMMdp9Hqs50AwKZlWci8nJypp1zf5gnD4fh9PWxvlwZ8yH70mygMH2hbvXTuqblbTmhE17GxBeNdALmn45Natad9rWjOZ8JkLIJ7HF57PwP2x9cUXs0SdoIiMtI840qwweudgpOfD6JkjpdCbMhmH1VgtVDZPhvNyIiugN6Mdvy4Dr7vMlx9vwhPaMXd83dbm5lUN9FdT/zNJadxERRn3sZkfvl+Sz6O54Eu0Snz5dfiSqFyiXyJCIatAgURvGYVakQi96gGj7CKqkkoF2Sg6aVwpsknsvo9R9qUYj6Kvt639PXHq2OMLx61M9lpWVP7pjLwzS2uvJUwJ3ZMUtjBs2LqlWUdm4YVFR6amjisYGaXPTRyZHqIeNHnVjKlbU2LCc0f4u4wP9k8Yo+mXRmYIUUJiCRRjseykcol+2ZNQXi2oluj9l51tHST6hdgW4u7a9tZLIe769t9gl7gUOYm7NAWGbXC3+CF8jQ6ToIWJ5eVNBdc8y+bX3/luxgeLwuYM0alifBasvHETTw3Znr6kdtc9dmmUfyY/77UP9hcfyLBTFPWSl5asWP5qAa5VDa1Y1TaUvvHpZ4LnaBidDLIHFlc2nYqj3t7LxzIWVsz5Vi/m/OrViJJa0cJ6FadTKbCp7UvqOP9CbE6dLCujLMVXIFLxHdJXwWJf8YTyasGSRO9bEmr8qBu9xZtWDqaftHKQ7nASyomNuHgw/XIvVNacy36nvrSsHpaNtMrrRbOvL6d3tCVu2rhxE70bLIs2yJwONc1piXJFEoU5LbU9ItF7mFBeJ6iQ6I3znRbSJfo17rTwXKTSCgiVndlF9q9oOK2m4b/W2hr+M7uufrt5y08fNNXvvLFpp7B3YCxan0HhS2eoVp4he2vyLsnDGGlOdVAHiX6BJCq7KdHbuLOtvUTvEk1uQBeDplfEcRcWTi317ru822k8A+cepKyNjyg5DXWY2g82SGviL0H0x6EOSvyJ9PYrEuXsJXoXXGBUC1QF/kDNZDjp6LBKyKJI6oqirYS6bZxFh65ZU80MWwWrvdiWxJwsxjwESVQu0S8dJSprkegdp84ThqN0kvgONaPOFc5RWsu+GyHNVEIDRRotWSY0WaTThcpZAW3ljBb1Q0MgEhtSiTQy0/lVqzWdZzWkSimwsB+Gv6FM0SeGDB08aorSd8/UzYf5pxtKiryqYodm7on4+GM+IrLGdV1T7eTvg/zMi3oEjw4J21+/oykpL+M1h+KBfY9sMi6PGo0t5kyeMBl0iQpkCtA1gei6/FSibLNEr4mU7yuoFSnZy3/c/hOi23+D1qcgCheovsOFmgPLFKfqcib825iU3t6YRETaOjlheKJycqInH2xgjN+bT5/uP94zMmBZwvR6fdDSSZVv3b2WnJGoSx7uOrJyWP48h34l/ItxdTNjRo6c6NHTHE8en9ILz6OjGC3/8Klec6BxsFO+m1/6hDcS99c3/DchJxN6oN/AjOiYdOPdwsxJ0zJSdQX4ztqTb+2F6MQoZH4Q3RQS83m5kGlHgPaA2PrA+EjhOHVbOMi6Qe2MqvCLDf4gbdMXBYVfbJ68LzR2ZNno8ndjqud5DZrpP6rs952bW+sMhllubuevVO2LA4+ibdlg8DhN9Jj0RKJ2Er30l/RiJ2VbJHo26QmiUDnskX9g7yIr1B9GQylXa/6kmkgWz1fQ2UGN9Zb+6xMr9idMOLYkZbnu8bIav9zY5OIhzvPYu4oW/8pxkcuf79j8sjbI0PPilfKjqVOGUebDxggRRIH/c+xdxgnN+ETIiJsUiyYiGlUDrwAFLOpNViE4Xah0jv+q5OEm/gS/Gyc2rrL0W5+4fJ8gKLlS92Rpjd+suPHFzs7zWY/S0t3/oAmi3wS+FTBidkgFnvtSnVnY7VLIlGo4gh23PCZmaXBU6KmJ62/n5l2sKjk9laL45MJNPSlHugZfm7chxN0tx28EONz6ombhD1vt3azwzbeadr8NPUC8kfkzS5w/CiRRZ4le6kLNJHq2k7LNEr2mEPZ+m3gdiUKB3JEeck9hTplmCdcxl7zxvwVH95063ckjsL/e0aqvryZvSfJ+/sC/hNuvn0vkGLWLluNKZa/kxY0tisPNf98BQn8v5ZOYeKYaGVAI9LcgpnO7ISNTW1TFEJFaG2kHphbD0JukB1JsRyWAh4zKa+S68Smp6fsW6saoevcLiHlv+u5M/uXTxg/i1rm/WVRQP6Z8ysnyxf6+KQnT31tQ8tZsPr147oJFswoLmerNCrMhJcnTtqeamVn69HXyDF8Uu+Gt4OosQ7RGE+EbFj4nUvu6o3vN5Kyd6Vgx6FjF9KzlSwpmz4fREKMh41kkjuevndRZohe70PEmaoGame2Mw+nOJ2ZS+7O/CrXkDAzsT+wNZCOskmSwyO6L7D05YdnMDTyU9p+axqT0gOyEPo3sDePRuLiGlUaaepmR6B09xIjZD4Ue15jssOQGS5haWv1f2aM+5Jv4w9sbu1uFGdTwF4ZBNdHHLQHV8037gEmg+hlCDMc4oB7gS7pZoL7Eg9t+xsH8x4xD27SSEtq6BOIW25Lee1PsPVrI5Uw+iW6VmSFbON25mnZfnCaQ7nrvgMULWpIRqi6/0z8t/7Hac2xVQTA/933jtyf2YZkuOFinHzmSGuM9apQ3/AIKolecX+661H5Uyvw42rftJ9CjXIwfjfLQBgdrPUZ1/JQUss2Swms0obwOdJuZqBM6S5O92YnOmDjpjau0MJbvQ0zzoFd6ifEwEA9FbiDmbeav3+iz8WkZHwrCqt59VDdwid20Q9VUC+kheI9xIpm0jKyhF1EZOQFfBy95QsUk/YyxugcFI8j4806U/AtjC77K2zcyDryT8RQVhL/Ep1qc2I8Fe9eNHwnvgb1S8aaqp2DtDFibCuokaxirBHPu/ABK8SWYuyaaUxtPUzr8Y+t9aIvRHFg3noBZOYmpy/ItBEZNzIxwT3B2cS6OrmriT7EftwZFDreRz1eoNlQwWhIbeZ+7B1oqSGzn24/jxg7O3pT4TYh6osCNHwn+CCfa55qsMJ9LFO42qJ7GqYiS1LHklAmHX1aD/49KfAKnjmnlr4zBRd3kUi23Z/zn+Ax6THfV0qwklRbly7XKLvPINJHO1PYa9j8pG6obe4dHB86I78M4rIxJJLNncXaJwTtmsBGjjtlD9g+14mpOxhUDbWW/QuZoIEJxJLE5Ti3WPOu/dFfsGmSjip0UYGM3srzu1eGnUzbUNPaOiDbMjO/DfmVw7R0YvPeRlau9W0CL6h+VOEtKLiFCobchTok2UyR6PoVE7yDsP8E9SWNJi1pSSP80qmJaUHDKUGVELKkj0CnvQ1nxXf1uluu8/mOK86k40ECKiUkWRF8PY+kA1sV7FnFxkhYrZZdyTyWvPjN52plVq85OnXZuVXllRXl5RTmjLftj17YX1eXPd+54UVlx5vrls2evXj0DsRC7pM6sFusMQhItk+iFKImyzRK9hoSaVM+3Au0j3a38SZujkubgn8Zab62XNimCUFBa15wFSmvPZk87h0dUj3dps4+sSvUwWqaXVRrmjS8vN8zpLvynwfzvIW2XZ/ItQ3DvdNp9XNGZa6sORZ+5uuZgNOgjSkjerO/MG0El48h4IaWw88wXr2aVXTedHJROa51eS19raMAD+xmaaocGD/RQeavnNnndrJGv6L2Ytl/8cklNL7M1PXq808SPWEwd+66Y3wgeiW3icYPo0YAk6izRSyI1fiToMFEONbfnw08s9Cr9AEbWmeyL//I+xXSd0uXqgXKbW63OnjVj2/jJB2cXnxoRGlA3ZcE07bysqesTFp3LrT0z6vXAbQUp4e6jffrYj8lLGb84eKRH3mBdhMHV4OFgH75gwqzKoDj/HG0QKCMKSBRbxCgskESdJXpJpLxaUCvR6y//qu1Fsa3xo25tm8mdyhbIol5sf6SEeE3VRq3T6vRyOH6aqhDTy/s/oXuO/vJLI8624RvTsv0nOesGDtpfRRUseWLDG5cYa5JS+9jC6ErWWOTQsYLjv7FK1/Nv8Qs+pxb8X+PU6cWLjYV/4QGiED38AlHsNNXc3ahY4Lxa8Czx60I1EDiMc1feDJzUB+EsAauDdeeaIIdk1JjU4tyElMQNzo215oGH09avZRyMttNSJ46iudb7NdHxO+opHmwTG2S27pFmq0gfysokSmar2JZtlug1sS2vE1QQKp48P0JIspwjtb7ShXISvUoiUUN+V0MkcG+S2eXaREvfeFy+6sfT75Q2frqltIFm22A6toXRbm1X6ENgTXyP5Nm+jvkpUWeJXuyk7A8SPdOlraNEzxE98/nxjA70WAgrtDklVF69Wrg5YXR8jWPuoUq7GW+G9PHh6w5iVzyEcWj9PGt/oXmpVWhBDAicSG8Cy8QGUXFYUtFBHSUq+ruAEP0d+Ot+Z7KBCrVt46mxxu+pb2tri+lXVy4BC6QtifmYGLMCSdRZope6UDOJniVUPJn+YTqZcuhbOOc8kdYmTlqFvg2WZiKhW0Q6TrJM6DGRJgNAbXwuvY/cHvYXejZO6DK56RP+7pec4v0mraLbsO1yrDA2VC4sK9PnJvlP6E/bJnjHBI0dEa3T4+xDVCJt1vZHmx01rmHPge0pG9NcPXO1vnOLluUsWGQ8wwRSfgijW7BS3mLvklNlZ41TqDi13EYcPnHyQg2k7oVmB/l4pg1ODMG04vHAkMLYgOBk58bG0Dr2rp3DfKU8InLdsrbDRVuzIwfOUY0tzqezlq1KLIkQ4is23Y72QnKkED9Dgmhgk2NOqbEGK1n4wqqm4gkrcoYuHVR2ZS0/xY1a42nM9qLWecJ1n949d6Iud1s8zpqOvbPtc7A2GzHE6mTTp47WqK9gF27nSY+p5Y5CJsCXpuNuXK3Gttj/OXaoeLqhhj9JNRhTcYLV5tdXx4+rT2tgMy/d2f5REs8+LizEvZYtW+ZdNj/rTT1iyI3YYPBig3qDjwHC7S6YFC3qteJiwNEmbyo1jdX41FerNo9cWfS57dmWpMKAZw+f0tltq+hs3sPSAq+/wpdTbtUL1qbP8VuS1DN2SfyZD+1wHXh1zysw5hu3UmFCZu+F7PkURsaJfJas60gGc8qC0uhhWLxIHkhbRepQ1Z7d6xZU+s09uXhC6Yi76w9EvBE7YkK4W4Kzq3OxckMF3f/K5ytmZex/+52UEW8kNM3/+NSsZWs3td027RzB4yGyqwuRPl8X76/l1G4cyzdt55twLBvCN9e0LaSX1mAf0IjvGz+izsHaaQ4au+8CqQyXIHPLSVP8rHsHVRtc7TzUN3+2dLN3NSAK27Nyup79AfwIe16IrSPPVV1+xxXugYHuLkFBOMc1MNDVLSiIlQe4uhkMbq4BHT9BwResA3VFZkY0dzlgUQn6UaP03iNHysykcxK0zmU+pwNkjogW9tp6lmb57GQBHq99CE9ns4iOkPmRp5CQVHskn+4l86vbk4xAtTXzG71JVgZPOXhuraT18IWtN6z+4O67K2+zQ3HKaP6oFqdE8MfBlhXzM71F5oxk0FbjqGU5DZ4QjS1yca/wl8zPcY8fxx3q3go8qh31SjounP81l38W/ULmPO7Ro3GHoZUL85BeLFMgC9JbpkpApg4Vl/zm6FcKFImjQ1IVBa+ELGIexi802IWlpYXZGRbGg+p5zE3aW5bz/9irJg2f5Os7afiwyb6+k4d5+Pt7aH19ZTn6ND+fNG/vNB+/NH2qQedlMHjpDKDJgnWkt8k4pBA1dV5+Svl4QRcxwnGAe+8s9fQQn7Bhjn097KdrsllHdw83V+8xme7uzi7ecTHCqISyY+lJbDPpd0g4ehKUbTt27CLhWQGvpn2hJtrCMyh9eq3izx/7ULvTYqzyJyaMyhkeMFPj3SdUpRvJ/+Dd//7KVyYGjEh0tlNmWsgdBVv1vI5WI4OgebLyL26e6B52U7OcPDtvliJ3GgzdLo5Gz34d7LTRRuoTNl/ME1pDuazPymDzrfiN5lDfO+YEIxPv07GdDNErZTcZDgl7/CdAPpe9Sl2WtQA5KxCwmMP+QAdy9sQiyzniCzhXy0/i7O8mN8DTLHg6krOR8vJ5OB/vwtnUbUoW7Fux9+mNXBFYuyBaA/KM3sI5IBmxpuE0jtRK3CvU2BqGLTiHW/Fbt8bfQqTdd9BO3jX74kNJ9oW1cvL4W7fit0ErN/YRvVT2+19lX0L44lgh+8aMTofsi1/KPgrIGvuaf2io/2tjswJA21z2Y1rHpYO2K6bYLWQ29FbZcyBXTSREpqcnyo4AuWYipjGXwY4WCTr3MotpSsaJ8WMNVbyU5+NkXCJ/RSs8Zf9LQ59JTxcv41vjOMcE/muv/wW3XUYGAAAAAAEAAAAFAIO0QZ2aXw889QADB9AAAAAA2wktdwAAAADdVa6+8iv8GAlQCWAAAAAGAAIAAAAAAAB42mNgZGBg3/O3hoGBM+GT9rcNnAFAEVRwCgCThwaOAHjafNIBBwJBEIbh/TgIRCEKEBLS/wgqEBICEBJRCiEoJDkACXAgggQIwEmhIigQBBABRQ03S63ZrMdrWKw1zkIVSPrX+xZQPYHH93SfFmWBRxzujsS4pgnbBxCm9oJqqkg8QcViYyhZuKQgmPwREmQNY4P+yxLPw1/vR0CtBAOSJyMytegLfJLi3lmVq63ZkfmkbeEzcDXX4mBwLWYC/4+koPtla1jpd/L8Iidjx+dkqRSuzgIJXNBAC1FE6GTQQRg5NOHihSviOKOO2mdAGRDUZ6wEynoCZdcyrgUAqEsMUwAAAHjaBcEDtCAhAADAsNUid7Zt27Zt27ZtPp5t27Zt2/b9GQBANdAJ9AUjwBSwDRwCXyCAHMaDqWA1OBJOgXPgergLHoUX4G34HCVDGVEeVBxVQq3QSDQFLUNn0HX0CL1FPzDGqXE2XB7Xwq1wNzwQj8Ez8Gp8Ft/Aj/E7L41Xz2vpdfH6e4e8s94Pgokk8UkT0p70IkPJBDKbXCJPyX8a0tg0GS1BK9N6tCXtQvvTUXQRXUt30MP0HH1KP9DfjLJELC3LwQqz8qwWa8o6sNVsGzvIzvrZ/IJ+e7+XP9Sf4M/2T/nXglhBxaBO0DzoFPQNzoQ5wyJh+bBO2DwcHW4M94SXwrtRyihLVCgqG7WMukYToznRxuhidDd6GX3hgGfi1XhDPpsv4Kv5LUGFEYlEWtFJ9BVLxQaxWxyXvnQyiUwvc8miso2cKxfL9XK3vCtfyM/ynwpVbJVMFVJlVQ3VWLVTE9RstUBtUwfVGXVdPVbv1E/t6WK6l56vLxlhypimZoBZYLabY+aqeWP+W2uz2UZ2hJ1mt9lb9qX9aH857KxL7jK4Iq666+r6ueFugpvhFroNMdkFeqsAeNpjYGRgYHjGxMaQwFDBwAXmIQAzAwsALJ8B2njalJDFWYQxEEAf7lxxyA13d+eC63Xd5XccCqCWrYECqIBukHyD60ZfMj5AJdcUUVBcAeRAuIBWcsKF1HInXMQC98LF9BXUC5fQWLAmXEpXgV+4lpGCGzQXQHXBrbD2yTIGJmfYJIgRx0UxxACDjNDLE+mtOCBOBMUaCWwCKG0Z1n872Bgknzik7RfxcIljYOOg6NB+XUwcpuinnxgJreERpI8QBhn6cTHI4pDijH4k0muczm9jb7zmvUfkiTzSBLAZpY8Bnf00yxywwtITffb5Zt37yf73WOqT9hERbBwSugL1Fj2PiNIj6ZBDCJsEJi4Ofdp3mj4MbGL0s80aGzwunCEVZh4AkbdX7QB42mNgZgCD/3MYjIAUIwMaAAAqlAHSAAA=) + format('woff'); + unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, + U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF; +} +@font-face { + font-family: Fira Code; + font-style: normal; + font-weight: 400; + font-display: swap; + src: url(data:font/woff;base64,d09GRgABAAAAAGmoAA8AAAAAw9QAAQABAAAAAAAAAAAAAAAAAAAAAAAAAABHREVGAAABWAAAAD4AAABSBboFKkdQT1MAAAGYAAAAIAAAACBEdkx1R1NVQgAAAbgAAB2lAABDmkK5r6FPUy8yAAAfYAAAAFsAAABgbi0j31NUQVQAAB+8AAAAKgAAAC55kWzdY21hcAAAH+gAAAG8AAACfnQbS85nYXNwAAAhpAAAAAgAAAAIAAAAEGdseWYAACGsAABAtQAAb2ymrer7aGVhZAAAYmQAAAA2AAAANhL1JvtoaGVhAABinAAAACAAAAAkAzn+tmhtdHgAAGK8AAACZwAABdbECm3rbG9jYQAAZSQAAANBAAADhkisLKVtYXhwAABoaAAAABwAAAAgAjACg25hbWUAAGiEAAABCwAAAkgzWFNlcG9zdAAAaZAAAAAWAAAAIP+fADN42gXBgQWAQBgG0Pf9IKQ5bo4gLZKQFkhyG92IvSfKAliVSWxid4jTJW6PeH2i6yotTTIyRBRmzMIPDl0G6QAAAAEAAAAKABwAHgABREZMVAAIAAQAAAAA//8AAAAAAAB42lzJA5QgMRRE0Zc21rZt27Zt27Zt27Zt27ZtW9kcTgc3qfoIwOOLVgGrUJFSlbjRsHuHVtxo2qFxS260qt+pDUl6NG/TjBs9unfvzg224eQvUjIemfLXKByPQgXzV4pHpYIVpI1K5q8Rj07lSsnpoEqyZ1KlCvK/CP7+xQQEGjp+iGwEshnIViDbgewEshvIHj4GqM4A1fmEali/VSdKNGrTtrWI0qRD/YYiVqu2DVuJJMpUygzKbMo8ykLKEspybTq37iCqAI0IT0SiEpM4xCchiUlOatKTiazkIDf5KEQxSlKWClSmOrWoQz0a0IgmNKMlbehAF3rQh/4MZAjDGMEoxjKeiUxmKtOZyWzmsYBFLGU5q1jDOjayma1sZye72ct+DnKYoxznJKc5y3kucYVr3OQ2d3nAI57wnFe84R0f+cI3fvBbOMITkURUEUPEFvFEIkAgAB0NHUPlcEpfGUoZVukqPaWtdJSIFFoVbYB2QrumPdETyX1K7Vzy1tAn6Kvke88wjE7GMDOG+8P9YaYy96j3nFXJ/WE1sV5If9ll7Gb2DvuSU+j/zKngXPHmeHOcR24zv5Rfyu3ivnJ/eI43Trar/H8MjwOs3mAUQGf+NmsbQ9u8YrZthLNtBrNtBLO9YLZt2/a+XN/oHAf8WvuKEbd9mG9m+qJvtb8guz673l/b/x0+Dh8PlAhMBn1p8CxWBCsSvB2aihUJLQ87eM1wy/B74jZxO/w30jN9MTI68j4aiDaP9o/uj96MYTEvtjl2Nl413jl+Uawef5xoKlZP9EzcFauD+TrZVpouTU92Td7UMlom+TzVPtUdxOjU9dTT1M90y3Tf9OH0xfT9jJFpnFmdOZhNZJnsUsC1N+fLUbmVue35VF7Lz81vhhDIglZDB+EErMB7AfFVpCnSEzmK3Ec/A+IQthTbjVt4Tbw5fhp/ShhEY+IsoH5JVibbkhvJ4xRCWdRl6ilt0LXpxfROphSDMUOZ2cxrtgTbku3LHmbvcgpXm1vM7eRL8Rg/lJ/Nv+Z/CgGhozBUOC08FQ3g1FRcLx6UQhInjQVmS+WMXE6eLK+V/yo+BVEGKxOVhWpI5dTh6lzNB5wZbTOIszqia/p6/Wg5A0Rd46zx24yZglnV7GqONuea682z5m1Lsurane3B9lR7s/3aPmxft187hRzI6Q1ivHMVxEu3AERD9yyIh570v5SzAY8qO+v4+547CZCEEIYwhGw2hJANw2was2GYHULEwGaRRoyAiBgpphQRIyIiRdxSRJ40pXSLETEiRkoRY8R0l+KWImKkkW4pIg8PIiLy8FC60oh0i4iUIg/1f9/z3jv3MvF77/Oemfs77zn/93zOnTNhmxqbWppWNT2bVzKvel5yXpJY55ihxZiB+7EqDmBd9GJlHKTPYnV8jot4PHfyJ7gr4FsF3z1YS91YTXuxnvZhRfVgTd2mb/CP8XL+cdmBOukzRFg/71Ie1/ErVMBJTlKhXw/PuvS9b2fuXmmlYsolkt2lkhzQKGy+5BN2HsbV5/OE8lz4M+2BOmXqotzvPRK+nz6X4SAFKD+HPsZniPFuGn2Y/8TXLAfBu9RZihMjdUuNtYyaERsjdVmhRPInFPHUUnvsK8hPksnkqFn/FyW/XPIDcWq7lmTKQAnR4HL9V+H9h4iR/gN93Y0U/kXonST2vpWIjWcXiJnGy7OriCRaTj8hp/HM7OjsqBCTPp1uhxdpT0TdculFxI0H8HpPmS15BjV1pa8p8/tt9n5y+Bf4NV7mxgCLUjU10GLstdvc2hoXuQbVRY2L0gdtHCBpijSmG9Pp3endwpx0vXtBZ4vGUizxlaXL4F0I3u5RvM8lnvOYzJzH6RahE0EJ7DY5c27PuZ1OCo1lojRzyfCH/rMYX73tGsr2u5eNEeQiRebss5eN8dU9uOqhs0NjLHFjfHXrq2VgHdZAJ0udbozLEOMypC4t1Vq3Qmeue2kNmRgxX9GPG/wYqyglY7nRrW9OxDXUF3l1uRdhwwNyGh682vxqM5FoloLdItNwC1G6xKRupG6AV2i8Za5X6hy8ToEWWKZ19aFcX+qxsBczUXEEtoqXjRxVqt81lNzQsMGLKtWDqFa6l086QVoaWlK9GtWCWXehmNaopoDxrKsgVdbAKrRkC+ouaihSv8xqvS599fMSVQTrqJxqqUlm/Q1rqVpPffYFKJanyolE5zzyClW5Uj2Ogj9VktHIg8ZPoeWM11m8JFtr1lFrszd6WrMOYEW0z25XLYO8xapVpR5bweYqCWmhPetFKwWtkdazcQ314/LX832snPvuJcQk7yXvgd5UzWq3XPIayHlrYNO15AmsrhNIXRb3IgE/QPkjj3XyimvQuIJU9ZND5CSH3EsIm3Vgx+BzDKmNqCZZA3ZQI0pITSWw3dbAXta6tsB7C1KX1WQiSrbRzP8kooRrKJVA6kVUgohK3MsnuSC5yVy+aiOauX4m+nnmQ42oFoxnroDdsgb2fbbkzAvwvoDUZXVeRODHaJ4fUSXV03xaSmtkBa7yzdtFWrFDtCKV/okfApkr5uXXIr823k0kcdSAlGtk9epR4JqQmZkYUg8oL3D3HjkS0SgqRh8lqZmWIaItUmeZb6TtKkC7CpCKJr1DXP9UTO6nu+/vial//Q0y9Temyz3u2mAXNMZZ6nHKNSGpTFT1h6g+cLeXxoZibKVVtIF2SJ3tvnmai6G5GKl330QGVuS+B/kiJ7hOom1FXrWY5xmDZ2z6XBvtK9tBcjXaNAiBPXRNyGwvPpDr1BS4uxCINk6NGOF1tJ32SZ3HxZzEg5lFMxGR1nqQIomb9U/dS5ip6pzWAr4bnufrh+uHhTqT8yZtqXP797JGNcf1ndRedxXstDXQRlCuO0Oc2IX29NX3WV/Vqkedm+q767uVhp9jBvln+TXpp7fpIqdG2k0m54mZyXmv5HotKHlMTsnjuod1D238hf2F/YjhtsY51y1XuA9+l0EvKrMlB8mUDNbZGfADmWgKy8jwr3Gz35PVlKYWWb+dMu57xUz9XqTe+GFG1O9wLyH88rtgG+CzAannsxI+K+tXvvyOjXTc7nG7QVs00nluuXFbQFLWwOZryUrUVInUZa95kcoc+aAbJd7HKE4NmJ3ttIm66IDEuc01lNyG1IuhAzF0uJeNobJn6krQFfBagdTzaoZXc33zS0VCuOoZWD188J8tF90R3QFWobG/7npF14MUWANboKP+mMwrj5G67AcDc/UGPII7ZAtW1iaZqWddQ6mzicMakczcV44nuhPdVn/qzYojoIfgdSix3bLx98ZjhiY6NKYPgvH4a/DaCrpcma1tDcqtScwX1uLFhBouk6HT9K8SV6E78xBjm4x7D/Uj5yLdooc8muWZZMYTMTPjCVKNc8YwOTOG3UvjTE15CnoVXleRusypjU+tnDIMOgQ6hNR6FtRGwQbABpCSzPezIPtB9iP1FLqg0DWjK9qsI7FtxmbQzfDajFTKJdaBtIO0I/XKtaJc64xW9IRHGikyo3FGY7QZ72xdLdEW8Lj24CIZ1RRIsTWwH9ayhNoJqctaM6Maf49eCc9I2dF300G3ruoNYiZ+Ln7Oi6IaqyJ+wr1sDBWR8vOgLfA6Ej8izKl5NOV++QnQFGi397kTfwOkAuQNvLMzYHf0Evg6jX+xxH8aZJk1sCVW9aU7KNcUb1I/fwZES8nQIH03tPYX0Wppg4NyA2LmpYHyy0RaF1bbSwfKz5SfsVFMmV8+GnQXvHaVv6UtSE6pffEh6GbQzeUHtL8rohXE5Z0a749KvAXwagHdqMxqpFAuVb5S2LLwMxh9BxEzXo/S2//ZnvWBqJj5QBSpxv0BvH6A3EsI13TC3idT8z5S9am5gdhv4NpkI56AC/S8RrxcIn4f5IQ1sB/XkodR02GkLlvhRQzeRZNG2ttfjroGhdoJtZ76y3idUOZeVn30hcRa4gl5qt4mc30pInhkDewnbcnEu+jd29Hb6pcZ35vyzPrGSBEkul2Dz0Ci34sAe4sTPZDoSfRoBC0z3gP1RuxDsg9cgvpm0I3KbMlm1NSeWKks9FnHv4IYmonxbhanOC3ROMipQDRQGbNxxnbUUK4qPyUqHei7MtA8nxEo2lMzesYjZSEVOsM/p5+oX3R1nlcZWzujBDWcVJUPi0oEbenC6xFlVmUr2rJpRreycFtq+RetCidGUintjB9HDUtV5SOycg+iHXdB5yqzKhj9xNUZCWVhlSb+JVWpE5URxi9+ScxULY0Pe+MXHySnqil+Na7P0dM2xKtAz2o0Py3lioirSvF6TJkt2YmacuO9ysI9O8TbtGe/lBVNK62W+fyGmKlZU2r8+bwOq2np5PuT79toqDjWTjz5pkbzM8S4/tYtHVuA0a5G3lnNseXjqC86+ZiycExf5jEo68Z0gr5Cl0fqodJiMVNaPG2hFxOic0rNtNS0lI1p0rNJz4inVWlMP+uWm3QXkdwALfIZgZwjM/lc5VNhHZloYvsR0Z/Rt0aKYPJe11Bu7/QaL4LJO8iZvGN66fRSjWDbpG3E00drBOslgnXwwzqufqjMllyAmhZU3xL28+FdERG8b3fF/+RZcrRrKD8aqUZS8oickkfuZSOJPYg9AH1PI/kFGZmbIJesgW3UkqfJlJxG6rJf9CIBP0TzR1KfPixmpg8jVfXpV8mZftW9tB9aJrWAenP1l6QfUiDHrIFt1pK9qKkXqcs+mlGfvoPqR1KfGhczU+NIVX1qjJypMfey6hXNFc2gEVX/ZbdcRR3svjWwrbZkxQ1430Dqsl/JqFecoeVhdbsyaKeYge301N1+hOHSlRHHxbRK1T8m5YphLWpE22S17NDydWRgdZLzcS8GKVMQOp/Ml1IfDZ2LLJDa1/qmMSF6A1tO5J/SLtB4fhUp84+qX60a0Y6QcmFIeYyUaclS9ts05biv3EBmyuEphzPKU/aq8k6p5XXrJzlvBHhDeA3wTngyXpPIyToJyj/tm+rmD5DJH0AqurwKpFd1O9Vjt5hLPuFpgWykhYG71VQwglqrNWr21eaSoSQltZX3Yd6u80n1KJM2CpH2ffC59jXzdmlfGjlZink3rFVe8xTzLpCpPFd5ThW3I++kKn5KPY6C9SkJa/0qN+upWjp7DPM2Wpt23NdqJzPt8LTAGE7zxvDT0pZm9Usj5w3lvuKYGih9HD4jnthUFfmmaug4U0VIRe3FhajzvpjmT7uFaG69mNaRLQK5pNF8Rj0GxVyyx4sD5AgtDNz1UH52P0/baW3qRl9tE/aW9ql6okiHkbdY1brVYzHYXCXhffsMfU/2bTyzZLW+Q/Si1so6fD1DpqytrM3qlWEtVT6QV82vvI38BqT+WJQlNJ69sh+cUb9TyIkq96Mq3upGxeTvZRVUh5YvlZGotMY1/khEyXAZl1mt/G4Qg3w9t6qABz1V7X3+2DDdVRKecz9hT3LpHC/JVpfREYuk/J7YRyZSHalW9U4QWCRm76fsxPtcVe/REquJnYdKwuptqn7+OfUFtErm/DvWplX7c/4IZllsWsy/34f7XD3/Yjrn9X7lfY1hv/C/Uu+1slaVByOBxzclkq9m9cMKiaTXWmWvr/wmVvqblW/699twv80pJPJjWK8xHJAYLqjfMuTAlAdigMewxPA1XpK9/s2Atam+ounFGtg2dVtGcaqn2CuKf61+m5GzTHlY8Z/g4yqeoPPBM0goLqe1tFXm037fVLdiF5mKXUjde1N0Ytw2sK1insdaeKydUC/3PKESZLmY3FMf3nufcwe1RNI1IZ8NfL6X0uuBuwIqCq5XOc1dL7PuobUS/xvzlPfIlAyVDGmM0cJrYFfgcVwInppwPySvfu+VdGtMn5PeO601HUDOVuWh3oMHNPE6wMns8co5aK3M/+zL2UOmbKBsILBH9Kri78t+Xat+a5HTqTykyLXc7ipyQneusd5aldHahd48RmfoEt1lI89yp3zTGCYdJTPpKFJ7kvlk7BmwA64JcV54v3B47Fu43yVmva68cB13m8Uk9lF78H61mFfvUjIwbx2eBzXUPKmRWM32ej3eJ8S8cqUoV1pS6d/nkQOLwsj2Lb3t9VbMW9N/IL01z5aIXXNNeF9mrsQGqS5wdyx4xq5nbh32V87iRmuxHi+G4hoysa5Yl2392KsFvWBl8NgixCk9P/ZswW6wPLA1wji2GPP8kbzKPfXjfZPG22/rnXAFrFZJeCYN0mNp7ducfG6Gr6CNsoZ6fCOtrYvMhK4JXpR1+Y/AtojZKKvGlue/h/s1Yv6cm+B9Th6VkRrU2tKuCf9jLzaQcvrBwF0RjRv5aWHyJWsTl/rfuM6QmTh/4nyrO7Ee5Ji8evmHkF/pjNZTyHLkRTWuz6vHdjAlz62CtTxfnzlnZT8rlO62xpnvn2/I81s686zAcdV6Wz1WgMWUhLToCt2RkbnI6ZGfFUpLffP0UK40D6ltWzfsiZjX9rtkJt/Fd1IdE5DrGs8XZEyuqN+Qa8KPe1GB9FMscHeAcrP7oCQuFngSLikJPglP2hF4En5HV94jiUWIrK901u+wW/V32HS24qQT1ibf8ldyH1p5CbPCKhbKnLCKJ9SjE+wtJWGtDn5Nn9BSI2i1iAVaN6kh2LrY4UDrTqpHibYORFqXeE5xo1XkhCoGPwm30C6p97K16HpPNzZEJroyulLuzZiB0ZvAjsNjkRCONuD+kLx6JbpRIqH7ZK7sbnK+w0tknQzD1zt7PKUlVhGPf6zEj3l8GxnejJizeidWo9bsa5aRiSVjSV2LnSDaO/YzDuwJWFSJr5G/DhofHUlj4jlrk/xnkYkn9VTFalQgb71qDKpHD1ibknDfb9K+r+PUCForrRXd9LUWkSm6WHTRahW/g7xB1TqjHgmwASVhrY9ZLfR66n+/bpxoYGYNBdeNEsb11bAifZmNPmN99T9fN4G53BdUNIcCime9daOKIKL4tSxFRxW/NoJis7XYOV8xSSZ2MnZSFWuR16+K76pHFKxHSUiLI/Rl/Zw+kaXlfzaP0/kvqmZcYlzCavEQ8kpV65x69IGNVvJ8u0bZdnFyBK311go2+1oryRSsKVijWsuRt0y1zqtHA9h8JeF25Wi73h6xXWQtssufk/fJRLZGtlotuou8dap1QT0ugi1X8ny7WMfrKyPM/33Wcpb7Wp1kchbkLMicMeSkVOuieqwGq1ISbleutusLz7VrgWjFrcWivhbmfwyXakVBHqjWJZl7X9ZnpvvIue7zcOtGa+su/z/PxC7Lzr0g60zsb4JnYsEnFujlSZnG7H51OqwVHPSUnTbMlz0Fe3S+rEDedlX+W/VIg61X8vxZ8H09Cx5hbppn1sY/8rTM+9jD74y/o628h7yrqvV36nEB7KyS57XuWi26OILWXt88rZ1kzE6kVmsHyCbV+nv1aHdNyHVfi80Cmhe4S9P47PEzVWonfbViqPWb/sz4mf2qdgMpI3rxY7TZ7PC5to/vSvu+nd2u8SXWxvmfvuPhP27luJWZdTBukSrdtB5Fd8AalITXQRN/RD9zZmW3qmjAN9KaeskU9SLVVoG8qVq3ZIY1qd9m14R/3VMEaaNXAneLnvseu5BW2GdJ7rCWl+fpMuak+5fnqlsk57s85q5+z/qKSwsbQJOgVzLnnGO8M/1vaD1RsONKwrPpL+ip3RFGmrl0Tc3/fKJzoTPVzsDn0z+qRx8sqoRxHX1O8Qk07fz9wv9zR/im1P8XWTvCcGhHaAntCIVS5v+rfFdq+fMs5X8OKS8MKRdJmc+P/B1q1CNrhf5+NOoOmcI9hXv8+6u4346UZNQ3gLwrr3Kf65ZdpdF9S0scAVukJDz/82jIPmHTl7JHfVSHtQLytTEP8+/n31ct94z+lmp9Wz3SYBeVhLRoiPP1mWvWyG3PfeKb6uViH8i9i9TqPYBdF/PyzyP/fK6et+a4ZU9pPP+iHv2uCXngxQOyh34scLeD8v3Tvjjm+EraYEuPPUKGNoKSfvtLejNgrK57Oftx6E/5+3mul0eNgTymP9XZUYVSK4T/m9a+QP1B9MQ/FfqtVesVhQHJzV6ZnWg3xp/O++dLJ1D2FOkZTeSOrDwbz3fUYx/u9ivJ6PXIGBUGNFr0d7QKuyJyVgdXRI495zHwZa4ErOZjXMnH+SR/ns/gesfrj5xq1f+u9MdfgpPmFAb4yefm5jh4ynxBDmISusz/fW4LrFRK/Dux7kAx2Bh4FSD6CRiFZnodzwEfpFbkfoK66JO0iz5Fu+nT9CZ9xq+pRl+JnkKD9d9fBFdsrihskSjq9IztAL1F99hwCddyM7fxRu7iXvTAWb7G9wyZUlNr5pvlpsNsN3tNnzllLpib5r6T55Q79c4Cp83Z4Ox0ep1jzrvOVedBpDBSEamPNEfkd9OCpJgpSEb0bKSg0przyN6bN3AfhUcUqRCqRu4V4khEYn/m9b6j37fl145insgxfoHLuJyn8Cd5F+/mbt7HPfzbvJ8P8O/y7/MR7uN+lDaj2k0MK3oYdezM1GkI7DJyLzvrbb3iu5rvgkPfWZ7x5Stgg8gddJoCvmt4kDgffk4i4NsP1kQmv8kpzviaat4LzTuwZwHfbbi/hNxLZtj3ZV5r9x9z2WVMwpaCNYINBhhWVN5VsKMBlsD9dlhPgKH1Y46ABVrPxs4Ws0EZE8v5kcmtp+HM/sMs/X8FpM8amBG/NJ0BORryGwDpseb7zaX9iLMu5NcJUibm+3GENiL7bMhvJTEfs6Z+TAtRf6l6OUJSIBUhUoUWnw6RqPSrRxh6mC2y286HnUfuGsmLZHafnBO8WFiO+C2EnZKn76BfH/z6OB7wa4V2E/yKg374fRK/UQKon67VK7B76sfE3rdwOkUGdlm9rVIjXgfxPahBaK7Sanj2Y/8hLbmfTOQZWW3Sc8WU5m2D7xrNY/0MS9q8yLu4bw/WHLmAu1YhoywZvQ53jUEf/ZdYQiT+LwV4iY4ZOFSYctzzIfeUk5cEdshiGiVruRzj8dtYtZ8EH2VPksQ3FfJegVqG+Ld4vvxbpAxvohx+Aat/P1b9rgCPg78I/jv8B/ypAC+Senr8enJGVFtMES7lXv5D/vUAbQCdwge4j3cHaBVFaCgrrkL4lmE36udukAhUwhrsrKa1/qdCrf/JW6YzdQwxWCt9nLbLeC2hFb5PecAnQhMoRt9n/86C2p779EVpyXGkfJvoTaWF+qtBNw3RNXqf3bbW8QJu4w28E31zlAf5Mt/hJ6bAlJu0WWrWmh1mn3nLDJnr5oETkWeZpWImd6njPd00WXOu2Xt+F/d18KhDmtnhTxAb+abE+f4Of1hbVIC0kKM8gT/Nb/Ie3su/xwf5EH+O/whRDfBbsl/s5g3Exi23MVMPr4A9Re5Tp03rgi9qmQ/+DL7NAd8a2DByh53ajC/0YsQ5O+BbEvAlsA6s9Q7HqK+ejPAeYmPX8Fhh2JFlr78WYEMoDTVz1meGztNbsq+TsELxOyC7uhjYOPG7RF0g80N+m0BqxXw/6K4ijpwL+bWAvGNN/WS3pOvqVeTtlnQrRKIos80nTMYdDX/X6oXyE8kbL6v7NVn1+jdKfEtyop63RH8h4D1fvdfDez0fD3tHcuFxMOC9zHo798g497jT9ybd0+3YTxDfVICvCPBZWkc/MTcpB9H+W6ZjEl7hUcy5P+JPh1c4F4+4widgdh7lN2UdXszaRfAkxJ/lP+bPBNhCsMP8ef6NAEuCHeIB3hNgFWBBRV3RWAlv8V7cO6qW9TzNXchdqvPLkV5ngvEW/5OiHncwIp4oHhXE0CMhsex/o5p9OqNloEL3dGXfUJWioArZ0S8Rj1MBlckhlXEyVnVZKiijKl2qssWq0NGQylqp8wXxWBZQKRuhLV8MqMylxX6Z7VpOTydog54VGFyNhBUh/zeBef6qaVWNco2jERYVMsV+o6A54HgSx+tXsOJf5yUYrR8KRVQiEQ0E/g64wdslqUONeKq/7y9XzUpZlyXoRdVWI54WqL+SVoe+w384pP0R0T7hf4+tld9oN9Oe4PcTfQ55SfSmQtdRpRNkqA2p5PoxH1IjrvZjflNjni5zFnXwb/p/x2igY1dxXGbAEs1ZrkY847lvVFNRmsnQZfgGW/ojoZa2hlq6WFp6+T8Ay31tswAAAHjaY2Bh2ck4gYGVgYHlC8skBgaGSRCaaTWDEVMFkObm4GQFUgwsDQwM6kD5bCDmYAAC5xAXJ4YDDLz//rPv+VsDFCxhfpHAwDD//nWgWbKsiUAlCgysAEDREo0AeNpjYARCDiBmYBABkzIMTOXpGSUgJgMTAzOIZGRinACk9jAwAAA5UANTAAB42nWLM3idYQCF31PEtvPdG9tObdt2m9q27a61bW+1bfzZn3qOl/pweoFaQG3Ar2pV83VqlQD5GOoQhDtpFDCPCmWoS60rtW7UelPrnXE1fibERBi7iTWFpqmZYo7Y7LaNts12H7t/eUVFBeCOIZ1CdlSRnX8hfU2QCashC/5FKhjoClBhg/If5Z/L35a/KQ2xrgJYm6wV1l5rsJVhzbdSPp77ePZj5MeQWvEIyAU68wa0jV+kNdrAf6UojmNxTokqVmtKuc4NziqdwzzgEOc5wlHlKls5nFQrhDMuuOGBL374E0AoYYQTicFOIsmkkEoa6eSQSx75FHKbC9xRIU90imKa0owWtKI9HehIJ3rSi970pR8DGUkJoxnDOMYzhalMYzqzuKlO3FK+ojmheCUrQSnqrLY6oXYs4p0KeKj2Oq+OymM3e3RaRWrDaV1gF4t5zwH2c5BT1KUWtXGkDg444YoPnnjhTQiBBBGMOzZiiSKaeGKUSRzZZJBJFgUkMZaG1KM+jWlAI5rQnHa0pg1t6UEXutKNlgxgKIMYzHCGKIthTGYCE5nEDEYxkwRG8Ia3vOAVr3lZCYILfzYAAQAB//8AD3janFoHWFNJ175zS7I2NEBARVAMEBEEIYTQQg+9g0iHoChdOgIqSkekKFgRuys2VNaG23TX3vu3vbtuX91mgVz+c2/CJfr374GE5M3MOe8pc+bMBIzEIoY3kWnURYzA+NgszAHDok0FpuYCUwHS54lmWkiljo5SBwvRTB6ffevg6CixNzAQ6vP4hAPzUsgOiyAnDT4h9gxdRb0zdPWm5wbZBk+3nTpxnMFUeaw4VimOz1g6y8RkFvOgLr64m0mlvNyFkwZTpxr08hThruHjxvGM9IxEk7yy3LJKJtL/MEOnW1lhOGaJYWQjpQR2YzHMy5QQIQkSIVOCWKD6Mv8gOvsFOntStQ1d+gal0jsp5cvt6Hf8q+Fh9Ty+Ps8CQxiG8dDbFMahxhz6DsahvIccOoBGxxpx6BktNIVD3x1Fec849D34gw//AOj7wH0ipqvhbso31TMVsg+wAe+ksxYcQ134EyFtuQiV0PsWo/m0MR2KgjvV5rTSc1rpKa3oKf4YInQO5MlA3jhMn9Ho5WBhIRIJJPbuOOGgfuWop6+DiyCC9iY4RIbHN8GJlZENET9/K8lOlMnWLr/xRWXtb/HrT6XSbSg68XBLTGCpd+jaFFSbWWhN8/UdUvFLpQto7zyaKtiUIKaUpuENGfFVQRPHK1owsK16+EdyCVWOGYN2ewNDvgWTGTyhvoEB6JYZ8iAXzHCpg64Zfr3xZJTSa2144dnSJe+VlqyXJXhc7dxHP922E02gyn29C2W2Oc/u3Xie7zenSB6/B8kf/4DcdjG+rKZFjA7w5VjWl+8vAF9i+8D2SLB9PDaVsdwG11gu09chWIMNDHSJTSHLOv137QnqrAwcCFyx89g8+jyyqHg0kIefOv5RrtngaduKjw8e+nPbfBGldFxL/4URbOQWglwCm4SZgGShqZT6r6Xju1UNRI1aQ/C61zUQVEND2H+tBPw2CFqMmMiBBgEEX/3go/2IpnG8aOgrQkefvEfPbacNWyhlG3iBncHmr446f+diHGrMoe/M5lDeQw4dsBoda8ShZ6yACRIC6glMxowwETE8zuHTVN8dIqyEQMJkjaobOADrRIi2FKItwjDFTAsmrrD6R8Kug4+EXWAqNhXweHjx7qd1qbtvLWnsj8zyaIkNXrPEK3r30oBVcvqpEN1Ovmu4Dbn91o/G9seFBuW5OrnUfrTj0svSmTPQng5Vgb0fsGOjPEbtJ6WA4SYRmMKDSFI9P3wYf+Mw3qoqppSqM7jfy+3M+JsYRnyj8avaq1J4lhLf0DeR/dAvyJ6+SSlbBk+0tJDBLeATdjzrVQOuKoygxhz6Dsah4NURdACNjjXi0DOI4bF2+Efia+Chx3gVliCURLGM9Y6UofP1nJyTTRkfRoUmdMk7uulMSjmUGXuwJcZTXuwkPr2TwNogw++C7evZTITYKMF0PSRBUOuqDx8ei5tcVn2Pe34Etq/Aa1TNKlCO0ESYYQczKMZbEiaOE/vwEn1KOejSDVxHPgeuxsCVj46heFUasJUDDm5kLPDSExE2uIOUEBEmONR0kZ5ET480D9tnRfDwH/peIBwRhPnusD++fMAUV/xW4IbVuSZDUuKacWHbek+VLZgSSRzRjp0usEEmhJCJHrLBpUz8DGgjxB/D2/kz+hWNH7uTfNswp3NPhCoMqHoad39WhR+DeIJ3WRlsHZ2hrqM0s/aTIQ+jIQ8nYkbAWB/niTTZCMmoy58E3sYFk3Ql9rpkdOE3vfu+LSz8dl/vN4UnN/b1bdy6v28jfuQ2/f6JY8j9wR3kfaqfPvsQ6SEz+hP6V/j5GpmCZrUONjNmcpkxghpz6DsYh/IecugAGh1rxKBcZhCAmsFYP4Y7W7OBsVDLAnNDPh/x+WKZDMn4YAa7pHQFUNnxuH1fFzPmwPO3KHNjuB39ro7fhnA75G5QfXijb0dB3wbvNqqcMUfbvFtiOmFwR/L34kElGZK/DKz87cazPDQD6d18XjDK/hnHU71XqQC9R5UDy1nq2g5blQE8C01hF2GfGS8DY0PW2RqSaJ+5nxneIqSnyHz4SELfIAPkuIEq2dTH/F/3Ut9rrSyrKl1RJsmhyseOb/V+dKi1/zf/1rETUAZKfYzc97bRz+gb8KNCPGR/fbAYYv0YMiCBUkLtN9Da4RwdZfrAQMRUK3uS2BGzLuXSWWVX7JnmJ1uP9qG0f5AxcTpnuUx1XFpbvvODOBpRylsg7V8gbT5Im4AZMhVCYk8KR+QgtVxoblDtxRdI2Phr94VDqPHTz1LXRr1FKX+89+WOy8n0MKWk21Q9jk1Ld64BeYn0m+RO8NJkzAzkqTdYQ74N/t8npOPybGVz6sxTllk95ds+LSj+BjKz6PjmI31btu/v24IfWffXGRe9kNqMgOx1wUeQ22iG6iMR/Sn9iyZDQfc1sKUKbNHBDDW6oThoPMIf2f9JSfymVLTpNt10pg+lDyP+mU07Ll/u2kN8uXjLQkNVDx6uOkYpP3y/vpjGKphVOx/ibgcWzVHL5AoX6xkLsQ2uafm093pDE5y0K/tq58a/5y8OOLM8Zl2CQ11Z06W8oiu17fdiFwUdiAteHuy5qTbnVAFaXnZqcVJMiU+4rHC+T0qgaFZGV97iHYmRIYXernPiFa6x/uLpyWwtjwD7UplOD5gwVklN+fjBw3QUOVGXvD7oQF5fv15dacnpXKVlCVswJUZfXWzJ6YU3Wtqu5R7qbGjshNqU3HK/rPz+amL30PyerVt7iP2wAtQy2LU+l1vrI6gxh76DcSjvIYcOoNGxRhyq3gXswIJq4MbDsAy2TZXgSajkCC05TkvevkBufbkdPsQQU9/JfUwvAzZA4YVfiR5bd/fd/W7b9h8/6Ovc+6BnL1NvyYmDT6FGppD4IE3uYua6w9wi9Y4XLUHqHQJ+F1xCNsj2HboCnbxE76f3vo2Owl7xOy5QNaim4PmqdfgXzGxbmL0KZr+h9jFiJOBHj9K2Z1EeKjyO66l+xQUEFGa8H6xkR7N+clL7aTwjox1QU3UHkQFFQoogUkIUht8RDtXjH6kKiKANG1pJz642riaac7XmnILJ5GZABaQEm47NBhn6bG6JeZrzhUSiOW+I2bwTIqbDgPeQeMTbs60tfRcZOh9YvO0k/aS7vsxhTZS18kDohQt0aFibzaa+9ozvPVx0ysYo/AKD+zt398UVpU4xrjYzOdWjWh3uhyYuzUjPgPipGfBcgJcby+utJ6OoFYceH0Wpxxx6VGusOYf2a6FLOPSEFsrn0JNPMIwY/gvQd8ELczAXzIupubAx8E21Oun/1ieGjo6I9Qg7FqowfGJqYUFkHN9Dqr7Xyc52jbcPc6uLze6UedQubHnzk3sJqfOlCV42Pi2exZXG0+vp5zEd+ZE+PgvsxumgjPjECaiSCCcl9C9PZOK3ei0tim1dUtKz5vd37jkSu0QJHpxulhoRmaL6pFS5MDM1SVqCPt74zpuHmVheAStmUZ9gAmw62MCdDoG4mC8SyPTs2TrCcBcYGKBCl42JrX0RaQNNpzLHd/b+VtfmtCQyrt7KcjnRFRLd9Gzv9hdtdXnUBeHLjdfvrT6VmOWp+sc9iMm6U6BnDHhrGmQM5yCLV4sTU5vwveHNLlGKD5J7Pi8p/XxbxrGgKJ9Gv6ajka2VDrPyXX0b/967bbBDLi+wtb1+Z82xaCY+p2gRIxvio2DjczqMsawJerrHYJku04t4GQpE4td0gsKRDhic79HbOcl18/zm/tj0gZrE1VKwzaUwKqF6tlUl9YnwpWtLTNjqZ7u3vWj3kI+7eafpdNIiT1zH05/R1AC2WfLGYaZMBfGSWbAl2FBmyDfQFei/qhQ+4yMHCzFXjEE9it5lX6wwj9sgb8lY1t9b9qBjxa2q0g8LF/U4T2tK24qOE4RkhzJgRdj2qtZ95ML9k0U6dXq2pl1xK6voMvrr3ucNxZ/3dH1eFeBdfd1vl+qJyHN6eHTQ5oq33n7IsOsBdkLw/FTMFNiZ4KP5+cp1gCYJUSgVszoyslYRHvTugs0fFRbdXFN/djGO0wmlPeNwc6IN3avsDpxru8TFG9yx43nb8sc7jGx10cM3+/YfhFiw2tiVGahemUKMQ6049PgoSj3m0KNaY805tF/I5A9UczIGojlZ++QqFEIBgzookkoYUwjZvNXujpIief4SlKFLH+4dHMzooz4xMVpuYBAb/7BuaIDwr7ub3hYKXqml48h5ZCsmZ7R4Mf4YyXsLsTowaseQrJ8k+tyeKlIvaZnGe+44NbKS4UPS1MFnU3xiUsqx5VJ/08nT3SLfy96vpF886f0getPcFWUlnf5Ni95pWuXqnBib/d6y+jfL6ZTqimUrC0pLydZtwrGz6xMydyWNHTvJycTCPmRlVPebitYceYRYHOocHLI0TJJmPrctI2dvChLOGmjOzlldU1JexXjnChSkH6kHmD6zL6jrLrjFgU0yPrxChe4nkre09caluOXGTuulHqhOR0fvWaci8Bep8x0jZqsQ9SGTK0/By3zeWNgbhCCJO4+hkXsiMBn/AlkO/YQU9AWU7OTj4yT19SWNhzLr6wm9evSrr51EoZDY+WJILYs0BllakkZnc5Mg5uqxbNZEqbOGGEWtOPT4KEo95tCjWmPHcugxLdScQ/sJxsr36TiiEqycgE1RdyEkX+yOS18zlKjcRt9/MG3rk0Y6CJ1z8vV1cvT2BtZrjv7aYVYzNfNEK/5S22Icu8/u7Z9gFGszQqIxOPiedKUtcMHnqpfoLm3USxrTFqp3cQ/0BXr3pQV1gYneUqhUv8NLActGawNhKOELlKFzY63mWFVHrOmj36UuDHqEeekLqoSm3c2khPUezCc/oy6AlQnqcyI+TrUY5GYAn2BY+SJ2zYymBF/7hcRwZE8iqiXJblsnO9smW/dMdrZLtO6uG2uVE+6WPcUql5RYr6gYeoL/vSDO1Wfo5shf0rhSHu0c5R46koOgDTKneESqWqUmDa+0T/A8l9jd2js5JMI9b9400nhd5Hw2CVfl1ssdIy1ViIkOPBGD1JeYDtOjR7MB4fNF6vWm918Krrbx0DeNWuimP9WnqWO819nE7rbeyaER8vx506gv5TaT3RWHf9W1MbJ1e2n6X+kED7Lc2R0+Wb3DYwyTTvCrMSlRn1tZD2pVc0OtZY8nrL+SkXmlq+vq4sxrXU0tzU1NzU2kpPGffTuft8KuuPt5S/OV+7evXr179wpoY+Wy2Z6mznYM41ArDj0+ilKPOfSo1lhzDu2HZwLrpAdh7DTurPoaY3NDgg8/Yj2Znozb/Bj6wL/jcg7wb7+am3kNebfGzxkyCluTZKealNLYIq+Mb2qSL33VnB8t6b8Dh27n0y9no8kpxNyYsiv3uk5EXLm74XgEx4/P8OP8SQwPAnoT/GkGXbdM0zHxXm+ZOLrqpNSurpSmT6rt6yGQ6g+dRYudY+1D3VbG5G+YZb6yrHRDgN/GsmXVM81q6cj06Oj09LBwNJCQMAHlk/5sd2Q0V0/THmUrEwrVlhSkxJc23rj70Qdvf333Gsm2RdAV0XFs5NVd0WhLJOCzCWjILJ1R7+1Ysy8o/njz4azedh2XnbL5TD8UXFvnkE1K1C1RJT1WSF3ojIxrZBoiuf9lpjfCRvRw3RdbubV1oVf0QPfVncCpQkdG9VCfqM4FhY3q4uepHr+mqRNq3mNSoumGwLUyiUAs0E5n7W4IN0td66jT3uu8Obb1YEji8UO1dY45UXE1oJCU+PkUv3QV4pMjg0EjNESN0A6dTEhXt0M4dg+qjjnpgBkyvV6xVAK7s6mhdpsHPhTqSWUS4t6ePchsuryv3VphZmfqKKroc3jYJlg7eRVhtOpFTduEsRvGjDnUR3uvwgceVdNbMcTkFfEzWGHFdJH/9QlXc8AVjh6GcduKVlFuQd7O+Izj5dXvege5dSxalimpzFm8OXbltcL2K75p7jtLEkPm+jlNM/IvSoxfpfCxK7KUhspt5HbGRiHL0gtaPKJdl0g8gMFZyOEkiJhsJC90CKG+CcGp00TLhpQ6uBOa1pktVo54ZObWOBtfH5vI8orIxQcWhq+Q+ponW2eUuiRkJDrb+ilsZ0YHFCztfUh9ElgT4xrj7uhs4RDsn9CQUbI9SjSzWGiUleOZoJD7JXu5hLlJPa3Nwxxrugevklb3P2V2ke3AbAI1A/yOZah3D7YvkgmgR9LsKuQExy1BB07/8UcvytWne5NzXRdaSc1m9a/BS2p+16dVNaq2uKRpBmxHwXTPsHvrje5JAgilWCMZFcYmzu+2goR3P5m8eSNprDLITFrgS/AHv22LmLe7E6ehCrAy2Dq3hKtzI6gVhx4fRanHHHpUa6w5hzJ1DjEXH6QMuPGAG3NKR4iU0as+pOv6kR2aQxoPfgvb9DKijhkrgrGtMBaOvkqto7qEePBbU9cPZw819F7a3rCHoIYGYU4wYTt0hzjBzAN9pBfMG8fMQwimqI/qcNKupw9e+uvZWfoQqrtJf4Vbo6f0UtREG6huoPMws4qOJ6UwcyLDTgdnWguZmqSUbjMvPNEyNW9F4DQnuuM4skGzge1nOf2lOg26QSWRQGEB0QN2szJYz5VzntOg1GMOPcp64waU1keg79XzfDceZDBE4wFw7fxde3s1MX5dzX9Rl88qGAnnsD+Jn8hp7C28IUJ8hMQIyRBRnUN/jMTwRN/PQdbsEzntlbfspyN9I3Xu/9k3EteGztTX4x/UoX+4LkrTnYGsf6M7A4FfjHZn+7Xkcl2W8v/WZSkHd3NdFvH+evDSs4UYBrXHmL05lEAiaf9yeaX1SwTuOvl705tPl618Xt/+R2PL8/rOH94/2Nh7aeuu61v2XN6y5fqady/1MNnKZJ/2QzsbX38w+/x1JuJQg6ZDdtuwdUgo+B9uYRBEQ+u+Afft3WtqauEeaWDXHtK87/G10swUy1UBNnHd6NHQb/iMkjUrEiPdCiyoT9bX0CVzrMflvSFzcpavLW9Y4xYTYDC1dObUl+9u3EhURgSFhMklwOcs8PkN+EyEajH99b5Do1+7W4pbfnLBwpPLlp9amHEap4Z+R435NTX5+StXUp/kXmysuVyQf7Gh9mIBo4X8YOPOnZs379y5EfSsh+w1osohT43UenQFI3e1hvCsb4KP3HsaGiIxHvfld999+cWjR19Ur5vhs9g/tsrLuSLHmg5yp8rpDvoAvZ9uR4VoPopFBY30n/TN7s+aPcuGr92ki+06h5pLmV3zPcjrceyN4Fj1jRslNmfMwX/upc8Hoi3oraFHcM93iaw9u5QenNXcDHlWBt74BFhO43YInM+sS3dyNCS4Uc3AQu+1Px/Em4VDN7Z+2h45o7Z4UY1XSdRlqnxhX37qiUt/dLc3r/9q/+rlPiUNfqEJC9mbx8WQw7+AbJtRL/O19jquVRCJZGpXcAqn1LybGVQZGNmWsPRf7cWPwgtdd8d07ApeGVUijPQpD9mUm9Dgmxx3kSpP7kmJborT4YWvzSl/Pz8uLUnhu7EmvciuXpIbWbTUw3NxdDDjmQ7mFhGY8DRVg1nySCAi9HCzNfQ6/MuhJfiXu5AhVe46tLmhEnUO7UEn0D7Ghi1gwyClZG8j+KbaPc+rJgBxkYC4OUX1lUehe8GBlOLb7cs+jMj0WBvftMm7UCFPcWuklA102MwpGR80N98uigtb6Omxd8eSlTJDQ/zoyI44RXM3zvUHuKGhvrYOsTYBG/ZbAHx7RIOLt22Wc/6WMIQ3bKqtlecH5uyRkL59+TlHc0oulq/oy7WreESVW4qLjI076b+Pe9G/ntlRWOu0cmFXyaKUc52bPi5NPfZi83co4jTD5MPhX4k/1DfLCrG6QN/owaeoKglbvbnk6TWrILtrge0c9rt5K8yJvc3nc37hbhzcIcVNcIJpfHRwzfUR0/CMxJr4e1lx446Se+s67+RtXJ63JLRqrW9w51L/ipQ385zT3da2dWxWPQpsSk5LW1VWWkNOWdjp4XRmZUH/osVH86uPODt0Fac2xllazqsbepmcG2A+NaJ8fmnjWmJ8eILzdFlhSmZlJVhTP/yQJKlSTDyShThTox3NHGUyR3AqV2n4ozUA99lwecG8fvqnc+LziGygCORakdqwur5s8QYfJD9UWtyfsfQqVbp66PBt+ssP6qQrZRsfH0o7dCtxz7ae9pL0dXFF2edXd15djOFINPwX0YK3MVUA9Dto6Xv1rs0A/ysqKCgmKiQoaqOiOWNRs59f86KMZgXyLklblJ9VsLgoYVNS0qaEpA0J8RsxhNph3ZriNUyMlAK+2FwiwNef9UOmheiLrIX7VSswGOMAYyrxNu4bHHZd49wyA63EYq/OFShDoHq4/bC33Hmuck5GZd+q1WjAIz3NoyJLWRBmPcfByjG0tYyRJwZbmkCe2pPCkZBrrwT1WoYXIys5q3K1Z3hszM51ETvlSTYFzqFB/v7JE33lPpWyTEmYYgPelhYl9ZkwwScgodDRI8RS7DDb3jrGfE6c2axoZ1tGqzlY0YxvwHSgYxBCdy5FhoREJhFKhITRWrob6Sz7/uz4hvyCgoI0dFFC1x08WA6zZMC1AvxjArNep8iuVXCGkPU8UbF3eUSXW8KsBbKAAG83o8AZeejRePqkScjMxbWfFpfYuYeZm7s5SSW6k5CyrFpHkA0VBc3S+GIa+w2menFya/OVUyExE4qeWjMxcWaQTVIyaZ0V5JGnCK8Nz24NCOwqcCqVfKJMGW/hLVMEeqNngklpGeI5s+P9/bOc4zenxm9IMDKhn0bN9LD0nOvkALZ5DD8lCvEarfWJW7YiGZ2L2090QV+Vp2MEMgJ+69nYz2Tr72iwuNXJGu8AuzC3MkcXZnGU27zEQ+s2vDkvVO65rbJuY0lZ2tKo6Ih4+nZwokzmHejvjX7w8eBNDfZIyM+b7xwqEPi5B6Wl0+usZk8y8xZb2yP/GRYCgdmMKWJzxl8Ww38T7cBHnznRZTg6yrSdxBCj9GBNjKxHtOTwgIUkXeFd7Af3u+v3DtLDx+2SLNC8CL/o0MXCyHgjC6t434AMh86Vp48Zo6Sp+iGhjnaSOdB3IhH+EdFCFfH4WBso/g6QdvwrwpRKB6QdkK8AcQCkksoHpEODiPH7RBOLrNUg5jCmmSoDZJ0GkcGYClZOpwaZxc3q0iAe+C2ikFICsh6QLwExgjHr2TEbNGMs8AdEO4tsVCPAsIwwJZ9rGJaxDMuAIalhWMYyzAZdpIZhGcuwDBiO1zAsw5DqGirApcSnGAERFyNDeow7aeOGCnJwLAcjhp/DLjhAQXZgYyErsGgYQalrB/qvy0MUM31oJVNXiggjzy51qdhxyMfdyU5pvajyyMrVauEdmqpDf/yfCgfopUHvWxq9U17V++qCTmD1rWD14W8xi3ti1fdnJ9QveVWLqkN7rcNNDcg/QeWDfCvMRS0f/R/r02sE8jxIG/nQ7srVHhGx83Z2RuyAmrXEOSwowA9qlptvlWOmQ6hiPRGvpvbo7PgRaohOi3L0hjIWGK8pY5YSq3kjZWwQ1yaMIbQPugo+CmROXRkOr5YNtM8m3F4SYWMTIbEPt9liF25rG25nF2lrGwnzNtOb8ZcwT4erwIRIj11FeJwiWWCwa1OaiSgJBaZ4mwXZ0q2oxcB/lk8ys/5ODP+IvyBo2Icmszq5f6YUgH7uDTqR7OuXnOznmzw7aI76xRqvtDQv39RUQmgTYJXi461UgrSN9CZW2gRsqjYT9tJT69jjiMf6JQsMgZX3qFwUnOplHjSXXoNabeBLevwtVqg3SGdOC57DP5EF2HPgacichsu1mJr/N689Q51dQ0NdnUNRR7izc2ios3M4WjeCFTmFhTk5h4c7v/aX8ckd8Mnn7P9ATVR/N67NHT8m2KivdAkNdXEOCaGUQxlE92BXmMwpPNxJFsbOpkvxz4lHmtl6Ir1XZm+b+uHkQGYwzMbHDOUSXeizMCdZeLjMiZmNvcX+D1e5ev/g7maEIvYihmuEXxE5v+pYSkBObuB+/+zsgKYM/w3uS+PuBbuEhbk4AcPyuNbwtIro8OxoRbhyZUJogve8ZEVo3OLUwRVarLG7dAyJAetxGr2ceD2WgPZJ04LlIsUbGbeBii7Q69/I6p1/v6LyWGpgTm4A8WjEKtosWlmdGJLgHZukCIlblBYPfJbGRGTH+DFVeR96SfCJBKhVB4CGLoZQBhoggoke1nuvfrvHg2TO9/TMV/jle3jkQzOyROGX5+6R76fId2f6UyV2gQwn69lVoGfOpwhDPT0ZYS6m9HBiAl0nQbXPGh49aniGamHFTSDr6ZzGbUX02XQURvenI8+ibY2IKc4YbOSkH6XUnM8IiVAEOWwKD7iJYh8SwhQeEiEyBXi9664Tszvm0J9bd8zZdkS+6y3rjrnIwrrDdocqHYnk9KdEB62ooQ+jaOZRg96uZfQxj1pagd4G3lnD9qQ/L5qpzvOhRj1tIuIabrrxHnm/+lm0DPGzGoi4Jp7A+4WRG+O9E1gy/oIs4vGwQ1jJ8DB4oBQ8IIX3J7CjzOrGmuHzberV7fX/WN3I+j8vb2Dzgv6BmMfrYO/T4KAKhxGcOWvoygx1CLTfMXtnTtyux1VVj3fF5e7MluLvbH12YyA1qR4ZoNhvv0OxyKAuKW3g2jOIciJIOqWR5GCDQyHWZf4ljbloIgi+NHtnbtzu76uqvt8dl7Mz2xF/p+fZtYG0pDr6J/rAd9/Csfen+qTUgRsgCfuZfko08hrZvBXCNymGegbseZJP8KC4C+E0JNNjGnopHCXFhIU7TjQGlntRs8dYxCv8EszGzKY8lwbGbClzGzvrDcvGhoZGyzdmjXUr7eY11hn7yelFMfnuE8a75sXTi9z9pgFUkYSWKVLsGuam+KIVSRV+xmCNJXC4oOFgz6lWk9HBR1RDdzNCBlmCRvm4WW9ImqoqmyVqjTGB5d484LUgMmzBrDdm87zLgniNjEK6xjdlboNdioKuYxTWTfNzR1vi81zGTfDMj0Fb5CyHgv+o7TsAoji6x6fs3kkSC6IiKggCHqggiHCUowuIiEhVlCIGoiD2Ehv2XqJgTTHWxIYVDaYY8083PTGmfWlfTL70HhW82+H/ZvbuWA5Ufk1YdnfKazPz5s17M2uTGy3TFfOdS0nW3b14Br7OjuG87/XJ1Y2fbUFQKg1Kxaml4p2t+1Tj2L04jx3TFTc885DOUA0yfY340x/Js6LXgRn5Gu1H/GtqeH1PyNmq5sRDDrzPEFkYxRN/aXpznXgp0FoHIcg5reZkQg48qzVK2Q5pZJOfrUYp/YHt2LaN+whfw58C/inQj9+BfozxGbadKJiiTuocpZni8Nvjo2PGdXJ9YkVmT/eZMTk5MX3Cg9hhPL1rJCLoX2w7vSLquYs5Q1vTt+XrTQ0cfHJ8dOyYTt0PrWwFtJ94iwqwouA46LP0qm6AiiPebkmDgujRQ275SpzyY+Py7nM9sDrLzR2fBoxj71MxSukcrltUEM5n1c5R/Vq8cSyf0qcBi5+KJfuOnFznnHTpeWBFhmsfjiQ2v5Or4ETeEZObG9PbGKwS79XiDWFcR58liuDEkQ/y7/zY2DGcViDcgVbE20dT07F9CkxAgFpT3h2dmxvtHiZQqnw9gaZJTpI/0qGO0LZ6DDYXxuqNlJex/bi4jP1FTpaxvbgEnk7F470L8YF4dj8rtT+2ghOPjbg7NlDrLZP9VYZL2N6yrfwBjjSUkTS8J54VLWQl8fgx+yPnZAGaRo0cjp0aaixlT+Jxpez6iViBMZaVOJS04iOr2PVSPI49WQrw98YKoLGI4BR6kZZDZJyKUUdDxA+e5Hml7zMeH3jSi6SD0sAvDvV3eP1/oqwoSTr1/aAvJFlzn24aRL6jOcL7yx0mejVuBOqXkFTPJGNBdFFoaFF0gTHJE8eW71qfE5axq27honO7MsJy1u/iEC4DhOtWCNz/YlQdb9w5Tco4hJjC0NDCGBXCFBXCuUUL62wQiAVGLx0tRrNeHbdecI0hjY0TSCMf2HzM0wYCpUZZS92r6ooQ69VAaOEjtOgRWqgWhwrYkopfhx7uJU4/ADfgxIIL7gA8hoYMEStlGj/fPWdhfvKkbDB74yJGhFuW0Puj0mLSY9LKs0YGxkykNCZiboZptKmvf98a3NfPAx4ncprz2a8kVbcR+QsvGpAMq0mXHsLryJ3okCA2cA4N5Loa1jouMYTvyGHXib/y8dQyjHMnJWd5l07lrzMOje0WvbCsbEFMN4LHHKAv79JtXBFXwAqqqlzEPDGhMGFl6LpFeFlIRlifNX2GZoTgzYtXDG6YqH8caFHWNbmR4UID36vR1IBNWUe3KfeRf3DATqvC1ic3PKNPRtTyKGjtd6AOt0gMLW0SEJC4tDYJtml2d41tohwmFdFKPrngaJ8ovqr+v7OdQt61zg7E8jReRevpZET57J0ILSo72GmpEmq8njw1Lm5qsjDVeDs/obXWQMcr34OV7YpTJQM6ZolDCIEF2NQFQU7jp00/4gVqjjkLcuDOZqklGobAXWrsDFZydzpH9C5XIRHuuOWXw6rJ1+GddrccpWMsRxsztaspuqrF25zqara6pobt1yyygjXPnMaXgPpZ0iHJgMPYDEHbz+bP4U6VNMg5L/z74iRbmcaWxu2x55X3+OIiPD2dbruTYX/dZr1LK9pj4VNLPZ5Ev7DLzC4xx7ajX5hPSNnmE8xT04A2kSwQjRgbJxoR2vBt4DWYMmip2qZwIYVaS0/RhkmQ46Tm3NwKOXA3j1ZL8FZGuoYUlEFnSKWCHhfkiQahCE073tZWvV0GnXHrW7nPrW8Vl1bGrOXrVkn2Nr4VX1wcnwR2bo+A1AGFiYkTJiizWiUhSUHoKv1Ckq3Uemnk15og65tNksq8gqTkgoLkpIIBqYGDUwfwJxv+5VYzmwQFpA4cmBrAkYFcT7HdVrme4PIEnCdAvpDDnGFs/CqXQM4p66g5JeQpN1wFiS8Se7I7Cz0x0KHviXXsHd7/sXa7m42aBa70tf1F2+Uqtcve1u+IWryb0ukX8gGb/k/ivherxNjcNXTfCvxWQ7L+mYbkukRd13jmoooDIenm7BY1O2vrqpfFndeXfP7eeV+FeqkwrlRXK041NXhRdTUfhyUgj6r/wTjEN6wCUVL+F8ehZHkTdBfEc0QLDUc59lW+pKUGom1GDTntpnkLkDo0qyAz1EqrW3bl0uR7mqlVku/qLBg9ZWRsysRU4GHJ2PSCYbmFnSMWVPyp5aK9nPI43wLgFFqS75YSY8bIW5C2hxe6wPzpGTrPPPbVO5FsG0h0STtoamoyX0OwZ1NaDePnvHkF10Po/DuQfvMyeoWulc+I9NF4EIL7zclifJ0Xmo2YjyAn+rj0G9ToDnYP7o5DMfYNob6usrrXwNcoj6RZlpPkRSVGKT/bDf8UwpzhDC37jN3YhYOZbMI/SB8pf9cqv5zH53DdZaXx9LENbM4sWN2Mn4w3bDh6FuhrbBpC9+uyBR27URDgr28ah7j+HqKuvcXYDkEokYLl0KZfwkvYALLj+vxgFKlWCtr0VJAk80XVVcEc1/B3Ngo+vN0CX9Ar1uWC3uF3pxe3a+1+MIoGW55rm4nvzO6CCfnzdq3v72Lu3Gzv6h84VVfeqnXWDk6tNl+7GuQVdQV/Z2LN660LfMkCfZrmyiVizHkLy8iLeunhwnfxY5EMrAtkt/qJv8rnd3NqSanshQb2Arl0J7pUesiHLejxBpRw3ZWegvr59Ye+6v+VMuZutOCP6QY4co/JljsSA9QMUb2roqXiUTq01e2pcBVt1bZuNsS0mDsP3o5Cc4VljyquWgfF7F0+o8itwnP2Q9WdrJrszk2Mv29LNfcevmHaysnrs7w0Sk4yX0SIXrb6L1WZ30XWvraZ+X3vA+cDtwaxL4O2Bu897XOgLn7rMOwLf/Ypi7C3D/tcdwxm+nLLA5Swm8vZOjyfX8ux00r8OfPh10p2EzvBRhi2Z/lyvvIawn08QIs7t5mSoOO3SYQ3v3whj12WVzb+a3wbbX0GZMxKhDA/2Uaeb0NIK+Ad0Zsr2A56VLdVYAzjOF3vglPWdVWX0sTQX1WVt9ycpJgbfe5CRoeTUtpDz09NW/z50fsxWfQjKMw9k4x3IO7DJ9kPv701PmfcB0044iWNumxqsuSD3v9U6P168x/qvLQhCOS3HPy/RJet7t1J5F4GJwL20EApQHEaT160dFVWc3exXKRMqWW+i/E5MvVWNvcdA0x3gHnNCvOcgFn/GJ/r3of0pWq6mNvgbp3r6oWNji3XEaLqjiGUrR7tm04ee0o5rhw7Tx4TRwJfN4fLJYDDWlJKwZ0Qkkvi0AuAAT9NupDvdOE6PfrGGmu9TDqT6yLlGqRcQ7jpF+InvUyeQ1RdQ3aTPiF+27cLL7M9R/gXGumbPAfg8jq0njwH2Fyk0whwxQFXTb+gq9LLkgyWnptodV+xb/y2drkcClsE4MK2e73GPg8cIexzFlpXV0dnwR88v7WJHgkLh1VgaS5W74IG2PfyslXP3WvbQ5bogMnR5u52/PhxugL+KL9qzGzyfUvw9IaDdU2AY22E4k7eAMcIBfsWB0SznXjRfzFKoeJ8uRknDOU2cXrZcOIKtvK2WLGH5dv2oBXRGEe8DprsDni1Y7f9OCm0ZrpUbl+DiP6J+QUjrxu5ogTgf9ivfBFiayrlG74CsdV8+TY1pU/MftInFqc2a6KUljXjNTXJa1hR3Mm1NqtKZhOsmBZqV0zauhQus4m+aIkh19gvvP7l1kAaf1Gp0AEsQYWmH7tq4N0GLn2G/GwJpB80pLSCjxe3hUeyrNbicaRZXJ+qMM29OLjG6tsSDZrEGkewa5IJIo5gzXlZm/OJNQeV8hxN7MFeB33I3qafy3nihIEznxi0m8Fc1ZNo/VW3qzP5KW5BRE5CZcTK7TuXR01NyAxfGLfz+RfzTiyV89iH+uDAGcH93nr/ykXDkAeDgpzYZ9ivJ+79zdYftnfFgbxvJ6Ft0hTpJZilBwMd4nyBeuRSONBd9epOWIPeoG7MMRq0B0nOnA2pSkleHHy28mQ/vwH9TleeC16YnFIVcrbyrJehv+dp0n3JypVLlixfLr10ztPHy/ts5engpalpS0NOTj3jBf+gXMiSEalVwec2Pbxm7e7da9c8zPvhBganW3T7YcU2AAU3y8DgLDzFKvvq2VC4q2Jwceb0UB2nzZXUzX8mZlLkqrSyU5V5x5eufej9xNLYPRNPXco8uHDtm/mNWeXp03T72ZWO4yIrwuKdWLjX5AOLig/PdmZfYHenWfHT43I7kAGR9Rsztz1wLw4wX2Gd/N/JmU/2dSrJSZ4YgDBKAV0bCVacQbsjUs83bnnZzuF054IjBtjUYYQrzIfcmrwjMdc407Si1h3/7M588bk+bHrPPTWF1YOCawrft3g/02crPdXnQADuLD8YELDQx3P/xTnPzLt4KtZw0mMA1t2Y98ycPxhCmO/fEft3+zmc4YSfbvbNMvzQAp91yPnK+sRZQ2anTpmOH2cTA0aRJ7pZHh89rMuhQ+OPyQ+OLsiLMS568M+5DVmbB21Z1yv9gWiM5mJU8eQEwJQBmErkEjECcYjA4KV+kwB+QjD/kUrY4t9Bu/Zh355hP+Ce7Icf2dLncXoHnC6XKFnzjs9l17D73OPzyEllLVkgzhLgGdJmsRdI7Igp0WwFgtyV6FEpQEq0fyNIxedMDuH17ME9bDFeJSWymZvZHLxpM97Ca3xPfOllchFR1SdGLyse5OLu3ZBzC3egT9HXBCxX3puhHxuMrjS9/Pp12y99rdL2UtkAML5HJfSyVCV2T/RWIWLtbgTNM8eEZ/I5UXOR+i1b2FPpRr43wZhOu8DTyJHwxEfbFY0H1O6/o19YbtB74LI6EoDu0yhBItIhNbLDFRL8o1jYW0qMdIj5qpYWrnMoq0au6JlMJYa8OE7pIB1azjJY2iL8r1r1myLAWYiq7bSy5VSQo9iTfX2AfY098YuKhxTCPtrMLmPjZjzAUqxGUcfg16V86iXOE6jxEKM9UCLiN/hRaxikf3OYJL7IMN8jaxH14pGQ4dboSMnwqKh5o0Tb4Y7QdvVIVveF89Z7RLlA6lke7r0F8rdJHpK7bovgTrUDyUG8sJ79wf48hxfqtihb8GesP5nJYZ1hY2mT5C4iOC028htAm/EjZ862k1n0NZ9ue7v0lgc/ljE6v7/+3iNHeozMKF4fILkrQyYdj3btVd4/vSDAGJrvyd6BE2fK2fLdmSWxFCGg07fpE2mzvMbaPwaiKCF3g3ZnvvbZ4LiL3+Gd/llpSS+nhqis0dGmjAzliPXBVLQiKWlFUeGq5ORVZIHmRV6TfGt3Mv53cXlJ5cQplQUUTXxg4hT+NH9sTV7O9vHjt+eMqR6r4PyavNxt48dvyx1TM1aMK6MUKZ1AOrvvaCWtt6TSnpYfpBOs1zHW6yDejXdB7HselAyQTkgpONpm40LqSpQmBdC/dTocxCPiTdCbpMuyUURcsR6DrKH9QDvzEwNkZhl7vp/J7Uk3kze7VCYblQ9mYoNH7GDzeSktMN6dfTqTQ2i6IF2WfhcQnEGL88CrEXO1To67mfrhhDIF2rcMx3ub3KTfzecGx7tjw0zlAxI4k33mERckjeRjyqUpTdoG2jAEJYh+SdXvCoHjxrsTEVLuIiY1tfH5NkJrfw3zcbEf1lNP6xkfvbo2tc/gJQtixkX2wh26JlaOnrra9N6F5GU5/eMMg4f2kDzHHdtQ8t2yCWuwm9v6UvdkU3LmwPv6RsN2/wNXf19kYXVPmMaX+ATmR817bxWWmzwClDOVMwcUHflq2ZbG5ypSZs6YW6Yse/XFiTty47Ldia4LsA5qD2aTRfJc5IuGaDW6IM2ru7ezYEPMvqFqtBVrvzZHAscdyCoLmZpWXpEwYxgZVOdRfmjOY68UHtw1vjyg4Bie2zB5RXRUVVnOan8ZzsgVRIbPzI8uj1ulfG3Ii55/cdKjr/bVdc+fG5O/Y7wyqmTL8OErRhtDEEa5bKyUL5eougLmXLhU7CFS/iP/fuTQF9PgIz5ySWPHHrqqxod70B/xlHNTZ9RXco4+bJpLP4U2CUWJjhy5qpZFW0cVDCqT1nGhU4uHiSyyYNrehMyoBTm5FYYpZQe3FCWExd9/Yua0o/FZUUtzcuf4VZQdrJmQEB47qTY0cIhxxwb4sx0OTQTN9g8YFRcQY+wXtmZe5nI//4qUcSuTooNnDhiUlhAYHeZlXPNg5jJ//ynDxq9MVt7oP35AZGJ0SP/xg4wJsYjC2G6U5spXQQYDUGTrr1a5ajjTbE8TJklzC1mPBtf+sXTpH7W1fy9b9ndd+uTQFMMov4ypk3PCsr0TBszJeejpcTsyqi8VF1+q3nqpqPh5+eph9l1tLfvu8GHcu7YW9z78l8EwwbPPos2rl/T3LPGJeOnC4iN5D236tXrrrxs3/rq1+tdNSEKF+EspE+jtArZjAAp1PEMUQ1wdyNIPEWaet8Eb+pmrd3fREmTspv+sXfufTZu+Xzdq04Xy2fXl5fWzZ58vLz+/9UZ6RO2q3eGzTkTFRsbJVzd8v3nTd+vWfbep4sLmjKIZF2fPenb69Gdnzb44Y+nRuFFdfvn0UxIyptY/OAth5EZyxRcse6lfW+vf3+hN4aeH2Kbh7Qw/sIJzkco9FnbDBOsKVs7WUUycZ/e5WvUq+XBynlxi+Qe/M7hsiPIUGTG4bDAbTB5TSsljM5R3yBD+JQo6id4nTk+5t3nKXHNQG7+Ws72wcHtO1vaiou1ZAVkhIVkByZWVcGB0U2np5tQRmx64f2Pqg/65CYljBhTfPxEsIdJROUIO6jsgqs5T5OBOfYcb+5wmIETIfU2h5IAuXczqIteFlziwc+dOXboSSV41n+R/EcJ4KiqgiSRG/U4frJnBp8fPlpJHjh6FRTiJObeorm7ROV5yOnai8XiN3aaJZ4F4TVUVIgBjB40ntNmGkNX8QfhDNojQJUv+WLKEr2/6glZxtWqVsaisDc3idRfNgv+rqkj5RquKaA7zvb0uIt//H6gt6ZH2luQxznr2Kz2s2yglo+9ts5xyAfZGzNcVQ9oPtjSWrhzBdfoOkgFnqhFPnKnuE2g4IXqFyBF+K7jf2IcQ0eFMeJOuX25Kxz/LW0VbdURdrDYOv3B3DP0E4xslu6Wg3VIHaYV5ye7d9C9LJ3lr40VdIr+UiFolSJd4axaZQaYiesu1KZ1kCGhO4ptZWji3Tu2mTzkAcQCAiPIwQKgDCLL48pWtLgvWVmxZSbJMg9UYgdXYAOhHESiO44W4TvdAAusxKk7lQS/WgfYO9SBGzYIshjSvyDCgMgKiNzNrDw2bf37NkJG7l42Kn/d44dq8DTWl8/YviVcXZ4mzkzeI5RmppFlK70HEX4mBldrnHQKTBp1JHzNAx/zcRlZWFxTvXTCy4yuXqEv40HPJCc6ULOartZ1T7sM+5ivKc50Sqkozt5FTnWbw9RpeDyEvFvApzuD2ssWIHgUrOBG52L+vpn5d02oPs7FijbGHpu0RCw5isK402Ey41HUHwjd/BihlAKW3FYoWkgaa8s8ey3kbQAeYWrga2MR8RcT5PkI61LU5zqcx1+1BPnYf/pW57GE9W8b1VrCOm1kX/Mdm/DciFu+21xxq7Nu+5qA3Z6Pj9AtpqN37w0vaSzdHuqWhmiA3VS41xZPJ8nJeS/RJvl2NXxBlNSiXpNQo8wVX/rd+gkkaHoUfxv9ewdzYBXGTL6xjPff3BY6bUD5wvFHdO5etrnh81dsAOseyeRh1s3xvGW9/lDYy0zFmWs4N1hXNj8BFHUCKtELqhlCiHZbmFqkF2X7oWkRI+ssdIjn1conVQ+UtVgEwGKCZwGrBeiyHerVyt/4TvZhd6+3j407GK4d8Y92x+2Lla/m5e7/8O0G75eFKBXvVw9fdZXvPKE/2agUpGbF9O41w9MFaSpGTNNYWD07sjkVPaRkPHsEXgpaTcsTtosF1fH14jnSrJb6to8GINvSEvhgpcHQUJ3GtWNoMPpsrVGz697RR6Lvh7XjHgDTXyemgtSbJW6VkXGzTyY0YNGsEpKXgIvNoW+o/55vS0ccitRD0sEgFHr6G+XmWfFjw4OzIA4VBZXnQ0kj1lnL5Jn0UpHyv5fq3O2V8lnkzrzoSXUvClddrlReewl/hL/GYxod0s/j8amLv0Pf+p3pRr1Lx85304oFFzXpR+dhDOcVl/D/Xinmvsh1qE/C9OznATaSGm5T/ET9WdU/bpe61bOm3/6/pfS2HpKNmCrCOnACrhrWPHI2GtQ2bzzX61d5j8Zca/WobIQBLfGnBcYRogDoODwf97TgiHFU5Hwm7QdvGy8thJDwgerfgpelf9HFZVr+WlYkBfagTpY9bJlpK6WO0k+Uvyz+yrLxcqzxPEmqVV/C3+GvmCXGziShfwtJGgDXJNn4aeoD23ANpKXhy86iyrEHONFu6InXGSxGSvuXxNeA6gUaquw9F5M6AQ9X9d3iZcgRBiRvfQq2bUCsFLxewVGoR+5gutUcTVX8Vd7Y3gcuKvjbOQqmyjq5aIxxXyvFFZFGtpVO0PjYBcUlD3UioK8axXbfLzUD+tsckLYUt4Wmjk1EOoIHDFPwSrad9pM7oPyqHiJgPW/0KY9GkdvsVRGhe/Gq8YiFWX1kMhV8XGDnezW6Hdroces3auGpQWPrQrh7ZLd1q+arDrcTQyS80ZWDYnic3hfeN9rF5JtrpltD3jhwad2BTP61vTnjrepYtWxmWlO7TwVzAfRVWvwW04glo24XSFeuOScE/BTYpv7t27yQB9xRkQbmYRLgYVEUoPGLF1K8izD/WlFIyLGlCiinW398UmVw6PCQ5Mm6cLQVyJySlbprcTTpBPJWvF2N3/yG+vkP82TVyPbHYz2Ty45f30CFeZL/sExToMTA2diBPypgWTHyUvcreChw5KMh1u2vQIByJsGU5fp0upV4owGFnt2MT2ZuK6jXbvEdnlqW0FnlgWsbkkY6bvuFXK0D1dyIiN/ORs1QJ8ipA5UCDo5Ba3dXohlao2rsLxs0CJff4RYcnl6QED4uIyx+WVJJsivNTJThsQkp0nN8AeC5O0qQLyW7pNzncPyY6uSRJlblfXNRwtQbIX6QPK4H0KY7yzxZSf1LyCQiwS90nNNTHEB7RX9MKyWoztXWRZa0aCBEYf5PoAvl31IHbkImgMrH4HhFYUP70gPkW2yW8vTtxH0kHFiuZyz2+5vk1NXw/XS34Y/PkNaCJTOa14ms8psuQjqdSE02UPXR6nGs9yzyd/kjjpQcgJU9NgTJzIeUapIzhKSL6GApRwcN3iT5aLX4s0RcscfSFG/PVO5m0i1Xscgw8SiZuMvBLRGe18FGiBqI1Oqt8tRMgaGoCj0AVLpEPg67eYNWkEtvrQCmKd6TOmdZZ0uHaq6FKS43kyK1q9XvBZYMhvWxJV760pOsMAsZz2+Ef+dkOgWj5UVvOzgmp3wnl6VJRsAUPD9ksMwceBHYXDeYsFakWJUDiOMlBgJSCt9r3YFDS0QGWRhpkLKlUtsPlIFoHaDV2aEQLDWBp4QAMv+02vrgE2A6NBHhJ+L4XSEAZvnMnj+jquzYOFeXwFOllukBTDi5rm9uospaj9a3K0Tf5fzagKYcatfCyreUaHcvpzSYEspSu2NtY7MjSyMe6xgMtDft9Y4nBAGrFAMPPyNWM2SSZzC9LJnmk5SJNtFy0/MVVQtUSV2PApClTJgUYXZdI0VfZ/sX4Ahu+GBfbEJNO1vtHYriv6z3UrWbu3Bq30F7r2BK8okIZwLpV4BViv4KGPj7W2qRHehnEBKLCvwr8VT3DAh+orHwgMKxnFV1wW1RI4tzTZ+3Q3Zv5bgnflzML3MoFtw7JBczcikuyWtWFb7AwG490ciuEFSIF38Q3EZIt0zWccYulewvunIhVxsDbIOlD8yCL2Y5CirrK9lVxmVbhCQ4McugtZSjhvg5tbMdjtONQPoe58fM6TVvZ4P7k2B5aiaHENuXVjTynDCPPsb8FyVXNgqq6g3SQaA+tTHoBfFA4XqpEMPbVTm3x5ipppSwrJWyKaA78Jgtl7o5Tkh/XSK52yVS0ml6Ipod1UXWU1iIRIxCfcgALSoccbwUKUU1/ckI9YNzxbUcYO5L++q058qYr9uZUqa7CHv7Bvr7B/uwb4ndnmqmm7ziJ9gQ8zRLCoBx70J8aDHYM5DP7owNsTY8kmn7iZIfJobF4fMny8W1AIKLpE13UeloJUk/LW3QoW+QgQgHEkbOmJlsPkJLxLtsKw9ZCoIN3N0cchayrRclH7GuRJHvth7W1RbkU/KgmXnndDvMxe6oW+542sD/eJvZ9bWDf2wb2/W1iP2BLRRi/LfmSevkzEfFs+UVekhYQ6+KZXWpy6Z0gfxYd6GZKOv2Hy6DegdG83XrLznSb/D26V2hI9ct0or6X5hmvD4qJCQqIjcXTA2NiAgfHxsrOpsDB0dGDA022O9DwhexO3tfdI+ZI7Ucc8ozDhhnDEhN199g/9gelZ0qfU5POV8QhwMVDZVY5jic+s+UXyH1QRjRdFylyXWUDaRrFiobqIrceG8frdpV+ont1A0Xs3uAbIusNeOJo3Hkm7jiyUfop+7ffss8Dbwulj2iYbno7vg48Nr40IqI0Pq4sIqIsLjgqKjgkIkI33VgYGV4YFlYYHlkIp09Dh0ZHDw2NBuydZV+6X6cXWref9htltkgdeTs0PcG3X1DPKd4VqeFpcb4ewb0rDJWyb1Dw4MCwlJKgoIEBYdmZnJMR8nBaKr+OqNr7aanyH9JLHr6M581h3jQCeVr/nxbY69PdMbZJjhZmdp19f96w6fGmaYawPiO8QhPZ92Ge12o63G9KGDOwl2tJZ2dfbrP20iFao/tI0uPT0Id+53Eg+Xsao+8tMMt6X/w2nhnCSvW9Pxt3CHKnQG6ivptd/jdHstwAfbete1T5y3/SvXp3IX+Z733xJTW44wjFnIY7690/zt23L/djjnWB/AoN1RcB1vMcK6R01nWj+3Q3IeUpNcXGpU6HLyAO+4S0nBKdXsWMDWTpSsaydfox7P0QniufokCtPXf5KmbO1vvmsa+H/n/vNtYKAAAAAAEAAAAFAINF8JSAXw889QADB9AAAAAA2wktdwAAAADdVa6+8iv8GAlQCWAAAAAGAAIAAAAAAAB42mNgZGBg3/O3hoGBM+GT9rcNnAFAERTAqAkAkugF7njaldMDkCNhEIbh/s+2bRTOtm3btm3bZuFs27Zt28rk5k/m3rrMVs16d1JPfd2dMSJtk1rIHjzrHXkcI21rkR1mYCox2RRrcSUIs3GD9eICUhxrbc2DZ3nIt7iLpriIhqiF2UHIjegogZy2mWiOycGzfpHnsdc2CROwPAiHMBbn8T0ER3ELg2ztcR7KzrnBs0zyvGO9m3Yew0qcD8JgZERPDHW4jLk47jivQZBI21ztyEs4hvk4ggHoiFlYgpU4ibEYz/PLiJnIh6zIjILIhpJIiSzhWM/fOiIenrFlwAuT2Vosxm4s5BxKkdcB2Ykb9jrtqVujCzoDbMMMEhp7XTfZlPxIZkcvVHWuh7PM0pGlIWiHsxBAbScf2u7T77RnqwE12FYRX7EfPD+9LdI2IwJZGY0jbfNMIpdiPzXfgPs+4uIkfVXme8nL9OXZriK1YGukbd749Lf5n/vv6susNfVF8EzNl8zOk+vgZpbHYYyN2jzsSxe9bozRSE1/nfwN+J239cl338hApIuj5hzNYoAe75i3g4DFX96S8jJFKsp8qckgo4yVt/IXN2WbbCMbYq5sl8z8MwD+Fuut9VYSSlepz36KSnNJLmMjxI4QS1hUd9VTdddpPXs9+7zVjc2/z/9N6lmse+iCro/mTZ3R1ddz1LRcO3+k1u2MZJ7qbvVrt/FMFzPq/e8X6Xa6jZFETzCS/XmlxUimK5pr9WY92tWYapNv72Yx65NZzLvSL61PEWIDFj9x++a6p0pLBq7Ls85vZ60uq5TqseqtBqoEaoiKq6qofioFR+pKP1jFpdusNv8Dwsk8NgB42mzBA4wdURQA0Id5nD+8g9q2HdS2bds2gtq2bduMartBHdTGxnsOQqgO6oEGo3FoKlqAVqNt6CaOcVXcAI/Bu/EVfAs/xW/wZ2KTyqQ1GUzGkalkAVlNzpKH5C35SrPSyrQenUCn00V0Ld1BvxiGUcXobcw3bjDEKrImbBibyGawxWwdO8Rus0/c5il5fl6KD+eT+Ey+hK/nu/hRkUE0EOPEVHFKerKKrC9bya5ygFyiqMquaqr2qpcaqiao6WqROqeeaqJtXVF31av1Nn1Xv9Dv9TeTm9XNRuZm81EiSFRNDE4csJiVx6plNbU6WL2tYdYMa4t10XplfbSxHduZ7PJ2V3uuvffPr045Z5Cz3bnofHLLuE3dae4194VXyhvqrfX2e4/8VH5Rv6O/2t/r/4BCUBoqQE1oBK2hC/SFYTAepsBcWAbrYQcch29B7mBCsCI4GjwPvbBy2CmcGJ4Mf0Q8yhxVjkZHU6Ml0ZpoSzKvR1/idHGbeFW8N76Q9Eb8NH4Xf0shf3cFD0BwxAAAAGubZxufU5Latm3btm3b7qC2bdu2bQ6KXSLN7w5RixhL7CZuEF9JkSxIViNbkwPJCeRa8hz5kIpLeVQnagx1nvpEJ6YJuirdiF5FX6Ef0p+YsswQZiIzj3nIJmItthP7mINcXq4cN5Abxz3ia/ML+adCJCwWnoqa2FccKS4X14sHxKviA/Gl+ElKLGWQeKmuNEU6JaeSi8gN5X7ybHmv/FHhFUfJqhT6aw9ln5pZraQOV9f9vFe9pj7WEmqhVlirqbXTxmlbtCPaLT2j3lYfpI/Vp/53k37VyGUMNRabyc365krzppXG4qzw9yJWRaup9clOYKeyadu2y9nt7ZH2W4dwCjktnb7ODGe7c8cl3WruCPeYe8G97T6LkbE+sfeABeVBTdAV9AejwBSwFKwBp8B3L6k32XvmA3+7f9V/6L/yPwcJgigoHVQNugczgpXB5uBccDP4GiYJ2dAPC4ZVw5bh1vBJZEW1o4HRmugZzACLwPZwNFwLt8ND8Ay8Bh/CN/AbSorSIxYZKESlUUc0Ak1Hy9BW9BCnxizOj0vg6rgZ7oUH4zF4Cl6M1/0AyhMX1gAAAHjaY2BkYGA8xMTGkMBQwcAF5CEDZgYWACjvAbd42pSQxVmEMRBAH+5cccgNd3fngut13eV3HAqglq2BAqiAbpB8g+tGXzI+QCXXFFFQXAHkQLiAVnLChdRyJ1zEAvfCxfQV1AuX0FiwJlxKV4FfuJaRghs0F0B1wa2w9skyBiZn2CSIEcdFMcQAg4zQyxPprTggTgTFGglsAihtGdZ/O9gYJJ84pO0X8XCJY2DjoOjQfl1MHKbop58YCa3hEaSPEAYZ+nExyOKQ4ox+JNJrnM5vY2+85r1H5Ik80gSwGaWPAZ39NMscsMLSE332+Wbd+8n+91jqk/YREWwcEroC9RY9j4jSI+mQQwibBCYuDn3ad5o+DGxi9LPNGhs8LpwhFWYeAJG3V+0AeNpjYGYAg/9zGIyAFCMDGgAAKpQB0gAA) + format('woff'); + unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, + U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, + U+FEFF, U+FFFD; +} + +/*!********************************************************************************************!*\ + !*** css ../../../node_modules/css-loader/dist/cjs.js!../../graphiql-react/dist/style.css ***! + \********************************************************************************************/ +.graphiql-container *{box-sizing:border-box;font-variant-ligatures:none}.graphiql-container,.CodeMirror-info,.CodeMirror-lint-tooltip,.graphiql-dialog,.graphiql-dialog-overlay,.graphiql-tooltip,[data-radix-popper-content-wrapper]{--color-primary: 320, 95%, 43%;--color-secondary: 242, 51%, 61%;--color-tertiary: 188, 100%, 36%;--color-info: 208, 100%, 46%;--color-success: 158, 60%, 42%;--color-warning: 36, 100%, 41%;--color-error: 13, 93%, 58%;--color-neutral: 219, 28%, 32%;--color-base: 219, 28%, 100%;--alpha-secondary: .76;--alpha-tertiary: .5;--alpha-background-heavy: .15;--alpha-background-medium: .1;--alpha-background-light: .07;--font-family: "Roboto", sans-serif;--font-family-mono: "Fira Code", monospace;--font-size-hint:.75rem;--font-size-inline-code:.8125rem;--font-size-body:.9375rem;--font-size-h4:1.125rem;--font-size-h3:1.375rem;--font-size-h2:1.8125rem;--font-weight-regular: 400;--font-weight-medium: 500;--line-height: 1.5;--px-2: 2px;--px-4: 4px;--px-6: 6px;--px-8: 8px;--px-10: 10px;--px-12: 12px;--px-16: 16px;--px-20: 20px;--px-24: 24px;--border-radius-2: 2px;--border-radius-4: 4px;--border-radius-8: 8px;--border-radius-12: 12px;--popover-box-shadow: 0px 6px 20px rgba(59, 76, 106, .13), 0px 1.34018px 4.46726px rgba(59, 76, 106, .0774939), 0px .399006px 1.33002px rgba(59, 76, 106, .0525061);--popover-border: none;--sidebar-width: 60px;--toolbar-width: 40px;--session-header-height: 51px}@media (prefers-color-scheme: dark){body:not(.graphiql-light) .graphiql-container,body:not(.graphiql-light) .CodeMirror-info,body:not(.graphiql-light) .CodeMirror-lint-tooltip,body:not(.graphiql-light) .graphiql-dialog,body:not(.graphiql-light) .graphiql-dialog-overlay,body:not(.graphiql-light) .graphiql-tooltip,body:not(.graphiql-light) [data-radix-popper-content-wrapper]{--color-primary: 338, 100%, 67%;--color-secondary: 243, 100%, 77%;--color-tertiary: 188, 100%, 44%;--color-info: 208, 100%, 72%;--color-success: 158, 100%, 42%;--color-warning: 30, 100%, 80%;--color-error: 13, 100%, 58%;--color-neutral: 219, 29%, 78%;--color-base: 219, 29%, 18%;--popover-box-shadow: none;--popover-border: 1px solid hsl(var(--color-neutral))}}body.graphiql-dark .graphiql-container,body.graphiql-dark .CodeMirror-info,body.graphiql-dark .CodeMirror-lint-tooltip,body.graphiql-dark .graphiql-dialog,body.graphiql-dark .graphiql-dialog-overlay,body.graphiql-dark .graphiql-tooltip,body.graphiql-dark [data-radix-popper-content-wrapper]{--color-primary: 338, 100%, 67%;--color-secondary: 243, 100%, 77%;--color-tertiary: 188, 100%, 44%;--color-info: 208, 100%, 72%;--color-success: 158, 100%, 42%;--color-warning: 30, 100%, 80%;--color-error: 13, 100%, 58%;--color-neutral: 219, 29%, 78%;--color-base: 219, 29%, 18%;--popover-box-shadow: none;--popover-border: 1px solid hsl(var(--color-neutral))}.graphiql-container,.CodeMirror-info,.CodeMirror-lint-tooltip,.graphiql-dialog,.graphiql-container:is(button),.CodeMirror-info:is(button),.CodeMirror-lint-tooltip:is(button),.graphiql-dialog:is(button){color:hsla(var(--color-neutral),1);font-family:var(--font-family);font-size:var(--font-size-body);font-weight:var(----font-weight-regular);line-height:var(--line-height)}.graphiql-container input,.CodeMirror-info input,.CodeMirror-lint-tooltip input,.graphiql-dialog input{color:hsla(var(--color-neutral),1);font-family:var(--font-family);font-size:var(--font-size-caption)}.graphiql-container input::placeholder,.CodeMirror-info input::placeholder,.CodeMirror-lint-tooltip input::placeholder,.graphiql-dialog input::placeholder{color:hsla(var(--color-neutral),var(--alpha-secondary))}.graphiql-container a,.CodeMirror-info a,.CodeMirror-lint-tooltip a,.graphiql-dialog a{color:hsl(var(--color-primary))}.graphiql-container a:focus,.CodeMirror-info a:focus,.CodeMirror-lint-tooltip a:focus,.graphiql-dialog a:focus{outline:hsl(var(--color-primary)) auto 1px}.graphiql-un-styled,button.graphiql-un-styled{all:unset;border-radius:var(--border-radius-4);cursor:pointer}:is(.graphiql-un-styled,button.graphiql-un-styled):hover{background-color:hsla(var(--color-neutral),var(--alpha-background-light))}:is(.graphiql-un-styled,button.graphiql-un-styled):active{background-color:hsla(var(--color-neutral),var(--alpha-background-medium))}:is(.graphiql-un-styled,button.graphiql-un-styled):focus{outline:hsla(var(--color-neutral),var(--alpha-background-heavy)) auto 1px}.graphiql-button,button.graphiql-button{background-color:hsla(var(--color-neutral),var(--alpha-background-light));border:none;border-radius:var(--border-radius-4);color:hsla(var(--color-neutral),1);cursor:pointer;font-size:var(--font-size-body);padding:var(--px-8) var(--px-12)}:is(.graphiql-button,button.graphiql-button):hover,:is(.graphiql-button,button.graphiql-button):active{background-color:hsla(var(--color-neutral),var(--alpha-background-medium))}:is(.graphiql-button,button.graphiql-button):focus{outline:hsla(var(--color-neutral),var(--alpha-background-heavy)) auto 1px}.graphiql-button-success:is(.graphiql-button,button.graphiql-button){background-color:hsla(var(--color-success),var(--alpha-background-heavy))}.graphiql-button-error:is(.graphiql-button,button.graphiql-button){background-color:hsla(var(--color-error),var(--alpha-background-heavy))}.graphiql-button-group{background-color:hsla(var(--color-neutral),var(--alpha-background-light));border-radius:calc(var(--border-radius-4) + var(--px-4));display:flex;padding:var(--px-4)}.graphiql-button-group>button.graphiql-button{background-color:transparent}.graphiql-button-group>button.graphiql-button:hover{background-color:hsla(var(--color-neutral),var(--alpha-background-light))}.graphiql-button-group>button.graphiql-button.active{background-color:hsl(var(--color-base));cursor:default}.graphiql-button-group>*+*{margin-left:var(--px-8)}.graphiql-dialog-overlay{position:fixed;inset:0;background-color:hsla(var(--color-neutral),var(--alpha-background-heavy));z-index:10}.graphiql-dialog{background-color:hsl(var(--color-base));border:var(--popover-border);border-radius:var(--border-radius-12);box-shadow:var(--popover-box-shadow);margin:0;max-height:80vh;max-width:80vw;overflow:auto;padding:0;width:unset;transform:translate(-50%,-50%);top:50%;left:50%;position:fixed;z-index:10}.graphiql-dialog-close>svg{color:hsla(var(--color-neutral),var(--alpha-secondary));display:block;height:var(--px-12);padding:var(--px-12);width:var(--px-12)}.graphiql-dropdown-content{background-color:hsl(var(--color-base));border:var(--popover-border);border-radius:var(--border-radius-8);box-shadow:var(--popover-box-shadow);font-size:inherit;max-width:250px;padding:var(--px-4);font-family:var(--font-family);color:hsl(var(--color-neutral));max-height:min(calc(var(--radix-dropdown-menu-content-available-height) - 10px),400px);overflow-y:scroll}.graphiql-dropdown-item{border-radius:var(--border-radius-4);font-size:inherit;margin:var(--px-4);overflow:hidden;padding:var(--px-6) var(--px-8);text-overflow:ellipsis;white-space:nowrap;outline:none;cursor:pointer;line-height:var(--line-height)}.graphiql-dropdown-item[data-selected],.graphiql-dropdown-item[data-current-nav],.graphiql-dropdown-item:hover{background-color:hsla(var(--color-neutral),var(--alpha-background-light));color:inherit}.graphiql-dropdown-item:not(:first-child){margin-top:0}:is(.graphiql-markdown-description,.graphiql-markdown-deprecation,.CodeMirror-hint-information-description,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-description,.CodeMirror-info .info-deprecation) blockquote{margin-left:0;margin-right:0;padding-left:var(--px-8)}:is(.graphiql-markdown-description,.graphiql-markdown-deprecation,.CodeMirror-hint-information-description,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-description,.CodeMirror-info .info-deprecation) code,:is(.graphiql-markdown-description,.graphiql-markdown-deprecation,.CodeMirror-hint-information-description,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-description,.CodeMirror-info .info-deprecation) pre{border-radius:var(--border-radius-4);font-family:var(--font-family-mono);font-size:var(--font-size-inline-code)}:is(.graphiql-markdown-description,.graphiql-markdown-deprecation,.CodeMirror-hint-information-description,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-description,.CodeMirror-info .info-deprecation) code{padding:var(--px-2)}:is(.graphiql-markdown-description,.graphiql-markdown-deprecation,.CodeMirror-hint-information-description,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-description,.CodeMirror-info .info-deprecation) pre{overflow:auto;padding:var(--px-6) var(--px-8)}:is(.graphiql-markdown-description,.graphiql-markdown-deprecation,.CodeMirror-hint-information-description,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-description,.CodeMirror-info .info-deprecation) pre code{background-color:initial;border-radius:0;padding:0}:is(.graphiql-markdown-description,.graphiql-markdown-deprecation,.CodeMirror-hint-information-description,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-description,.CodeMirror-info .info-deprecation) ol,:is(.graphiql-markdown-description,.graphiql-markdown-deprecation,.CodeMirror-hint-information-description,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-description,.CodeMirror-info .info-deprecation) ul{padding-left:var(--px-16)}:is(.graphiql-markdown-description,.graphiql-markdown-deprecation,.CodeMirror-hint-information-description,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-description,.CodeMirror-info .info-deprecation) ol{list-style-type:decimal}:is(.graphiql-markdown-description,.graphiql-markdown-deprecation,.CodeMirror-hint-information-description,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-description,.CodeMirror-info .info-deprecation) ul{list-style-type:disc}:is(.graphiql-markdown-description,.graphiql-markdown-deprecation,.CodeMirror-hint-information-description,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-description,.CodeMirror-info .info-deprecation) img{border-radius:var(--border-radius-4);max-height:120px;max-width:100%}:is(.graphiql-markdown-description,.graphiql-markdown-deprecation,.CodeMirror-hint-information-description,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-description,.CodeMirror-info .info-deprecation)>:first-child{margin-top:0}:is(.graphiql-markdown-description,.graphiql-markdown-deprecation,.CodeMirror-hint-information-description,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-description,.CodeMirror-info .info-deprecation)>:last-child{margin-bottom:0}:is(.graphiql-markdown-description,.CodeMirror-hint-information-description,.CodeMirror-info .info-description) a{color:hsl(var(--color-primary));text-decoration:none}:is(.graphiql-markdown-description,.CodeMirror-hint-information-description,.CodeMirror-info .info-description) a:hover{text-decoration:underline}:is(.graphiql-markdown-description,.CodeMirror-hint-information-description,.CodeMirror-info .info-description) blockquote{border-left:1.5px solid hsla(var(--color-neutral),var(--alpha-tertiary))}:is(.graphiql-markdown-description,.CodeMirror-hint-information-description,.CodeMirror-info .info-description) code,:is(.graphiql-markdown-description,.CodeMirror-hint-information-description,.CodeMirror-info .info-description) pre{background-color:hsla(var(--color-neutral),var(--alpha-background-light));color:hsla(var(--color-neutral),1)}:is(.graphiql-markdown-description,.CodeMirror-hint-information-description,.CodeMirror-info .info-description)>*{margin:var(--px-12) 0}:is(.graphiql-markdown-deprecation,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-deprecation) a{color:hsl(var(--color-warning));text-decoration:underline}:is(.graphiql-markdown-deprecation,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-deprecation) blockquote{border-left:1.5px solid hsl(var(--color-warning))}:is(.graphiql-markdown-deprecation,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-deprecation) code,:is(.graphiql-markdown-deprecation,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-deprecation) pre{background-color:hsla(var(--color-warning),var(--alpha-background-heavy))}:is(.graphiql-markdown-deprecation,.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-deprecation)>*{margin:var(--px-8) 0}.graphiql-markdown-preview>:not(:first-child){display:none}.CodeMirror-hint-information-deprecation,.CodeMirror-info .info-deprecation{background-color:hsla(var(--color-warning),var(--alpha-background-light));border:1px solid hsl(var(--color-warning));border-radius:var(--border-radius-4);color:hsl(var(--color-warning));margin-top:var(--px-12);padding:var(--px-6) var(--px-8)}.CodeMirror-hint-information-deprecation-label,.CodeMirror-info .info-deprecation-label{font-size:var(--font-size-hint);font-weight:var(--font-weight-medium)}.CodeMirror-hint-information-deprecation-reason,.CodeMirror-info .info-deprecation-reason{margin-top:var(--px-6)}.graphiql-spinner{height:56px;margin:auto;margin-top:var(--px-16);width:56px}.graphiql-spinner:after{animation:rotation .8s linear 0s infinite;border:4px solid transparent;border-radius:100%;border-top:4px solid hsla(var(--color-neutral),var(--alpha-tertiary));content:"";display:inline-block;height:46px;vertical-align:middle;width:46px}@keyframes rotation{0%{transform:rotate(0)}to{transform:rotate(360deg)}}.graphiql-tooltip{background:hsl(var(--color-base));border:var(--popover-border);border-radius:var(--border-radius-4);box-shadow:var(--popover-box-shadow);color:hsl(var(--color-neutral));font-size:inherit;padding:var(--px-4) var(--px-6);font-family:var(--font-family)}.graphiql-tabs{display:flex;align-items:center;overflow-x:auto;padding:var(--px-12)}.graphiql-tabs>:not(:first-child){margin-left:var(--px-12)}.graphiql-tab{align-items:stretch;border-radius:var(--border-radius-8);color:hsla(var(--color-neutral),var(--alpha-secondary));display:flex}.graphiql-tab>button.graphiql-tab-close{visibility:hidden}.graphiql-tab.graphiql-tab-active>button.graphiql-tab-close,.graphiql-tab:hover>button.graphiql-tab-close,.graphiql-tab:focus-within>button.graphiql-tab-close{visibility:unset}.graphiql-tab.graphiql-tab-active{background-color:hsla(var(--color-neutral),var(--alpha-background-heavy));color:hsla(var(--color-neutral),1)}button.graphiql-tab-button{padding:var(--px-4) 0 var(--px-4) var(--px-8)}button.graphiql-tab-close{align-items:center;display:flex;padding:var(--px-4) var(--px-8)}button.graphiql-tab-close>svg{height:var(--px-8);width:var(--px-8)}.graphiql-history-header{font-size:var(--font-size-h2);font-weight:var(--font-weight-medium);display:flex;justify-content:space-between;align-items:center}.graphiql-history-header button{font-size:var(--font-size-inline-code);padding:var(--px-6) var(--px-10)}.graphiql-history-items{margin:var(--px-16) 0 0;list-style:none;padding:0}.graphiql-history-item{border-radius:var(--border-radius-4);color:hsla(var(--color-neutral),var(--alpha-secondary));display:flex;font-size:var(--font-size-inline-code);font-family:var(--font-family-mono);height:34px}.graphiql-history-item:hover{color:hsla(var(--color-neutral),1);background-color:hsla(var(--color-neutral),var(--alpha-background-light))}.graphiql-history-item:not(:first-child){margin-top:var(--px-4)}.graphiql-history-item.editable{background-color:hsla(var(--color-primary),var(--alpha-background-medium))}.graphiql-history-item.editable>input{background:transparent;border:none;flex:1;margin:0;outline:none;padding:0 var(--px-10);width:100%}.graphiql-history-item.editable>input::placeholder{color:hsla(var(--color-neutral),var(--alpha-secondary))}.graphiql-history-item.editable>button{color:hsl(var(--color-primary));padding:0 var(--px-10)}.graphiql-history-item.editable>button:active{background-color:hsla(var(--color-primary),var(--alpha-background-heavy))}.graphiql-history-item.editable>button:focus{outline:hsl(var(--color-primary)) auto 1px}.graphiql-history-item.editable>button>svg{display:block}button.graphiql-history-item-label{flex:1;padding:var(--px-8) var(--px-10);overflow:hidden;text-overflow:ellipsis;white-space:nowrap}button.graphiql-history-item-action{align-items:center;color:hsla(var(--color-neutral),var(--alpha-secondary));display:flex;padding:var(--px-8) var(--px-6)}button.graphiql-history-item-action:hover{color:hsla(var(--color-neutral),1)}button.graphiql-history-item-action>svg{height:14px;width:14px}.graphiql-history-item-spacer{height:var(--px-16)}.graphiql-doc-explorer-default-value{color:hsl(var(--color-success))}a.graphiql-doc-explorer-type-name{color:hsl(var(--color-warning));text-decoration:none}a.graphiql-doc-explorer-type-name:hover{text-decoration:underline}a.graphiql-doc-explorer-type-name:focus{outline:hsl(var(--color-warning)) auto 1px}.graphiql-doc-explorer-argument>*+*{margin-top:var(--px-12)}.graphiql-doc-explorer-argument-name{color:hsl(var(--color-secondary))}.graphiql-doc-explorer-argument-deprecation{background-color:hsla(var(--color-warning),var(--alpha-background-light));border:1px solid hsl(var(--color-warning));border-radius:var(--border-radius-4);color:hsl(var(--color-warning));padding:var(--px-8)}.graphiql-doc-explorer-argument-deprecation-label{font-size:var(--font-size-hint);font-weight:var(--font-weight-medium)}.graphiql-doc-explorer-deprecation{background-color:hsla(var(--color-warning),var(--alpha-background-light));border:1px solid hsl(var(--color-warning));border-radius:var(--px-4);color:hsl(var(--color-warning));padding:var(--px-8)}.graphiql-doc-explorer-deprecation-label{font-size:var(--font-size-hint);font-weight:var(--font-weight-medium)}.graphiql-doc-explorer-directive{color:hsl(var(--color-secondary))}.graphiql-doc-explorer-section-title{align-items:center;display:flex;font-size:var(--font-size-hint);font-weight:var(--font-weight-medium);line-height:1}.graphiql-doc-explorer-section-title>svg{height:var(--px-16);margin-right:var(--px-8);width:var(--px-16)}.graphiql-doc-explorer-section-content{margin-left:var(--px-8);margin-top:var(--px-16)}.graphiql-doc-explorer-section-content>*+*{margin-top:var(--px-16)}.graphiql-doc-explorer-root-type{color:hsl(var(--color-info))}.graphiql-doc-explorer-search{color:hsla(var(--color-neutral),var(--alpha-secondary))}.graphiql-doc-explorer-search:not([data-state="idle"]){border:var(--popover-border);border-radius:var(--border-radius-4);box-shadow:var(--popover-box-shadow);color:hsla(var(--color-neutral),1)}.graphiql-doc-explorer-search:not([data-state="idle"]) .graphiql-doc-explorer-search-input{background:hsl(var(--color-base))}.graphiql-doc-explorer-search-input{align-items:center;background-color:hsla(var(--color-neutral),var(--alpha-background-light));border-radius:var(--border-radius-4);display:flex;padding:var(--px-8) var(--px-12)}.graphiql-doc-explorer-search [role=combobox]{border:none;background-color:transparent;margin-left:var(--px-4);width:100%}.graphiql-doc-explorer-search [role=combobox]:focus{outline:none}.graphiql-doc-explorer-search [role=listbox]{background-color:hsl(var(--color-base));border:none;border-bottom-left-radius:var(--border-radius-4);border-bottom-right-radius:var(--border-radius-4);border-top:1px solid hsla(var(--color-neutral),var(--alpha-background-heavy));max-height:400px;overflow-y:auto;margin:0;font-size:var(--font-size-body);padding:var(--px-4);position:relative}.graphiql-doc-explorer-search [role=option]{border-radius:var(--border-radius-4);color:hsla(var(--color-neutral),var(--alpha-secondary));overflow-x:hidden;padding:var(--px-8) var(--px-12);text-overflow:ellipsis;white-space:nowrap;cursor:pointer}.graphiql-doc-explorer-search [role=option][data-headlessui-state=active]{background-color:hsla(var(--color-neutral),var(--alpha-background-light))}.graphiql-doc-explorer-search [role=option]:hover{background-color:hsla(var(--color-neutral),var(--alpha-background-medium))}.graphiql-doc-explorer-search [role=option][data-headlessui-state=active]:hover{background-color:hsla(var(--color-neutral),var(--alpha-background-heavy))}:is(.graphiql-doc-explorer-search [role="option"])+:is(.graphiql-doc-explorer-search [role="option"]){margin-top:var(--px-4)}.graphiql-doc-explorer-search-type{color:hsl(var(--color-info))}.graphiql-doc-explorer-search-field{color:hsl(var(--color-warning))}.graphiql-doc-explorer-search-argument{color:hsl(var(--color-secondary))}.graphiql-doc-explorer-search-divider{color:hsla(var(--color-neutral),var(--alpha-secondary));font-size:var(--font-size-hint);font-weight:var(--font-weight-medium);margin-top:var(--px-8);padding:var(--px-8) var(--px-12)}.graphiql-doc-explorer-search-empty{color:hsla(var(--color-neutral),var(--alpha-secondary));padding:var(--px-8) var(--px-12)}a.graphiql-doc-explorer-field-name{color:hsl(var(--color-info));text-decoration:none}a.graphiql-doc-explorer-field-name:hover{text-decoration:underline}a.graphiql-doc-explorer-field-name:focus{outline:hsl(var(--color-info)) auto 1px}.graphiql-doc-explorer-item>:not(:first-child){margin-top:var(--px-12)}.graphiql-doc-explorer-argument-multiple{margin-left:var(--px-8)}.graphiql-doc-explorer-enum-value{color:hsl(var(--color-info))}.graphiql-doc-explorer-header{display:flex;justify-content:space-between;position:relative}.graphiql-doc-explorer-header:focus-within .graphiql-doc-explorer-title{visibility:hidden}.graphiql-doc-explorer-header:focus-within .graphiql-doc-explorer-back:not(:focus){color:transparent}.graphiql-doc-explorer-header-content{display:flex;flex-direction:column;min-width:0}.graphiql-doc-explorer-search{position:absolute;right:0;top:0}.graphiql-doc-explorer-search:focus-within{left:0}.graphiql-doc-explorer-search [role=combobox]{height:24px;width:4ch}.graphiql-doc-explorer-search [role=combobox]:focus{width:100%}a.graphiql-doc-explorer-back{align-items:center;color:hsla(var(--color-neutral),var(--alpha-secondary));display:flex;text-decoration:none}a.graphiql-doc-explorer-back:hover{text-decoration:underline}a.graphiql-doc-explorer-back:focus{outline:hsla(var(--color-neutral),var(--alpha-secondary)) auto 1px}a.graphiql-doc-explorer-back:focus+.graphiql-doc-explorer-title{visibility:unset}a.graphiql-doc-explorer-back>svg{height:var(--px-8);margin-right:var(--px-8);width:var(--px-8)}.graphiql-doc-explorer-title{font-weight:var(--font-weight-medium);font-size:var(--font-size-h2);overflow-x:hidden;text-overflow:ellipsis;white-space:nowrap}.graphiql-doc-explorer-title:not(:first-child){font-size:var(--font-size-h3);margin-top:var(--px-8)}.graphiql-doc-explorer-content>*{color:hsla(var(--color-neutral),var(--alpha-secondary));margin-top:var(--px-20)}.graphiql-doc-explorer-error{background-color:hsla(var(--color-error),var(--alpha-background-heavy));border:1px solid hsl(var(--color-error));border-radius:var(--border-radius-8);color:hsl(var(--color-error));padding:var(--px-8) var(--px-12)}.CodeMirror{font-family:monospace;height:300px;color:#000;direction:ltr}.CodeMirror-lines{padding:4px 0}.CodeMirror pre.CodeMirror-line,.CodeMirror pre.CodeMirror-line-like{padding:0 4px}.CodeMirror-scrollbar-filler,.CodeMirror-gutter-filler{background-color:#fff}.CodeMirror-gutters{border-right:1px solid #ddd;background-color:#f7f7f7;white-space:nowrap}.CodeMirror-linenumber{padding:0 3px 0 5px;min-width:20px;text-align:right;color:#999;white-space:nowrap}.CodeMirror-guttermarker{color:#000}.CodeMirror-guttermarker-subtle{color:#999}.CodeMirror-cursor{border-left:1px solid black;border-right:none;width:0}.CodeMirror div.CodeMirror-secondarycursor{border-left:1px solid silver}.cm-fat-cursor .CodeMirror-cursor{width:auto;border:0!important;background:#7e7}.cm-fat-cursor div.CodeMirror-cursors{z-index:1}.cm-fat-cursor .CodeMirror-line::selection,.cm-fat-cursor .CodeMirror-line>span::selection,.cm-fat-cursor .CodeMirror-line>span>span::selection{background:transparent}.cm-fat-cursor .CodeMirror-line::-moz-selection,.cm-fat-cursor .CodeMirror-line>span::-moz-selection,.cm-fat-cursor .CodeMirror-line>span>span::-moz-selection{background:transparent}.cm-fat-cursor{caret-color:transparent}@-moz-keyframes blink{50%{background-color:transparent}}@-webkit-keyframes blink{50%{background-color:transparent}}@keyframes blink{50%{background-color:transparent}}.cm-tab{display:inline-block;text-decoration:inherit}.CodeMirror-rulers{position:absolute;left:0;right:0;top:-50px;bottom:0;overflow:hidden}.CodeMirror-ruler{border-left:1px solid #ccc;top:0;bottom:0;position:absolute}.cm-s-default .cm-header{color:#00f}.cm-s-default .cm-quote{color:#090}.cm-negative{color:#d44}.cm-positive{color:#292}.cm-header,.cm-strong{font-weight:700}.cm-em{font-style:italic}.cm-link{text-decoration:underline}.cm-strikethrough{text-decoration:line-through}.cm-s-default .cm-keyword{color:#708}.cm-s-default .cm-atom{color:#219}.cm-s-default .cm-number{color:#164}.cm-s-default .cm-def{color:#00f}.cm-s-default .cm-variable-2{color:#05a}.cm-s-default .cm-variable-3,.cm-s-default .cm-type{color:#085}.cm-s-default .cm-comment{color:#a50}.cm-s-default .cm-string{color:#a11}.cm-s-default .cm-string-2{color:#f50}.cm-s-default .cm-meta,.cm-s-default .cm-qualifier{color:#555}.cm-s-default .cm-builtin{color:#30a}.cm-s-default .cm-bracket{color:#997}.cm-s-default .cm-tag{color:#170}.cm-s-default .cm-attribute{color:#00c}.cm-s-default .cm-hr{color:#999}.cm-s-default .cm-link{color:#00c}.cm-s-default .cm-error,.cm-invalidchar{color:red}.CodeMirror-composing{border-bottom:2px solid}div.CodeMirror span.CodeMirror-matchingbracket{color:#0b0}div.CodeMirror span.CodeMirror-nonmatchingbracket{color:#a22}.CodeMirror-matchingtag{background:rgba(255,150,0,.3)}.CodeMirror-activeline-background{background:#e8f2ff}.CodeMirror{position:relative;overflow:hidden;background:white}.CodeMirror-scroll{overflow:scroll!important;margin-bottom:-50px;margin-right:-50px;padding-bottom:50px;height:100%;outline:none;position:relative;z-index:0}.CodeMirror-sizer{position:relative;border-right:50px solid transparent}.CodeMirror-vscrollbar,.CodeMirror-hscrollbar,.CodeMirror-scrollbar-filler,.CodeMirror-gutter-filler{position:absolute;z-index:6;display:none;outline:none}.CodeMirror-vscrollbar{right:0;top:0;overflow-x:hidden;overflow-y:scroll}.CodeMirror-hscrollbar{bottom:0;left:0;overflow-y:hidden;overflow-x:scroll}.CodeMirror-scrollbar-filler{right:0;bottom:0}.CodeMirror-gutter-filler{left:0;bottom:0}.CodeMirror-gutters{position:absolute;left:0;top:0;min-height:100%;z-index:3}.CodeMirror-gutter{white-space:normal;height:100%;display:inline-block;vertical-align:top;margin-bottom:-50px}.CodeMirror-gutter-wrapper{position:absolute;z-index:4;background:none!important;border:none!important}.CodeMirror-gutter-background{position:absolute;top:0;bottom:0;z-index:4}.CodeMirror-gutter-elt{position:absolute;cursor:default;z-index:4}.CodeMirror-gutter-wrapper ::selection{background-color:transparent}.CodeMirror-gutter-wrapper ::-moz-selection{background-color:transparent}.CodeMirror-lines{cursor:text;min-height:1px}.CodeMirror pre.CodeMirror-line,.CodeMirror pre.CodeMirror-line-like{-moz-border-radius:0;-webkit-border-radius:0;border-radius:0;border-width:0;background:transparent;font-family:inherit;font-size:inherit;margin:0;white-space:pre;word-wrap:normal;line-height:inherit;color:inherit;z-index:2;position:relative;overflow:visible;-webkit-tap-highlight-color:transparent;-webkit-font-variant-ligatures:contextual;font-variant-ligatures:contextual}.CodeMirror-wrap pre.CodeMirror-line,.CodeMirror-wrap pre.CodeMirror-line-like{word-wrap:break-word;white-space:pre-wrap;word-break:normal}.CodeMirror-linebackground{position:absolute;left:0;right:0;top:0;bottom:0;z-index:0}.CodeMirror-linewidget{position:relative;z-index:2;padding:.1px}.CodeMirror-rtl pre{direction:rtl}.CodeMirror-code{outline:none}.CodeMirror-scroll,.CodeMirror-sizer,.CodeMirror-gutter,.CodeMirror-gutters,.CodeMirror-linenumber{-moz-box-sizing:content-box;box-sizing:content-box}.CodeMirror-measure{position:absolute;width:100%;height:0;overflow:hidden;visibility:hidden}.CodeMirror-cursor{position:absolute;pointer-events:none}.CodeMirror-measure pre{position:static}div.CodeMirror-cursors{visibility:hidden;position:relative;z-index:3}div.CodeMirror-dragcursors,.CodeMirror-focused div.CodeMirror-cursors{visibility:visible}.CodeMirror-selected{background:#d9d9d9}.CodeMirror-focused .CodeMirror-selected{background:#d7d4f0}.CodeMirror-crosshair{cursor:crosshair}.CodeMirror-line::selection,.CodeMirror-line>span::selection,.CodeMirror-line>span>span::selection{background:#d7d4f0}.CodeMirror-line::-moz-selection,.CodeMirror-line>span::-moz-selection,.CodeMirror-line>span>span::-moz-selection{background:#d7d4f0}.cm-searching{background-color:#ffa;background-color:#ff06}.cm-force-border{padding-right:.1px}@media print{.CodeMirror div.CodeMirror-cursors{visibility:hidden}}.cm-tab-wrap-hack:after{content:""}span.CodeMirror-selectedtext{background:none}.graphiql-container .CodeMirror{height:100%;position:absolute;width:100%}.graphiql-container .CodeMirror{font-family:var(--font-family-mono)}.graphiql-container .CodeMirror,.graphiql-container .CodeMirror-gutters{background:none;background-color:var(--editor-background, hsl(var(--color-base)))}.graphiql-container .CodeMirror-linenumber{padding:0}.graphiql-container .CodeMirror-gutters{border:none}.cm-s-graphiql{color:hsla(var(--color-neutral),var(--alpha-tertiary))}.cm-s-graphiql .cm-keyword{color:hsl(var(--color-primary))}.cm-s-graphiql .cm-def{color:hsl(var(--color-tertiary))}.cm-s-graphiql .cm-punctuation{color:hsla(var(--color-neutral),var(--alpha-tertiary))}.cm-s-graphiql .cm-variable{color:hsl(var(--color-secondary))}.cm-s-graphiql .cm-atom{color:hsl(var(--color-tertiary))}.cm-s-graphiql .cm-number{color:hsl(var(--color-success))}.cm-s-graphiql .cm-string{color:hsl(var(--color-warning))}.cm-s-graphiql .cm-builtin{color:hsl(var(--color-success))}.cm-s-graphiql .cm-string-2{color:hsl(var(--color-secondary))}.cm-s-graphiql .cm-attribute,.cm-s-graphiql .cm-meta{color:hsl(var(--color-tertiary))}.cm-s-graphiql .cm-property{color:hsl(var(--color-info))}.cm-s-graphiql .cm-qualifier{color:hsl(var(--color-secondary))}.cm-s-graphiql .cm-comment{color:hsla(var(--color-neutral),var(--alpha-secondary))}.cm-s-graphiql .cm-ws{color:hsla(var(--color-neutral),var(--alpha-tertiary))}.cm-s-graphiql .cm-invalidchar{color:hsl(var(--color-error))}.cm-s-graphiql .CodeMirror-cursor{border-left:2px solid hsla(var(--color-neutral),var(--alpha-secondary))}.cm-s-graphiql .CodeMirror-linenumber{color:hsla(var(--color-neutral),var(--alpha-tertiary))}.graphiql-container div.CodeMirror span.CodeMirror-matchingbracket,.graphiql-container div.CodeMirror span.CodeMirror-nonmatchingbracket{color:hsl(var(--color-warning))}.graphiql-container .CodeMirror-selected,.graphiql-container .CodeMirror-focused .CodeMirror-selected{background:hsla(var(--color-neutral),var(--alpha-background-heavy))}.graphiql-container .CodeMirror-dialog{background:inherit;color:inherit;left:0;right:0;overflow:hidden;padding:var(--px-2) var(--px-6);position:absolute;z-index:6}.graphiql-container .CodeMirror-dialog-top{border-bottom:1px solid hsla(var(--color-neutral),var(--alpha-background-heavy));padding-bottom:var(--px-12);top:0}.graphiql-container .CodeMirror-dialog-bottom{border-top:1px solid hsla(var(--color-neutral),var(--alpha-background-heavy));bottom:0;padding-top:var(--px-12)}.graphiql-container .CodeMirror-search-hint{display:none}.graphiql-container .CodeMirror-dialog input{border:1px solid hsla(var(--color-neutral),var(--alpha-background-heavy));border-radius:var(--border-radius-4);padding:var(--px-4)}.graphiql-container .CodeMirror-dialog input:focus{outline:hsl(var(--color-primary)) solid 2px}.graphiql-container .cm-searching{background-color:hsla(var(--color-warning),var(--alpha-background-light));padding-bottom:1.5px;padding-top:.5px}.CodeMirror-foldmarker{color:#00f;text-shadow:#b9f 1px 1px 2px,#b9f -1px -1px 2px,#b9f 1px -1px 2px,#b9f -1px 1px 2px;font-family:arial;line-height:.3;cursor:pointer}.CodeMirror-foldgutter{width:.7em}.CodeMirror-foldgutter-open,.CodeMirror-foldgutter-folded{cursor:pointer}.CodeMirror-foldgutter-open:after{content:"▾"}.CodeMirror-foldgutter-folded:after{content:"▸"}.CodeMirror-foldgutter{width:var(--px-12)}.CodeMirror-foldmarker{background-color:hsl(var(--color-info));border-radius:var(--border-radius-4);color:hsl(var(--color-base));font-family:inherit;margin:0 var(--px-4);padding:0 var(--px-8);text-shadow:none}.CodeMirror-foldgutter-open,.CodeMirror-foldgutter-folded{color:hsla(var(--color-neutral),var(--alpha-tertiary))}.CodeMirror-foldgutter-open:after,.CodeMirror-foldgutter-folded:after{margin:0 var(--px-2)}.graphiql-editor{height:100%;position:relative;width:100%}.graphiql-editor.hidden{left:-9999px;position:absolute;top:-9999px;visibility:hidden}.CodeMirror-lint-markers{width:16px}.CodeMirror-lint-tooltip{background-color:#ffd;border:1px solid black;border-radius:4px;color:#000;font-family:monospace;font-size:10pt;overflow:hidden;padding:2px 5px;position:fixed;white-space:pre;white-space:pre-wrap;z-index:100;max-width:600px;opacity:0;transition:opacity .4s;-moz-transition:opacity .4s;-webkit-transition:opacity .4s;-o-transition:opacity .4s;-ms-transition:opacity .4s}.CodeMirror-lint-mark{background-position:left bottom;background-repeat:repeat-x}.CodeMirror-lint-mark-warning{background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAQAAAADCAYAAAC09K7GAAAAAXNSR0IArs4c6QAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlzAAALEwAACxMBAJqcGAAAAAd0SU1FB9sJFhQXEbhTg7YAAAAZdEVYdENvbW1lbnQAQ3JlYXRlZCB3aXRoIEdJTVBXgQ4XAAAAMklEQVQI12NkgIIvJ3QXMjAwdDN+OaEbysDA4MPAwNDNwMCwiOHLCd1zX07o6kBVGQEAKBANtobskNMAAAAASUVORK5CYII=)}.CodeMirror-lint-mark-error{background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAQAAAADCAYAAAC09K7GAAAAAXNSR0IArs4c6QAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlzAAALEwAACxMBAJqcGAAAAAd0SU1FB9sJDw4cOCW1/KIAAAAZdEVYdENvbW1lbnQAQ3JlYXRlZCB3aXRoIEdJTVBXgQ4XAAAAHElEQVQI12NggIL/DAz/GdA5/xkY/qPKMDAwAADLZwf5rvm+LQAAAABJRU5ErkJggg==)}.CodeMirror-lint-marker{background-position:center center;background-repeat:no-repeat;cursor:pointer;display:inline-block;height:16px;width:16px;vertical-align:middle;position:relative}.CodeMirror-lint-message{padding-left:18px;background-position:top left;background-repeat:no-repeat}.CodeMirror-lint-marker-warning,.CodeMirror-lint-message-warning{background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQCAMAAAAoLQ9TAAAANlBMVEX/uwDvrwD/uwD/uwD/uwD/uwD/uwD/uwD/uwD6twD/uwAAAADurwD2tQD7uAD+ugAAAAD/uwDhmeTRAAAADHRSTlMJ8mN1EYcbmiixgACm7WbuAAAAVklEQVR42n3PUQqAIBBFUU1LLc3u/jdbOJoW1P08DA9Gba8+YWJ6gNJoNYIBzAA2chBth5kLmG9YUoG0NHAUwFXwO9LuBQL1giCQb8gC9Oro2vp5rncCIY8L8uEx5ZkAAAAASUVORK5CYII=)}.CodeMirror-lint-marker-error,.CodeMirror-lint-message-error{background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQCAMAAAAoLQ9TAAAAHlBMVEW7AAC7AACxAAC7AAC7AAAAAAC4AAC5AAD///+7AAAUdclpAAAABnRSTlMXnORSiwCK0ZKSAAAATUlEQVR42mWPOQ7AQAgDuQLx/z8csYRmPRIFIwRGnosRrpamvkKi0FTIiMASR3hhKW+hAN6/tIWhu9PDWiTGNEkTtIOucA5Oyr9ckPgAWm0GPBog6v4AAAAASUVORK5CYII=)}.CodeMirror-lint-marker-multiple{background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAcAAAAHCAMAAADzjKfhAAAACVBMVEUAAAAAAAC/v7914kyHAAAAAXRSTlMAQObYZgAAACNJREFUeNo1ioEJAAAIwmz/H90iFFSGJgFMe3gaLZ0od+9/AQZ0ADosbYraAAAAAElFTkSuQmCC);background-repeat:no-repeat;background-position:right bottom;width:100%;height:100%}.CodeMirror-lint-line-error{background-color:#b74c5114}.CodeMirror-lint-line-warning{background-color:#ffd3001a}.CodeMirror-lint-mark-error,.CodeMirror-lint-mark-warning{background-repeat:repeat-x;background-size:10px 3px;background-position:0 95%}.cm-s-graphiql .CodeMirror-lint-mark-error{color:hsl(var(--color-error))}.CodeMirror-lint-mark-error{background-image:linear-gradient(45deg,transparent 65%,hsl(var(--color-error)) 80%,transparent 90%),linear-gradient(135deg,transparent 5%,hsl(var(--color-error)) 15%,transparent 25%),linear-gradient(135deg,transparent 45%,hsl(var(--color-error)) 55%,transparent 65%),linear-gradient(45deg,transparent 25%,hsl(var(--color-error)) 35%,transparent 50%)}.cm-s-graphiql .CodeMirror-lint-mark-warning{color:hsl(var(--color-warning))}.CodeMirror-lint-mark-warning{background-image:linear-gradient(45deg,transparent 65%,hsl(var(--color-warning)) 80%,transparent 90%),linear-gradient(135deg,transparent 5%,hsl(var(--color-warning)) 15%,transparent 25%),linear-gradient(135deg,transparent 45%,hsl(var(--color-warning)) 55%,transparent 65%),linear-gradient(45deg,transparent 25%,hsl(var(--color-warning)) 35%,transparent 50%)}.CodeMirror-lint-tooltip{background-color:hsl(var(--color-base));border:var(--popover-border);border-radius:var(--border-radius-8);box-shadow:var(--popover-box-shadow);font-size:var(--font-size-body);font-family:var(--font-family);max-width:600px;overflow:hidden;padding:var(--px-12)}.CodeMirror-lint-message-error,.CodeMirror-lint-message-warning{background-image:none;padding:0}.CodeMirror-lint-message-error{color:hsl(var(--color-error))}.CodeMirror-lint-message-warning{color:hsl(var(--color-warning))}.CodeMirror-hints{position:absolute;z-index:10;overflow:hidden;list-style:none;margin:0;padding:2px;-webkit-box-shadow:2px 3px 5px rgba(0,0,0,.2);-moz-box-shadow:2px 3px 5px rgba(0,0,0,.2);box-shadow:2px 3px 5px #0003;border-radius:3px;border:1px solid silver;background:white;font-size:90%;font-family:monospace;max-height:20em;overflow-y:auto}.CodeMirror-hint{margin:0;padding:0 4px;border-radius:2px;white-space:pre;color:#000;cursor:pointer}li.CodeMirror-hint-active{background:#08f;color:#fff}.CodeMirror-hints{background:hsl(var(--color-base));border:var(--popover-border);border-radius:var(--border-radius-8);box-shadow:var(--popover-box-shadow);display:grid;font-family:var(--font-family);font-size:var(--font-size-body);grid-template-columns:auto fit-content(300px);max-height:264px;padding:0}.CodeMirror-hint{border-radius:var(--border-radius-4);color:hsla(var(--color-neutral),var(--alpha-secondary));grid-column:1 / 2;margin:var(--px-4);padding:var(--px-6) var(--px-8)!important}.CodeMirror-hint:not(:first-child){margin-top:0}li.CodeMirror-hint-active{background:hsla(var(--color-primary),var(--alpha-background-medium));color:hsl(var(--color-primary))}.CodeMirror-hint-information{border-left:1px solid hsla(var(--color-neutral),var(--alpha-background-heavy));grid-column:2 / 3;grid-row:1 / 99999;max-height:264px;overflow:auto;padding:var(--px-12)}.CodeMirror-hint-information-header{display:flex;align-items:baseline}.CodeMirror-hint-information-field-name{font-size:var(--font-size-h4);font-weight:var(--font-weight-medium)}.CodeMirror-hint-information-type-name-pill{border:1px solid hsla(var(--color-neutral),var(--alpha-tertiary));border-radius:var(--border-radius-4);color:hsla(var(--color-neutral),var(--alpha-secondary));margin-left:var(--px-6);padding:var(--px-4)}.CodeMirror-hint-information-type-name{color:inherit;text-decoration:none}.CodeMirror-hint-information-type-name:hover{text-decoration:underline dotted}.CodeMirror-hint-information-description{color:hsla(var(--color-neutral),var(--alpha-secondary));margin-top:var(--px-12)}.CodeMirror-info{background-color:hsl(var(--color-base));border:var(--popover-border);border-radius:var(--border-radius-8);box-shadow:var(--popover-box-shadow);color:hsla(var(--color-neutral),1);max-height:300px;max-width:400px;opacity:0;overflow:auto;padding:var(--px-12);position:fixed;transition:opacity .15s;z-index:10}.CodeMirror-info a{color:inherit;text-decoration:none}.CodeMirror-info a:hover{text-decoration:underline dotted}.CodeMirror-info .CodeMirror-info-header{display:flex;align-items:baseline}.CodeMirror-info .CodeMirror-info-header>.type-name,.CodeMirror-info .CodeMirror-info-header>.field-name,.CodeMirror-info .CodeMirror-info-header>.arg-name,.CodeMirror-info .CodeMirror-info-header>.directive-name,.CodeMirror-info .CodeMirror-info-header>.enum-value{font-size:var(--font-size-h4);font-weight:var(--font-weight-medium)}.CodeMirror-info .type-name-pill{border:1px solid hsla(var(--color-neutral),var(--alpha-tertiary));border-radius:var(--border-radius-4);color:hsla(var(--color-neutral),var(--alpha-secondary));margin-left:var(--px-6);padding:var(--px-4)}.CodeMirror-info .info-description{color:hsla(var(--color-neutral),var(--alpha-secondary));margin-top:var(--px-12);overflow:hidden}.CodeMirror-jump-token{text-decoration:underline dotted;cursor:pointer}.auto-inserted-leaf.cm-property{animation-duration:6s;animation-name:insertionFade;border-radius:var(--border-radius-4);padding:var(--px-2)}@keyframes insertionFade{0%,to{background-color:none}15%,85%{background-color:hsla(var(--color-warning),var(--alpha-background-light))}}button.graphiql-toolbar-button{display:flex;align-items:center;justify-content:center;height:var(--toolbar-width);width:var(--toolbar-width)}button.graphiql-toolbar-button.error{background:hsla(var(--color-error),var(--alpha-background-heavy))}.graphiql-execute-button-wrapper{position:relative}button.graphiql-execute-button{background-color:hsl(var(--color-primary));border:none;border-radius:var(--border-radius-8);cursor:pointer;height:var(--toolbar-width);padding:0;width:var(--toolbar-width)}button.graphiql-execute-button:hover{background-color:hsla(var(--color-primary),.9)}button.graphiql-execute-button:active{background-color:hsla(var(--color-primary),.8)}button.graphiql-execute-button:focus{outline:hsla(var(--color-primary),.8) auto 1px}button.graphiql-execute-button>svg{color:#fff;display:block;height:var(--px-16);margin:auto;width:var(--px-16)}button.graphiql-toolbar-menu{display:block;height:var(--toolbar-width);width:var(--toolbar-width)} + +/*!*********************************************************************************************************************!*\ + !*** css ../../../node_modules/css-loader/dist/cjs.js!../../../node_modules/postcss-loader/dist/cjs.js!./style.css ***! + \*********************************************************************************************************************/ +/* Everything */ +.graphiql-container { + background-color: hsl(var(--color-base)); + display: flex; + height: 100%; + margin: 0; + overflow: hidden; + width: 100%; +} +/* The sidebar */ +.graphiql-container .graphiql-sidebar { + display: flex; + flex-direction: column; + justify-content: space-between; + padding: var(--px-8); + width: var(--sidebar-width); +} +.graphiql-container .graphiql-sidebar .graphiql-sidebar-section { + display: flex; + flex-direction: column; + gap: var(--px-8); +} +.graphiql-container .graphiql-sidebar button { + display: flex; + align-items: center; + justify-content: center; + color: hsla(var(--color-neutral), var(--alpha-secondary)); + height: calc(var(--sidebar-width) - (2 * var(--px-8))); + width: calc(var(--sidebar-width) - (2 * var(--px-8))); +} +.graphiql-container .graphiql-sidebar button.active { + color: hsla(var(--color-neutral), 1); +} +.graphiql-container .graphiql-sidebar button:not(:first-child) { + margin-top: var(--px-4); +} +.graphiql-container .graphiql-sidebar button > svg { + height: var(--px-20); + width: var(--px-20); +} +/* The main content, i.e. everything except the sidebar */ +.graphiql-container .graphiql-main { + display: flex; + flex: 1; + min-width: 0; +} +/* The current session and tabs */ +.graphiql-container .graphiql-sessions { + background-color: hsla(var(--color-neutral), var(--alpha-background-light)); + /* Adding the 8px of padding to the inner border radius of the query editor */ + border-radius: calc(var(--border-radius-12) + var(--px-8)); + display: flex; + flex-direction: column; + flex: 1; + max-height: 100%; + margin: var(--px-16); + margin-left: 0; + min-width: 0; +} +/* The session header containing tabs and the logo */ +.graphiql-container .graphiql-session-header { + align-items: center; + display: flex; + justify-content: space-between; + height: var(--session-header-height); +} +/* The button to add a new tab */ +button.graphiql-tab-add { + height: 100%; + padding: var(--px-4); +} +button.graphiql-tab-add > svg { + color: hsla(var(--color-neutral), var(--alpha-secondary)); + display: block; + height: var(--px-16); + width: var(--px-16); +} +/* The right-hand-side of the session header */ +.graphiql-container .graphiql-session-header-right { + align-items: center; + display: flex; +} +/* The GraphiQL logo */ +.graphiql-container .graphiql-logo { + color: hsla(var(--color-neutral), var(--alpha-secondary)); + font-size: var(--font-size-h4); + font-weight: var(--font-weight-medium); + padding: var(--px-12) var(--px-16); +} +/* Undo default link styling for the default GraphiQL logo link */ +.graphiql-container .graphiql-logo .graphiql-logo-link { + color: hsla(var(--color-neutral), var(--alpha-secondary)); + text-decoration: none; +} +/* The editor of the session */ +.graphiql-container .graphiql-session { + display: flex; + flex: 1; + padding: 0 var(--px-8) var(--px-8); +} +/* All editors (query, variable, headers) */ +.graphiql-container .graphiql-editors { + background-color: hsl(var(--color-base)); + border-radius: calc(var(--border-radius-12)); + box-shadow: var(--popover-box-shadow); + display: flex; + flex: 1; + flex-direction: column; +} +.graphiql-container .graphiql-editors.full-height { + margin-top: calc(var(--px-8) - var(--session-header-height)); +} +/* The query editor and the toolbar */ +.graphiql-container .graphiql-query-editor { + border-bottom: 1px solid + hsla(var(--color-neutral), var(--alpha-background-heavy)); + padding: var(--px-16); + column-gap: var(--px-16); + display: flex; + width: 100%; +} +/* The vertical toolbar next to the query editor */ +.graphiql-container .graphiql-toolbar { + width: var(--toolbar-width); +} +.graphiql-container .graphiql-toolbar > * + * { + margin-top: var(--px-8); +} +/* The toolbar icons */ +.graphiql-toolbar-icon { + color: hsla(var(--color-neutral), var(--alpha-tertiary)); + display: block; + height: calc(var(--toolbar-width) - (var(--px-8) * 2)); + width: calc(var(--toolbar-width) - (var(--px-8) * 2)); +} +/* The tab bar for editor tools */ +.graphiql-container .graphiql-editor-tools { + cursor: row-resize; + display: flex; + width: 100%; + column-gap: var(--px-8); + padding: var(--px-8); +} +.graphiql-container .graphiql-editor-tools button { + color: hsla(var(--color-neutral), var(--alpha-secondary)); +} +.graphiql-container .graphiql-editor-tools button.active { + color: hsla(var(--color-neutral), 1); +} +/* The tab buttons to switch between editor tools */ +.graphiql-container + .graphiql-editor-tools + > button:not(.graphiql-toggle-editor-tools) { + padding: var(--px-8) var(--px-12); +} +.graphiql-container .graphiql-editor-tools .graphiql-toggle-editor-tools { + margin-left: auto; +} +/* An editor tool, e.g. variable or header editor */ +.graphiql-container .graphiql-editor-tool { + flex: 1; + padding: var(--px-16); +} +/** + * The way CodeMirror editors are styled they overflow their containing + * element. For some OS-browser-combinations this might cause overlap issues, + * setting the position of this to `relative` makes sure this element will + * always be on top of any editors. + */ +.graphiql-container .graphiql-toolbar, +.graphiql-container .graphiql-editor-tools, +.graphiql-container .graphiql-editor-tool { + position: relative; +} +/* The response view */ +.graphiql-container .graphiql-response { + --editor-background: transparent; + display: flex; + width: 100%; + flex-direction: column; +} +/* The results editor wrapping container */ +.graphiql-container .graphiql-response .result-window { + position: relative; + flex: 1; +} +/* The footer below the response view */ +.graphiql-container .graphiql-footer { + border-top: 1px solid + hsla(var(--color-neutral), var(--alpha-background-heavy)); +} +/* The plugin container */ +.graphiql-container .graphiql-plugin { + border-left: 1px solid + hsla(var(--color-neutral), var(--alpha-background-heavy)); + flex: 1; + overflow-y: auto; + padding: var(--px-16); +} +/* Generic drag bar for horizontal resizing */ +.graphiql-horizontal-drag-bar { + width: var(--px-12); + cursor: col-resize; +} +.graphiql-horizontal-drag-bar:hover::after { + border: var(--px-2) solid + hsla(var(--color-neutral), var(--alpha-background-heavy)); + border-radius: var(--border-radius-2); + content: ''; + display: block; + height: 25%; + margin: 0 auto; + position: relative; + /* (100% - 25%) / 2 = 37.5% */ + top: 37.5%; + width: 0; +} +.graphiql-container .graphiql-chevron-icon { + color: hsla(var(--color-neutral), var(--alpha-tertiary)); + display: block; + height: var(--px-12); + margin: var(--px-12); + width: var(--px-12); +} +/* Generic spin animation */ +.graphiql-spin { + animation: spin 0.8s linear 0s infinite; +} +@keyframes spin { + from { + transform: rotate(0deg); + } + to { + transform: rotate(360deg); + } +} +/* The header of the settings dialog */ +.graphiql-dialog .graphiql-dialog-header { + align-items: center; + display: flex; + justify-content: space-between; + padding: var(--px-24); +} +/* The title of the settings dialog */ +.graphiql-dialog .graphiql-dialog-title { + font-size: var(--font-size-h3); + font-weight: var(--font-weight-medium); + margin: 0; +} +/* A section inside the settings dialog */ +.graphiql-dialog .graphiql-dialog-section { + align-items: center; + border-top: 1px solid + hsla(var(--color-neutral), var(--alpha-background-heavy)); + display: flex; + justify-content: space-between; + padding: var(--px-24); +} +.graphiql-dialog .graphiql-dialog-section > :not(:first-child) { + margin-left: var(--px-24); +} +/* The section title in the settings dialog */ +.graphiql-dialog .graphiql-dialog-section-title { + font-size: var(--font-size-h4); + font-weight: var(--font-weight-medium); +} +/* The section caption in the settings dialog */ +.graphiql-dialog .graphiql-dialog-section-caption { + color: hsla(var(--color-neutral), var(--alpha-secondary)); +} +.graphiql-dialog .graphiql-warning-text { + color: hsl(var(--color-warning)); + font-weight: var(--font-weight-medium); +} +.graphiql-dialog .graphiql-table { + border-collapse: collapse; + width: 100%; +} +.graphiql-dialog .graphiql-table :is(th, td) { + border: 1px solid hsla(var(--color-neutral), var(--alpha-background-heavy)); + padding: var(--px-8) var(--px-12); +} +/* A single key the short-key dialog */ +.graphiql-dialog .graphiql-key { + background-color: hsla(var(--color-neutral), var(--alpha-background-medium)); + border-radius: var(--border-radius-4); + padding: var(--px-4); +} +/* Avoid showing native tooltips for icons with titles */ +.graphiql-container svg { + pointer-events: none; +} + + +/*# sourceMappingURL=graphiql.min.css.map*/ \ No newline at end of file diff --git a/netbox/project-static/dist/graphiql/graphiql.min.js b/netbox/project-static/dist/graphiql/graphiql.min.js new file mode 100644 index 000000000..b7f9a866d --- /dev/null +++ b/netbox/project-static/dist/graphiql/graphiql.min.js @@ -0,0 +1,83667 @@ +/******/ (function() { // webpackBootstrap +/******/ "use strict"; +/******/ var __webpack_modules__ = ({ + +/***/ "../../../node_modules/@emotion/is-prop-valid/dist/is-prop-valid.browser.esm.js": +/*!**************************************************************************************!*\ + !*** ../../../node_modules/@emotion/is-prop-valid/dist/is-prop-valid.browser.esm.js ***! + \**************************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; +var _memoize = _interopRequireDefault(__webpack_require__(/*! @emotion/memoize */ "../../../node_modules/@emotion/memoize/dist/memoize.browser.esm.js")); +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } +var reactPropsRegex = /^((children|dangerouslySetInnerHTML|key|ref|autoFocus|defaultValue|defaultChecked|innerHTML|suppressContentEditableWarning|suppressHydrationWarning|valueLink|accept|acceptCharset|accessKey|action|allow|allowUserMedia|allowPaymentRequest|allowFullScreen|allowTransparency|alt|async|autoComplete|autoPlay|capture|cellPadding|cellSpacing|challenge|charSet|checked|cite|classID|className|cols|colSpan|content|contentEditable|contextMenu|controls|controlsList|coords|crossOrigin|data|dateTime|decoding|default|defer|dir|disabled|disablePictureInPicture|download|draggable|encType|form|formAction|formEncType|formMethod|formNoValidate|formTarget|frameBorder|headers|height|hidden|high|href|hrefLang|htmlFor|httpEquiv|id|inputMode|integrity|is|keyParams|keyType|kind|label|lang|list|loading|loop|low|marginHeight|marginWidth|max|maxLength|media|mediaGroup|method|min|minLength|multiple|muted|name|nonce|noValidate|open|optimum|pattern|placeholder|playsInline|poster|preload|profile|radioGroup|readOnly|referrerPolicy|rel|required|reversed|role|rows|rowSpan|sandbox|scope|scoped|scrolling|seamless|selected|shape|size|sizes|slot|span|spellCheck|src|srcDoc|srcLang|srcSet|start|step|style|summary|tabIndex|target|title|type|useMap|value|width|wmode|wrap|about|datatype|inlist|prefix|property|resource|typeof|vocab|autoCapitalize|autoCorrect|autoSave|color|inert|itemProp|itemScope|itemType|itemID|itemRef|on|results|security|unselectable|accentHeight|accumulate|additive|alignmentBaseline|allowReorder|alphabetic|amplitude|arabicForm|ascent|attributeName|attributeType|autoReverse|azimuth|baseFrequency|baselineShift|baseProfile|bbox|begin|bias|by|calcMode|capHeight|clip|clipPathUnits|clipPath|clipRule|colorInterpolation|colorInterpolationFilters|colorProfile|colorRendering|contentScriptType|contentStyleType|cursor|cx|cy|d|decelerate|descent|diffuseConstant|direction|display|divisor|dominantBaseline|dur|dx|dy|edgeMode|elevation|enableBackground|end|exponent|externalResourcesRequired|fill|fillOpacity|fillRule|filter|filterRes|filterUnits|floodColor|floodOpacity|focusable|fontFamily|fontSize|fontSizeAdjust|fontStretch|fontStyle|fontVariant|fontWeight|format|from|fr|fx|fy|g1|g2|glyphName|glyphOrientationHorizontal|glyphOrientationVertical|glyphRef|gradientTransform|gradientUnits|hanging|horizAdvX|horizOriginX|ideographic|imageRendering|in|in2|intercept|k|k1|k2|k3|k4|kernelMatrix|kernelUnitLength|kerning|keyPoints|keySplines|keyTimes|lengthAdjust|letterSpacing|lightingColor|limitingConeAngle|local|markerEnd|markerMid|markerStart|markerHeight|markerUnits|markerWidth|mask|maskContentUnits|maskUnits|mathematical|mode|numOctaves|offset|opacity|operator|order|orient|orientation|origin|overflow|overlinePosition|overlineThickness|panose1|paintOrder|pathLength|patternContentUnits|patternTransform|patternUnits|pointerEvents|points|pointsAtX|pointsAtY|pointsAtZ|preserveAlpha|preserveAspectRatio|primitiveUnits|r|radius|refX|refY|renderingIntent|repeatCount|repeatDur|requiredExtensions|requiredFeatures|restart|result|rotate|rx|ry|scale|seed|shapeRendering|slope|spacing|specularConstant|specularExponent|speed|spreadMethod|startOffset|stdDeviation|stemh|stemv|stitchTiles|stopColor|stopOpacity|strikethroughPosition|strikethroughThickness|string|stroke|strokeDasharray|strokeDashoffset|strokeLinecap|strokeLinejoin|strokeMiterlimit|strokeOpacity|strokeWidth|surfaceScale|systemLanguage|tableValues|targetX|targetY|textAnchor|textDecoration|textRendering|textLength|to|transform|u1|u2|underlinePosition|underlineThickness|unicode|unicodeBidi|unicodeRange|unitsPerEm|vAlphabetic|vHanging|vIdeographic|vMathematical|values|vectorEffect|version|vertAdvY|vertOriginX|vertOriginY|viewBox|viewTarget|visibility|widths|wordSpacing|writingMode|x|xHeight|x1|x2|xChannelSelector|xlinkActuate|xlinkArcrole|xlinkHref|xlinkRole|xlinkShow|xlinkTitle|xlinkType|xmlBase|xmlns|xmlnsXlink|xmlLang|xmlSpace|y|y1|y2|yChannelSelector|z|zoomAndPan|for|class|autofocus)|(([Dd][Aa][Tt][Aa]|[Aa][Rr][Ii][Aa]|x)-.*))$/; // https://esbench.com/bench/5bfee68a4cd7e6009ef61d23 + +var index = (0, _memoize.default)(function (prop) { + return reactPropsRegex.test(prop) || prop.charCodeAt(0) === 111 + /* o */ && prop.charCodeAt(1) === 110 + /* n */ && prop.charCodeAt(2) < 91; +} +/* Z+1 */); +var _default = index; +exports["default"] = _default; + +/***/ }), + +/***/ "../../../node_modules/@emotion/memoize/dist/memoize.browser.esm.js": +/*!**************************************************************************!*\ + !*** ../../../node_modules/@emotion/memoize/dist/memoize.browser.esm.js ***! + \**************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; +function memoize(fn) { + var cache = {}; + return function (arg) { + if (cache[arg] === undefined) cache[arg] = fn(arg); + return cache[arg]; + }; +} +var _default = memoize; +exports["default"] = _default; + +/***/ }), + +/***/ "../../../node_modules/@floating-ui/core/dist/floating-ui.core.esm.js": +/*!****************************************************************************!*\ + !*** ../../../node_modules/@floating-ui/core/dist/floating-ui.core.esm.js ***! + \****************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.computePosition = exports.autoPlacement = exports.arrow = void 0; +exports.detectOverflow = detectOverflow; +exports.offset = exports.limitShift = exports.inline = exports.hide = exports.flip = void 0; +exports.rectToClientRect = rectToClientRect; +exports.size = exports.shift = void 0; +function getAlignment(placement) { + return placement.split('-')[1]; +} +function getLengthFromAxis(axis) { + return axis === 'y' ? 'height' : 'width'; +} +function getSide(placement) { + return placement.split('-')[0]; +} +function getMainAxisFromPlacement(placement) { + return ['top', 'bottom'].includes(getSide(placement)) ? 'x' : 'y'; +} +function computeCoordsFromPlacement(_ref, placement, rtl) { + let { + reference, + floating + } = _ref; + const commonX = reference.x + reference.width / 2 - floating.width / 2; + const commonY = reference.y + reference.height / 2 - floating.height / 2; + const mainAxis = getMainAxisFromPlacement(placement); + const length = getLengthFromAxis(mainAxis); + const commonAlign = reference[length] / 2 - floating[length] / 2; + const side = getSide(placement); + const isVertical = mainAxis === 'x'; + let coords; + switch (side) { + case 'top': + coords = { + x: commonX, + y: reference.y - floating.height + }; + break; + case 'bottom': + coords = { + x: commonX, + y: reference.y + reference.height + }; + break; + case 'right': + coords = { + x: reference.x + reference.width, + y: commonY + }; + break; + case 'left': + coords = { + x: reference.x - floating.width, + y: commonY + }; + break; + default: + coords = { + x: reference.x, + y: reference.y + }; + } + switch (getAlignment(placement)) { + case 'start': + coords[mainAxis] -= commonAlign * (rtl && isVertical ? -1 : 1); + break; + case 'end': + coords[mainAxis] += commonAlign * (rtl && isVertical ? -1 : 1); + break; + } + return coords; +} + +/** + * Computes the `x` and `y` coordinates that will place the floating element + * next to a reference element when it is given a certain positioning strategy. + * + * This export does not have any `platform` interface logic. You will need to + * write one for the platform you are using Floating UI with. + */ +const computePosition = async (reference, floating, config) => { + const { + placement = 'bottom', + strategy = 'absolute', + middleware = [], + platform + } = config; + const validMiddleware = middleware.filter(Boolean); + const rtl = await (platform.isRTL == null ? void 0 : platform.isRTL(floating)); + let rects = await platform.getElementRects({ + reference, + floating, + strategy + }); + let { + x, + y + } = computeCoordsFromPlacement(rects, placement, rtl); + let statefulPlacement = placement; + let middlewareData = {}; + let resetCount = 0; + for (let i = 0; i < validMiddleware.length; i++) { + const { + name, + fn + } = validMiddleware[i]; + const { + x: nextX, + y: nextY, + data, + reset + } = await fn({ + x, + y, + initialPlacement: placement, + placement: statefulPlacement, + strategy, + middlewareData, + rects, + platform, + elements: { + reference, + floating + } + }); + x = nextX != null ? nextX : x; + y = nextY != null ? nextY : y; + middlewareData = { + ...middlewareData, + [name]: { + ...middlewareData[name], + ...data + } + }; + if (reset && resetCount <= 50) { + resetCount++; + if (typeof reset === 'object') { + if (reset.placement) { + statefulPlacement = reset.placement; + } + if (reset.rects) { + rects = reset.rects === true ? await platform.getElementRects({ + reference, + floating, + strategy + }) : reset.rects; + } + ({ + x, + y + } = computeCoordsFromPlacement(rects, statefulPlacement, rtl)); + } + i = -1; + continue; + } + } + return { + x, + y, + placement: statefulPlacement, + strategy, + middlewareData + }; +}; +exports.computePosition = computePosition; +function evaluate(value, param) { + return typeof value === 'function' ? value(param) : value; +} +function expandPaddingObject(padding) { + return { + top: 0, + right: 0, + bottom: 0, + left: 0, + ...padding + }; +} +function getSideObjectFromPadding(padding) { + return typeof padding !== 'number' ? expandPaddingObject(padding) : { + top: padding, + right: padding, + bottom: padding, + left: padding + }; +} +function rectToClientRect(rect) { + return { + ...rect, + top: rect.y, + left: rect.x, + right: rect.x + rect.width, + bottom: rect.y + rect.height + }; +} + +/** + * Resolves with an object of overflow side offsets that determine how much the + * element is overflowing a given clipping boundary on each side. + * - positive = overflowing the boundary by that number of pixels + * - negative = how many pixels left before it will overflow + * - 0 = lies flush with the boundary + * @see https://floating-ui.com/docs/detectOverflow + */ +async function detectOverflow(state, options) { + var _await$platform$isEle; + if (options === void 0) { + options = {}; + } + const { + x, + y, + platform, + rects, + elements, + strategy + } = state; + const { + boundary = 'clippingAncestors', + rootBoundary = 'viewport', + elementContext = 'floating', + altBoundary = false, + padding = 0 + } = evaluate(options, state); + const paddingObject = getSideObjectFromPadding(padding); + const altContext = elementContext === 'floating' ? 'reference' : 'floating'; + const element = elements[altBoundary ? altContext : elementContext]; + const clippingClientRect = rectToClientRect(await platform.getClippingRect({ + element: ((_await$platform$isEle = await (platform.isElement == null ? void 0 : platform.isElement(element))) != null ? _await$platform$isEle : true) ? element : element.contextElement || (await (platform.getDocumentElement == null ? void 0 : platform.getDocumentElement(elements.floating))), + boundary, + rootBoundary, + strategy + })); + const rect = elementContext === 'floating' ? { + ...rects.floating, + x, + y + } : rects.reference; + const offsetParent = await (platform.getOffsetParent == null ? void 0 : platform.getOffsetParent(elements.floating)); + const offsetScale = (await (platform.isElement == null ? void 0 : platform.isElement(offsetParent))) ? (await (platform.getScale == null ? void 0 : platform.getScale(offsetParent))) || { + x: 1, + y: 1 + } : { + x: 1, + y: 1 + }; + const elementClientRect = rectToClientRect(platform.convertOffsetParentRelativeRectToViewportRelativeRect ? await platform.convertOffsetParentRelativeRectToViewportRelativeRect({ + rect, + offsetParent, + strategy + }) : rect); + return { + top: (clippingClientRect.top - elementClientRect.top + paddingObject.top) / offsetScale.y, + bottom: (elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom) / offsetScale.y, + left: (clippingClientRect.left - elementClientRect.left + paddingObject.left) / offsetScale.x, + right: (elementClientRect.right - clippingClientRect.right + paddingObject.right) / offsetScale.x + }; +} +const min = Math.min; +const max = Math.max; +function within(min$1, value, max$1) { + return max(min$1, min(value, max$1)); +} + +/** + * Provides data to position an inner element of the floating element so that it + * appears centered to the reference element. + * @see https://floating-ui.com/docs/arrow + */ +const arrow = options => ({ + name: 'arrow', + options, + async fn(state) { + const { + x, + y, + placement, + rects, + platform, + elements + } = state; + // Since `element` is required, we don't Partial<> the type. + const { + element, + padding = 0 + } = evaluate(options, state) || {}; + if (element == null) { + return {}; + } + const paddingObject = getSideObjectFromPadding(padding); + const coords = { + x, + y + }; + const axis = getMainAxisFromPlacement(placement); + const length = getLengthFromAxis(axis); + const arrowDimensions = await platform.getDimensions(element); + const isYAxis = axis === 'y'; + const minProp = isYAxis ? 'top' : 'left'; + const maxProp = isYAxis ? 'bottom' : 'right'; + const clientProp = isYAxis ? 'clientHeight' : 'clientWidth'; + const endDiff = rects.reference[length] + rects.reference[axis] - coords[axis] - rects.floating[length]; + const startDiff = coords[axis] - rects.reference[axis]; + const arrowOffsetParent = await (platform.getOffsetParent == null ? void 0 : platform.getOffsetParent(element)); + let clientSize = arrowOffsetParent ? arrowOffsetParent[clientProp] : 0; + + // DOM platform can return `window` as the `offsetParent`. + if (!clientSize || !(await (platform.isElement == null ? void 0 : platform.isElement(arrowOffsetParent)))) { + clientSize = elements.floating[clientProp] || rects.floating[length]; + } + const centerToReference = endDiff / 2 - startDiff / 2; + + // If the padding is large enough that it causes the arrow to no longer be + // centered, modify the padding so that it is centered. + const largestPossiblePadding = clientSize / 2 - arrowDimensions[length] / 2 - 1; + const minPadding = min(paddingObject[minProp], largestPossiblePadding); + const maxPadding = min(paddingObject[maxProp], largestPossiblePadding); + + // Make sure the arrow doesn't overflow the floating element if the center + // point is outside the floating element's bounds. + const min$1 = minPadding; + const max = clientSize - arrowDimensions[length] - maxPadding; + const center = clientSize / 2 - arrowDimensions[length] / 2 + centerToReference; + const offset = within(min$1, center, max); + + // If the reference is small enough that the arrow's padding causes it to + // to point to nothing for an aligned placement, adjust the offset of the + // floating element itself. This stops `shift()` from taking action, but can + // be worked around by calling it again after the `arrow()` if desired. + const shouldAddOffset = getAlignment(placement) != null && center != offset && rects.reference[length] / 2 - (center < min$1 ? minPadding : maxPadding) - arrowDimensions[length] / 2 < 0; + const alignmentOffset = shouldAddOffset ? center < min$1 ? min$1 - center : max - center : 0; + return { + [axis]: coords[axis] - alignmentOffset, + data: { + [axis]: offset, + centerOffset: center - offset + } + }; + } +}); +exports.arrow = arrow; +const sides = ['top', 'right', 'bottom', 'left']; +const allPlacements = /*#__PURE__*/sides.reduce((acc, side) => acc.concat(side, side + "-start", side + "-end"), []); +const oppositeSideMap = { + left: 'right', + right: 'left', + bottom: 'top', + top: 'bottom' +}; +function getOppositePlacement(placement) { + return placement.replace(/left|right|bottom|top/g, side => oppositeSideMap[side]); +} +function getAlignmentSides(placement, rects, rtl) { + if (rtl === void 0) { + rtl = false; + } + const alignment = getAlignment(placement); + const mainAxis = getMainAxisFromPlacement(placement); + const length = getLengthFromAxis(mainAxis); + let mainAlignmentSide = mainAxis === 'x' ? alignment === (rtl ? 'end' : 'start') ? 'right' : 'left' : alignment === 'start' ? 'bottom' : 'top'; + if (rects.reference[length] > rects.floating[length]) { + mainAlignmentSide = getOppositePlacement(mainAlignmentSide); + } + return { + main: mainAlignmentSide, + cross: getOppositePlacement(mainAlignmentSide) + }; +} +const oppositeAlignmentMap = { + start: 'end', + end: 'start' +}; +function getOppositeAlignmentPlacement(placement) { + return placement.replace(/start|end/g, alignment => oppositeAlignmentMap[alignment]); +} +function getPlacementList(alignment, autoAlignment, allowedPlacements) { + const allowedPlacementsSortedByAlignment = alignment ? [...allowedPlacements.filter(placement => getAlignment(placement) === alignment), ...allowedPlacements.filter(placement => getAlignment(placement) !== alignment)] : allowedPlacements.filter(placement => getSide(placement) === placement); + return allowedPlacementsSortedByAlignment.filter(placement => { + if (alignment) { + return getAlignment(placement) === alignment || (autoAlignment ? getOppositeAlignmentPlacement(placement) !== placement : false); + } + return true; + }); +} +/** + * Optimizes the visibility of the floating element by choosing the placement + * that has the most space available automatically, without needing to specify a + * preferred placement. Alternative to `flip`. + * @see https://floating-ui.com/docs/autoPlacement + */ +const autoPlacement = function (options) { + if (options === void 0) { + options = {}; + } + return { + name: 'autoPlacement', + options, + async fn(state) { + var _middlewareData$autoP, _middlewareData$autoP2, _placementsThatFitOnE; + const { + rects, + middlewareData, + placement, + platform, + elements + } = state; + const { + crossAxis = false, + alignment, + allowedPlacements = allPlacements, + autoAlignment = true, + ...detectOverflowOptions + } = evaluate(options, state); + const placements = alignment !== undefined || allowedPlacements === allPlacements ? getPlacementList(alignment || null, autoAlignment, allowedPlacements) : allowedPlacements; + const overflow = await detectOverflow(state, detectOverflowOptions); + const currentIndex = ((_middlewareData$autoP = middlewareData.autoPlacement) == null ? void 0 : _middlewareData$autoP.index) || 0; + const currentPlacement = placements[currentIndex]; + if (currentPlacement == null) { + return {}; + } + const { + main, + cross + } = getAlignmentSides(currentPlacement, rects, await (platform.isRTL == null ? void 0 : platform.isRTL(elements.floating))); + + // Make `computeCoords` start from the right place. + if (placement !== currentPlacement) { + return { + reset: { + placement: placements[0] + } + }; + } + const currentOverflows = [overflow[getSide(currentPlacement)], overflow[main], overflow[cross]]; + const allOverflows = [...(((_middlewareData$autoP2 = middlewareData.autoPlacement) == null ? void 0 : _middlewareData$autoP2.overflows) || []), { + placement: currentPlacement, + overflows: currentOverflows + }]; + const nextPlacement = placements[currentIndex + 1]; + + // There are more placements to check. + if (nextPlacement) { + return { + data: { + index: currentIndex + 1, + overflows: allOverflows + }, + reset: { + placement: nextPlacement + } + }; + } + const placementsSortedByMostSpace = allOverflows.map(d => { + const alignment = getAlignment(d.placement); + return [d.placement, alignment && crossAxis ? + // Check along the mainAxis and main crossAxis side. + d.overflows.slice(0, 2).reduce((acc, v) => acc + v, 0) : + // Check only the mainAxis. + d.overflows[0], d.overflows]; + }).sort((a, b) => a[1] - b[1]); + const placementsThatFitOnEachSide = placementsSortedByMostSpace.filter(d => d[2].slice(0, + // Aligned placements should not check their opposite crossAxis + // side. + getAlignment(d[0]) ? 2 : 3).every(v => v <= 0)); + const resetPlacement = ((_placementsThatFitOnE = placementsThatFitOnEachSide[0]) == null ? void 0 : _placementsThatFitOnE[0]) || placementsSortedByMostSpace[0][0]; + if (resetPlacement !== placement) { + return { + data: { + index: currentIndex + 1, + overflows: allOverflows + }, + reset: { + placement: resetPlacement + } + }; + } + return {}; + } + }; +}; +exports.autoPlacement = autoPlacement; +function getExpandedPlacements(placement) { + const oppositePlacement = getOppositePlacement(placement); + return [getOppositeAlignmentPlacement(placement), oppositePlacement, getOppositeAlignmentPlacement(oppositePlacement)]; +} +function getSideList(side, isStart, rtl) { + const lr = ['left', 'right']; + const rl = ['right', 'left']; + const tb = ['top', 'bottom']; + const bt = ['bottom', 'top']; + switch (side) { + case 'top': + case 'bottom': + if (rtl) return isStart ? rl : lr; + return isStart ? lr : rl; + case 'left': + case 'right': + return isStart ? tb : bt; + default: + return []; + } +} +function getOppositeAxisPlacements(placement, flipAlignment, direction, rtl) { + const alignment = getAlignment(placement); + let list = getSideList(getSide(placement), direction === 'start', rtl); + if (alignment) { + list = list.map(side => side + "-" + alignment); + if (flipAlignment) { + list = list.concat(list.map(getOppositeAlignmentPlacement)); + } + } + return list; +} + +/** + * Optimizes the visibility of the floating element by flipping the `placement` + * in order to keep it in view when the preferred placement(s) will overflow the + * clipping boundary. Alternative to `autoPlacement`. + * @see https://floating-ui.com/docs/flip + */ +const flip = function (options) { + if (options === void 0) { + options = {}; + } + return { + name: 'flip', + options, + async fn(state) { + var _middlewareData$flip; + const { + placement, + middlewareData, + rects, + initialPlacement, + platform, + elements + } = state; + const { + mainAxis: checkMainAxis = true, + crossAxis: checkCrossAxis = true, + fallbackPlacements: specifiedFallbackPlacements, + fallbackStrategy = 'bestFit', + fallbackAxisSideDirection = 'none', + flipAlignment = true, + ...detectOverflowOptions + } = evaluate(options, state); + const side = getSide(placement); + const isBasePlacement = getSide(initialPlacement) === initialPlacement; + const rtl = await (platform.isRTL == null ? void 0 : platform.isRTL(elements.floating)); + const fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipAlignment ? [getOppositePlacement(initialPlacement)] : getExpandedPlacements(initialPlacement)); + if (!specifiedFallbackPlacements && fallbackAxisSideDirection !== 'none') { + fallbackPlacements.push(...getOppositeAxisPlacements(initialPlacement, flipAlignment, fallbackAxisSideDirection, rtl)); + } + const placements = [initialPlacement, ...fallbackPlacements]; + const overflow = await detectOverflow(state, detectOverflowOptions); + const overflows = []; + let overflowsData = ((_middlewareData$flip = middlewareData.flip) == null ? void 0 : _middlewareData$flip.overflows) || []; + if (checkMainAxis) { + overflows.push(overflow[side]); + } + if (checkCrossAxis) { + const { + main, + cross + } = getAlignmentSides(placement, rects, rtl); + overflows.push(overflow[main], overflow[cross]); + } + overflowsData = [...overflowsData, { + placement, + overflows + }]; + + // One or more sides is overflowing. + if (!overflows.every(side => side <= 0)) { + var _middlewareData$flip2, _overflowsData$filter; + const nextIndex = (((_middlewareData$flip2 = middlewareData.flip) == null ? void 0 : _middlewareData$flip2.index) || 0) + 1; + const nextPlacement = placements[nextIndex]; + if (nextPlacement) { + // Try next placement and re-run the lifecycle. + return { + data: { + index: nextIndex, + overflows: overflowsData + }, + reset: { + placement: nextPlacement + } + }; + } + + // First, find the candidates that fit on the mainAxis side of overflow, + // then find the placement that fits the best on the main crossAxis side. + let resetPlacement = (_overflowsData$filter = overflowsData.filter(d => d.overflows[0] <= 0).sort((a, b) => a.overflows[1] - b.overflows[1])[0]) == null ? void 0 : _overflowsData$filter.placement; + + // Otherwise fallback. + if (!resetPlacement) { + switch (fallbackStrategy) { + case 'bestFit': + { + var _overflowsData$map$so; + const placement = (_overflowsData$map$so = overflowsData.map(d => [d.placement, d.overflows.filter(overflow => overflow > 0).reduce((acc, overflow) => acc + overflow, 0)]).sort((a, b) => a[1] - b[1])[0]) == null ? void 0 : _overflowsData$map$so[0]; + if (placement) { + resetPlacement = placement; + } + break; + } + case 'initialPlacement': + resetPlacement = initialPlacement; + break; + } + } + if (placement !== resetPlacement) { + return { + reset: { + placement: resetPlacement + } + }; + } + } + return {}; + } + }; +}; +exports.flip = flip; +function getSideOffsets(overflow, rect) { + return { + top: overflow.top - rect.height, + right: overflow.right - rect.width, + bottom: overflow.bottom - rect.height, + left: overflow.left - rect.width + }; +} +function isAnySideFullyClipped(overflow) { + return sides.some(side => overflow[side] >= 0); +} +/** + * Provides data to hide the floating element in applicable situations, such as + * when it is not in the same clipping context as the reference element. + * @see https://floating-ui.com/docs/hide + */ +const hide = function (options) { + if (options === void 0) { + options = {}; + } + return { + name: 'hide', + options, + async fn(state) { + const { + rects + } = state; + const { + strategy = 'referenceHidden', + ...detectOverflowOptions + } = evaluate(options, state); + switch (strategy) { + case 'referenceHidden': + { + const overflow = await detectOverflow(state, { + ...detectOverflowOptions, + elementContext: 'reference' + }); + const offsets = getSideOffsets(overflow, rects.reference); + return { + data: { + referenceHiddenOffsets: offsets, + referenceHidden: isAnySideFullyClipped(offsets) + } + }; + } + case 'escaped': + { + const overflow = await detectOverflow(state, { + ...detectOverflowOptions, + altBoundary: true + }); + const offsets = getSideOffsets(overflow, rects.floating); + return { + data: { + escapedOffsets: offsets, + escaped: isAnySideFullyClipped(offsets) + } + }; + } + default: + { + return {}; + } + } + } + }; +}; +exports.hide = hide; +function getBoundingRect(rects) { + const minX = min(...rects.map(rect => rect.left)); + const minY = min(...rects.map(rect => rect.top)); + const maxX = max(...rects.map(rect => rect.right)); + const maxY = max(...rects.map(rect => rect.bottom)); + return { + x: minX, + y: minY, + width: maxX - minX, + height: maxY - minY + }; +} +function getRectsByLine(rects) { + const sortedRects = rects.slice().sort((a, b) => a.y - b.y); + const groups = []; + let prevRect = null; + for (let i = 0; i < sortedRects.length; i++) { + const rect = sortedRects[i]; + if (!prevRect || rect.y - prevRect.y > prevRect.height / 2) { + groups.push([rect]); + } else { + groups[groups.length - 1].push(rect); + } + prevRect = rect; + } + return groups.map(rect => rectToClientRect(getBoundingRect(rect))); +} +/** + * Provides improved positioning for inline reference elements that can span + * over multiple lines, such as hyperlinks or range selections. + * @see https://floating-ui.com/docs/inline + */ +const inline = function (options) { + if (options === void 0) { + options = {}; + } + return { + name: 'inline', + options, + async fn(state) { + const { + placement, + elements, + rects, + platform, + strategy + } = state; + // A MouseEvent's client{X,Y} coords can be up to 2 pixels off a + // ClientRect's bounds, despite the event listener being triggered. A + // padding of 2 seems to handle this issue. + const { + padding = 2, + x, + y + } = evaluate(options, state); + const nativeClientRects = Array.from((await (platform.getClientRects == null ? void 0 : platform.getClientRects(elements.reference))) || []); + const clientRects = getRectsByLine(nativeClientRects); + const fallback = rectToClientRect(getBoundingRect(nativeClientRects)); + const paddingObject = getSideObjectFromPadding(padding); + function getBoundingClientRect() { + // There are two rects and they are disjoined. + if (clientRects.length === 2 && clientRects[0].left > clientRects[1].right && x != null && y != null) { + // Find the first rect in which the point is fully inside. + return clientRects.find(rect => x > rect.left - paddingObject.left && x < rect.right + paddingObject.right && y > rect.top - paddingObject.top && y < rect.bottom + paddingObject.bottom) || fallback; + } + + // There are 2 or more connected rects. + if (clientRects.length >= 2) { + if (getMainAxisFromPlacement(placement) === 'x') { + const firstRect = clientRects[0]; + const lastRect = clientRects[clientRects.length - 1]; + const isTop = getSide(placement) === 'top'; + const top = firstRect.top; + const bottom = lastRect.bottom; + const left = isTop ? firstRect.left : lastRect.left; + const right = isTop ? firstRect.right : lastRect.right; + const width = right - left; + const height = bottom - top; + return { + top, + bottom, + left, + right, + width, + height, + x: left, + y: top + }; + } + const isLeftSide = getSide(placement) === 'left'; + const maxRight = max(...clientRects.map(rect => rect.right)); + const minLeft = min(...clientRects.map(rect => rect.left)); + const measureRects = clientRects.filter(rect => isLeftSide ? rect.left === minLeft : rect.right === maxRight); + const top = measureRects[0].top; + const bottom = measureRects[measureRects.length - 1].bottom; + const left = minLeft; + const right = maxRight; + const width = right - left; + const height = bottom - top; + return { + top, + bottom, + left, + right, + width, + height, + x: left, + y: top + }; + } + return fallback; + } + const resetRects = await platform.getElementRects({ + reference: { + getBoundingClientRect + }, + floating: elements.floating, + strategy + }); + if (rects.reference.x !== resetRects.reference.x || rects.reference.y !== resetRects.reference.y || rects.reference.width !== resetRects.reference.width || rects.reference.height !== resetRects.reference.height) { + return { + reset: { + rects: resetRects + } + }; + } + return {}; + } + }; +}; +exports.inline = inline; +async function convertValueToCoords(state, options) { + const { + placement, + platform, + elements + } = state; + const rtl = await (platform.isRTL == null ? void 0 : platform.isRTL(elements.floating)); + const side = getSide(placement); + const alignment = getAlignment(placement); + const isVertical = getMainAxisFromPlacement(placement) === 'x'; + const mainAxisMulti = ['left', 'top'].includes(side) ? -1 : 1; + const crossAxisMulti = rtl && isVertical ? -1 : 1; + const rawValue = evaluate(options, state); + + // eslint-disable-next-line prefer-const + let { + mainAxis, + crossAxis, + alignmentAxis + } = typeof rawValue === 'number' ? { + mainAxis: rawValue, + crossAxis: 0, + alignmentAxis: null + } : { + mainAxis: 0, + crossAxis: 0, + alignmentAxis: null, + ...rawValue + }; + if (alignment && typeof alignmentAxis === 'number') { + crossAxis = alignment === 'end' ? alignmentAxis * -1 : alignmentAxis; + } + return isVertical ? { + x: crossAxis * crossAxisMulti, + y: mainAxis * mainAxisMulti + } : { + x: mainAxis * mainAxisMulti, + y: crossAxis * crossAxisMulti + }; +} + +/** + * Modifies the placement by translating the floating element along the + * specified axes. + * A number (shorthand for `mainAxis` or distance), or an axes configuration + * object may be passed. + * @see https://floating-ui.com/docs/offset + */ +const offset = function (options) { + if (options === void 0) { + options = 0; + } + return { + name: 'offset', + options, + async fn(state) { + const { + x, + y + } = state; + const diffCoords = await convertValueToCoords(state, options); + return { + x: x + diffCoords.x, + y: y + diffCoords.y, + data: diffCoords + }; + } + }; +}; +exports.offset = offset; +function getCrossAxis(axis) { + return axis === 'x' ? 'y' : 'x'; +} + +/** + * Optimizes the visibility of the floating element by shifting it in order to + * keep it in view when it will overflow the clipping boundary. + * @see https://floating-ui.com/docs/shift + */ +const shift = function (options) { + if (options === void 0) { + options = {}; + } + return { + name: 'shift', + options, + async fn(state) { + const { + x, + y, + placement + } = state; + const { + mainAxis: checkMainAxis = true, + crossAxis: checkCrossAxis = false, + limiter = { + fn: _ref => { + let { + x, + y + } = _ref; + return { + x, + y + }; + } + }, + ...detectOverflowOptions + } = evaluate(options, state); + const coords = { + x, + y + }; + const overflow = await detectOverflow(state, detectOverflowOptions); + const mainAxis = getMainAxisFromPlacement(getSide(placement)); + const crossAxis = getCrossAxis(mainAxis); + let mainAxisCoord = coords[mainAxis]; + let crossAxisCoord = coords[crossAxis]; + if (checkMainAxis) { + const minSide = mainAxis === 'y' ? 'top' : 'left'; + const maxSide = mainAxis === 'y' ? 'bottom' : 'right'; + const min = mainAxisCoord + overflow[minSide]; + const max = mainAxisCoord - overflow[maxSide]; + mainAxisCoord = within(min, mainAxisCoord, max); + } + if (checkCrossAxis) { + const minSide = crossAxis === 'y' ? 'top' : 'left'; + const maxSide = crossAxis === 'y' ? 'bottom' : 'right'; + const min = crossAxisCoord + overflow[minSide]; + const max = crossAxisCoord - overflow[maxSide]; + crossAxisCoord = within(min, crossAxisCoord, max); + } + const limitedCoords = limiter.fn({ + ...state, + [mainAxis]: mainAxisCoord, + [crossAxis]: crossAxisCoord + }); + return { + ...limitedCoords, + data: { + x: limitedCoords.x - x, + y: limitedCoords.y - y + } + }; + } + }; +}; +/** + * Built-in `limiter` that will stop `shift()` at a certain point. + */ +exports.shift = shift; +const limitShift = function (options) { + if (options === void 0) { + options = {}; + } + return { + options, + fn(state) { + const { + x, + y, + placement, + rects, + middlewareData + } = state; + const { + offset = 0, + mainAxis: checkMainAxis = true, + crossAxis: checkCrossAxis = true + } = evaluate(options, state); + const coords = { + x, + y + }; + const mainAxis = getMainAxisFromPlacement(placement); + const crossAxis = getCrossAxis(mainAxis); + let mainAxisCoord = coords[mainAxis]; + let crossAxisCoord = coords[crossAxis]; + const rawOffset = evaluate(offset, state); + const computedOffset = typeof rawOffset === 'number' ? { + mainAxis: rawOffset, + crossAxis: 0 + } : { + mainAxis: 0, + crossAxis: 0, + ...rawOffset + }; + if (checkMainAxis) { + const len = mainAxis === 'y' ? 'height' : 'width'; + const limitMin = rects.reference[mainAxis] - rects.floating[len] + computedOffset.mainAxis; + const limitMax = rects.reference[mainAxis] + rects.reference[len] - computedOffset.mainAxis; + if (mainAxisCoord < limitMin) { + mainAxisCoord = limitMin; + } else if (mainAxisCoord > limitMax) { + mainAxisCoord = limitMax; + } + } + if (checkCrossAxis) { + var _middlewareData$offse, _middlewareData$offse2; + const len = mainAxis === 'y' ? 'width' : 'height'; + const isOriginSide = ['top', 'left'].includes(getSide(placement)); + const limitMin = rects.reference[crossAxis] - rects.floating[len] + (isOriginSide ? ((_middlewareData$offse = middlewareData.offset) == null ? void 0 : _middlewareData$offse[crossAxis]) || 0 : 0) + (isOriginSide ? 0 : computedOffset.crossAxis); + const limitMax = rects.reference[crossAxis] + rects.reference[len] + (isOriginSide ? 0 : ((_middlewareData$offse2 = middlewareData.offset) == null ? void 0 : _middlewareData$offse2[crossAxis]) || 0) - (isOriginSide ? computedOffset.crossAxis : 0); + if (crossAxisCoord < limitMin) { + crossAxisCoord = limitMin; + } else if (crossAxisCoord > limitMax) { + crossAxisCoord = limitMax; + } + } + return { + [mainAxis]: mainAxisCoord, + [crossAxis]: crossAxisCoord + }; + } + }; +}; + +/** + * Provides data that allows you to change the size of the floating element — + * for instance, prevent it from overflowing the clipping boundary or match the + * width of the reference element. + * @see https://floating-ui.com/docs/size + */ +exports.limitShift = limitShift; +const size = function (options) { + if (options === void 0) { + options = {}; + } + return { + name: 'size', + options, + async fn(state) { + const { + placement, + rects, + platform, + elements + } = state; + const { + apply = () => {}, + ...detectOverflowOptions + } = evaluate(options, state); + const overflow = await detectOverflow(state, detectOverflowOptions); + const side = getSide(placement); + const alignment = getAlignment(placement); + const axis = getMainAxisFromPlacement(placement); + const isXAxis = axis === 'x'; + const { + width, + height + } = rects.floating; + let heightSide; + let widthSide; + if (side === 'top' || side === 'bottom') { + heightSide = side; + widthSide = alignment === ((await (platform.isRTL == null ? void 0 : platform.isRTL(elements.floating))) ? 'start' : 'end') ? 'left' : 'right'; + } else { + widthSide = side; + heightSide = alignment === 'end' ? 'top' : 'bottom'; + } + const overflowAvailableHeight = height - overflow[heightSide]; + const overflowAvailableWidth = width - overflow[widthSide]; + const noShift = !state.middlewareData.shift; + let availableHeight = overflowAvailableHeight; + let availableWidth = overflowAvailableWidth; + if (isXAxis) { + const maximumClippingWidth = width - overflow.left - overflow.right; + availableWidth = alignment || noShift ? min(overflowAvailableWidth, maximumClippingWidth) : maximumClippingWidth; + } else { + const maximumClippingHeight = height - overflow.top - overflow.bottom; + availableHeight = alignment || noShift ? min(overflowAvailableHeight, maximumClippingHeight) : maximumClippingHeight; + } + if (noShift && !alignment) { + const xMin = max(overflow.left, 0); + const xMax = max(overflow.right, 0); + const yMin = max(overflow.top, 0); + const yMax = max(overflow.bottom, 0); + if (isXAxis) { + availableWidth = width - 2 * (xMin !== 0 || xMax !== 0 ? xMin + xMax : max(overflow.left, overflow.right)); + } else { + availableHeight = height - 2 * (yMin !== 0 || yMax !== 0 ? yMin + yMax : max(overflow.top, overflow.bottom)); + } + } + await apply({ + ...state, + availableWidth, + availableHeight + }); + const nextDimensions = await platform.getDimensions(elements.floating); + if (width !== nextDimensions.width || height !== nextDimensions.height) { + return { + reset: { + rects: true + } + }; + } + return {}; + } + }; +}; +exports.size = size; + +/***/ }), + +/***/ "../../../node_modules/@floating-ui/dom/dist/floating-ui.dom.esm.js": +/*!**************************************************************************!*\ + !*** ../../../node_modules/@floating-ui/dom/dist/floating-ui.dom.esm.js ***! + \**************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +Object.defineProperty(exports, "arrow", ({ + enumerable: true, + get: function () { + return _core.arrow; + } +})); +Object.defineProperty(exports, "autoPlacement", ({ + enumerable: true, + get: function () { + return _core.autoPlacement; + } +})); +exports.autoUpdate = autoUpdate; +exports.computePosition = void 0; +Object.defineProperty(exports, "detectOverflow", ({ + enumerable: true, + get: function () { + return _core.detectOverflow; + } +})); +Object.defineProperty(exports, "flip", ({ + enumerable: true, + get: function () { + return _core.flip; + } +})); +exports.getOverflowAncestors = getOverflowAncestors; +Object.defineProperty(exports, "hide", ({ + enumerable: true, + get: function () { + return _core.hide; + } +})); +Object.defineProperty(exports, "inline", ({ + enumerable: true, + get: function () { + return _core.inline; + } +})); +Object.defineProperty(exports, "limitShift", ({ + enumerable: true, + get: function () { + return _core.limitShift; + } +})); +Object.defineProperty(exports, "offset", ({ + enumerable: true, + get: function () { + return _core.offset; + } +})); +exports.platform = void 0; +Object.defineProperty(exports, "shift", ({ + enumerable: true, + get: function () { + return _core.shift; + } +})); +Object.defineProperty(exports, "size", ({ + enumerable: true, + get: function () { + return _core.size; + } +})); +var _core = __webpack_require__(/*! @floating-ui/core */ "../../../node_modules/@floating-ui/core/dist/floating-ui.core.esm.js"); +function getWindow(node) { + var _node$ownerDocument; + return ((_node$ownerDocument = node.ownerDocument) == null ? void 0 : _node$ownerDocument.defaultView) || window; +} +function getComputedStyle$1(element) { + return getWindow(element).getComputedStyle(element); +} +function isNode(value) { + return value instanceof getWindow(value).Node; +} +function getNodeName(node) { + return isNode(node) ? (node.nodeName || '').toLowerCase() : ''; +} +function isHTMLElement(value) { + return value instanceof getWindow(value).HTMLElement; +} +function isElement(value) { + return value instanceof getWindow(value).Element; +} +function isShadowRoot(node) { + // Browsers without `ShadowRoot` support. + if (typeof ShadowRoot === 'undefined') { + return false; + } + const OwnElement = getWindow(node).ShadowRoot; + return node instanceof OwnElement || node instanceof ShadowRoot; +} +function isOverflowElement(element) { + const { + overflow, + overflowX, + overflowY, + display + } = getComputedStyle$1(element); + return /auto|scroll|overlay|hidden|clip/.test(overflow + overflowY + overflowX) && !['inline', 'contents'].includes(display); +} +function isTableElement(element) { + return ['table', 'td', 'th'].includes(getNodeName(element)); +} +function isContainingBlock(element) { + const safari = isSafari(); + const css = getComputedStyle$1(element); + + // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block + return css.transform !== 'none' || css.perspective !== 'none' || !safari && (css.backdropFilter ? css.backdropFilter !== 'none' : false) || !safari && (css.filter ? css.filter !== 'none' : false) || ['transform', 'perspective', 'filter'].some(value => (css.willChange || '').includes(value)) || ['paint', 'layout', 'strict', 'content'].some(value => (css.contain || '').includes(value)); +} +function isSafari() { + if (typeof CSS === 'undefined' || !CSS.supports) return false; + return CSS.supports('-webkit-backdrop-filter', 'none'); +} +function isLastTraversableNode(node) { + return ['html', 'body', '#document'].includes(getNodeName(node)); +} +const min = Math.min; +const max = Math.max; +const round = Math.round; +function getCssDimensions(element) { + const css = getComputedStyle$1(element); + // In testing environments, the `width` and `height` properties are empty + // strings for SVG elements, returning NaN. Fallback to `0` in this case. + let width = parseFloat(css.width) || 0; + let height = parseFloat(css.height) || 0; + const hasOffset = isHTMLElement(element); + const offsetWidth = hasOffset ? element.offsetWidth : width; + const offsetHeight = hasOffset ? element.offsetHeight : height; + const shouldFallback = round(width) !== offsetWidth || round(height) !== offsetHeight; + if (shouldFallback) { + width = offsetWidth; + height = offsetHeight; + } + return { + width, + height, + fallback: shouldFallback + }; +} +function unwrapElement(element) { + return !isElement(element) ? element.contextElement : element; +} +const FALLBACK_SCALE = { + x: 1, + y: 1 +}; +function getScale(element) { + const domElement = unwrapElement(element); + if (!isHTMLElement(domElement)) { + return FALLBACK_SCALE; + } + const rect = domElement.getBoundingClientRect(); + const { + width, + height, + fallback + } = getCssDimensions(domElement); + let x = (fallback ? round(rect.width) : rect.width) / width; + let y = (fallback ? round(rect.height) : rect.height) / height; + + // 0, NaN, or Infinity should always fallback to 1. + + if (!x || !Number.isFinite(x)) { + x = 1; + } + if (!y || !Number.isFinite(y)) { + y = 1; + } + return { + x, + y + }; +} +const noOffsets = { + x: 0, + y: 0 +}; +function getVisualOffsets(element, isFixed, floatingOffsetParent) { + var _win$visualViewport, _win$visualViewport2; + if (isFixed === void 0) { + isFixed = true; + } + if (!isSafari()) { + return noOffsets; + } + const win = element ? getWindow(element) : window; + if (!floatingOffsetParent || isFixed && floatingOffsetParent !== win) { + return noOffsets; + } + return { + x: ((_win$visualViewport = win.visualViewport) == null ? void 0 : _win$visualViewport.offsetLeft) || 0, + y: ((_win$visualViewport2 = win.visualViewport) == null ? void 0 : _win$visualViewport2.offsetTop) || 0 + }; +} +function getBoundingClientRect(element, includeScale, isFixedStrategy, offsetParent) { + if (includeScale === void 0) { + includeScale = false; + } + if (isFixedStrategy === void 0) { + isFixedStrategy = false; + } + const clientRect = element.getBoundingClientRect(); + const domElement = unwrapElement(element); + let scale = FALLBACK_SCALE; + if (includeScale) { + if (offsetParent) { + if (isElement(offsetParent)) { + scale = getScale(offsetParent); + } + } else { + scale = getScale(element); + } + } + const visualOffsets = getVisualOffsets(domElement, isFixedStrategy, offsetParent); + let x = (clientRect.left + visualOffsets.x) / scale.x; + let y = (clientRect.top + visualOffsets.y) / scale.y; + let width = clientRect.width / scale.x; + let height = clientRect.height / scale.y; + if (domElement) { + const win = getWindow(domElement); + const offsetWin = offsetParent && isElement(offsetParent) ? getWindow(offsetParent) : offsetParent; + let currentIFrame = win.frameElement; + while (currentIFrame && offsetParent && offsetWin !== win) { + const iframeScale = getScale(currentIFrame); + const iframeRect = currentIFrame.getBoundingClientRect(); + const css = getComputedStyle(currentIFrame); + iframeRect.x += (currentIFrame.clientLeft + parseFloat(css.paddingLeft)) * iframeScale.x; + iframeRect.y += (currentIFrame.clientTop + parseFloat(css.paddingTop)) * iframeScale.y; + x *= iframeScale.x; + y *= iframeScale.y; + width *= iframeScale.x; + height *= iframeScale.y; + x += iframeRect.x; + y += iframeRect.y; + currentIFrame = getWindow(currentIFrame).frameElement; + } + } + return (0, _core.rectToClientRect)({ + width, + height, + x, + y + }); +} +function getDocumentElement(node) { + return ((isNode(node) ? node.ownerDocument : node.document) || window.document).documentElement; +} +function getNodeScroll(element) { + if (isElement(element)) { + return { + scrollLeft: element.scrollLeft, + scrollTop: element.scrollTop + }; + } + return { + scrollLeft: element.pageXOffset, + scrollTop: element.pageYOffset + }; +} +function convertOffsetParentRelativeRectToViewportRelativeRect(_ref) { + let { + rect, + offsetParent, + strategy + } = _ref; + const isOffsetParentAnElement = isHTMLElement(offsetParent); + const documentElement = getDocumentElement(offsetParent); + if (offsetParent === documentElement) { + return rect; + } + let scroll = { + scrollLeft: 0, + scrollTop: 0 + }; + let scale = { + x: 1, + y: 1 + }; + const offsets = { + x: 0, + y: 0 + }; + if (isOffsetParentAnElement || !isOffsetParentAnElement && strategy !== 'fixed') { + if (getNodeName(offsetParent) !== 'body' || isOverflowElement(documentElement)) { + scroll = getNodeScroll(offsetParent); + } + if (isHTMLElement(offsetParent)) { + const offsetRect = getBoundingClientRect(offsetParent); + scale = getScale(offsetParent); + offsets.x = offsetRect.x + offsetParent.clientLeft; + offsets.y = offsetRect.y + offsetParent.clientTop; + } + } + return { + width: rect.width * scale.x, + height: rect.height * scale.y, + x: rect.x * scale.x - scroll.scrollLeft * scale.x + offsets.x, + y: rect.y * scale.y - scroll.scrollTop * scale.y + offsets.y + }; +} +function getWindowScrollBarX(element) { + // If has a CSS width greater than the viewport, then this will be + // incorrect for RTL. + return getBoundingClientRect(getDocumentElement(element)).left + getNodeScroll(element).scrollLeft; +} + +// Gets the entire size of the scrollable document area, even extending outside +// of the `` and `` rect bounds if horizontally scrollable. +function getDocumentRect(element) { + const html = getDocumentElement(element); + const scroll = getNodeScroll(element); + const body = element.ownerDocument.body; + const width = max(html.scrollWidth, html.clientWidth, body.scrollWidth, body.clientWidth); + const height = max(html.scrollHeight, html.clientHeight, body.scrollHeight, body.clientHeight); + let x = -scroll.scrollLeft + getWindowScrollBarX(element); + const y = -scroll.scrollTop; + if (getComputedStyle$1(body).direction === 'rtl') { + x += max(html.clientWidth, body.clientWidth) - width; + } + return { + width, + height, + x, + y + }; +} +function getParentNode(node) { + if (getNodeName(node) === 'html') { + return node; + } + const result = + // Step into the shadow DOM of the parent of a slotted node. + node.assignedSlot || + // DOM Element detected. + node.parentNode || + // ShadowRoot detected. + isShadowRoot(node) && node.host || + // Fallback. + getDocumentElement(node); + return isShadowRoot(result) ? result.host : result; +} +function getNearestOverflowAncestor(node) { + const parentNode = getParentNode(node); + if (isLastTraversableNode(parentNode)) { + // `getParentNode` will never return a `Document` due to the fallback + // check, so it's either the or element. + return parentNode.ownerDocument.body; + } + if (isHTMLElement(parentNode) && isOverflowElement(parentNode)) { + return parentNode; + } + return getNearestOverflowAncestor(parentNode); +} +function getOverflowAncestors(node, list) { + var _node$ownerDocument; + if (list === void 0) { + list = []; + } + const scrollableAncestor = getNearestOverflowAncestor(node); + const isBody = scrollableAncestor === ((_node$ownerDocument = node.ownerDocument) == null ? void 0 : _node$ownerDocument.body); + const win = getWindow(scrollableAncestor); + if (isBody) { + return list.concat(win, win.visualViewport || [], isOverflowElement(scrollableAncestor) ? scrollableAncestor : []); + } + return list.concat(scrollableAncestor, getOverflowAncestors(scrollableAncestor)); +} +function getViewportRect(element, strategy) { + const win = getWindow(element); + const html = getDocumentElement(element); + const visualViewport = win.visualViewport; + let width = html.clientWidth; + let height = html.clientHeight; + let x = 0; + let y = 0; + if (visualViewport) { + width = visualViewport.width; + height = visualViewport.height; + const visualViewportBased = isSafari(); + if (!visualViewportBased || visualViewportBased && strategy === 'fixed') { + x = visualViewport.offsetLeft; + y = visualViewport.offsetTop; + } + } + return { + width, + height, + x, + y + }; +} + +// Returns the inner client rect, subtracting scrollbars if present. +function getInnerBoundingClientRect(element, strategy) { + const clientRect = getBoundingClientRect(element, true, strategy === 'fixed'); + const top = clientRect.top + element.clientTop; + const left = clientRect.left + element.clientLeft; + const scale = isHTMLElement(element) ? getScale(element) : { + x: 1, + y: 1 + }; + const width = element.clientWidth * scale.x; + const height = element.clientHeight * scale.y; + const x = left * scale.x; + const y = top * scale.y; + return { + width, + height, + x, + y + }; +} +function getClientRectFromClippingAncestor(element, clippingAncestor, strategy) { + let rect; + if (clippingAncestor === 'viewport') { + rect = getViewportRect(element, strategy); + } else if (clippingAncestor === 'document') { + rect = getDocumentRect(getDocumentElement(element)); + } else if (isElement(clippingAncestor)) { + rect = getInnerBoundingClientRect(clippingAncestor, strategy); + } else { + const visualOffsets = getVisualOffsets(element); + rect = { + ...clippingAncestor, + x: clippingAncestor.x - visualOffsets.x, + y: clippingAncestor.y - visualOffsets.y + }; + } + return (0, _core.rectToClientRect)(rect); +} +function hasFixedPositionAncestor(element, stopNode) { + const parentNode = getParentNode(element); + if (parentNode === stopNode || !isElement(parentNode) || isLastTraversableNode(parentNode)) { + return false; + } + return getComputedStyle$1(parentNode).position === 'fixed' || hasFixedPositionAncestor(parentNode, stopNode); +} + +// A "clipping ancestor" is an `overflow` element with the characteristic of +// clipping (or hiding) child elements. This returns all clipping ancestors +// of the given element up the tree. +function getClippingElementAncestors(element, cache) { + const cachedResult = cache.get(element); + if (cachedResult) { + return cachedResult; + } + let result = getOverflowAncestors(element).filter(el => isElement(el) && getNodeName(el) !== 'body'); + let currentContainingBlockComputedStyle = null; + const elementIsFixed = getComputedStyle$1(element).position === 'fixed'; + let currentNode = elementIsFixed ? getParentNode(element) : element; + + // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block + while (isElement(currentNode) && !isLastTraversableNode(currentNode)) { + const computedStyle = getComputedStyle$1(currentNode); + const currentNodeIsContaining = isContainingBlock(currentNode); + if (!currentNodeIsContaining && computedStyle.position === 'fixed') { + currentContainingBlockComputedStyle = null; + } + const shouldDropCurrentNode = elementIsFixed ? !currentNodeIsContaining && !currentContainingBlockComputedStyle : !currentNodeIsContaining && computedStyle.position === 'static' && !!currentContainingBlockComputedStyle && ['absolute', 'fixed'].includes(currentContainingBlockComputedStyle.position) || isOverflowElement(currentNode) && !currentNodeIsContaining && hasFixedPositionAncestor(element, currentNode); + if (shouldDropCurrentNode) { + // Drop non-containing blocks. + result = result.filter(ancestor => ancestor !== currentNode); + } else { + // Record last containing block for next iteration. + currentContainingBlockComputedStyle = computedStyle; + } + currentNode = getParentNode(currentNode); + } + cache.set(element, result); + return result; +} + +// Gets the maximum area that the element is visible in due to any number of +// clipping ancestors. +function getClippingRect(_ref) { + let { + element, + boundary, + rootBoundary, + strategy + } = _ref; + const elementClippingAncestors = boundary === 'clippingAncestors' ? getClippingElementAncestors(element, this._c) : [].concat(boundary); + const clippingAncestors = [...elementClippingAncestors, rootBoundary]; + const firstClippingAncestor = clippingAncestors[0]; + const clippingRect = clippingAncestors.reduce((accRect, clippingAncestor) => { + const rect = getClientRectFromClippingAncestor(element, clippingAncestor, strategy); + accRect.top = max(rect.top, accRect.top); + accRect.right = min(rect.right, accRect.right); + accRect.bottom = min(rect.bottom, accRect.bottom); + accRect.left = max(rect.left, accRect.left); + return accRect; + }, getClientRectFromClippingAncestor(element, firstClippingAncestor, strategy)); + return { + width: clippingRect.right - clippingRect.left, + height: clippingRect.bottom - clippingRect.top, + x: clippingRect.left, + y: clippingRect.top + }; +} +function getDimensions(element) { + return getCssDimensions(element); +} +function getTrueOffsetParent(element, polyfill) { + if (!isHTMLElement(element) || getComputedStyle$1(element).position === 'fixed') { + return null; + } + if (polyfill) { + return polyfill(element); + } + return element.offsetParent; +} +function getContainingBlock(element) { + let currentNode = getParentNode(element); + while (isHTMLElement(currentNode) && !isLastTraversableNode(currentNode)) { + if (isContainingBlock(currentNode)) { + return currentNode; + } else { + currentNode = getParentNode(currentNode); + } + } + return null; +} + +// Gets the closest ancestor positioned element. Handles some edge cases, +// such as table ancestors and cross browser bugs. +function getOffsetParent(element, polyfill) { + const window = getWindow(element); + if (!isHTMLElement(element)) { + return window; + } + let offsetParent = getTrueOffsetParent(element, polyfill); + while (offsetParent && isTableElement(offsetParent) && getComputedStyle$1(offsetParent).position === 'static') { + offsetParent = getTrueOffsetParent(offsetParent, polyfill); + } + if (offsetParent && (getNodeName(offsetParent) === 'html' || getNodeName(offsetParent) === 'body' && getComputedStyle$1(offsetParent).position === 'static' && !isContainingBlock(offsetParent))) { + return window; + } + return offsetParent || getContainingBlock(element) || window; +} +function getRectRelativeToOffsetParent(element, offsetParent, strategy) { + const isOffsetParentAnElement = isHTMLElement(offsetParent); + const documentElement = getDocumentElement(offsetParent); + const isFixed = strategy === 'fixed'; + const rect = getBoundingClientRect(element, true, isFixed, offsetParent); + let scroll = { + scrollLeft: 0, + scrollTop: 0 + }; + const offsets = { + x: 0, + y: 0 + }; + if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) { + if (getNodeName(offsetParent) !== 'body' || isOverflowElement(documentElement)) { + scroll = getNodeScroll(offsetParent); + } + if (isHTMLElement(offsetParent)) { + const offsetRect = getBoundingClientRect(offsetParent, true, isFixed, offsetParent); + offsets.x = offsetRect.x + offsetParent.clientLeft; + offsets.y = offsetRect.y + offsetParent.clientTop; + } else if (documentElement) { + offsets.x = getWindowScrollBarX(documentElement); + } + } + return { + x: rect.left + scroll.scrollLeft - offsets.x, + y: rect.top + scroll.scrollTop - offsets.y, + width: rect.width, + height: rect.height + }; +} +const platform = { + getClippingRect, + convertOffsetParentRelativeRectToViewportRelativeRect, + isElement, + getDimensions, + getOffsetParent, + getDocumentElement, + getScale, + async getElementRects(_ref) { + let { + reference, + floating, + strategy + } = _ref; + const getOffsetParentFn = this.getOffsetParent || getOffsetParent; + const getDimensionsFn = this.getDimensions; + return { + reference: getRectRelativeToOffsetParent(reference, await getOffsetParentFn(floating), strategy), + floating: { + x: 0, + y: 0, + ...(await getDimensionsFn(floating)) + } + }; + }, + getClientRects: element => Array.from(element.getClientRects()), + isRTL: element => getComputedStyle$1(element).direction === 'rtl' +}; + +/** + * Automatically updates the position of the floating element when necessary. + * Should only be called when the floating element is mounted on the DOM or + * visible on the screen. + * @returns cleanup function that should be invoked when the floating element is + * removed from the DOM or hidden from the screen. + * @see https://floating-ui.com/docs/autoUpdate + */ +exports.platform = platform; +function autoUpdate(reference, floating, update, options) { + if (options === void 0) { + options = {}; + } + const { + ancestorScroll = true, + ancestorResize = true, + elementResize = true, + animationFrame = false + } = options; + const ancestors = ancestorScroll || ancestorResize ? [...(isElement(reference) ? getOverflowAncestors(reference) : reference.contextElement ? getOverflowAncestors(reference.contextElement) : []), ...getOverflowAncestors(floating)] : []; + ancestors.forEach(ancestor => { + // ignores Window, checks for [object VisualViewport] + const isVisualViewport = !isElement(ancestor) && ancestor.toString().includes('V'); + if (ancestorScroll && (animationFrame ? isVisualViewport : true)) { + ancestor.addEventListener('scroll', update, { + passive: true + }); + } + ancestorResize && ancestor.addEventListener('resize', update); + }); + let observer = null; + if (elementResize) { + observer = new ResizeObserver(() => { + update(); + }); + isElement(reference) && !animationFrame && observer.observe(reference); + if (!isElement(reference) && reference.contextElement && !animationFrame) { + observer.observe(reference.contextElement); + } + observer.observe(floating); + } + let frameId; + let prevRefRect = animationFrame ? getBoundingClientRect(reference) : null; + if (animationFrame) { + frameLoop(); + } + function frameLoop() { + const nextRefRect = getBoundingClientRect(reference); + if (prevRefRect && (nextRefRect.x !== prevRefRect.x || nextRefRect.y !== prevRefRect.y || nextRefRect.width !== prevRefRect.width || nextRefRect.height !== prevRefRect.height)) { + update(); + } + prevRefRect = nextRefRect; + frameId = requestAnimationFrame(frameLoop); + } + update(); + return () => { + var _observer; + ancestors.forEach(ancestor => { + ancestorScroll && ancestor.removeEventListener('scroll', update); + ancestorResize && ancestor.removeEventListener('resize', update); + }); + (_observer = observer) == null ? void 0 : _observer.disconnect(); + observer = null; + if (animationFrame) { + cancelAnimationFrame(frameId); + } + }; +} + +/** + * Computes the `x` and `y` coordinates that will place the floating element + * next to a reference element when it is given a certain CSS positioning + * strategy. + */ +const computePosition = (reference, floating, options) => { + // This caches the expensive `getClippingElementAncestors` function so that + // multiple lifecycle resets re-use the same result. It only lives for a + // single call. If other functions become expensive, we can add them as well. + const cache = new Map(); + const mergedOptions = { + platform, + ...options + }; + const platformWithCache = { + ...mergedOptions.platform, + _c: cache + }; + return (0, _core.computePosition)(reference, floating, { + ...mergedOptions, + platform: platformWithCache + }); +}; +exports.computePosition = computePosition; + +/***/ }), + +/***/ "../../../node_modules/@floating-ui/react-dom/dist/floating-ui.react-dom.esm.js": +/*!**************************************************************************************!*\ + !*** ../../../node_modules/@floating-ui/react-dom/dist/floating-ui.react-dom.esm.js ***! + \**************************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.arrow = void 0; +Object.defineProperty(exports, "autoPlacement", ({ + enumerable: true, + get: function () { + return _dom.autoPlacement; + } +})); +Object.defineProperty(exports, "autoUpdate", ({ + enumerable: true, + get: function () { + return _dom.autoUpdate; + } +})); +Object.defineProperty(exports, "computePosition", ({ + enumerable: true, + get: function () { + return _dom.computePosition; + } +})); +Object.defineProperty(exports, "detectOverflow", ({ + enumerable: true, + get: function () { + return _dom.detectOverflow; + } +})); +Object.defineProperty(exports, "flip", ({ + enumerable: true, + get: function () { + return _dom.flip; + } +})); +Object.defineProperty(exports, "getOverflowAncestors", ({ + enumerable: true, + get: function () { + return _dom.getOverflowAncestors; + } +})); +Object.defineProperty(exports, "hide", ({ + enumerable: true, + get: function () { + return _dom.hide; + } +})); +Object.defineProperty(exports, "inline", ({ + enumerable: true, + get: function () { + return _dom.inline; + } +})); +Object.defineProperty(exports, "limitShift", ({ + enumerable: true, + get: function () { + return _dom.limitShift; + } +})); +Object.defineProperty(exports, "offset", ({ + enumerable: true, + get: function () { + return _dom.offset; + } +})); +Object.defineProperty(exports, "platform", ({ + enumerable: true, + get: function () { + return _dom.platform; + } +})); +Object.defineProperty(exports, "shift", ({ + enumerable: true, + get: function () { + return _dom.shift; + } +})); +Object.defineProperty(exports, "size", ({ + enumerable: true, + get: function () { + return _dom.size; + } +})); +exports.useFloating = useFloating; +var _dom = __webpack_require__(/*! @floating-ui/dom */ "../../../node_modules/@floating-ui/dom/dist/floating-ui.dom.esm.js"); +var React = _interopRequireWildcard(__webpack_require__(/*! react */ "react")); +var ReactDOM = _interopRequireWildcard(__webpack_require__(/*! react-dom */ "react-dom")); +function _getRequireWildcardCache(nodeInterop) { if (typeof WeakMap !== "function") return null; var cacheBabelInterop = new WeakMap(); var cacheNodeInterop = new WeakMap(); return (_getRequireWildcardCache = function (nodeInterop) { return nodeInterop ? cacheNodeInterop : cacheBabelInterop; })(nodeInterop); } +function _interopRequireWildcard(obj, nodeInterop) { if (!nodeInterop && obj && obj.__esModule) { return obj; } if (obj === null || typeof obj !== "object" && typeof obj !== "function") { return { default: obj }; } var cache = _getRequireWildcardCache(nodeInterop); if (cache && cache.has(obj)) { return cache.get(obj); } var newObj = {}; var hasPropertyDescriptor = Object.defineProperty && Object.getOwnPropertyDescriptor; for (var key in obj) { if (key !== "default" && Object.prototype.hasOwnProperty.call(obj, key)) { var desc = hasPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : null; if (desc && (desc.get || desc.set)) { Object.defineProperty(newObj, key, desc); } else { newObj[key] = obj[key]; } } } newObj.default = obj; if (cache) { cache.set(obj, newObj); } return newObj; } +/** + * Provides data to position an inner element of the floating element so that it + * appears centered to the reference element. + * This wraps the core `arrow` middleware to allow React refs as the element. + * @see https://floating-ui.com/docs/arrow + */ +const arrow = options => { + function isRef(value) { + return {}.hasOwnProperty.call(value, 'current'); + } + return { + name: 'arrow', + options, + fn(state) { + const { + element, + padding + } = typeof options === 'function' ? options(state) : options; + if (element && isRef(element)) { + if (element.current != null) { + return (0, _dom.arrow)({ + element: element.current, + padding + }).fn(state); + } + return {}; + } else if (element) { + return (0, _dom.arrow)({ + element, + padding + }).fn(state); + } + return {}; + } + }; +}; +exports.arrow = arrow; +var index = typeof document !== 'undefined' ? React.useLayoutEffect : React.useEffect; + +// Fork of `fast-deep-equal` that only does the comparisons we need and compares +// functions +function deepEqual(a, b) { + if (a === b) { + return true; + } + if (typeof a !== typeof b) { + return false; + } + if (typeof a === 'function' && a.toString() === b.toString()) { + return true; + } + let length, i, keys; + if (a && b && typeof a == 'object') { + if (Array.isArray(a)) { + length = a.length; + if (length != b.length) return false; + for (i = length; i-- !== 0;) { + if (!deepEqual(a[i], b[i])) { + return false; + } + } + return true; + } + keys = Object.keys(a); + length = keys.length; + if (length !== Object.keys(b).length) { + return false; + } + for (i = length; i-- !== 0;) { + if (!{}.hasOwnProperty.call(b, keys[i])) { + return false; + } + } + for (i = length; i-- !== 0;) { + const key = keys[i]; + if (key === '_owner' && a.$$typeof) { + continue; + } + if (!deepEqual(a[key], b[key])) { + return false; + } + } + return true; + } + return a !== a && b !== b; +} +function getDPR(element) { + if (typeof window === 'undefined') { + return 1; + } + const win = element.ownerDocument.defaultView || window; + return win.devicePixelRatio || 1; +} +function roundByDPR(element, value) { + const dpr = getDPR(element); + return Math.round(value * dpr) / dpr; +} +function useLatestRef(value) { + const ref = React.useRef(value); + index(() => { + ref.current = value; + }); + return ref; +} + +/** + * Provides data to position a floating element. + * @see https://floating-ui.com/docs/react + */ +function useFloating(options) { + if (options === void 0) { + options = {}; + } + const { + placement = 'bottom', + strategy = 'absolute', + middleware = [], + platform, + elements: { + reference: externalReference, + floating: externalFloating + } = {}, + transform = true, + whileElementsMounted, + open + } = options; + const [data, setData] = React.useState({ + x: 0, + y: 0, + strategy, + placement, + middlewareData: {}, + isPositioned: false + }); + const [latestMiddleware, setLatestMiddleware] = React.useState(middleware); + if (!deepEqual(latestMiddleware, middleware)) { + setLatestMiddleware(middleware); + } + const [_reference, _setReference] = React.useState(null); + const [_floating, _setFloating] = React.useState(null); + const setReference = React.useCallback(node => { + if (node != referenceRef.current) { + referenceRef.current = node; + _setReference(node); + } + }, [_setReference]); + const setFloating = React.useCallback(node => { + if (node !== floatingRef.current) { + floatingRef.current = node; + _setFloating(node); + } + }, [_setFloating]); + const referenceEl = externalReference || _reference; + const floatingEl = externalFloating || _floating; + const referenceRef = React.useRef(null); + const floatingRef = React.useRef(null); + const dataRef = React.useRef(data); + const whileElementsMountedRef = useLatestRef(whileElementsMounted); + const platformRef = useLatestRef(platform); + const update = React.useCallback(() => { + if (!referenceRef.current || !floatingRef.current) { + return; + } + const config = { + placement, + strategy, + middleware: latestMiddleware + }; + if (platformRef.current) { + config.platform = platformRef.current; + } + (0, _dom.computePosition)(referenceRef.current, floatingRef.current, config).then(data => { + const fullData = { + ...data, + isPositioned: true + }; + if (isMountedRef.current && !deepEqual(dataRef.current, fullData)) { + dataRef.current = fullData; + ReactDOM.flushSync(() => { + setData(fullData); + }); + } + }); + }, [latestMiddleware, placement, strategy, platformRef]); + index(() => { + if (open === false && dataRef.current.isPositioned) { + dataRef.current.isPositioned = false; + setData(data => ({ + ...data, + isPositioned: false + })); + } + }, [open]); + const isMountedRef = React.useRef(false); + index(() => { + isMountedRef.current = true; + return () => { + isMountedRef.current = false; + }; + }, []); + index(() => { + if (referenceEl) referenceRef.current = referenceEl; + if (floatingEl) floatingRef.current = floatingEl; + if (referenceEl && floatingEl) { + if (whileElementsMountedRef.current) { + return whileElementsMountedRef.current(referenceEl, floatingEl, update); + } else { + update(); + } + } + }, [referenceEl, floatingEl, update, whileElementsMountedRef]); + const refs = React.useMemo(() => ({ + reference: referenceRef, + floating: floatingRef, + setReference, + setFloating + }), [setReference, setFloating]); + const elements = React.useMemo(() => ({ + reference: referenceEl, + floating: floatingEl + }), [referenceEl, floatingEl]); + const floatingStyles = React.useMemo(() => { + const initialStyles = { + position: strategy, + left: 0, + top: 0 + }; + if (!elements.floating) { + return initialStyles; + } + const x = roundByDPR(elements.floating, data.x); + const y = roundByDPR(elements.floating, data.y); + if (transform) { + return { + ...initialStyles, + transform: "translate(" + x + "px, " + y + "px)", + ...(getDPR(elements.floating) >= 1.5 && { + willChange: 'transform' + }) + }; + } + return { + position: strategy, + left: x, + top: y + }; + }, [strategy, transform, elements.floating, data.x, data.y]); + return React.useMemo(() => ({ + ...data, + update, + refs, + elements, + floatingStyles + }), [data, update, refs, elements, floatingStyles]); +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/animation/dist/Animation.es.js": +/*!***********************************************************************!*\ + !*** ../../../node_modules/@motionone/animation/dist/Animation.es.js ***! + \***********************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.Animation = void 0; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +var _easingEs = __webpack_require__(/*! ./utils/easing.es.js */ "../../../node_modules/@motionone/animation/dist/utils/easing.es.js"); +class Animation { + constructor(output) { + let keyframes = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : [0, 1]; + let { + easing, + duration: initialDuration = _utils.defaults.duration, + delay = _utils.defaults.delay, + endDelay = _utils.defaults.endDelay, + repeat = _utils.defaults.repeat, + offset, + direction = "normal" + } = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; + this.startTime = null; + this.rate = 1; + this.t = 0; + this.cancelTimestamp = null; + this.easing = _utils.noopReturn; + this.duration = 0; + this.totalDuration = 0; + this.repeat = 0; + this.playState = "idle"; + this.finished = new Promise((resolve, reject) => { + this.resolve = resolve; + this.reject = reject; + }); + easing = easing || _utils.defaults.easing; + if ((0, _utils.isEasingGenerator)(easing)) { + const custom = easing.createAnimation(keyframes); + easing = custom.easing; + keyframes = custom.keyframes || keyframes; + initialDuration = custom.duration || initialDuration; + } + this.repeat = repeat; + this.easing = (0, _utils.isEasingList)(easing) ? _utils.noopReturn : (0, _easingEs.getEasingFunction)(easing); + this.updateDuration(initialDuration); + const interpolate$1 = (0, _utils.interpolate)(keyframes, offset, (0, _utils.isEasingList)(easing) ? easing.map(_easingEs.getEasingFunction) : _utils.noopReturn); + this.tick = timestamp => { + var _a; + // TODO: Temporary fix for OptionsResolver typing + delay = delay; + let t = 0; + if (this.pauseTime !== undefined) { + t = this.pauseTime; + } else { + t = (timestamp - this.startTime) * this.rate; + } + this.t = t; + // Convert to seconds + t /= 1000; + // Rebase on delay + t = Math.max(t - delay, 0); + /** + * If this animation has finished, set the current time + * to the total duration. + */ + if (this.playState === "finished" && this.pauseTime === undefined) { + t = this.totalDuration; + } + /** + * Get the current progress (0-1) of the animation. If t is > + * than duration we'll get values like 2.5 (midway through the + * third iteration) + */ + const progress = t / this.duration; + // TODO progress += iterationStart + /** + * Get the current iteration (0 indexed). For instance the floor of + * 2.5 is 2. + */ + let currentIteration = Math.floor(progress); + /** + * Get the current progress of the iteration by taking the remainder + * so 2.5 is 0.5 through iteration 2 + */ + let iterationProgress = progress % 1.0; + if (!iterationProgress && progress >= 1) { + iterationProgress = 1; + } + /** + * If iteration progress is 1 we count that as the end + * of the previous iteration. + */ + iterationProgress === 1 && currentIteration--; + /** + * Reverse progress if we're not running in "normal" direction + */ + const iterationIsOdd = currentIteration % 2; + if (direction === "reverse" || direction === "alternate" && iterationIsOdd || direction === "alternate-reverse" && !iterationIsOdd) { + iterationProgress = 1 - iterationProgress; + } + const p = t >= this.totalDuration ? 1 : Math.min(iterationProgress, 1); + const latest = interpolate$1(this.easing(p)); + output(latest); + const isAnimationFinished = this.pauseTime === undefined && (this.playState === "finished" || t >= this.totalDuration + endDelay); + if (isAnimationFinished) { + this.playState = "finished"; + (_a = this.resolve) === null || _a === void 0 ? void 0 : _a.call(this, latest); + } else if (this.playState !== "idle") { + this.frameRequestId = requestAnimationFrame(this.tick); + } + }; + this.play(); + } + play() { + const now = performance.now(); + this.playState = "running"; + if (this.pauseTime !== undefined) { + this.startTime = now - this.pauseTime; + } else if (!this.startTime) { + this.startTime = now; + } + this.cancelTimestamp = this.startTime; + this.pauseTime = undefined; + this.frameRequestId = requestAnimationFrame(this.tick); + } + pause() { + this.playState = "paused"; + this.pauseTime = this.t; + } + finish() { + this.playState = "finished"; + this.tick(0); + } + stop() { + var _a; + this.playState = "idle"; + if (this.frameRequestId !== undefined) { + cancelAnimationFrame(this.frameRequestId); + } + (_a = this.reject) === null || _a === void 0 ? void 0 : _a.call(this, false); + } + cancel() { + this.stop(); + this.tick(this.cancelTimestamp); + } + reverse() { + this.rate *= -1; + } + commitStyles() {} + updateDuration(duration) { + this.duration = duration; + this.totalDuration = duration * (this.repeat + 1); + } + get currentTime() { + return this.t; + } + set currentTime(t) { + if (this.pauseTime !== undefined || this.rate === 0) { + this.pauseTime = t; + } else { + this.startTime = performance.now() - t / this.rate; + } + } + get playbackRate() { + return this.rate; + } + set playbackRate(rate) { + this.rate = rate; + } +} +exports.Animation = Animation; + +/***/ }), + +/***/ "../../../node_modules/@motionone/animation/dist/index.es.js": +/*!*******************************************************************!*\ + !*** ../../../node_modules/@motionone/animation/dist/index.es.js ***! + \*******************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +Object.defineProperty(exports, "Animation", ({ + enumerable: true, + get: function () { + return _AnimationEs.Animation; + } +})); +Object.defineProperty(exports, "getEasingFunction", ({ + enumerable: true, + get: function () { + return _easingEs.getEasingFunction; + } +})); +var _AnimationEs = __webpack_require__(/*! ./Animation.es.js */ "../../../node_modules/@motionone/animation/dist/Animation.es.js"); +var _easingEs = __webpack_require__(/*! ./utils/easing.es.js */ "../../../node_modules/@motionone/animation/dist/utils/easing.es.js"); + +/***/ }), + +/***/ "../../../node_modules/@motionone/animation/dist/utils/easing.es.js": +/*!**************************************************************************!*\ + !*** ../../../node_modules/@motionone/animation/dist/utils/easing.es.js ***! + \**************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.getEasingFunction = getEasingFunction; +var _easing = __webpack_require__(/*! @motionone/easing */ "../../../node_modules/@motionone/easing/dist/index.es.js"); +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +const namedEasings = { + ease: (0, _easing.cubicBezier)(0.25, 0.1, 0.25, 1.0), + "ease-in": (0, _easing.cubicBezier)(0.42, 0.0, 1.0, 1.0), + "ease-in-out": (0, _easing.cubicBezier)(0.42, 0.0, 0.58, 1.0), + "ease-out": (0, _easing.cubicBezier)(0.0, 0.0, 0.58, 1.0) +}; +const functionArgsRegex = /\((.*?)\)/; +function getEasingFunction(definition) { + // If already an easing function, return + if ((0, _utils.isFunction)(definition)) return definition; + // If an easing curve definition, return bezier function + if ((0, _utils.isCubicBezier)(definition)) return (0, _easing.cubicBezier)(...definition); + // If we have a predefined easing function, return + if (namedEasings[definition]) return namedEasings[definition]; + // If this is a steps function, attempt to create easing curve + if (definition.startsWith("steps")) { + const args = functionArgsRegex.exec(definition); + if (args) { + const argsArray = args[1].split(","); + return (0, _easing.steps)(parseFloat(argsArray[0]), argsArray[1].trim()); + } + } + return _utils.noopReturn; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/animate-style.es.js": +/*!*****************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/animate-style.es.js ***! + \*****************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.animateStyle = animateStyle; +var _dataEs = __webpack_require__(/*! ./data.es.js */ "../../../node_modules/@motionone/dom/dist/animate/data.es.js"); +var _cssVarEs = __webpack_require__(/*! ./utils/css-var.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/css-var.es.js"); +var _animation = __webpack_require__(/*! @motionone/animation */ "../../../node_modules/@motionone/animation/dist/index.es.js"); +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +var _transformsEs = __webpack_require__(/*! ./utils/transforms.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/transforms.es.js"); +var _easingEs = __webpack_require__(/*! ./utils/easing.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/easing.es.js"); +var _featureDetectionEs = __webpack_require__(/*! ./utils/feature-detection.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/feature-detection.es.js"); +var _keyframesEs = __webpack_require__(/*! ./utils/keyframes.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/keyframes.es.js"); +var _styleEs = __webpack_require__(/*! ./style.es.js */ "../../../node_modules/@motionone/dom/dist/animate/style.es.js"); +var _getStyleNameEs = __webpack_require__(/*! ./utils/get-style-name.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/get-style-name.es.js"); +var _stopAnimationEs = __webpack_require__(/*! ./utils/stop-animation.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/stop-animation.es.js"); +function getDevToolsRecord() { + return window.__MOTION_DEV_TOOLS_RECORD; +} +function animateStyle(element, key, keyframesDefinition) { + let options = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : {}; + const record = getDevToolsRecord(); + const isRecording = options.record !== false && record; + let animation; + let { + duration = _utils.defaults.duration, + delay = _utils.defaults.delay, + endDelay = _utils.defaults.endDelay, + repeat = _utils.defaults.repeat, + easing = _utils.defaults.easing, + direction, + offset, + allowWebkitAcceleration = false + } = options; + const data = (0, _dataEs.getAnimationData)(element); + let canAnimateNatively = _featureDetectionEs.supports.waapi(); + const valueIsTransform = (0, _transformsEs.isTransform)(key); + /** + * If this is an individual transform, we need to map its + * key to a CSS variable and update the element's transform style + */ + valueIsTransform && (0, _transformsEs.addTransformToElement)(element, key); + const name = (0, _getStyleNameEs.getStyleName)(key); + const motionValue = (0, _dataEs.getMotionValue)(data.values, name); + /** + * Get definition of value, this will be used to convert numerical + * keyframes into the default value type. + */ + const definition = _transformsEs.transformDefinitions.get(name); + /** + * Stop the current animation, if any. Because this will trigger + * commitStyles (DOM writes) and we might later trigger DOM reads, + * this is fired now and we return a factory function to create + * the actual animation that can get called in batch, + */ + (0, _stopAnimationEs.stopAnimation)(motionValue.animation, !((0, _utils.isEasingGenerator)(easing) && motionValue.generator) && options.record !== false); + /** + * Batchable factory function containing all DOM reads. + */ + return () => { + const readInitialValue = () => { + var _a, _b; + return (_b = (_a = _styleEs.style.get(element, name)) !== null && _a !== void 0 ? _a : definition === null || definition === void 0 ? void 0 : definition.initialValue) !== null && _b !== void 0 ? _b : 0; + }; + /** + * Replace null values with the previous keyframe value, or read + * it from the DOM if it's the first keyframe. + */ + let keyframes = (0, _keyframesEs.hydrateKeyframes)((0, _keyframesEs.keyframesList)(keyframesDefinition), readInitialValue); + if ((0, _utils.isEasingGenerator)(easing)) { + const custom = easing.createAnimation(keyframes, readInitialValue, valueIsTransform, name, motionValue); + easing = custom.easing; + if (custom.keyframes !== undefined) keyframes = custom.keyframes; + if (custom.duration !== undefined) duration = custom.duration; + } + /** + * If this is a CSS variable we need to register it with the browser + * before it can be animated natively. We also set it with setProperty + * rather than directly onto the element.style object. + */ + if ((0, _cssVarEs.isCssVar)(name)) { + if (_featureDetectionEs.supports.cssRegisterProperty()) { + (0, _cssVarEs.registerCssVariable)(name); + } else { + canAnimateNatively = false; + } + } + /** + * If we can animate this value with WAAPI, do so. Currently this only + * feature detects CSS.registerProperty but could check WAAPI too. + */ + if (canAnimateNatively) { + /** + * Convert numbers to default value types. Currently this only supports + * transforms but it could also support other value types. + */ + if (definition) { + keyframes = keyframes.map(value => (0, _utils.isNumber)(value) ? definition.toDefaultUnit(value) : value); + } + /** + * If this browser doesn't support partial/implicit keyframes we need to + * explicitly provide one. + */ + if (keyframes.length === 1 && (!_featureDetectionEs.supports.partialKeyframes() || isRecording)) { + keyframes.unshift(readInitialValue()); + } + const animationOptions = { + delay: _utils.time.ms(delay), + duration: _utils.time.ms(duration), + endDelay: _utils.time.ms(endDelay), + easing: !(0, _utils.isEasingList)(easing) ? (0, _easingEs.convertEasing)(easing) : undefined, + direction, + iterations: repeat + 1, + fill: "both" + }; + animation = element.animate({ + [name]: keyframes, + offset, + easing: (0, _utils.isEasingList)(easing) ? easing.map(_easingEs.convertEasing) : undefined + }, animationOptions); + /** + * Polyfill finished Promise in browsers that don't support it + */ + if (!animation.finished) { + animation.finished = new Promise((resolve, reject) => { + animation.onfinish = resolve; + animation.oncancel = reject; + }); + } + const target = keyframes[keyframes.length - 1]; + animation.finished.then(() => { + // Apply styles to target + _styleEs.style.set(element, name, target); + // Ensure fill modes don't persist + animation.cancel(); + }).catch(_utils.noop); + /** + * This forces Webkit to run animations on the main thread by exploiting + * this condition: + * https://trac.webkit.org/browser/webkit/trunk/Source/WebCore/platform/graphics/ca/GraphicsLayerCA.cpp?rev=281238#L1099 + * + * This fixes Webkit's timing bugs, like accelerated animations falling + * out of sync with main thread animations and massive delays in starting + * accelerated animations in WKWebView. + */ + if (!allowWebkitAcceleration) animation.playbackRate = 1.000001; + /** + * If we can't animate the value natively then we can fallback to the numbers-only + * polyfill for transforms. + */ + } else if (valueIsTransform) { + /** + * If any keyframe is a string (because we measured it from the DOM), we need to convert + * it into a number before passing to the Animation polyfill. + */ + keyframes = keyframes.map(value => typeof value === "string" ? parseFloat(value) : value); + /** + * If we only have a single keyframe, we need to create an initial keyframe by reading + * the current value from the DOM. + */ + if (keyframes.length === 1) { + keyframes.unshift(parseFloat(readInitialValue())); + } + const render = latest => { + if (definition) latest = definition.toDefaultUnit(latest); + _styleEs.style.set(element, name, latest); + }; + animation = new _animation.Animation(render, keyframes, Object.assign(Object.assign({}, options), { + duration, + easing + })); + } else { + const target = keyframes[keyframes.length - 1]; + _styleEs.style.set(element, name, definition && (0, _utils.isNumber)(target) ? definition.toDefaultUnit(target) : target); + } + if (isRecording) { + record(element, key, keyframes, { + duration, + delay: delay, + easing, + repeat, + offset + }, "motion-one"); + } + motionValue.setAnimation(animation); + return animation; + }; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/data.es.js": +/*!********************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/data.es.js ***! + \********************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.getAnimationData = getAnimationData; +exports.getMotionValue = getMotionValue; +var _types = __webpack_require__(/*! @motionone/types */ "../../../node_modules/@motionone/types/dist/index.es.js"); +const data = new WeakMap(); +function getAnimationData(element) { + if (!data.has(element)) { + data.set(element, { + transforms: [], + values: new Map() + }); + } + return data.get(element); +} +function getMotionValue(motionValues, name) { + if (!motionValues.has(name)) { + motionValues.set(name, new _types.MotionValue()); + } + return motionValues.get(name); +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/index.es.js": +/*!*********************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/index.es.js ***! + \*********************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.animate = animate; +var _animateStyleEs = __webpack_require__(/*! ./animate-style.es.js */ "../../../node_modules/@motionone/dom/dist/animate/animate-style.es.js"); +var _optionsEs = __webpack_require__(/*! ./utils/options.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/options.es.js"); +var _resolveElementsEs = __webpack_require__(/*! ../utils/resolve-elements.es.js */ "../../../node_modules/@motionone/dom/dist/utils/resolve-elements.es.js"); +var _controlsEs = __webpack_require__(/*! ./utils/controls.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/controls.es.js"); +var _staggerEs = __webpack_require__(/*! ../utils/stagger.es.js */ "../../../node_modules/@motionone/dom/dist/utils/stagger.es.js"); +function animate(elements, keyframes) { + let options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; + elements = (0, _resolveElementsEs.resolveElements)(elements); + const numElements = elements.length; + /** + * Create and start new animations + */ + const animationFactories = []; + for (let i = 0; i < numElements; i++) { + const element = elements[i]; + for (const key in keyframes) { + const valueOptions = (0, _optionsEs.getOptions)(options, key); + valueOptions.delay = (0, _staggerEs.resolveOption)(valueOptions.delay, i, numElements); + const animation = (0, _animateStyleEs.animateStyle)(element, key, keyframes[key], valueOptions); + animationFactories.push(animation); + } + } + return (0, _controlsEs.withControls)(animationFactories, options, + /** + * TODO: + * If easing is set to spring or glide, duration will be dynamically + * generated. Ideally we would dynamically generate this from + * animation.effect.getComputedTiming().duration but this isn't + * supported in iOS13 or our number polyfill. Perhaps it's possible + * to Proxy animations returned from animateStyle that has duration + * as a getter. + */ + options.duration); +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/style.es.js": +/*!*********************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/style.es.js ***! + \*********************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.style = void 0; +var _cssVarEs = __webpack_require__(/*! ./utils/css-var.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/css-var.es.js"); +var _getStyleNameEs = __webpack_require__(/*! ./utils/get-style-name.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/get-style-name.es.js"); +var _transformsEs = __webpack_require__(/*! ./utils/transforms.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/transforms.es.js"); +const style = { + get: (element, name) => { + name = (0, _getStyleNameEs.getStyleName)(name); + let value = (0, _cssVarEs.isCssVar)(name) ? element.style.getPropertyValue(name) : getComputedStyle(element)[name]; + if (!value && value !== 0) { + const definition = _transformsEs.transformDefinitions.get(name); + if (definition) value = definition.initialValue; + } + return value; + }, + set: (element, name, value) => { + name = (0, _getStyleNameEs.getStyleName)(name); + if ((0, _cssVarEs.isCssVar)(name)) { + element.style.setProperty(name, value); + } else { + element.style[name] = value; + } + } +}; +exports.style = style; + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/utils/controls.es.js": +/*!******************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/utils/controls.es.js ***! + \******************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.withControls = exports.controls = void 0; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +var _stopAnimationEs = __webpack_require__(/*! ./stop-animation.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/stop-animation.es.js"); +const createAnimation = factory => factory(); +const withControls = function (animationFactory, options) { + let duration = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : _utils.defaults.duration; + return new Proxy({ + animations: animationFactory.map(createAnimation).filter(Boolean), + duration, + options + }, controls); +}; +/** + * TODO: + * Currently this returns the first animation, ideally it would return + * the first active animation. + */ +exports.withControls = withControls; +const getActiveAnimation = state => state.animations[0]; +const controls = { + get: (target, key) => { + const activeAnimation = getActiveAnimation(target); + switch (key) { + case "duration": + return target.duration; + case "currentTime": + return _utils.time.s((activeAnimation === null || activeAnimation === void 0 ? void 0 : activeAnimation[key]) || 0); + case "playbackRate": + case "playState": + return activeAnimation === null || activeAnimation === void 0 ? void 0 : activeAnimation[key]; + case "finished": + if (!target.finished) { + target.finished = Promise.all(target.animations.map(selectFinished)).catch(_utils.noop); + } + return target.finished; + case "stop": + return () => { + target.animations.forEach(animation => (0, _stopAnimationEs.stopAnimation)(animation)); + }; + case "forEachNative": + /** + * This is for internal use only, fire a callback for each + * underlying animation. + */ + return callback => { + target.animations.forEach(animation => callback(animation, target)); + }; + default: + return typeof (activeAnimation === null || activeAnimation === void 0 ? void 0 : activeAnimation[key]) === "undefined" ? undefined : () => target.animations.forEach(animation => animation[key]()); + } + }, + set: (target, key, value) => { + switch (key) { + case "currentTime": + value = _utils.time.ms(value); + case "currentTime": + case "playbackRate": + for (let i = 0; i < target.animations.length; i++) { + target.animations[i][key] = value; + } + return true; + } + return false; + } +}; +exports.controls = controls; +const selectFinished = animation => animation.finished; + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/utils/css-var.es.js": +/*!*****************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/utils/css-var.es.js ***! + \*****************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.isCssVar = void 0; +exports.registerCssVariable = registerCssVariable; +exports.registeredProperties = void 0; +var _transformsEs = __webpack_require__(/*! ./transforms.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/transforms.es.js"); +const isCssVar = name => name.startsWith("--"); +exports.isCssVar = isCssVar; +const registeredProperties = new Set(); +exports.registeredProperties = registeredProperties; +function registerCssVariable(name) { + if (registeredProperties.has(name)) return; + registeredProperties.add(name); + try { + const { + syntax, + initialValue + } = _transformsEs.transformDefinitions.has(name) ? _transformsEs.transformDefinitions.get(name) : {}; + CSS.registerProperty({ + name, + inherits: false, + syntax, + initialValue + }); + } catch (e) {} +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/utils/easing.es.js": +/*!****************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/utils/easing.es.js ***! + \****************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.cubicBezierAsString = exports.convertEasing = void 0; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +const convertEasing = easing => (0, _utils.isCubicBezier)(easing) ? cubicBezierAsString(easing) : easing; +exports.convertEasing = convertEasing; +const cubicBezierAsString = _ref => { + let [a, b, c, d] = _ref; + return `cubic-bezier(${a}, ${b}, ${c}, ${d})`; +}; +exports.cubicBezierAsString = cubicBezierAsString; + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/utils/feature-detection.es.js": +/*!***************************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/utils/feature-detection.es.js ***! + \***************************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.supports = void 0; +const testAnimation = keyframes => document.createElement("div").animate(keyframes, { + duration: 0.001 +}); +const featureTests = { + cssRegisterProperty: () => typeof CSS !== "undefined" && Object.hasOwnProperty.call(CSS, "registerProperty"), + waapi: () => Object.hasOwnProperty.call(Element.prototype, "animate"), + partialKeyframes: () => { + try { + testAnimation({ + opacity: [1] + }); + } catch (e) { + return false; + } + return true; + }, + finished: () => Boolean(testAnimation({ + opacity: [0, 1] + }).finished) +}; +const results = {}; +const supports = {}; +exports.supports = supports; +for (const key in featureTests) { + supports[key] = () => { + if (results[key] === undefined) results[key] = featureTests[key](); + return results[key]; + }; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/utils/get-style-name.es.js": +/*!************************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/utils/get-style-name.es.js ***! + \************************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.getStyleName = getStyleName; +var _transformsEs = __webpack_require__(/*! ./transforms.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/transforms.es.js"); +function getStyleName(key) { + if (_transformsEs.transformAlias[key]) key = _transformsEs.transformAlias[key]; + return (0, _transformsEs.isTransform)(key) ? (0, _transformsEs.asTransformCssVar)(key) : key; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/utils/keyframes.es.js": +/*!*******************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/utils/keyframes.es.js ***! + \*******************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.hydrateKeyframes = hydrateKeyframes; +exports.keyframesList = void 0; +function hydrateKeyframes(keyframes, readInitialValue) { + for (let i = 0; i < keyframes.length; i++) { + if (keyframes[i] === null) { + keyframes[i] = i ? keyframes[i - 1] : readInitialValue(); + } + } + return keyframes; +} +const keyframesList = keyframes => Array.isArray(keyframes) ? keyframes : [keyframes]; +exports.keyframesList = keyframesList; + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/utils/options.es.js": +/*!*****************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/utils/options.es.js ***! + \*****************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.getOptions = void 0; +const getOptions = (options, key) => +/** + * TODO: Make test for this + * Always return a new object otherwise delay is overwritten by results of stagger + * and this results in no stagger + */ +options[key] ? Object.assign(Object.assign({}, options), options[key]) : Object.assign({}, options); +exports.getOptions = getOptions; + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/utils/stop-animation.es.js": +/*!************************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/utils/stop-animation.es.js ***! + \************************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.stopAnimation = stopAnimation; +function stopAnimation(animation) { + let needsCommit = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true; + if (!animation || animation.playState === "finished") return; + // Suppress error thrown by WAAPI + try { + if (animation.stop) { + animation.stop(); + } else { + needsCommit && animation.commitStyles(); + animation.cancel(); + } + } catch (e) {} +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/utils/style-object.es.js": +/*!**********************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/utils/style-object.es.js ***! + \**********************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.createStyles = createStyles; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +var _transformsEs = __webpack_require__(/*! ./transforms.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/transforms.es.js"); +function createStyles(keyframes) { + const initialKeyframes = {}; + const transformKeys = []; + for (let key in keyframes) { + const value = keyframes[key]; + if ((0, _transformsEs.isTransform)(key)) { + if (_transformsEs.transformAlias[key]) key = _transformsEs.transformAlias[key]; + transformKeys.push(key); + key = (0, _transformsEs.asTransformCssVar)(key); + } + let initialKeyframe = Array.isArray(value) ? value[0] : value; + /** + * If this is a number and we have a default value type, convert the number + * to this type. + */ + const definition = _transformsEs.transformDefinitions.get(key); + if (definition) { + initialKeyframe = (0, _utils.isNumber)(value) ? definition.toDefaultUnit(value) : value; + } + initialKeyframes[key] = initialKeyframe; + } + if (transformKeys.length) { + initialKeyframes.transform = (0, _transformsEs.buildTransformTemplate)(transformKeys); + } + return initialKeyframes; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/utils/style-string.es.js": +/*!**********************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/utils/style-string.es.js ***! + \**********************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.createStyleString = createStyleString; +var _styleObjectEs = __webpack_require__(/*! ./style-object.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/style-object.es.js"); +const camelLetterToPipeLetter = letter => `-${letter.toLowerCase()}`; +const camelToPipeCase = str => str.replace(/[A-Z]/g, camelLetterToPipeLetter); +function createStyleString() { + let target = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {}; + const styles = (0, _styleObjectEs.createStyles)(target); + let style = ""; + for (const key in styles) { + style += key.startsWith("--") ? key : camelToPipeCase(key); + style += `: ${styles[key]}; `; + } + return style; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/animate/utils/transforms.es.js": +/*!********************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/animate/utils/transforms.es.js ***! + \********************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.transformDefinitions = exports.transformAlias = exports.isTransform = exports.compareTransformOrder = exports.buildTransformTemplate = exports.axes = exports.asTransformCssVar = exports.addTransformToElement = void 0; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +var _dataEs = __webpack_require__(/*! ../data.es.js */ "../../../node_modules/@motionone/dom/dist/animate/data.es.js"); +/** + * A list of all transformable axes. We'll use this list to generated a version + * of each axes for each transform. + */ +const axes = ["", "X", "Y", "Z"]; +/** + * An ordered array of each transformable value. By default, transform values + * will be sorted to this order. + */ +exports.axes = axes; +const order = ["translate", "scale", "rotate", "skew"]; +const transformAlias = { + x: "translateX", + y: "translateY", + z: "translateZ" +}; +exports.transformAlias = transformAlias; +const rotation = { + syntax: "", + initialValue: "0deg", + toDefaultUnit: v => v + "deg" +}; +const baseTransformProperties = { + translate: { + syntax: "", + initialValue: "0px", + toDefaultUnit: v => v + "px" + }, + rotate: rotation, + scale: { + syntax: "", + initialValue: 1, + toDefaultUnit: _utils.noopReturn + }, + skew: rotation +}; +const transformDefinitions = new Map(); +exports.transformDefinitions = transformDefinitions; +const asTransformCssVar = name => `--motion-${name}`; +/** + * Generate a list of every possible transform key + */ +exports.asTransformCssVar = asTransformCssVar; +const transforms = ["x", "y", "z"]; +order.forEach(name => { + axes.forEach(axis => { + transforms.push(name + axis); + transformDefinitions.set(asTransformCssVar(name + axis), baseTransformProperties[name]); + }); +}); +/** + * A function to use with Array.sort to sort transform keys by their default order. + */ +const compareTransformOrder = (a, b) => transforms.indexOf(a) - transforms.indexOf(b); +/** + * Provide a quick way to check if a string is the name of a transform + */ +exports.compareTransformOrder = compareTransformOrder; +const transformLookup = new Set(transforms); +const isTransform = name => transformLookup.has(name); +exports.isTransform = isTransform; +const addTransformToElement = (element, name) => { + // Map x to translateX etc + if (transformAlias[name]) name = transformAlias[name]; + const { + transforms + } = (0, _dataEs.getAnimationData)(element); + (0, _utils.addUniqueItem)(transforms, name); + /** + * TODO: An optimisation here could be to cache the transform in element data + * and only update if this has changed. + */ + element.style.transform = buildTransformTemplate(transforms); +}; +exports.addTransformToElement = addTransformToElement; +const buildTransformTemplate = transforms => transforms.sort(compareTransformOrder).reduce(transformListToString, "").trim(); +exports.buildTransformTemplate = buildTransformTemplate; +const transformListToString = (template, name) => `${template} ${name}(var(${asTransformCssVar(name)}))`; + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/easing/create-generator-easing.es.js": +/*!**************************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/easing/create-generator-easing.es.js ***! + \**************************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.createGeneratorEasing = createGeneratorEasing; +var _generators = __webpack_require__(/*! @motionone/generators */ "../../../node_modules/@motionone/generators/dist/index.es.js"); +function createGeneratorEasing(createGenerator) { + const keyframesCache = new WeakMap(); + return function () { + let options = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {}; + const generatorCache = new Map(); + const getGenerator = function () { + let from = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0; + let to = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 100; + let velocity = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 0; + let isScale = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : false; + const key = `${from}-${to}-${velocity}-${isScale}`; + if (!generatorCache.has(key)) { + generatorCache.set(key, createGenerator(Object.assign({ + from, + to, + velocity, + restSpeed: isScale ? 0.05 : 2, + restDistance: isScale ? 0.01 : 0.5 + }, options))); + } + return generatorCache.get(key); + }; + const getKeyframes = generator => { + if (!keyframesCache.has(generator)) { + keyframesCache.set(generator, (0, _generators.pregenerateKeyframes)(generator)); + } + return keyframesCache.get(generator); + }; + return { + createAnimation: (keyframes, getOrigin, canUseGenerator, name, motionValue) => { + var _a, _b; + let settings; + const numKeyframes = keyframes.length; + let shouldUseGenerator = canUseGenerator && numKeyframes <= 2 && keyframes.every(isNumberOrNull); + if (shouldUseGenerator) { + const target = keyframes[numKeyframes - 1]; + const unresolvedOrigin = numKeyframes === 1 ? null : keyframes[0]; + let velocity = 0; + let origin = 0; + const prevGenerator = motionValue === null || motionValue === void 0 ? void 0 : motionValue.generator; + if (prevGenerator) { + /** + * If we have a generator for this value we can use it to resolve + * the animations's current value and velocity. + */ + const { + animation, + generatorStartTime + } = motionValue; + const startTime = (animation === null || animation === void 0 ? void 0 : animation.startTime) || generatorStartTime || 0; + const currentTime = (animation === null || animation === void 0 ? void 0 : animation.currentTime) || performance.now() - startTime; + const prevGeneratorCurrent = prevGenerator(currentTime).current; + origin = (_a = unresolvedOrigin) !== null && _a !== void 0 ? _a : prevGeneratorCurrent; + if (numKeyframes === 1 || numKeyframes === 2 && keyframes[0] === null) { + velocity = (0, _generators.calcGeneratorVelocity)(t => prevGenerator(t).current, currentTime, prevGeneratorCurrent); + } + } else { + origin = (_b = unresolvedOrigin) !== null && _b !== void 0 ? _b : parseFloat(getOrigin()); + } + const generator = getGenerator(origin, target, velocity, name === null || name === void 0 ? void 0 : name.includes("scale")); + const keyframesMetadata = getKeyframes(generator); + settings = Object.assign(Object.assign({}, keyframesMetadata), { + easing: "linear" + }); + // TODO Add test for this + if (motionValue) { + motionValue.generator = generator; + motionValue.generatorStartTime = performance.now(); + } + } else { + const keyframesMetadata = getKeyframes(getGenerator(0, 100)); + settings = { + easing: "ease", + duration: keyframesMetadata.overshootDuration + }; + } + return settings; + } + }; + }; +} +const isNumberOrNull = value => typeof value !== "string"; + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/easing/glide/index.es.js": +/*!**************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/easing/glide/index.es.js ***! + \**************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.glide = void 0; +var _generators = __webpack_require__(/*! @motionone/generators */ "../../../node_modules/@motionone/generators/dist/index.es.js"); +var _createGeneratorEasingEs = __webpack_require__(/*! ../create-generator-easing.es.js */ "../../../node_modules/@motionone/dom/dist/easing/create-generator-easing.es.js"); +const glide = (0, _createGeneratorEasingEs.createGeneratorEasing)(_generators.glide); +exports.glide = glide; + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/easing/spring/index.es.js": +/*!***************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/easing/spring/index.es.js ***! + \***************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.spring = void 0; +var _generators = __webpack_require__(/*! @motionone/generators */ "../../../node_modules/@motionone/generators/dist/index.es.js"); +var _createGeneratorEasingEs = __webpack_require__(/*! ../create-generator-easing.es.js */ "../../../node_modules/@motionone/dom/dist/easing/create-generator-easing.es.js"); +const spring = (0, _createGeneratorEasingEs.createGeneratorEasing)(_generators.spring); +exports.spring = spring; + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/gestures/in-view.es.js": +/*!************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/gestures/in-view.es.js ***! + \************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.inView = inView; +var _resolveElementsEs = __webpack_require__(/*! ../utils/resolve-elements.es.js */ "../../../node_modules/@motionone/dom/dist/utils/resolve-elements.es.js"); +const thresholds = { + any: 0, + all: 1 +}; +function inView(elementOrSelector, onStart) { + let { + root, + margin: rootMargin, + amount = "any" + } = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; + /** + * If this browser doesn't support IntersectionObserver, return a dummy stop function. + * Default triggering of onStart is tricky - it could be used for starting/stopping + * videos, lazy loading content etc. We could provide an option to enable a fallback, or + * provide a fallback callback option. + */ + if (typeof IntersectionObserver === "undefined") { + return () => {}; + } + const elements = (0, _resolveElementsEs.resolveElements)(elementOrSelector); + const activeIntersections = new WeakMap(); + const onIntersectionChange = entries => { + entries.forEach(entry => { + const onEnd = activeIntersections.get(entry.target); + /** + * If there's no change to the intersection, we don't need to + * do anything here. + */ + if (entry.isIntersecting === Boolean(onEnd)) return; + if (entry.isIntersecting) { + const newOnEnd = onStart(entry); + if (typeof newOnEnd === "function") { + activeIntersections.set(entry.target, newOnEnd); + } else { + observer.unobserve(entry.target); + } + } else if (onEnd) { + onEnd(entry); + activeIntersections.delete(entry.target); + } + }); + }; + const observer = new IntersectionObserver(onIntersectionChange, { + root, + rootMargin, + threshold: typeof amount === "number" ? amount : thresholds[amount] + }); + elements.forEach(element => observer.observe(element)); + return () => observer.disconnect(); +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/gestures/resize/handle-element.es.js": +/*!**************************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/gestures/resize/handle-element.es.js ***! + \**************************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.resizeElement = resizeElement; +var _resolveElementsEs = __webpack_require__(/*! ../../utils/resolve-elements.es.js */ "../../../node_modules/@motionone/dom/dist/utils/resolve-elements.es.js"); +const resizeHandlers = new WeakMap(); +let observer; +function getElementSize(target, borderBoxSize) { + if (borderBoxSize) { + const { + inlineSize, + blockSize + } = borderBoxSize[0]; + return { + width: inlineSize, + height: blockSize + }; + } else if (target instanceof SVGElement && "getBBox" in target) { + return target.getBBox(); + } else { + return { + width: target.offsetWidth, + height: target.offsetHeight + }; + } +} +function notifyTarget(_ref) { + let { + target, + contentRect, + borderBoxSize + } = _ref; + var _a; + (_a = resizeHandlers.get(target)) === null || _a === void 0 ? void 0 : _a.forEach(handler => { + handler({ + target, + contentSize: contentRect, + get size() { + return getElementSize(target, borderBoxSize); + } + }); + }); +} +function notifyAll(entries) { + entries.forEach(notifyTarget); +} +function createResizeObserver() { + if (typeof ResizeObserver === "undefined") return; + observer = new ResizeObserver(notifyAll); +} +function resizeElement(target, handler) { + if (!observer) createResizeObserver(); + const elements = (0, _resolveElementsEs.resolveElements)(target); + elements.forEach(element => { + let elementHandlers = resizeHandlers.get(element); + if (!elementHandlers) { + elementHandlers = new Set(); + resizeHandlers.set(element, elementHandlers); + } + elementHandlers.add(handler); + observer === null || observer === void 0 ? void 0 : observer.observe(element); + }); + return () => { + elements.forEach(element => { + const elementHandlers = resizeHandlers.get(element); + elementHandlers === null || elementHandlers === void 0 ? void 0 : elementHandlers.delete(handler); + if (!(elementHandlers === null || elementHandlers === void 0 ? void 0 : elementHandlers.size)) { + observer === null || observer === void 0 ? void 0 : observer.unobserve(element); + } + }); + }; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/gestures/resize/handle-window.es.js": +/*!*************************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/gestures/resize/handle-window.es.js ***! + \*************************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.resizeWindow = resizeWindow; +const windowCallbacks = new Set(); +let windowResizeHandler; +function createWindowResizeHandler() { + windowResizeHandler = () => { + const size = { + width: window.innerWidth, + height: window.innerHeight + }; + const info = { + target: window, + size, + contentSize: size + }; + windowCallbacks.forEach(callback => callback(info)); + }; + window.addEventListener("resize", windowResizeHandler); +} +function resizeWindow(callback) { + windowCallbacks.add(callback); + if (!windowResizeHandler) createWindowResizeHandler(); + return () => { + windowCallbacks.delete(callback); + if (!windowCallbacks.size && windowResizeHandler) { + windowResizeHandler = undefined; + } + }; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/gestures/resize/index.es.js": +/*!*****************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/gestures/resize/index.es.js ***! + \*****************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.resize = resize; +var _handleElementEs = __webpack_require__(/*! ./handle-element.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/resize/handle-element.es.js"); +var _handleWindowEs = __webpack_require__(/*! ./handle-window.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/resize/handle-window.es.js"); +function resize(a, b) { + return typeof a === "function" ? (0, _handleWindowEs.resizeWindow)(a) : (0, _handleElementEs.resizeElement)(a, b); +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/gestures/scroll/index.es.js": +/*!*****************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/gestures/scroll/index.es.js ***! + \*****************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.scroll = scroll; +var _tslib = __webpack_require__(/*! tslib */ "../../../node_modules/tslib/tslib.es6.js"); +var _indexEs = __webpack_require__(/*! ../resize/index.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/resize/index.es.js"); +var _infoEs = __webpack_require__(/*! ./info.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/scroll/info.es.js"); +var _onScrollHandlerEs = __webpack_require__(/*! ./on-scroll-handler.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/scroll/on-scroll-handler.es.js"); +const scrollListeners = new WeakMap(); +const resizeListeners = new WeakMap(); +const onScrollHandlers = new WeakMap(); +const getEventTarget = element => element === document.documentElement ? window : element; +function scroll(onScroll) { + let _a = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + var { + container = document.documentElement + } = _a, + options = (0, _tslib.__rest)(_a, ["container"]); + let containerHandlers = onScrollHandlers.get(container); + /** + * Get the onScroll handlers for this container. + * If one isn't found, create a new one. + */ + if (!containerHandlers) { + containerHandlers = new Set(); + onScrollHandlers.set(container, containerHandlers); + } + /** + * Create a new onScroll handler for the provided callback. + */ + const info = (0, _infoEs.createScrollInfo)(); + const containerHandler = (0, _onScrollHandlerEs.createOnScrollHandler)(container, onScroll, info, options); + containerHandlers.add(containerHandler); + /** + * Check if there's a scroll event listener for this container. + * If not, create one. + */ + if (!scrollListeners.has(container)) { + const listener = () => { + const time = performance.now(); + for (const handler of containerHandlers) handler.measure(); + for (const handler of containerHandlers) handler.update(time); + for (const handler of containerHandlers) handler.notify(); + }; + scrollListeners.set(container, listener); + const target = getEventTarget(container); + window.addEventListener("resize", listener, { + passive: true + }); + if (container !== document.documentElement) { + resizeListeners.set(container, (0, _indexEs.resize)(container, listener)); + } + target.addEventListener("scroll", listener, { + passive: true + }); + } + const listener = scrollListeners.get(container); + const onLoadProcesss = requestAnimationFrame(listener); + return () => { + var _a; + if (typeof onScroll !== "function") onScroll.stop(); + cancelAnimationFrame(onLoadProcesss); + /** + * Check if we even have any handlers for this container. + */ + const containerHandlers = onScrollHandlers.get(container); + if (!containerHandlers) return; + containerHandlers.delete(containerHandler); + if (containerHandlers.size) return; + /** + * If no more handlers, remove the scroll listener too. + */ + const listener = scrollListeners.get(container); + scrollListeners.delete(container); + if (listener) { + getEventTarget(container).removeEventListener("scroll", listener); + (_a = resizeListeners.get(container)) === null || _a === void 0 ? void 0 : _a(); + window.removeEventListener("resize", listener); + } + }; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/gestures/scroll/info.es.js": +/*!****************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/gestures/scroll/info.es.js ***! + \****************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.createScrollInfo = void 0; +exports.updateScrollInfo = updateScrollInfo; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +/** + * A time in milliseconds, beyond which we consider the scroll velocity to be 0. + */ +const maxElapsed = 50; +const createAxisInfo = () => ({ + current: 0, + offset: [], + progress: 0, + scrollLength: 0, + targetOffset: 0, + targetLength: 0, + containerLength: 0, + velocity: 0 +}); +const createScrollInfo = () => ({ + time: 0, + x: createAxisInfo(), + y: createAxisInfo() +}); +exports.createScrollInfo = createScrollInfo; +const keys = { + x: { + length: "Width", + position: "Left" + }, + y: { + length: "Height", + position: "Top" + } +}; +function updateAxisInfo(element, axisName, info, time) { + const axis = info[axisName]; + const { + length, + position + } = keys[axisName]; + const prev = axis.current; + const prevTime = info.time; + axis.current = element["scroll" + position]; + axis.scrollLength = element["scroll" + length] - element["client" + length]; + axis.offset.length = 0; + axis.offset[0] = 0; + axis.offset[1] = axis.scrollLength; + axis.progress = (0, _utils.progress)(0, axis.scrollLength, axis.current); + const elapsed = time - prevTime; + axis.velocity = elapsed > maxElapsed ? 0 : (0, _utils.velocityPerSecond)(axis.current - prev, elapsed); +} +function updateScrollInfo(element, info, time) { + updateAxisInfo(element, "x", info, time); + updateAxisInfo(element, "y", info, time); + info.time = time; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/edge.es.js": +/*!************************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/edge.es.js ***! + \************************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.namedEdges = void 0; +exports.resolveEdge = resolveEdge; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +const namedEdges = { + start: 0, + center: 0.5, + end: 1 +}; +exports.namedEdges = namedEdges; +function resolveEdge(edge, length) { + let inset = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 0; + let delta = 0; + /** + * If we have this edge defined as a preset, replace the definition + * with the numerical value. + */ + if (namedEdges[edge] !== undefined) { + edge = namedEdges[edge]; + } + /** + * Handle unit values + */ + if ((0, _utils.isString)(edge)) { + const asNumber = parseFloat(edge); + if (edge.endsWith("px")) { + delta = asNumber; + } else if (edge.endsWith("%")) { + edge = asNumber / 100; + } else if (edge.endsWith("vw")) { + delta = asNumber / 100 * document.documentElement.clientWidth; + } else if (edge.endsWith("vh")) { + delta = asNumber / 100 * document.documentElement.clientHeight; + } else { + edge = asNumber; + } + } + /** + * If the edge is defined as a number, handle as a progress value. + */ + if ((0, _utils.isNumber)(edge)) { + delta = length * edge; + } + return inset + delta; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/index.es.js": +/*!*************************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/index.es.js ***! + \*************************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.resolveOffsets = resolveOffsets; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +var _insetEs = __webpack_require__(/*! ./inset.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/inset.es.js"); +var _presetsEs = __webpack_require__(/*! ./presets.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/presets.es.js"); +var _offsetEs = __webpack_require__(/*! ./offset.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/offset.es.js"); +const point = { + x: 0, + y: 0 +}; +function resolveOffsets(container, info, options) { + let { + offset: offsetDefinition = _presetsEs.ScrollOffset.All + } = options; + const { + target = container, + axis = "y" + } = options; + const lengthLabel = axis === "y" ? "height" : "width"; + const inset = target !== container ? (0, _insetEs.calcInset)(target, container) : point; + /** + * Measure the target and container. If they're the same thing then we + * use the container's scrollWidth/Height as the target, from there + * all other calculations can remain the same. + */ + const targetSize = target === container ? { + width: container.scrollWidth, + height: container.scrollHeight + } : { + width: target.clientWidth, + height: target.clientHeight + }; + const containerSize = { + width: container.clientWidth, + height: container.clientHeight + }; + /** + * Reset the length of the resolved offset array rather than creating a new one. + * TODO: More reusable data structures for targetSize/containerSize would also be good. + */ + info[axis].offset.length = 0; + /** + * Populate the offset array by resolving the user's offset definition into + * a list of pixel scroll offets. + */ + let hasChanged = !info[axis].interpolate; + const numOffsets = offsetDefinition.length; + for (let i = 0; i < numOffsets; i++) { + const offset = (0, _offsetEs.resolveOffset)(offsetDefinition[i], containerSize[lengthLabel], targetSize[lengthLabel], inset[axis]); + if (!hasChanged && offset !== info[axis].interpolatorOffsets[i]) { + hasChanged = true; + } + info[axis].offset[i] = offset; + } + /** + * If the pixel scroll offsets have changed, create a new interpolator function + * to map scroll value into a progress. + */ + if (hasChanged) { + info[axis].interpolate = (0, _utils.interpolate)((0, _utils.defaultOffset)(numOffsets), info[axis].offset); + info[axis].interpolatorOffsets = [...info[axis].offset]; + } + info[axis].progress = info[axis].interpolate(info[axis].current); +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/inset.es.js": +/*!*************************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/inset.es.js ***! + \*************************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.calcInset = calcInset; +function calcInset(element, container) { + let inset = { + x: 0, + y: 0 + }; + let current = element; + while (current && current !== container) { + if (current instanceof HTMLElement) { + inset.x += current.offsetLeft; + inset.y += current.offsetTop; + current = current.offsetParent; + } else if (current instanceof SVGGraphicsElement && "getBBox" in current) { + const { + top, + left + } = current.getBBox(); + inset.x += left; + inset.y += top; + /** + * Assign the next parent element as the tag. + */ + while (current && current.tagName !== "svg") { + current = current.parentNode; + } + } + } + return inset; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/offset.es.js": +/*!**************************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/offset.es.js ***! + \**************************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.resolveOffset = resolveOffset; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +var _edgeEs = __webpack_require__(/*! ./edge.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/edge.es.js"); +const defaultOffset = [0, 0]; +function resolveOffset(offset, containerLength, targetLength, targetInset) { + let offsetDefinition = Array.isArray(offset) ? offset : defaultOffset; + let targetPoint = 0; + let containerPoint = 0; + if ((0, _utils.isNumber)(offset)) { + /** + * If we're provided offset: [0, 0.5, 1] then each number x should become + * [x, x], so we default to the behaviour of mapping 0 => 0 of both target + * and container etc. + */ + offsetDefinition = [offset, offset]; + } else if ((0, _utils.isString)(offset)) { + offset = offset.trim(); + if (offset.includes(" ")) { + offsetDefinition = offset.split(" "); + } else { + /** + * If we're provided a definition like "100px" then we want to apply + * that only to the top of the target point, leaving the container at 0. + * Whereas a named offset like "end" should be applied to both. + */ + offsetDefinition = [offset, _edgeEs.namedEdges[offset] ? offset : `0`]; + } + } + targetPoint = (0, _edgeEs.resolveEdge)(offsetDefinition[0], targetLength, targetInset); + containerPoint = (0, _edgeEs.resolveEdge)(offsetDefinition[1], containerLength); + return targetPoint - containerPoint; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/presets.es.js": +/*!***************************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/presets.es.js ***! + \***************************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.ScrollOffset = void 0; +const ScrollOffset = { + Enter: [[0, 1], [1, 1]], + Exit: [[0, 0], [1, 0]], + Any: [[1, 0], [0, 1]], + All: [[0, 0], [1, 1]] +}; +exports.ScrollOffset = ScrollOffset; + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/gestures/scroll/on-scroll-handler.es.js": +/*!*****************************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/gestures/scroll/on-scroll-handler.es.js ***! + \*****************************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.createOnScrollHandler = createOnScrollHandler; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +var _infoEs = __webpack_require__(/*! ./info.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/scroll/info.es.js"); +var _indexEs = __webpack_require__(/*! ./offsets/index.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/index.es.js"); +function measure(container) { + let target = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : container; + let info = arguments.length > 2 ? arguments[2] : undefined; + /** + * Find inset of target within scrollable container + */ + info.x.targetOffset = 0; + info.y.targetOffset = 0; + if (target !== container) { + let node = target; + while (node && node != container) { + info.x.targetOffset += node.offsetLeft; + info.y.targetOffset += node.offsetTop; + node = node.offsetParent; + } + } + info.x.targetLength = target === container ? target.scrollWidth : target.clientWidth; + info.y.targetLength = target === container ? target.scrollHeight : target.clientHeight; + info.x.containerLength = container.clientWidth; + info.y.containerLength = container.clientHeight; +} +function createOnScrollHandler(element, onScroll, info) { + let options = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : {}; + const axis = options.axis || "y"; + return { + measure: () => measure(element, options.target, info), + update: time => { + (0, _infoEs.updateScrollInfo)(element, info, time); + if (options.offset || options.target) { + (0, _indexEs.resolveOffsets)(element, info, options); + } + }, + notify: typeof onScroll === "function" ? () => onScroll(info) : scrubAnimation(onScroll, info[axis]) + }; +} +function scrubAnimation(controls, axisInfo) { + controls.pause(); + controls.forEachNative((animation, _ref) => { + let { + easing + } = _ref; + var _a, _b; + if (animation.updateDuration) { + if (!easing) animation.easing = _utils.noopReturn; + animation.updateDuration(1); + } else { + const timingOptions = { + duration: 1000 + }; + if (!easing) timingOptions.easing = "linear"; + (_b = (_a = animation.effect) === null || _a === void 0 ? void 0 : _a.updateTiming) === null || _b === void 0 ? void 0 : _b.call(_a, timingOptions); + } + }); + return () => { + controls.currentTime = axisInfo.progress; + }; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/index.es.js": +/*!*************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/index.es.js ***! + \*************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +Object.defineProperty(exports, "ScrollOffset", ({ + enumerable: true, + get: function () { + return _presetsEs.ScrollOffset; + } +})); +Object.defineProperty(exports, "animate", ({ + enumerable: true, + get: function () { + return _indexEs.animate; + } +})); +Object.defineProperty(exports, "animateStyle", ({ + enumerable: true, + get: function () { + return _animateStyleEs.animateStyle; + } +})); +Object.defineProperty(exports, "createMotionState", ({ + enumerable: true, + get: function () { + return _indexEs7.createMotionState; + } +})); +Object.defineProperty(exports, "createStyleString", ({ + enumerable: true, + get: function () { + return _styleStringEs.createStyleString; + } +})); +Object.defineProperty(exports, "createStyles", ({ + enumerable: true, + get: function () { + return _styleObjectEs.createStyles; + } +})); +Object.defineProperty(exports, "getAnimationData", ({ + enumerable: true, + get: function () { + return _dataEs.getAnimationData; + } +})); +Object.defineProperty(exports, "getStyleName", ({ + enumerable: true, + get: function () { + return _getStyleNameEs.getStyleName; + } +})); +Object.defineProperty(exports, "glide", ({ + enumerable: true, + get: function () { + return _indexEs4.glide; + } +})); +Object.defineProperty(exports, "inView", ({ + enumerable: true, + get: function () { + return _inViewEs.inView; + } +})); +Object.defineProperty(exports, "mountedStates", ({ + enumerable: true, + get: function () { + return _indexEs7.mountedStates; + } +})); +Object.defineProperty(exports, "resize", ({ + enumerable: true, + get: function () { + return _indexEs5.resize; + } +})); +Object.defineProperty(exports, "scroll", ({ + enumerable: true, + get: function () { + return _indexEs6.scroll; + } +})); +Object.defineProperty(exports, "spring", ({ + enumerable: true, + get: function () { + return _indexEs3.spring; + } +})); +Object.defineProperty(exports, "stagger", ({ + enumerable: true, + get: function () { + return _staggerEs.stagger; + } +})); +Object.defineProperty(exports, "style", ({ + enumerable: true, + get: function () { + return _styleEs.style; + } +})); +Object.defineProperty(exports, "timeline", ({ + enumerable: true, + get: function () { + return _indexEs2.timeline; + } +})); +Object.defineProperty(exports, "withControls", ({ + enumerable: true, + get: function () { + return _controlsEs.withControls; + } +})); +var _indexEs = __webpack_require__(/*! ./animate/index.es.js */ "../../../node_modules/@motionone/dom/dist/animate/index.es.js"); +var _animateStyleEs = __webpack_require__(/*! ./animate/animate-style.es.js */ "../../../node_modules/@motionone/dom/dist/animate/animate-style.es.js"); +var _indexEs2 = __webpack_require__(/*! ./timeline/index.es.js */ "../../../node_modules/@motionone/dom/dist/timeline/index.es.js"); +var _staggerEs = __webpack_require__(/*! ./utils/stagger.es.js */ "../../../node_modules/@motionone/dom/dist/utils/stagger.es.js"); +var _indexEs3 = __webpack_require__(/*! ./easing/spring/index.es.js */ "../../../node_modules/@motionone/dom/dist/easing/spring/index.es.js"); +var _indexEs4 = __webpack_require__(/*! ./easing/glide/index.es.js */ "../../../node_modules/@motionone/dom/dist/easing/glide/index.es.js"); +var _styleEs = __webpack_require__(/*! ./animate/style.es.js */ "../../../node_modules/@motionone/dom/dist/animate/style.es.js"); +var _inViewEs = __webpack_require__(/*! ./gestures/in-view.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/in-view.es.js"); +var _indexEs5 = __webpack_require__(/*! ./gestures/resize/index.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/resize/index.es.js"); +var _indexEs6 = __webpack_require__(/*! ./gestures/scroll/index.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/scroll/index.es.js"); +var _presetsEs = __webpack_require__(/*! ./gestures/scroll/offsets/presets.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/scroll/offsets/presets.es.js"); +var _controlsEs = __webpack_require__(/*! ./animate/utils/controls.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/controls.es.js"); +var _dataEs = __webpack_require__(/*! ./animate/data.es.js */ "../../../node_modules/@motionone/dom/dist/animate/data.es.js"); +var _getStyleNameEs = __webpack_require__(/*! ./animate/utils/get-style-name.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/get-style-name.es.js"); +var _indexEs7 = __webpack_require__(/*! ./state/index.es.js */ "../../../node_modules/@motionone/dom/dist/state/index.es.js"); +var _styleObjectEs = __webpack_require__(/*! ./animate/utils/style-object.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/style-object.es.js"); +var _styleStringEs = __webpack_require__(/*! ./animate/utils/style-string.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/style-string.es.js"); + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/state/gestures/hover.es.js": +/*!****************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/state/gestures/hover.es.js ***! + \****************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.hover = void 0; +var _eventsEs = __webpack_require__(/*! ../utils/events.es.js */ "../../../node_modules/@motionone/dom/dist/state/utils/events.es.js"); +const mouseEvent = (element, name, action) => event => { + if (event.pointerType && event.pointerType !== "mouse") return; + action(); + (0, _eventsEs.dispatchPointerEvent)(element, name, event); +}; +const hover = { + isActive: options => Boolean(options.hover), + subscribe: (element, _ref) => { + let { + enable, + disable + } = _ref; + const onEnter = mouseEvent(element, "hoverstart", enable); + const onLeave = mouseEvent(element, "hoverend", disable); + element.addEventListener("pointerenter", onEnter); + element.addEventListener("pointerleave", onLeave); + return () => { + element.removeEventListener("pointerenter", onEnter); + element.removeEventListener("pointerleave", onLeave); + }; + } +}; +exports.hover = hover; + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/state/gestures/in-view.es.js": +/*!******************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/state/gestures/in-view.es.js ***! + \******************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.inView = void 0; +var _tslib = __webpack_require__(/*! tslib */ "../../../node_modules/tslib/tslib.es6.js"); +var _eventsEs = __webpack_require__(/*! ../utils/events.es.js */ "../../../node_modules/@motionone/dom/dist/state/utils/events.es.js"); +var _inViewEs = __webpack_require__(/*! ../../gestures/in-view.es.js */ "../../../node_modules/@motionone/dom/dist/gestures/in-view.es.js"); +const inView = { + isActive: options => Boolean(options.inView), + subscribe: (element, _ref, _ref2) => { + let { + enable, + disable + } = _ref; + let { + inViewOptions = {} + } = _ref2; + const { + once + } = inViewOptions, + viewOptions = (0, _tslib.__rest)(inViewOptions, ["once"]); + return (0, _inViewEs.inView)(element, enterEntry => { + enable(); + (0, _eventsEs.dispatchViewEvent)(element, "viewenter", enterEntry); + if (!once) { + return leaveEntry => { + disable(); + (0, _eventsEs.dispatchViewEvent)(element, "viewleave", leaveEntry); + }; + } + }, viewOptions); + } +}; +exports.inView = inView; + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/state/gestures/press.es.js": +/*!****************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/state/gestures/press.es.js ***! + \****************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.press = void 0; +var _eventsEs = __webpack_require__(/*! ../utils/events.es.js */ "../../../node_modules/@motionone/dom/dist/state/utils/events.es.js"); +const press = { + isActive: options => Boolean(options.press), + subscribe: (element, _ref) => { + let { + enable, + disable + } = _ref; + const onPointerUp = event => { + disable(); + (0, _eventsEs.dispatchPointerEvent)(element, "pressend", event); + window.removeEventListener("pointerup", onPointerUp); + }; + const onPointerDown = event => { + enable(); + (0, _eventsEs.dispatchPointerEvent)(element, "pressstart", event); + window.addEventListener("pointerup", onPointerUp); + }; + element.addEventListener("pointerdown", onPointerDown); + return () => { + element.removeEventListener("pointerdown", onPointerDown); + window.removeEventListener("pointerup", onPointerUp); + }; + } +}; +exports.press = press; + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/state/index.es.js": +/*!*******************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/state/index.es.js ***! + \*******************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.createMotionState = createMotionState; +exports.mountedStates = void 0; +var _tslib = __webpack_require__(/*! tslib */ "../../../node_modules/tslib/tslib.es6.js"); +var _heyListen = __webpack_require__(/*! hey-listen */ "../../../node_modules/hey-listen/dist/hey-listen.es.js"); +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +var _animateStyleEs = __webpack_require__(/*! ../animate/animate-style.es.js */ "../../../node_modules/@motionone/dom/dist/animate/animate-style.es.js"); +var _styleEs = __webpack_require__(/*! ../animate/style.es.js */ "../../../node_modules/@motionone/dom/dist/animate/style.es.js"); +var _optionsEs = __webpack_require__(/*! ../animate/utils/options.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/options.es.js"); +var _hasChangedEs = __webpack_require__(/*! ./utils/has-changed.es.js */ "../../../node_modules/@motionone/dom/dist/state/utils/has-changed.es.js"); +var _resolveVariantEs = __webpack_require__(/*! ./utils/resolve-variant.es.js */ "../../../node_modules/@motionone/dom/dist/state/utils/resolve-variant.es.js"); +var _scheduleEs = __webpack_require__(/*! ./utils/schedule.es.js */ "../../../node_modules/@motionone/dom/dist/state/utils/schedule.es.js"); +var _inViewEs = __webpack_require__(/*! ./gestures/in-view.es.js */ "../../../node_modules/@motionone/dom/dist/state/gestures/in-view.es.js"); +var _hoverEs = __webpack_require__(/*! ./gestures/hover.es.js */ "../../../node_modules/@motionone/dom/dist/state/gestures/hover.es.js"); +var _pressEs = __webpack_require__(/*! ./gestures/press.es.js */ "../../../node_modules/@motionone/dom/dist/state/gestures/press.es.js"); +var _eventsEs = __webpack_require__(/*! ./utils/events.es.js */ "../../../node_modules/@motionone/dom/dist/state/utils/events.es.js"); +const gestures = { + inView: _inViewEs.inView, + hover: _hoverEs.hover, + press: _pressEs.press +}; +/** + * A list of state types, in priority order. If a value is defined in + * a righter-most type, it will override any definition in a lefter-most. + */ +const stateTypes = ["initial", "animate", ...Object.keys(gestures), "exit"]; +/** + * A global store of all generated motion states. This can be used to lookup + * a motion state for a given Element. + */ +const mountedStates = new WeakMap(); +exports.mountedStates = mountedStates; +function createMotionState() { + let options = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {}; + let parent = arguments.length > 1 ? arguments[1] : undefined; + /** + * The element represented by the motion state. This is an empty reference + * when we create the state to support SSR and allow for later mounting + * in view libraries. + * + * @ts-ignore + */ + let element; + /** + * Calculate a depth that we can use to order motion states by tree depth. + */ + let depth = parent ? parent.getDepth() + 1 : 0; + /** + * Track which states are currently active. + */ + const activeStates = { + initial: true, + animate: true + }; + /** + * A map of functions that, when called, will remove event listeners for + * a given gesture. + */ + const gestureSubscriptions = {}; + /** + * Initialise a context to share through motion states. This + * will be populated by variant names (if any). + */ + const context = {}; + for (const name of stateTypes) { + context[name] = typeof options[name] === "string" ? options[name] : parent === null || parent === void 0 ? void 0 : parent.getContext()[name]; + } + /** + * If initial is set to false we use the animate prop as the initial + * animation state. + */ + const initialVariantSource = options.initial === false ? "animate" : "initial"; + /** + * Destructure an initial target out from the resolved initial variant. + */ + let _a = (0, _resolveVariantEs.resolveVariant)(options[initialVariantSource] || context[initialVariantSource], options.variants) || {}, + target = (0, _tslib.__rest)(_a, ["transition"]); + /** + * The base target is a cached map of values that we'll use to animate + * back to if a value is removed from all active state types. This + * is usually the initial value as read from the DOM, for instance if + * it hasn't been defined in initial. + */ + const baseTarget = Object.assign({}, target); + /** + * A generator that will be processed by the global animation scheduler. + * This yeilds when it switches from reading the DOM to writing to it + * to prevent layout thrashing. + */ + function* animateUpdates() { + var _a, _b; + const prevTarget = target; + target = {}; + const animationOptions = {}; + for (const name of stateTypes) { + if (!activeStates[name]) continue; + const variant = (0, _resolveVariantEs.resolveVariant)(options[name]); + if (!variant) continue; + for (const key in variant) { + if (key === "transition") continue; + target[key] = variant[key]; + animationOptions[key] = (0, _optionsEs.getOptions)((_b = (_a = variant.transition) !== null && _a !== void 0 ? _a : options.transition) !== null && _b !== void 0 ? _b : {}, key); + } + } + const allTargetKeys = new Set([...Object.keys(target), ...Object.keys(prevTarget)]); + const animationFactories = []; + allTargetKeys.forEach(key => { + var _a; + if (target[key] === undefined) { + target[key] = baseTarget[key]; + } + if ((0, _hasChangedEs.hasChanged)(prevTarget[key], target[key])) { + (_a = baseTarget[key]) !== null && _a !== void 0 ? _a : baseTarget[key] = _styleEs.style.get(element, key); + animationFactories.push((0, _animateStyleEs.animateStyle)(element, key, target[key], animationOptions[key])); + } + }); + // Wait for all animation states to read from the DOM + yield; + const animations = animationFactories.map(factory => factory()).filter(Boolean); + if (!animations.length) return; + const animationTarget = target; + element.dispatchEvent((0, _eventsEs.motionEvent)("motionstart", animationTarget)); + Promise.all(animations.map(animation => animation.finished)).then(() => { + element.dispatchEvent((0, _eventsEs.motionEvent)("motioncomplete", animationTarget)); + }).catch(_utils.noop); + } + const setGesture = (name, isActive) => () => { + activeStates[name] = isActive; + (0, _scheduleEs.scheduleAnimation)(state); + }; + const updateGestureSubscriptions = () => { + for (const name in gestures) { + const isGestureActive = gestures[name].isActive(options); + const remove = gestureSubscriptions[name]; + if (isGestureActive && !remove) { + gestureSubscriptions[name] = gestures[name].subscribe(element, { + enable: setGesture(name, true), + disable: setGesture(name, false) + }, options); + } else if (!isGestureActive && remove) { + remove(); + delete gestureSubscriptions[name]; + } + } + }; + const state = { + update: newOptions => { + if (!element) return; + options = newOptions; + updateGestureSubscriptions(); + (0, _scheduleEs.scheduleAnimation)(state); + }, + setActive: (name, isActive) => { + if (!element) return; + activeStates[name] = isActive; + (0, _scheduleEs.scheduleAnimation)(state); + }, + animateUpdates, + getDepth: () => depth, + getTarget: () => target, + getOptions: () => options, + getContext: () => context, + mount: newElement => { + (0, _heyListen.invariant)(Boolean(newElement), "Animation state must be mounted with valid Element"); + element = newElement; + mountedStates.set(element, state); + updateGestureSubscriptions(); + return () => { + mountedStates.delete(element); + (0, _scheduleEs.unscheduleAnimation)(state); + for (const key in gestureSubscriptions) { + gestureSubscriptions[key](); + } + }; + }, + isMounted: () => Boolean(element) + }; + return state; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/state/utils/events.es.js": +/*!**************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/state/utils/events.es.js ***! + \**************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.dispatchPointerEvent = dispatchPointerEvent; +exports.dispatchViewEvent = dispatchViewEvent; +exports.motionEvent = void 0; +const motionEvent = (name, target) => new CustomEvent(name, { + detail: { + target + } +}); +exports.motionEvent = motionEvent; +function dispatchPointerEvent(element, name, event) { + element.dispatchEvent(new CustomEvent(name, { + detail: { + originalEvent: event + } + })); +} +function dispatchViewEvent(element, name, entry) { + element.dispatchEvent(new CustomEvent(name, { + detail: { + originalEntry: entry + } + })); +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/state/utils/has-changed.es.js": +/*!*******************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/state/utils/has-changed.es.js ***! + \*******************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.hasChanged = hasChanged; +exports.shallowCompare = shallowCompare; +function hasChanged(a, b) { + if (typeof a !== typeof b) return true; + if (Array.isArray(a) && Array.isArray(b)) return !shallowCompare(a, b); + return a !== b; +} +function shallowCompare(next, prev) { + const prevLength = prev.length; + if (prevLength !== next.length) return false; + for (let i = 0; i < prevLength; i++) { + if (prev[i] !== next[i]) return false; + } + return true; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/state/utils/is-variant.es.js": +/*!******************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/state/utils/is-variant.es.js ***! + \******************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.isVariant = isVariant; +function isVariant(definition) { + return typeof definition === "object"; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/state/utils/resolve-variant.es.js": +/*!***********************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/state/utils/resolve-variant.es.js ***! + \***********************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.resolveVariant = resolveVariant; +var _isVariantEs = __webpack_require__(/*! ./is-variant.es.js */ "../../../node_modules/@motionone/dom/dist/state/utils/is-variant.es.js"); +function resolveVariant(definition, variants) { + if ((0, _isVariantEs.isVariant)(definition)) { + return definition; + } else if (definition && variants) { + return variants[definition]; + } +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/state/utils/schedule.es.js": +/*!****************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/state/utils/schedule.es.js ***! + \****************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.scheduleAnimation = scheduleAnimation; +exports.unscheduleAnimation = unscheduleAnimation; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +let scheduled = undefined; +function processScheduledAnimations() { + if (!scheduled) return; + const generators = scheduled.sort(compareByDepth).map(fireAnimateUpdates); + generators.forEach(fireNext); + generators.forEach(fireNext); + scheduled = undefined; +} +function scheduleAnimation(state) { + if (!scheduled) { + scheduled = [state]; + requestAnimationFrame(processScheduledAnimations); + } else { + (0, _utils.addUniqueItem)(scheduled, state); + } +} +function unscheduleAnimation(state) { + scheduled && (0, _utils.removeItem)(scheduled, state); +} +const compareByDepth = (a, b) => a.getDepth() - b.getDepth(); +const fireAnimateUpdates = state => state.animateUpdates(); +const fireNext = iterator => iterator.next(); + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/timeline/index.es.js": +/*!**********************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/timeline/index.es.js ***! + \**********************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.createAnimationsFromTimeline = createAnimationsFromTimeline; +exports.timeline = timeline; +var _tslib = __webpack_require__(/*! tslib */ "../../../node_modules/tslib/tslib.es6.js"); +var _heyListen = __webpack_require__(/*! hey-listen */ "../../../node_modules/hey-listen/dist/hey-listen.es.js"); +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +var _staggerEs = __webpack_require__(/*! ../utils/stagger.es.js */ "../../../node_modules/@motionone/dom/dist/utils/stagger.es.js"); +var _animateStyleEs = __webpack_require__(/*! ../animate/animate-style.es.js */ "../../../node_modules/@motionone/dom/dist/animate/animate-style.es.js"); +var _controlsEs = __webpack_require__(/*! ../animate/utils/controls.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/controls.es.js"); +var _keyframesEs = __webpack_require__(/*! ../animate/utils/keyframes.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/keyframes.es.js"); +var _optionsEs = __webpack_require__(/*! ../animate/utils/options.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/options.es.js"); +var _resolveElementsEs = __webpack_require__(/*! ../utils/resolve-elements.es.js */ "../../../node_modules/@motionone/dom/dist/utils/resolve-elements.es.js"); +var _transformsEs = __webpack_require__(/*! ../animate/utils/transforms.es.js */ "../../../node_modules/@motionone/dom/dist/animate/utils/transforms.es.js"); +var _calcTimeEs = __webpack_require__(/*! ./utils/calc-time.es.js */ "../../../node_modules/@motionone/dom/dist/timeline/utils/calc-time.es.js"); +var _editEs = __webpack_require__(/*! ./utils/edit.es.js */ "../../../node_modules/@motionone/dom/dist/timeline/utils/edit.es.js"); +var _sortEs = __webpack_require__(/*! ./utils/sort.es.js */ "../../../node_modules/@motionone/dom/dist/timeline/utils/sort.es.js"); +function timeline(definition) { + let options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + var _a; + const animationDefinitions = createAnimationsFromTimeline(definition, options); + /** + * Create and start animations + */ + const animationFactories = animationDefinitions.map(definition => (0, _animateStyleEs.animateStyle)(...definition)).filter(Boolean); + return (0, _controlsEs.withControls)(animationFactories, options, + // Get the duration from the first animation definition + (_a = animationDefinitions[0]) === null || _a === void 0 ? void 0 : _a[3].duration); +} +function createAnimationsFromTimeline(definition) { + let _a = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + var { + defaultOptions = {} + } = _a, + timelineOptions = (0, _tslib.__rest)(_a, ["defaultOptions"]); + const animationDefinitions = []; + const elementSequences = new Map(); + const elementCache = {}; + const timeLabels = new Map(); + let prevTime = 0; + let currentTime = 0; + let totalDuration = 0; + /** + * Build the timeline by mapping over the definition array and converting + * the definitions into keyframes and offsets with absolute time values. + * These will later get converted into relative offsets in a second pass. + */ + for (let i = 0; i < definition.length; i++) { + const segment = definition[i]; + /** + * If this is a timeline label, mark it and skip the rest of this iteration. + */ + if ((0, _utils.isString)(segment)) { + timeLabels.set(segment, currentTime); + continue; + } else if (!Array.isArray(segment)) { + timeLabels.set(segment.name, (0, _calcTimeEs.calcNextTime)(currentTime, segment.at, prevTime, timeLabels)); + continue; + } + const [elementDefinition, keyframes, options = {}] = segment; + /** + * If a relative or absolute time value has been specified we need to resolve + * it in relation to the currentTime. + */ + if (options.at !== undefined) { + currentTime = (0, _calcTimeEs.calcNextTime)(currentTime, options.at, prevTime, timeLabels); + } + /** + * Keep track of the maximum duration in this definition. This will be + * applied to currentTime once the definition has been parsed. + */ + let maxDuration = 0; + /** + * Find all the elements specified in the definition and parse value + * keyframes from their timeline definitions. + */ + const elements = (0, _resolveElementsEs.resolveElements)(elementDefinition, elementCache); + const numElements = elements.length; + for (let elementIndex = 0; elementIndex < numElements; elementIndex++) { + const element = elements[elementIndex]; + const elementSequence = getElementSequence(element, elementSequences); + for (const key in keyframes) { + const valueSequence = getValueSequence(key, elementSequence); + let valueKeyframes = (0, _keyframesEs.keyframesList)(keyframes[key]); + const valueOptions = (0, _optionsEs.getOptions)(options, key); + let { + duration = defaultOptions.duration || _utils.defaults.duration, + easing = defaultOptions.easing || _utils.defaults.easing + } = valueOptions; + if ((0, _utils.isEasingGenerator)(easing)) { + const valueIsTransform = (0, _transformsEs.isTransform)(key); + (0, _heyListen.invariant)(valueKeyframes.length === 2 || !valueIsTransform, "spring must be provided 2 keyframes within timeline"); + const custom = easing.createAnimation(valueKeyframes, + // TODO We currently only support explicit keyframes + // so this doesn't currently read from the DOM + () => "0", valueIsTransform); + easing = custom.easing; + if (custom.keyframes !== undefined) valueKeyframes = custom.keyframes; + if (custom.duration !== undefined) duration = custom.duration; + } + const delay = (0, _staggerEs.resolveOption)(options.delay, elementIndex, numElements) || 0; + const startTime = currentTime + delay; + const targetTime = startTime + duration; + /** + * + */ + let { + offset = (0, _utils.defaultOffset)(valueKeyframes.length) + } = valueOptions; + /** + * If there's only one offset of 0, fill in a second with length 1 + * + * TODO: Ensure there's a test that covers this removal + */ + if (offset.length === 1 && offset[0] === 0) { + offset[1] = 1; + } + /** + * Fill out if offset if fewer offsets than keyframes + */ + const remainder = length - valueKeyframes.length; + remainder > 0 && (0, _utils.fillOffset)(offset, remainder); + /** + * If only one value has been set, ie [1], push a null to the start of + * the keyframe array. This will let us mark a keyframe at this point + * that will later be hydrated with the previous value. + */ + valueKeyframes.length === 1 && valueKeyframes.unshift(null); + /** + * Add keyframes, mapping offsets to absolute time. + */ + (0, _editEs.addKeyframes)(valueSequence, valueKeyframes, easing, offset, startTime, targetTime); + maxDuration = Math.max(delay + duration, maxDuration); + totalDuration = Math.max(targetTime, totalDuration); + } + } + prevTime = currentTime; + currentTime += maxDuration; + } + /** + * For every element and value combination create a new animation. + */ + elementSequences.forEach((valueSequences, element) => { + for (const key in valueSequences) { + const valueSequence = valueSequences[key]; + /** + * Arrange all the keyframes in ascending time order. + */ + valueSequence.sort(_sortEs.compareByTime); + const keyframes = []; + const valueOffset = []; + const valueEasing = []; + /** + * For each keyframe, translate absolute times into + * relative offsets based on the total duration of the timeline. + */ + for (let i = 0; i < valueSequence.length; i++) { + const { + at, + value, + easing + } = valueSequence[i]; + keyframes.push(value); + valueOffset.push((0, _utils.progress)(0, totalDuration, at)); + valueEasing.push(easing || _utils.defaults.easing); + } + /** + * If the first keyframe doesn't land on offset: 0 + * provide one by duplicating the initial keyframe. This ensures + * it snaps to the first keyframe when the animation starts. + */ + if (valueOffset[0] !== 0) { + valueOffset.unshift(0); + keyframes.unshift(keyframes[0]); + valueEasing.unshift("linear"); + } + /** + * If the last keyframe doesn't land on offset: 1 + * provide one with a null wildcard value. This will ensure it + * stays static until the end of the animation. + */ + if (valueOffset[valueOffset.length - 1] !== 1) { + valueOffset.push(1); + keyframes.push(null); + } + animationDefinitions.push([element, key, keyframes, Object.assign(Object.assign(Object.assign({}, defaultOptions), { + duration: totalDuration, + easing: valueEasing, + offset: valueOffset + }), timelineOptions)]); + } + }); + return animationDefinitions; +} +function getElementSequence(element, sequences) { + !sequences.has(element) && sequences.set(element, {}); + return sequences.get(element); +} +function getValueSequence(name, sequences) { + if (!sequences[name]) sequences[name] = []; + return sequences[name]; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/timeline/utils/calc-time.es.js": +/*!********************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/timeline/utils/calc-time.es.js ***! + \********************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.calcNextTime = calcNextTime; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +function calcNextTime(current, next, prev, labels) { + var _a; + if ((0, _utils.isNumber)(next)) { + return next; + } else if (next.startsWith("-") || next.startsWith("+")) { + return Math.max(0, current + parseFloat(next)); + } else if (next === "<") { + return prev; + } else { + return (_a = labels.get(next)) !== null && _a !== void 0 ? _a : current; + } +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/timeline/utils/edit.es.js": +/*!***************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/timeline/utils/edit.es.js ***! + \***************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.addKeyframes = addKeyframes; +exports.eraseKeyframes = eraseKeyframes; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +function eraseKeyframes(sequence, startTime, endTime) { + for (let i = 0; i < sequence.length; i++) { + const keyframe = sequence[i]; + if (keyframe.at > startTime && keyframe.at < endTime) { + (0, _utils.removeItem)(sequence, keyframe); + // If we remove this item we have to push the pointer back one + i--; + } + } +} +function addKeyframes(sequence, keyframes, easing, offset, startTime, endTime) { + /** + * Erase every existing value between currentTime and targetTime, + * this will essentially splice this timeline into any currently + * defined ones. + */ + eraseKeyframes(sequence, startTime, endTime); + for (let i = 0; i < keyframes.length; i++) { + sequence.push({ + value: keyframes[i], + at: (0, _utils.mix)(startTime, endTime, offset[i]), + easing: (0, _utils.getEasingForSegment)(easing, i) + }); + } +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/timeline/utils/sort.es.js": +/*!***************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/timeline/utils/sort.es.js ***! + \***************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.compareByTime = compareByTime; +function compareByTime(a, b) { + if (a.at === b.at) { + return a.value === null ? 1 : -1; + } else { + return a.at - b.at; + } +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/utils/resolve-elements.es.js": +/*!******************************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/utils/resolve-elements.es.js ***! + \******************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.resolveElements = resolveElements; +function resolveElements(elements, selectorCache) { + var _a; + if (typeof elements === "string") { + if (selectorCache) { + (_a = selectorCache[elements]) !== null && _a !== void 0 ? _a : selectorCache[elements] = document.querySelectorAll(elements); + elements = selectorCache[elements]; + } else { + elements = document.querySelectorAll(elements); + } + } else if (elements instanceof Element) { + elements = [elements]; + } + /** + * Return an empty array + */ + return Array.from(elements || []); +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/dom/dist/utils/stagger.es.js": +/*!*********************************************************************!*\ + !*** ../../../node_modules/@motionone/dom/dist/utils/stagger.es.js ***! + \*********************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.getFromIndex = getFromIndex; +exports.resolveOption = resolveOption; +exports.stagger = stagger; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +var _animation = __webpack_require__(/*! @motionone/animation */ "../../../node_modules/@motionone/animation/dist/index.es.js"); +function stagger() { + let duration = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0.1; + let { + start = 0, + from = 0, + easing + } = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + return (i, total) => { + const fromIndex = (0, _utils.isNumber)(from) ? from : getFromIndex(from, total); + const distance = Math.abs(fromIndex - i); + let delay = duration * distance; + if (easing) { + const maxDelay = total * duration; + const easingFunction = (0, _animation.getEasingFunction)(easing); + delay = easingFunction(delay / maxDelay) * maxDelay; + } + return start + delay; + }; +} +function getFromIndex(from, total) { + if (from === "first") { + return 0; + } else { + const lastIndex = total - 1; + return from === "last" ? lastIndex : lastIndex / 2; + } +} +function resolveOption(option, i, total) { + return typeof option === "function" ? option(i, total) : option; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/easing/dist/cubic-bezier.es.js": +/*!***********************************************************************!*\ + !*** ../../../node_modules/@motionone/easing/dist/cubic-bezier.es.js ***! + \***********************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.cubicBezier = cubicBezier; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +/* + Bezier function generator + + This has been modified from Gaëtan Renaudeau's BezierEasing + https://github.com/gre/bezier-easing/blob/master/src/index.js + https://github.com/gre/bezier-easing/blob/master/LICENSE + + I've removed the newtonRaphsonIterate algo because in benchmarking it + wasn't noticiably faster than binarySubdivision, indeed removing it + usually improved times, depending on the curve. + + I also removed the lookup table, as for the added bundle size and loop we're + only cutting ~4 or so subdivision iterations. I bumped the max iterations up + to 12 to compensate and this still tended to be faster for no perceivable + loss in accuracy. + + Usage + const easeOut = cubicBezier(.17,.67,.83,.67); + const x = easeOut(0.5); // returns 0.627... +*/ +// Returns x(t) given t, x1, and x2, or y(t) given t, y1, and y2. +const calcBezier = (t, a1, a2) => (((1.0 - 3.0 * a2 + 3.0 * a1) * t + (3.0 * a2 - 6.0 * a1)) * t + 3.0 * a1) * t; +const subdivisionPrecision = 0.0000001; +const subdivisionMaxIterations = 12; +function binarySubdivide(x, lowerBound, upperBound, mX1, mX2) { + let currentX; + let currentT; + let i = 0; + do { + currentT = lowerBound + (upperBound - lowerBound) / 2.0; + currentX = calcBezier(currentT, mX1, mX2) - x; + if (currentX > 0.0) { + upperBound = currentT; + } else { + lowerBound = currentT; + } + } while (Math.abs(currentX) > subdivisionPrecision && ++i < subdivisionMaxIterations); + return currentT; +} +function cubicBezier(mX1, mY1, mX2, mY2) { + // If this is a linear gradient, return linear easing + if (mX1 === mY1 && mX2 === mY2) return _utils.noopReturn; + const getTForX = aX => binarySubdivide(aX, 0, 1, mX1, mX2); + // If animation is at start/end, return t without easing + return t => t === 0 || t === 1 ? t : calcBezier(getTForX(t), mY1, mY2); +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/easing/dist/index.es.js": +/*!****************************************************************!*\ + !*** ../../../node_modules/@motionone/easing/dist/index.es.js ***! + \****************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +Object.defineProperty(exports, "cubicBezier", ({ + enumerable: true, + get: function () { + return _cubicBezierEs.cubicBezier; + } +})); +Object.defineProperty(exports, "steps", ({ + enumerable: true, + get: function () { + return _stepsEs.steps; + } +})); +var _cubicBezierEs = __webpack_require__(/*! ./cubic-bezier.es.js */ "../../../node_modules/@motionone/easing/dist/cubic-bezier.es.js"); +var _stepsEs = __webpack_require__(/*! ./steps.es.js */ "../../../node_modules/@motionone/easing/dist/steps.es.js"); + +/***/ }), + +/***/ "../../../node_modules/@motionone/easing/dist/steps.es.js": +/*!****************************************************************!*\ + !*** ../../../node_modules/@motionone/easing/dist/steps.es.js ***! + \****************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.steps = void 0; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +const steps = function (steps) { + let direction = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : "end"; + return progress => { + progress = direction === "end" ? Math.min(progress, 0.999) : Math.max(progress, 0.001); + const expanded = progress * steps; + const rounded = direction === "end" ? Math.floor(expanded) : Math.ceil(expanded); + return (0, _utils.clamp)(0, 1, rounded / steps); + }; +}; +exports.steps = steps; + +/***/ }), + +/***/ "../../../node_modules/@motionone/generators/dist/glide/index.es.js": +/*!**************************************************************************!*\ + !*** ../../../node_modules/@motionone/generators/dist/glide/index.es.js ***! + \**************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.glide = void 0; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +var _velocityEs = __webpack_require__(/*! ../utils/velocity.es.js */ "../../../node_modules/@motionone/generators/dist/utils/velocity.es.js"); +var _indexEs = __webpack_require__(/*! ../spring/index.es.js */ "../../../node_modules/@motionone/generators/dist/spring/index.es.js"); +const glide = _ref => { + let { + from = 0, + velocity = 0.0, + power = 0.8, + decay = 0.325, + bounceDamping, + bounceStiffness, + changeTarget, + min, + max, + restDistance = 0.5, + restSpeed + } = _ref; + decay = _utils.time.ms(decay); + const state = { + hasReachedTarget: false, + done: false, + current: from, + target: from + }; + const isOutOfBounds = v => min !== undefined && v < min || max !== undefined && v > max; + const nearestBoundary = v => { + if (min === undefined) return max; + if (max === undefined) return min; + return Math.abs(min - v) < Math.abs(max - v) ? min : max; + }; + let amplitude = power * velocity; + const ideal = from + amplitude; + const target = changeTarget === undefined ? ideal : changeTarget(ideal); + state.target = target; + /** + * If the target has changed we need to re-calculate the amplitude, otherwise + * the animation will start from the wrong position. + */ + if (target !== ideal) amplitude = target - from; + const calcDelta = t => -amplitude * Math.exp(-t / decay); + const calcLatest = t => target + calcDelta(t); + const applyFriction = t => { + const delta = calcDelta(t); + const latest = calcLatest(t); + state.done = Math.abs(delta) <= restDistance; + state.current = state.done ? target : latest; + }; + /** + * Ideally this would resolve for t in a stateless way, we could + * do that by always precalculating the animation but as we know + * this will be done anyway we can assume that spring will + * be discovered during that. + */ + let timeReachedBoundary; + let spring$1; + const checkCatchBoundary = t => { + if (!isOutOfBounds(state.current)) return; + timeReachedBoundary = t; + spring$1 = (0, _indexEs.spring)({ + from: state.current, + to: nearestBoundary(state.current), + velocity: (0, _velocityEs.calcGeneratorVelocity)(calcLatest, t, state.current), + damping: bounceDamping, + stiffness: bounceStiffness, + restDistance, + restSpeed + }); + }; + checkCatchBoundary(0); + return t => { + /** + * We need to resolve the friction to figure out if we need a + * spring but we don't want to do this twice per frame. So here + * we flag if we updated for this frame and later if we did + * we can skip doing it again. + */ + let hasUpdatedFrame = false; + if (!spring$1 && timeReachedBoundary === undefined) { + hasUpdatedFrame = true; + applyFriction(t); + checkCatchBoundary(t); + } + /** + * If we have a spring and the provided t is beyond the moment the friction + * animation crossed the min/max boundary, use the spring. + */ + if (timeReachedBoundary !== undefined && t > timeReachedBoundary) { + state.hasReachedTarget = true; + return spring$1(t - timeReachedBoundary); + } else { + state.hasReachedTarget = false; + !hasUpdatedFrame && applyFriction(t); + return state; + } + }; +}; +exports.glide = glide; + +/***/ }), + +/***/ "../../../node_modules/@motionone/generators/dist/index.es.js": +/*!********************************************************************!*\ + !*** ../../../node_modules/@motionone/generators/dist/index.es.js ***! + \********************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +Object.defineProperty(exports, "calcGeneratorVelocity", ({ + enumerable: true, + get: function () { + return _velocityEs.calcGeneratorVelocity; + } +})); +Object.defineProperty(exports, "glide", ({ + enumerable: true, + get: function () { + return _indexEs.glide; + } +})); +Object.defineProperty(exports, "pregenerateKeyframes", ({ + enumerable: true, + get: function () { + return _pregenerateKeyframesEs.pregenerateKeyframes; + } +})); +Object.defineProperty(exports, "spring", ({ + enumerable: true, + get: function () { + return _indexEs2.spring; + } +})); +var _indexEs = __webpack_require__(/*! ./glide/index.es.js */ "../../../node_modules/@motionone/generators/dist/glide/index.es.js"); +var _indexEs2 = __webpack_require__(/*! ./spring/index.es.js */ "../../../node_modules/@motionone/generators/dist/spring/index.es.js"); +var _pregenerateKeyframesEs = __webpack_require__(/*! ./utils/pregenerate-keyframes.es.js */ "../../../node_modules/@motionone/generators/dist/utils/pregenerate-keyframes.es.js"); +var _velocityEs = __webpack_require__(/*! ./utils/velocity.es.js */ "../../../node_modules/@motionone/generators/dist/utils/velocity.es.js"); + +/***/ }), + +/***/ "../../../node_modules/@motionone/generators/dist/spring/defaults.es.js": +/*!******************************************************************************!*\ + !*** ../../../node_modules/@motionone/generators/dist/spring/defaults.es.js ***! + \******************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.defaults = void 0; +const defaults = { + stiffness: 100.0, + damping: 10.0, + mass: 1.0 +}; +exports.defaults = defaults; + +/***/ }), + +/***/ "../../../node_modules/@motionone/generators/dist/spring/index.es.js": +/*!***************************************************************************!*\ + !*** ../../../node_modules/@motionone/generators/dist/spring/index.es.js ***! + \***************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.spring = void 0; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +var _defaultsEs = __webpack_require__(/*! ./defaults.es.js */ "../../../node_modules/@motionone/generators/dist/spring/defaults.es.js"); +var _utilsEs = __webpack_require__(/*! ./utils.es.js */ "../../../node_modules/@motionone/generators/dist/spring/utils.es.js"); +var _hasReachedTargetEs = __webpack_require__(/*! ../utils/has-reached-target.es.js */ "../../../node_modules/@motionone/generators/dist/utils/has-reached-target.es.js"); +var _velocityEs = __webpack_require__(/*! ../utils/velocity.es.js */ "../../../node_modules/@motionone/generators/dist/utils/velocity.es.js"); +const spring = function () { + let { + stiffness = _defaultsEs.defaults.stiffness, + damping = _defaultsEs.defaults.damping, + mass = _defaultsEs.defaults.mass, + from = 0, + to = 1, + velocity = 0.0, + restSpeed = 2, + restDistance = 0.5 + } = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {}; + velocity = velocity ? _utils.time.s(velocity) : 0.0; + const state = { + done: false, + hasReachedTarget: false, + current: from, + target: to + }; + const initialDelta = to - from; + const undampedAngularFreq = Math.sqrt(stiffness / mass) / 1000; + const dampingRatio = (0, _utilsEs.calcDampingRatio)(stiffness, damping, mass); + let resolveSpring; + if (dampingRatio < 1) { + const angularFreq = undampedAngularFreq * Math.sqrt(1 - dampingRatio * dampingRatio); + // Underdamped spring (bouncy) + resolveSpring = t => to - Math.exp(-dampingRatio * undampedAngularFreq * t) * ((-velocity + dampingRatio * undampedAngularFreq * initialDelta) / angularFreq * Math.sin(angularFreq * t) + initialDelta * Math.cos(angularFreq * t)); + } else { + // Critically damped spring + resolveSpring = t => { + return to - Math.exp(-undampedAngularFreq * t) * (initialDelta + (-velocity + undampedAngularFreq * initialDelta) * t); + }; + } + return t => { + state.current = resolveSpring(t); + const currentVelocity = t === 0 ? velocity : (0, _velocityEs.calcGeneratorVelocity)(resolveSpring, t, state.current); + const isBelowVelocityThreshold = Math.abs(currentVelocity) <= restSpeed; + const isBelowDisplacementThreshold = Math.abs(to - state.current) <= restDistance; + state.done = isBelowVelocityThreshold && isBelowDisplacementThreshold; + state.hasReachedTarget = (0, _hasReachedTargetEs.hasReachedTarget)(from, to, state.current); + return state; + }; +}; +exports.spring = spring; + +/***/ }), + +/***/ "../../../node_modules/@motionone/generators/dist/spring/utils.es.js": +/*!***************************************************************************!*\ + !*** ../../../node_modules/@motionone/generators/dist/spring/utils.es.js ***! + \***************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.calcDampingRatio = void 0; +var _defaultsEs = __webpack_require__(/*! ./defaults.es.js */ "../../../node_modules/@motionone/generators/dist/spring/defaults.es.js"); +const calcDampingRatio = function () { + let stiffness = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : _defaultsEs.defaults.stiffness; + let damping = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : _defaultsEs.defaults.damping; + let mass = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : _defaultsEs.defaults.mass; + return damping / (2 * Math.sqrt(stiffness * mass)); +}; +exports.calcDampingRatio = calcDampingRatio; + +/***/ }), + +/***/ "../../../node_modules/@motionone/generators/dist/utils/has-reached-target.es.js": +/*!***************************************************************************************!*\ + !*** ../../../node_modules/@motionone/generators/dist/utils/has-reached-target.es.js ***! + \***************************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.hasReachedTarget = hasReachedTarget; +function hasReachedTarget(origin, target, current) { + return origin < target && current >= target || origin > target && current <= target; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/generators/dist/utils/pregenerate-keyframes.es.js": +/*!******************************************************************************************!*\ + !*** ../../../node_modules/@motionone/generators/dist/utils/pregenerate-keyframes.es.js ***! + \******************************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.pregenerateKeyframes = pregenerateKeyframes; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +const timeStep = 10; +const maxDuration = 10000; +function pregenerateKeyframes(generator) { + let toUnit = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : _utils.noopReturn; + let overshootDuration = undefined; + let timestamp = timeStep; + let state = generator(0); + const keyframes = [toUnit(state.current)]; + while (!state.done && timestamp < maxDuration) { + state = generator(timestamp); + keyframes.push(toUnit(state.done ? state.target : state.current)); + if (overshootDuration === undefined && state.hasReachedTarget) { + overshootDuration = timestamp; + } + timestamp += timeStep; + } + const duration = timestamp - timeStep; + /** + * If generating an animation that didn't actually move, + * generate a second keyframe so we have an origin and target. + */ + if (keyframes.length === 1) keyframes.push(state.current); + return { + keyframes, + duration: duration / 1000, + overshootDuration: (overshootDuration !== null && overshootDuration !== void 0 ? overshootDuration : duration) / 1000 + }; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/generators/dist/utils/velocity.es.js": +/*!*****************************************************************************!*\ + !*** ../../../node_modules/@motionone/generators/dist/utils/velocity.es.js ***! + \*****************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.calcGeneratorVelocity = calcGeneratorVelocity; +var _utils = __webpack_require__(/*! @motionone/utils */ "../../../node_modules/@motionone/utils/dist/index.es.js"); +const sampleT = 5; // ms +function calcGeneratorVelocity(resolveValue, t, current) { + const prevT = Math.max(t - sampleT, 0); + return (0, _utils.velocityPerSecond)(current - resolveValue(prevT), t - prevT); +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/types/dist/MotionValue.es.js": +/*!*********************************************************************!*\ + !*** ../../../node_modules/@motionone/types/dist/MotionValue.es.js ***! + \*********************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.MotionValue = void 0; +/** + * The MotionValue tracks the state of a single animatable + * value. Currently, updatedAt and current are unused. The + * long term idea is to use this to minimise the number + * of DOM reads, and to abstract the DOM interactions here. + */ +class MotionValue { + setAnimation(animation) { + this.animation = animation; + animation === null || animation === void 0 ? void 0 : animation.finished.then(() => this.clearAnimation()).catch(() => {}); + } + clearAnimation() { + this.animation = this.generator = undefined; + } +} +exports.MotionValue = MotionValue; + +/***/ }), + +/***/ "../../../node_modules/@motionone/types/dist/index.es.js": +/*!***************************************************************!*\ + !*** ../../../node_modules/@motionone/types/dist/index.es.js ***! + \***************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +Object.defineProperty(exports, "MotionValue", ({ + enumerable: true, + get: function () { + return _MotionValueEs.MotionValue; + } +})); +var _MotionValueEs = __webpack_require__(/*! ./MotionValue.es.js */ "../../../node_modules/@motionone/types/dist/MotionValue.es.js"); + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/array.es.js": +/*!***************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/array.es.js ***! + \***************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.addUniqueItem = addUniqueItem; +exports.removeItem = removeItem; +function addUniqueItem(array, item) { + array.indexOf(item) === -1 && array.push(item); +} +function removeItem(arr, item) { + const index = arr.indexOf(item); + index > -1 && arr.splice(index, 1); +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/clamp.es.js": +/*!***************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/clamp.es.js ***! + \***************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.clamp = void 0; +const clamp = (min, max, v) => Math.min(Math.max(v, min), max); +exports.clamp = clamp; + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/defaults.es.js": +/*!******************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/defaults.es.js ***! + \******************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.defaults = void 0; +const defaults = { + duration: 0.3, + delay: 0, + endDelay: 0, + repeat: 0, + easing: "ease" +}; +exports.defaults = defaults; + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/easing.es.js": +/*!****************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/easing.es.js ***! + \****************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.getEasingForSegment = getEasingForSegment; +var _isEasingListEs = __webpack_require__(/*! ./is-easing-list.es.js */ "../../../node_modules/@motionone/utils/dist/is-easing-list.es.js"); +var _wrapEs = __webpack_require__(/*! ./wrap.es.js */ "../../../node_modules/@motionone/utils/dist/wrap.es.js"); +function getEasingForSegment(easing, i) { + return (0, _isEasingListEs.isEasingList)(easing) ? easing[(0, _wrapEs.wrap)(0, easing.length, i)] : easing; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/index.es.js": +/*!***************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/index.es.js ***! + \***************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +Object.defineProperty(exports, "addUniqueItem", ({ + enumerable: true, + get: function () { + return _arrayEs.addUniqueItem; + } +})); +Object.defineProperty(exports, "clamp", ({ + enumerable: true, + get: function () { + return _clampEs.clamp; + } +})); +Object.defineProperty(exports, "defaultOffset", ({ + enumerable: true, + get: function () { + return _offsetEs.defaultOffset; + } +})); +Object.defineProperty(exports, "defaults", ({ + enumerable: true, + get: function () { + return _defaultsEs.defaults; + } +})); +Object.defineProperty(exports, "fillOffset", ({ + enumerable: true, + get: function () { + return _offsetEs.fillOffset; + } +})); +Object.defineProperty(exports, "getEasingForSegment", ({ + enumerable: true, + get: function () { + return _easingEs.getEasingForSegment; + } +})); +Object.defineProperty(exports, "interpolate", ({ + enumerable: true, + get: function () { + return _interpolateEs.interpolate; + } +})); +Object.defineProperty(exports, "isCubicBezier", ({ + enumerable: true, + get: function () { + return _isCubicBezierEs.isCubicBezier; + } +})); +Object.defineProperty(exports, "isEasingGenerator", ({ + enumerable: true, + get: function () { + return _isEasingGeneratorEs.isEasingGenerator; + } +})); +Object.defineProperty(exports, "isEasingList", ({ + enumerable: true, + get: function () { + return _isEasingListEs.isEasingList; + } +})); +Object.defineProperty(exports, "isFunction", ({ + enumerable: true, + get: function () { + return _isFunctionEs.isFunction; + } +})); +Object.defineProperty(exports, "isNumber", ({ + enumerable: true, + get: function () { + return _isNumberEs.isNumber; + } +})); +Object.defineProperty(exports, "isString", ({ + enumerable: true, + get: function () { + return _isStringEs.isString; + } +})); +Object.defineProperty(exports, "mix", ({ + enumerable: true, + get: function () { + return _mixEs.mix; + } +})); +Object.defineProperty(exports, "noop", ({ + enumerable: true, + get: function () { + return _noopEs.noop; + } +})); +Object.defineProperty(exports, "noopReturn", ({ + enumerable: true, + get: function () { + return _noopEs.noopReturn; + } +})); +Object.defineProperty(exports, "progress", ({ + enumerable: true, + get: function () { + return _progressEs.progress; + } +})); +Object.defineProperty(exports, "removeItem", ({ + enumerable: true, + get: function () { + return _arrayEs.removeItem; + } +})); +Object.defineProperty(exports, "time", ({ + enumerable: true, + get: function () { + return _timeEs.time; + } +})); +Object.defineProperty(exports, "velocityPerSecond", ({ + enumerable: true, + get: function () { + return _velocityEs.velocityPerSecond; + } +})); +Object.defineProperty(exports, "wrap", ({ + enumerable: true, + get: function () { + return _wrapEs.wrap; + } +})); +var _arrayEs = __webpack_require__(/*! ./array.es.js */ "../../../node_modules/@motionone/utils/dist/array.es.js"); +var _clampEs = __webpack_require__(/*! ./clamp.es.js */ "../../../node_modules/@motionone/utils/dist/clamp.es.js"); +var _defaultsEs = __webpack_require__(/*! ./defaults.es.js */ "../../../node_modules/@motionone/utils/dist/defaults.es.js"); +var _easingEs = __webpack_require__(/*! ./easing.es.js */ "../../../node_modules/@motionone/utils/dist/easing.es.js"); +var _interpolateEs = __webpack_require__(/*! ./interpolate.es.js */ "../../../node_modules/@motionone/utils/dist/interpolate.es.js"); +var _isCubicBezierEs = __webpack_require__(/*! ./is-cubic-bezier.es.js */ "../../../node_modules/@motionone/utils/dist/is-cubic-bezier.es.js"); +var _isEasingGeneratorEs = __webpack_require__(/*! ./is-easing-generator.es.js */ "../../../node_modules/@motionone/utils/dist/is-easing-generator.es.js"); +var _isEasingListEs = __webpack_require__(/*! ./is-easing-list.es.js */ "../../../node_modules/@motionone/utils/dist/is-easing-list.es.js"); +var _isFunctionEs = __webpack_require__(/*! ./is-function.es.js */ "../../../node_modules/@motionone/utils/dist/is-function.es.js"); +var _isNumberEs = __webpack_require__(/*! ./is-number.es.js */ "../../../node_modules/@motionone/utils/dist/is-number.es.js"); +var _isStringEs = __webpack_require__(/*! ./is-string.es.js */ "../../../node_modules/@motionone/utils/dist/is-string.es.js"); +var _mixEs = __webpack_require__(/*! ./mix.es.js */ "../../../node_modules/@motionone/utils/dist/mix.es.js"); +var _noopEs = __webpack_require__(/*! ./noop.es.js */ "../../../node_modules/@motionone/utils/dist/noop.es.js"); +var _offsetEs = __webpack_require__(/*! ./offset.es.js */ "../../../node_modules/@motionone/utils/dist/offset.es.js"); +var _progressEs = __webpack_require__(/*! ./progress.es.js */ "../../../node_modules/@motionone/utils/dist/progress.es.js"); +var _timeEs = __webpack_require__(/*! ./time.es.js */ "../../../node_modules/@motionone/utils/dist/time.es.js"); +var _velocityEs = __webpack_require__(/*! ./velocity.es.js */ "../../../node_modules/@motionone/utils/dist/velocity.es.js"); +var _wrapEs = __webpack_require__(/*! ./wrap.es.js */ "../../../node_modules/@motionone/utils/dist/wrap.es.js"); + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/interpolate.es.js": +/*!*********************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/interpolate.es.js ***! + \*********************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.interpolate = interpolate; +var _mixEs = __webpack_require__(/*! ./mix.es.js */ "../../../node_modules/@motionone/utils/dist/mix.es.js"); +var _noopEs = __webpack_require__(/*! ./noop.es.js */ "../../../node_modules/@motionone/utils/dist/noop.es.js"); +var _offsetEs = __webpack_require__(/*! ./offset.es.js */ "../../../node_modules/@motionone/utils/dist/offset.es.js"); +var _progressEs = __webpack_require__(/*! ./progress.es.js */ "../../../node_modules/@motionone/utils/dist/progress.es.js"); +var _easingEs = __webpack_require__(/*! ./easing.es.js */ "../../../node_modules/@motionone/utils/dist/easing.es.js"); +var _clampEs = __webpack_require__(/*! ./clamp.es.js */ "../../../node_modules/@motionone/utils/dist/clamp.es.js"); +function interpolate(output) { + let input = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : (0, _offsetEs.defaultOffset)(output.length); + let easing = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : _noopEs.noopReturn; + const length = output.length; + /** + * If the input length is lower than the output we + * fill the input to match. This currently assumes the input + * is an animation progress value so is a good candidate for + * moving outside the function. + */ + const remainder = length - input.length; + remainder > 0 && (0, _offsetEs.fillOffset)(input, remainder); + return t => { + let i = 0; + for (; i < length - 2; i++) { + if (t < input[i + 1]) break; + } + let progressInRange = (0, _clampEs.clamp)(0, 1, (0, _progressEs.progress)(input[i], input[i + 1], t)); + const segmentEasing = (0, _easingEs.getEasingForSegment)(easing, i); + progressInRange = segmentEasing(progressInRange); + return (0, _mixEs.mix)(output[i], output[i + 1], progressInRange); + }; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/is-cubic-bezier.es.js": +/*!*************************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/is-cubic-bezier.es.js ***! + \*************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.isCubicBezier = void 0; +var _isNumberEs = __webpack_require__(/*! ./is-number.es.js */ "../../../node_modules/@motionone/utils/dist/is-number.es.js"); +const isCubicBezier = easing => Array.isArray(easing) && (0, _isNumberEs.isNumber)(easing[0]); +exports.isCubicBezier = isCubicBezier; + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/is-easing-generator.es.js": +/*!*****************************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/is-easing-generator.es.js ***! + \*****************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.isEasingGenerator = void 0; +const isEasingGenerator = easing => typeof easing === "object" && Boolean(easing.createAnimation); +exports.isEasingGenerator = isEasingGenerator; + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/is-easing-list.es.js": +/*!************************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/is-easing-list.es.js ***! + \************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.isEasingList = void 0; +var _isNumberEs = __webpack_require__(/*! ./is-number.es.js */ "../../../node_modules/@motionone/utils/dist/is-number.es.js"); +const isEasingList = easing => Array.isArray(easing) && !(0, _isNumberEs.isNumber)(easing[0]); +exports.isEasingList = isEasingList; + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/is-function.es.js": +/*!*********************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/is-function.es.js ***! + \*********************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.isFunction = void 0; +const isFunction = value => typeof value === "function"; +exports.isFunction = isFunction; + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/is-number.es.js": +/*!*******************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/is-number.es.js ***! + \*******************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.isNumber = void 0; +const isNumber = value => typeof value === "number"; +exports.isNumber = isNumber; + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/is-string.es.js": +/*!*******************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/is-string.es.js ***! + \*******************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.isString = void 0; +const isString = value => typeof value === "string"; +exports.isString = isString; + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/mix.es.js": +/*!*************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/mix.es.js ***! + \*************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.mix = void 0; +const mix = (min, max, progress) => -progress * min + progress * max + min; +exports.mix = mix; + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/noop.es.js": +/*!**************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/noop.es.js ***! + \**************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.noopReturn = exports.noop = void 0; +const noop = () => {}; +exports.noop = noop; +const noopReturn = v => v; +exports.noopReturn = noopReturn; + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/offset.es.js": +/*!****************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/offset.es.js ***! + \****************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.defaultOffset = defaultOffset; +exports.fillOffset = fillOffset; +var _mixEs = __webpack_require__(/*! ./mix.es.js */ "../../../node_modules/@motionone/utils/dist/mix.es.js"); +var _progressEs = __webpack_require__(/*! ./progress.es.js */ "../../../node_modules/@motionone/utils/dist/progress.es.js"); +function fillOffset(offset, remaining) { + const min = offset[offset.length - 1]; + for (let i = 1; i <= remaining; i++) { + const offsetProgress = (0, _progressEs.progress)(0, remaining, i); + offset.push((0, _mixEs.mix)(min, 1, offsetProgress)); + } +} +function defaultOffset(length) { + const offset = [0]; + fillOffset(offset, length - 1); + return offset; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/progress.es.js": +/*!******************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/progress.es.js ***! + \******************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.progress = void 0; +const progress = (min, max, value) => max - min === 0 ? 1 : (value - min) / (max - min); +exports.progress = progress; + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/time.es.js": +/*!**************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/time.es.js ***! + \**************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.time = void 0; +const time = { + ms: seconds => seconds * 1000, + s: milliseconds => milliseconds / 1000 +}; +exports.time = time; + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/velocity.es.js": +/*!******************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/velocity.es.js ***! + \******************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.velocityPerSecond = velocityPerSecond; +/* + Convert velocity into velocity per second + + @param [number]: Unit per frame + @param [number]: Frame duration in ms +*/ +function velocityPerSecond(velocity, frameDuration) { + return frameDuration ? velocity * (1000 / frameDuration) : 0; +} + +/***/ }), + +/***/ "../../../node_modules/@motionone/utils/dist/wrap.es.js": +/*!**************************************************************!*\ + !*** ../../../node_modules/@motionone/utils/dist/wrap.es.js ***! + \**************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.wrap = void 0; +const wrap = (min, max, v) => { + const rangeSize = max - min; + return ((v - min) % rangeSize + rangeSize) % rangeSize + min; +}; +exports.wrap = wrap; + +/***/ }), + +/***/ "../../../node_modules/@n1ru4l/push-pull-async-iterable-iterator/index.js": +/*!********************************************************************************!*\ + !*** ../../../node_modules/@n1ru4l/push-pull-async-iterable-iterator/index.js ***! + \********************************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +function createDeferred() { + const d = {}; + d.promise = new Promise((resolve, reject) => { + d.resolve = resolve; + d.reject = reject; + }); + return d; +} +const SYMBOL_FINISHED = Symbol(); +const SYMBOL_NEW_VALUE = Symbol(); +/** + * makePushPullAsyncIterableIterator + * + * The iterable will publish values until return or throw is called. + * Afterwards it is in the completed state and cannot be used for publishing any further values. + * It will handle back-pressure and keep pushed values until they are consumed by a source. + */ +function makePushPullAsyncIterableIterator() { + let isRunning = true; + const values = []; + let newValueD = createDeferred(); + const finishedD = createDeferred(); + const asyncIterableIterator = async function* PushPullAsyncIterableIterator() { + while (true) { + if (values.length > 0) { + // eslint-disable-next-line @typescript-eslint/no-non-null-assertion + yield values.shift(); + } else { + const result = await Promise.race([newValueD.promise, finishedD.promise]); + if (result === SYMBOL_FINISHED) { + break; + } + if (result !== SYMBOL_NEW_VALUE) { + throw result; + } + } + } + }(); + function pushValue(value) { + if (isRunning === false) { + // TODO: Should this throw? + return; + } + values.push(value); + newValueD.resolve(SYMBOL_NEW_VALUE); + newValueD = createDeferred(); + } + // We monkey patch the original generator for clean-up + // eslint-disable-next-line @typescript-eslint/no-non-null-assertion + const originalReturn = asyncIterableIterator.return.bind(asyncIterableIterator); + asyncIterableIterator.return = function () { + isRunning = false; + finishedD.resolve(SYMBOL_FINISHED); + return originalReturn(...arguments); + }; + // eslint-disable-next-line @typescript-eslint/no-non-null-assertion + const originalThrow = asyncIterableIterator.throw.bind(asyncIterableIterator); + asyncIterableIterator.throw = err => { + isRunning = false; + finishedD.resolve(err); + return originalThrow(err); + }; + return { + pushValue, + asyncIterableIterator + }; +} +const makeAsyncIterableIteratorFromSink = make => { + const { + pushValue, + asyncIterableIterator + } = makePushPullAsyncIterableIterator(); + const dispose = make({ + next: value => { + pushValue(value); + }, + complete: () => { + // eslint-disable-next-line @typescript-eslint/no-non-null-assertion + asyncIterableIterator.return(); + }, + error: err => { + // eslint-disable-next-line @typescript-eslint/no-non-null-assertion + asyncIterableIterator.throw(err); + } + }); + // eslint-disable-next-line @typescript-eslint/no-non-null-assertion + const originalReturn = asyncIterableIterator.return; + let returnValue = undefined; + asyncIterableIterator.return = () => { + if (returnValue === undefined) { + dispose(); + returnValue = originalReturn(); + } + return returnValue; + }; + return asyncIterableIterator; +}; +function applyAsyncIterableIteratorToSink(asyncIterableIterator, sink) { + const run = async () => { + try { + for await (const value of asyncIterableIterator) { + sink.next(value); + } + sink.complete(); + } catch (err) { + sink.error(err); + } + }; + run(); + return () => { + var _a; + (_a = asyncIterableIterator.return) === null || _a === void 0 ? void 0 : _a.call(asyncIterableIterator); + }; +} +function isAsyncIterable(input) { + return typeof input === "object" && input !== null && ( + // The AsyncGenerator check is for Safari on iOS which currently does not have + // Symbol.asyncIterator implemented + // That means every custom AsyncIterable must be built using a AsyncGeneratorFunction (async function * () {}) + // eslint-disable-next-line @typescript-eslint/no-explicit-any + input[Symbol.toStringTag] === "AsyncGenerator" || Symbol.asyncIterator && Symbol.asyncIterator in input); +} +exports.applyAsyncIterableIteratorToSink = applyAsyncIterableIteratorToSink; +exports.isAsyncIterable = isAsyncIterable; +exports.makeAsyncIterableIteratorFromSink = makeAsyncIterableIteratorFromSink; +exports.makePushPullAsyncIterableIterator = makePushPullAsyncIterableIterator; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/primitive/dist/index.js": +/*!***************************************************************!*\ + !*** ../../../node_modules/@radix-ui/primitive/dist/index.js ***! + \***************************************************************/ +/***/ (function(module) { + + + +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +$parcel$export(module.exports, "composeEventHandlers", () => $1a6a90a521dcd173$export$b9ecd428b558ff10); +function $1a6a90a521dcd173$export$b9ecd428b558ff10(originalEventHandler, ourEventHandler) { + let { + checkForDefaultPrevented = true + } = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; + return function handleEvent(event) { + originalEventHandler === null || originalEventHandler === void 0 || originalEventHandler(event); + if (checkForDefaultPrevented === false || !event.defaultPrevented) return ourEventHandler === null || ourEventHandler === void 0 ? void 0 : ourEventHandler(event); + }; +} + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-arrow/dist/index.js": +/*!*****************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-arrow/dist/index.js ***! + \*****************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $eQpDd$babelruntimehelpersextends = __webpack_require__(/*! @babel/runtime/helpers/extends */ "../../../node_modules/@babel/runtime/helpers/extends.js"); +var $eQpDd$react = __webpack_require__(/*! react */ "react"); +var $eQpDd$radixuireactprimitive = __webpack_require__(/*! @radix-ui/react-primitive */ "../../../node_modules/@radix-ui/react-primitive/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "Arrow", () => $09f4ad68a9251bc3$export$21b07c8f274aebd5); +$parcel$export(module.exports, "Root", () => $09f4ad68a9251bc3$export$be92b6f5f03c0fe9); + +/* ------------------------------------------------------------------------------------------------- + * Arrow + * -----------------------------------------------------------------------------------------------*/ +const $09f4ad68a9251bc3$var$NAME = 'Arrow'; +const $09f4ad68a9251bc3$export$21b07c8f274aebd5 = /*#__PURE__*/$eQpDd$react.forwardRef((props, forwardedRef) => { + const { + children: children, + width = 10, + height = 5, + ...arrowProps + } = props; + return /*#__PURE__*/$eQpDd$react.createElement($eQpDd$radixuireactprimitive.Primitive.svg, $parcel$interopDefault($eQpDd$babelruntimehelpersextends)({}, arrowProps, { + ref: forwardedRef, + width: width, + height: height, + viewBox: "0 0 30 10", + preserveAspectRatio: "none" + }), props.asChild ? children : /*#__PURE__*/$eQpDd$react.createElement("polygon", { + points: "0,0 30,0 15,10" + })); +}); +/*#__PURE__*/ +Object.assign($09f4ad68a9251bc3$export$21b07c8f274aebd5, { + displayName: $09f4ad68a9251bc3$var$NAME +}); +/* -----------------------------------------------------------------------------------------------*/ +const $09f4ad68a9251bc3$export$be92b6f5f03c0fe9 = $09f4ad68a9251bc3$export$21b07c8f274aebd5; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-collection/dist/index.js": +/*!**********************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-collection/dist/index.js ***! + \**********************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $hnlpS$react = __webpack_require__(/*! react */ "react"); +var $hnlpS$radixuireactcontext = __webpack_require__(/*! @radix-ui/react-context */ "../../../node_modules/@radix-ui/react-context/dist/index.js"); +var $hnlpS$radixuireactcomposerefs = __webpack_require__(/*! @radix-ui/react-compose-refs */ "../../../node_modules/@radix-ui/react-compose-refs/dist/index.js"); +var $hnlpS$radixuireactslot = __webpack_require__(/*! @radix-ui/react-slot */ "../../../node_modules/@radix-ui/react-slot/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "createCollection", () => $1a96635ec239608b$export$c74125a8e3af6bb2); + +// We have resorted to returning slots directly rather than exposing primitives that can then +// be slotted like ``. +// This is because we encountered issues with generic types that cannot be statically analysed +// due to creating them dynamically via createCollection. +function $1a96635ec239608b$export$c74125a8e3af6bb2(name) { + /* ----------------------------------------------------------------------------------------------- + * CollectionProvider + * ---------------------------------------------------------------------------------------------*/ + const PROVIDER_NAME = name + 'CollectionProvider'; + const [createCollectionContext, createCollectionScope] = $hnlpS$radixuireactcontext.createContextScope(PROVIDER_NAME); + const [CollectionProviderImpl, useCollectionContext] = createCollectionContext(PROVIDER_NAME, { + collectionRef: { + current: null + }, + itemMap: new Map() + }); + const CollectionProvider = props => { + const { + scope: scope, + children: children + } = props; + const ref = $parcel$interopDefault($hnlpS$react).useRef(null); + const itemMap = $parcel$interopDefault($hnlpS$react).useRef(new Map()).current; + return /*#__PURE__*/$parcel$interopDefault($hnlpS$react).createElement(CollectionProviderImpl, { + scope: scope, + itemMap: itemMap, + collectionRef: ref + }, children); + }; + /*#__PURE__*/ + Object.assign(CollectionProvider, { + displayName: PROVIDER_NAME + }); + /* ----------------------------------------------------------------------------------------------- + * CollectionSlot + * ---------------------------------------------------------------------------------------------*/ + const COLLECTION_SLOT_NAME = name + 'CollectionSlot'; + const CollectionSlot = /*#__PURE__*/$parcel$interopDefault($hnlpS$react).forwardRef((props, forwardedRef) => { + const { + scope: scope, + children: children + } = props; + const context = useCollectionContext(COLLECTION_SLOT_NAME, scope); + const composedRefs = $hnlpS$radixuireactcomposerefs.useComposedRefs(forwardedRef, context.collectionRef); + return /*#__PURE__*/$parcel$interopDefault($hnlpS$react).createElement($hnlpS$radixuireactslot.Slot, { + ref: composedRefs + }, children); + }); + /*#__PURE__*/ + Object.assign(CollectionSlot, { + displayName: COLLECTION_SLOT_NAME + }); + /* ----------------------------------------------------------------------------------------------- + * CollectionItem + * ---------------------------------------------------------------------------------------------*/ + const ITEM_SLOT_NAME = name + 'CollectionItemSlot'; + const ITEM_DATA_ATTR = 'data-radix-collection-item'; + const CollectionItemSlot = /*#__PURE__*/$parcel$interopDefault($hnlpS$react).forwardRef((props, forwardedRef) => { + const { + scope: scope, + children: children, + ...itemData + } = props; + const ref = $parcel$interopDefault($hnlpS$react).useRef(null); + const composedRefs = $hnlpS$radixuireactcomposerefs.useComposedRefs(forwardedRef, ref); + const context = useCollectionContext(ITEM_SLOT_NAME, scope); + $parcel$interopDefault($hnlpS$react).useEffect(() => { + context.itemMap.set(ref, { + ref: ref, + ...itemData + }); + return () => void context.itemMap.delete(ref); + }); + return /*#__PURE__*/$parcel$interopDefault($hnlpS$react).createElement($hnlpS$radixuireactslot.Slot, { + [ITEM_DATA_ATTR]: '', + ref: composedRefs + }, children); + }); + /*#__PURE__*/ + Object.assign(CollectionItemSlot, { + displayName: ITEM_SLOT_NAME + }); + /* ----------------------------------------------------------------------------------------------- + * useCollection + * ---------------------------------------------------------------------------------------------*/ + function useCollection(scope) { + const context = useCollectionContext(name + 'CollectionConsumer', scope); + const getItems = $parcel$interopDefault($hnlpS$react).useCallback(() => { + const collectionNode = context.collectionRef.current; + if (!collectionNode) return []; + const orderedNodes = Array.from(collectionNode.querySelectorAll(`[${ITEM_DATA_ATTR}]`)); + const items = Array.from(context.itemMap.values()); + const orderedItems = items.sort((a, b) => orderedNodes.indexOf(a.ref.current) - orderedNodes.indexOf(b.ref.current)); + return orderedItems; + }, [context.collectionRef, context.itemMap]); + return getItems; + } + return [{ + Provider: CollectionProvider, + Slot: CollectionSlot, + ItemSlot: CollectionItemSlot + }, useCollection, createCollectionScope]; +} + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-compose-refs/dist/index.js": +/*!************************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-compose-refs/dist/index.js ***! + \************************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $dJwbH$react = __webpack_require__(/*! react */ "react"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +$parcel$export(module.exports, "composeRefs", () => $9c2aaba23466b352$export$43e446d32b3d21af); +$parcel$export(module.exports, "useComposedRefs", () => $9c2aaba23466b352$export$c7b2cbe3552a0d05); + +/** + * Set a given ref to a given value + * This utility takes care of different types of refs: callback refs and RefObject(s) + */ +function $9c2aaba23466b352$var$setRef(ref, value) { + if (typeof ref === 'function') ref(value);else if (ref !== null && ref !== undefined) ref.current = value; +} +/** + * A utility to compose multiple refs together + * Accepts callback refs and RefObject(s) + */ +function $9c2aaba23466b352$export$43e446d32b3d21af() { + for (var _len = arguments.length, refs = new Array(_len), _key = 0; _key < _len; _key++) { + refs[_key] = arguments[_key]; + } + return node => refs.forEach(ref => $9c2aaba23466b352$var$setRef(ref, node)); +} +/** + * A custom hook that composes multiple refs + * Accepts callback refs and RefObject(s) + */ +function $9c2aaba23466b352$export$c7b2cbe3552a0d05() { + for (var _len2 = arguments.length, refs = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) { + refs[_key2] = arguments[_key2]; + } + // eslint-disable-next-line react-hooks/exhaustive-deps + return $dJwbH$react.useCallback($9c2aaba23466b352$export$43e446d32b3d21af(...refs), refs); +} + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-context/dist/index.js": +/*!*******************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-context/dist/index.js ***! + \*******************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $4O1Ne$react = __webpack_require__(/*! react */ "react"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +$parcel$export(module.exports, "createContext", () => $dec3cc0142d4f286$export$fd42f52fd3ae1109); +$parcel$export(module.exports, "createContextScope", () => $dec3cc0142d4f286$export$50c7b4e9d9f19c1); +function $dec3cc0142d4f286$export$fd42f52fd3ae1109(rootComponentName, defaultContext) { + const Context = /*#__PURE__*/$4O1Ne$react.createContext(defaultContext); + function Provider(props) { + const { + children: children, + ...context + } = props; // Only re-memoize when prop values change + // eslint-disable-next-line react-hooks/exhaustive-deps + const value = $4O1Ne$react.useMemo(() => context, Object.values(context)); + return /*#__PURE__*/$4O1Ne$react.createElement(Context.Provider, { + value: value + }, children); + } + function useContext(consumerName) { + const context = $4O1Ne$react.useContext(Context); + if (context) return context; + if (defaultContext !== undefined) return defaultContext; // if a defaultContext wasn't specified, it's a required context. + throw new Error(`\`${consumerName}\` must be used within \`${rootComponentName}\``); + } + Provider.displayName = rootComponentName + 'Provider'; + return [Provider, useContext]; +} +/* ------------------------------------------------------------------------------------------------- + * createContextScope + * -----------------------------------------------------------------------------------------------*/ +function $dec3cc0142d4f286$export$50c7b4e9d9f19c1(scopeName) { + let createContextScopeDeps = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : []; + let defaultContexts = []; + /* ----------------------------------------------------------------------------------------------- + * createContext + * ---------------------------------------------------------------------------------------------*/ + function $dec3cc0142d4f286$export$fd42f52fd3ae1109(rootComponentName, defaultContext) { + const BaseContext = /*#__PURE__*/$4O1Ne$react.createContext(defaultContext); + const index = defaultContexts.length; + defaultContexts = [...defaultContexts, defaultContext]; + function Provider(props) { + const { + scope: scope, + children: children, + ...context + } = props; + const Context = (scope === null || scope === void 0 ? void 0 : scope[scopeName][index]) || BaseContext; // Only re-memoize when prop values change + // eslint-disable-next-line react-hooks/exhaustive-deps + const value = $4O1Ne$react.useMemo(() => context, Object.values(context)); + return /*#__PURE__*/$4O1Ne$react.createElement(Context.Provider, { + value: value + }, children); + } + function useContext(consumerName, scope) { + const Context = (scope === null || scope === void 0 ? void 0 : scope[scopeName][index]) || BaseContext; + const context = $4O1Ne$react.useContext(Context); + if (context) return context; + if (defaultContext !== undefined) return defaultContext; // if a defaultContext wasn't specified, it's a required context. + throw new Error(`\`${consumerName}\` must be used within \`${rootComponentName}\``); + } + Provider.displayName = rootComponentName + 'Provider'; + return [Provider, useContext]; + } + /* ----------------------------------------------------------------------------------------------- + * createScope + * ---------------------------------------------------------------------------------------------*/ + const createScope = () => { + const scopeContexts = defaultContexts.map(defaultContext => { + return /*#__PURE__*/$4O1Ne$react.createContext(defaultContext); + }); + return function useScope(scope) { + const contexts = (scope === null || scope === void 0 ? void 0 : scope[scopeName]) || scopeContexts; + return $4O1Ne$react.useMemo(() => ({ + [`__scope${scopeName}`]: { + ...scope, + [scopeName]: contexts + } + }), [scope, contexts]); + }; + }; + createScope.scopeName = scopeName; + return [$dec3cc0142d4f286$export$fd42f52fd3ae1109, $dec3cc0142d4f286$var$composeContextScopes(createScope, ...createContextScopeDeps)]; +} +/* ------------------------------------------------------------------------------------------------- + * composeContextScopes + * -----------------------------------------------------------------------------------------------*/ +function $dec3cc0142d4f286$var$composeContextScopes() { + for (var _len = arguments.length, scopes = new Array(_len), _key = 0; _key < _len; _key++) { + scopes[_key] = arguments[_key]; + } + const baseScope = scopes[0]; + if (scopes.length === 1) return baseScope; + const createScope1 = () => { + const scopeHooks = scopes.map(createScope => ({ + useScope: createScope(), + scopeName: createScope.scopeName + })); + return function useComposedScopes(overrideScopes) { + const nextScopes1 = scopeHooks.reduce((nextScopes, _ref) => { + let { + useScope: useScope, + scopeName: scopeName + } = _ref; + // We are calling a hook inside a callback which React warns against to avoid inconsistent + // renders, however, scoping doesn't have render side effects so we ignore the rule. + // eslint-disable-next-line react-hooks/rules-of-hooks + const scopeProps = useScope(overrideScopes); + const currentScope = scopeProps[`__scope${scopeName}`]; + return { + ...nextScopes, + ...currentScope + }; + }, {}); + return $4O1Ne$react.useMemo(() => ({ + [`__scope${baseScope.scopeName}`]: nextScopes1 + }), [nextScopes1]); + }; + }; + createScope1.scopeName = baseScope.scopeName; + return createScope1; +} + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-dialog/dist/index.js": +/*!******************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-dialog/dist/index.js ***! + \******************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $aJCrN$babelruntimehelpersextends = __webpack_require__(/*! @babel/runtime/helpers/extends */ "../../../node_modules/@babel/runtime/helpers/extends.js"); +var $aJCrN$react = __webpack_require__(/*! react */ "react"); +var $aJCrN$radixuiprimitive = __webpack_require__(/*! @radix-ui/primitive */ "../../../node_modules/@radix-ui/primitive/dist/index.js"); +var $aJCrN$radixuireactcomposerefs = __webpack_require__(/*! @radix-ui/react-compose-refs */ "../../../node_modules/@radix-ui/react-compose-refs/dist/index.js"); +var $aJCrN$radixuireactcontext = __webpack_require__(/*! @radix-ui/react-context */ "../../../node_modules/@radix-ui/react-context/dist/index.js"); +var $aJCrN$radixuireactid = __webpack_require__(/*! @radix-ui/react-id */ "../../../node_modules/@radix-ui/react-id/dist/index.js"); +var $aJCrN$radixuireactusecontrollablestate = __webpack_require__(/*! @radix-ui/react-use-controllable-state */ "../../../node_modules/@radix-ui/react-use-controllable-state/dist/index.js"); +var $aJCrN$radixuireactdismissablelayer = __webpack_require__(/*! @radix-ui/react-dismissable-layer */ "../../../node_modules/@radix-ui/react-dismissable-layer/dist/index.js"); +var $aJCrN$radixuireactfocusscope = __webpack_require__(/*! @radix-ui/react-focus-scope */ "../../../node_modules/@radix-ui/react-focus-scope/dist/index.js"); +var $aJCrN$radixuireactportal = __webpack_require__(/*! @radix-ui/react-portal */ "../../../node_modules/@radix-ui/react-portal/dist/index.js"); +var $aJCrN$radixuireactpresence = __webpack_require__(/*! @radix-ui/react-presence */ "../../../node_modules/@radix-ui/react-presence/dist/index.js"); +var $aJCrN$radixuireactprimitive = __webpack_require__(/*! @radix-ui/react-primitive */ "../../../node_modules/@radix-ui/react-primitive/dist/index.js"); +var $aJCrN$radixuireactfocusguards = __webpack_require__(/*! @radix-ui/react-focus-guards */ "../../../node_modules/@radix-ui/react-focus-guards/dist/index.js"); +var $aJCrN$reactremovescroll = __webpack_require__(/*! react-remove-scroll */ "../../../node_modules/react-remove-scroll/dist/es2015/index.js"); +var $aJCrN$ariahidden = __webpack_require__(/*! aria-hidden */ "../../../node_modules/aria-hidden/dist/es2015/index.js"); +var $aJCrN$radixuireactslot = __webpack_require__(/*! @radix-ui/react-slot */ "../../../node_modules/@radix-ui/react-slot/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "createDialogScope", () => $f4833395aa1bca1a$export$cc702773b8ea3e41); +$parcel$export(module.exports, "Dialog", () => $f4833395aa1bca1a$export$3ddf2d174ce01153); +$parcel$export(module.exports, "DialogTrigger", () => $f4833395aa1bca1a$export$2e1e1122cf0cba88); +$parcel$export(module.exports, "DialogPortal", () => $f4833395aa1bca1a$export$dad7c95542bacce0); +$parcel$export(module.exports, "DialogOverlay", () => $f4833395aa1bca1a$export$bd1d06c79be19e17); +$parcel$export(module.exports, "DialogContent", () => $f4833395aa1bca1a$export$b6d9565de1e068cf); +$parcel$export(module.exports, "DialogTitle", () => $f4833395aa1bca1a$export$16f7638e4a34b909); +$parcel$export(module.exports, "DialogDescription", () => $f4833395aa1bca1a$export$94e94c2ec2c954d5); +$parcel$export(module.exports, "DialogClose", () => $f4833395aa1bca1a$export$fba2fb7cd781b7ac); +$parcel$export(module.exports, "Root", () => $f4833395aa1bca1a$export$be92b6f5f03c0fe9); +$parcel$export(module.exports, "Trigger", () => $f4833395aa1bca1a$export$41fb9f06171c75f4); +$parcel$export(module.exports, "Portal", () => $f4833395aa1bca1a$export$602eac185826482c); +$parcel$export(module.exports, "Overlay", () => $f4833395aa1bca1a$export$c6fdb837b070b4ff); +$parcel$export(module.exports, "Content", () => $f4833395aa1bca1a$export$7c6e2c02157bb7d2); +$parcel$export(module.exports, "Title", () => $f4833395aa1bca1a$export$f99233281efd08a0); +$parcel$export(module.exports, "Description", () => $f4833395aa1bca1a$export$393edc798c47379d); +$parcel$export(module.exports, "Close", () => $f4833395aa1bca1a$export$f39c2d165cd861fe); +$parcel$export(module.exports, "WarningProvider", () => $f4833395aa1bca1a$export$69b62a49393917d6); + +/* ------------------------------------------------------------------------------------------------- + * Dialog + * -----------------------------------------------------------------------------------------------*/ +const $f4833395aa1bca1a$var$DIALOG_NAME = 'Dialog'; +const [$f4833395aa1bca1a$var$createDialogContext, $f4833395aa1bca1a$export$cc702773b8ea3e41] = $aJCrN$radixuireactcontext.createContextScope($f4833395aa1bca1a$var$DIALOG_NAME); +const [$f4833395aa1bca1a$var$DialogProvider, $f4833395aa1bca1a$var$useDialogContext] = $f4833395aa1bca1a$var$createDialogContext($f4833395aa1bca1a$var$DIALOG_NAME); +const $f4833395aa1bca1a$export$3ddf2d174ce01153 = props => { + const { + __scopeDialog: __scopeDialog, + children: children, + open: openProp, + defaultOpen: defaultOpen, + onOpenChange: onOpenChange, + modal = true + } = props; + const triggerRef = $aJCrN$react.useRef(null); + const contentRef = $aJCrN$react.useRef(null); + const [open = false, setOpen] = $aJCrN$radixuireactusecontrollablestate.useControllableState({ + prop: openProp, + defaultProp: defaultOpen, + onChange: onOpenChange + }); + return /*#__PURE__*/$aJCrN$react.createElement($f4833395aa1bca1a$var$DialogProvider, { + scope: __scopeDialog, + triggerRef: triggerRef, + contentRef: contentRef, + contentId: $aJCrN$radixuireactid.useId(), + titleId: $aJCrN$radixuireactid.useId(), + descriptionId: $aJCrN$radixuireactid.useId(), + open: open, + onOpenChange: setOpen, + onOpenToggle: $aJCrN$react.useCallback(() => setOpen(prevOpen => !prevOpen), [setOpen]), + modal: modal + }, children); +}; +/*#__PURE__*/ +Object.assign($f4833395aa1bca1a$export$3ddf2d174ce01153, { + displayName: $f4833395aa1bca1a$var$DIALOG_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DialogTrigger + * -----------------------------------------------------------------------------------------------*/ +const $f4833395aa1bca1a$var$TRIGGER_NAME = 'DialogTrigger'; +const $f4833395aa1bca1a$export$2e1e1122cf0cba88 = /*#__PURE__*/$aJCrN$react.forwardRef((props, forwardedRef) => { + const { + __scopeDialog: __scopeDialog, + ...triggerProps + } = props; + const context = $f4833395aa1bca1a$var$useDialogContext($f4833395aa1bca1a$var$TRIGGER_NAME, __scopeDialog); + const composedTriggerRef = $aJCrN$radixuireactcomposerefs.useComposedRefs(forwardedRef, context.triggerRef); + return /*#__PURE__*/$aJCrN$react.createElement($aJCrN$radixuireactprimitive.Primitive.button, $parcel$interopDefault($aJCrN$babelruntimehelpersextends)({ + type: "button", + "aria-haspopup": "dialog", + "aria-expanded": context.open, + "aria-controls": context.contentId, + "data-state": $f4833395aa1bca1a$var$getState(context.open) + }, triggerProps, { + ref: composedTriggerRef, + onClick: $aJCrN$radixuiprimitive.composeEventHandlers(props.onClick, context.onOpenToggle) + })); +}); +/*#__PURE__*/ +Object.assign($f4833395aa1bca1a$export$2e1e1122cf0cba88, { + displayName: $f4833395aa1bca1a$var$TRIGGER_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DialogPortal + * -----------------------------------------------------------------------------------------------*/ +const $f4833395aa1bca1a$var$PORTAL_NAME = 'DialogPortal'; +const [$f4833395aa1bca1a$var$PortalProvider, $f4833395aa1bca1a$var$usePortalContext] = $f4833395aa1bca1a$var$createDialogContext($f4833395aa1bca1a$var$PORTAL_NAME, { + forceMount: undefined +}); +const $f4833395aa1bca1a$export$dad7c95542bacce0 = props => { + const { + __scopeDialog: __scopeDialog, + forceMount: forceMount, + children: children, + container: container + } = props; + const context = $f4833395aa1bca1a$var$useDialogContext($f4833395aa1bca1a$var$PORTAL_NAME, __scopeDialog); + return /*#__PURE__*/$aJCrN$react.createElement($f4833395aa1bca1a$var$PortalProvider, { + scope: __scopeDialog, + forceMount: forceMount + }, $aJCrN$react.Children.map(children, child => /*#__PURE__*/$aJCrN$react.createElement($aJCrN$radixuireactpresence.Presence, { + present: forceMount || context.open + }, /*#__PURE__*/$aJCrN$react.createElement($aJCrN$radixuireactportal.Portal, { + asChild: true, + container: container + }, child)))); +}; +/*#__PURE__*/ +Object.assign($f4833395aa1bca1a$export$dad7c95542bacce0, { + displayName: $f4833395aa1bca1a$var$PORTAL_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DialogOverlay + * -----------------------------------------------------------------------------------------------*/ +const $f4833395aa1bca1a$var$OVERLAY_NAME = 'DialogOverlay'; +const $f4833395aa1bca1a$export$bd1d06c79be19e17 = /*#__PURE__*/$aJCrN$react.forwardRef((props, forwardedRef) => { + const portalContext = $f4833395aa1bca1a$var$usePortalContext($f4833395aa1bca1a$var$OVERLAY_NAME, props.__scopeDialog); + const { + forceMount = portalContext.forceMount, + ...overlayProps + } = props; + const context = $f4833395aa1bca1a$var$useDialogContext($f4833395aa1bca1a$var$OVERLAY_NAME, props.__scopeDialog); + return context.modal ? /*#__PURE__*/$aJCrN$react.createElement($aJCrN$radixuireactpresence.Presence, { + present: forceMount || context.open + }, /*#__PURE__*/$aJCrN$react.createElement($f4833395aa1bca1a$var$DialogOverlayImpl, $parcel$interopDefault($aJCrN$babelruntimehelpersextends)({}, overlayProps, { + ref: forwardedRef + }))) : null; +}); +/*#__PURE__*/ +Object.assign($f4833395aa1bca1a$export$bd1d06c79be19e17, { + displayName: $f4833395aa1bca1a$var$OVERLAY_NAME +}); +const $f4833395aa1bca1a$var$DialogOverlayImpl = /*#__PURE__*/$aJCrN$react.forwardRef((props, forwardedRef) => { + const { + __scopeDialog: __scopeDialog, + ...overlayProps + } = props; + const context = $f4833395aa1bca1a$var$useDialogContext($f4833395aa1bca1a$var$OVERLAY_NAME, __scopeDialog); + return /*#__PURE__*/ (// Make sure `Content` is scrollable even when it doesn't live inside `RemoveScroll` + // ie. when `Overlay` and `Content` are siblings + $aJCrN$react.createElement($aJCrN$reactremovescroll.RemoveScroll, { + as: $aJCrN$radixuireactslot.Slot, + allowPinchZoom: true, + shards: [context.contentRef] + }, /*#__PURE__*/$aJCrN$react.createElement($aJCrN$radixuireactprimitive.Primitive.div, $parcel$interopDefault($aJCrN$babelruntimehelpersextends)({ + "data-state": $f4833395aa1bca1a$var$getState(context.open) + }, overlayProps, { + ref: forwardedRef // We re-enable pointer-events prevented by `Dialog.Content` to allow scrolling the overlay. + , + + style: { + pointerEvents: 'auto', + ...overlayProps.style + } + }))) + ); +}); +/* ------------------------------------------------------------------------------------------------- + * DialogContent + * -----------------------------------------------------------------------------------------------*/ +const $f4833395aa1bca1a$var$CONTENT_NAME = 'DialogContent'; +const $f4833395aa1bca1a$export$b6d9565de1e068cf = /*#__PURE__*/$aJCrN$react.forwardRef((props, forwardedRef) => { + const portalContext = $f4833395aa1bca1a$var$usePortalContext($f4833395aa1bca1a$var$CONTENT_NAME, props.__scopeDialog); + const { + forceMount = portalContext.forceMount, + ...contentProps + } = props; + const context = $f4833395aa1bca1a$var$useDialogContext($f4833395aa1bca1a$var$CONTENT_NAME, props.__scopeDialog); + return /*#__PURE__*/$aJCrN$react.createElement($aJCrN$radixuireactpresence.Presence, { + present: forceMount || context.open + }, context.modal ? /*#__PURE__*/$aJCrN$react.createElement($f4833395aa1bca1a$var$DialogContentModal, $parcel$interopDefault($aJCrN$babelruntimehelpersextends)({}, contentProps, { + ref: forwardedRef + })) : /*#__PURE__*/$aJCrN$react.createElement($f4833395aa1bca1a$var$DialogContentNonModal, $parcel$interopDefault($aJCrN$babelruntimehelpersextends)({}, contentProps, { + ref: forwardedRef + }))); +}); +/*#__PURE__*/ +Object.assign($f4833395aa1bca1a$export$b6d9565de1e068cf, { + displayName: $f4833395aa1bca1a$var$CONTENT_NAME +}); +/* -----------------------------------------------------------------------------------------------*/ +const $f4833395aa1bca1a$var$DialogContentModal = /*#__PURE__*/$aJCrN$react.forwardRef((props, forwardedRef) => { + const context = $f4833395aa1bca1a$var$useDialogContext($f4833395aa1bca1a$var$CONTENT_NAME, props.__scopeDialog); + const contentRef = $aJCrN$react.useRef(null); + const composedRefs = $aJCrN$radixuireactcomposerefs.useComposedRefs(forwardedRef, context.contentRef, contentRef); // aria-hide everything except the content (better supported equivalent to setting aria-modal) + $aJCrN$react.useEffect(() => { + const content = contentRef.current; + if (content) return $aJCrN$ariahidden.hideOthers(content); + }, []); + return /*#__PURE__*/$aJCrN$react.createElement($f4833395aa1bca1a$var$DialogContentImpl, $parcel$interopDefault($aJCrN$babelruntimehelpersextends)({}, props, { + ref: composedRefs // we make sure focus isn't trapped once `DialogContent` has been closed + , + + trapFocus: context.open, + disableOutsidePointerEvents: true, + onCloseAutoFocus: $aJCrN$radixuiprimitive.composeEventHandlers(props.onCloseAutoFocus, event => { + var _context$triggerRef$c; + event.preventDefault(); + (_context$triggerRef$c = context.triggerRef.current) === null || _context$triggerRef$c === void 0 || _context$triggerRef$c.focus(); + }), + onPointerDownOutside: $aJCrN$radixuiprimitive.composeEventHandlers(props.onPointerDownOutside, event => { + const originalEvent = event.detail.originalEvent; + const ctrlLeftClick = originalEvent.button === 0 && originalEvent.ctrlKey === true; + const isRightClick = originalEvent.button === 2 || ctrlLeftClick; // If the event is a right-click, we shouldn't close because + // it is effectively as if we right-clicked the `Overlay`. + if (isRightClick) event.preventDefault(); + }) // When focus is trapped, a `focusout` event may still happen. + , + + onFocusOutside: $aJCrN$radixuiprimitive.composeEventHandlers(props.onFocusOutside, event => event.preventDefault()) + })); +}); +/* -----------------------------------------------------------------------------------------------*/ +const $f4833395aa1bca1a$var$DialogContentNonModal = /*#__PURE__*/$aJCrN$react.forwardRef((props, forwardedRef) => { + const context = $f4833395aa1bca1a$var$useDialogContext($f4833395aa1bca1a$var$CONTENT_NAME, props.__scopeDialog); + const hasInteractedOutsideRef = $aJCrN$react.useRef(false); + const hasPointerDownOutsideRef = $aJCrN$react.useRef(false); + return /*#__PURE__*/$aJCrN$react.createElement($f4833395aa1bca1a$var$DialogContentImpl, $parcel$interopDefault($aJCrN$babelruntimehelpersextends)({}, props, { + ref: forwardedRef, + trapFocus: false, + disableOutsidePointerEvents: false, + onCloseAutoFocus: event => { + var _props$onCloseAutoFoc; + (_props$onCloseAutoFoc = props.onCloseAutoFocus) === null || _props$onCloseAutoFoc === void 0 || _props$onCloseAutoFoc.call(props, event); + if (!event.defaultPrevented) { + var _context$triggerRef$c2; + if (!hasInteractedOutsideRef.current) (_context$triggerRef$c2 = context.triggerRef.current) === null || _context$triggerRef$c2 === void 0 || _context$triggerRef$c2.focus(); // Always prevent auto focus because we either focus manually or want user agent focus + event.preventDefault(); + } + hasInteractedOutsideRef.current = false; + hasPointerDownOutsideRef.current = false; + }, + onInteractOutside: event => { + var _props$onInteractOuts, _context$triggerRef$c3; + (_props$onInteractOuts = props.onInteractOutside) === null || _props$onInteractOuts === void 0 || _props$onInteractOuts.call(props, event); + if (!event.defaultPrevented) { + hasInteractedOutsideRef.current = true; + if (event.detail.originalEvent.type === 'pointerdown') hasPointerDownOutsideRef.current = true; + } // Prevent dismissing when clicking the trigger. + // As the trigger is already setup to close, without doing so would + // cause it to close and immediately open. + const target = event.target; + const targetIsTrigger = (_context$triggerRef$c3 = context.triggerRef.current) === null || _context$triggerRef$c3 === void 0 ? void 0 : _context$triggerRef$c3.contains(target); + if (targetIsTrigger) event.preventDefault(); // On Safari if the trigger is inside a container with tabIndex={0}, when clicked + // we will get the pointer down outside event on the trigger, but then a subsequent + // focus outside event on the container, we ignore any focus outside event when we've + // already had a pointer down outside event. + if (event.detail.originalEvent.type === 'focusin' && hasPointerDownOutsideRef.current) event.preventDefault(); + } + })); +}); +/* -----------------------------------------------------------------------------------------------*/ +const $f4833395aa1bca1a$var$DialogContentImpl = /*#__PURE__*/$aJCrN$react.forwardRef((props, forwardedRef) => { + const { + __scopeDialog: __scopeDialog, + trapFocus: trapFocus, + onOpenAutoFocus: onOpenAutoFocus, + onCloseAutoFocus: onCloseAutoFocus, + ...contentProps + } = props; + const context = $f4833395aa1bca1a$var$useDialogContext($f4833395aa1bca1a$var$CONTENT_NAME, __scopeDialog); + const contentRef = $aJCrN$react.useRef(null); + const composedRefs = $aJCrN$radixuireactcomposerefs.useComposedRefs(forwardedRef, contentRef); // Make sure the whole tree has focus guards as our `Dialog` will be + // the last element in the DOM (beacuse of the `Portal`) + $aJCrN$radixuireactfocusguards.useFocusGuards(); + return /*#__PURE__*/$aJCrN$react.createElement($aJCrN$react.Fragment, null, /*#__PURE__*/$aJCrN$react.createElement($aJCrN$radixuireactfocusscope.FocusScope, { + asChild: true, + loop: true, + trapped: trapFocus, + onMountAutoFocus: onOpenAutoFocus, + onUnmountAutoFocus: onCloseAutoFocus + }, /*#__PURE__*/$aJCrN$react.createElement($aJCrN$radixuireactdismissablelayer.DismissableLayer, $parcel$interopDefault($aJCrN$babelruntimehelpersextends)({ + role: "dialog", + id: context.contentId, + "aria-describedby": context.descriptionId, + "aria-labelledby": context.titleId, + "data-state": $f4833395aa1bca1a$var$getState(context.open) + }, contentProps, { + ref: composedRefs, + onDismiss: () => context.onOpenChange(false) + }))), false); +}); +/* ------------------------------------------------------------------------------------------------- + * DialogTitle + * -----------------------------------------------------------------------------------------------*/ +const $f4833395aa1bca1a$var$TITLE_NAME = 'DialogTitle'; +const $f4833395aa1bca1a$export$16f7638e4a34b909 = /*#__PURE__*/$aJCrN$react.forwardRef((props, forwardedRef) => { + const { + __scopeDialog: __scopeDialog, + ...titleProps + } = props; + const context = $f4833395aa1bca1a$var$useDialogContext($f4833395aa1bca1a$var$TITLE_NAME, __scopeDialog); + return /*#__PURE__*/$aJCrN$react.createElement($aJCrN$radixuireactprimitive.Primitive.h2, $parcel$interopDefault($aJCrN$babelruntimehelpersextends)({ + id: context.titleId + }, titleProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($f4833395aa1bca1a$export$16f7638e4a34b909, { + displayName: $f4833395aa1bca1a$var$TITLE_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DialogDescription + * -----------------------------------------------------------------------------------------------*/ +const $f4833395aa1bca1a$var$DESCRIPTION_NAME = 'DialogDescription'; +const $f4833395aa1bca1a$export$94e94c2ec2c954d5 = /*#__PURE__*/$aJCrN$react.forwardRef((props, forwardedRef) => { + const { + __scopeDialog: __scopeDialog, + ...descriptionProps + } = props; + const context = $f4833395aa1bca1a$var$useDialogContext($f4833395aa1bca1a$var$DESCRIPTION_NAME, __scopeDialog); + return /*#__PURE__*/$aJCrN$react.createElement($aJCrN$radixuireactprimitive.Primitive.p, $parcel$interopDefault($aJCrN$babelruntimehelpersextends)({ + id: context.descriptionId + }, descriptionProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($f4833395aa1bca1a$export$94e94c2ec2c954d5, { + displayName: $f4833395aa1bca1a$var$DESCRIPTION_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DialogClose + * -----------------------------------------------------------------------------------------------*/ +const $f4833395aa1bca1a$var$CLOSE_NAME = 'DialogClose'; +const $f4833395aa1bca1a$export$fba2fb7cd781b7ac = /*#__PURE__*/$aJCrN$react.forwardRef((props, forwardedRef) => { + const { + __scopeDialog: __scopeDialog, + ...closeProps + } = props; + const context = $f4833395aa1bca1a$var$useDialogContext($f4833395aa1bca1a$var$CLOSE_NAME, __scopeDialog); + return /*#__PURE__*/$aJCrN$react.createElement($aJCrN$radixuireactprimitive.Primitive.button, $parcel$interopDefault($aJCrN$babelruntimehelpersextends)({ + type: "button" + }, closeProps, { + ref: forwardedRef, + onClick: $aJCrN$radixuiprimitive.composeEventHandlers(props.onClick, () => context.onOpenChange(false)) + })); +}); +/*#__PURE__*/ +Object.assign($f4833395aa1bca1a$export$fba2fb7cd781b7ac, { + displayName: $f4833395aa1bca1a$var$CLOSE_NAME +}); +/* -----------------------------------------------------------------------------------------------*/ +function $f4833395aa1bca1a$var$getState(open) { + return open ? 'open' : 'closed'; +} +const $f4833395aa1bca1a$var$TITLE_WARNING_NAME = 'DialogTitleWarning'; +const [$f4833395aa1bca1a$export$69b62a49393917d6, $f4833395aa1bca1a$var$useWarningContext] = $aJCrN$radixuireactcontext.createContext($f4833395aa1bca1a$var$TITLE_WARNING_NAME, { + contentName: $f4833395aa1bca1a$var$CONTENT_NAME, + titleName: $f4833395aa1bca1a$var$TITLE_NAME, + docsSlug: 'dialog' +}); +const $f4833395aa1bca1a$var$TitleWarning = _ref => { + let { + titleId: titleId + } = _ref; + const titleWarningContext = $f4833395aa1bca1a$var$useWarningContext($f4833395aa1bca1a$var$TITLE_WARNING_NAME); + const MESSAGE = `\`${titleWarningContext.contentName}\` requires a \`${titleWarningContext.titleName}\` for the component to be accessible for screen reader users. + +If you want to hide the \`${titleWarningContext.titleName}\`, you can wrap it with our VisuallyHidden component. + +For more information, see https://radix-ui.com/primitives/docs/components/${titleWarningContext.docsSlug}`; + $aJCrN$react.useEffect(() => { + if (titleId) { + const hasTitle = document.getElementById(titleId); + if (!hasTitle) throw new Error(MESSAGE); + } + }, [MESSAGE, titleId]); + return null; +}; +const $f4833395aa1bca1a$var$DESCRIPTION_WARNING_NAME = 'DialogDescriptionWarning'; +const $f4833395aa1bca1a$var$DescriptionWarning = _ref2 => { + let { + contentRef: contentRef, + descriptionId: descriptionId + } = _ref2; + const descriptionWarningContext = $f4833395aa1bca1a$var$useWarningContext($f4833395aa1bca1a$var$DESCRIPTION_WARNING_NAME); + const MESSAGE = `Warning: Missing \`Description\` or \`aria-describedby={undefined}\` for {${descriptionWarningContext.contentName}}.`; + $aJCrN$react.useEffect(() => { + var _contentRef$current; + const describedById = (_contentRef$current = contentRef.current) === null || _contentRef$current === void 0 ? void 0 : _contentRef$current.getAttribute('aria-describedby'); // if we have an id and the user hasn't set aria-describedby={undefined} + if (descriptionId && describedById) { + const hasDescription = document.getElementById(descriptionId); + if (!hasDescription) console.warn(MESSAGE); + } + }, [MESSAGE, contentRef, descriptionId]); + return null; +}; +const $f4833395aa1bca1a$export$be92b6f5f03c0fe9 = $f4833395aa1bca1a$export$3ddf2d174ce01153; +const $f4833395aa1bca1a$export$41fb9f06171c75f4 = $f4833395aa1bca1a$export$2e1e1122cf0cba88; +const $f4833395aa1bca1a$export$602eac185826482c = $f4833395aa1bca1a$export$dad7c95542bacce0; +const $f4833395aa1bca1a$export$c6fdb837b070b4ff = $f4833395aa1bca1a$export$bd1d06c79be19e17; +const $f4833395aa1bca1a$export$7c6e2c02157bb7d2 = $f4833395aa1bca1a$export$b6d9565de1e068cf; +const $f4833395aa1bca1a$export$f99233281efd08a0 = $f4833395aa1bca1a$export$16f7638e4a34b909; +const $f4833395aa1bca1a$export$393edc798c47379d = $f4833395aa1bca1a$export$94e94c2ec2c954d5; +const $f4833395aa1bca1a$export$f39c2d165cd861fe = $f4833395aa1bca1a$export$fba2fb7cd781b7ac; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-direction/dist/index.js": +/*!*********************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-direction/dist/index.js ***! + \*********************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $9g4ps$react = __webpack_require__(/*! react */ "react"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +$parcel$export(module.exports, "useDirection", () => $cc45c1b701a63adc$export$b39126d51d94e6f3); +$parcel$export(module.exports, "Provider", () => $cc45c1b701a63adc$export$2881499e37b75b9a); +$parcel$export(module.exports, "DirectionProvider", () => $cc45c1b701a63adc$export$c760c09fdd558351); +const $cc45c1b701a63adc$var$DirectionContext = /*#__PURE__*/$9g4ps$react.createContext(undefined); +/* ------------------------------------------------------------------------------------------------- + * Direction + * -----------------------------------------------------------------------------------------------*/ +const $cc45c1b701a63adc$export$c760c09fdd558351 = props => { + const { + dir: dir, + children: children + } = props; + return /*#__PURE__*/$9g4ps$react.createElement($cc45c1b701a63adc$var$DirectionContext.Provider, { + value: dir + }, children); +}; +/* -----------------------------------------------------------------------------------------------*/ +function $cc45c1b701a63adc$export$b39126d51d94e6f3(localDir) { + const globalDir = $9g4ps$react.useContext($cc45c1b701a63adc$var$DirectionContext); + return localDir || globalDir || 'ltr'; +} +const $cc45c1b701a63adc$export$2881499e37b75b9a = $cc45c1b701a63adc$export$c760c09fdd558351; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-dismissable-layer/dist/index.js": +/*!*****************************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-dismissable-layer/dist/index.js ***! + \*****************************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $g2vWm$babelruntimehelpersextends = __webpack_require__(/*! @babel/runtime/helpers/extends */ "../../../node_modules/@babel/runtime/helpers/extends.js"); +var $g2vWm$react = __webpack_require__(/*! react */ "react"); +var $g2vWm$radixuiprimitive = __webpack_require__(/*! @radix-ui/primitive */ "../../../node_modules/@radix-ui/primitive/dist/index.js"); +var $g2vWm$radixuireactprimitive = __webpack_require__(/*! @radix-ui/react-primitive */ "../../../node_modules/@radix-ui/react-primitive/dist/index.js"); +var $g2vWm$radixuireactcomposerefs = __webpack_require__(/*! @radix-ui/react-compose-refs */ "../../../node_modules/@radix-ui/react-compose-refs/dist/index.js"); +var $g2vWm$radixuireactusecallbackref = __webpack_require__(/*! @radix-ui/react-use-callback-ref */ "../../../node_modules/@radix-ui/react-use-callback-ref/dist/index.js"); +var $g2vWm$radixuireactuseescapekeydown = __webpack_require__(/*! @radix-ui/react-use-escape-keydown */ "../../../node_modules/@radix-ui/react-use-escape-keydown/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "DismissableLayer", () => $d715e0554b679f1f$export$177fb62ff3ec1f22); +$parcel$export(module.exports, "DismissableLayerBranch", () => $d715e0554b679f1f$export$4d5eb2109db14228); +$parcel$export(module.exports, "Root", () => $d715e0554b679f1f$export$be92b6f5f03c0fe9); +$parcel$export(module.exports, "Branch", () => $d715e0554b679f1f$export$aecb2ddcb55c95be); + +/* ------------------------------------------------------------------------------------------------- + * DismissableLayer + * -----------------------------------------------------------------------------------------------*/ +const $d715e0554b679f1f$var$DISMISSABLE_LAYER_NAME = 'DismissableLayer'; +const $d715e0554b679f1f$var$CONTEXT_UPDATE = 'dismissableLayer.update'; +const $d715e0554b679f1f$var$POINTER_DOWN_OUTSIDE = 'dismissableLayer.pointerDownOutside'; +const $d715e0554b679f1f$var$FOCUS_OUTSIDE = 'dismissableLayer.focusOutside'; +let $d715e0554b679f1f$var$originalBodyPointerEvents; +const $d715e0554b679f1f$var$DismissableLayerContext = /*#__PURE__*/$g2vWm$react.createContext({ + layers: new Set(), + layersWithOutsidePointerEventsDisabled: new Set(), + branches: new Set() +}); +const $d715e0554b679f1f$export$177fb62ff3ec1f22 = /*#__PURE__*/$g2vWm$react.forwardRef((props, forwardedRef) => { + var _node$ownerDocument; + const { + disableOutsidePointerEvents = false, + onEscapeKeyDown: onEscapeKeyDown, + onPointerDownOutside: onPointerDownOutside, + onFocusOutside: onFocusOutside, + onInteractOutside: onInteractOutside, + onDismiss: onDismiss, + ...layerProps + } = props; + const context = $g2vWm$react.useContext($d715e0554b679f1f$var$DismissableLayerContext); + const [node1, setNode] = $g2vWm$react.useState(null); + const ownerDocument = (_node$ownerDocument = node1 === null || node1 === void 0 ? void 0 : node1.ownerDocument) !== null && _node$ownerDocument !== void 0 ? _node$ownerDocument : globalThis === null || globalThis === void 0 ? void 0 : globalThis.document; + const [, force] = $g2vWm$react.useState({}); + const composedRefs = $g2vWm$radixuireactcomposerefs.useComposedRefs(forwardedRef, node => setNode(node)); + const layers = Array.from(context.layers); + const [highestLayerWithOutsidePointerEventsDisabled] = [...context.layersWithOutsidePointerEventsDisabled].slice(-1); // prettier-ignore + const highestLayerWithOutsidePointerEventsDisabledIndex = layers.indexOf(highestLayerWithOutsidePointerEventsDisabled); // prettier-ignore + const index = node1 ? layers.indexOf(node1) : -1; + const isBodyPointerEventsDisabled = context.layersWithOutsidePointerEventsDisabled.size > 0; + const isPointerEventsEnabled = index >= highestLayerWithOutsidePointerEventsDisabledIndex; + const pointerDownOutside = $d715e0554b679f1f$var$usePointerDownOutside(event => { + const target = event.target; + const isPointerDownOnBranch = [...context.branches].some(branch => branch.contains(target)); + if (!isPointerEventsEnabled || isPointerDownOnBranch) return; + onPointerDownOutside === null || onPointerDownOutside === void 0 || onPointerDownOutside(event); + onInteractOutside === null || onInteractOutside === void 0 || onInteractOutside(event); + if (!event.defaultPrevented) onDismiss === null || onDismiss === void 0 || onDismiss(); + }, ownerDocument); + const focusOutside = $d715e0554b679f1f$var$useFocusOutside(event => { + const target = event.target; + const isFocusInBranch = [...context.branches].some(branch => branch.contains(target)); + if (isFocusInBranch) return; + onFocusOutside === null || onFocusOutside === void 0 || onFocusOutside(event); + onInteractOutside === null || onInteractOutside === void 0 || onInteractOutside(event); + if (!event.defaultPrevented) onDismiss === null || onDismiss === void 0 || onDismiss(); + }, ownerDocument); + $g2vWm$radixuireactuseescapekeydown.useEscapeKeydown(event => { + const isHighestLayer = index === context.layers.size - 1; + if (!isHighestLayer) return; + onEscapeKeyDown === null || onEscapeKeyDown === void 0 || onEscapeKeyDown(event); + if (!event.defaultPrevented && onDismiss) { + event.preventDefault(); + onDismiss(); + } + }, ownerDocument); + $g2vWm$react.useEffect(() => { + if (!node1) return; + if (disableOutsidePointerEvents) { + if (context.layersWithOutsidePointerEventsDisabled.size === 0) { + $d715e0554b679f1f$var$originalBodyPointerEvents = ownerDocument.body.style.pointerEvents; + ownerDocument.body.style.pointerEvents = 'none'; + } + context.layersWithOutsidePointerEventsDisabled.add(node1); + } + context.layers.add(node1); + $d715e0554b679f1f$var$dispatchUpdate(); + return () => { + if (disableOutsidePointerEvents && context.layersWithOutsidePointerEventsDisabled.size === 1) ownerDocument.body.style.pointerEvents = $d715e0554b679f1f$var$originalBodyPointerEvents; + }; + }, [node1, ownerDocument, disableOutsidePointerEvents, context]); + /** + * We purposefully prevent combining this effect with the `disableOutsidePointerEvents` effect + * because a change to `disableOutsidePointerEvents` would remove this layer from the stack + * and add it to the end again so the layering order wouldn't be _creation order_. + * We only want them to be removed from context stacks when unmounted. + */ + $g2vWm$react.useEffect(() => { + return () => { + if (!node1) return; + context.layers.delete(node1); + context.layersWithOutsidePointerEventsDisabled.delete(node1); + $d715e0554b679f1f$var$dispatchUpdate(); + }; + }, [node1, context]); + $g2vWm$react.useEffect(() => { + const handleUpdate = () => force({}); + document.addEventListener($d715e0554b679f1f$var$CONTEXT_UPDATE, handleUpdate); + return () => document.removeEventListener($d715e0554b679f1f$var$CONTEXT_UPDATE, handleUpdate); + }, []); + return /*#__PURE__*/$g2vWm$react.createElement($g2vWm$radixuireactprimitive.Primitive.div, $parcel$interopDefault($g2vWm$babelruntimehelpersextends)({}, layerProps, { + ref: composedRefs, + style: { + pointerEvents: isBodyPointerEventsDisabled ? isPointerEventsEnabled ? 'auto' : 'none' : undefined, + ...props.style + }, + onFocusCapture: $g2vWm$radixuiprimitive.composeEventHandlers(props.onFocusCapture, focusOutside.onFocusCapture), + onBlurCapture: $g2vWm$radixuiprimitive.composeEventHandlers(props.onBlurCapture, focusOutside.onBlurCapture), + onPointerDownCapture: $g2vWm$radixuiprimitive.composeEventHandlers(props.onPointerDownCapture, pointerDownOutside.onPointerDownCapture) + })); +}); +/*#__PURE__*/ +Object.assign($d715e0554b679f1f$export$177fb62ff3ec1f22, { + displayName: $d715e0554b679f1f$var$DISMISSABLE_LAYER_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DismissableLayerBranch + * -----------------------------------------------------------------------------------------------*/ +const $d715e0554b679f1f$var$BRANCH_NAME = 'DismissableLayerBranch'; +const $d715e0554b679f1f$export$4d5eb2109db14228 = /*#__PURE__*/$g2vWm$react.forwardRef((props, forwardedRef) => { + const context = $g2vWm$react.useContext($d715e0554b679f1f$var$DismissableLayerContext); + const ref = $g2vWm$react.useRef(null); + const composedRefs = $g2vWm$radixuireactcomposerefs.useComposedRefs(forwardedRef, ref); + $g2vWm$react.useEffect(() => { + const node = ref.current; + if (node) { + context.branches.add(node); + return () => { + context.branches.delete(node); + }; + } + }, [context.branches]); + return /*#__PURE__*/$g2vWm$react.createElement($g2vWm$radixuireactprimitive.Primitive.div, $parcel$interopDefault($g2vWm$babelruntimehelpersextends)({}, props, { + ref: composedRefs + })); +}); +/*#__PURE__*/ +Object.assign($d715e0554b679f1f$export$4d5eb2109db14228, { + displayName: $d715e0554b679f1f$var$BRANCH_NAME +}); +/* -----------------------------------------------------------------------------------------------*/ /** + * Listens for `pointerdown` outside a react subtree. We use `pointerdown` rather than `pointerup` + * to mimic layer dismissing behaviour present in OS. + * Returns props to pass to the node we want to check for outside events. + */ +function $d715e0554b679f1f$var$usePointerDownOutside(onPointerDownOutside) { + let ownerDocument = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : globalThis === null || globalThis === void 0 ? void 0 : globalThis.document; + const handlePointerDownOutside = $g2vWm$radixuireactusecallbackref.useCallbackRef(onPointerDownOutside); + const isPointerInsideReactTreeRef = $g2vWm$react.useRef(false); + const handleClickRef = $g2vWm$react.useRef(() => {}); + $g2vWm$react.useEffect(() => { + const handlePointerDown = event => { + if (event.target && !isPointerInsideReactTreeRef.current) { + const eventDetail = { + originalEvent: event + }; + function handleAndDispatchPointerDownOutsideEvent() { + $d715e0554b679f1f$var$handleAndDispatchCustomEvent($d715e0554b679f1f$var$POINTER_DOWN_OUTSIDE, handlePointerDownOutside, eventDetail, { + discrete: true + }); + } + /** + * On touch devices, we need to wait for a click event because browsers implement + * a ~350ms delay between the time the user stops touching the display and when the + * browser executres events. We need to ensure we don't reactivate pointer-events within + * this timeframe otherwise the browser may execute events that should have been prevented. + * + * Additionally, this also lets us deal automatically with cancellations when a click event + * isn't raised because the page was considered scrolled/drag-scrolled, long-pressed, etc. + * + * This is why we also continuously remove the previous listener, because we cannot be + * certain that it was raised, and therefore cleaned-up. + */ + if (event.pointerType === 'touch') { + ownerDocument.removeEventListener('click', handleClickRef.current); + handleClickRef.current = handleAndDispatchPointerDownOutsideEvent; + ownerDocument.addEventListener('click', handleClickRef.current, { + once: true + }); + } else handleAndDispatchPointerDownOutsideEvent(); + } + isPointerInsideReactTreeRef.current = false; + }; + /** + * if this hook executes in a component that mounts via a `pointerdown` event, the event + * would bubble up to the document and trigger a `pointerDownOutside` event. We avoid + * this by delaying the event listener registration on the document. + * This is not React specific, but rather how the DOM works, ie: + * ``` + * button.addEventListener('pointerdown', () => { + * console.log('I will log'); + * document.addEventListener('pointerdown', () => { + * console.log('I will also log'); + * }) + * }); + */ + const timerId = window.setTimeout(() => { + ownerDocument.addEventListener('pointerdown', handlePointerDown); + }, 0); + return () => { + window.clearTimeout(timerId); + ownerDocument.removeEventListener('pointerdown', handlePointerDown); + ownerDocument.removeEventListener('click', handleClickRef.current); + }; + }, [ownerDocument, handlePointerDownOutside]); + return { + // ensures we check React component tree (not just DOM tree) + onPointerDownCapture: () => isPointerInsideReactTreeRef.current = true + }; +} +/** + * Listens for when focus happens outside a react subtree. + * Returns props to pass to the root (node) of the subtree we want to check. + */ +function $d715e0554b679f1f$var$useFocusOutside(onFocusOutside) { + let ownerDocument = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : globalThis === null || globalThis === void 0 ? void 0 : globalThis.document; + const handleFocusOutside = $g2vWm$radixuireactusecallbackref.useCallbackRef(onFocusOutside); + const isFocusInsideReactTreeRef = $g2vWm$react.useRef(false); + $g2vWm$react.useEffect(() => { + const handleFocus = event => { + if (event.target && !isFocusInsideReactTreeRef.current) { + const eventDetail = { + originalEvent: event + }; + $d715e0554b679f1f$var$handleAndDispatchCustomEvent($d715e0554b679f1f$var$FOCUS_OUTSIDE, handleFocusOutside, eventDetail, { + discrete: false + }); + } + }; + ownerDocument.addEventListener('focusin', handleFocus); + return () => ownerDocument.removeEventListener('focusin', handleFocus); + }, [ownerDocument, handleFocusOutside]); + return { + onFocusCapture: () => isFocusInsideReactTreeRef.current = true, + onBlurCapture: () => isFocusInsideReactTreeRef.current = false + }; +} +function $d715e0554b679f1f$var$dispatchUpdate() { + const event = new CustomEvent($d715e0554b679f1f$var$CONTEXT_UPDATE); + document.dispatchEvent(event); +} +function $d715e0554b679f1f$var$handleAndDispatchCustomEvent(name, handler, detail, _ref) { + let { + discrete: discrete + } = _ref; + const target = detail.originalEvent.target; + const event = new CustomEvent(name, { + bubbles: false, + cancelable: true, + detail: detail + }); + if (handler) target.addEventListener(name, handler, { + once: true + }); + if (discrete) $g2vWm$radixuireactprimitive.dispatchDiscreteCustomEvent(target, event);else target.dispatchEvent(event); +} +const $d715e0554b679f1f$export$be92b6f5f03c0fe9 = $d715e0554b679f1f$export$177fb62ff3ec1f22; +const $d715e0554b679f1f$export$aecb2ddcb55c95be = $d715e0554b679f1f$export$4d5eb2109db14228; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-dropdown-menu/dist/index.js": +/*!*************************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-dropdown-menu/dist/index.js ***! + \*************************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $7dQ7Q$babelruntimehelpersextends = __webpack_require__(/*! @babel/runtime/helpers/extends */ "../../../node_modules/@babel/runtime/helpers/extends.js"); +var $7dQ7Q$react = __webpack_require__(/*! react */ "react"); +var $7dQ7Q$radixuiprimitive = __webpack_require__(/*! @radix-ui/primitive */ "../../../node_modules/@radix-ui/primitive/dist/index.js"); +var $7dQ7Q$radixuireactcomposerefs = __webpack_require__(/*! @radix-ui/react-compose-refs */ "../../../node_modules/@radix-ui/react-compose-refs/dist/index.js"); +var $7dQ7Q$radixuireactcontext = __webpack_require__(/*! @radix-ui/react-context */ "../../../node_modules/@radix-ui/react-context/dist/index.js"); +var $7dQ7Q$radixuireactusecontrollablestate = __webpack_require__(/*! @radix-ui/react-use-controllable-state */ "../../../node_modules/@radix-ui/react-use-controllable-state/dist/index.js"); +var $7dQ7Q$radixuireactprimitive = __webpack_require__(/*! @radix-ui/react-primitive */ "../../../node_modules/@radix-ui/react-primitive/dist/index.js"); +var $7dQ7Q$radixuireactmenu = __webpack_require__(/*! @radix-ui/react-menu */ "../../../node_modules/@radix-ui/react-menu/dist/index.js"); +var $7dQ7Q$radixuireactid = __webpack_require__(/*! @radix-ui/react-id */ "../../../node_modules/@radix-ui/react-id/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "createDropdownMenuScope", () => $d1bf075a6b218014$export$c0623cd925aeb687); +$parcel$export(module.exports, "DropdownMenu", () => $d1bf075a6b218014$export$e44a253a59704894); +$parcel$export(module.exports, "DropdownMenuTrigger", () => $d1bf075a6b218014$export$d2469213b3befba9); +$parcel$export(module.exports, "DropdownMenuPortal", () => $d1bf075a6b218014$export$cd369b4d4d54efc9); +$parcel$export(module.exports, "DropdownMenuContent", () => $d1bf075a6b218014$export$6e76d93a37c01248); +$parcel$export(module.exports, "DropdownMenuGroup", () => $d1bf075a6b218014$export$246bebaba3a2f70e); +$parcel$export(module.exports, "DropdownMenuLabel", () => $d1bf075a6b218014$export$76e48c5b57f24495); +$parcel$export(module.exports, "DropdownMenuItem", () => $d1bf075a6b218014$export$ed97964d1871885d); +$parcel$export(module.exports, "DropdownMenuCheckboxItem", () => $d1bf075a6b218014$export$53a69729da201fa9); +$parcel$export(module.exports, "DropdownMenuRadioGroup", () => $d1bf075a6b218014$export$3323ad73d55f587e); +$parcel$export(module.exports, "DropdownMenuRadioItem", () => $d1bf075a6b218014$export$e4f69b41b1637536); +$parcel$export(module.exports, "DropdownMenuItemIndicator", () => $d1bf075a6b218014$export$42355ae145153fb6); +$parcel$export(module.exports, "DropdownMenuSeparator", () => $d1bf075a6b218014$export$da160178fd3bc7e9); +$parcel$export(module.exports, "DropdownMenuArrow", () => $d1bf075a6b218014$export$34b8980744021ec5); +$parcel$export(module.exports, "DropdownMenuSub", () => $d1bf075a6b218014$export$2f307d81a64f5442); +$parcel$export(module.exports, "DropdownMenuSubTrigger", () => $d1bf075a6b218014$export$21dcb7ec56f874cf); +$parcel$export(module.exports, "DropdownMenuSubContent", () => $d1bf075a6b218014$export$f34ec8bc2482cc5f); +$parcel$export(module.exports, "Root", () => $d1bf075a6b218014$export$be92b6f5f03c0fe9); +$parcel$export(module.exports, "Trigger", () => $d1bf075a6b218014$export$41fb9f06171c75f4); +$parcel$export(module.exports, "Portal", () => $d1bf075a6b218014$export$602eac185826482c); +$parcel$export(module.exports, "Content", () => $d1bf075a6b218014$export$7c6e2c02157bb7d2); +$parcel$export(module.exports, "Group", () => $d1bf075a6b218014$export$eb2fcfdbd7ba97d4); +$parcel$export(module.exports, "Label", () => $d1bf075a6b218014$export$b04be29aa201d4f5); +$parcel$export(module.exports, "Item", () => $d1bf075a6b218014$export$6d08773d2e66f8f2); +$parcel$export(module.exports, "CheckboxItem", () => $d1bf075a6b218014$export$16ce288f89fa631c); +$parcel$export(module.exports, "RadioGroup", () => $d1bf075a6b218014$export$a98f0dcb43a68a25); +$parcel$export(module.exports, "RadioItem", () => $d1bf075a6b218014$export$371ab307eab489c0); +$parcel$export(module.exports, "ItemIndicator", () => $d1bf075a6b218014$export$c3468e2714d175fa); +$parcel$export(module.exports, "Separator", () => $d1bf075a6b218014$export$1ff3c3f08ae963c0); +$parcel$export(module.exports, "Arrow", () => $d1bf075a6b218014$export$21b07c8f274aebd5); +$parcel$export(module.exports, "Sub", () => $d1bf075a6b218014$export$d7a01e11500dfb6f); +$parcel$export(module.exports, "SubTrigger", () => $d1bf075a6b218014$export$2ea8a7a591ac5eac); +$parcel$export(module.exports, "SubContent", () => $d1bf075a6b218014$export$6d4de93b380beddf); + +/* ------------------------------------------------------------------------------------------------- + * DropdownMenu + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$DROPDOWN_MENU_NAME = 'DropdownMenu'; +const [$d1bf075a6b218014$var$createDropdownMenuContext, $d1bf075a6b218014$export$c0623cd925aeb687] = $7dQ7Q$radixuireactcontext.createContextScope($d1bf075a6b218014$var$DROPDOWN_MENU_NAME, [$7dQ7Q$radixuireactmenu.createMenuScope]); +const $d1bf075a6b218014$var$useMenuScope = $7dQ7Q$radixuireactmenu.createMenuScope(); +const [$d1bf075a6b218014$var$DropdownMenuProvider, $d1bf075a6b218014$var$useDropdownMenuContext] = $d1bf075a6b218014$var$createDropdownMenuContext($d1bf075a6b218014$var$DROPDOWN_MENU_NAME); +const $d1bf075a6b218014$export$e44a253a59704894 = props => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + children: children, + dir: dir, + open: openProp, + defaultOpen: defaultOpen, + onOpenChange: onOpenChange, + modal = true + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + const triggerRef = $7dQ7Q$react.useRef(null); + const [open = false, setOpen] = $7dQ7Q$radixuireactusecontrollablestate.useControllableState({ + prop: openProp, + defaultProp: defaultOpen, + onChange: onOpenChange + }); + return /*#__PURE__*/$7dQ7Q$react.createElement($d1bf075a6b218014$var$DropdownMenuProvider, { + scope: __scopeDropdownMenu, + triggerId: $7dQ7Q$radixuireactid.useId(), + triggerRef: triggerRef, + contentId: $7dQ7Q$radixuireactid.useId(), + open: open, + onOpenChange: setOpen, + onOpenToggle: $7dQ7Q$react.useCallback(() => setOpen(prevOpen => !prevOpen), [setOpen]), + modal: modal + }, /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.Root, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, { + open: open, + onOpenChange: setOpen, + dir: dir, + modal: modal + }), children)); +}; +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$e44a253a59704894, { + displayName: $d1bf075a6b218014$var$DROPDOWN_MENU_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuTrigger + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$TRIGGER_NAME = 'DropdownMenuTrigger'; +const $d1bf075a6b218014$export$d2469213b3befba9 = /*#__PURE__*/$7dQ7Q$react.forwardRef((props, forwardedRef) => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + disabled = false, + ...triggerProps + } = props; + const context = $d1bf075a6b218014$var$useDropdownMenuContext($d1bf075a6b218014$var$TRIGGER_NAME, __scopeDropdownMenu); + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.Anchor, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({ + asChild: true + }, menuScope), /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactprimitive.Primitive.button, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({ + type: "button", + id: context.triggerId, + "aria-haspopup": "menu", + "aria-expanded": context.open, + "aria-controls": context.open ? context.contentId : undefined, + "data-state": context.open ? 'open' : 'closed', + "data-disabled": disabled ? '' : undefined, + disabled: disabled + }, triggerProps, { + ref: $7dQ7Q$radixuireactcomposerefs.composeRefs(forwardedRef, context.triggerRef), + onPointerDown: $7dQ7Q$radixuiprimitive.composeEventHandlers(props.onPointerDown, event => { + // only call handler if it's the left button (mousedown gets triggered by all mouse buttons) + // but not when the control key is pressed (avoiding MacOS right click) + if (!disabled && event.button === 0 && event.ctrlKey === false) { + context.onOpenToggle(); // prevent trigger focusing when opening + // this allows the content to be given focus without competition + if (!context.open) event.preventDefault(); + } + }), + onKeyDown: $7dQ7Q$radixuiprimitive.composeEventHandlers(props.onKeyDown, event => { + if (disabled) return; + if (['Enter', ' '].includes(event.key)) context.onOpenToggle(); + if (event.key === 'ArrowDown') context.onOpenChange(true); // prevent keydown from scrolling window / first focused item to execute + // that keydown (inadvertently closing the menu) + if (['Enter', ' ', 'ArrowDown'].includes(event.key)) event.preventDefault(); + }) + }))); +}); +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$d2469213b3befba9, { + displayName: $d1bf075a6b218014$var$TRIGGER_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuPortal + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$PORTAL_NAME = 'DropdownMenuPortal'; +const $d1bf075a6b218014$export$cd369b4d4d54efc9 = props => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + ...portalProps + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.Portal, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, portalProps)); +}; +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$cd369b4d4d54efc9, { + displayName: $d1bf075a6b218014$var$PORTAL_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuContent + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$CONTENT_NAME = 'DropdownMenuContent'; +const $d1bf075a6b218014$export$6e76d93a37c01248 = /*#__PURE__*/$7dQ7Q$react.forwardRef((props, forwardedRef) => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + ...contentProps + } = props; + const context = $d1bf075a6b218014$var$useDropdownMenuContext($d1bf075a6b218014$var$CONTENT_NAME, __scopeDropdownMenu); + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + const hasInteractedOutsideRef = $7dQ7Q$react.useRef(false); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.Content, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({ + id: context.contentId, + "aria-labelledby": context.triggerId + }, menuScope, contentProps, { + ref: forwardedRef, + onCloseAutoFocus: $7dQ7Q$radixuiprimitive.composeEventHandlers(props.onCloseAutoFocus, event => { + var _context$triggerRef$c; + if (!hasInteractedOutsideRef.current) (_context$triggerRef$c = context.triggerRef.current) === null || _context$triggerRef$c === void 0 || _context$triggerRef$c.focus(); + hasInteractedOutsideRef.current = false; // Always prevent auto focus because we either focus manually or want user agent focus + event.preventDefault(); + }), + onInteractOutside: $7dQ7Q$radixuiprimitive.composeEventHandlers(props.onInteractOutside, event => { + const originalEvent = event.detail.originalEvent; + const ctrlLeftClick = originalEvent.button === 0 && originalEvent.ctrlKey === true; + const isRightClick = originalEvent.button === 2 || ctrlLeftClick; + if (!context.modal || isRightClick) hasInteractedOutsideRef.current = true; + }), + style: { + ...props.style, + '--radix-dropdown-menu-content-transform-origin': 'var(--radix-popper-transform-origin)', + '--radix-dropdown-menu-content-available-width': 'var(--radix-popper-available-width)', + '--radix-dropdown-menu-content-available-height': 'var(--radix-popper-available-height)', + '--radix-dropdown-menu-trigger-width': 'var(--radix-popper-anchor-width)', + '--radix-dropdown-menu-trigger-height': 'var(--radix-popper-anchor-height)' + } + })); +}); +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$6e76d93a37c01248, { + displayName: $d1bf075a6b218014$var$CONTENT_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuGroup + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$GROUP_NAME = 'DropdownMenuGroup'; +const $d1bf075a6b218014$export$246bebaba3a2f70e = /*#__PURE__*/$7dQ7Q$react.forwardRef((props, forwardedRef) => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + ...groupProps + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.Group, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, groupProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$246bebaba3a2f70e, { + displayName: $d1bf075a6b218014$var$GROUP_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuLabel + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$LABEL_NAME = 'DropdownMenuLabel'; +const $d1bf075a6b218014$export$76e48c5b57f24495 = /*#__PURE__*/$7dQ7Q$react.forwardRef((props, forwardedRef) => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + ...labelProps + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.Label, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, labelProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$76e48c5b57f24495, { + displayName: $d1bf075a6b218014$var$LABEL_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuItem + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$ITEM_NAME = 'DropdownMenuItem'; +const $d1bf075a6b218014$export$ed97964d1871885d = /*#__PURE__*/$7dQ7Q$react.forwardRef((props, forwardedRef) => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + ...itemProps + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.Item, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, itemProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$ed97964d1871885d, { + displayName: $d1bf075a6b218014$var$ITEM_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuCheckboxItem + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$CHECKBOX_ITEM_NAME = 'DropdownMenuCheckboxItem'; +const $d1bf075a6b218014$export$53a69729da201fa9 = /*#__PURE__*/$7dQ7Q$react.forwardRef((props, forwardedRef) => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + ...checkboxItemProps + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.CheckboxItem, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, checkboxItemProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$53a69729da201fa9, { + displayName: $d1bf075a6b218014$var$CHECKBOX_ITEM_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuRadioGroup + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$RADIO_GROUP_NAME = 'DropdownMenuRadioGroup'; +const $d1bf075a6b218014$export$3323ad73d55f587e = /*#__PURE__*/$7dQ7Q$react.forwardRef((props, forwardedRef) => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + ...radioGroupProps + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.RadioGroup, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, radioGroupProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$3323ad73d55f587e, { + displayName: $d1bf075a6b218014$var$RADIO_GROUP_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuRadioItem + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$RADIO_ITEM_NAME = 'DropdownMenuRadioItem'; +const $d1bf075a6b218014$export$e4f69b41b1637536 = /*#__PURE__*/$7dQ7Q$react.forwardRef((props, forwardedRef) => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + ...radioItemProps + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.RadioItem, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, radioItemProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$e4f69b41b1637536, { + displayName: $d1bf075a6b218014$var$RADIO_ITEM_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuItemIndicator + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$INDICATOR_NAME = 'DropdownMenuItemIndicator'; +const $d1bf075a6b218014$export$42355ae145153fb6 = /*#__PURE__*/$7dQ7Q$react.forwardRef((props, forwardedRef) => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + ...itemIndicatorProps + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.ItemIndicator, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, itemIndicatorProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$42355ae145153fb6, { + displayName: $d1bf075a6b218014$var$INDICATOR_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuSeparator + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$SEPARATOR_NAME = 'DropdownMenuSeparator'; +const $d1bf075a6b218014$export$da160178fd3bc7e9 = /*#__PURE__*/$7dQ7Q$react.forwardRef((props, forwardedRef) => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + ...separatorProps + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.Separator, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, separatorProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$da160178fd3bc7e9, { + displayName: $d1bf075a6b218014$var$SEPARATOR_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuArrow + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$ARROW_NAME = 'DropdownMenuArrow'; +const $d1bf075a6b218014$export$34b8980744021ec5 = /*#__PURE__*/$7dQ7Q$react.forwardRef((props, forwardedRef) => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + ...arrowProps + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.Arrow, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, arrowProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$34b8980744021ec5, { + displayName: $d1bf075a6b218014$var$ARROW_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuSub + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$export$2f307d81a64f5442 = props => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + children: children, + open: openProp, + onOpenChange: onOpenChange, + defaultOpen: defaultOpen + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + const [open = false, setOpen] = $7dQ7Q$radixuireactusecontrollablestate.useControllableState({ + prop: openProp, + defaultProp: defaultOpen, + onChange: onOpenChange + }); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.Sub, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, { + open: open, + onOpenChange: setOpen + }), children); +}; +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuSubTrigger + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$SUB_TRIGGER_NAME = 'DropdownMenuSubTrigger'; +const $d1bf075a6b218014$export$21dcb7ec56f874cf = /*#__PURE__*/$7dQ7Q$react.forwardRef((props, forwardedRef) => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + ...subTriggerProps + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.SubTrigger, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, subTriggerProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$21dcb7ec56f874cf, { + displayName: $d1bf075a6b218014$var$SUB_TRIGGER_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * DropdownMenuSubContent + * -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$var$SUB_CONTENT_NAME = 'DropdownMenuSubContent'; +const $d1bf075a6b218014$export$f34ec8bc2482cc5f = /*#__PURE__*/$7dQ7Q$react.forwardRef((props, forwardedRef) => { + const { + __scopeDropdownMenu: __scopeDropdownMenu, + ...subContentProps + } = props; + const menuScope = $d1bf075a6b218014$var$useMenuScope(__scopeDropdownMenu); + return /*#__PURE__*/$7dQ7Q$react.createElement($7dQ7Q$radixuireactmenu.SubContent, $parcel$interopDefault($7dQ7Q$babelruntimehelpersextends)({}, menuScope, subContentProps, { + ref: forwardedRef, + style: { + ...props.style, + '--radix-dropdown-menu-content-transform-origin': 'var(--radix-popper-transform-origin)', + '--radix-dropdown-menu-content-available-width': 'var(--radix-popper-available-width)', + '--radix-dropdown-menu-content-available-height': 'var(--radix-popper-available-height)', + '--radix-dropdown-menu-trigger-width': 'var(--radix-popper-anchor-width)', + '--radix-dropdown-menu-trigger-height': 'var(--radix-popper-anchor-height)' + } + })); +}); +/*#__PURE__*/ +Object.assign($d1bf075a6b218014$export$f34ec8bc2482cc5f, { + displayName: $d1bf075a6b218014$var$SUB_CONTENT_NAME +}); +/* -----------------------------------------------------------------------------------------------*/ +const $d1bf075a6b218014$export$be92b6f5f03c0fe9 = $d1bf075a6b218014$export$e44a253a59704894; +const $d1bf075a6b218014$export$41fb9f06171c75f4 = $d1bf075a6b218014$export$d2469213b3befba9; +const $d1bf075a6b218014$export$602eac185826482c = $d1bf075a6b218014$export$cd369b4d4d54efc9; +const $d1bf075a6b218014$export$7c6e2c02157bb7d2 = $d1bf075a6b218014$export$6e76d93a37c01248; +const $d1bf075a6b218014$export$eb2fcfdbd7ba97d4 = $d1bf075a6b218014$export$246bebaba3a2f70e; +const $d1bf075a6b218014$export$b04be29aa201d4f5 = $d1bf075a6b218014$export$76e48c5b57f24495; +const $d1bf075a6b218014$export$6d08773d2e66f8f2 = $d1bf075a6b218014$export$ed97964d1871885d; +const $d1bf075a6b218014$export$16ce288f89fa631c = $d1bf075a6b218014$export$53a69729da201fa9; +const $d1bf075a6b218014$export$a98f0dcb43a68a25 = $d1bf075a6b218014$export$3323ad73d55f587e; +const $d1bf075a6b218014$export$371ab307eab489c0 = $d1bf075a6b218014$export$e4f69b41b1637536; +const $d1bf075a6b218014$export$c3468e2714d175fa = $d1bf075a6b218014$export$42355ae145153fb6; +const $d1bf075a6b218014$export$1ff3c3f08ae963c0 = $d1bf075a6b218014$export$da160178fd3bc7e9; +const $d1bf075a6b218014$export$21b07c8f274aebd5 = $d1bf075a6b218014$export$34b8980744021ec5; +const $d1bf075a6b218014$export$d7a01e11500dfb6f = $d1bf075a6b218014$export$2f307d81a64f5442; +const $d1bf075a6b218014$export$2ea8a7a591ac5eac = $d1bf075a6b218014$export$21dcb7ec56f874cf; +const $d1bf075a6b218014$export$6d4de93b380beddf = $d1bf075a6b218014$export$f34ec8bc2482cc5f; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-focus-guards/dist/index.js": +/*!************************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-focus-guards/dist/index.js ***! + \************************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $cnctE$react = __webpack_require__(/*! react */ "react"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +$parcel$export(module.exports, "FocusGuards", () => $71476a6ed7dbbaf3$export$ac5b58043b79449b); +$parcel$export(module.exports, "Root", () => $71476a6ed7dbbaf3$export$be92b6f5f03c0fe9); +$parcel$export(module.exports, "useFocusGuards", () => $71476a6ed7dbbaf3$export$b7ece24a22aeda8c); + +/** Number of components which have requested interest to have focus guards */ +let $71476a6ed7dbbaf3$var$count = 0; +function $71476a6ed7dbbaf3$export$ac5b58043b79449b(props) { + $71476a6ed7dbbaf3$export$b7ece24a22aeda8c(); + return props.children; +} +/** + * Injects a pair of focus guards at the edges of the whole DOM tree + * to ensure `focusin` & `focusout` events can be caught consistently. + */ +function $71476a6ed7dbbaf3$export$b7ece24a22aeda8c() { + $cnctE$react.useEffect(() => { + var _edgeGuards$, _edgeGuards$2; + const edgeGuards = document.querySelectorAll('[data-radix-focus-guard]'); + document.body.insertAdjacentElement('afterbegin', (_edgeGuards$ = edgeGuards[0]) !== null && _edgeGuards$ !== void 0 ? _edgeGuards$ : $71476a6ed7dbbaf3$var$createFocusGuard()); + document.body.insertAdjacentElement('beforeend', (_edgeGuards$2 = edgeGuards[1]) !== null && _edgeGuards$2 !== void 0 ? _edgeGuards$2 : $71476a6ed7dbbaf3$var$createFocusGuard()); + $71476a6ed7dbbaf3$var$count++; + return () => { + if ($71476a6ed7dbbaf3$var$count === 1) document.querySelectorAll('[data-radix-focus-guard]').forEach(node => node.remove()); + $71476a6ed7dbbaf3$var$count--; + }; + }, []); +} +function $71476a6ed7dbbaf3$var$createFocusGuard() { + const element = document.createElement('span'); + element.setAttribute('data-radix-focus-guard', ''); + element.tabIndex = 0; + element.style.cssText = 'outline: none; opacity: 0; position: fixed; pointer-events: none'; + return element; +} +const $71476a6ed7dbbaf3$export$be92b6f5f03c0fe9 = $71476a6ed7dbbaf3$export$ac5b58043b79449b; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-focus-scope/dist/index.js": +/*!***********************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-focus-scope/dist/index.js ***! + \***********************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $buum9$babelruntimehelpersextends = __webpack_require__(/*! @babel/runtime/helpers/extends */ "../../../node_modules/@babel/runtime/helpers/extends.js"); +var $buum9$react = __webpack_require__(/*! react */ "react"); +var $buum9$radixuireactcomposerefs = __webpack_require__(/*! @radix-ui/react-compose-refs */ "../../../node_modules/@radix-ui/react-compose-refs/dist/index.js"); +var $buum9$radixuireactprimitive = __webpack_require__(/*! @radix-ui/react-primitive */ "../../../node_modules/@radix-ui/react-primitive/dist/index.js"); +var $buum9$radixuireactusecallbackref = __webpack_require__(/*! @radix-ui/react-use-callback-ref */ "../../../node_modules/@radix-ui/react-use-callback-ref/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "FocusScope", () => $2bc01e66e04aa9ed$export$20e40289641fbbb6); +$parcel$export(module.exports, "Root", () => $2bc01e66e04aa9ed$export$be92b6f5f03c0fe9); +const $2bc01e66e04aa9ed$var$AUTOFOCUS_ON_MOUNT = 'focusScope.autoFocusOnMount'; +const $2bc01e66e04aa9ed$var$AUTOFOCUS_ON_UNMOUNT = 'focusScope.autoFocusOnUnmount'; +const $2bc01e66e04aa9ed$var$EVENT_OPTIONS = { + bubbles: false, + cancelable: true +}; +/* ------------------------------------------------------------------------------------------------- + * FocusScope + * -----------------------------------------------------------------------------------------------*/ +const $2bc01e66e04aa9ed$var$FOCUS_SCOPE_NAME = 'FocusScope'; +const $2bc01e66e04aa9ed$export$20e40289641fbbb6 = /*#__PURE__*/$buum9$react.forwardRef((props, forwardedRef) => { + const { + loop = false, + trapped = false, + onMountAutoFocus: onMountAutoFocusProp, + onUnmountAutoFocus: onUnmountAutoFocusProp, + ...scopeProps + } = props; + const [container1, setContainer] = $buum9$react.useState(null); + const onMountAutoFocus = $buum9$radixuireactusecallbackref.useCallbackRef(onMountAutoFocusProp); + const onUnmountAutoFocus = $buum9$radixuireactusecallbackref.useCallbackRef(onUnmountAutoFocusProp); + const lastFocusedElementRef = $buum9$react.useRef(null); + const composedRefs = $buum9$radixuireactcomposerefs.useComposedRefs(forwardedRef, node => setContainer(node)); + const focusScope = $buum9$react.useRef({ + paused: false, + pause() { + this.paused = true; + }, + resume() { + this.paused = false; + } + }).current; // Takes care of trapping focus if focus is moved outside programmatically for example + $buum9$react.useEffect(() => { + if (trapped) { + function handleFocusIn(event) { + if (focusScope.paused || !container1) return; + const target = event.target; + if (container1.contains(target)) lastFocusedElementRef.current = target;else $2bc01e66e04aa9ed$var$focus(lastFocusedElementRef.current, { + select: true + }); + } + function handleFocusOut(event) { + if (focusScope.paused || !container1) return; + const relatedTarget = event.relatedTarget; // A `focusout` event with a `null` `relatedTarget` will happen in at least two cases: + // + // 1. When the user switches app/tabs/windows/the browser itself loses focus. + // 2. In Google Chrome, when the focused element is removed from the DOM. + // + // We let the browser do its thing here because: + // + // 1. The browser already keeps a memory of what's focused for when the page gets refocused. + // 2. In Google Chrome, if we try to focus the deleted focused element (as per below), it + // throws the CPU to 100%, so we avoid doing anything for this reason here too. + if (relatedTarget === null) return; // If the focus has moved to an actual legitimate element (`relatedTarget !== null`) + // that is outside the container, we move focus to the last valid focused element inside. + if (!container1.contains(relatedTarget)) $2bc01e66e04aa9ed$var$focus(lastFocusedElementRef.current, { + select: true + }); + } // When the focused element gets removed from the DOM, browsers move focus + // back to the document.body. In this case, we move focus to the container + // to keep focus trapped correctly. + function handleMutations(mutations) { + const focusedElement = document.activeElement; + for (const mutation of mutations) { + if (mutation.removedNodes.length > 0) { + if (!(container1 !== null && container1 !== void 0 && container1.contains(focusedElement))) $2bc01e66e04aa9ed$var$focus(container1); + } + } + } + document.addEventListener('focusin', handleFocusIn); + document.addEventListener('focusout', handleFocusOut); + const mutationObserver = new MutationObserver(handleMutations); + if (container1) mutationObserver.observe(container1, { + childList: true, + subtree: true + }); + return () => { + document.removeEventListener('focusin', handleFocusIn); + document.removeEventListener('focusout', handleFocusOut); + mutationObserver.disconnect(); + }; + } + }, [trapped, container1, focusScope.paused]); + $buum9$react.useEffect(() => { + if (container1) { + $2bc01e66e04aa9ed$var$focusScopesStack.add(focusScope); + const previouslyFocusedElement = document.activeElement; + const hasFocusedCandidate = container1.contains(previouslyFocusedElement); + if (!hasFocusedCandidate) { + const mountEvent = new CustomEvent($2bc01e66e04aa9ed$var$AUTOFOCUS_ON_MOUNT, $2bc01e66e04aa9ed$var$EVENT_OPTIONS); + container1.addEventListener($2bc01e66e04aa9ed$var$AUTOFOCUS_ON_MOUNT, onMountAutoFocus); + container1.dispatchEvent(mountEvent); + if (!mountEvent.defaultPrevented) { + $2bc01e66e04aa9ed$var$focusFirst($2bc01e66e04aa9ed$var$removeLinks($2bc01e66e04aa9ed$var$getTabbableCandidates(container1)), { + select: true + }); + if (document.activeElement === previouslyFocusedElement) $2bc01e66e04aa9ed$var$focus(container1); + } + } + return () => { + container1.removeEventListener($2bc01e66e04aa9ed$var$AUTOFOCUS_ON_MOUNT, onMountAutoFocus); // We hit a react bug (fixed in v17) with focusing in unmount. + // We need to delay the focus a little to get around it for now. + // See: https://github.com/facebook/react/issues/17894 + setTimeout(() => { + const unmountEvent = new CustomEvent($2bc01e66e04aa9ed$var$AUTOFOCUS_ON_UNMOUNT, $2bc01e66e04aa9ed$var$EVENT_OPTIONS); + container1.addEventListener($2bc01e66e04aa9ed$var$AUTOFOCUS_ON_UNMOUNT, onUnmountAutoFocus); + container1.dispatchEvent(unmountEvent); + if (!unmountEvent.defaultPrevented) $2bc01e66e04aa9ed$var$focus(previouslyFocusedElement !== null && previouslyFocusedElement !== void 0 ? previouslyFocusedElement : document.body, { + select: true + }); + // we need to remove the listener after we `dispatchEvent` + container1.removeEventListener($2bc01e66e04aa9ed$var$AUTOFOCUS_ON_UNMOUNT, onUnmountAutoFocus); + $2bc01e66e04aa9ed$var$focusScopesStack.remove(focusScope); + }, 0); + }; + } + }, [container1, onMountAutoFocus, onUnmountAutoFocus, focusScope]); // Takes care of looping focus (when tabbing whilst at the edges) + const handleKeyDown = $buum9$react.useCallback(event => { + if (!loop && !trapped) return; + if (focusScope.paused) return; + const isTabKey = event.key === 'Tab' && !event.altKey && !event.ctrlKey && !event.metaKey; + const focusedElement = document.activeElement; + if (isTabKey && focusedElement) { + const container = event.currentTarget; + const [first, last] = $2bc01e66e04aa9ed$var$getTabbableEdges(container); + const hasTabbableElementsInside = first && last; // we can only wrap focus if we have tabbable edges + if (!hasTabbableElementsInside) { + if (focusedElement === container) event.preventDefault(); + } else { + if (!event.shiftKey && focusedElement === last) { + event.preventDefault(); + if (loop) $2bc01e66e04aa9ed$var$focus(first, { + select: true + }); + } else if (event.shiftKey && focusedElement === first) { + event.preventDefault(); + if (loop) $2bc01e66e04aa9ed$var$focus(last, { + select: true + }); + } + } + } + }, [loop, trapped, focusScope.paused]); + return /*#__PURE__*/$buum9$react.createElement($buum9$radixuireactprimitive.Primitive.div, $parcel$interopDefault($buum9$babelruntimehelpersextends)({ + tabIndex: -1 + }, scopeProps, { + ref: composedRefs, + onKeyDown: handleKeyDown + })); +}); +/*#__PURE__*/ +Object.assign($2bc01e66e04aa9ed$export$20e40289641fbbb6, { + displayName: $2bc01e66e04aa9ed$var$FOCUS_SCOPE_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * Utils + * -----------------------------------------------------------------------------------------------*/ /** + * Attempts focusing the first element in a list of candidates. + * Stops when focus has actually moved. + */ +function $2bc01e66e04aa9ed$var$focusFirst(candidates) { + let { + select = false + } = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + const previouslyFocusedElement = document.activeElement; + for (const candidate of candidates) { + $2bc01e66e04aa9ed$var$focus(candidate, { + select: select + }); + if (document.activeElement !== previouslyFocusedElement) return; + } +} +/** + * Returns the first and last tabbable elements inside a container. + */ +function $2bc01e66e04aa9ed$var$getTabbableEdges(container) { + const candidates = $2bc01e66e04aa9ed$var$getTabbableCandidates(container); + const first = $2bc01e66e04aa9ed$var$findVisible(candidates, container); + const last = $2bc01e66e04aa9ed$var$findVisible(candidates.reverse(), container); + return [first, last]; +} +/** + * Returns a list of potential tabbable candidates. + * + * NOTE: This is only a close approximation. For example it doesn't take into account cases like when + * elements are not visible. This cannot be worked out easily by just reading a property, but rather + * necessitate runtime knowledge (computed styles, etc). We deal with these cases separately. + * + * See: https://developer.mozilla.org/en-US/docs/Web/API/TreeWalker + * Credit: https://github.com/discord/focus-layers/blob/master/src/util/wrapFocus.tsx#L1 + */ +function $2bc01e66e04aa9ed$var$getTabbableCandidates(container) { + const nodes = []; + const walker = document.createTreeWalker(container, NodeFilter.SHOW_ELEMENT, { + acceptNode: node => { + const isHiddenInput = node.tagName === 'INPUT' && node.type === 'hidden'; + if (node.disabled || node.hidden || isHiddenInput) return NodeFilter.FILTER_SKIP; // `.tabIndex` is not the same as the `tabindex` attribute. It works on the + // runtime's understanding of tabbability, so this automatically accounts + // for any kind of element that could be tabbed to. + return node.tabIndex >= 0 ? NodeFilter.FILTER_ACCEPT : NodeFilter.FILTER_SKIP; + } + }); + while (walker.nextNode()) nodes.push(walker.currentNode); // we do not take into account the order of nodes with positive `tabIndex` as it + // hinders accessibility to have tab order different from visual order. + return nodes; +} +/** + * Returns the first visible element in a list. + * NOTE: Only checks visibility up to the `container`. + */ +function $2bc01e66e04aa9ed$var$findVisible(elements, container) { + for (const element of elements) { + // we stop checking if it's hidden at the `container` level (excluding) + if (!$2bc01e66e04aa9ed$var$isHidden(element, { + upTo: container + })) return element; + } +} +function $2bc01e66e04aa9ed$var$isHidden(node, _ref) { + let { + upTo: upTo + } = _ref; + if (getComputedStyle(node).visibility === 'hidden') return true; + while (node) { + // we stop at `upTo` (excluding it) + if (upTo !== undefined && node === upTo) return false; + if (getComputedStyle(node).display === 'none') return true; + node = node.parentElement; + } + return false; +} +function $2bc01e66e04aa9ed$var$isSelectableInput(element) { + return element instanceof HTMLInputElement && 'select' in element; +} +function $2bc01e66e04aa9ed$var$focus(element) { + let { + select = false + } = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + // only focus if that element is focusable + if (element && element.focus) { + const previouslyFocusedElement = document.activeElement; // NOTE: we prevent scrolling on focus, to minimize jarring transitions for users + element.focus({ + preventScroll: true + }); // only select if its not the same element, it supports selection and we need to select + if (element !== previouslyFocusedElement && $2bc01e66e04aa9ed$var$isSelectableInput(element) && select) element.select(); + } +} +/* ------------------------------------------------------------------------------------------------- + * FocusScope stack + * -----------------------------------------------------------------------------------------------*/ +const $2bc01e66e04aa9ed$var$focusScopesStack = $2bc01e66e04aa9ed$var$createFocusScopesStack(); +function $2bc01e66e04aa9ed$var$createFocusScopesStack() { + /** A stack of focus scopes, with the active one at the top */let stack = []; + return { + add(focusScope) { + // pause the currently active focus scope (at the top of the stack) + const activeFocusScope = stack[0]; + if (focusScope !== activeFocusScope) activeFocusScope === null || activeFocusScope === void 0 || activeFocusScope.pause(); + // remove in case it already exists (because we'll re-add it at the top of the stack) + stack = $2bc01e66e04aa9ed$var$arrayRemove(stack, focusScope); + stack.unshift(focusScope); + }, + remove(focusScope) { + var _stack$; + stack = $2bc01e66e04aa9ed$var$arrayRemove(stack, focusScope); + (_stack$ = stack[0]) === null || _stack$ === void 0 || _stack$.resume(); + } + }; +} +function $2bc01e66e04aa9ed$var$arrayRemove(array, item) { + const updatedArray = [...array]; + const index = updatedArray.indexOf(item); + if (index !== -1) updatedArray.splice(index, 1); + return updatedArray; +} +function $2bc01e66e04aa9ed$var$removeLinks(items) { + return items.filter(item => item.tagName !== 'A'); +} +const $2bc01e66e04aa9ed$export$be92b6f5f03c0fe9 = $2bc01e66e04aa9ed$export$20e40289641fbbb6; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-id/dist/index.js": +/*!**************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-id/dist/index.js ***! + \**************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $47woD$react = __webpack_require__(/*! react */ "react"); +var $47woD$radixuireactuselayouteffect = __webpack_require__(/*! @radix-ui/react-use-layout-effect */ "../../../node_modules/@radix-ui/react-use-layout-effect/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +$parcel$export(module.exports, "useId", () => $dc478e4659f630c5$export$f680877a34711e37); +const $dc478e4659f630c5$var$useReactId = $47woD$react['useId'.toString()] || (() => undefined); +let $dc478e4659f630c5$var$count = 0; +function $dc478e4659f630c5$export$f680877a34711e37(deterministicId) { + const [id, setId] = $47woD$react.useState($dc478e4659f630c5$var$useReactId()); // React versions older than 18 will have client-side ids only. + $47woD$radixuireactuselayouteffect.useLayoutEffect(() => { + if (!deterministicId) setId(reactId => reactId !== null && reactId !== void 0 ? reactId : String($dc478e4659f630c5$var$count++)); + }, [deterministicId]); + return deterministicId || (id ? `radix-${id}` : ''); +} + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-menu/dist/index.js": +/*!****************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-menu/dist/index.js ***! + \****************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $cnSS2$babelruntimehelpersextends = __webpack_require__(/*! @babel/runtime/helpers/extends */ "../../../node_modules/@babel/runtime/helpers/extends.js"); +var $cnSS2$react = __webpack_require__(/*! react */ "react"); +var $cnSS2$radixuiprimitive = __webpack_require__(/*! @radix-ui/primitive */ "../../../node_modules/@radix-ui/primitive/dist/index.js"); +var $cnSS2$radixuireactcollection = __webpack_require__(/*! @radix-ui/react-collection */ "../../../node_modules/@radix-ui/react-collection/dist/index.js"); +var $cnSS2$radixuireactcomposerefs = __webpack_require__(/*! @radix-ui/react-compose-refs */ "../../../node_modules/@radix-ui/react-compose-refs/dist/index.js"); +var $cnSS2$radixuireactcontext = __webpack_require__(/*! @radix-ui/react-context */ "../../../node_modules/@radix-ui/react-context/dist/index.js"); +var $cnSS2$radixuireactdirection = __webpack_require__(/*! @radix-ui/react-direction */ "../../../node_modules/@radix-ui/react-direction/dist/index.js"); +var $cnSS2$radixuireactdismissablelayer = __webpack_require__(/*! @radix-ui/react-dismissable-layer */ "../../../node_modules/@radix-ui/react-dismissable-layer/dist/index.js"); +var $cnSS2$radixuireactfocusguards = __webpack_require__(/*! @radix-ui/react-focus-guards */ "../../../node_modules/@radix-ui/react-focus-guards/dist/index.js"); +var $cnSS2$radixuireactfocusscope = __webpack_require__(/*! @radix-ui/react-focus-scope */ "../../../node_modules/@radix-ui/react-focus-scope/dist/index.js"); +var $cnSS2$radixuireactid = __webpack_require__(/*! @radix-ui/react-id */ "../../../node_modules/@radix-ui/react-id/dist/index.js"); +var $cnSS2$radixuireactpopper = __webpack_require__(/*! @radix-ui/react-popper */ "../../../node_modules/@radix-ui/react-popper/dist/index.js"); +var $cnSS2$radixuireactportal = __webpack_require__(/*! @radix-ui/react-portal */ "../../../node_modules/@radix-ui/react-portal/dist/index.js"); +var $cnSS2$radixuireactpresence = __webpack_require__(/*! @radix-ui/react-presence */ "../../../node_modules/@radix-ui/react-presence/dist/index.js"); +var $cnSS2$radixuireactprimitive = __webpack_require__(/*! @radix-ui/react-primitive */ "../../../node_modules/@radix-ui/react-primitive/dist/index.js"); +var $cnSS2$radixuireactrovingfocus = __webpack_require__(/*! @radix-ui/react-roving-focus */ "../../../node_modules/@radix-ui/react-roving-focus/dist/index.js"); +var $cnSS2$radixuireactslot = __webpack_require__(/*! @radix-ui/react-slot */ "../../../node_modules/@radix-ui/react-slot/dist/index.js"); +var $cnSS2$radixuireactusecallbackref = __webpack_require__(/*! @radix-ui/react-use-callback-ref */ "../../../node_modules/@radix-ui/react-use-callback-ref/dist/index.js"); +var $cnSS2$ariahidden = __webpack_require__(/*! aria-hidden */ "../../../node_modules/aria-hidden/dist/es2015/index.js"); +var $cnSS2$reactremovescroll = __webpack_require__(/*! react-remove-scroll */ "../../../node_modules/react-remove-scroll/dist/es2015/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "createMenuScope", () => $213e4d2df823067d$export$4027731b685e72eb); +$parcel$export(module.exports, "Menu", () => $213e4d2df823067d$export$d9b273488cd8ce6f); +$parcel$export(module.exports, "MenuAnchor", () => $213e4d2df823067d$export$9fa5ebd18bee4d43); +$parcel$export(module.exports, "MenuPortal", () => $213e4d2df823067d$export$793392f970497feb); +$parcel$export(module.exports, "MenuContent", () => $213e4d2df823067d$export$479f0f2f71193efe); +$parcel$export(module.exports, "MenuGroup", () => $213e4d2df823067d$export$22a631d1f72787bb); +$parcel$export(module.exports, "MenuLabel", () => $213e4d2df823067d$export$dd37bec0e8a99143); +$parcel$export(module.exports, "MenuItem", () => $213e4d2df823067d$export$2ce376c2cc3355c8); +$parcel$export(module.exports, "MenuCheckboxItem", () => $213e4d2df823067d$export$f6f243521332502d); +$parcel$export(module.exports, "MenuRadioGroup", () => $213e4d2df823067d$export$ea2200c9eee416b3); +$parcel$export(module.exports, "MenuRadioItem", () => $213e4d2df823067d$export$69bd225e9817f6d0); +$parcel$export(module.exports, "MenuItemIndicator", () => $213e4d2df823067d$export$a2593e23056970a3); +$parcel$export(module.exports, "MenuSeparator", () => $213e4d2df823067d$export$1cec7dcdd713e220); +$parcel$export(module.exports, "MenuArrow", () => $213e4d2df823067d$export$bcdda4773debf5fa); +$parcel$export(module.exports, "MenuSub", () => $213e4d2df823067d$export$71bdb9d1e2909932); +$parcel$export(module.exports, "MenuSubTrigger", () => $213e4d2df823067d$export$5fbbb3ba7297405f); +$parcel$export(module.exports, "MenuSubContent", () => $213e4d2df823067d$export$e7142ab31822bde6); +$parcel$export(module.exports, "Root", () => $213e4d2df823067d$export$be92b6f5f03c0fe9); +$parcel$export(module.exports, "Anchor", () => $213e4d2df823067d$export$b688253958b8dfe7); +$parcel$export(module.exports, "Portal", () => $213e4d2df823067d$export$602eac185826482c); +$parcel$export(module.exports, "Content", () => $213e4d2df823067d$export$7c6e2c02157bb7d2); +$parcel$export(module.exports, "Group", () => $213e4d2df823067d$export$eb2fcfdbd7ba97d4); +$parcel$export(module.exports, "Label", () => $213e4d2df823067d$export$b04be29aa201d4f5); +$parcel$export(module.exports, "Item", () => $213e4d2df823067d$export$6d08773d2e66f8f2); +$parcel$export(module.exports, "CheckboxItem", () => $213e4d2df823067d$export$16ce288f89fa631c); +$parcel$export(module.exports, "RadioGroup", () => $213e4d2df823067d$export$a98f0dcb43a68a25); +$parcel$export(module.exports, "RadioItem", () => $213e4d2df823067d$export$371ab307eab489c0); +$parcel$export(module.exports, "ItemIndicator", () => $213e4d2df823067d$export$c3468e2714d175fa); +$parcel$export(module.exports, "Separator", () => $213e4d2df823067d$export$1ff3c3f08ae963c0); +$parcel$export(module.exports, "Arrow", () => $213e4d2df823067d$export$21b07c8f274aebd5); +$parcel$export(module.exports, "Sub", () => $213e4d2df823067d$export$d7a01e11500dfb6f); +$parcel$export(module.exports, "SubTrigger", () => $213e4d2df823067d$export$2ea8a7a591ac5eac); +$parcel$export(module.exports, "SubContent", () => $213e4d2df823067d$export$6d4de93b380beddf); +const $213e4d2df823067d$var$SELECTION_KEYS = ['Enter', ' ']; +const $213e4d2df823067d$var$FIRST_KEYS = ['ArrowDown', 'PageUp', 'Home']; +const $213e4d2df823067d$var$LAST_KEYS = ['ArrowUp', 'PageDown', 'End']; +const $213e4d2df823067d$var$FIRST_LAST_KEYS = [...$213e4d2df823067d$var$FIRST_KEYS, ...$213e4d2df823067d$var$LAST_KEYS]; +const $213e4d2df823067d$var$SUB_OPEN_KEYS = { + ltr: [...$213e4d2df823067d$var$SELECTION_KEYS, 'ArrowRight'], + rtl: [...$213e4d2df823067d$var$SELECTION_KEYS, 'ArrowLeft'] +}; +const $213e4d2df823067d$var$SUB_CLOSE_KEYS = { + ltr: ['ArrowLeft'], + rtl: ['ArrowRight'] +}; +/* ------------------------------------------------------------------------------------------------- + * Menu + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$MENU_NAME = 'Menu'; +const [$213e4d2df823067d$var$Collection, $213e4d2df823067d$var$useCollection, $213e4d2df823067d$var$createCollectionScope] = $cnSS2$radixuireactcollection.createCollection($213e4d2df823067d$var$MENU_NAME); +const [$213e4d2df823067d$var$createMenuContext, $213e4d2df823067d$export$4027731b685e72eb] = $cnSS2$radixuireactcontext.createContextScope($213e4d2df823067d$var$MENU_NAME, [$213e4d2df823067d$var$createCollectionScope, $cnSS2$radixuireactpopper.createPopperScope, $cnSS2$radixuireactrovingfocus.createRovingFocusGroupScope]); +const $213e4d2df823067d$var$usePopperScope = $cnSS2$radixuireactpopper.createPopperScope(); +const $213e4d2df823067d$var$useRovingFocusGroupScope = $cnSS2$radixuireactrovingfocus.createRovingFocusGroupScope(); +const [$213e4d2df823067d$var$MenuProvider, $213e4d2df823067d$var$useMenuContext] = $213e4d2df823067d$var$createMenuContext($213e4d2df823067d$var$MENU_NAME); +const [$213e4d2df823067d$var$MenuRootProvider, $213e4d2df823067d$var$useMenuRootContext] = $213e4d2df823067d$var$createMenuContext($213e4d2df823067d$var$MENU_NAME); +const $213e4d2df823067d$export$d9b273488cd8ce6f = props => { + const { + __scopeMenu: __scopeMenu, + open = false, + children: children, + dir: dir, + onOpenChange: onOpenChange, + modal = true + } = props; + const popperScope = $213e4d2df823067d$var$usePopperScope(__scopeMenu); + const [content, setContent] = $cnSS2$react.useState(null); + const isUsingKeyboardRef = $cnSS2$react.useRef(false); + const handleOpenChange = $cnSS2$radixuireactusecallbackref.useCallbackRef(onOpenChange); + const direction = $cnSS2$radixuireactdirection.useDirection(dir); + $cnSS2$react.useEffect(() => { + // Capture phase ensures we set the boolean before any side effects execute + // in response to the key or pointer event as they might depend on this value. + const handleKeyDown = () => { + isUsingKeyboardRef.current = true; + document.addEventListener('pointerdown', handlePointer, { + capture: true, + once: true + }); + document.addEventListener('pointermove', handlePointer, { + capture: true, + once: true + }); + }; + const handlePointer = () => isUsingKeyboardRef.current = false; + document.addEventListener('keydown', handleKeyDown, { + capture: true + }); + return () => { + document.removeEventListener('keydown', handleKeyDown, { + capture: true + }); + document.removeEventListener('pointerdown', handlePointer, { + capture: true + }); + document.removeEventListener('pointermove', handlePointer, { + capture: true + }); + }; + }, []); + return /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactpopper.Root, popperScope, /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$MenuProvider, { + scope: __scopeMenu, + open: open, + onOpenChange: handleOpenChange, + content: content, + onContentChange: setContent + }, /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$MenuRootProvider, { + scope: __scopeMenu, + onClose: $cnSS2$react.useCallback(() => handleOpenChange(false), [handleOpenChange]), + isUsingKeyboardRef: isUsingKeyboardRef, + dir: direction, + modal: modal + }, children))); +}; +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$d9b273488cd8ce6f, { + displayName: $213e4d2df823067d$var$MENU_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuAnchor + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$ANCHOR_NAME = 'MenuAnchor'; +const $213e4d2df823067d$export$9fa5ebd18bee4d43 = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const { + __scopeMenu: __scopeMenu, + ...anchorProps + } = props; + const popperScope = $213e4d2df823067d$var$usePopperScope(__scopeMenu); + return /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactpopper.Anchor, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({}, popperScope, anchorProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$9fa5ebd18bee4d43, { + displayName: $213e4d2df823067d$var$ANCHOR_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuPortal + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$PORTAL_NAME = 'MenuPortal'; +const [$213e4d2df823067d$var$PortalProvider, $213e4d2df823067d$var$usePortalContext] = $213e4d2df823067d$var$createMenuContext($213e4d2df823067d$var$PORTAL_NAME, { + forceMount: undefined +}); +const $213e4d2df823067d$export$793392f970497feb = props => { + const { + __scopeMenu: __scopeMenu, + forceMount: forceMount, + children: children, + container: container + } = props; + const context = $213e4d2df823067d$var$useMenuContext($213e4d2df823067d$var$PORTAL_NAME, __scopeMenu); + return /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$PortalProvider, { + scope: __scopeMenu, + forceMount: forceMount + }, /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactpresence.Presence, { + present: forceMount || context.open + }, /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactportal.Portal, { + asChild: true, + container: container + }, children))); +}; +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$793392f970497feb, { + displayName: $213e4d2df823067d$var$PORTAL_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuContent + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$CONTENT_NAME = 'MenuContent'; +const [$213e4d2df823067d$var$MenuContentProvider, $213e4d2df823067d$var$useMenuContentContext] = $213e4d2df823067d$var$createMenuContext($213e4d2df823067d$var$CONTENT_NAME); +const $213e4d2df823067d$export$479f0f2f71193efe = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const portalContext = $213e4d2df823067d$var$usePortalContext($213e4d2df823067d$var$CONTENT_NAME, props.__scopeMenu); + const { + forceMount = portalContext.forceMount, + ...contentProps + } = props; + const context = $213e4d2df823067d$var$useMenuContext($213e4d2df823067d$var$CONTENT_NAME, props.__scopeMenu); + const rootContext = $213e4d2df823067d$var$useMenuRootContext($213e4d2df823067d$var$CONTENT_NAME, props.__scopeMenu); + return /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$Collection.Provider, { + scope: props.__scopeMenu + }, /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactpresence.Presence, { + present: forceMount || context.open + }, /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$Collection.Slot, { + scope: props.__scopeMenu + }, rootContext.modal ? /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$MenuRootContentModal, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({}, contentProps, { + ref: forwardedRef + })) : /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$MenuRootContentNonModal, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({}, contentProps, { + ref: forwardedRef + }))))); +}); +/* ---------------------------------------------------------------------------------------------- */ +const $213e4d2df823067d$var$MenuRootContentModal = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const context = $213e4d2df823067d$var$useMenuContext($213e4d2df823067d$var$CONTENT_NAME, props.__scopeMenu); + const ref = $cnSS2$react.useRef(null); + const composedRefs = $cnSS2$radixuireactcomposerefs.useComposedRefs(forwardedRef, ref); // Hide everything from ARIA except the `MenuContent` + $cnSS2$react.useEffect(() => { + const content = ref.current; + if (content) return $cnSS2$ariahidden.hideOthers(content); + }, []); + return /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$MenuContentImpl, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({}, props, { + ref: composedRefs // we make sure we're not trapping once it's been closed + , + + trapFocus: context.open // make sure to only disable pointer events when open + , + + disableOutsidePointerEvents: context.open, + disableOutsideScroll: true // When focus is trapped, a `focusout` event may still happen. + , + + onFocusOutside: $cnSS2$radixuiprimitive.composeEventHandlers(props.onFocusOutside, event => event.preventDefault(), { + checkForDefaultPrevented: false + }), + onDismiss: () => context.onOpenChange(false) + })); +}); +const $213e4d2df823067d$var$MenuRootContentNonModal = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const context = $213e4d2df823067d$var$useMenuContext($213e4d2df823067d$var$CONTENT_NAME, props.__scopeMenu); + return /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$MenuContentImpl, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({}, props, { + ref: forwardedRef, + trapFocus: false, + disableOutsidePointerEvents: false, + disableOutsideScroll: false, + onDismiss: () => context.onOpenChange(false) + })); +}); +/* ---------------------------------------------------------------------------------------------- */ +const $213e4d2df823067d$var$MenuContentImpl = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const { + __scopeMenu: __scopeMenu, + loop = false, + trapFocus: trapFocus, + onOpenAutoFocus: onOpenAutoFocus, + onCloseAutoFocus: onCloseAutoFocus, + disableOutsidePointerEvents: disableOutsidePointerEvents, + onEntryFocus: onEntryFocus, + onEscapeKeyDown: onEscapeKeyDown, + onPointerDownOutside: onPointerDownOutside, + onFocusOutside: onFocusOutside, + onInteractOutside: onInteractOutside, + onDismiss: onDismiss, + disableOutsideScroll: disableOutsideScroll, + ...contentProps + } = props; + const context = $213e4d2df823067d$var$useMenuContext($213e4d2df823067d$var$CONTENT_NAME, __scopeMenu); + const rootContext = $213e4d2df823067d$var$useMenuRootContext($213e4d2df823067d$var$CONTENT_NAME, __scopeMenu); + const popperScope = $213e4d2df823067d$var$usePopperScope(__scopeMenu); + const rovingFocusGroupScope = $213e4d2df823067d$var$useRovingFocusGroupScope(__scopeMenu); + const getItems = $213e4d2df823067d$var$useCollection(__scopeMenu); + const [currentItemId, setCurrentItemId] = $cnSS2$react.useState(null); + const contentRef = $cnSS2$react.useRef(null); + const composedRefs = $cnSS2$radixuireactcomposerefs.useComposedRefs(forwardedRef, contentRef, context.onContentChange); + const timerRef = $cnSS2$react.useRef(0); + const searchRef = $cnSS2$react.useRef(''); + const pointerGraceTimerRef = $cnSS2$react.useRef(0); + const pointerGraceIntentRef = $cnSS2$react.useRef(null); + const pointerDirRef = $cnSS2$react.useRef('right'); + const lastPointerXRef = $cnSS2$react.useRef(0); + const ScrollLockWrapper = disableOutsideScroll ? $cnSS2$reactremovescroll.RemoveScroll : $cnSS2$react.Fragment; + const scrollLockWrapperProps = disableOutsideScroll ? { + as: $cnSS2$radixuireactslot.Slot, + allowPinchZoom: true + } : undefined; + const handleTypeaheadSearch = key => { + var _items$find, _items$find2; + const search = searchRef.current + key; + const items = getItems().filter(item => !item.disabled); + const currentItem = document.activeElement; + const currentMatch = (_items$find = items.find(item => item.ref.current === currentItem)) === null || _items$find === void 0 ? void 0 : _items$find.textValue; + const values = items.map(item => item.textValue); + const nextMatch = $213e4d2df823067d$var$getNextMatch(values, search, currentMatch); + const newItem = (_items$find2 = items.find(item => item.textValue === nextMatch)) === null || _items$find2 === void 0 ? void 0 : _items$find2.ref.current; // Reset `searchRef` 1 second after it was last updated + (function updateSearch(value) { + searchRef.current = value; + window.clearTimeout(timerRef.current); + if (value !== '') timerRef.current = window.setTimeout(() => updateSearch(''), 1000); + })(search); + if (newItem) + /** + * Imperative focus during keydown is risky so we prevent React's batching updates + * to avoid potential bugs. See: https://github.com/facebook/react/issues/20332 + */ + setTimeout(() => newItem.focus()); + }; + $cnSS2$react.useEffect(() => { + return () => window.clearTimeout(timerRef.current); + }, []); // Make sure the whole tree has focus guards as our `MenuContent` may be + // the last element in the DOM (beacuse of the `Portal`) + $cnSS2$radixuireactfocusguards.useFocusGuards(); + const isPointerMovingToSubmenu = $cnSS2$react.useCallback(event => { + var _pointerGraceIntentRe, _pointerGraceIntentRe2; + const isMovingTowards = pointerDirRef.current === ((_pointerGraceIntentRe = pointerGraceIntentRef.current) === null || _pointerGraceIntentRe === void 0 ? void 0 : _pointerGraceIntentRe.side); + return isMovingTowards && $213e4d2df823067d$var$isPointerInGraceArea(event, (_pointerGraceIntentRe2 = pointerGraceIntentRef.current) === null || _pointerGraceIntentRe2 === void 0 ? void 0 : _pointerGraceIntentRe2.area); + }, []); + return /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$MenuContentProvider, { + scope: __scopeMenu, + searchRef: searchRef, + onItemEnter: $cnSS2$react.useCallback(event => { + if (isPointerMovingToSubmenu(event)) event.preventDefault(); + }, [isPointerMovingToSubmenu]), + onItemLeave: $cnSS2$react.useCallback(event => { + var _contentRef$current; + if (isPointerMovingToSubmenu(event)) return; + (_contentRef$current = contentRef.current) === null || _contentRef$current === void 0 || _contentRef$current.focus(); + setCurrentItemId(null); + }, [isPointerMovingToSubmenu]), + onTriggerLeave: $cnSS2$react.useCallback(event => { + if (isPointerMovingToSubmenu(event)) event.preventDefault(); + }, [isPointerMovingToSubmenu]), + pointerGraceTimerRef: pointerGraceTimerRef, + onPointerGraceIntentChange: $cnSS2$react.useCallback(intent => { + pointerGraceIntentRef.current = intent; + }, []) + }, /*#__PURE__*/$cnSS2$react.createElement(ScrollLockWrapper, scrollLockWrapperProps, /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactfocusscope.FocusScope, { + asChild: true, + trapped: trapFocus, + onMountAutoFocus: $cnSS2$radixuiprimitive.composeEventHandlers(onOpenAutoFocus, event => { + var _contentRef$current2; + // when opening, explicitly focus the content area only and leave + // `onEntryFocus` in control of focusing first item + event.preventDefault(); + (_contentRef$current2 = contentRef.current) === null || _contentRef$current2 === void 0 || _contentRef$current2.focus(); + }), + onUnmountAutoFocus: onCloseAutoFocus + }, /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactdismissablelayer.DismissableLayer, { + asChild: true, + disableOutsidePointerEvents: disableOutsidePointerEvents, + onEscapeKeyDown: onEscapeKeyDown, + onPointerDownOutside: onPointerDownOutside, + onFocusOutside: onFocusOutside, + onInteractOutside: onInteractOutside, + onDismiss: onDismiss + }, /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactrovingfocus.Root, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({ + asChild: true + }, rovingFocusGroupScope, { + dir: rootContext.dir, + orientation: "vertical", + loop: loop, + currentTabStopId: currentItemId, + onCurrentTabStopIdChange: setCurrentItemId, + onEntryFocus: $cnSS2$radixuiprimitive.composeEventHandlers(onEntryFocus, event => { + // only focus first item when using keyboard + if (!rootContext.isUsingKeyboardRef.current) event.preventDefault(); + }) + }), /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactpopper.Content, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({ + role: "menu", + "aria-orientation": "vertical", + "data-state": $213e4d2df823067d$var$getOpenState(context.open), + "data-radix-menu-content": "", + dir: rootContext.dir + }, popperScope, contentProps, { + ref: composedRefs, + style: { + outline: 'none', + ...contentProps.style + }, + onKeyDown: $cnSS2$radixuiprimitive.composeEventHandlers(contentProps.onKeyDown, event => { + // submenu key events bubble through portals. We only care about keys in this menu. + const target = event.target; + const isKeyDownInside = target.closest('[data-radix-menu-content]') === event.currentTarget; + const isModifierKey = event.ctrlKey || event.altKey || event.metaKey; + const isCharacterKey = event.key.length === 1; + if (isKeyDownInside) { + // menus should not be navigated using tab key so we prevent it + if (event.key === 'Tab') event.preventDefault(); + if (!isModifierKey && isCharacterKey) handleTypeaheadSearch(event.key); + } // focus first/last item based on key pressed + const content = contentRef.current; + if (event.target !== content) return; + if (!$213e4d2df823067d$var$FIRST_LAST_KEYS.includes(event.key)) return; + event.preventDefault(); + const items = getItems().filter(item => !item.disabled); + const candidateNodes = items.map(item => item.ref.current); + if ($213e4d2df823067d$var$LAST_KEYS.includes(event.key)) candidateNodes.reverse(); + $213e4d2df823067d$var$focusFirst(candidateNodes); + }), + onBlur: $cnSS2$radixuiprimitive.composeEventHandlers(props.onBlur, event => { + // clear search buffer when leaving the menu + if (!event.currentTarget.contains(event.target)) { + window.clearTimeout(timerRef.current); + searchRef.current = ''; + } + }), + onPointerMove: $cnSS2$radixuiprimitive.composeEventHandlers(props.onPointerMove, $213e4d2df823067d$var$whenMouse(event => { + const target = event.target; + const pointerXHasChanged = lastPointerXRef.current !== event.clientX; // We don't use `event.movementX` for this check because Safari will + // always return `0` on a pointer event. + if (event.currentTarget.contains(target) && pointerXHasChanged) { + const newDir = event.clientX > lastPointerXRef.current ? 'right' : 'left'; + pointerDirRef.current = newDir; + lastPointerXRef.current = event.clientX; + } + })) + }))))))); +}); +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$479f0f2f71193efe, { + displayName: $213e4d2df823067d$var$CONTENT_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuGroup + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$GROUP_NAME = 'MenuGroup'; +const $213e4d2df823067d$export$22a631d1f72787bb = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const { + __scopeMenu: __scopeMenu, + ...groupProps + } = props; + return /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactprimitive.Primitive.div, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({ + role: "group" + }, groupProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$22a631d1f72787bb, { + displayName: $213e4d2df823067d$var$GROUP_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuLabel + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$LABEL_NAME = 'MenuLabel'; +const $213e4d2df823067d$export$dd37bec0e8a99143 = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const { + __scopeMenu: __scopeMenu, + ...labelProps + } = props; + return /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactprimitive.Primitive.div, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({}, labelProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$dd37bec0e8a99143, { + displayName: $213e4d2df823067d$var$LABEL_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuItem + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$ITEM_NAME = 'MenuItem'; +const $213e4d2df823067d$var$ITEM_SELECT = 'menu.itemSelect'; +const $213e4d2df823067d$export$2ce376c2cc3355c8 = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const { + disabled = false, + onSelect: onSelect, + ...itemProps + } = props; + const ref = $cnSS2$react.useRef(null); + const rootContext = $213e4d2df823067d$var$useMenuRootContext($213e4d2df823067d$var$ITEM_NAME, props.__scopeMenu); + const contentContext = $213e4d2df823067d$var$useMenuContentContext($213e4d2df823067d$var$ITEM_NAME, props.__scopeMenu); + const composedRefs = $cnSS2$radixuireactcomposerefs.useComposedRefs(forwardedRef, ref); + const isPointerDownRef = $cnSS2$react.useRef(false); + const handleSelect = () => { + const menuItem = ref.current; + if (!disabled && menuItem) { + const itemSelectEvent = new CustomEvent($213e4d2df823067d$var$ITEM_SELECT, { + bubbles: true, + cancelable: true + }); + menuItem.addEventListener($213e4d2df823067d$var$ITEM_SELECT, event => onSelect === null || onSelect === void 0 ? void 0 : onSelect(event), { + once: true + }); + $cnSS2$radixuireactprimitive.dispatchDiscreteCustomEvent(menuItem, itemSelectEvent); + if (itemSelectEvent.defaultPrevented) isPointerDownRef.current = false;else rootContext.onClose(); + } + }; + return /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$MenuItemImpl, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({}, itemProps, { + ref: composedRefs, + disabled: disabled, + onClick: $cnSS2$radixuiprimitive.composeEventHandlers(props.onClick, handleSelect), + onPointerDown: event => { + var _props$onPointerDown; + (_props$onPointerDown = props.onPointerDown) === null || _props$onPointerDown === void 0 || _props$onPointerDown.call(props, event); + isPointerDownRef.current = true; + }, + onPointerUp: $cnSS2$radixuiprimitive.composeEventHandlers(props.onPointerUp, event => { + var _event$currentTarget; + // Pointer down can move to a different menu item which should activate it on pointer up. + // We dispatch a click for selection to allow composition with click based triggers and to + // prevent Firefox from getting stuck in text selection mode when the menu closes. + if (!isPointerDownRef.current) (_event$currentTarget = event.currentTarget) === null || _event$currentTarget === void 0 || _event$currentTarget.click(); + }), + onKeyDown: $cnSS2$radixuiprimitive.composeEventHandlers(props.onKeyDown, event => { + const isTypingAhead = contentContext.searchRef.current !== ''; + if (disabled || isTypingAhead && event.key === ' ') return; + if ($213e4d2df823067d$var$SELECTION_KEYS.includes(event.key)) { + event.currentTarget.click(); + /** + * We prevent default browser behaviour for selection keys as they should trigger + * a selection only: + * - prevents space from scrolling the page. + * - if keydown causes focus to move, prevents keydown from firing on the new target. + */ + event.preventDefault(); + } + }) + })); +}); +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$2ce376c2cc3355c8, { + displayName: $213e4d2df823067d$var$ITEM_NAME +}); +/* ---------------------------------------------------------------------------------------------- */ +const $213e4d2df823067d$var$MenuItemImpl = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const { + __scopeMenu: __scopeMenu, + disabled = false, + textValue: textValue, + ...itemProps + } = props; + const contentContext = $213e4d2df823067d$var$useMenuContentContext($213e4d2df823067d$var$ITEM_NAME, __scopeMenu); + const rovingFocusGroupScope = $213e4d2df823067d$var$useRovingFocusGroupScope(__scopeMenu); + const ref = $cnSS2$react.useRef(null); + const composedRefs = $cnSS2$radixuireactcomposerefs.useComposedRefs(forwardedRef, ref); + const [isFocused, setIsFocused] = $cnSS2$react.useState(false); // get the item's `.textContent` as default strategy for typeahead `textValue` + const [textContent, setTextContent] = $cnSS2$react.useState(''); + $cnSS2$react.useEffect(() => { + const menuItem = ref.current; + if (menuItem) { + var _menuItem$textContent; + setTextContent(((_menuItem$textContent = menuItem.textContent) !== null && _menuItem$textContent !== void 0 ? _menuItem$textContent : '').trim()); + } + }, [itemProps.children]); + return /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$Collection.ItemSlot, { + scope: __scopeMenu, + disabled: disabled, + textValue: textValue !== null && textValue !== void 0 ? textValue : textContent + }, /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactrovingfocus.Item, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({ + asChild: true + }, rovingFocusGroupScope, { + focusable: !disabled + }), /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactprimitive.Primitive.div, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({ + role: "menuitem", + "data-highlighted": isFocused ? '' : undefined, + "aria-disabled": disabled || undefined, + "data-disabled": disabled ? '' : undefined + }, itemProps, { + ref: composedRefs, + onPointerMove: $cnSS2$radixuiprimitive.composeEventHandlers(props.onPointerMove, $213e4d2df823067d$var$whenMouse(event => { + if (disabled) contentContext.onItemLeave(event);else { + contentContext.onItemEnter(event); + if (!event.defaultPrevented) { + const item = event.currentTarget; + item.focus(); + } + } + })), + onPointerLeave: $cnSS2$radixuiprimitive.composeEventHandlers(props.onPointerLeave, $213e4d2df823067d$var$whenMouse(event => contentContext.onItemLeave(event))), + onFocus: $cnSS2$radixuiprimitive.composeEventHandlers(props.onFocus, () => setIsFocused(true)), + onBlur: $cnSS2$radixuiprimitive.composeEventHandlers(props.onBlur, () => setIsFocused(false)) + })))); +}); +/* ------------------------------------------------------------------------------------------------- + * MenuCheckboxItem + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$CHECKBOX_ITEM_NAME = 'MenuCheckboxItem'; +const $213e4d2df823067d$export$f6f243521332502d = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const { + checked = false, + onCheckedChange: onCheckedChange, + ...checkboxItemProps + } = props; + return /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$ItemIndicatorProvider, { + scope: props.__scopeMenu, + checked: checked + }, /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$export$2ce376c2cc3355c8, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({ + role: "menuitemcheckbox", + "aria-checked": $213e4d2df823067d$var$isIndeterminate(checked) ? 'mixed' : checked + }, checkboxItemProps, { + ref: forwardedRef, + "data-state": $213e4d2df823067d$var$getCheckedState(checked), + onSelect: $cnSS2$radixuiprimitive.composeEventHandlers(checkboxItemProps.onSelect, () => onCheckedChange === null || onCheckedChange === void 0 ? void 0 : onCheckedChange($213e4d2df823067d$var$isIndeterminate(checked) ? true : !checked), { + checkForDefaultPrevented: false + }) + }))); +}); +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$f6f243521332502d, { + displayName: $213e4d2df823067d$var$CHECKBOX_ITEM_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuRadioGroup + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$RADIO_GROUP_NAME = 'MenuRadioGroup'; +const [$213e4d2df823067d$var$RadioGroupProvider, $213e4d2df823067d$var$useRadioGroupContext] = $213e4d2df823067d$var$createMenuContext($213e4d2df823067d$var$RADIO_GROUP_NAME, { + value: undefined, + onValueChange: () => {} +}); +const $213e4d2df823067d$export$ea2200c9eee416b3 = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const { + value: value, + onValueChange: onValueChange, + ...groupProps + } = props; + const handleValueChange = $cnSS2$radixuireactusecallbackref.useCallbackRef(onValueChange); + return /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$RadioGroupProvider, { + scope: props.__scopeMenu, + value: value, + onValueChange: handleValueChange + }, /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$export$22a631d1f72787bb, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({}, groupProps, { + ref: forwardedRef + }))); +}); +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$ea2200c9eee416b3, { + displayName: $213e4d2df823067d$var$RADIO_GROUP_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuRadioItem + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$RADIO_ITEM_NAME = 'MenuRadioItem'; +const $213e4d2df823067d$export$69bd225e9817f6d0 = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const { + value: value, + ...radioItemProps + } = props; + const context = $213e4d2df823067d$var$useRadioGroupContext($213e4d2df823067d$var$RADIO_ITEM_NAME, props.__scopeMenu); + const checked = value === context.value; + return /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$ItemIndicatorProvider, { + scope: props.__scopeMenu, + checked: checked + }, /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$export$2ce376c2cc3355c8, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({ + role: "menuitemradio", + "aria-checked": checked + }, radioItemProps, { + ref: forwardedRef, + "data-state": $213e4d2df823067d$var$getCheckedState(checked), + onSelect: $cnSS2$radixuiprimitive.composeEventHandlers(radioItemProps.onSelect, () => { + var _context$onValueChang; + return (_context$onValueChang = context.onValueChange) === null || _context$onValueChang === void 0 ? void 0 : _context$onValueChang.call(context, value); + }, { + checkForDefaultPrevented: false + }) + }))); +}); +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$69bd225e9817f6d0, { + displayName: $213e4d2df823067d$var$RADIO_ITEM_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuItemIndicator + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$ITEM_INDICATOR_NAME = 'MenuItemIndicator'; +const [$213e4d2df823067d$var$ItemIndicatorProvider, $213e4d2df823067d$var$useItemIndicatorContext] = $213e4d2df823067d$var$createMenuContext($213e4d2df823067d$var$ITEM_INDICATOR_NAME, { + checked: false +}); +const $213e4d2df823067d$export$a2593e23056970a3 = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const { + __scopeMenu: __scopeMenu, + forceMount: forceMount, + ...itemIndicatorProps + } = props; + const indicatorContext = $213e4d2df823067d$var$useItemIndicatorContext($213e4d2df823067d$var$ITEM_INDICATOR_NAME, __scopeMenu); + return /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactpresence.Presence, { + present: forceMount || $213e4d2df823067d$var$isIndeterminate(indicatorContext.checked) || indicatorContext.checked === true + }, /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactprimitive.Primitive.span, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({}, itemIndicatorProps, { + ref: forwardedRef, + "data-state": $213e4d2df823067d$var$getCheckedState(indicatorContext.checked) + }))); +}); +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$a2593e23056970a3, { + displayName: $213e4d2df823067d$var$ITEM_INDICATOR_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuSeparator + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$SEPARATOR_NAME = 'MenuSeparator'; +const $213e4d2df823067d$export$1cec7dcdd713e220 = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const { + __scopeMenu: __scopeMenu, + ...separatorProps + } = props; + return /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactprimitive.Primitive.div, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({ + role: "separator", + "aria-orientation": "horizontal" + }, separatorProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$1cec7dcdd713e220, { + displayName: $213e4d2df823067d$var$SEPARATOR_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuArrow + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$ARROW_NAME = 'MenuArrow'; +const $213e4d2df823067d$export$bcdda4773debf5fa = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const { + __scopeMenu: __scopeMenu, + ...arrowProps + } = props; + const popperScope = $213e4d2df823067d$var$usePopperScope(__scopeMenu); + return /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactpopper.Arrow, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({}, popperScope, arrowProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$bcdda4773debf5fa, { + displayName: $213e4d2df823067d$var$ARROW_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuSub + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$SUB_NAME = 'MenuSub'; +const [$213e4d2df823067d$var$MenuSubProvider, $213e4d2df823067d$var$useMenuSubContext] = $213e4d2df823067d$var$createMenuContext($213e4d2df823067d$var$SUB_NAME); +const $213e4d2df823067d$export$71bdb9d1e2909932 = props => { + const { + __scopeMenu: __scopeMenu, + children: children, + open = false, + onOpenChange: onOpenChange + } = props; + const parentMenuContext = $213e4d2df823067d$var$useMenuContext($213e4d2df823067d$var$SUB_NAME, __scopeMenu); + const popperScope = $213e4d2df823067d$var$usePopperScope(__scopeMenu); + const [trigger, setTrigger] = $cnSS2$react.useState(null); + const [content, setContent] = $cnSS2$react.useState(null); + const handleOpenChange = $cnSS2$radixuireactusecallbackref.useCallbackRef(onOpenChange); // Prevent the parent menu from reopening with open submenus. + $cnSS2$react.useEffect(() => { + if (parentMenuContext.open === false) handleOpenChange(false); + return () => handleOpenChange(false); + }, [parentMenuContext.open, handleOpenChange]); + return /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactpopper.Root, popperScope, /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$MenuProvider, { + scope: __scopeMenu, + open: open, + onOpenChange: handleOpenChange, + content: content, + onContentChange: setContent + }, /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$MenuSubProvider, { + scope: __scopeMenu, + contentId: $cnSS2$radixuireactid.useId(), + triggerId: $cnSS2$radixuireactid.useId(), + trigger: trigger, + onTriggerChange: setTrigger + }, children))); +}; +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$71bdb9d1e2909932, { + displayName: $213e4d2df823067d$var$SUB_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuSubTrigger + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$SUB_TRIGGER_NAME = 'MenuSubTrigger'; +const $213e4d2df823067d$export$5fbbb3ba7297405f = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const context = $213e4d2df823067d$var$useMenuContext($213e4d2df823067d$var$SUB_TRIGGER_NAME, props.__scopeMenu); + const rootContext = $213e4d2df823067d$var$useMenuRootContext($213e4d2df823067d$var$SUB_TRIGGER_NAME, props.__scopeMenu); + const subContext = $213e4d2df823067d$var$useMenuSubContext($213e4d2df823067d$var$SUB_TRIGGER_NAME, props.__scopeMenu); + const contentContext = $213e4d2df823067d$var$useMenuContentContext($213e4d2df823067d$var$SUB_TRIGGER_NAME, props.__scopeMenu); + const openTimerRef = $cnSS2$react.useRef(null); + const { + pointerGraceTimerRef: pointerGraceTimerRef, + onPointerGraceIntentChange: onPointerGraceIntentChange + } = contentContext; + const scope = { + __scopeMenu: props.__scopeMenu + }; + const clearOpenTimer = $cnSS2$react.useCallback(() => { + if (openTimerRef.current) window.clearTimeout(openTimerRef.current); + openTimerRef.current = null; + }, []); + $cnSS2$react.useEffect(() => clearOpenTimer, [clearOpenTimer]); + $cnSS2$react.useEffect(() => { + const pointerGraceTimer = pointerGraceTimerRef.current; + return () => { + window.clearTimeout(pointerGraceTimer); + onPointerGraceIntentChange(null); + }; + }, [pointerGraceTimerRef, onPointerGraceIntentChange]); + return /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$export$9fa5ebd18bee4d43, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({ + asChild: true + }, scope), /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$MenuItemImpl, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({ + id: subContext.triggerId, + "aria-haspopup": "menu", + "aria-expanded": context.open, + "aria-controls": subContext.contentId, + "data-state": $213e4d2df823067d$var$getOpenState(context.open) + }, props, { + ref: $cnSS2$radixuireactcomposerefs.composeRefs(forwardedRef, subContext.onTriggerChange) // This is redundant for mouse users but we cannot determine pointer type from + , + + onClick: event => { + var _props$onClick; + (_props$onClick = props.onClick) === null || _props$onClick === void 0 || _props$onClick.call(props, event); + if (props.disabled || event.defaultPrevented) return; + /** + * We manually focus because iOS Safari doesn't always focus on click (e.g. buttons) + * and we rely heavily on `onFocusOutside` for submenus to close when switching + * between separate submenus. + */ + event.currentTarget.focus(); + if (!context.open) context.onOpenChange(true); + }, + onPointerMove: $cnSS2$radixuiprimitive.composeEventHandlers(props.onPointerMove, $213e4d2df823067d$var$whenMouse(event => { + contentContext.onItemEnter(event); + if (event.defaultPrevented) return; + if (!props.disabled && !context.open && !openTimerRef.current) { + contentContext.onPointerGraceIntentChange(null); + openTimerRef.current = window.setTimeout(() => { + context.onOpenChange(true); + clearOpenTimer(); + }, 100); + } + })), + onPointerLeave: $cnSS2$radixuiprimitive.composeEventHandlers(props.onPointerLeave, $213e4d2df823067d$var$whenMouse(event => { + var _context$content; + clearOpenTimer(); + const contentRect = (_context$content = context.content) === null || _context$content === void 0 ? void 0 : _context$content.getBoundingClientRect(); + if (contentRect) { + var _context$content2; + // TODO: make sure to update this when we change positioning logic + const side = (_context$content2 = context.content) === null || _context$content2 === void 0 ? void 0 : _context$content2.dataset.side; + const rightSide = side === 'right'; + const bleed = rightSide ? -5 : 5; + const contentNearEdge = contentRect[rightSide ? 'left' : 'right']; + const contentFarEdge = contentRect[rightSide ? 'right' : 'left']; + contentContext.onPointerGraceIntentChange({ + area: [ + // consistently within polygon bounds + { + x: event.clientX + bleed, + y: event.clientY + }, { + x: contentNearEdge, + y: contentRect.top + }, { + x: contentFarEdge, + y: contentRect.top + }, { + x: contentFarEdge, + y: contentRect.bottom + }, { + x: contentNearEdge, + y: contentRect.bottom + }], + side: side + }); + window.clearTimeout(pointerGraceTimerRef.current); + pointerGraceTimerRef.current = window.setTimeout(() => contentContext.onPointerGraceIntentChange(null), 300); + } else { + contentContext.onTriggerLeave(event); + if (event.defaultPrevented) return; // There's 100ms where the user may leave an item before the submenu was opened. + contentContext.onPointerGraceIntentChange(null); + } + })), + onKeyDown: $cnSS2$radixuiprimitive.composeEventHandlers(props.onKeyDown, event => { + const isTypingAhead = contentContext.searchRef.current !== ''; + if (props.disabled || isTypingAhead && event.key === ' ') return; + if ($213e4d2df823067d$var$SUB_OPEN_KEYS[rootContext.dir].includes(event.key)) { + var _context$content3; + context.onOpenChange(true); // The trigger may hold focus if opened via pointer interaction + // so we ensure content is given focus again when switching to keyboard. + (_context$content3 = context.content) === null || _context$content3 === void 0 || _context$content3.focus(); // prevent window from scrolling + event.preventDefault(); + } + }) + }))); +}); +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$5fbbb3ba7297405f, { + displayName: $213e4d2df823067d$var$SUB_TRIGGER_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * MenuSubContent + * -----------------------------------------------------------------------------------------------*/ +const $213e4d2df823067d$var$SUB_CONTENT_NAME = 'MenuSubContent'; +const $213e4d2df823067d$export$e7142ab31822bde6 = /*#__PURE__*/$cnSS2$react.forwardRef((props, forwardedRef) => { + const portalContext = $213e4d2df823067d$var$usePortalContext($213e4d2df823067d$var$CONTENT_NAME, props.__scopeMenu); + const { + forceMount = portalContext.forceMount, + ...subContentProps + } = props; + const context = $213e4d2df823067d$var$useMenuContext($213e4d2df823067d$var$CONTENT_NAME, props.__scopeMenu); + const rootContext = $213e4d2df823067d$var$useMenuRootContext($213e4d2df823067d$var$CONTENT_NAME, props.__scopeMenu); + const subContext = $213e4d2df823067d$var$useMenuSubContext($213e4d2df823067d$var$SUB_CONTENT_NAME, props.__scopeMenu); + const ref = $cnSS2$react.useRef(null); + const composedRefs = $cnSS2$radixuireactcomposerefs.useComposedRefs(forwardedRef, ref); + return /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$Collection.Provider, { + scope: props.__scopeMenu + }, /*#__PURE__*/$cnSS2$react.createElement($cnSS2$radixuireactpresence.Presence, { + present: forceMount || context.open + }, /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$Collection.Slot, { + scope: props.__scopeMenu + }, /*#__PURE__*/$cnSS2$react.createElement($213e4d2df823067d$var$MenuContentImpl, $parcel$interopDefault($cnSS2$babelruntimehelpersextends)({ + id: subContext.contentId, + "aria-labelledby": subContext.triggerId + }, subContentProps, { + ref: composedRefs, + align: "start", + side: rootContext.dir === 'rtl' ? 'left' : 'right', + disableOutsidePointerEvents: false, + disableOutsideScroll: false, + trapFocus: false, + onOpenAutoFocus: event => { + var _ref$current; + // when opening a submenu, focus content for keyboard users only + if (rootContext.isUsingKeyboardRef.current) (_ref$current = ref.current) === null || _ref$current === void 0 || _ref$current.focus(); + event.preventDefault(); + } // The menu might close because of focusing another menu item in the parent menu. We + , + + onCloseAutoFocus: event => event.preventDefault(), + onFocusOutside: $cnSS2$radixuiprimitive.composeEventHandlers(props.onFocusOutside, event => { + // We prevent closing when the trigger is focused to avoid triggering a re-open animation + // on pointer interaction. + if (event.target !== subContext.trigger) context.onOpenChange(false); + }), + onEscapeKeyDown: $cnSS2$radixuiprimitive.composeEventHandlers(props.onEscapeKeyDown, event => { + rootContext.onClose(); // ensure pressing escape in submenu doesn't escape full screen mode + event.preventDefault(); + }), + onKeyDown: $cnSS2$radixuiprimitive.composeEventHandlers(props.onKeyDown, event => { + // Submenu key events bubble through portals. We only care about keys in this menu. + const isKeyDownInside = event.currentTarget.contains(event.target); + const isCloseKey = $213e4d2df823067d$var$SUB_CLOSE_KEYS[rootContext.dir].includes(event.key); + if (isKeyDownInside && isCloseKey) { + var _subContext$trigger; + context.onOpenChange(false); // We focus manually because we prevented it in `onCloseAutoFocus` + (_subContext$trigger = subContext.trigger) === null || _subContext$trigger === void 0 || _subContext$trigger.focus(); // prevent window from scrolling + event.preventDefault(); + } + }) + }))))); +}); +/*#__PURE__*/ +Object.assign($213e4d2df823067d$export$e7142ab31822bde6, { + displayName: $213e4d2df823067d$var$SUB_CONTENT_NAME +}); +/* -----------------------------------------------------------------------------------------------*/ +function $213e4d2df823067d$var$getOpenState(open) { + return open ? 'open' : 'closed'; +} +function $213e4d2df823067d$var$isIndeterminate(checked) { + return checked === 'indeterminate'; +} +function $213e4d2df823067d$var$getCheckedState(checked) { + return $213e4d2df823067d$var$isIndeterminate(checked) ? 'indeterminate' : checked ? 'checked' : 'unchecked'; +} +function $213e4d2df823067d$var$focusFirst(candidates) { + const PREVIOUSLY_FOCUSED_ELEMENT = document.activeElement; + for (const candidate of candidates) { + // if focus is already where we want to go, we don't want to keep going through the candidates + if (candidate === PREVIOUSLY_FOCUSED_ELEMENT) return; + candidate.focus(); + if (document.activeElement !== PREVIOUSLY_FOCUSED_ELEMENT) return; + } +} +/** + * Wraps an array around itself at a given start index + * Example: `wrapArray(['a', 'b', 'c', 'd'], 2) === ['c', 'd', 'a', 'b']` + */ +function $213e4d2df823067d$var$wrapArray(array, startIndex) { + return array.map((_, index) => array[(startIndex + index) % array.length]); +} +/** + * This is the "meat" of the typeahead matching logic. It takes in all the values, + * the search and the current match, and returns the next match (or `undefined`). + * + * We normalize the search because if a user has repeatedly pressed a character, + * we want the exact same behavior as if we only had that one character + * (ie. cycle through options starting with that character) + * + * We also reorder the values by wrapping the array around the current match. + * This is so we always look forward from the current match, and picking the first + * match will always be the correct one. + * + * Finally, if the normalized search is exactly one character, we exclude the + * current match from the values because otherwise it would be the first to match always + * and focus would never move. This is as opposed to the regular case, where we + * don't want focus to move if the current match still matches. + */ +function $213e4d2df823067d$var$getNextMatch(values, search, currentMatch) { + const isRepeated = search.length > 1 && Array.from(search).every(char => char === search[0]); + const normalizedSearch = isRepeated ? search[0] : search; + const currentMatchIndex = currentMatch ? values.indexOf(currentMatch) : -1; + let wrappedValues = $213e4d2df823067d$var$wrapArray(values, Math.max(currentMatchIndex, 0)); + const excludeCurrentMatch = normalizedSearch.length === 1; + if (excludeCurrentMatch) wrappedValues = wrappedValues.filter(v => v !== currentMatch); + const nextMatch = wrappedValues.find(value => value.toLowerCase().startsWith(normalizedSearch.toLowerCase())); + return nextMatch !== currentMatch ? nextMatch : undefined; +} +// Determine if a point is inside of a polygon. +// Based on https://github.com/substack/point-in-polygon +function $213e4d2df823067d$var$isPointInPolygon(point, polygon) { + const { + x: x, + y: y + } = point; + let inside = false; + for (let i = 0, j = polygon.length - 1; i < polygon.length; j = i++) { + const xi = polygon[i].x; + const yi = polygon[i].y; + const xj = polygon[j].x; + const yj = polygon[j].y; // prettier-ignore + const intersect = yi > y !== yj > y && x < (xj - xi) * (y - yi) / (yj - yi) + xi; + if (intersect) inside = !inside; + } + return inside; +} +function $213e4d2df823067d$var$isPointerInGraceArea(event, area) { + if (!area) return false; + const cursorPos = { + x: event.clientX, + y: event.clientY + }; + return $213e4d2df823067d$var$isPointInPolygon(cursorPos, area); +} +function $213e4d2df823067d$var$whenMouse(handler) { + return event => event.pointerType === 'mouse' ? handler(event) : undefined; +} +const $213e4d2df823067d$export$be92b6f5f03c0fe9 = $213e4d2df823067d$export$d9b273488cd8ce6f; +const $213e4d2df823067d$export$b688253958b8dfe7 = $213e4d2df823067d$export$9fa5ebd18bee4d43; +const $213e4d2df823067d$export$602eac185826482c = $213e4d2df823067d$export$793392f970497feb; +const $213e4d2df823067d$export$7c6e2c02157bb7d2 = $213e4d2df823067d$export$479f0f2f71193efe; +const $213e4d2df823067d$export$eb2fcfdbd7ba97d4 = $213e4d2df823067d$export$22a631d1f72787bb; +const $213e4d2df823067d$export$b04be29aa201d4f5 = $213e4d2df823067d$export$dd37bec0e8a99143; +const $213e4d2df823067d$export$6d08773d2e66f8f2 = $213e4d2df823067d$export$2ce376c2cc3355c8; +const $213e4d2df823067d$export$16ce288f89fa631c = $213e4d2df823067d$export$f6f243521332502d; +const $213e4d2df823067d$export$a98f0dcb43a68a25 = $213e4d2df823067d$export$ea2200c9eee416b3; +const $213e4d2df823067d$export$371ab307eab489c0 = $213e4d2df823067d$export$69bd225e9817f6d0; +const $213e4d2df823067d$export$c3468e2714d175fa = $213e4d2df823067d$export$a2593e23056970a3; +const $213e4d2df823067d$export$1ff3c3f08ae963c0 = $213e4d2df823067d$export$1cec7dcdd713e220; +const $213e4d2df823067d$export$21b07c8f274aebd5 = $213e4d2df823067d$export$bcdda4773debf5fa; +const $213e4d2df823067d$export$d7a01e11500dfb6f = $213e4d2df823067d$export$71bdb9d1e2909932; +const $213e4d2df823067d$export$2ea8a7a591ac5eac = $213e4d2df823067d$export$5fbbb3ba7297405f; +const $213e4d2df823067d$export$6d4de93b380beddf = $213e4d2df823067d$export$e7142ab31822bde6; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-popper/dist/index.js": +/*!******************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-popper/dist/index.js ***! + \******************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $50Iv9$babelruntimehelpersextends = __webpack_require__(/*! @babel/runtime/helpers/extends */ "../../../node_modules/@babel/runtime/helpers/extends.js"); +var $50Iv9$react = __webpack_require__(/*! react */ "react"); +var $50Iv9$floatinguireactdom = __webpack_require__(/*! @floating-ui/react-dom */ "../../../node_modules/@floating-ui/react-dom/dist/floating-ui.react-dom.esm.js"); +var $50Iv9$radixuireactarrow = __webpack_require__(/*! @radix-ui/react-arrow */ "../../../node_modules/@radix-ui/react-arrow/dist/index.js"); +var $50Iv9$radixuireactcomposerefs = __webpack_require__(/*! @radix-ui/react-compose-refs */ "../../../node_modules/@radix-ui/react-compose-refs/dist/index.js"); +var $50Iv9$radixuireactcontext = __webpack_require__(/*! @radix-ui/react-context */ "../../../node_modules/@radix-ui/react-context/dist/index.js"); +var $50Iv9$radixuireactprimitive = __webpack_require__(/*! @radix-ui/react-primitive */ "../../../node_modules/@radix-ui/react-primitive/dist/index.js"); +var $50Iv9$radixuireactusecallbackref = __webpack_require__(/*! @radix-ui/react-use-callback-ref */ "../../../node_modules/@radix-ui/react-use-callback-ref/dist/index.js"); +var $50Iv9$radixuireactuselayouteffect = __webpack_require__(/*! @radix-ui/react-use-layout-effect */ "../../../node_modules/@radix-ui/react-use-layout-effect/dist/index.js"); +var $50Iv9$radixuireactusesize = __webpack_require__(/*! @radix-ui/react-use-size */ "../../../node_modules/@radix-ui/react-use-size/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "createPopperScope", () => $34310caa050a8d63$export$722aac194ae923); +$parcel$export(module.exports, "Popper", () => $34310caa050a8d63$export$badac9ada3a0bdf9); +$parcel$export(module.exports, "PopperAnchor", () => $34310caa050a8d63$export$ecd4e1ccab6ed6d); +$parcel$export(module.exports, "PopperContent", () => $34310caa050a8d63$export$bc4ae5855d3c4fc); +$parcel$export(module.exports, "PopperArrow", () => $34310caa050a8d63$export$79d62cd4e10a3fd0); +$parcel$export(module.exports, "Root", () => $34310caa050a8d63$export$be92b6f5f03c0fe9); +$parcel$export(module.exports, "Anchor", () => $34310caa050a8d63$export$b688253958b8dfe7); +$parcel$export(module.exports, "Content", () => $34310caa050a8d63$export$7c6e2c02157bb7d2); +$parcel$export(module.exports, "Arrow", () => $34310caa050a8d63$export$21b07c8f274aebd5); +$parcel$export(module.exports, "SIDE_OPTIONS", () => $34310caa050a8d63$export$36f0086da09c4b9f); +$parcel$export(module.exports, "ALIGN_OPTIONS", () => $34310caa050a8d63$export$3671ffab7b302fc9); +const $34310caa050a8d63$export$36f0086da09c4b9f = ['top', 'right', 'bottom', 'left']; +const $34310caa050a8d63$export$3671ffab7b302fc9 = ['start', 'center', 'end']; +/* ------------------------------------------------------------------------------------------------- + * Popper + * -----------------------------------------------------------------------------------------------*/ +const $34310caa050a8d63$var$POPPER_NAME = 'Popper'; +const [$34310caa050a8d63$var$createPopperContext, $34310caa050a8d63$export$722aac194ae923] = $50Iv9$radixuireactcontext.createContextScope($34310caa050a8d63$var$POPPER_NAME); +const [$34310caa050a8d63$var$PopperProvider, $34310caa050a8d63$var$usePopperContext] = $34310caa050a8d63$var$createPopperContext($34310caa050a8d63$var$POPPER_NAME); +const $34310caa050a8d63$export$badac9ada3a0bdf9 = props => { + const { + __scopePopper: __scopePopper, + children: children + } = props; + const [anchor, setAnchor] = $50Iv9$react.useState(null); + return /*#__PURE__*/$50Iv9$react.createElement($34310caa050a8d63$var$PopperProvider, { + scope: __scopePopper, + anchor: anchor, + onAnchorChange: setAnchor + }, children); +}; +/*#__PURE__*/ +Object.assign($34310caa050a8d63$export$badac9ada3a0bdf9, { + displayName: $34310caa050a8d63$var$POPPER_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * PopperAnchor + * -----------------------------------------------------------------------------------------------*/ +const $34310caa050a8d63$var$ANCHOR_NAME = 'PopperAnchor'; +const $34310caa050a8d63$export$ecd4e1ccab6ed6d = /*#__PURE__*/$50Iv9$react.forwardRef((props, forwardedRef) => { + const { + __scopePopper: __scopePopper, + virtualRef: virtualRef, + ...anchorProps + } = props; + const context = $34310caa050a8d63$var$usePopperContext($34310caa050a8d63$var$ANCHOR_NAME, __scopePopper); + const ref = $50Iv9$react.useRef(null); + const composedRefs = $50Iv9$radixuireactcomposerefs.useComposedRefs(forwardedRef, ref); + $50Iv9$react.useEffect(() => { + // Consumer can anchor the popper to something that isn't + // a DOM node e.g. pointer position, so we override the + // `anchorRef` with their virtual ref in this case. + context.onAnchorChange((virtualRef === null || virtualRef === void 0 ? void 0 : virtualRef.current) || ref.current); + }); + return virtualRef ? null : /*#__PURE__*/$50Iv9$react.createElement($50Iv9$radixuireactprimitive.Primitive.div, $parcel$interopDefault($50Iv9$babelruntimehelpersextends)({}, anchorProps, { + ref: composedRefs + })); +}); +/*#__PURE__*/ +Object.assign($34310caa050a8d63$export$ecd4e1ccab6ed6d, { + displayName: $34310caa050a8d63$var$ANCHOR_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * PopperContent + * -----------------------------------------------------------------------------------------------*/ +const $34310caa050a8d63$var$CONTENT_NAME = 'PopperContent'; +const [$34310caa050a8d63$var$PopperContentProvider, $34310caa050a8d63$var$useContentContext] = $34310caa050a8d63$var$createPopperContext($34310caa050a8d63$var$CONTENT_NAME); +const $34310caa050a8d63$export$bc4ae5855d3c4fc = /*#__PURE__*/$50Iv9$react.forwardRef((props, forwardedRef) => { + var _arrowSize$width, _arrowSize$height, _middlewareData$arrow, _middlewareData$arrow2, _middlewareData$arrow3, _middlewareData$trans, _middlewareData$trans2, _middlewareData$hide; + const { + __scopePopper: __scopePopper, + side = 'bottom', + sideOffset = 0, + align = 'center', + alignOffset = 0, + arrowPadding = 0, + collisionBoundary = [], + collisionPadding: collisionPaddingProp = 0, + sticky = 'partial', + hideWhenDetached = false, + avoidCollisions = true, + onPlaced: onPlaced, + ...contentProps + } = props; + const context = $34310caa050a8d63$var$usePopperContext($34310caa050a8d63$var$CONTENT_NAME, __scopePopper); + const [content, setContent] = $50Iv9$react.useState(null); + const composedRefs = $50Iv9$radixuireactcomposerefs.useComposedRefs(forwardedRef, node => setContent(node)); + const [arrow, setArrow] = $50Iv9$react.useState(null); + const arrowSize = $50Iv9$radixuireactusesize.useSize(arrow); + const arrowWidth = (_arrowSize$width = arrowSize === null || arrowSize === void 0 ? void 0 : arrowSize.width) !== null && _arrowSize$width !== void 0 ? _arrowSize$width : 0; + const arrowHeight = (_arrowSize$height = arrowSize === null || arrowSize === void 0 ? void 0 : arrowSize.height) !== null && _arrowSize$height !== void 0 ? _arrowSize$height : 0; + const desiredPlacement = side + (align !== 'center' ? '-' + align : ''); + const collisionPadding = typeof collisionPaddingProp === 'number' ? collisionPaddingProp : { + top: 0, + right: 0, + bottom: 0, + left: 0, + ...collisionPaddingProp + }; + const boundary = Array.isArray(collisionBoundary) ? collisionBoundary : [collisionBoundary]; + const hasExplicitBoundaries = boundary.length > 0; + const detectOverflowOptions = { + padding: collisionPadding, + boundary: boundary.filter($34310caa050a8d63$var$isNotNull), + // with `strategy: 'fixed'`, this is the only way to get it to respect boundaries + altBoundary: hasExplicitBoundaries + }; + const { + refs: refs, + floatingStyles: floatingStyles, + placement: placement, + isPositioned: isPositioned, + middlewareData: middlewareData + } = $50Iv9$floatinguireactdom.useFloating({ + // default to `fixed` strategy so users don't have to pick and we also avoid focus scroll issues + strategy: 'fixed', + placement: desiredPlacement, + whileElementsMounted: $50Iv9$floatinguireactdom.autoUpdate, + elements: { + reference: context.anchor + }, + middleware: [$50Iv9$floatinguireactdom.offset({ + mainAxis: sideOffset + arrowHeight, + alignmentAxis: alignOffset + }), avoidCollisions && $50Iv9$floatinguireactdom.shift({ + mainAxis: true, + crossAxis: false, + limiter: sticky === 'partial' ? $50Iv9$floatinguireactdom.limitShift() : undefined, + ...detectOverflowOptions + }), avoidCollisions && $50Iv9$floatinguireactdom.flip({ + ...detectOverflowOptions + }), $50Iv9$floatinguireactdom.size({ + ...detectOverflowOptions, + apply: _ref => { + let { + elements: elements, + rects: rects, + availableWidth: availableWidth, + availableHeight: availableHeight + } = _ref; + const { + width: anchorWidth, + height: anchorHeight + } = rects.reference; + const contentStyle = elements.floating.style; + contentStyle.setProperty('--radix-popper-available-width', `${availableWidth}px`); + contentStyle.setProperty('--radix-popper-available-height', `${availableHeight}px`); + contentStyle.setProperty('--radix-popper-anchor-width', `${anchorWidth}px`); + contentStyle.setProperty('--radix-popper-anchor-height', `${anchorHeight}px`); + } + }), arrow && $50Iv9$floatinguireactdom.arrow({ + element: arrow, + padding: arrowPadding + }), $34310caa050a8d63$var$transformOrigin({ + arrowWidth: arrowWidth, + arrowHeight: arrowHeight + }), hideWhenDetached && $50Iv9$floatinguireactdom.hide({ + strategy: 'referenceHidden' + })] + }); + const [placedSide, placedAlign] = $34310caa050a8d63$var$getSideAndAlignFromPlacement(placement); + const handlePlaced = $50Iv9$radixuireactusecallbackref.useCallbackRef(onPlaced); + $50Iv9$radixuireactuselayouteffect.useLayoutEffect(() => { + if (isPositioned) handlePlaced === null || handlePlaced === void 0 || handlePlaced(); + }, [isPositioned, handlePlaced]); + const arrowX = (_middlewareData$arrow = middlewareData.arrow) === null || _middlewareData$arrow === void 0 ? void 0 : _middlewareData$arrow.x; + const arrowY = (_middlewareData$arrow2 = middlewareData.arrow) === null || _middlewareData$arrow2 === void 0 ? void 0 : _middlewareData$arrow2.y; + const cannotCenterArrow = ((_middlewareData$arrow3 = middlewareData.arrow) === null || _middlewareData$arrow3 === void 0 ? void 0 : _middlewareData$arrow3.centerOffset) !== 0; + const [contentZIndex, setContentZIndex] = $50Iv9$react.useState(); + $50Iv9$radixuireactuselayouteffect.useLayoutEffect(() => { + if (content) setContentZIndex(window.getComputedStyle(content).zIndex); + }, [content]); + return /*#__PURE__*/$50Iv9$react.createElement("div", { + ref: refs.setFloating, + "data-radix-popper-content-wrapper": "", + style: { + ...floatingStyles, + transform: isPositioned ? floatingStyles.transform : 'translate(0, -200%)', + // keep off the page when measuring + minWidth: 'max-content', + zIndex: contentZIndex, + ['--radix-popper-transform-origin']: [(_middlewareData$trans = middlewareData.transformOrigin) === null || _middlewareData$trans === void 0 ? void 0 : _middlewareData$trans.x, (_middlewareData$trans2 = middlewareData.transformOrigin) === null || _middlewareData$trans2 === void 0 ? void 0 : _middlewareData$trans2.y].join(' ') + } // Floating UI interally calculates logical alignment based the `dir` attribute on + , + + dir: props.dir + }, /*#__PURE__*/$50Iv9$react.createElement($34310caa050a8d63$var$PopperContentProvider, { + scope: __scopePopper, + placedSide: placedSide, + onArrowChange: setArrow, + arrowX: arrowX, + arrowY: arrowY, + shouldHideArrow: cannotCenterArrow + }, /*#__PURE__*/$50Iv9$react.createElement($50Iv9$radixuireactprimitive.Primitive.div, $parcel$interopDefault($50Iv9$babelruntimehelpersextends)({ + "data-side": placedSide, + "data-align": placedAlign + }, contentProps, { + ref: composedRefs, + style: { + ...contentProps.style, + // if the PopperContent hasn't been placed yet (not all measurements done) + // we prevent animations so that users's animation don't kick in too early referring wrong sides + animation: !isPositioned ? 'none' : undefined, + // hide the content if using the hide middleware and should be hidden + opacity: (_middlewareData$hide = middlewareData.hide) !== null && _middlewareData$hide !== void 0 && _middlewareData$hide.referenceHidden ? 0 : undefined + } + })))); +}); +/*#__PURE__*/ +Object.assign($34310caa050a8d63$export$bc4ae5855d3c4fc, { + displayName: $34310caa050a8d63$var$CONTENT_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * PopperArrow + * -----------------------------------------------------------------------------------------------*/ +const $34310caa050a8d63$var$ARROW_NAME = 'PopperArrow'; +const $34310caa050a8d63$var$OPPOSITE_SIDE = { + top: 'bottom', + right: 'left', + bottom: 'top', + left: 'right' +}; +const $34310caa050a8d63$export$79d62cd4e10a3fd0 = /*#__PURE__*/$50Iv9$react.forwardRef(function $34310caa050a8d63$export$79d62cd4e10a3fd0(props, forwardedRef) { + const { + __scopePopper: __scopePopper, + ...arrowProps + } = props; + const contentContext = $34310caa050a8d63$var$useContentContext($34310caa050a8d63$var$ARROW_NAME, __scopePopper); + const baseSide = $34310caa050a8d63$var$OPPOSITE_SIDE[contentContext.placedSide]; + return /*#__PURE__*/ (// we have to use an extra wrapper because `ResizeObserver` (used by `useSize`) + // doesn't report size as we'd expect on SVG elements. + // it reports their bounding box which is effectively the largest path inside the SVG. + $50Iv9$react.createElement("span", { + ref: contentContext.onArrowChange, + style: { + position: 'absolute', + left: contentContext.arrowX, + top: contentContext.arrowY, + [baseSide]: 0, + transformOrigin: { + top: '', + right: '0 0', + bottom: 'center 0', + left: '100% 0' + }[contentContext.placedSide], + transform: { + top: 'translateY(100%)', + right: 'translateY(50%) rotate(90deg) translateX(-50%)', + bottom: `rotate(180deg)`, + left: 'translateY(50%) rotate(-90deg) translateX(50%)' + }[contentContext.placedSide], + visibility: contentContext.shouldHideArrow ? 'hidden' : undefined + } + }, /*#__PURE__*/$50Iv9$react.createElement($50Iv9$radixuireactarrow.Root, $parcel$interopDefault($50Iv9$babelruntimehelpersextends)({}, arrowProps, { + ref: forwardedRef, + style: { + ...arrowProps.style, + // ensures the element can be measured correctly (mostly for if SVG) + display: 'block' + } + }))) + ); +}); +/*#__PURE__*/ +Object.assign($34310caa050a8d63$export$79d62cd4e10a3fd0, { + displayName: $34310caa050a8d63$var$ARROW_NAME +}); +/* -----------------------------------------------------------------------------------------------*/ +function $34310caa050a8d63$var$isNotNull(value) { + return value !== null; +} +const $34310caa050a8d63$var$transformOrigin = options => ({ + name: 'transformOrigin', + options: options, + fn(data) { + var _middlewareData$arrow4, _middlewareData$arrow5, _middlewareData$arrow6, _middlewareData$arrow7, _middlewareData$arrow8; + const { + placement: placement, + rects: rects, + middlewareData: middlewareData + } = data; + const cannotCenterArrow = ((_middlewareData$arrow4 = middlewareData.arrow) === null || _middlewareData$arrow4 === void 0 ? void 0 : _middlewareData$arrow4.centerOffset) !== 0; + const isArrowHidden = cannotCenterArrow; + const arrowWidth = isArrowHidden ? 0 : options.arrowWidth; + const arrowHeight = isArrowHidden ? 0 : options.arrowHeight; + const [placedSide, placedAlign] = $34310caa050a8d63$var$getSideAndAlignFromPlacement(placement); + const noArrowAlign = { + start: '0%', + center: '50%', + end: '100%' + }[placedAlign]; + const arrowXCenter = ((_middlewareData$arrow5 = (_middlewareData$arrow6 = middlewareData.arrow) === null || _middlewareData$arrow6 === void 0 ? void 0 : _middlewareData$arrow6.x) !== null && _middlewareData$arrow5 !== void 0 ? _middlewareData$arrow5 : 0) + arrowWidth / 2; + const arrowYCenter = ((_middlewareData$arrow7 = (_middlewareData$arrow8 = middlewareData.arrow) === null || _middlewareData$arrow8 === void 0 ? void 0 : _middlewareData$arrow8.y) !== null && _middlewareData$arrow7 !== void 0 ? _middlewareData$arrow7 : 0) + arrowHeight / 2; + let x = ''; + let y = ''; + if (placedSide === 'bottom') { + x = isArrowHidden ? noArrowAlign : `${arrowXCenter}px`; + y = `${-arrowHeight}px`; + } else if (placedSide === 'top') { + x = isArrowHidden ? noArrowAlign : `${arrowXCenter}px`; + y = `${rects.floating.height + arrowHeight}px`; + } else if (placedSide === 'right') { + x = `${-arrowHeight}px`; + y = isArrowHidden ? noArrowAlign : `${arrowYCenter}px`; + } else if (placedSide === 'left') { + x = `${rects.floating.width + arrowHeight}px`; + y = isArrowHidden ? noArrowAlign : `${arrowYCenter}px`; + } + return { + data: { + x: x, + y: y + } + }; + } +}); +function $34310caa050a8d63$var$getSideAndAlignFromPlacement(placement) { + const [side, align = 'center'] = placement.split('-'); + return [side, align]; +} +const $34310caa050a8d63$export$be92b6f5f03c0fe9 = $34310caa050a8d63$export$badac9ada3a0bdf9; +const $34310caa050a8d63$export$b688253958b8dfe7 = $34310caa050a8d63$export$ecd4e1ccab6ed6d; +const $34310caa050a8d63$export$7c6e2c02157bb7d2 = $34310caa050a8d63$export$bc4ae5855d3c4fc; +const $34310caa050a8d63$export$21b07c8f274aebd5 = $34310caa050a8d63$export$79d62cd4e10a3fd0; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-portal/dist/index.js": +/*!******************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-portal/dist/index.js ***! + \******************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $amzHf$babelruntimehelpersextends = __webpack_require__(/*! @babel/runtime/helpers/extends */ "../../../node_modules/@babel/runtime/helpers/extends.js"); +var $amzHf$react = __webpack_require__(/*! react */ "react"); +var $amzHf$reactdom = __webpack_require__(/*! react-dom */ "react-dom"); +var $amzHf$radixuireactprimitive = __webpack_require__(/*! @radix-ui/react-primitive */ "../../../node_modules/@radix-ui/react-primitive/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "Portal", () => $913a70b877676c16$export$602eac185826482c); +$parcel$export(module.exports, "Root", () => $913a70b877676c16$export$be92b6f5f03c0fe9); + +/* ------------------------------------------------------------------------------------------------- + * Portal + * -----------------------------------------------------------------------------------------------*/ +const $913a70b877676c16$var$PORTAL_NAME = 'Portal'; +const $913a70b877676c16$export$602eac185826482c = /*#__PURE__*/$amzHf$react.forwardRef((props, forwardedRef) => { + var _globalThis$document; + const { + container = globalThis === null || globalThis === void 0 ? void 0 : (_globalThis$document = globalThis.document) === null || _globalThis$document === void 0 ? void 0 : _globalThis$document.body, + ...portalProps + } = props; + return container ? /*#__PURE__*/$parcel$interopDefault($amzHf$reactdom).createPortal( /*#__PURE__*/$amzHf$react.createElement($amzHf$radixuireactprimitive.Primitive.div, $parcel$interopDefault($amzHf$babelruntimehelpersextends)({}, portalProps, { + ref: forwardedRef + })), container) : null; +}); +/*#__PURE__*/ +Object.assign($913a70b877676c16$export$602eac185826482c, { + displayName: $913a70b877676c16$var$PORTAL_NAME +}); +/* -----------------------------------------------------------------------------------------------*/ +const $913a70b877676c16$export$be92b6f5f03c0fe9 = $913a70b877676c16$export$602eac185826482c; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-presence/dist/index.js": +/*!********************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-presence/dist/index.js ***! + \********************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $fnLeV$react = __webpack_require__(/*! react */ "react"); +var $fnLeV$reactdom = __webpack_require__(/*! react-dom */ "react-dom"); +var $fnLeV$radixuireactcomposerefs = __webpack_require__(/*! @radix-ui/react-compose-refs */ "../../../node_modules/@radix-ui/react-compose-refs/dist/index.js"); +var $fnLeV$radixuireactuselayouteffect = __webpack_require__(/*! @radix-ui/react-use-layout-effect */ "../../../node_modules/@radix-ui/react-use-layout-effect/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +$parcel$export(module.exports, "Presence", () => $a2fa0214bb2735a1$export$99c2b779aa4e8b8b); +function $8f63844556d0d3cd$export$3e6543de14f8614f(initialState, machine) { + return $fnLeV$react.useReducer((state, event) => { + const nextState = machine[state][event]; + return nextState !== null && nextState !== void 0 ? nextState : state; + }, initialState); +} +const $a2fa0214bb2735a1$export$99c2b779aa4e8b8b = props => { + const { + present: present, + children: children + } = props; + const presence = $a2fa0214bb2735a1$var$usePresence(present); + const child = typeof children === 'function' ? children({ + present: presence.isPresent + }) : $fnLeV$react.Children.only(children); + const ref = $fnLeV$radixuireactcomposerefs.useComposedRefs(presence.ref, child.ref); + const forceMount = typeof children === 'function'; + return forceMount || presence.isPresent ? /*#__PURE__*/$fnLeV$react.cloneElement(child, { + ref: ref + }) : null; +}; +$a2fa0214bb2735a1$export$99c2b779aa4e8b8b.displayName = 'Presence'; +/* ------------------------------------------------------------------------------------------------- + * usePresence + * -----------------------------------------------------------------------------------------------*/ +function $a2fa0214bb2735a1$var$usePresence(present) { + const [node1, setNode] = $fnLeV$react.useState(); + const stylesRef = $fnLeV$react.useRef({}); + const prevPresentRef = $fnLeV$react.useRef(present); + const prevAnimationNameRef = $fnLeV$react.useRef('none'); + const initialState = present ? 'mounted' : 'unmounted'; + const [state, send] = $8f63844556d0d3cd$export$3e6543de14f8614f(initialState, { + mounted: { + UNMOUNT: 'unmounted', + ANIMATION_OUT: 'unmountSuspended' + }, + unmountSuspended: { + MOUNT: 'mounted', + ANIMATION_END: 'unmounted' + }, + unmounted: { + MOUNT: 'mounted' + } + }); + $fnLeV$react.useEffect(() => { + const currentAnimationName = $a2fa0214bb2735a1$var$getAnimationName(stylesRef.current); + prevAnimationNameRef.current = state === 'mounted' ? currentAnimationName : 'none'; + }, [state]); + $fnLeV$radixuireactuselayouteffect.useLayoutEffect(() => { + const styles = stylesRef.current; + const wasPresent = prevPresentRef.current; + const hasPresentChanged = wasPresent !== present; + if (hasPresentChanged) { + const prevAnimationName = prevAnimationNameRef.current; + const currentAnimationName = $a2fa0214bb2735a1$var$getAnimationName(styles); + if (present) send('MOUNT');else if (currentAnimationName === 'none' || (styles === null || styles === void 0 ? void 0 : styles.display) === 'none') + // If there is no exit animation or the element is hidden, animations won't run + // so we unmount instantly + send('UNMOUNT');else { + /** + * When `present` changes to `false`, we check changes to animation-name to + * determine whether an animation has started. We chose this approach (reading + * computed styles) because there is no `animationrun` event and `animationstart` + * fires after `animation-delay` has expired which would be too late. + */ + const isAnimating = prevAnimationName !== currentAnimationName; + if (wasPresent && isAnimating) send('ANIMATION_OUT');else send('UNMOUNT'); + } + prevPresentRef.current = present; + } + }, [present, send]); + $fnLeV$radixuireactuselayouteffect.useLayoutEffect(() => { + if (node1) { + /** + * Triggering an ANIMATION_OUT during an ANIMATION_IN will fire an `animationcancel` + * event for ANIMATION_IN after we have entered `unmountSuspended` state. So, we + * make sure we only trigger ANIMATION_END for the currently active animation. + */ + const handleAnimationEnd = event => { + const currentAnimationName = $a2fa0214bb2735a1$var$getAnimationName(stylesRef.current); + const isCurrentAnimation = currentAnimationName.includes(event.animationName); + if (event.target === node1 && isCurrentAnimation) + // With React 18 concurrency this update is applied + // a frame after the animation ends, creating a flash of visible content. + // By manually flushing we ensure they sync within a frame, removing the flash. + $fnLeV$reactdom.flushSync(() => send('ANIMATION_END')); + }; + const handleAnimationStart = event => { + if (event.target === node1) + // if animation occurred, store its name as the previous animation. + prevAnimationNameRef.current = $a2fa0214bb2735a1$var$getAnimationName(stylesRef.current); + }; + node1.addEventListener('animationstart', handleAnimationStart); + node1.addEventListener('animationcancel', handleAnimationEnd); + node1.addEventListener('animationend', handleAnimationEnd); + return () => { + node1.removeEventListener('animationstart', handleAnimationStart); + node1.removeEventListener('animationcancel', handleAnimationEnd); + node1.removeEventListener('animationend', handleAnimationEnd); + }; + } else + // Transition to the unmounted state if the node is removed prematurely. + // We avoid doing so during cleanup as the node may change but still exist. + send('ANIMATION_END'); + }, [node1, send]); + return { + isPresent: ['mounted', 'unmountSuspended'].includes(state), + ref: $fnLeV$react.useCallback(node => { + if (node) stylesRef.current = getComputedStyle(node); + setNode(node); + }, []) + }; +} +/* -----------------------------------------------------------------------------------------------*/ +function $a2fa0214bb2735a1$var$getAnimationName(styles) { + return (styles === null || styles === void 0 ? void 0 : styles.animationName) || 'none'; +} + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-primitive/dist/index.js": +/*!*********************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-primitive/dist/index.js ***! + \*********************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $iMixA$babelruntimehelpersextends = __webpack_require__(/*! @babel/runtime/helpers/extends */ "../../../node_modules/@babel/runtime/helpers/extends.js"); +var $iMixA$react = __webpack_require__(/*! react */ "react"); +var $iMixA$reactdom = __webpack_require__(/*! react-dom */ "react-dom"); +var $iMixA$radixuireactslot = __webpack_require__(/*! @radix-ui/react-slot */ "../../../node_modules/@radix-ui/react-slot/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "Primitive", () => $c3def6332c2749a6$export$250ffa63cdc0d034); +$parcel$export(module.exports, "Root", () => $c3def6332c2749a6$export$be92b6f5f03c0fe9); +$parcel$export(module.exports, "dispatchDiscreteCustomEvent", () => $c3def6332c2749a6$export$6d1a0317bde7de7f); +const $c3def6332c2749a6$var$NODES = ['a', 'button', 'div', 'form', 'h2', 'h3', 'img', 'input', 'label', 'li', 'nav', 'ol', 'p', 'span', 'svg', 'ul']; // Temporary while we await merge of this fix: +// https://github.com/DefinitelyTyped/DefinitelyTyped/pull/55396 +// prettier-ignore +/* ------------------------------------------------------------------------------------------------- + * Primitive + * -----------------------------------------------------------------------------------------------*/ +const $c3def6332c2749a6$export$250ffa63cdc0d034 = $c3def6332c2749a6$var$NODES.reduce((primitive, node) => { + const Node = /*#__PURE__*/$iMixA$react.forwardRef((props, forwardedRef) => { + const { + asChild: asChild, + ...primitiveProps + } = props; + const Comp = asChild ? $iMixA$radixuireactslot.Slot : node; + $iMixA$react.useEffect(() => { + window[Symbol.for('radix-ui')] = true; + }, []); + return /*#__PURE__*/$iMixA$react.createElement(Comp, $parcel$interopDefault($iMixA$babelruntimehelpersextends)({}, primitiveProps, { + ref: forwardedRef + })); + }); + Node.displayName = `Primitive.${node}`; + return { + ...primitive, + [node]: Node + }; +}, {}); +/* ------------------------------------------------------------------------------------------------- + * Utils + * -----------------------------------------------------------------------------------------------*/ /** + * Flush custom event dispatch + * https://github.com/radix-ui/primitives/pull/1378 + * + * React batches *all* event handlers since version 18, this introduces certain considerations when using custom event types. + * + * Internally, React prioritises events in the following order: + * - discrete + * - continuous + * - default + * + * https://github.com/facebook/react/blob/a8a4742f1c54493df00da648a3f9d26e3db9c8b5/packages/react-dom/src/events/ReactDOMEventListener.js#L294-L350 + * + * `discrete` is an important distinction as updates within these events are applied immediately. + * React however, is not able to infer the priority of custom event types due to how they are detected internally. + * Because of this, it's possible for updates from custom events to be unexpectedly batched when + * dispatched by another `discrete` event. + * + * In order to ensure that updates from custom events are applied predictably, we need to manually flush the batch. + * This utility should be used when dispatching a custom event from within another `discrete` event, this utility + * is not nessesary when dispatching known event types, or if dispatching a custom type inside a non-discrete event. + * For example: + * + * dispatching a known click 👎 + * target.dispatchEvent(new Event(‘click’)) + * + * dispatching a custom type within a non-discrete event 👎 + * onScroll={(event) => event.target.dispatchEvent(new CustomEvent(‘customType’))} + * + * dispatching a custom type within a `discrete` event 👍 + * onPointerDown={(event) => dispatchDiscreteCustomEvent(event.target, new CustomEvent(‘customType’))} + * + * Note: though React classifies `focus`, `focusin` and `focusout` events as `discrete`, it's not recommended to use + * this utility with them. This is because it's possible for those handlers to be called implicitly during render + * e.g. when focus is within a component as it is unmounted, or when managing focus on mount. + */ +function $c3def6332c2749a6$export$6d1a0317bde7de7f(target, event) { + if (target) $iMixA$reactdom.flushSync(() => target.dispatchEvent(event)); +} +/* -----------------------------------------------------------------------------------------------*/ +const $c3def6332c2749a6$export$be92b6f5f03c0fe9 = $c3def6332c2749a6$export$250ffa63cdc0d034; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-roving-focus/dist/index.js": +/*!************************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-roving-focus/dist/index.js ***! + \************************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $9QJ9Y$babelruntimehelpersextends = __webpack_require__(/*! @babel/runtime/helpers/extends */ "../../../node_modules/@babel/runtime/helpers/extends.js"); +var $9QJ9Y$react = __webpack_require__(/*! react */ "react"); +var $9QJ9Y$radixuiprimitive = __webpack_require__(/*! @radix-ui/primitive */ "../../../node_modules/@radix-ui/primitive/dist/index.js"); +var $9QJ9Y$radixuireactcollection = __webpack_require__(/*! @radix-ui/react-collection */ "../../../node_modules/@radix-ui/react-collection/dist/index.js"); +var $9QJ9Y$radixuireactcomposerefs = __webpack_require__(/*! @radix-ui/react-compose-refs */ "../../../node_modules/@radix-ui/react-compose-refs/dist/index.js"); +var $9QJ9Y$radixuireactcontext = __webpack_require__(/*! @radix-ui/react-context */ "../../../node_modules/@radix-ui/react-context/dist/index.js"); +var $9QJ9Y$radixuireactid = __webpack_require__(/*! @radix-ui/react-id */ "../../../node_modules/@radix-ui/react-id/dist/index.js"); +var $9QJ9Y$radixuireactprimitive = __webpack_require__(/*! @radix-ui/react-primitive */ "../../../node_modules/@radix-ui/react-primitive/dist/index.js"); +var $9QJ9Y$radixuireactusecallbackref = __webpack_require__(/*! @radix-ui/react-use-callback-ref */ "../../../node_modules/@radix-ui/react-use-callback-ref/dist/index.js"); +var $9QJ9Y$radixuireactusecontrollablestate = __webpack_require__(/*! @radix-ui/react-use-controllable-state */ "../../../node_modules/@radix-ui/react-use-controllable-state/dist/index.js"); +var $9QJ9Y$radixuireactdirection = __webpack_require__(/*! @radix-ui/react-direction */ "../../../node_modules/@radix-ui/react-direction/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "createRovingFocusGroupScope", () => $0063afae63b3fa70$export$c7109489551a4f4); +$parcel$export(module.exports, "RovingFocusGroup", () => $0063afae63b3fa70$export$8699f7c8af148338); +$parcel$export(module.exports, "RovingFocusGroupItem", () => $0063afae63b3fa70$export$ab9df7c53fe8454); +$parcel$export(module.exports, "Root", () => $0063afae63b3fa70$export$be92b6f5f03c0fe9); +$parcel$export(module.exports, "Item", () => $0063afae63b3fa70$export$6d08773d2e66f8f2); +const $0063afae63b3fa70$var$ENTRY_FOCUS = 'rovingFocusGroup.onEntryFocus'; +const $0063afae63b3fa70$var$EVENT_OPTIONS = { + bubbles: false, + cancelable: true +}; +/* ------------------------------------------------------------------------------------------------- + * RovingFocusGroup + * -----------------------------------------------------------------------------------------------*/ +const $0063afae63b3fa70$var$GROUP_NAME = 'RovingFocusGroup'; +const [$0063afae63b3fa70$var$Collection, $0063afae63b3fa70$var$useCollection, $0063afae63b3fa70$var$createCollectionScope] = $9QJ9Y$radixuireactcollection.createCollection($0063afae63b3fa70$var$GROUP_NAME); +const [$0063afae63b3fa70$var$createRovingFocusGroupContext, $0063afae63b3fa70$export$c7109489551a4f4] = $9QJ9Y$radixuireactcontext.createContextScope($0063afae63b3fa70$var$GROUP_NAME, [$0063afae63b3fa70$var$createCollectionScope]); +const [$0063afae63b3fa70$var$RovingFocusProvider, $0063afae63b3fa70$var$useRovingFocusContext] = $0063afae63b3fa70$var$createRovingFocusGroupContext($0063afae63b3fa70$var$GROUP_NAME); +const $0063afae63b3fa70$export$8699f7c8af148338 = /*#__PURE__*/$9QJ9Y$react.forwardRef((props, forwardedRef) => { + return /*#__PURE__*/$9QJ9Y$react.createElement($0063afae63b3fa70$var$Collection.Provider, { + scope: props.__scopeRovingFocusGroup + }, /*#__PURE__*/$9QJ9Y$react.createElement($0063afae63b3fa70$var$Collection.Slot, { + scope: props.__scopeRovingFocusGroup + }, /*#__PURE__*/$9QJ9Y$react.createElement($0063afae63b3fa70$var$RovingFocusGroupImpl, $parcel$interopDefault($9QJ9Y$babelruntimehelpersextends)({}, props, { + ref: forwardedRef + })))); +}); +/*#__PURE__*/ +Object.assign($0063afae63b3fa70$export$8699f7c8af148338, { + displayName: $0063afae63b3fa70$var$GROUP_NAME +}); +/* -----------------------------------------------------------------------------------------------*/ +const $0063afae63b3fa70$var$RovingFocusGroupImpl = /*#__PURE__*/$9QJ9Y$react.forwardRef((props, forwardedRef) => { + const { + __scopeRovingFocusGroup: __scopeRovingFocusGroup, + orientation: orientation, + loop = false, + dir: dir, + currentTabStopId: currentTabStopIdProp, + defaultCurrentTabStopId: defaultCurrentTabStopId, + onCurrentTabStopIdChange: onCurrentTabStopIdChange, + onEntryFocus: onEntryFocus, + ...groupProps + } = props; + const ref = $9QJ9Y$react.useRef(null); + const composedRefs = $9QJ9Y$radixuireactcomposerefs.useComposedRefs(forwardedRef, ref); + const direction = $9QJ9Y$radixuireactdirection.useDirection(dir); + const [currentTabStopId = null, setCurrentTabStopId] = $9QJ9Y$radixuireactusecontrollablestate.useControllableState({ + prop: currentTabStopIdProp, + defaultProp: defaultCurrentTabStopId, + onChange: onCurrentTabStopIdChange + }); + const [isTabbingBackOut, setIsTabbingBackOut] = $9QJ9Y$react.useState(false); + const handleEntryFocus = $9QJ9Y$radixuireactusecallbackref.useCallbackRef(onEntryFocus); + const getItems = $0063afae63b3fa70$var$useCollection(__scopeRovingFocusGroup); + const isClickFocusRef = $9QJ9Y$react.useRef(false); + const [focusableItemsCount, setFocusableItemsCount] = $9QJ9Y$react.useState(0); + $9QJ9Y$react.useEffect(() => { + const node = ref.current; + if (node) { + node.addEventListener($0063afae63b3fa70$var$ENTRY_FOCUS, handleEntryFocus); + return () => node.removeEventListener($0063afae63b3fa70$var$ENTRY_FOCUS, handleEntryFocus); + } + }, [handleEntryFocus]); + return /*#__PURE__*/$9QJ9Y$react.createElement($0063afae63b3fa70$var$RovingFocusProvider, { + scope: __scopeRovingFocusGroup, + orientation: orientation, + dir: direction, + loop: loop, + currentTabStopId: currentTabStopId, + onItemFocus: $9QJ9Y$react.useCallback(tabStopId => setCurrentTabStopId(tabStopId), [setCurrentTabStopId]), + onItemShiftTab: $9QJ9Y$react.useCallback(() => setIsTabbingBackOut(true), []), + onFocusableItemAdd: $9QJ9Y$react.useCallback(() => setFocusableItemsCount(prevCount => prevCount + 1), []), + onFocusableItemRemove: $9QJ9Y$react.useCallback(() => setFocusableItemsCount(prevCount => prevCount - 1), []) + }, /*#__PURE__*/$9QJ9Y$react.createElement($9QJ9Y$radixuireactprimitive.Primitive.div, $parcel$interopDefault($9QJ9Y$babelruntimehelpersextends)({ + tabIndex: isTabbingBackOut || focusableItemsCount === 0 ? -1 : 0, + "data-orientation": orientation + }, groupProps, { + ref: composedRefs, + style: { + outline: 'none', + ...props.style + }, + onMouseDown: $9QJ9Y$radixuiprimitive.composeEventHandlers(props.onMouseDown, () => { + isClickFocusRef.current = true; + }), + onFocus: $9QJ9Y$radixuiprimitive.composeEventHandlers(props.onFocus, event => { + // We normally wouldn't need this check, because we already check + // that the focus is on the current target and not bubbling to it. + // We do this because Safari doesn't focus buttons when clicked, and + // instead, the wrapper will get focused and not through a bubbling event. + const isKeyboardFocus = !isClickFocusRef.current; + if (event.target === event.currentTarget && isKeyboardFocus && !isTabbingBackOut) { + const entryFocusEvent = new CustomEvent($0063afae63b3fa70$var$ENTRY_FOCUS, $0063afae63b3fa70$var$EVENT_OPTIONS); + event.currentTarget.dispatchEvent(entryFocusEvent); + if (!entryFocusEvent.defaultPrevented) { + const items = getItems().filter(item => item.focusable); + const activeItem = items.find(item => item.active); + const currentItem = items.find(item => item.id === currentTabStopId); + const candidateItems = [activeItem, currentItem, ...items].filter(Boolean); + const candidateNodes = candidateItems.map(item => item.ref.current); + $0063afae63b3fa70$var$focusFirst(candidateNodes); + } + } + isClickFocusRef.current = false; + }), + onBlur: $9QJ9Y$radixuiprimitive.composeEventHandlers(props.onBlur, () => setIsTabbingBackOut(false)) + }))); +}); +/* ------------------------------------------------------------------------------------------------- + * RovingFocusGroupItem + * -----------------------------------------------------------------------------------------------*/ +const $0063afae63b3fa70$var$ITEM_NAME = 'RovingFocusGroupItem'; +const $0063afae63b3fa70$export$ab9df7c53fe8454 = /*#__PURE__*/$9QJ9Y$react.forwardRef((props, forwardedRef) => { + const { + __scopeRovingFocusGroup: __scopeRovingFocusGroup, + focusable = true, + active = false, + tabStopId: tabStopId, + ...itemProps + } = props; + const autoId = $9QJ9Y$radixuireactid.useId(); + const id = tabStopId || autoId; + const context = $0063afae63b3fa70$var$useRovingFocusContext($0063afae63b3fa70$var$ITEM_NAME, __scopeRovingFocusGroup); + const isCurrentTabStop = context.currentTabStopId === id; + const getItems = $0063afae63b3fa70$var$useCollection(__scopeRovingFocusGroup); + const { + onFocusableItemAdd: onFocusableItemAdd, + onFocusableItemRemove: onFocusableItemRemove + } = context; + $9QJ9Y$react.useEffect(() => { + if (focusable) { + onFocusableItemAdd(); + return () => onFocusableItemRemove(); + } + }, [focusable, onFocusableItemAdd, onFocusableItemRemove]); + return /*#__PURE__*/$9QJ9Y$react.createElement($0063afae63b3fa70$var$Collection.ItemSlot, { + scope: __scopeRovingFocusGroup, + id: id, + focusable: focusable, + active: active + }, /*#__PURE__*/$9QJ9Y$react.createElement($9QJ9Y$radixuireactprimitive.Primitive.span, $parcel$interopDefault($9QJ9Y$babelruntimehelpersextends)({ + tabIndex: isCurrentTabStop ? 0 : -1, + "data-orientation": context.orientation + }, itemProps, { + ref: forwardedRef, + onMouseDown: $9QJ9Y$radixuiprimitive.composeEventHandlers(props.onMouseDown, event => { + // We prevent focusing non-focusable items on `mousedown`. + // Even though the item has tabIndex={-1}, that only means take it out of the tab order. + if (!focusable) event.preventDefault(); // Safari doesn't focus a button when clicked so we run our logic on mousedown also + else context.onItemFocus(id); + }), + onFocus: $9QJ9Y$radixuiprimitive.composeEventHandlers(props.onFocus, () => context.onItemFocus(id)), + onKeyDown: $9QJ9Y$radixuiprimitive.composeEventHandlers(props.onKeyDown, event => { + if (event.key === 'Tab' && event.shiftKey) { + context.onItemShiftTab(); + return; + } + if (event.target !== event.currentTarget) return; + const focusIntent = $0063afae63b3fa70$var$getFocusIntent(event, context.orientation, context.dir); + if (focusIntent !== undefined) { + event.preventDefault(); + const items = getItems().filter(item => item.focusable); + let candidateNodes = items.map(item => item.ref.current); + if (focusIntent === 'last') candidateNodes.reverse();else if (focusIntent === 'prev' || focusIntent === 'next') { + if (focusIntent === 'prev') candidateNodes.reverse(); + const currentIndex = candidateNodes.indexOf(event.currentTarget); + candidateNodes = context.loop ? $0063afae63b3fa70$var$wrapArray(candidateNodes, currentIndex + 1) : candidateNodes.slice(currentIndex + 1); + } + /** + * Imperative focus during keydown is risky so we prevent React's batching updates + * to avoid potential bugs. See: https://github.com/facebook/react/issues/20332 + */ + setTimeout(() => $0063afae63b3fa70$var$focusFirst(candidateNodes)); + } + }) + }))); +}); +/*#__PURE__*/ +Object.assign($0063afae63b3fa70$export$ab9df7c53fe8454, { + displayName: $0063afae63b3fa70$var$ITEM_NAME +}); +/* -----------------------------------------------------------------------------------------------*/ // prettier-ignore +const $0063afae63b3fa70$var$MAP_KEY_TO_FOCUS_INTENT = { + ArrowLeft: 'prev', + ArrowUp: 'prev', + ArrowRight: 'next', + ArrowDown: 'next', + PageUp: 'first', + Home: 'first', + PageDown: 'last', + End: 'last' +}; +function $0063afae63b3fa70$var$getDirectionAwareKey(key, dir) { + if (dir !== 'rtl') return key; + return key === 'ArrowLeft' ? 'ArrowRight' : key === 'ArrowRight' ? 'ArrowLeft' : key; +} +function $0063afae63b3fa70$var$getFocusIntent(event, orientation, dir) { + const key = $0063afae63b3fa70$var$getDirectionAwareKey(event.key, dir); + if (orientation === 'vertical' && ['ArrowLeft', 'ArrowRight'].includes(key)) return undefined; + if (orientation === 'horizontal' && ['ArrowUp', 'ArrowDown'].includes(key)) return undefined; + return $0063afae63b3fa70$var$MAP_KEY_TO_FOCUS_INTENT[key]; +} +function $0063afae63b3fa70$var$focusFirst(candidates) { + const PREVIOUSLY_FOCUSED_ELEMENT = document.activeElement; + for (const candidate of candidates) { + // if focus is already where we want to go, we don't want to keep going through the candidates + if (candidate === PREVIOUSLY_FOCUSED_ELEMENT) return; + candidate.focus(); + if (document.activeElement !== PREVIOUSLY_FOCUSED_ELEMENT) return; + } +} +/** + * Wraps an array around itself at a given start index + * Example: `wrapArray(['a', 'b', 'c', 'd'], 2) === ['c', 'd', 'a', 'b']` + */ +function $0063afae63b3fa70$var$wrapArray(array, startIndex) { + return array.map((_, index) => array[(startIndex + index) % array.length]); +} +const $0063afae63b3fa70$export$be92b6f5f03c0fe9 = $0063afae63b3fa70$export$8699f7c8af148338; +const $0063afae63b3fa70$export$6d08773d2e66f8f2 = $0063afae63b3fa70$export$ab9df7c53fe8454; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-slot/dist/index.js": +/*!****************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-slot/dist/index.js ***! + \****************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $dAvBt$babelruntimehelpersextends = __webpack_require__(/*! @babel/runtime/helpers/extends */ "../../../node_modules/@babel/runtime/helpers/extends.js"); +var $dAvBt$react = __webpack_require__(/*! react */ "react"); +var $dAvBt$radixuireactcomposerefs = __webpack_require__(/*! @radix-ui/react-compose-refs */ "../../../node_modules/@radix-ui/react-compose-refs/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "Slot", () => $82dc8d030dec7549$export$8c6ed5c666ac1360); +$parcel$export(module.exports, "Slottable", () => $82dc8d030dec7549$export$d9f1ccf0bdb05d45); +$parcel$export(module.exports, "Root", () => $82dc8d030dec7549$export$be92b6f5f03c0fe9); + +/* ------------------------------------------------------------------------------------------------- + * Slot + * -----------------------------------------------------------------------------------------------*/ +const $82dc8d030dec7549$export$8c6ed5c666ac1360 = /*#__PURE__*/$dAvBt$react.forwardRef((props, forwardedRef) => { + const { + children: children, + ...slotProps + } = props; + const childrenArray = $dAvBt$react.Children.toArray(children); + const slottable = childrenArray.find($82dc8d030dec7549$var$isSlottable); + if (slottable) { + // the new element to render is the one passed as a child of `Slottable` + const newElement = slottable.props.children; + const newChildren = childrenArray.map(child => { + if (child === slottable) { + // because the new element will be the one rendered, we are only interested + // in grabbing its children (`newElement.props.children`) + if ($dAvBt$react.Children.count(newElement) > 1) return $dAvBt$react.Children.only(null); + return /*#__PURE__*/$dAvBt$react.isValidElement(newElement) ? newElement.props.children : null; + } else return child; + }); + return /*#__PURE__*/$dAvBt$react.createElement($82dc8d030dec7549$var$SlotClone, $parcel$interopDefault($dAvBt$babelruntimehelpersextends)({}, slotProps, { + ref: forwardedRef + }), /*#__PURE__*/$dAvBt$react.isValidElement(newElement) ? /*#__PURE__*/$dAvBt$react.cloneElement(newElement, undefined, newChildren) : null); + } + return /*#__PURE__*/$dAvBt$react.createElement($82dc8d030dec7549$var$SlotClone, $parcel$interopDefault($dAvBt$babelruntimehelpersextends)({}, slotProps, { + ref: forwardedRef + }), children); +}); +$82dc8d030dec7549$export$8c6ed5c666ac1360.displayName = 'Slot'; +/* ------------------------------------------------------------------------------------------------- + * SlotClone + * -----------------------------------------------------------------------------------------------*/ +const $82dc8d030dec7549$var$SlotClone = /*#__PURE__*/$dAvBt$react.forwardRef((props, forwardedRef) => { + const { + children: children, + ...slotProps + } = props; + if ( /*#__PURE__*/$dAvBt$react.isValidElement(children)) return /*#__PURE__*/$dAvBt$react.cloneElement(children, { + ...$82dc8d030dec7549$var$mergeProps(slotProps, children.props), + ref: forwardedRef ? $dAvBt$radixuireactcomposerefs.composeRefs(forwardedRef, children.ref) : children.ref + }); + return $dAvBt$react.Children.count(children) > 1 ? $dAvBt$react.Children.only(null) : null; +}); +$82dc8d030dec7549$var$SlotClone.displayName = 'SlotClone'; +/* ------------------------------------------------------------------------------------------------- + * Slottable + * -----------------------------------------------------------------------------------------------*/ +const $82dc8d030dec7549$export$d9f1ccf0bdb05d45 = _ref => { + let { + children: children + } = _ref; + return /*#__PURE__*/$dAvBt$react.createElement($dAvBt$react.Fragment, null, children); +}; +/* ---------------------------------------------------------------------------------------------- */ +function $82dc8d030dec7549$var$isSlottable(child) { + return /*#__PURE__*/$dAvBt$react.isValidElement(child) && child.type === $82dc8d030dec7549$export$d9f1ccf0bdb05d45; +} +function $82dc8d030dec7549$var$mergeProps(slotProps, childProps) { + // all child props should override + const overrideProps = { + ...childProps + }; + for (const propName in childProps) { + const slotPropValue = slotProps[propName]; + const childPropValue = childProps[propName]; + const isHandler = /^on[A-Z]/.test(propName); + if (isHandler) { + // if the handler exists on both, we compose them + if (slotPropValue && childPropValue) overrideProps[propName] = function () { + childPropValue(...arguments); + slotPropValue(...arguments); + };else if (slotPropValue) overrideProps[propName] = slotPropValue; + } else if (propName === 'style') overrideProps[propName] = { + ...slotPropValue, + ...childPropValue + };else if (propName === 'className') overrideProps[propName] = [slotPropValue, childPropValue].filter(Boolean).join(' '); + } + return { + ...slotProps, + ...overrideProps + }; +} +const $82dc8d030dec7549$export$be92b6f5f03c0fe9 = $82dc8d030dec7549$export$8c6ed5c666ac1360; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-tooltip/dist/index.js": +/*!*******************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-tooltip/dist/index.js ***! + \*******************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $iVrL9$babelruntimehelpersextends = __webpack_require__(/*! @babel/runtime/helpers/extends */ "../../../node_modules/@babel/runtime/helpers/extends.js"); +var $iVrL9$react = __webpack_require__(/*! react */ "react"); +var $iVrL9$radixuiprimitive = __webpack_require__(/*! @radix-ui/primitive */ "../../../node_modules/@radix-ui/primitive/dist/index.js"); +var $iVrL9$radixuireactcomposerefs = __webpack_require__(/*! @radix-ui/react-compose-refs */ "../../../node_modules/@radix-ui/react-compose-refs/dist/index.js"); +var $iVrL9$radixuireactcontext = __webpack_require__(/*! @radix-ui/react-context */ "../../../node_modules/@radix-ui/react-context/dist/index.js"); +var $iVrL9$radixuireactdismissablelayer = __webpack_require__(/*! @radix-ui/react-dismissable-layer */ "../../../node_modules/@radix-ui/react-dismissable-layer/dist/index.js"); +var $iVrL9$radixuireactid = __webpack_require__(/*! @radix-ui/react-id */ "../../../node_modules/@radix-ui/react-id/dist/index.js"); +var $iVrL9$radixuireactpopper = __webpack_require__(/*! @radix-ui/react-popper */ "../../../node_modules/@radix-ui/react-popper/dist/index.js"); +var $iVrL9$radixuireactportal = __webpack_require__(/*! @radix-ui/react-portal */ "../../../node_modules/@radix-ui/react-portal/dist/index.js"); +var $iVrL9$radixuireactpresence = __webpack_require__(/*! @radix-ui/react-presence */ "../../../node_modules/@radix-ui/react-presence/dist/index.js"); +var $iVrL9$radixuireactprimitive = __webpack_require__(/*! @radix-ui/react-primitive */ "../../../node_modules/@radix-ui/react-primitive/dist/index.js"); +var $iVrL9$radixuireactslot = __webpack_require__(/*! @radix-ui/react-slot */ "../../../node_modules/@radix-ui/react-slot/dist/index.js"); +var $iVrL9$radixuireactusecontrollablestate = __webpack_require__(/*! @radix-ui/react-use-controllable-state */ "../../../node_modules/@radix-ui/react-use-controllable-state/dist/index.js"); +var $iVrL9$radixuireactvisuallyhidden = __webpack_require__(/*! @radix-ui/react-visually-hidden */ "../../../node_modules/@radix-ui/react-visually-hidden/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "createTooltipScope", () => $c34afbc43c90cc6f$export$1c540a2224f0d865); +$parcel$export(module.exports, "TooltipProvider", () => $c34afbc43c90cc6f$export$f78649fb9ca566b8); +$parcel$export(module.exports, "Tooltip", () => $c34afbc43c90cc6f$export$28c660c63b792dea); +$parcel$export(module.exports, "TooltipTrigger", () => $c34afbc43c90cc6f$export$8c610744efcf8a1d); +$parcel$export(module.exports, "TooltipPortal", () => $c34afbc43c90cc6f$export$7b36b8f925ab7497); +$parcel$export(module.exports, "TooltipContent", () => $c34afbc43c90cc6f$export$e9003e2be37ec060); +$parcel$export(module.exports, "TooltipArrow", () => $c34afbc43c90cc6f$export$c27ee0ad710f7559); +$parcel$export(module.exports, "Provider", () => $c34afbc43c90cc6f$export$2881499e37b75b9a); +$parcel$export(module.exports, "Root", () => $c34afbc43c90cc6f$export$be92b6f5f03c0fe9); +$parcel$export(module.exports, "Trigger", () => $c34afbc43c90cc6f$export$41fb9f06171c75f4); +$parcel$export(module.exports, "Portal", () => $c34afbc43c90cc6f$export$602eac185826482c); +$parcel$export(module.exports, "Content", () => $c34afbc43c90cc6f$export$7c6e2c02157bb7d2); +$parcel$export(module.exports, "Arrow", () => $c34afbc43c90cc6f$export$21b07c8f274aebd5); +const [$c34afbc43c90cc6f$var$createTooltipContext, $c34afbc43c90cc6f$export$1c540a2224f0d865] = $iVrL9$radixuireactcontext.createContextScope('Tooltip', [$iVrL9$radixuireactpopper.createPopperScope]); +const $c34afbc43c90cc6f$var$usePopperScope = $iVrL9$radixuireactpopper.createPopperScope(); +/* ------------------------------------------------------------------------------------------------- + * TooltipProvider + * -----------------------------------------------------------------------------------------------*/ +const $c34afbc43c90cc6f$var$PROVIDER_NAME = 'TooltipProvider'; +const $c34afbc43c90cc6f$var$DEFAULT_DELAY_DURATION = 700; +const $c34afbc43c90cc6f$var$TOOLTIP_OPEN = 'tooltip.open'; +const [$c34afbc43c90cc6f$var$TooltipProviderContextProvider, $c34afbc43c90cc6f$var$useTooltipProviderContext] = $c34afbc43c90cc6f$var$createTooltipContext($c34afbc43c90cc6f$var$PROVIDER_NAME); +const $c34afbc43c90cc6f$export$f78649fb9ca566b8 = props => { + const { + __scopeTooltip: __scopeTooltip, + delayDuration = $c34afbc43c90cc6f$var$DEFAULT_DELAY_DURATION, + skipDelayDuration = 300, + disableHoverableContent = false, + children: children + } = props; + const [isOpenDelayed, setIsOpenDelayed] = $iVrL9$react.useState(true); + const isPointerInTransitRef = $iVrL9$react.useRef(false); + const skipDelayTimerRef = $iVrL9$react.useRef(0); + $iVrL9$react.useEffect(() => { + const skipDelayTimer = skipDelayTimerRef.current; + return () => window.clearTimeout(skipDelayTimer); + }, []); + return /*#__PURE__*/$iVrL9$react.createElement($c34afbc43c90cc6f$var$TooltipProviderContextProvider, { + scope: __scopeTooltip, + isOpenDelayed: isOpenDelayed, + delayDuration: delayDuration, + onOpen: $iVrL9$react.useCallback(() => { + window.clearTimeout(skipDelayTimerRef.current); + setIsOpenDelayed(false); + }, []), + onClose: $iVrL9$react.useCallback(() => { + window.clearTimeout(skipDelayTimerRef.current); + skipDelayTimerRef.current = window.setTimeout(() => setIsOpenDelayed(true), skipDelayDuration); + }, [skipDelayDuration]), + isPointerInTransitRef: isPointerInTransitRef, + onPointerInTransitChange: $iVrL9$react.useCallback(inTransit => { + isPointerInTransitRef.current = inTransit; + }, []), + disableHoverableContent: disableHoverableContent + }, children); +}; +/*#__PURE__*/ +Object.assign($c34afbc43c90cc6f$export$f78649fb9ca566b8, { + displayName: $c34afbc43c90cc6f$var$PROVIDER_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * Tooltip + * -----------------------------------------------------------------------------------------------*/ +const $c34afbc43c90cc6f$var$TOOLTIP_NAME = 'Tooltip'; +const [$c34afbc43c90cc6f$var$TooltipContextProvider, $c34afbc43c90cc6f$var$useTooltipContext] = $c34afbc43c90cc6f$var$createTooltipContext($c34afbc43c90cc6f$var$TOOLTIP_NAME); +const $c34afbc43c90cc6f$export$28c660c63b792dea = props => { + const { + __scopeTooltip: __scopeTooltip, + children: children, + open: openProp, + defaultOpen = false, + onOpenChange: onOpenChange, + disableHoverableContent: disableHoverableContentProp, + delayDuration: delayDurationProp + } = props; + const providerContext = $c34afbc43c90cc6f$var$useTooltipProviderContext($c34afbc43c90cc6f$var$TOOLTIP_NAME, props.__scopeTooltip); + const popperScope = $c34afbc43c90cc6f$var$usePopperScope(__scopeTooltip); + const [trigger, setTrigger] = $iVrL9$react.useState(null); + const contentId = $iVrL9$radixuireactid.useId(); + const openTimerRef = $iVrL9$react.useRef(0); + const disableHoverableContent = disableHoverableContentProp !== null && disableHoverableContentProp !== void 0 ? disableHoverableContentProp : providerContext.disableHoverableContent; + const delayDuration = delayDurationProp !== null && delayDurationProp !== void 0 ? delayDurationProp : providerContext.delayDuration; + const wasOpenDelayedRef = $iVrL9$react.useRef(false); + const [open1 = false, setOpen] = $iVrL9$radixuireactusecontrollablestate.useControllableState({ + prop: openProp, + defaultProp: defaultOpen, + onChange: open => { + if (open) { + providerContext.onOpen(); // as `onChange` is called within a lifecycle method we + // avoid dispatching via `dispatchDiscreteCustomEvent`. + document.dispatchEvent(new CustomEvent($c34afbc43c90cc6f$var$TOOLTIP_OPEN)); + } else providerContext.onClose(); + onOpenChange === null || onOpenChange === void 0 || onOpenChange(open); + } + }); + const stateAttribute = $iVrL9$react.useMemo(() => { + return open1 ? wasOpenDelayedRef.current ? 'delayed-open' : 'instant-open' : 'closed'; + }, [open1]); + const handleOpen = $iVrL9$react.useCallback(() => { + window.clearTimeout(openTimerRef.current); + wasOpenDelayedRef.current = false; + setOpen(true); + }, [setOpen]); + const handleClose = $iVrL9$react.useCallback(() => { + window.clearTimeout(openTimerRef.current); + setOpen(false); + }, [setOpen]); + const handleDelayedOpen = $iVrL9$react.useCallback(() => { + window.clearTimeout(openTimerRef.current); + openTimerRef.current = window.setTimeout(() => { + wasOpenDelayedRef.current = true; + setOpen(true); + }, delayDuration); + }, [delayDuration, setOpen]); + $iVrL9$react.useEffect(() => { + return () => window.clearTimeout(openTimerRef.current); + }, []); + return /*#__PURE__*/$iVrL9$react.createElement($iVrL9$radixuireactpopper.Root, popperScope, /*#__PURE__*/$iVrL9$react.createElement($c34afbc43c90cc6f$var$TooltipContextProvider, { + scope: __scopeTooltip, + contentId: contentId, + open: open1, + stateAttribute: stateAttribute, + trigger: trigger, + onTriggerChange: setTrigger, + onTriggerEnter: $iVrL9$react.useCallback(() => { + if (providerContext.isOpenDelayed) handleDelayedOpen();else handleOpen(); + }, [providerContext.isOpenDelayed, handleDelayedOpen, handleOpen]), + onTriggerLeave: $iVrL9$react.useCallback(() => { + if (disableHoverableContent) handleClose();else + // Clear the timer in case the pointer leaves the trigger before the tooltip is opened. + window.clearTimeout(openTimerRef.current); + }, [handleClose, disableHoverableContent]), + onOpen: handleOpen, + onClose: handleClose, + disableHoverableContent: disableHoverableContent + }, children)); +}; +/*#__PURE__*/ +Object.assign($c34afbc43c90cc6f$export$28c660c63b792dea, { + displayName: $c34afbc43c90cc6f$var$TOOLTIP_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * TooltipTrigger + * -----------------------------------------------------------------------------------------------*/ +const $c34afbc43c90cc6f$var$TRIGGER_NAME = 'TooltipTrigger'; +const $c34afbc43c90cc6f$export$8c610744efcf8a1d = /*#__PURE__*/$iVrL9$react.forwardRef((props, forwardedRef) => { + const { + __scopeTooltip: __scopeTooltip, + ...triggerProps + } = props; + const context = $c34afbc43c90cc6f$var$useTooltipContext($c34afbc43c90cc6f$var$TRIGGER_NAME, __scopeTooltip); + const providerContext = $c34afbc43c90cc6f$var$useTooltipProviderContext($c34afbc43c90cc6f$var$TRIGGER_NAME, __scopeTooltip); + const popperScope = $c34afbc43c90cc6f$var$usePopperScope(__scopeTooltip); + const ref = $iVrL9$react.useRef(null); + const composedRefs = $iVrL9$radixuireactcomposerefs.useComposedRefs(forwardedRef, ref, context.onTriggerChange); + const isPointerDownRef = $iVrL9$react.useRef(false); + const hasPointerMoveOpenedRef = $iVrL9$react.useRef(false); + const handlePointerUp = $iVrL9$react.useCallback(() => isPointerDownRef.current = false, []); + $iVrL9$react.useEffect(() => { + return () => document.removeEventListener('pointerup', handlePointerUp); + }, [handlePointerUp]); + return /*#__PURE__*/$iVrL9$react.createElement($iVrL9$radixuireactpopper.Anchor, $parcel$interopDefault($iVrL9$babelruntimehelpersextends)({ + asChild: true + }, popperScope), /*#__PURE__*/$iVrL9$react.createElement($iVrL9$radixuireactprimitive.Primitive.button, $parcel$interopDefault($iVrL9$babelruntimehelpersextends)({ + // We purposefully avoid adding `type=button` here because tooltip triggers are also + // commonly anchors and the anchor `type` attribute signifies MIME type. + "aria-describedby": context.open ? context.contentId : undefined, + "data-state": context.stateAttribute + }, triggerProps, { + ref: composedRefs, + onPointerMove: $iVrL9$radixuiprimitive.composeEventHandlers(props.onPointerMove, event => { + if (event.pointerType === 'touch') return; + if (!hasPointerMoveOpenedRef.current && !providerContext.isPointerInTransitRef.current) { + context.onTriggerEnter(); + hasPointerMoveOpenedRef.current = true; + } + }), + onPointerLeave: $iVrL9$radixuiprimitive.composeEventHandlers(props.onPointerLeave, () => { + context.onTriggerLeave(); + hasPointerMoveOpenedRef.current = false; + }), + onPointerDown: $iVrL9$radixuiprimitive.composeEventHandlers(props.onPointerDown, () => { + isPointerDownRef.current = true; + document.addEventListener('pointerup', handlePointerUp, { + once: true + }); + }), + onFocus: $iVrL9$radixuiprimitive.composeEventHandlers(props.onFocus, () => { + if (!isPointerDownRef.current) context.onOpen(); + }), + onBlur: $iVrL9$radixuiprimitive.composeEventHandlers(props.onBlur, context.onClose), + onClick: $iVrL9$radixuiprimitive.composeEventHandlers(props.onClick, context.onClose) + }))); +}); +/*#__PURE__*/ +Object.assign($c34afbc43c90cc6f$export$8c610744efcf8a1d, { + displayName: $c34afbc43c90cc6f$var$TRIGGER_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * TooltipPortal + * -----------------------------------------------------------------------------------------------*/ +const $c34afbc43c90cc6f$var$PORTAL_NAME = 'TooltipPortal'; +const [$c34afbc43c90cc6f$var$PortalProvider, $c34afbc43c90cc6f$var$usePortalContext] = $c34afbc43c90cc6f$var$createTooltipContext($c34afbc43c90cc6f$var$PORTAL_NAME, { + forceMount: undefined +}); +const $c34afbc43c90cc6f$export$7b36b8f925ab7497 = props => { + const { + __scopeTooltip: __scopeTooltip, + forceMount: forceMount, + children: children, + container: container + } = props; + const context = $c34afbc43c90cc6f$var$useTooltipContext($c34afbc43c90cc6f$var$PORTAL_NAME, __scopeTooltip); + return /*#__PURE__*/$iVrL9$react.createElement($c34afbc43c90cc6f$var$PortalProvider, { + scope: __scopeTooltip, + forceMount: forceMount + }, /*#__PURE__*/$iVrL9$react.createElement($iVrL9$radixuireactpresence.Presence, { + present: forceMount || context.open + }, /*#__PURE__*/$iVrL9$react.createElement($iVrL9$radixuireactportal.Portal, { + asChild: true, + container: container + }, children))); +}; +/*#__PURE__*/ +Object.assign($c34afbc43c90cc6f$export$7b36b8f925ab7497, { + displayName: $c34afbc43c90cc6f$var$PORTAL_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * TooltipContent + * -----------------------------------------------------------------------------------------------*/ +const $c34afbc43c90cc6f$var$CONTENT_NAME = 'TooltipContent'; +const $c34afbc43c90cc6f$export$e9003e2be37ec060 = /*#__PURE__*/$iVrL9$react.forwardRef((props, forwardedRef) => { + const portalContext = $c34afbc43c90cc6f$var$usePortalContext($c34afbc43c90cc6f$var$CONTENT_NAME, props.__scopeTooltip); + const { + forceMount = portalContext.forceMount, + side = 'top', + ...contentProps + } = props; + const context = $c34afbc43c90cc6f$var$useTooltipContext($c34afbc43c90cc6f$var$CONTENT_NAME, props.__scopeTooltip); + return /*#__PURE__*/$iVrL9$react.createElement($iVrL9$radixuireactpresence.Presence, { + present: forceMount || context.open + }, context.disableHoverableContent ? /*#__PURE__*/$iVrL9$react.createElement($c34afbc43c90cc6f$var$TooltipContentImpl, $parcel$interopDefault($iVrL9$babelruntimehelpersextends)({ + side: side + }, contentProps, { + ref: forwardedRef + })) : /*#__PURE__*/$iVrL9$react.createElement($c34afbc43c90cc6f$var$TooltipContentHoverable, $parcel$interopDefault($iVrL9$babelruntimehelpersextends)({ + side: side + }, contentProps, { + ref: forwardedRef + }))); +}); +const $c34afbc43c90cc6f$var$TooltipContentHoverable = /*#__PURE__*/$iVrL9$react.forwardRef((props, forwardedRef) => { + const context = $c34afbc43c90cc6f$var$useTooltipContext($c34afbc43c90cc6f$var$CONTENT_NAME, props.__scopeTooltip); + const providerContext = $c34afbc43c90cc6f$var$useTooltipProviderContext($c34afbc43c90cc6f$var$CONTENT_NAME, props.__scopeTooltip); + const ref = $iVrL9$react.useRef(null); + const composedRefs = $iVrL9$radixuireactcomposerefs.useComposedRefs(forwardedRef, ref); + const [pointerGraceArea, setPointerGraceArea] = $iVrL9$react.useState(null); + const { + trigger: trigger, + onClose: onClose + } = context; + const content = ref.current; + const { + onPointerInTransitChange: onPointerInTransitChange + } = providerContext; + const handleRemoveGraceArea = $iVrL9$react.useCallback(() => { + setPointerGraceArea(null); + onPointerInTransitChange(false); + }, [onPointerInTransitChange]); + const handleCreateGraceArea = $iVrL9$react.useCallback((event, hoverTarget) => { + const currentTarget = event.currentTarget; + const exitPoint = { + x: event.clientX, + y: event.clientY + }; + const exitSide = $c34afbc43c90cc6f$var$getExitSideFromRect(exitPoint, currentTarget.getBoundingClientRect()); + const paddedExitPoints = $c34afbc43c90cc6f$var$getPaddedExitPoints(exitPoint, exitSide); + const hoverTargetPoints = $c34afbc43c90cc6f$var$getPointsFromRect(hoverTarget.getBoundingClientRect()); + const graceArea = $c34afbc43c90cc6f$var$getHull([...paddedExitPoints, ...hoverTargetPoints]); + setPointerGraceArea(graceArea); + onPointerInTransitChange(true); + }, [onPointerInTransitChange]); + $iVrL9$react.useEffect(() => { + return () => handleRemoveGraceArea(); + }, [handleRemoveGraceArea]); + $iVrL9$react.useEffect(() => { + if (trigger && content) { + const handleTriggerLeave = event => handleCreateGraceArea(event, content); + const handleContentLeave = event => handleCreateGraceArea(event, trigger); + trigger.addEventListener('pointerleave', handleTriggerLeave); + content.addEventListener('pointerleave', handleContentLeave); + return () => { + trigger.removeEventListener('pointerleave', handleTriggerLeave); + content.removeEventListener('pointerleave', handleContentLeave); + }; + } + }, [trigger, content, handleCreateGraceArea, handleRemoveGraceArea]); + $iVrL9$react.useEffect(() => { + if (pointerGraceArea) { + const handleTrackPointerGrace = event => { + const target = event.target; + const pointerPosition = { + x: event.clientX, + y: event.clientY + }; + const hasEnteredTarget = (trigger === null || trigger === void 0 ? void 0 : trigger.contains(target)) || (content === null || content === void 0 ? void 0 : content.contains(target)); + const isPointerOutsideGraceArea = !$c34afbc43c90cc6f$var$isPointInPolygon(pointerPosition, pointerGraceArea); + if (hasEnteredTarget) handleRemoveGraceArea();else if (isPointerOutsideGraceArea) { + handleRemoveGraceArea(); + onClose(); + } + }; + document.addEventListener('pointermove', handleTrackPointerGrace); + return () => document.removeEventListener('pointermove', handleTrackPointerGrace); + } + }, [trigger, content, pointerGraceArea, onClose, handleRemoveGraceArea]); + return /*#__PURE__*/$iVrL9$react.createElement($c34afbc43c90cc6f$var$TooltipContentImpl, $parcel$interopDefault($iVrL9$babelruntimehelpersextends)({}, props, { + ref: composedRefs + })); +}); +const [$c34afbc43c90cc6f$var$VisuallyHiddenContentContextProvider, $c34afbc43c90cc6f$var$useVisuallyHiddenContentContext] = $c34afbc43c90cc6f$var$createTooltipContext($c34afbc43c90cc6f$var$TOOLTIP_NAME, { + isInside: false +}); +const $c34afbc43c90cc6f$var$TooltipContentImpl = /*#__PURE__*/$iVrL9$react.forwardRef((props, forwardedRef) => { + const { + __scopeTooltip: __scopeTooltip, + children: children, + 'aria-label': ariaLabel, + onEscapeKeyDown: onEscapeKeyDown, + onPointerDownOutside: onPointerDownOutside, + ...contentProps + } = props; + const context = $c34afbc43c90cc6f$var$useTooltipContext($c34afbc43c90cc6f$var$CONTENT_NAME, __scopeTooltip); + const popperScope = $c34afbc43c90cc6f$var$usePopperScope(__scopeTooltip); + const { + onClose: onClose + } = context; // Close this tooltip if another one opens + $iVrL9$react.useEffect(() => { + document.addEventListener($c34afbc43c90cc6f$var$TOOLTIP_OPEN, onClose); + return () => document.removeEventListener($c34afbc43c90cc6f$var$TOOLTIP_OPEN, onClose); + }, [onClose]); // Close the tooltip if the trigger is scrolled + $iVrL9$react.useEffect(() => { + if (context.trigger) { + const handleScroll = event => { + const target = event.target; + if (target !== null && target !== void 0 && target.contains(context.trigger)) onClose(); + }; + window.addEventListener('scroll', handleScroll, { + capture: true + }); + return () => window.removeEventListener('scroll', handleScroll, { + capture: true + }); + } + }, [context.trigger, onClose]); + return /*#__PURE__*/$iVrL9$react.createElement($iVrL9$radixuireactdismissablelayer.DismissableLayer, { + asChild: true, + disableOutsidePointerEvents: false, + onEscapeKeyDown: onEscapeKeyDown, + onPointerDownOutside: onPointerDownOutside, + onFocusOutside: event => event.preventDefault(), + onDismiss: onClose + }, /*#__PURE__*/$iVrL9$react.createElement($iVrL9$radixuireactpopper.Content, $parcel$interopDefault($iVrL9$babelruntimehelpersextends)({ + "data-state": context.stateAttribute + }, popperScope, contentProps, { + ref: forwardedRef, + style: { + ...contentProps.style, + '--radix-tooltip-content-transform-origin': 'var(--radix-popper-transform-origin)', + '--radix-tooltip-content-available-width': 'var(--radix-popper-available-width)', + '--radix-tooltip-content-available-height': 'var(--radix-popper-available-height)', + '--radix-tooltip-trigger-width': 'var(--radix-popper-anchor-width)', + '--radix-tooltip-trigger-height': 'var(--radix-popper-anchor-height)' + } + }), /*#__PURE__*/$iVrL9$react.createElement($iVrL9$radixuireactslot.Slottable, null, children), /*#__PURE__*/$iVrL9$react.createElement($c34afbc43c90cc6f$var$VisuallyHiddenContentContextProvider, { + scope: __scopeTooltip, + isInside: true + }, /*#__PURE__*/$iVrL9$react.createElement($iVrL9$radixuireactvisuallyhidden.Root, { + id: context.contentId, + role: "tooltip" + }, ariaLabel || children)))); +}); +/*#__PURE__*/ +Object.assign($c34afbc43c90cc6f$export$e9003e2be37ec060, { + displayName: $c34afbc43c90cc6f$var$CONTENT_NAME +}); +/* ------------------------------------------------------------------------------------------------- + * TooltipArrow + * -----------------------------------------------------------------------------------------------*/ +const $c34afbc43c90cc6f$var$ARROW_NAME = 'TooltipArrow'; +const $c34afbc43c90cc6f$export$c27ee0ad710f7559 = /*#__PURE__*/$iVrL9$react.forwardRef((props, forwardedRef) => { + const { + __scopeTooltip: __scopeTooltip, + ...arrowProps + } = props; + const popperScope = $c34afbc43c90cc6f$var$usePopperScope(__scopeTooltip); + const visuallyHiddenContentContext = $c34afbc43c90cc6f$var$useVisuallyHiddenContentContext($c34afbc43c90cc6f$var$ARROW_NAME, __scopeTooltip); // if the arrow is inside the `VisuallyHidden`, we don't want to render it all to + // prevent issues in positioning the arrow due to the duplicate + return visuallyHiddenContentContext.isInside ? null : /*#__PURE__*/$iVrL9$react.createElement($iVrL9$radixuireactpopper.Arrow, $parcel$interopDefault($iVrL9$babelruntimehelpersextends)({}, popperScope, arrowProps, { + ref: forwardedRef + })); +}); +/*#__PURE__*/ +Object.assign($c34afbc43c90cc6f$export$c27ee0ad710f7559, { + displayName: $c34afbc43c90cc6f$var$ARROW_NAME +}); +/* -----------------------------------------------------------------------------------------------*/ +function $c34afbc43c90cc6f$var$getExitSideFromRect(point, rect) { + const top = Math.abs(rect.top - point.y); + const bottom = Math.abs(rect.bottom - point.y); + const right = Math.abs(rect.right - point.x); + const left = Math.abs(rect.left - point.x); + switch (Math.min(top, bottom, right, left)) { + case left: + return 'left'; + case right: + return 'right'; + case top: + return 'top'; + case bottom: + return 'bottom'; + default: + throw new Error('unreachable'); + } +} +function $c34afbc43c90cc6f$var$getPaddedExitPoints(exitPoint, exitSide) { + let padding = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 5; + const paddedExitPoints = []; + switch (exitSide) { + case 'top': + paddedExitPoints.push({ + x: exitPoint.x - padding, + y: exitPoint.y + padding + }, { + x: exitPoint.x + padding, + y: exitPoint.y + padding + }); + break; + case 'bottom': + paddedExitPoints.push({ + x: exitPoint.x - padding, + y: exitPoint.y - padding + }, { + x: exitPoint.x + padding, + y: exitPoint.y - padding + }); + break; + case 'left': + paddedExitPoints.push({ + x: exitPoint.x + padding, + y: exitPoint.y - padding + }, { + x: exitPoint.x + padding, + y: exitPoint.y + padding + }); + break; + case 'right': + paddedExitPoints.push({ + x: exitPoint.x - padding, + y: exitPoint.y - padding + }, { + x: exitPoint.x - padding, + y: exitPoint.y + padding + }); + break; + } + return paddedExitPoints; +} +function $c34afbc43c90cc6f$var$getPointsFromRect(rect) { + const { + top: top, + right: right, + bottom: bottom, + left: left + } = rect; + return [{ + x: left, + y: top + }, { + x: right, + y: top + }, { + x: right, + y: bottom + }, { + x: left, + y: bottom + }]; +} // Determine if a point is inside of a polygon. +// Based on https://github.com/substack/point-in-polygon +function $c34afbc43c90cc6f$var$isPointInPolygon(point, polygon) { + const { + x: x, + y: y + } = point; + let inside = false; + for (let i = 0, j = polygon.length - 1; i < polygon.length; j = i++) { + const xi = polygon[i].x; + const yi = polygon[i].y; + const xj = polygon[j].x; + const yj = polygon[j].y; // prettier-ignore + const intersect = yi > y !== yj > y && x < (xj - xi) * (y - yi) / (yj - yi) + xi; + if (intersect) inside = !inside; + } + return inside; +} // Returns a new array of points representing the convex hull of the given set of points. +// https://www.nayuki.io/page/convex-hull-algorithm +function $c34afbc43c90cc6f$var$getHull(points) { + const newPoints = points.slice(); + newPoints.sort((a, b) => { + if (a.x < b.x) return -1;else if (a.x > b.x) return 1;else if (a.y < b.y) return -1;else if (a.y > b.y) return 1;else return 0; + }); + return $c34afbc43c90cc6f$var$getHullPresorted(newPoints); +} // Returns the convex hull, assuming that each points[i] <= points[i + 1]. Runs in O(n) time. +function $c34afbc43c90cc6f$var$getHullPresorted(points) { + if (points.length <= 1) return points.slice(); + const upperHull = []; + for (let i = 0; i < points.length; i++) { + const p = points[i]; + while (upperHull.length >= 2) { + const q = upperHull[upperHull.length - 1]; + const r = upperHull[upperHull.length - 2]; + if ((q.x - r.x) * (p.y - r.y) >= (q.y - r.y) * (p.x - r.x)) upperHull.pop();else break; + } + upperHull.push(p); + } + upperHull.pop(); + const lowerHull = []; + for (let i1 = points.length - 1; i1 >= 0; i1--) { + const p = points[i1]; + while (lowerHull.length >= 2) { + const q = lowerHull[lowerHull.length - 1]; + const r = lowerHull[lowerHull.length - 2]; + if ((q.x - r.x) * (p.y - r.y) >= (q.y - r.y) * (p.x - r.x)) lowerHull.pop();else break; + } + lowerHull.push(p); + } + lowerHull.pop(); + if (upperHull.length === 1 && lowerHull.length === 1 && upperHull[0].x === lowerHull[0].x && upperHull[0].y === lowerHull[0].y) return upperHull;else return upperHull.concat(lowerHull); +} +const $c34afbc43c90cc6f$export$2881499e37b75b9a = $c34afbc43c90cc6f$export$f78649fb9ca566b8; +const $c34afbc43c90cc6f$export$be92b6f5f03c0fe9 = $c34afbc43c90cc6f$export$28c660c63b792dea; +const $c34afbc43c90cc6f$export$41fb9f06171c75f4 = $c34afbc43c90cc6f$export$8c610744efcf8a1d; +const $c34afbc43c90cc6f$export$602eac185826482c = $c34afbc43c90cc6f$export$7b36b8f925ab7497; +const $c34afbc43c90cc6f$export$7c6e2c02157bb7d2 = $c34afbc43c90cc6f$export$e9003e2be37ec060; +const $c34afbc43c90cc6f$export$21b07c8f274aebd5 = $c34afbc43c90cc6f$export$c27ee0ad710f7559; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-use-callback-ref/dist/index.js": +/*!****************************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-use-callback-ref/dist/index.js ***! + \****************************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $92muK$react = __webpack_require__(/*! react */ "react"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +$parcel$export(module.exports, "useCallbackRef", () => $28e03942f763e819$export$25bec8c6f54ee79a); + +/** + * A custom hook that converts a callback to a ref to avoid triggering re-renders when passed as a + * prop or avoid re-executing effects when passed as a dependency + */ +function $28e03942f763e819$export$25bec8c6f54ee79a(callback) { + const callbackRef = $92muK$react.useRef(callback); + $92muK$react.useEffect(() => { + callbackRef.current = callback; + }); // https://github.com/facebook/react/issues/19240 + return $92muK$react.useMemo(() => function () { + var _callbackRef$current; + for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) { + args[_key] = arguments[_key]; + } + return (_callbackRef$current = callbackRef.current) === null || _callbackRef$current === void 0 ? void 0 : _callbackRef$current.call(callbackRef, ...args); + }, []); +} + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-use-controllable-state/dist/index.js": +/*!**********************************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-use-controllable-state/dist/index.js ***! + \**********************************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $ijazI$react = __webpack_require__(/*! react */ "react"); +var $ijazI$radixuireactusecallbackref = __webpack_require__(/*! @radix-ui/react-use-callback-ref */ "../../../node_modules/@radix-ui/react-use-callback-ref/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +$parcel$export(module.exports, "useControllableState", () => $b84d42d44371bff7$export$6f32135080cb4c3); +function $b84d42d44371bff7$export$6f32135080cb4c3(_ref) { + let { + prop: prop, + defaultProp: defaultProp, + onChange = () => {} + } = _ref; + const [uncontrolledProp, setUncontrolledProp] = $b84d42d44371bff7$var$useUncontrolledState({ + defaultProp: defaultProp, + onChange: onChange + }); + const isControlled = prop !== undefined; + const value1 = isControlled ? prop : uncontrolledProp; + const handleChange = $ijazI$radixuireactusecallbackref.useCallbackRef(onChange); + const setValue = $ijazI$react.useCallback(nextValue => { + if (isControlled) { + const setter = nextValue; + const value = typeof nextValue === 'function' ? setter(prop) : nextValue; + if (value !== prop) handleChange(value); + } else setUncontrolledProp(nextValue); + }, [isControlled, prop, setUncontrolledProp, handleChange]); + return [value1, setValue]; +} +function $b84d42d44371bff7$var$useUncontrolledState(_ref2) { + let { + defaultProp: defaultProp, + onChange: onChange + } = _ref2; + const uncontrolledState = $ijazI$react.useState(defaultProp); + const [value] = uncontrolledState; + const prevValueRef = $ijazI$react.useRef(value); + const handleChange = $ijazI$radixuireactusecallbackref.useCallbackRef(onChange); + $ijazI$react.useEffect(() => { + if (prevValueRef.current !== value) { + handleChange(value); + prevValueRef.current = value; + } + }, [value, prevValueRef, handleChange]); + return uncontrolledState; +} + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-use-escape-keydown/dist/index.js": +/*!******************************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-use-escape-keydown/dist/index.js ***! + \******************************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $b0gz3$react = __webpack_require__(/*! react */ "react"); +var $b0gz3$radixuireactusecallbackref = __webpack_require__(/*! @radix-ui/react-use-callback-ref */ "../../../node_modules/@radix-ui/react-use-callback-ref/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +$parcel$export(module.exports, "useEscapeKeydown", () => $24c84e9f83c4454f$export$3a72a57244d6e765); + +/** + * Listens for when the escape key is down + */ +function $24c84e9f83c4454f$export$3a72a57244d6e765(onEscapeKeyDownProp) { + let ownerDocument = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : globalThis === null || globalThis === void 0 ? void 0 : globalThis.document; + const onEscapeKeyDown = $b0gz3$radixuireactusecallbackref.useCallbackRef(onEscapeKeyDownProp); + $b0gz3$react.useEffect(() => { + const handleKeyDown = event => { + if (event.key === 'Escape') onEscapeKeyDown(event); + }; + ownerDocument.addEventListener('keydown', handleKeyDown); + return () => ownerDocument.removeEventListener('keydown', handleKeyDown); + }, [onEscapeKeyDown, ownerDocument]); +} + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-use-layout-effect/dist/index.js": +/*!*****************************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-use-layout-effect/dist/index.js ***! + \*****************************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $caHyQ$react = __webpack_require__(/*! react */ "react"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +$parcel$export(module.exports, "useLayoutEffect", () => $ca21affb0542a8a4$export$e5c5a5f917a5871c); + +/** + * On the server, React emits a warning when calling `useLayoutEffect`. + * This is because neither `useLayoutEffect` nor `useEffect` run on the server. + * We use this safe version which suppresses the warning by replacing it with a noop on the server. + * + * See: https://reactjs.org/docs/hooks-reference.html#uselayouteffect + */ +const $ca21affb0542a8a4$export$e5c5a5f917a5871c = Boolean(globalThis === null || globalThis === void 0 ? void 0 : globalThis.document) ? $caHyQ$react.useLayoutEffect : () => {}; + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-use-size/dist/index.js": +/*!********************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-use-size/dist/index.js ***! + \********************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $ksDzM$react = __webpack_require__(/*! react */ "react"); +var $ksDzM$radixuireactuselayouteffect = __webpack_require__(/*! @radix-ui/react-use-layout-effect */ "../../../node_modules/@radix-ui/react-use-layout-effect/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +$parcel$export(module.exports, "useSize", () => $d2c1d285af17635b$export$1ab7ae714698c4b8); +function $d2c1d285af17635b$export$1ab7ae714698c4b8(element) { + const [size, setSize] = $ksDzM$react.useState(undefined); + $ksDzM$radixuireactuselayouteffect.useLayoutEffect(() => { + if (element) { + // provide size as early as possible + setSize({ + width: element.offsetWidth, + height: element.offsetHeight + }); + const resizeObserver = new ResizeObserver(entries => { + if (!Array.isArray(entries)) return; + // Since we only observe the one element, we don't need to loop over the + // array + if (!entries.length) return; + const entry = entries[0]; + let width; + let height; + if ('borderBoxSize' in entry) { + const borderSizeEntry = entry['borderBoxSize']; // iron out differences between browsers + const borderSize = Array.isArray(borderSizeEntry) ? borderSizeEntry[0] : borderSizeEntry; + width = borderSize['inlineSize']; + height = borderSize['blockSize']; + } else { + // for browsers that don't support `borderBoxSize` + // we calculate it ourselves to get the correct border box. + width = element.offsetWidth; + height = element.offsetHeight; + } + setSize({ + width: width, + height: height + }); + }); + resizeObserver.observe(element, { + box: 'border-box' + }); + return () => resizeObserver.unobserve(element); + } else + // We only want to reset to `undefined` when the element becomes `null`, + // not if it changes to another element. + setSize(undefined); + }, [element]); + return size; +} + +/***/ }), + +/***/ "../../../node_modules/@radix-ui/react-visually-hidden/dist/index.js": +/*!***************************************************************************!*\ + !*** ../../../node_modules/@radix-ui/react-visually-hidden/dist/index.js ***! + \***************************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var $awrN2$babelruntimehelpersextends = __webpack_require__(/*! @babel/runtime/helpers/extends */ "../../../node_modules/@babel/runtime/helpers/extends.js"); +var $awrN2$react = __webpack_require__(/*! react */ "react"); +var $awrN2$radixuireactprimitive = __webpack_require__(/*! @radix-ui/react-primitive */ "../../../node_modules/@radix-ui/react-primitive/dist/index.js"); +function $parcel$export(e, n, v, s) { + Object.defineProperty(e, n, { + get: v, + set: s, + enumerable: true, + configurable: true + }); +} +function $parcel$interopDefault(a) { + return a && a.__esModule ? a.default : a; +} +$parcel$export(module.exports, "VisuallyHidden", () => $685371e9c20848e2$export$439d29a4e110a164); +$parcel$export(module.exports, "Root", () => $685371e9c20848e2$export$be92b6f5f03c0fe9); + +/* ------------------------------------------------------------------------------------------------- + * VisuallyHidden + * -----------------------------------------------------------------------------------------------*/ +const $685371e9c20848e2$var$NAME = 'VisuallyHidden'; +const $685371e9c20848e2$export$439d29a4e110a164 = /*#__PURE__*/$awrN2$react.forwardRef((props, forwardedRef) => { + return /*#__PURE__*/$awrN2$react.createElement($awrN2$radixuireactprimitive.Primitive.span, $parcel$interopDefault($awrN2$babelruntimehelpersextends)({}, props, { + ref: forwardedRef, + style: { + // See: https://github.com/twbs/bootstrap/blob/master/scss/mixins/_screen-reader.scss + position: 'absolute', + border: 0, + width: 1, + height: 1, + padding: 0, + margin: -1, + overflow: 'hidden', + clip: 'rect(0, 0, 0, 0)', + whiteSpace: 'nowrap', + wordWrap: 'normal', + ...props.style + } + })); +}); +/*#__PURE__*/ +Object.assign($685371e9c20848e2$export$439d29a4e110a164, { + displayName: $685371e9c20848e2$var$NAME +}); +/* -----------------------------------------------------------------------------------------------*/ +const $685371e9c20848e2$export$be92b6f5f03c0fe9 = $685371e9c20848e2$export$439d29a4e110a164; + +/***/ }), + +/***/ "../../../node_modules/aria-hidden/dist/es2015/index.js": +/*!**************************************************************!*\ + !*** ../../../node_modules/aria-hidden/dist/es2015/index.js ***! + \**************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.suppressOthers = exports.supportsInert = exports.inertOthers = exports.hideOthers = void 0; +var getDefaultParent = function (originalTarget) { + if (typeof document === 'undefined') { + return null; + } + var sampleTarget = Array.isArray(originalTarget) ? originalTarget[0] : originalTarget; + return sampleTarget.ownerDocument.body; +}; +var counterMap = new WeakMap(); +var uncontrolledNodes = new WeakMap(); +var markerMap = {}; +var lockCount = 0; +var unwrapHost = function (node) { + return node && (node.host || unwrapHost(node.parentNode)); +}; +var correctTargets = function (parent, targets) { + return targets.map(function (target) { + if (parent.contains(target)) { + return target; + } + var correctedTarget = unwrapHost(target); + if (correctedTarget && parent.contains(correctedTarget)) { + return correctedTarget; + } + console.error('aria-hidden', target, 'in not contained inside', parent, '. Doing nothing'); + return null; + }).filter(function (x) { + return Boolean(x); + }); +}; +/** + * Marks everything except given node(or nodes) as aria-hidden + * @param {Element | Element[]} originalTarget - elements to keep on the page + * @param [parentNode] - top element, defaults to document.body + * @param {String} [markerName] - a special attribute to mark every node + * @param {String} [controlAttribute] - html Attribute to control + * @return {Undo} undo command + */ +var applyAttributeToOthers = function (originalTarget, parentNode, markerName, controlAttribute) { + var targets = correctTargets(parentNode, Array.isArray(originalTarget) ? originalTarget : [originalTarget]); + if (!markerMap[markerName]) { + markerMap[markerName] = new WeakMap(); + } + var markerCounter = markerMap[markerName]; + var hiddenNodes = []; + var elementsToKeep = new Set(); + var elementsToStop = new Set(targets); + var keep = function (el) { + if (!el || elementsToKeep.has(el)) { + return; + } + elementsToKeep.add(el); + keep(el.parentNode); + }; + targets.forEach(keep); + var deep = function (parent) { + if (!parent || elementsToStop.has(parent)) { + return; + } + Array.prototype.forEach.call(parent.children, function (node) { + if (elementsToKeep.has(node)) { + deep(node); + } else { + var attr = node.getAttribute(controlAttribute); + var alreadyHidden = attr !== null && attr !== 'false'; + var counterValue = (counterMap.get(node) || 0) + 1; + var markerValue = (markerCounter.get(node) || 0) + 1; + counterMap.set(node, counterValue); + markerCounter.set(node, markerValue); + hiddenNodes.push(node); + if (counterValue === 1 && alreadyHidden) { + uncontrolledNodes.set(node, true); + } + if (markerValue === 1) { + node.setAttribute(markerName, 'true'); + } + if (!alreadyHidden) { + node.setAttribute(controlAttribute, 'true'); + } + } + }); + }; + deep(parentNode); + elementsToKeep.clear(); + lockCount++; + return function () { + hiddenNodes.forEach(function (node) { + var counterValue = counterMap.get(node) - 1; + var markerValue = markerCounter.get(node) - 1; + counterMap.set(node, counterValue); + markerCounter.set(node, markerValue); + if (!counterValue) { + if (!uncontrolledNodes.has(node)) { + node.removeAttribute(controlAttribute); + } + uncontrolledNodes.delete(node); + } + if (!markerValue) { + node.removeAttribute(markerName); + } + }); + lockCount--; + if (!lockCount) { + // clear + counterMap = new WeakMap(); + counterMap = new WeakMap(); + uncontrolledNodes = new WeakMap(); + markerMap = {}; + } + }; +}; +/** + * Marks everything except given node(or nodes) as aria-hidden + * @param {Element | Element[]} originalTarget - elements to keep on the page + * @param [parentNode] - top element, defaults to document.body + * @param {String} [markerName] - a special attribute to mark every node + * @return {Undo} undo command + */ +var hideOthers = function (originalTarget, parentNode, markerName) { + if (markerName === void 0) { + markerName = 'data-aria-hidden'; + } + var targets = Array.from(Array.isArray(originalTarget) ? originalTarget : [originalTarget]); + var activeParentNode = parentNode || getDefaultParent(originalTarget); + if (!activeParentNode) { + return function () { + return null; + }; + } + // we should not hide ariaLive elements - https://github.com/theKashey/aria-hidden/issues/10 + targets.push.apply(targets, Array.from(activeParentNode.querySelectorAll('[aria-live]'))); + return applyAttributeToOthers(targets, activeParentNode, markerName, 'aria-hidden'); +}; +/** + * Marks everything except given node(or nodes) as inert + * @param {Element | Element[]} originalTarget - elements to keep on the page + * @param [parentNode] - top element, defaults to document.body + * @param {String} [markerName] - a special attribute to mark every node + * @return {Undo} undo command + */ +exports.hideOthers = hideOthers; +var inertOthers = function (originalTarget, parentNode, markerName) { + if (markerName === void 0) { + markerName = 'data-inert-ed'; + } + var activeParentNode = parentNode || getDefaultParent(originalTarget); + if (!activeParentNode) { + return function () { + return null; + }; + } + return applyAttributeToOthers(originalTarget, activeParentNode, markerName, 'inert'); +}; +/** + * @returns if current browser supports inert + */ +exports.inertOthers = inertOthers; +var supportsInert = function () { + return typeof HTMLElement !== 'undefined' && HTMLElement.prototype.hasOwnProperty('inert'); +}; +/** + * Automatic function to "suppress" DOM elements - _hide_ or _inert_ in the best possible way + * @param {Element | Element[]} originalTarget - elements to keep on the page + * @param [parentNode] - top element, defaults to document.body + * @param {String} [markerName] - a special attribute to mark every node + * @return {Undo} undo command + */ +exports.supportsInert = supportsInert; +var suppressOthers = function (originalTarget, parentNode, markerName) { + if (markerName === void 0) { + markerName = 'data-suppressed'; + } + return (supportsInert() ? inertOthers : hideOthers)(originalTarget, parentNode, markerName); +}; +exports.suppressOthers = suppressOthers; + +/***/ }), + +/***/ "../../../node_modules/clsx/dist/clsx.m.js": +/*!*************************************************!*\ + !*** ../../../node_modules/clsx/dist/clsx.m.js ***! + \*************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.clsx = clsx; +exports["default"] = void 0; +function r(e) { + var t, + f, + n = ""; + if ("string" == typeof e || "number" == typeof e) n += e;else if ("object" == typeof e) if (Array.isArray(e)) for (t = 0; t < e.length; t++) e[t] && (f = r(e[t])) && (n && (n += " "), n += f);else for (t in e) e[t] && (n && (n += " "), n += t); + return n; +} +function clsx() { + for (var e, t, f = 0, n = ""; f < arguments.length;) (e = arguments[f++]) && (t = r(e)) && (n && (n += " "), n += t); + return n; +} +var _default = clsx; +exports["default"] = _default; + +/***/ }), + +/***/ "../../../node_modules/copy-to-clipboard/index.js": +/*!********************************************************!*\ + !*** ../../../node_modules/copy-to-clipboard/index.js ***! + \********************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + + +var deselectCurrent = __webpack_require__(/*! toggle-selection */ "../../../node_modules/toggle-selection/index.js"); +var clipboardToIE11Formatting = { + "text/plain": "Text", + "text/html": "Url", + "default": "Text" +}; +var defaultMessage = "Copy to clipboard: #{key}, Enter"; +function format(message) { + var copyKey = (/mac os x/i.test(navigator.userAgent) ? "⌘" : "Ctrl") + "+C"; + return message.replace(/#{\s*key\s*}/g, copyKey); +} +function copy(text, options) { + var debug, + message, + reselectPrevious, + range, + selection, + mark, + success = false; + if (!options) { + options = {}; + } + debug = options.debug || false; + try { + reselectPrevious = deselectCurrent(); + range = document.createRange(); + selection = document.getSelection(); + mark = document.createElement("span"); + mark.textContent = text; + // avoid screen readers from reading out loud the text + mark.ariaHidden = "true"; + // reset user styles for span element + mark.style.all = "unset"; + // prevents scrolling to the end of the page + mark.style.position = "fixed"; + mark.style.top = 0; + mark.style.clip = "rect(0, 0, 0, 0)"; + // used to preserve spaces and line breaks + mark.style.whiteSpace = "pre"; + // do not inherit user-select (it may be `none`) + mark.style.webkitUserSelect = "text"; + mark.style.MozUserSelect = "text"; + mark.style.msUserSelect = "text"; + mark.style.userSelect = "text"; + mark.addEventListener("copy", function (e) { + e.stopPropagation(); + if (options.format) { + e.preventDefault(); + if (typeof e.clipboardData === "undefined") { + // IE 11 + debug && console.warn("unable to use e.clipboardData"); + debug && console.warn("trying IE specific stuff"); + window.clipboardData.clearData(); + var format = clipboardToIE11Formatting[options.format] || clipboardToIE11Formatting["default"]; + window.clipboardData.setData(format, text); + } else { + // all other browsers + e.clipboardData.clearData(); + e.clipboardData.setData(options.format, text); + } + } + if (options.onCopy) { + e.preventDefault(); + options.onCopy(e.clipboardData); + } + }); + document.body.appendChild(mark); + range.selectNodeContents(mark); + selection.addRange(range); + var successful = document.execCommand("copy"); + if (!successful) { + throw new Error("copy command was unsuccessful"); + } + success = true; + } catch (err) { + debug && console.error("unable to copy using execCommand: ", err); + debug && console.warn("trying IE specific stuff"); + try { + window.clipboardData.setData(options.format || "text", text); + options.onCopy && options.onCopy(window.clipboardData); + success = true; + } catch (err) { + debug && console.error("unable to copy using clipboardData: ", err); + debug && console.error("falling back to prompt"); + message = format("message" in options ? options.message : defaultMessage); + window.prompt(message, text); + } + } finally { + if (selection) { + if (typeof selection.removeRange == "function") { + selection.removeRange(range); + } else { + selection.removeAllRanges(); + } + } + if (mark) { + document.body.removeChild(mark); + } + reselectPrevious(); + } + return success; +} +module.exports = copy; + +/***/ }), + +/***/ "../../../node_modules/detect-node-es/esm/browser.js": +/*!***********************************************************!*\ + !*** ../../../node_modules/detect-node-es/esm/browser.js ***! + \***********************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.isNode = void 0; +const isNode = false; +exports.isNode = isNode; + +/***/ }), + +/***/ "../../../node_modules/framer-motion/dist/cjs/index.js": +/*!*************************************************************!*\ + !*** ../../../node_modules/framer-motion/dist/cjs/index.js ***! + \*************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +var tslib = __webpack_require__(/*! tslib */ "../../../node_modules/tslib/tslib.es6.js"); +var React = __webpack_require__(/*! react */ "react"); +var heyListen = __webpack_require__(/*! hey-listen */ "../../../node_modules/hey-listen/dist/hey-listen.es.js"); +var styleValueTypes = __webpack_require__(/*! style-value-types */ "../../../node_modules/style-value-types/dist/valueTypes.cjs.js"); +var popmotion = __webpack_require__(/*! popmotion */ "../../../node_modules/popmotion/dist/popmotion.cjs.js"); +var sync = __webpack_require__(/*! framesync */ "../../../node_modules/framesync/dist/framesync.cjs.js"); +var dom = __webpack_require__(/*! @motionone/dom */ "../../../node_modules/@motionone/dom/dist/index.es.js"); +function _interopDefaultLegacy(e) { + return e && typeof e === 'object' && 'default' in e ? e : { + 'default': e + }; +} +function _interopNamespace(e) { + if (e && e.__esModule) return e; + var n = Object.create(null); + if (e) { + Object.keys(e).forEach(function (k) { + if (k !== 'default') { + var d = Object.getOwnPropertyDescriptor(e, k); + Object.defineProperty(n, k, d.get ? d : { + enumerable: true, + get: function () { + return e[k]; + } + }); + } + }); + } + n["default"] = e; + return Object.freeze(n); +} +var React__namespace = /*#__PURE__*/_interopNamespace(React); +var React__default = /*#__PURE__*/_interopDefaultLegacy(React); +var sync__default = /*#__PURE__*/_interopDefaultLegacy(sync); + +/** + * Browser-safe usage of process + */ +var defaultEnvironment = "production"; +var env = typeof process === "undefined" || process.env === undefined ? defaultEnvironment : "development" || 0; +var createDefinition = function (propNames) { + return { + isEnabled: function (props) { + return propNames.some(function (name) { + return !!props[name]; + }); + } + }; +}; +var featureDefinitions = { + measureLayout: createDefinition(["layout", "layoutId", "drag"]), + animation: createDefinition(["animate", "exit", "variants", "whileHover", "whileTap", "whileFocus", "whileDrag", "whileInView"]), + exit: createDefinition(["exit"]), + drag: createDefinition(["drag", "dragControls"]), + focus: createDefinition(["whileFocus"]), + hover: createDefinition(["whileHover", "onHoverStart", "onHoverEnd"]), + tap: createDefinition(["whileTap", "onTap", "onTapStart", "onTapCancel"]), + pan: createDefinition(["onPan", "onPanStart", "onPanSessionStart", "onPanEnd"]), + inView: createDefinition(["whileInView", "onViewportEnter", "onViewportLeave"]) +}; +function loadFeatures(features) { + for (var key in features) { + if (features[key] === null) continue; + if (key === "projectionNodeConstructor") { + featureDefinitions.projectionNodeConstructor = features[key]; + } else { + featureDefinitions[key].Component = features[key]; + } + } +} +var LazyContext = React.createContext({ + strict: false +}); +var featureNames = Object.keys(featureDefinitions); +var numFeatures = featureNames.length; +/** + * Load features via renderless components based on the provided MotionProps. + */ +function useFeatures(props, visualElement, preloadedFeatures) { + var features = []; + var lazyContext = React.useContext(LazyContext); + if (!visualElement) return null; + /** + * If we're in development mode, check to make sure we're not rendering a motion component + * as a child of LazyMotion, as this will break the file-size benefits of using it. + */ + if (env !== "production" && preloadedFeatures && lazyContext.strict) { + heyListen.invariant(false, "You have rendered a `motion` component within a `LazyMotion` component. This will break tree shaking. Import and render a `m` component instead."); + } + for (var i = 0; i < numFeatures; i++) { + var name_1 = featureNames[i]; + var _a = featureDefinitions[name_1], + isEnabled = _a.isEnabled, + Component = _a.Component; + /** + * It might be possible in the future to use this moment to + * dynamically request functionality. In initial tests this + * was producing a lot of duplication amongst bundles. + */ + if (isEnabled(props) && Component) { + features.push(React__namespace.createElement(Component, tslib.__assign({ + key: name_1 + }, props, { + visualElement: visualElement + }))); + } + } + return features; +} + +/** + * @public + */ +var MotionConfigContext = React.createContext({ + transformPagePoint: function (p) { + return p; + }, + isStatic: false, + reducedMotion: "never" +}); +var MotionContext = React.createContext({}); +function useVisualElementContext() { + return React.useContext(MotionContext).visualElement; +} + +/** + * @public + */ +var PresenceContext = React.createContext(null); +var isBrowser = typeof document !== "undefined"; +var useIsomorphicLayoutEffect = isBrowser ? React.useLayoutEffect : React.useEffect; + +// Does this device prefer reduced motion? Returns `null` server-side. +var prefersReducedMotion = { + current: null +}; +var hasDetected = false; +function initPrefersReducedMotion() { + hasDetected = true; + if (!isBrowser) return; + if (window.matchMedia) { + var motionMediaQuery_1 = window.matchMedia("(prefers-reduced-motion)"); + var setReducedMotionPreferences = function () { + return prefersReducedMotion.current = motionMediaQuery_1.matches; + }; + motionMediaQuery_1.addListener(setReducedMotionPreferences); + setReducedMotionPreferences(); + } else { + prefersReducedMotion.current = false; + } +} +/** + * A hook that returns `true` if we should be using reduced motion based on the current device's Reduced Motion setting. + * + * This can be used to implement changes to your UI based on Reduced Motion. For instance, replacing motion-sickness inducing + * `x`/`y` animations with `opacity`, disabling the autoplay of background videos, or turning off parallax motion. + * + * It will actively respond to changes and re-render your components with the latest setting. + * + * ```jsx + * export function Sidebar({ isOpen }) { + * const shouldReduceMotion = useReducedMotion() + * const closedX = shouldReduceMotion ? 0 : "-100%" + * + * return ( + * + * ) + * } + * ``` + * + * @return boolean + * + * @public + */ +function useReducedMotion() { + /** + * Lazy initialisation of prefersReducedMotion + */ + !hasDetected && initPrefersReducedMotion(); + var _a = tslib.__read(React.useState(prefersReducedMotion.current), 1), + shouldReduceMotion = _a[0]; + /** + * TODO See if people miss automatically updating shouldReduceMotion setting + */ + return shouldReduceMotion; +} +function useReducedMotionConfig() { + var reducedMotionPreference = useReducedMotion(); + var reducedMotion = React.useContext(MotionConfigContext).reducedMotion; + if (reducedMotion === "never") { + return false; + } else if (reducedMotion === "always") { + return true; + } else { + return reducedMotionPreference; + } +} +function useVisualElement(Component, visualState, props, createVisualElement) { + var lazyContext = React.useContext(LazyContext); + var parent = useVisualElementContext(); + var presenceContext = React.useContext(PresenceContext); + var shouldReduceMotion = useReducedMotionConfig(); + var visualElementRef = React.useRef(undefined); + /** + * If we haven't preloaded a renderer, check to see if we have one lazy-loaded + */ + if (!createVisualElement) createVisualElement = lazyContext.renderer; + if (!visualElementRef.current && createVisualElement) { + visualElementRef.current = createVisualElement(Component, { + visualState: visualState, + parent: parent, + props: props, + presenceId: presenceContext === null || presenceContext === void 0 ? void 0 : presenceContext.id, + blockInitialAnimation: (presenceContext === null || presenceContext === void 0 ? void 0 : presenceContext.initial) === false, + shouldReduceMotion: shouldReduceMotion + }); + } + var visualElement = visualElementRef.current; + useIsomorphicLayoutEffect(function () { + visualElement === null || visualElement === void 0 ? void 0 : visualElement.syncRender(); + }); + React.useEffect(function () { + var _a; + (_a = visualElement === null || visualElement === void 0 ? void 0 : visualElement.animationState) === null || _a === void 0 ? void 0 : _a.animateChanges(); + }); + useIsomorphicLayoutEffect(function () { + return function () { + return visualElement === null || visualElement === void 0 ? void 0 : visualElement.notifyUnmount(); + }; + }, []); + return visualElement; +} +function isRefObject(ref) { + return typeof ref === "object" && Object.prototype.hasOwnProperty.call(ref, "current"); +} + +/** + * Creates a ref function that, when called, hydrates the provided + * external ref and VisualElement. + */ +function useMotionRef(visualState, visualElement, externalRef) { + return React.useCallback(function (instance) { + var _a; + instance && ((_a = visualState.mount) === null || _a === void 0 ? void 0 : _a.call(visualState, instance)); + if (visualElement) { + instance ? visualElement.mount(instance) : visualElement.unmount(); + } + if (externalRef) { + if (typeof externalRef === "function") { + externalRef(instance); + } else if (isRefObject(externalRef)) { + externalRef.current = instance; + } + } + }, + /** + * Only pass a new ref callback to React if we've received a visual element + * factory. Otherwise we'll be mounting/remounting every time externalRef + * or other dependencies change. + */ + [visualElement]); +} + +/** + * Decides if the supplied variable is an array of variant labels + */ +function isVariantLabels(v) { + return Array.isArray(v); +} +/** + * Decides if the supplied variable is variant label + */ +function isVariantLabel(v) { + return typeof v === "string" || isVariantLabels(v); +} +/** + * Creates an object containing the latest state of every MotionValue on a VisualElement + */ +function getCurrent(visualElement) { + var current = {}; + visualElement.forEachValue(function (value, key) { + return current[key] = value.get(); + }); + return current; +} +/** + * Creates an object containing the latest velocity of every MotionValue on a VisualElement + */ +function getVelocity$1(visualElement) { + var velocity = {}; + visualElement.forEachValue(function (value, key) { + return velocity[key] = value.getVelocity(); + }); + return velocity; +} +function resolveVariantFromProps(props, definition, custom, currentValues, currentVelocity) { + var _a; + if (currentValues === void 0) { + currentValues = {}; + } + if (currentVelocity === void 0) { + currentVelocity = {}; + } + /** + * If the variant definition is a function, resolve. + */ + if (typeof definition === "function") { + definition = definition(custom !== null && custom !== void 0 ? custom : props.custom, currentValues, currentVelocity); + } + /** + * If the variant definition is a variant label, or + * the function returned a variant label, resolve. + */ + if (typeof definition === "string") { + definition = (_a = props.variants) === null || _a === void 0 ? void 0 : _a[definition]; + } + /** + * At this point we've resolved both functions and variant labels, + * but the resolved variant label might itself have been a function. + * If so, resolve. This can only have returned a valid target object. + */ + if (typeof definition === "function") { + definition = definition(custom !== null && custom !== void 0 ? custom : props.custom, currentValues, currentVelocity); + } + return definition; +} +function resolveVariant(visualElement, definition, custom) { + var props = visualElement.getProps(); + return resolveVariantFromProps(props, definition, custom !== null && custom !== void 0 ? custom : props.custom, getCurrent(visualElement), getVelocity$1(visualElement)); +} +function checkIfControllingVariants(props) { + var _a; + return typeof ((_a = props.animate) === null || _a === void 0 ? void 0 : _a.start) === "function" || isVariantLabel(props.initial) || isVariantLabel(props.animate) || isVariantLabel(props.whileHover) || isVariantLabel(props.whileDrag) || isVariantLabel(props.whileTap) || isVariantLabel(props.whileFocus) || isVariantLabel(props.exit); +} +function checkIfVariantNode(props) { + return Boolean(checkIfControllingVariants(props) || props.variants); +} +function getCurrentTreeVariants(props, context) { + if (checkIfControllingVariants(props)) { + var initial = props.initial, + animate = props.animate; + return { + initial: initial === false || isVariantLabel(initial) ? initial : undefined, + animate: isVariantLabel(animate) ? animate : undefined + }; + } + return props.inherit !== false ? context : {}; +} +function useCreateMotionContext(props) { + var _a = getCurrentTreeVariants(props, React.useContext(MotionContext)), + initial = _a.initial, + animate = _a.animate; + return React.useMemo(function () { + return { + initial: initial, + animate: animate + }; + }, [variantLabelsAsDependency(initial), variantLabelsAsDependency(animate)]); +} +function variantLabelsAsDependency(prop) { + return Array.isArray(prop) ? prop.join(" ") : prop; +} + +/** + * Creates a constant value over the lifecycle of a component. + * + * Even if `useMemo` is provided an empty array as its final argument, it doesn't offer + * a guarantee that it won't re-run for performance reasons later on. By using `useConstant` + * you can ensure that initialisers don't execute twice or more. + */ +function useConstant(init) { + var ref = React.useRef(null); + if (ref.current === null) { + ref.current = init(); + } + return ref.current; +} + +/** + * This should only ever be modified on the client otherwise it'll + * persist through server requests. If we need instanced states we + * could lazy-init via root. + */ +var globalProjectionState = { + /** + * Global flag as to whether the tree has animated since the last time + * we resized the window + */ + hasAnimatedSinceResize: true, + /** + * We set this to true once, on the first update. Any nodes added to the tree beyond that + * update will be given a `data-projection-id` attribute. + */ + hasEverUpdated: false +}; +var id$1 = 1; +function useProjectionId() { + return useConstant(function () { + if (globalProjectionState.hasEverUpdated) { + return id$1++; + } + }); +} +var LayoutGroupContext = React.createContext({}); + +/** + * Internal, exported only for usage in Framer + */ +var SwitchLayoutGroupContext = React.createContext({}); +function useProjection(projectionId, _a, visualElement, ProjectionNodeConstructor) { + var _b; + var layoutId = _a.layoutId, + layout = _a.layout, + drag = _a.drag, + dragConstraints = _a.dragConstraints, + layoutScroll = _a.layoutScroll; + var initialPromotionConfig = React.useContext(SwitchLayoutGroupContext); + if (!ProjectionNodeConstructor || !visualElement || (visualElement === null || visualElement === void 0 ? void 0 : visualElement.projection)) { + return; + } + visualElement.projection = new ProjectionNodeConstructor(projectionId, visualElement.getLatestValues(), (_b = visualElement.parent) === null || _b === void 0 ? void 0 : _b.projection); + visualElement.projection.setOptions({ + layoutId: layoutId, + layout: layout, + alwaysMeasureLayout: Boolean(drag) || dragConstraints && isRefObject(dragConstraints), + visualElement: visualElement, + scheduleRender: function () { + return visualElement.scheduleRender(); + }, + /** + * TODO: Update options in an effect. This could be tricky as it'll be too late + * to update by the time layout animations run. + * We also need to fix this safeToRemove by linking it up to the one returned by usePresence, + * ensuring it gets called if there's no potential layout animations. + * + */ + animationType: typeof layout === "string" ? layout : "both", + initialPromotionConfig: initialPromotionConfig, + layoutScroll: layoutScroll + }); +} +var VisualElementHandler = /** @class */function (_super) { + tslib.__extends(VisualElementHandler, _super); + function VisualElementHandler() { + return _super !== null && _super.apply(this, arguments) || this; + } + /** + * Update visual element props as soon as we know this update is going to be commited. + */ + VisualElementHandler.prototype.getSnapshotBeforeUpdate = function () { + this.updateProps(); + return null; + }; + VisualElementHandler.prototype.componentDidUpdate = function () {}; + VisualElementHandler.prototype.updateProps = function () { + var _a = this.props, + visualElement = _a.visualElement, + props = _a.props; + if (visualElement) visualElement.setProps(props); + }; + VisualElementHandler.prototype.render = function () { + return this.props.children; + }; + return VisualElementHandler; +}(React__default["default"].Component); + +/** + * Create a `motion` component. + * + * This function accepts a Component argument, which can be either a string (ie "div" + * for `motion.div`), or an actual React component. + * + * Alongside this is a config option which provides a way of rendering the provided + * component "offline", or outside the React render cycle. + */ +function createMotionComponent(_a) { + var preloadedFeatures = _a.preloadedFeatures, + createVisualElement = _a.createVisualElement, + projectionNodeConstructor = _a.projectionNodeConstructor, + useRender = _a.useRender, + useVisualState = _a.useVisualState, + Component = _a.Component; + preloadedFeatures && loadFeatures(preloadedFeatures); + function MotionComponent(props, externalRef) { + var layoutId = useLayoutId(props); + props = tslib.__assign(tslib.__assign({}, props), { + layoutId: layoutId + }); + /** + * If we're rendering in a static environment, we only visually update the component + * as a result of a React-rerender rather than interactions or animations. This + * means we don't need to load additional memory structures like VisualElement, + * or any gesture/animation features. + */ + var config = React.useContext(MotionConfigContext); + var features = null; + var context = useCreateMotionContext(props); + /** + * Create a unique projection ID for this component. If a new component is added + * during a layout animation we'll use this to query the DOM and hydrate its ref early, allowing + * us to measure it as soon as any layout effect flushes pending layout animations. + * + * Performance note: It'd be better not to have to search the DOM for these elements. + * For newly-entering components it could be enough to only correct treeScale, in which + * case we could mount in a scale-correction mode. This wouldn't be enough for + * shared element transitions however. Perhaps for those we could revert to a root node + * that gets forceRendered and layout animations are triggered on its layout effect. + */ + var projectionId = config.isStatic ? undefined : useProjectionId(); + /** + * + */ + var visualState = useVisualState(props, config.isStatic); + if (!config.isStatic && isBrowser) { + /** + * Create a VisualElement for this component. A VisualElement provides a common + * interface to renderer-specific APIs (ie DOM/Three.js etc) as well as + * providing a way of rendering to these APIs outside of the React render loop + * for more performant animations and interactions + */ + context.visualElement = useVisualElement(Component, visualState, tslib.__assign(tslib.__assign({}, config), props), createVisualElement); + useProjection(projectionId, props, context.visualElement, projectionNodeConstructor || featureDefinitions.projectionNodeConstructor); + /** + * Load Motion gesture and animation features. These are rendered as renderless + * components so each feature can optionally make use of React lifecycle methods. + */ + features = useFeatures(props, context.visualElement, preloadedFeatures); + } + /** + * The mount order and hierarchy is specific to ensure our element ref + * is hydrated by the time features fire their effects. + */ + return React__namespace.createElement(VisualElementHandler, { + visualElement: context.visualElement, + props: tslib.__assign(tslib.__assign({}, config), props) + }, features, React__namespace.createElement(MotionContext.Provider, { + value: context + }, useRender(Component, props, projectionId, useMotionRef(visualState, context.visualElement, externalRef), visualState, config.isStatic, context.visualElement))); + } + return React.forwardRef(MotionComponent); +} +function useLayoutId(_a) { + var _b; + var layoutId = _a.layoutId; + var layoutGroupId = (_b = React.useContext(LayoutGroupContext)) === null || _b === void 0 ? void 0 : _b.id; + return layoutGroupId && layoutId !== undefined ? layoutGroupId + "-" + layoutId : layoutId; +} + +/** + * Convert any React component into a `motion` component. The provided component + * **must** use `React.forwardRef` to the underlying DOM component you want to animate. + * + * ```jsx + * const Component = React.forwardRef((props, ref) => { + * return
+ * }) + * + * const MotionComponent = motion(Component) + * ``` + * + * @public + */ +function createMotionProxy(createConfig) { + function custom(Component, customMotionComponentConfig) { + if (customMotionComponentConfig === void 0) { + customMotionComponentConfig = {}; + } + return createMotionComponent(createConfig(Component, customMotionComponentConfig)); + } + if (typeof Proxy === "undefined") { + return custom; + } + /** + * A cache of generated `motion` components, e.g `motion.div`, `motion.input` etc. + * Rather than generating them anew every render. + */ + var componentCache = new Map(); + return new Proxy(custom, { + /** + * Called when `motion` is referenced with a prop: `motion.div`, `motion.input` etc. + * The prop name is passed through as `key` and we can use that to generate a `motion` + * DOM component with that name. + */ + get: function (_target, key) { + /** + * If this element doesn't exist in the component cache, create it and cache. + */ + if (!componentCache.has(key)) { + componentCache.set(key, custom(key)); + } + return componentCache.get(key); + } + }); +} + +/** + * We keep these listed seperately as we use the lowercase tag names as part + * of the runtime bundle to detect SVG components + */ +var lowercaseSVGElements = ["animate", "circle", "defs", "desc", "ellipse", "g", "image", "line", "filter", "marker", "mask", "metadata", "path", "pattern", "polygon", "polyline", "rect", "stop", "svg", "switch", "symbol", "text", "tspan", "use", "view"]; +function isSVGComponent(Component) { + if ( + /** + * If it's not a string, it's a custom React component. Currently we only support + * HTML custom React components. + */ + typeof Component !== "string" || + /** + * If it contains a dash, the element is a custom HTML webcomponent. + */ + Component.includes("-")) { + return false; + } else if ( + /** + * If it's in our list of lowercase SVG tags, it's an SVG component + */ + lowercaseSVGElements.indexOf(Component) > -1 || + /** + * If it contains a capital letter, it's an SVG component + */ + /[A-Z]/.test(Component)) { + return true; + } + return false; +} +var scaleCorrectors = {}; +function addScaleCorrector(correctors) { + Object.assign(scaleCorrectors, correctors); +} + +/** + * A list of all transformable axes. We'll use this list to generated a version + * of each axes for each transform. + */ +var transformAxes = ["", "X", "Y", "Z"]; +/** + * An ordered array of each transformable value. By default, transform values + * will be sorted to this order. + */ +var order = ["translate", "scale", "rotate", "skew"]; +/** + * Generate a list of every possible transform key. + */ +var transformProps = ["transformPerspective", "x", "y", "z"]; +order.forEach(function (operationKey) { + return transformAxes.forEach(function (axesKey) { + return transformProps.push(operationKey + axesKey); + }); +}); +/** + * A function to use with Array.sort to sort transform keys by their default order. + */ +function sortTransformProps(a, b) { + return transformProps.indexOf(a) - transformProps.indexOf(b); +} +/** + * A quick lookup for transform props. + */ +var transformPropSet = new Set(transformProps); +function isTransformProp(key) { + return transformPropSet.has(key); +} +/** + * A quick lookup for transform origin props + */ +var transformOriginProps = new Set(["originX", "originY", "originZ"]); +function isTransformOriginProp(key) { + return transformOriginProps.has(key); +} +function isForcedMotionValue(key, _a) { + var layout = _a.layout, + layoutId = _a.layoutId; + return isTransformProp(key) || isTransformOriginProp(key) || (layout || layoutId !== undefined) && (!!scaleCorrectors[key] || key === "opacity"); +} +var isMotionValue = function (value) { + return Boolean(value !== null && typeof value === "object" && value.getVelocity); +}; +var translateAlias = { + x: "translateX", + y: "translateY", + z: "translateZ", + transformPerspective: "perspective" +}; +/** + * Build a CSS transform style from individual x/y/scale etc properties. + * + * This outputs with a default order of transforms/scales/rotations, this can be customised by + * providing a transformTemplate function. + */ +function buildTransform(_a, _b, transformIsDefault, transformTemplate) { + var transform = _a.transform, + transformKeys = _a.transformKeys; + var _c = _b.enableHardwareAcceleration, + enableHardwareAcceleration = _c === void 0 ? true : _c, + _d = _b.allowTransformNone, + allowTransformNone = _d === void 0 ? true : _d; + // The transform string we're going to build into. + var transformString = ""; + // Transform keys into their default order - this will determine the output order. + transformKeys.sort(sortTransformProps); + // Track whether the defined transform has a defined z so we don't add a + // second to enable hardware acceleration + var transformHasZ = false; + // Loop over each transform and build them into transformString + var numTransformKeys = transformKeys.length; + for (var i = 0; i < numTransformKeys; i++) { + var key = transformKeys[i]; + transformString += "".concat(translateAlias[key] || key, "(").concat(transform[key], ") "); + if (key === "z") transformHasZ = true; + } + if (!transformHasZ && enableHardwareAcceleration) { + transformString += "translateZ(0)"; + } else { + transformString = transformString.trim(); + } + // If we have a custom `transform` template, pass our transform values and + // generated transformString to that before returning + if (transformTemplate) { + transformString = transformTemplate(transform, transformIsDefault ? "" : transformString); + } else if (allowTransformNone && transformIsDefault) { + transformString = "none"; + } + return transformString; +} +/** + * Build a transformOrigin style. Uses the same defaults as the browser for + * undefined origins. + */ +function buildTransformOrigin(_a) { + var _b = _a.originX, + originX = _b === void 0 ? "50%" : _b, + _c = _a.originY, + originY = _c === void 0 ? "50%" : _c, + _d = _a.originZ, + originZ = _d === void 0 ? 0 : _d; + return "".concat(originX, " ").concat(originY, " ").concat(originZ); +} + +/** + * Returns true if the provided key is a CSS variable + */ +function isCSSVariable$1(key) { + return key.startsWith("--"); +} + +/** + * Provided a value and a ValueType, returns the value as that value type. + */ +var getValueAsType = function (value, type) { + return type && typeof value === "number" ? type.transform(value) : value; +}; +var int = tslib.__assign(tslib.__assign({}, styleValueTypes.number), { + transform: Math.round +}); +var numberValueTypes = { + // Border props + borderWidth: styleValueTypes.px, + borderTopWidth: styleValueTypes.px, + borderRightWidth: styleValueTypes.px, + borderBottomWidth: styleValueTypes.px, + borderLeftWidth: styleValueTypes.px, + borderRadius: styleValueTypes.px, + radius: styleValueTypes.px, + borderTopLeftRadius: styleValueTypes.px, + borderTopRightRadius: styleValueTypes.px, + borderBottomRightRadius: styleValueTypes.px, + borderBottomLeftRadius: styleValueTypes.px, + // Positioning props + width: styleValueTypes.px, + maxWidth: styleValueTypes.px, + height: styleValueTypes.px, + maxHeight: styleValueTypes.px, + size: styleValueTypes.px, + top: styleValueTypes.px, + right: styleValueTypes.px, + bottom: styleValueTypes.px, + left: styleValueTypes.px, + // Spacing props + padding: styleValueTypes.px, + paddingTop: styleValueTypes.px, + paddingRight: styleValueTypes.px, + paddingBottom: styleValueTypes.px, + paddingLeft: styleValueTypes.px, + margin: styleValueTypes.px, + marginTop: styleValueTypes.px, + marginRight: styleValueTypes.px, + marginBottom: styleValueTypes.px, + marginLeft: styleValueTypes.px, + // Transform props + rotate: styleValueTypes.degrees, + rotateX: styleValueTypes.degrees, + rotateY: styleValueTypes.degrees, + rotateZ: styleValueTypes.degrees, + scale: styleValueTypes.scale, + scaleX: styleValueTypes.scale, + scaleY: styleValueTypes.scale, + scaleZ: styleValueTypes.scale, + skew: styleValueTypes.degrees, + skewX: styleValueTypes.degrees, + skewY: styleValueTypes.degrees, + distance: styleValueTypes.px, + translateX: styleValueTypes.px, + translateY: styleValueTypes.px, + translateZ: styleValueTypes.px, + x: styleValueTypes.px, + y: styleValueTypes.px, + z: styleValueTypes.px, + perspective: styleValueTypes.px, + transformPerspective: styleValueTypes.px, + opacity: styleValueTypes.alpha, + originX: styleValueTypes.progressPercentage, + originY: styleValueTypes.progressPercentage, + originZ: styleValueTypes.px, + // Misc + zIndex: int, + // SVG + fillOpacity: styleValueTypes.alpha, + strokeOpacity: styleValueTypes.alpha, + numOctaves: int +}; +function buildHTMLStyles(state, latestValues, options, transformTemplate) { + var _a; + var style = state.style, + vars = state.vars, + transform = state.transform, + transformKeys = state.transformKeys, + transformOrigin = state.transformOrigin; + // Empty the transformKeys array. As we're throwing out refs to its items + // this might not be as cheap as suspected. Maybe using the array as a buffer + // with a manual incrementation would be better. + transformKeys.length = 0; + // Track whether we encounter any transform or transformOrigin values. + var hasTransform = false; + var hasTransformOrigin = false; + // Does the calculated transform essentially equal "none"? + var transformIsNone = true; + /** + * Loop over all our latest animated values and decide whether to handle them + * as a style or CSS variable. + * + * Transforms and transform origins are kept seperately for further processing. + */ + for (var key in latestValues) { + var value = latestValues[key]; + /** + * If this is a CSS variable we don't do any further processing. + */ + if (isCSSVariable$1(key)) { + vars[key] = value; + continue; + } + // Convert the value to its default value type, ie 0 -> "0px" + var valueType = numberValueTypes[key]; + var valueAsType = getValueAsType(value, valueType); + if (isTransformProp(key)) { + // If this is a transform, flag to enable further transform processing + hasTransform = true; + transform[key] = valueAsType; + transformKeys.push(key); + // If we already know we have a non-default transform, early return + if (!transformIsNone) continue; + // Otherwise check to see if this is a default transform + if (value !== ((_a = valueType.default) !== null && _a !== void 0 ? _a : 0)) transformIsNone = false; + } else if (isTransformOriginProp(key)) { + transformOrigin[key] = valueAsType; + // If this is a transform origin, flag and enable further transform-origin processing + hasTransformOrigin = true; + } else { + style[key] = valueAsType; + } + } + if (hasTransform) { + style.transform = buildTransform(state, options, transformIsNone, transformTemplate); + } else if (transformTemplate) { + style.transform = transformTemplate({}, ""); + } else if (!latestValues.transform && style.transform) { + style.transform = "none"; + } + if (hasTransformOrigin) { + style.transformOrigin = buildTransformOrigin(transformOrigin); + } +} +var createHtmlRenderState = function () { + return { + style: {}, + transform: {}, + transformKeys: [], + transformOrigin: {}, + vars: {} + }; +}; +function copyRawValuesOnly(target, source, props) { + for (var key in source) { + if (!isMotionValue(source[key]) && !isForcedMotionValue(key, props)) { + target[key] = source[key]; + } + } +} +function useInitialMotionValues(_a, visualState, isStatic) { + var transformTemplate = _a.transformTemplate; + return React.useMemo(function () { + var state = createHtmlRenderState(); + buildHTMLStyles(state, visualState, { + enableHardwareAcceleration: !isStatic + }, transformTemplate); + var vars = state.vars, + style = state.style; + return tslib.__assign(tslib.__assign({}, vars), style); + }, [visualState]); +} +function useStyle(props, visualState, isStatic) { + var styleProp = props.style || {}; + var style = {}; + /** + * Copy non-Motion Values straight into style + */ + copyRawValuesOnly(style, styleProp, props); + Object.assign(style, useInitialMotionValues(props, visualState, isStatic)); + if (props.transformValues) { + style = props.transformValues(style); + } + return style; +} +function useHTMLProps(props, visualState, isStatic) { + // The `any` isn't ideal but it is the type of createElement props argument + var htmlProps = {}; + var style = useStyle(props, visualState, isStatic); + if (Boolean(props.drag) && props.dragListener !== false) { + // Disable the ghost element when a user drags + htmlProps.draggable = false; + // Disable text selection + style.userSelect = style.WebkitUserSelect = style.WebkitTouchCallout = "none"; + // Disable scrolling on the draggable direction + style.touchAction = props.drag === true ? "none" : "pan-".concat(props.drag === "x" ? "y" : "x"); + } + htmlProps.style = style; + return htmlProps; +} + +/** + * A list of all valid MotionProps. + * + * @privateRemarks + * This doesn't throw if a `MotionProp` name is missing - it should. + */ +var validMotionProps = new Set(["initial", "animate", "exit", "style", "variants", "transition", "transformTemplate", "transformValues", "custom", "inherit", "layout", "layoutId", "layoutDependency", "onLayoutAnimationStart", "onLayoutAnimationComplete", "onLayoutMeasure", "onBeforeLayoutMeasure", "onAnimationStart", "onAnimationComplete", "onUpdate", "onDragStart", "onDrag", "onDragEnd", "onMeasureDragConstraints", "onDirectionLock", "onDragTransitionEnd", "drag", "dragControls", "dragListener", "dragConstraints", "dragDirectionLock", "dragSnapToOrigin", "_dragX", "_dragY", "dragElastic", "dragMomentum", "dragPropagation", "dragTransition", "whileDrag", "onPan", "onPanStart", "onPanEnd", "onPanSessionStart", "onTap", "onTapStart", "onTapCancel", "onHoverStart", "onHoverEnd", "whileFocus", "whileTap", "whileHover", "whileInView", "onViewportEnter", "onViewportLeave", "viewport", "layoutScroll"]); +/** + * Check whether a prop name is a valid `MotionProp` key. + * + * @param key - Name of the property to check + * @returns `true` is key is a valid `MotionProp`. + * + * @public + */ +function isValidMotionProp(key) { + return validMotionProps.has(key); +} +var shouldForward = function (key) { + return !isValidMotionProp(key); +}; +function loadExternalIsValidProp(isValidProp) { + if (!isValidProp) return; + // Explicitly filter our events + shouldForward = function (key) { + return key.startsWith("on") ? !isValidMotionProp(key) : isValidProp(key); + }; +} +/** + * Emotion and Styled Components both allow users to pass through arbitrary props to their components + * to dynamically generate CSS. They both use the `@emotion/is-prop-valid` package to determine which + * of these should be passed to the underlying DOM node. + * + * However, when styling a Motion component `styled(motion.div)`, both packages pass through *all* props + * as it's seen as an arbitrary component rather than a DOM node. Motion only allows arbitrary props + * passed through the `custom` prop so it doesn't *need* the payload or computational overhead of + * `@emotion/is-prop-valid`, however to fix this problem we need to use it. + * + * By making it an optionalDependency we can offer this functionality only in the situations where it's + * actually required. + */ +try { + /** + * We attempt to import this package but require won't be defined in esm environments, in that case + * isPropValid will have to be provided via `MotionContext`. In a 6.0.0 this should probably be removed + * in favour of explicit injection. + */ + loadExternalIsValidProp((__webpack_require__(/*! @emotion/is-prop-valid */ "../../../node_modules/@emotion/is-prop-valid/dist/is-prop-valid.browser.esm.js")["default"])); +} catch (_a) { + // We don't need to actually do anything here - the fallback is the existing `isPropValid`. +} +function filterProps(props, isDom, forwardMotionProps) { + var filteredProps = {}; + for (var key in props) { + if (shouldForward(key) || forwardMotionProps === true && isValidMotionProp(key) || !isDom && !isValidMotionProp(key) || + // If trying to use native HTML drag events, forward drag listeners + props["draggable"] && key.startsWith("onDrag")) { + filteredProps[key] = props[key]; + } + } + return filteredProps; +} +function calcOrigin$1(origin, offset, size) { + return typeof origin === "string" ? origin : styleValueTypes.px.transform(offset + size * origin); +} +/** + * The SVG transform origin defaults are different to CSS and is less intuitive, + * so we use the measured dimensions of the SVG to reconcile these. + */ +function calcSVGTransformOrigin(dimensions, originX, originY) { + var pxOriginX = calcOrigin$1(originX, dimensions.x, dimensions.width); + var pxOriginY = calcOrigin$1(originY, dimensions.y, dimensions.height); + return "".concat(pxOriginX, " ").concat(pxOriginY); +} +var dashKeys = { + offset: "stroke-dashoffset", + array: "stroke-dasharray" +}; +var camelKeys = { + offset: "strokeDashoffset", + array: "strokeDasharray" +}; +/** + * Build SVG path properties. Uses the path's measured length to convert + * our custom pathLength, pathSpacing and pathOffset into stroke-dashoffset + * and stroke-dasharray attributes. + * + * This function is mutative to reduce per-frame GC. + */ +function buildSVGPath(attrs, length, spacing, offset, useDashCase) { + if (spacing === void 0) { + spacing = 1; + } + if (offset === void 0) { + offset = 0; + } + if (useDashCase === void 0) { + useDashCase = true; + } + // Normalise path length by setting SVG attribute pathLength to 1 + attrs.pathLength = 1; + // We use dash case when setting attributes directly to the DOM node and camel case + // when defining props on a React component. + var keys = useDashCase ? dashKeys : camelKeys; + // Build the dash offset + attrs[keys.offset] = styleValueTypes.px.transform(-offset); + // Build the dash array + var pathLength = styleValueTypes.px.transform(length); + var pathSpacing = styleValueTypes.px.transform(spacing); + attrs[keys.array] = "".concat(pathLength, " ").concat(pathSpacing); +} + +/** + * Build SVG visual attrbutes, like cx and style.transform + */ +function buildSVGAttrs(state, _a, options, transformTemplate) { + var attrX = _a.attrX, + attrY = _a.attrY, + originX = _a.originX, + originY = _a.originY, + pathLength = _a.pathLength, + _b = _a.pathSpacing, + pathSpacing = _b === void 0 ? 1 : _b, + _c = _a.pathOffset, + pathOffset = _c === void 0 ? 0 : _c, + // This is object creation, which we try to avoid per-frame. + latest = tslib.__rest(_a, ["attrX", "attrY", "originX", "originY", "pathLength", "pathSpacing", "pathOffset"]); + buildHTMLStyles(state, latest, options, transformTemplate); + state.attrs = state.style; + state.style = {}; + var attrs = state.attrs, + style = state.style, + dimensions = state.dimensions; + /** + * However, we apply transforms as CSS transforms. So if we detect a transform we take it from attrs + * and copy it into style. + */ + if (attrs.transform) { + if (dimensions) style.transform = attrs.transform; + delete attrs.transform; + } + // Parse transformOrigin + if (dimensions && (originX !== undefined || originY !== undefined || style.transform)) { + style.transformOrigin = calcSVGTransformOrigin(dimensions, originX !== undefined ? originX : 0.5, originY !== undefined ? originY : 0.5); + } + // Treat x/y not as shortcuts but as actual attributes + if (attrX !== undefined) attrs.x = attrX; + if (attrY !== undefined) attrs.y = attrY; + // Build SVG path if one has been defined + if (pathLength !== undefined) { + buildSVGPath(attrs, pathLength, pathSpacing, pathOffset, false); + } +} +var createSvgRenderState = function () { + return tslib.__assign(tslib.__assign({}, createHtmlRenderState()), { + attrs: {} + }); +}; +function useSVGProps(props, visualState) { + var visualProps = React.useMemo(function () { + var state = createSvgRenderState(); + buildSVGAttrs(state, visualState, { + enableHardwareAcceleration: false + }, props.transformTemplate); + return tslib.__assign(tslib.__assign({}, state.attrs), { + style: tslib.__assign({}, state.style) + }); + }, [visualState]); + if (props.style) { + var rawStyles = {}; + copyRawValuesOnly(rawStyles, props.style, props); + visualProps.style = tslib.__assign(tslib.__assign({}, rawStyles), visualProps.style); + } + return visualProps; +} +function createUseRender(forwardMotionProps) { + if (forwardMotionProps === void 0) { + forwardMotionProps = false; + } + var useRender = function (Component, props, projectionId, ref, _a, isStatic) { + var latestValues = _a.latestValues; + var useVisualProps = isSVGComponent(Component) ? useSVGProps : useHTMLProps; + var visualProps = useVisualProps(props, latestValues, isStatic); + var filteredProps = filterProps(props, typeof Component === "string", forwardMotionProps); + var elementProps = tslib.__assign(tslib.__assign(tslib.__assign({}, filteredProps), visualProps), { + ref: ref + }); + if (projectionId) { + elementProps["data-projection-id"] = projectionId; + } + return React.createElement(Component, elementProps); + }; + return useRender; +} +var CAMEL_CASE_PATTERN = /([a-z])([A-Z])/g; +var REPLACE_TEMPLATE = "$1-$2"; +/** + * Convert camelCase to dash-case properties. + */ +var camelToDash = function (str) { + return str.replace(CAMEL_CASE_PATTERN, REPLACE_TEMPLATE).toLowerCase(); +}; +function renderHTML(element, _a, styleProp, projection) { + var style = _a.style, + vars = _a.vars; + Object.assign(element.style, style, projection && projection.getProjectionStyles(styleProp)); + // Loop over any CSS variables and assign those. + for (var key in vars) { + element.style.setProperty(key, vars[key]); + } +} + +/** + * A set of attribute names that are always read/written as camel case. + */ +var camelCaseAttributes = new Set(["baseFrequency", "diffuseConstant", "kernelMatrix", "kernelUnitLength", "keySplines", "keyTimes", "limitingConeAngle", "markerHeight", "markerWidth", "numOctaves", "targetX", "targetY", "surfaceScale", "specularConstant", "specularExponent", "stdDeviation", "tableValues", "viewBox", "gradientTransform", "pathLength"]); +function renderSVG(element, renderState, _styleProp, projection) { + renderHTML(element, renderState, undefined, projection); + for (var key in renderState.attrs) { + element.setAttribute(!camelCaseAttributes.has(key) ? camelToDash(key) : key, renderState.attrs[key]); + } +} +function scrapeMotionValuesFromProps$1(props) { + var style = props.style; + var newValues = {}; + for (var key in style) { + if (isMotionValue(style[key]) || isForcedMotionValue(key, props)) { + newValues[key] = style[key]; + } + } + return newValues; +} +function scrapeMotionValuesFromProps(props) { + var newValues = scrapeMotionValuesFromProps$1(props); + for (var key in props) { + if (isMotionValue(props[key])) { + var targetKey = key === "x" || key === "y" ? "attr" + key.toUpperCase() : key; + newValues[targetKey] = props[key]; + } + } + return newValues; +} +function isAnimationControls(v) { + return typeof v === "object" && typeof v.start === "function"; +} +var isKeyframesTarget = function (v) { + return Array.isArray(v); +}; +var isCustomValue = function (v) { + return Boolean(v && typeof v === "object" && v.mix && v.toValue); +}; +var resolveFinalValueInKeyframes = function (v) { + // TODO maybe throw if v.length - 1 is placeholder token? + return isKeyframesTarget(v) ? v[v.length - 1] || 0 : v; +}; + +/** + * If the provided value is a MotionValue, this returns the actual value, otherwise just the value itself + * + * TODO: Remove and move to library + */ +function resolveMotionValue(value) { + var unwrappedValue = isMotionValue(value) ? value.get() : value; + return isCustomValue(unwrappedValue) ? unwrappedValue.toValue() : unwrappedValue; +} +function makeState(_a, props, context, presenceContext) { + var scrapeMotionValuesFromProps = _a.scrapeMotionValuesFromProps, + createRenderState = _a.createRenderState, + onMount = _a.onMount; + var state = { + latestValues: makeLatestValues(props, context, presenceContext, scrapeMotionValuesFromProps), + renderState: createRenderState() + }; + if (onMount) { + state.mount = function (instance) { + return onMount(props, instance, state); + }; + } + return state; +} +var makeUseVisualState = function (config) { + return function (props, isStatic) { + var context = React.useContext(MotionContext); + var presenceContext = React.useContext(PresenceContext); + return isStatic ? makeState(config, props, context, presenceContext) : useConstant(function () { + return makeState(config, props, context, presenceContext); + }); + }; +}; +function makeLatestValues(props, context, presenceContext, scrapeMotionValues) { + var values = {}; + var blockInitialAnimation = (presenceContext === null || presenceContext === void 0 ? void 0 : presenceContext.initial) === false; + var motionValues = scrapeMotionValues(props); + for (var key in motionValues) { + values[key] = resolveMotionValue(motionValues[key]); + } + var initial = props.initial, + animate = props.animate; + var isControllingVariants = checkIfControllingVariants(props); + var isVariantNode = checkIfVariantNode(props); + if (context && isVariantNode && !isControllingVariants && props.inherit !== false) { + initial !== null && initial !== void 0 ? initial : initial = context.initial; + animate !== null && animate !== void 0 ? animate : animate = context.animate; + } + var initialAnimationIsBlocked = blockInitialAnimation || initial === false; + var variantToSet = initialAnimationIsBlocked ? animate : initial; + if (variantToSet && typeof variantToSet !== "boolean" && !isAnimationControls(variantToSet)) { + var list = Array.isArray(variantToSet) ? variantToSet : [variantToSet]; + list.forEach(function (definition) { + var resolved = resolveVariantFromProps(props, definition); + if (!resolved) return; + var transitionEnd = resolved.transitionEnd; + resolved.transition; + var target = tslib.__rest(resolved, ["transitionEnd", "transition"]); + for (var key in target) { + var valueTarget = target[key]; + if (Array.isArray(valueTarget)) { + /** + * Take final keyframe if the initial animation is blocked because + * we want to initialise at the end of that blocked animation. + */ + var index = initialAnimationIsBlocked ? valueTarget.length - 1 : 0; + valueTarget = valueTarget[index]; + } + if (valueTarget !== null) { + values[key] = valueTarget; + } + } + for (var key in transitionEnd) values[key] = transitionEnd[key]; + }); + } + return values; +} +var svgMotionConfig = { + useVisualState: makeUseVisualState({ + scrapeMotionValuesFromProps: scrapeMotionValuesFromProps, + createRenderState: createSvgRenderState, + onMount: function (props, instance, _a) { + var renderState = _a.renderState, + latestValues = _a.latestValues; + try { + renderState.dimensions = typeof instance.getBBox === "function" ? instance.getBBox() : instance.getBoundingClientRect(); + } catch (e) { + // Most likely trying to measure an unrendered element under Firefox + renderState.dimensions = { + x: 0, + y: 0, + width: 0, + height: 0 + }; + } + buildSVGAttrs(renderState, latestValues, { + enableHardwareAcceleration: false + }, props.transformTemplate); + renderSVG(instance, renderState); + } + }) +}; +var htmlMotionConfig = { + useVisualState: makeUseVisualState({ + scrapeMotionValuesFromProps: scrapeMotionValuesFromProps$1, + createRenderState: createHtmlRenderState + }) +}; +function createDomMotionConfig(Component, _a, preloadedFeatures, createVisualElement, projectionNodeConstructor) { + var _b = _a.forwardMotionProps, + forwardMotionProps = _b === void 0 ? false : _b; + var baseConfig = isSVGComponent(Component) ? svgMotionConfig : htmlMotionConfig; + return tslib.__assign(tslib.__assign({}, baseConfig), { + preloadedFeatures: preloadedFeatures, + useRender: createUseRender(forwardMotionProps), + createVisualElement: createVisualElement, + projectionNodeConstructor: projectionNodeConstructor, + Component: Component + }); +} +exports.AnimationType = void 0; +(function (AnimationType) { + AnimationType["Animate"] = "animate"; + AnimationType["Hover"] = "whileHover"; + AnimationType["Tap"] = "whileTap"; + AnimationType["Drag"] = "whileDrag"; + AnimationType["Focus"] = "whileFocus"; + AnimationType["InView"] = "whileInView"; + AnimationType["Exit"] = "exit"; +})(exports.AnimationType || (exports.AnimationType = {})); +function addDomEvent(target, eventName, handler, options) { + if (options === void 0) { + options = { + passive: true + }; + } + target.addEventListener(eventName, handler, options); + return function () { + return target.removeEventListener(eventName, handler); + }; +} +/** + * Attaches an event listener directly to the provided DOM element. + * + * Bypassing React's event system can be desirable, for instance when attaching non-passive + * event handlers. + * + * ```jsx + * const ref = useRef(null) + * + * useDomEvent(ref, 'wheel', onWheel, { passive: false }) + * + * return
+ * ``` + * + * @param ref - React.RefObject that's been provided to the element you want to bind the listener to. + * @param eventName - Name of the event you want listen for. + * @param handler - Function to fire when receiving the event. + * @param options - Options to pass to `Event.addEventListener`. + * + * @public + */ +function useDomEvent(ref, eventName, handler, options) { + React.useEffect(function () { + var element = ref.current; + if (handler && element) { + return addDomEvent(element, eventName, handler, options); + } + }, [ref, eventName, handler, options]); +} + +/** + * + * @param props + * @param ref + * @internal + */ +function useFocusGesture(_a) { + var whileFocus = _a.whileFocus, + visualElement = _a.visualElement; + var onFocus = function () { + var _a; + (_a = visualElement.animationState) === null || _a === void 0 ? void 0 : _a.setActive(exports.AnimationType.Focus, true); + }; + var onBlur = function () { + var _a; + (_a = visualElement.animationState) === null || _a === void 0 ? void 0 : _a.setActive(exports.AnimationType.Focus, false); + }; + useDomEvent(visualElement, "focus", whileFocus ? onFocus : undefined); + useDomEvent(visualElement, "blur", whileFocus ? onBlur : undefined); +} +function isMouseEvent(event) { + // PointerEvent inherits from MouseEvent so we can't use a straight instanceof check. + if (typeof PointerEvent !== "undefined" && event instanceof PointerEvent) { + return !!(event.pointerType === "mouse"); + } + return event instanceof MouseEvent; +} +function isTouchEvent(event) { + var hasTouches = !!event.touches; + return hasTouches; +} + +/** + * Filters out events not attached to the primary pointer (currently left mouse button) + * @param eventHandler + */ +function filterPrimaryPointer(eventHandler) { + return function (event) { + var isMouseEvent = event instanceof MouseEvent; + var isPrimaryPointer = !isMouseEvent || isMouseEvent && event.button === 0; + if (isPrimaryPointer) { + eventHandler(event); + } + }; +} +var defaultPagePoint = { + pageX: 0, + pageY: 0 +}; +function pointFromTouch(e, pointType) { + if (pointType === void 0) { + pointType = "page"; + } + var primaryTouch = e.touches[0] || e.changedTouches[0]; + var point = primaryTouch || defaultPagePoint; + return { + x: point[pointType + "X"], + y: point[pointType + "Y"] + }; +} +function pointFromMouse(point, pointType) { + if (pointType === void 0) { + pointType = "page"; + } + return { + x: point[pointType + "X"], + y: point[pointType + "Y"] + }; +} +function extractEventInfo(event, pointType) { + if (pointType === void 0) { + pointType = "page"; + } + return { + point: isTouchEvent(event) ? pointFromTouch(event, pointType) : pointFromMouse(event, pointType) + }; +} +var wrapHandler = function (handler, shouldFilterPrimaryPointer) { + if (shouldFilterPrimaryPointer === void 0) { + shouldFilterPrimaryPointer = false; + } + var listener = function (event) { + return handler(event, extractEventInfo(event)); + }; + return shouldFilterPrimaryPointer ? filterPrimaryPointer(listener) : listener; +}; + +// We check for event support via functions in case they've been mocked by a testing suite. +var supportsPointerEvents = function () { + return isBrowser && window.onpointerdown === null; +}; +var supportsTouchEvents = function () { + return isBrowser && window.ontouchstart === null; +}; +var supportsMouseEvents = function () { + return isBrowser && window.onmousedown === null; +}; +var mouseEventNames = { + pointerdown: "mousedown", + pointermove: "mousemove", + pointerup: "mouseup", + pointercancel: "mousecancel", + pointerover: "mouseover", + pointerout: "mouseout", + pointerenter: "mouseenter", + pointerleave: "mouseleave" +}; +var touchEventNames = { + pointerdown: "touchstart", + pointermove: "touchmove", + pointerup: "touchend", + pointercancel: "touchcancel" +}; +function getPointerEventName(name) { + if (supportsPointerEvents()) { + return name; + } else if (supportsTouchEvents()) { + return touchEventNames[name]; + } else if (supportsMouseEvents()) { + return mouseEventNames[name]; + } + return name; +} +function addPointerEvent(target, eventName, handler, options) { + return addDomEvent(target, getPointerEventName(eventName), wrapHandler(handler, eventName === "pointerdown"), options); +} +function usePointerEvent(ref, eventName, handler, options) { + return useDomEvent(ref, getPointerEventName(eventName), handler && wrapHandler(handler, eventName === "pointerdown"), options); +} +function createLock(name) { + var lock = null; + return function () { + var openLock = function () { + lock = null; + }; + if (lock === null) { + lock = name; + return openLock; + } + return false; + }; +} +var globalHorizontalLock = createLock("dragHorizontal"); +var globalVerticalLock = createLock("dragVertical"); +function getGlobalLock(drag) { + var lock = false; + if (drag === "y") { + lock = globalVerticalLock(); + } else if (drag === "x") { + lock = globalHorizontalLock(); + } else { + var openHorizontal_1 = globalHorizontalLock(); + var openVertical_1 = globalVerticalLock(); + if (openHorizontal_1 && openVertical_1) { + lock = function () { + openHorizontal_1(); + openVertical_1(); + }; + } else { + // Release the locks because we don't use them + if (openHorizontal_1) openHorizontal_1(); + if (openVertical_1) openVertical_1(); + } + } + return lock; +} +function isDragActive() { + // Check the gesture lock - if we get it, it means no drag gesture is active + // and we can safely fire the tap gesture. + var openGestureLock = getGlobalLock(true); + if (!openGestureLock) return true; + openGestureLock(); + return false; +} +function createHoverEvent(visualElement, isActive, callback) { + return function (event, info) { + var _a; + if (!isMouseEvent(event) || isDragActive()) return; + /** + * Ensure we trigger animations before firing event callback + */ + (_a = visualElement.animationState) === null || _a === void 0 ? void 0 : _a.setActive(exports.AnimationType.Hover, isActive); + callback === null || callback === void 0 ? void 0 : callback(event, info); + }; +} +function useHoverGesture(_a) { + var onHoverStart = _a.onHoverStart, + onHoverEnd = _a.onHoverEnd, + whileHover = _a.whileHover, + visualElement = _a.visualElement; + usePointerEvent(visualElement, "pointerenter", onHoverStart || whileHover ? createHoverEvent(visualElement, true, onHoverStart) : undefined, { + passive: !onHoverStart + }); + usePointerEvent(visualElement, "pointerleave", onHoverEnd || whileHover ? createHoverEvent(visualElement, false, onHoverEnd) : undefined, { + passive: !onHoverEnd + }); +} + +/** + * Recursively traverse up the tree to check whether the provided child node + * is the parent or a descendant of it. + * + * @param parent - Element to find + * @param child - Element to test against parent + */ +var isNodeOrChild = function (parent, child) { + if (!child) { + return false; + } else if (parent === child) { + return true; + } else { + return isNodeOrChild(parent, child.parentElement); + } +}; +function useUnmountEffect(callback) { + return React.useEffect(function () { + return function () { + return callback(); + }; + }, []); +} + +/** + * @param handlers - + * @internal + */ +function useTapGesture(_a) { + var onTap = _a.onTap, + onTapStart = _a.onTapStart, + onTapCancel = _a.onTapCancel, + whileTap = _a.whileTap, + visualElement = _a.visualElement; + var hasPressListeners = onTap || onTapStart || onTapCancel || whileTap; + var isPressing = React.useRef(false); + var cancelPointerEndListeners = React.useRef(null); + /** + * Only set listener to passive if there are no external listeners. + */ + var eventOptions = { + passive: !(onTapStart || onTap || onTapCancel || onPointerDown) + }; + function removePointerEndListener() { + var _a; + (_a = cancelPointerEndListeners.current) === null || _a === void 0 ? void 0 : _a.call(cancelPointerEndListeners); + cancelPointerEndListeners.current = null; + } + function checkPointerEnd() { + var _a; + removePointerEndListener(); + isPressing.current = false; + (_a = visualElement.animationState) === null || _a === void 0 ? void 0 : _a.setActive(exports.AnimationType.Tap, false); + return !isDragActive(); + } + function onPointerUp(event, info) { + if (!checkPointerEnd()) return; + /** + * We only count this as a tap gesture if the event.target is the same + * as, or a child of, this component's element + */ + !isNodeOrChild(visualElement.getInstance(), event.target) ? onTapCancel === null || onTapCancel === void 0 ? void 0 : onTapCancel(event, info) : onTap === null || onTap === void 0 ? void 0 : onTap(event, info); + } + function onPointerCancel(event, info) { + if (!checkPointerEnd()) return; + onTapCancel === null || onTapCancel === void 0 ? void 0 : onTapCancel(event, info); + } + function onPointerDown(event, info) { + var _a; + removePointerEndListener(); + if (isPressing.current) return; + isPressing.current = true; + cancelPointerEndListeners.current = popmotion.pipe(addPointerEvent(window, "pointerup", onPointerUp, eventOptions), addPointerEvent(window, "pointercancel", onPointerCancel, eventOptions)); + /** + * Ensure we trigger animations before firing event callback + */ + (_a = visualElement.animationState) === null || _a === void 0 ? void 0 : _a.setActive(exports.AnimationType.Tap, true); + onTapStart === null || onTapStart === void 0 ? void 0 : onTapStart(event, info); + } + usePointerEvent(visualElement, "pointerdown", hasPressListeners ? onPointerDown : undefined, eventOptions); + useUnmountEffect(removePointerEndListener); +} +var warned = new Set(); +function warnOnce(condition, message, element) { + if (condition || warned.has(message)) return; + console.warn(message); + if (element) console.warn(element); + warned.add(message); +} + +/** + * Map an IntersectionHandler callback to an element. We only ever make one handler for one + * element, so even though these handlers might all be triggered by different + * observers, we can keep them in the same map. + */ +var observerCallbacks = new WeakMap(); +/** + * Multiple observers can be created for multiple element/document roots. Each with + * different settings. So here we store dictionaries of observers to each root, + * using serialised settings (threshold/margin) as lookup keys. + */ +var observers = new WeakMap(); +var fireObserverCallback = function (entry) { + var _a; + (_a = observerCallbacks.get(entry.target)) === null || _a === void 0 ? void 0 : _a(entry); +}; +var fireAllObserverCallbacks = function (entries) { + entries.forEach(fireObserverCallback); +}; +function initIntersectionObserver(_a) { + var root = _a.root, + options = tslib.__rest(_a, ["root"]); + var lookupRoot = root || document; + /** + * If we don't have an observer lookup map for this root, create one. + */ + if (!observers.has(lookupRoot)) { + observers.set(lookupRoot, {}); + } + var rootObservers = observers.get(lookupRoot); + var key = JSON.stringify(options); + /** + * If we don't have an observer for this combination of root and settings, + * create one. + */ + if (!rootObservers[key]) { + rootObservers[key] = new IntersectionObserver(fireAllObserverCallbacks, tslib.__assign({ + root: root + }, options)); + } + return rootObservers[key]; +} +function observeIntersection(element, options, callback) { + var rootInteresectionObserver = initIntersectionObserver(options); + observerCallbacks.set(element, callback); + rootInteresectionObserver.observe(element); + return function () { + observerCallbacks.delete(element); + rootInteresectionObserver.unobserve(element); + }; +} +function useViewport(_a) { + var visualElement = _a.visualElement, + whileInView = _a.whileInView, + onViewportEnter = _a.onViewportEnter, + onViewportLeave = _a.onViewportLeave, + _b = _a.viewport, + viewport = _b === void 0 ? {} : _b; + var state = React.useRef({ + hasEnteredView: false, + isInView: false + }); + var shouldObserve = Boolean(whileInView || onViewportEnter || onViewportLeave); + if (viewport.once && state.current.hasEnteredView) shouldObserve = false; + var useObserver = typeof IntersectionObserver === "undefined" ? useMissingIntersectionObserver : useIntersectionObserver; + useObserver(shouldObserve, state.current, visualElement, viewport); +} +var thresholdNames = { + some: 0, + all: 1 +}; +function useIntersectionObserver(shouldObserve, state, visualElement, _a) { + var root = _a.root, + rootMargin = _a.margin, + _b = _a.amount, + amount = _b === void 0 ? "some" : _b, + once = _a.once; + React.useEffect(function () { + if (!shouldObserve) return; + var options = { + root: root === null || root === void 0 ? void 0 : root.current, + rootMargin: rootMargin, + threshold: typeof amount === "number" ? amount : thresholdNames[amount] + }; + var intersectionCallback = function (entry) { + var _a; + var isIntersecting = entry.isIntersecting; + /** + * If there's been no change in the viewport state, early return. + */ + if (state.isInView === isIntersecting) return; + state.isInView = isIntersecting; + /** + * Handle hasEnteredView. If this is only meant to run once, and + * element isn't visible, early return. Otherwise set hasEnteredView to true. + */ + if (once && !isIntersecting && state.hasEnteredView) { + return; + } else if (isIntersecting) { + state.hasEnteredView = true; + } + (_a = visualElement.animationState) === null || _a === void 0 ? void 0 : _a.setActive(exports.AnimationType.InView, isIntersecting); + /** + * Use the latest committed props rather than the ones in scope + * when this observer is created + */ + var props = visualElement.getProps(); + var callback = isIntersecting ? props.onViewportEnter : props.onViewportLeave; + callback === null || callback === void 0 ? void 0 : callback(entry); + }; + return observeIntersection(visualElement.getInstance(), options, intersectionCallback); + }, [shouldObserve, root, rootMargin, amount]); +} +/** + * If IntersectionObserver is missing, we activate inView and fire onViewportEnter + * on mount. This way, the page will be in the state the author expects users + * to see it in for everyone. + */ +function useMissingIntersectionObserver(shouldObserve, state, visualElement, _a) { + var _b = _a.fallback, + fallback = _b === void 0 ? true : _b; + React.useEffect(function () { + if (!shouldObserve || !fallback) return; + if (env !== "production") { + warnOnce(false, "IntersectionObserver not available on this device. whileInView animations will trigger on mount."); + } + /** + * Fire this in an rAF because, at this point, the animation state + * won't have flushed for the first time and there's certain logic in + * there that behaves differently on the initial animation. + * + * This hook should be quite rarely called so setting this in an rAF + * is preferred to changing the behaviour of the animation state. + */ + requestAnimationFrame(function () { + var _a; + state.hasEnteredView = true; + var onViewportEnter = visualElement.getProps().onViewportEnter; + onViewportEnter === null || onViewportEnter === void 0 ? void 0 : onViewportEnter(null); + (_a = visualElement.animationState) === null || _a === void 0 ? void 0 : _a.setActive(exports.AnimationType.InView, true); + }); + }, [shouldObserve]); +} +var makeRenderlessComponent = function (hook) { + return function (props) { + hook(props); + return null; + }; +}; +var gestureAnimations = { + inView: makeRenderlessComponent(useViewport), + tap: makeRenderlessComponent(useTapGesture), + focus: makeRenderlessComponent(useFocusGesture), + hover: makeRenderlessComponent(useHoverGesture) +}; +var counter = 0; +var incrementId = function () { + return counter++; +}; +var useId = function () { + return useConstant(incrementId); +}; +/** + * Ideally we'd use the following code to support React 18 optionally. + * But this fairly fails in Webpack (otherwise treeshaking wouldn't work at all). + * Need to come up with a different way of figuring this out. + */ +// export const useId = (React as any).useId +// ? (React as any).useId +// : () => useConstant(incrementId) + +/** + * When a component is the child of `AnimatePresence`, it can use `usePresence` + * to access information about whether it's still present in the React tree. + * + * ```jsx + * import { usePresence } from "framer-motion" + * + * export const Component = () => { + * const [isPresent, safeToRemove] = usePresence() + * + * useEffect(() => { + * !isPresent && setTimeout(safeToRemove, 1000) + * }, [isPresent]) + * + * return
+ * } + * ``` + * + * If `isPresent` is `false`, it means that a component has been removed the tree, but + * `AnimatePresence` won't really remove it until `safeToRemove` has been called. + * + * @public + */ +function usePresence() { + var context = React.useContext(PresenceContext); + if (context === null) return [true, null]; + var isPresent = context.isPresent, + onExitComplete = context.onExitComplete, + register = context.register; + // It's safe to call the following hooks conditionally (after an early return) because the context will always + // either be null or non-null for the lifespan of the component. + // Replace with useId when released in React + var id = useId(); + React.useEffect(function () { + return register(id); + }, []); + var safeToRemove = function () { + return onExitComplete === null || onExitComplete === void 0 ? void 0 : onExitComplete(id); + }; + return !isPresent && onExitComplete ? [false, safeToRemove] : [true]; +} +/** + * Similar to `usePresence`, except `useIsPresent` simply returns whether or not the component is present. + * There is no `safeToRemove` function. + * + * ```jsx + * import { useIsPresent } from "framer-motion" + * + * export const Component = () => { + * const isPresent = useIsPresent() + * + * useEffect(() => { + * !isPresent && console.log("I've been removed!") + * }, [isPresent]) + * + * return
+ * } + * ``` + * + * @public + */ +function useIsPresent() { + return isPresent(React.useContext(PresenceContext)); +} +function isPresent(context) { + return context === null ? true : context.isPresent; +} +function shallowCompare(next, prev) { + if (!Array.isArray(prev)) return false; + var prevLength = prev.length; + if (prevLength !== next.length) return false; + for (var i = 0; i < prevLength; i++) { + if (prev[i] !== next[i]) return false; + } + return true; +} + +/** + * Converts seconds to milliseconds + * + * @param seconds - Time in seconds. + * @return milliseconds - Converted time in milliseconds. + */ +var secondsToMilliseconds = function (seconds) { + return seconds * 1000; +}; +var easingLookup = { + linear: popmotion.linear, + easeIn: popmotion.easeIn, + easeInOut: popmotion.easeInOut, + easeOut: popmotion.easeOut, + circIn: popmotion.circIn, + circInOut: popmotion.circInOut, + circOut: popmotion.circOut, + backIn: popmotion.backIn, + backInOut: popmotion.backInOut, + backOut: popmotion.backOut, + anticipate: popmotion.anticipate, + bounceIn: popmotion.bounceIn, + bounceInOut: popmotion.bounceInOut, + bounceOut: popmotion.bounceOut +}; +var easingDefinitionToFunction = function (definition) { + if (Array.isArray(definition)) { + // If cubic bezier definition, create bezier curve + heyListen.invariant(definition.length === 4, "Cubic bezier arrays must contain four numerical values."); + var _a = tslib.__read(definition, 4), + x1 = _a[0], + y1 = _a[1], + x2 = _a[2], + y2 = _a[3]; + return popmotion.cubicBezier(x1, y1, x2, y2); + } else if (typeof definition === "string") { + // Else lookup from table + heyListen.invariant(easingLookup[definition] !== undefined, "Invalid easing type '".concat(definition, "'")); + return easingLookup[definition]; + } + return definition; +}; +var isEasingArray = function (ease) { + return Array.isArray(ease) && typeof ease[0] !== "number"; +}; + +/** + * Check if a value is animatable. Examples: + * + * ✅: 100, "100px", "#fff" + * ❌: "block", "url(2.jpg)" + * @param value + * + * @internal + */ +var isAnimatable = function (key, value) { + // If the list of keys tat might be non-animatable grows, replace with Set + if (key === "zIndex") return false; + // If it's a number or a keyframes array, we can animate it. We might at some point + // need to do a deep isAnimatable check of keyframes, or let Popmotion handle this, + // but for now lets leave it like this for performance reasons + if (typeof value === "number" || Array.isArray(value)) return true; + if (typeof value === "string" && + // It's animatable if we have a string + styleValueTypes.complex.test(value) && + // And it contains numbers and/or colors + !value.startsWith("url(") // Unless it starts with "url(" + ) { + return true; + } + return false; +}; +var underDampedSpring = function () { + return { + type: "spring", + stiffness: 500, + damping: 25, + restSpeed: 10 + }; +}; +var criticallyDampedSpring = function (to) { + return { + type: "spring", + stiffness: 550, + damping: to === 0 ? 2 * Math.sqrt(550) : 30, + restSpeed: 10 + }; +}; +var linearTween = function () { + return { + type: "keyframes", + ease: "linear", + duration: 0.3 + }; +}; +var keyframes = function (values) { + return { + type: "keyframes", + duration: 0.8, + values: values + }; +}; +var defaultTransitions = { + x: underDampedSpring, + y: underDampedSpring, + z: underDampedSpring, + rotate: underDampedSpring, + rotateX: underDampedSpring, + rotateY: underDampedSpring, + rotateZ: underDampedSpring, + scaleX: criticallyDampedSpring, + scaleY: criticallyDampedSpring, + scale: criticallyDampedSpring, + opacity: linearTween, + backgroundColor: linearTween, + color: linearTween, + default: criticallyDampedSpring +}; +var getDefaultTransition = function (valueKey, to) { + var transitionFactory; + if (isKeyframesTarget(to)) { + transitionFactory = keyframes; + } else { + transitionFactory = defaultTransitions[valueKey] || defaultTransitions.default; + } + return tslib.__assign({ + to: to + }, transitionFactory(to)); +}; + +/** + * A map of default value types for common values + */ +var defaultValueTypes = tslib.__assign(tslib.__assign({}, numberValueTypes), { + // Color props + color: styleValueTypes.color, + backgroundColor: styleValueTypes.color, + outlineColor: styleValueTypes.color, + fill: styleValueTypes.color, + stroke: styleValueTypes.color, + // Border props + borderColor: styleValueTypes.color, + borderTopColor: styleValueTypes.color, + borderRightColor: styleValueTypes.color, + borderBottomColor: styleValueTypes.color, + borderLeftColor: styleValueTypes.color, + filter: styleValueTypes.filter, + WebkitFilter: styleValueTypes.filter +}); +/** + * Gets the default ValueType for the provided value key + */ +var getDefaultValueType = function (key) { + return defaultValueTypes[key]; +}; +function getAnimatableNone(key, value) { + var _a; + var defaultValueType = getDefaultValueType(key); + if (defaultValueType !== styleValueTypes.filter) defaultValueType = styleValueTypes.complex; + // If value is not recognised as animatable, ie "none", create an animatable version origin based on the target + return (_a = defaultValueType.getAnimatableNone) === null || _a === void 0 ? void 0 : _a.call(defaultValueType, value); +} +var instantAnimationState = { + current: false +}; + +/** + * Decide whether a transition is defined on a given Transition. + * This filters out orchestration options and returns true + * if any options are left. + */ +function isTransitionDefined(_a) { + _a.when; + _a.delay; + _a.delayChildren; + _a.staggerChildren; + _a.staggerDirection; + _a.repeat; + _a.repeatType; + _a.repeatDelay; + _a.from; + var transition = tslib.__rest(_a, ["when", "delay", "delayChildren", "staggerChildren", "staggerDirection", "repeat", "repeatType", "repeatDelay", "from"]); + return !!Object.keys(transition).length; +} +var legacyRepeatWarning = false; +/** + * Convert Framer Motion's Transition type into Popmotion-compatible options. + */ +function convertTransitionToAnimationOptions(_a) { + var ease = _a.ease, + times = _a.times, + yoyo = _a.yoyo, + flip = _a.flip, + loop = _a.loop, + transition = tslib.__rest(_a, ["ease", "times", "yoyo", "flip", "loop"]); + var options = tslib.__assign({}, transition); + if (times) options["offset"] = times; + /** + * Convert any existing durations from seconds to milliseconds + */ + if (transition.duration) options["duration"] = secondsToMilliseconds(transition.duration); + if (transition.repeatDelay) options.repeatDelay = secondsToMilliseconds(transition.repeatDelay); + /** + * Map easing names to Popmotion's easing functions + */ + if (ease) { + options["ease"] = isEasingArray(ease) ? ease.map(easingDefinitionToFunction) : easingDefinitionToFunction(ease); + } + /** + * Support legacy transition API + */ + if (transition.type === "tween") options.type = "keyframes"; + /** + * TODO: These options are officially removed from the API. + */ + if (yoyo || loop || flip) { + heyListen.warning(!legacyRepeatWarning, "yoyo, loop and flip have been removed from the API. Replace with repeat and repeatType options."); + legacyRepeatWarning = true; + if (yoyo) { + options.repeatType = "reverse"; + } else if (loop) { + options.repeatType = "loop"; + } else if (flip) { + options.repeatType = "mirror"; + } + options.repeat = loop || yoyo || flip || transition.repeat; + } + /** + * TODO: Popmotion 9 has the ability to automatically detect whether to use + * a keyframes or spring animation, but does so by detecting velocity and other spring options. + * It'd be good to introduce a similar thing here. + */ + if (transition.type !== "spring") options.type = "keyframes"; + return options; +} +/** + * Get the delay for a value by checking Transition with decreasing specificity. + */ +function getDelayFromTransition(transition, key) { + var _a, _b; + var valueTransition = getValueTransition(transition, key) || {}; + return (_b = (_a = valueTransition.delay) !== null && _a !== void 0 ? _a : transition.delay) !== null && _b !== void 0 ? _b : 0; +} +function hydrateKeyframes(options) { + if (Array.isArray(options.to) && options.to[0] === null) { + options.to = tslib.__spreadArray([], tslib.__read(options.to), false); + options.to[0] = options.from; + } + return options; +} +function getPopmotionAnimationOptions(transition, options, key) { + var _a; + if (Array.isArray(options.to)) { + (_a = transition.duration) !== null && _a !== void 0 ? _a : transition.duration = 0.8; + } + hydrateKeyframes(options); + /** + * Get a default transition if none is determined to be defined. + */ + if (!isTransitionDefined(transition)) { + transition = tslib.__assign(tslib.__assign({}, transition), getDefaultTransition(key, options.to)); + } + return tslib.__assign(tslib.__assign({}, options), convertTransitionToAnimationOptions(transition)); +} +/** + * + */ +function getAnimation(key, value, target, transition, onComplete) { + var _a; + var valueTransition = getValueTransition(transition, key); + var origin = (_a = valueTransition.from) !== null && _a !== void 0 ? _a : value.get(); + var isTargetAnimatable = isAnimatable(key, target); + if (origin === "none" && isTargetAnimatable && typeof target === "string") { + /** + * If we're trying to animate from "none", try and get an animatable version + * of the target. This could be improved to work both ways. + */ + origin = getAnimatableNone(key, target); + } else if (isZero(origin) && typeof target === "string") { + origin = getZeroUnit(target); + } else if (!Array.isArray(target) && isZero(target) && typeof origin === "string") { + target = getZeroUnit(origin); + } + var isOriginAnimatable = isAnimatable(key, origin); + heyListen.warning(isOriginAnimatable === isTargetAnimatable, "You are trying to animate ".concat(key, " from \"").concat(origin, "\" to \"").concat(target, "\". ").concat(origin, " is not an animatable value - to enable this animation set ").concat(origin, " to a value animatable to ").concat(target, " via the `style` property.")); + function start() { + var options = { + from: origin, + to: target, + velocity: value.getVelocity(), + onComplete: onComplete, + onUpdate: function (v) { + return value.set(v); + } + }; + return valueTransition.type === "inertia" || valueTransition.type === "decay" ? popmotion.inertia(tslib.__assign(tslib.__assign({}, options), valueTransition)) : popmotion.animate(tslib.__assign(tslib.__assign({}, getPopmotionAnimationOptions(valueTransition, options, key)), { + onUpdate: function (v) { + var _a; + options.onUpdate(v); + (_a = valueTransition.onUpdate) === null || _a === void 0 ? void 0 : _a.call(valueTransition, v); + }, + onComplete: function () { + var _a; + options.onComplete(); + (_a = valueTransition.onComplete) === null || _a === void 0 ? void 0 : _a.call(valueTransition); + } + })); + } + function set() { + var _a, _b; + var finalTarget = resolveFinalValueInKeyframes(target); + value.set(finalTarget); + onComplete(); + (_a = valueTransition === null || valueTransition === void 0 ? void 0 : valueTransition.onUpdate) === null || _a === void 0 ? void 0 : _a.call(valueTransition, finalTarget); + (_b = valueTransition === null || valueTransition === void 0 ? void 0 : valueTransition.onComplete) === null || _b === void 0 ? void 0 : _b.call(valueTransition); + return { + stop: function () {} + }; + } + return !isOriginAnimatable || !isTargetAnimatable || valueTransition.type === false ? set : start; +} +function isZero(value) { + return value === 0 || typeof value === "string" && parseFloat(value) === 0 && value.indexOf(" ") === -1; +} +function getZeroUnit(potentialUnitType) { + return typeof potentialUnitType === "number" ? 0 : getAnimatableNone("", potentialUnitType); +} +function getValueTransition(transition, key) { + return transition[key] || transition["default"] || transition; +} +/** + * Start animation on a MotionValue. This function is an interface between + * Framer Motion and Popmotion + */ +function startAnimation(key, value, target, transition) { + if (transition === void 0) { + transition = {}; + } + if (instantAnimationState.current) { + transition = { + type: false + }; + } + return value.start(function (onComplete) { + var delayTimer; + var controls; + var animation = getAnimation(key, value, target, transition, onComplete); + var delay = getDelayFromTransition(transition, key); + var start = function () { + return controls = animation(); + }; + if (delay) { + delayTimer = window.setTimeout(start, secondsToMilliseconds(delay)); + } else { + start(); + } + return function () { + clearTimeout(delayTimer); + controls === null || controls === void 0 ? void 0 : controls.stop(); + }; + }); +} + +/** + * Check if value is a numerical string, ie a string that is purely a number eg "100" or "-100.1" + */ +var isNumericalString = function (v) { + return /^\-?\d*\.?\d+$/.test(v); +}; + +/** + * Check if the value is a zero value string like "0px" or "0%" + */ +var isZeroValueString = function (v) { + return /^0[^.\s]+$/.test(v); +}; +function addUniqueItem(arr, item) { + arr.indexOf(item) === -1 && arr.push(item); +} +function removeItem(arr, item) { + var index = arr.indexOf(item); + index > -1 && arr.splice(index, 1); +} +// Adapted from array-move +function moveItem(_a, fromIndex, toIndex) { + var _b = tslib.__read(_a), + arr = _b.slice(0); + var startIndex = fromIndex < 0 ? arr.length + fromIndex : fromIndex; + if (startIndex >= 0 && startIndex < arr.length) { + var endIndex = toIndex < 0 ? arr.length + toIndex : toIndex; + var _c = tslib.__read(arr.splice(fromIndex, 1), 1), + item = _c[0]; + arr.splice(endIndex, 0, item); + } + return arr; +} +var SubscriptionManager = /** @class */function () { + function SubscriptionManager() { + this.subscriptions = []; + } + SubscriptionManager.prototype.add = function (handler) { + var _this = this; + addUniqueItem(this.subscriptions, handler); + return function () { + return removeItem(_this.subscriptions, handler); + }; + }; + SubscriptionManager.prototype.notify = function (a, b, c) { + var numSubscriptions = this.subscriptions.length; + if (!numSubscriptions) return; + if (numSubscriptions === 1) { + /** + * If there's only a single handler we can just call it without invoking a loop. + */ + this.subscriptions[0](a, b, c); + } else { + for (var i = 0; i < numSubscriptions; i++) { + /** + * Check whether the handler exists before firing as it's possible + * the subscriptions were modified during this loop running. + */ + var handler = this.subscriptions[i]; + handler && handler(a, b, c); + } + } + }; + SubscriptionManager.prototype.getSize = function () { + return this.subscriptions.length; + }; + SubscriptionManager.prototype.clear = function () { + this.subscriptions.length = 0; + }; + return SubscriptionManager; +}(); +var isFloat = function (value) { + return !isNaN(parseFloat(value)); +}; +/** + * `MotionValue` is used to track the state and velocity of motion values. + * + * @public + */ +var MotionValue = /** @class */function () { + /** + * @param init - The initiating value + * @param config - Optional configuration options + * + * - `transformer`: A function to transform incoming values with. + * + * @internal + */ + function MotionValue(init) { + var _this = this; + /** + * This will be replaced by the build step with the latest version number. + * When MotionValues are provided to motion components, warn if versions are mixed. + */ + this.version = "6.5.1"; + /** + * Duration, in milliseconds, since last updating frame. + * + * @internal + */ + this.timeDelta = 0; + /** + * Timestamp of the last time this `MotionValue` was updated. + * + * @internal + */ + this.lastUpdated = 0; + /** + * Functions to notify when the `MotionValue` updates. + * + * @internal + */ + this.updateSubscribers = new SubscriptionManager(); + /** + * Functions to notify when the velocity updates. + * + * @internal + */ + this.velocityUpdateSubscribers = new SubscriptionManager(); + /** + * Functions to notify when the `MotionValue` updates and `render` is set to `true`. + * + * @internal + */ + this.renderSubscribers = new SubscriptionManager(); + /** + * Tracks whether this value can output a velocity. Currently this is only true + * if the value is numerical, but we might be able to widen the scope here and support + * other value types. + * + * @internal + */ + this.canTrackVelocity = false; + this.updateAndNotify = function (v, render) { + if (render === void 0) { + render = true; + } + _this.prev = _this.current; + _this.current = v; + // Update timestamp + var _a = sync.getFrameData(), + delta = _a.delta, + timestamp = _a.timestamp; + if (_this.lastUpdated !== timestamp) { + _this.timeDelta = delta; + _this.lastUpdated = timestamp; + sync__default["default"].postRender(_this.scheduleVelocityCheck); + } + // Update update subscribers + if (_this.prev !== _this.current) { + _this.updateSubscribers.notify(_this.current); + } + // Update velocity subscribers + if (_this.velocityUpdateSubscribers.getSize()) { + _this.velocityUpdateSubscribers.notify(_this.getVelocity()); + } + // Update render subscribers + if (render) { + _this.renderSubscribers.notify(_this.current); + } + }; + /** + * Schedule a velocity check for the next frame. + * + * This is an instanced and bound function to prevent generating a new + * function once per frame. + * + * @internal + */ + this.scheduleVelocityCheck = function () { + return sync__default["default"].postRender(_this.velocityCheck); + }; + /** + * Updates `prev` with `current` if the value hasn't been updated this frame. + * This ensures velocity calculations return `0`. + * + * This is an instanced and bound function to prevent generating a new + * function once per frame. + * + * @internal + */ + this.velocityCheck = function (_a) { + var timestamp = _a.timestamp; + if (timestamp !== _this.lastUpdated) { + _this.prev = _this.current; + _this.velocityUpdateSubscribers.notify(_this.getVelocity()); + } + }; + this.hasAnimated = false; + this.prev = this.current = init; + this.canTrackVelocity = isFloat(this.current); + } + /** + * Adds a function that will be notified when the `MotionValue` is updated. + * + * It returns a function that, when called, will cancel the subscription. + * + * When calling `onChange` inside a React component, it should be wrapped with the + * `useEffect` hook. As it returns an unsubscribe function, this should be returned + * from the `useEffect` function to ensure you don't add duplicate subscribers.. + * + * ```jsx + * export const MyComponent = () => { + * const x = useMotionValue(0) + * const y = useMotionValue(0) + * const opacity = useMotionValue(1) + * + * useEffect(() => { + * function updateOpacity() { + * const maxXY = Math.max(x.get(), y.get()) + * const newOpacity = transform(maxXY, [0, 100], [1, 0]) + * opacity.set(newOpacity) + * } + * + * const unsubscribeX = x.onChange(updateOpacity) + * const unsubscribeY = y.onChange(updateOpacity) + * + * return () => { + * unsubscribeX() + * unsubscribeY() + * } + * }, []) + * + * return + * } + * ``` + * + * @privateRemarks + * + * We could look into a `useOnChange` hook if the above lifecycle management proves confusing. + * + * ```jsx + * useOnChange(x, () => {}) + * ``` + * + * @param subscriber - A function that receives the latest value. + * @returns A function that, when called, will cancel this subscription. + * + * @public + */ + MotionValue.prototype.onChange = function (subscription) { + return this.updateSubscribers.add(subscription); + }; + MotionValue.prototype.clearListeners = function () { + this.updateSubscribers.clear(); + }; + /** + * Adds a function that will be notified when the `MotionValue` requests a render. + * + * @param subscriber - A function that's provided the latest value. + * @returns A function that, when called, will cancel this subscription. + * + * @internal + */ + MotionValue.prototype.onRenderRequest = function (subscription) { + // Render immediately + subscription(this.get()); + return this.renderSubscribers.add(subscription); + }; + /** + * Attaches a passive effect to the `MotionValue`. + * + * @internal + */ + MotionValue.prototype.attach = function (passiveEffect) { + this.passiveEffect = passiveEffect; + }; + /** + * Sets the state of the `MotionValue`. + * + * @remarks + * + * ```jsx + * const x = useMotionValue(0) + * x.set(10) + * ``` + * + * @param latest - Latest value to set. + * @param render - Whether to notify render subscribers. Defaults to `true` + * + * @public + */ + MotionValue.prototype.set = function (v, render) { + if (render === void 0) { + render = true; + } + if (!render || !this.passiveEffect) { + this.updateAndNotify(v, render); + } else { + this.passiveEffect(v, this.updateAndNotify); + } + }; + /** + * Returns the latest state of `MotionValue` + * + * @returns - The latest state of `MotionValue` + * + * @public + */ + MotionValue.prototype.get = function () { + return this.current; + }; + /** + * @public + */ + MotionValue.prototype.getPrevious = function () { + return this.prev; + }; + /** + * Returns the latest velocity of `MotionValue` + * + * @returns - The latest velocity of `MotionValue`. Returns `0` if the state is non-numerical. + * + * @public + */ + MotionValue.prototype.getVelocity = function () { + // This could be isFloat(this.prev) && isFloat(this.current), but that would be wasteful + return this.canTrackVelocity ? + // These casts could be avoided if parseFloat would be typed better + popmotion.velocityPerSecond(parseFloat(this.current) - parseFloat(this.prev), this.timeDelta) : 0; + }; + /** + * Registers a new animation to control this `MotionValue`. Only one + * animation can drive a `MotionValue` at one time. + * + * ```jsx + * value.start() + * ``` + * + * @param animation - A function that starts the provided animation + * + * @internal + */ + MotionValue.prototype.start = function (animation) { + var _this = this; + this.stop(); + return new Promise(function (resolve) { + _this.hasAnimated = true; + _this.stopAnimation = animation(resolve); + }).then(function () { + return _this.clearAnimation(); + }); + }; + /** + * Stop the currently active animation. + * + * @public + */ + MotionValue.prototype.stop = function () { + if (this.stopAnimation) this.stopAnimation(); + this.clearAnimation(); + }; + /** + * Returns `true` if this value is currently animating. + * + * @public + */ + MotionValue.prototype.isAnimating = function () { + return !!this.stopAnimation; + }; + MotionValue.prototype.clearAnimation = function () { + this.stopAnimation = null; + }; + /** + * Destroy and clean up subscribers to this `MotionValue`. + * + * The `MotionValue` hooks like `useMotionValue` and `useTransform` automatically + * handle the lifecycle of the returned `MotionValue`, so this method is only necessary if you've manually + * created a `MotionValue` via the `motionValue` function. + * + * @public + */ + MotionValue.prototype.destroy = function () { + this.updateSubscribers.clear(); + this.renderSubscribers.clear(); + this.stop(); + }; + return MotionValue; +}(); +function motionValue(init) { + return new MotionValue(init); +} + +/** + * Tests a provided value against a ValueType + */ +var testValueType = function (v) { + return function (type) { + return type.test(v); + }; +}; + +/** + * ValueType for "auto" + */ +var auto = { + test: function (v) { + return v === "auto"; + }, + parse: function (v) { + return v; + } +}; + +/** + * A list of value types commonly used for dimensions + */ +var dimensionValueTypes = [styleValueTypes.number, styleValueTypes.px, styleValueTypes.percent, styleValueTypes.degrees, styleValueTypes.vw, styleValueTypes.vh, auto]; +/** + * Tests a dimensional value against the list of dimension ValueTypes + */ +var findDimensionValueType = function (v) { + return dimensionValueTypes.find(testValueType(v)); +}; + +/** + * A list of all ValueTypes + */ +var valueTypes = tslib.__spreadArray(tslib.__spreadArray([], tslib.__read(dimensionValueTypes), false), [styleValueTypes.color, styleValueTypes.complex], false); +/** + * Tests a value against the list of ValueTypes + */ +var findValueType = function (v) { + return valueTypes.find(testValueType(v)); +}; + +/** + * Set VisualElement's MotionValue, creating a new MotionValue for it if + * it doesn't exist. + */ +function setMotionValue(visualElement, key, value) { + if (visualElement.hasValue(key)) { + visualElement.getValue(key).set(value); + } else { + visualElement.addValue(key, motionValue(value)); + } +} +function setTarget(visualElement, definition) { + var resolved = resolveVariant(visualElement, definition); + var _a = resolved ? visualElement.makeTargetAnimatable(resolved, false) : {}, + _b = _a.transitionEnd, + transitionEnd = _b === void 0 ? {} : _b; + _a.transition; + var target = tslib.__rest(_a, ["transitionEnd", "transition"]); + target = tslib.__assign(tslib.__assign({}, target), transitionEnd); + for (var key in target) { + var value = resolveFinalValueInKeyframes(target[key]); + setMotionValue(visualElement, key, value); + } +} +function setVariants(visualElement, variantLabels) { + var reversedLabels = tslib.__spreadArray([], tslib.__read(variantLabels), false).reverse(); + reversedLabels.forEach(function (key) { + var _a; + var variant = visualElement.getVariant(key); + variant && setTarget(visualElement, variant); + (_a = visualElement.variantChildren) === null || _a === void 0 ? void 0 : _a.forEach(function (child) { + setVariants(child, variantLabels); + }); + }); +} +function setValues(visualElement, definition) { + if (Array.isArray(definition)) { + return setVariants(visualElement, definition); + } else if (typeof definition === "string") { + return setVariants(visualElement, [definition]); + } else { + setTarget(visualElement, definition); + } +} +function checkTargetForNewValues(visualElement, target, origin) { + var _a, _b, _c; + var _d; + var newValueKeys = Object.keys(target).filter(function (key) { + return !visualElement.hasValue(key); + }); + var numNewValues = newValueKeys.length; + if (!numNewValues) return; + for (var i = 0; i < numNewValues; i++) { + var key = newValueKeys[i]; + var targetValue = target[key]; + var value = null; + /** + * If the target is a series of keyframes, we can use the first value + * in the array. If this first value is null, we'll still need to read from the DOM. + */ + if (Array.isArray(targetValue)) { + value = targetValue[0]; + } + /** + * If the target isn't keyframes, or the first keyframe was null, we need to + * first check if an origin value was explicitly defined in the transition as "from", + * if not read the value from the DOM. As an absolute fallback, take the defined target value. + */ + if (value === null) { + value = (_b = (_a = origin[key]) !== null && _a !== void 0 ? _a : visualElement.readValue(key)) !== null && _b !== void 0 ? _b : target[key]; + } + /** + * If value is still undefined or null, ignore it. Preferably this would throw, + * but this was causing issues in Framer. + */ + if (value === undefined || value === null) continue; + if (typeof value === "string" && (isNumericalString(value) || isZeroValueString(value))) { + // If this is a number read as a string, ie "0" or "200", convert it to a number + value = parseFloat(value); + } else if (!findValueType(value) && styleValueTypes.complex.test(targetValue)) { + value = getAnimatableNone(key, targetValue); + } + visualElement.addValue(key, motionValue(value)); + (_c = (_d = origin)[key]) !== null && _c !== void 0 ? _c : _d[key] = value; + visualElement.setBaseTarget(key, value); + } +} +function getOriginFromTransition(key, transition) { + if (!transition) return; + var valueTransition = transition[key] || transition["default"] || transition; + return valueTransition.from; +} +function getOrigin(target, transition, visualElement) { + var _a, _b; + var origin = {}; + for (var key in target) { + origin[key] = (_a = getOriginFromTransition(key, transition)) !== null && _a !== void 0 ? _a : (_b = visualElement.getValue(key)) === null || _b === void 0 ? void 0 : _b.get(); + } + return origin; +} +function animateVisualElement(visualElement, definition, options) { + if (options === void 0) { + options = {}; + } + visualElement.notifyAnimationStart(definition); + var animation; + if (Array.isArray(definition)) { + var animations = definition.map(function (variant) { + return animateVariant(visualElement, variant, options); + }); + animation = Promise.all(animations); + } else if (typeof definition === "string") { + animation = animateVariant(visualElement, definition, options); + } else { + var resolvedDefinition = typeof definition === "function" ? resolveVariant(visualElement, definition, options.custom) : definition; + animation = animateTarget(visualElement, resolvedDefinition, options); + } + return animation.then(function () { + return visualElement.notifyAnimationComplete(definition); + }); +} +function animateVariant(visualElement, variant, options) { + var _a; + if (options === void 0) { + options = {}; + } + var resolved = resolveVariant(visualElement, variant, options.custom); + var _b = (resolved || {}).transition, + transition = _b === void 0 ? visualElement.getDefaultTransition() || {} : _b; + if (options.transitionOverride) { + transition = options.transitionOverride; + } + /** + * If we have a variant, create a callback that runs it as an animation. + * Otherwise, we resolve a Promise immediately for a composable no-op. + */ + var getAnimation = resolved ? function () { + return animateTarget(visualElement, resolved, options); + } : function () { + return Promise.resolve(); + }; + /** + * If we have children, create a callback that runs all their animations. + * Otherwise, we resolve a Promise immediately for a composable no-op. + */ + var getChildAnimations = ((_a = visualElement.variantChildren) === null || _a === void 0 ? void 0 : _a.size) ? function (forwardDelay) { + if (forwardDelay === void 0) { + forwardDelay = 0; + } + var _a = transition.delayChildren, + delayChildren = _a === void 0 ? 0 : _a, + staggerChildren = transition.staggerChildren, + staggerDirection = transition.staggerDirection; + return animateChildren(visualElement, variant, delayChildren + forwardDelay, staggerChildren, staggerDirection, options); + } : function () { + return Promise.resolve(); + }; + /** + * If the transition explicitly defines a "when" option, we need to resolve either + * this animation or all children animations before playing the other. + */ + var when = transition.when; + if (when) { + var _c = tslib.__read(when === "beforeChildren" ? [getAnimation, getChildAnimations] : [getChildAnimations, getAnimation], 2), + first = _c[0], + last = _c[1]; + return first().then(last); + } else { + return Promise.all([getAnimation(), getChildAnimations(options.delay)]); + } +} +/** + * @internal + */ +function animateTarget(visualElement, definition, _a) { + var _b; + var _c = _a === void 0 ? {} : _a, + _d = _c.delay, + delay = _d === void 0 ? 0 : _d, + transitionOverride = _c.transitionOverride, + type = _c.type; + var _e = visualElement.makeTargetAnimatable(definition), + _f = _e.transition, + transition = _f === void 0 ? visualElement.getDefaultTransition() : _f, + transitionEnd = _e.transitionEnd, + target = tslib.__rest(_e, ["transition", "transitionEnd"]); + if (transitionOverride) transition = transitionOverride; + var animations = []; + var animationTypeState = type && ((_b = visualElement.animationState) === null || _b === void 0 ? void 0 : _b.getState()[type]); + for (var key in target) { + var value = visualElement.getValue(key); + var valueTarget = target[key]; + if (!value || valueTarget === undefined || animationTypeState && shouldBlockAnimation(animationTypeState, key)) { + continue; + } + var valueTransition = tslib.__assign({ + delay: delay + }, transition); + /** + * Make animation instant if this is a transform prop and we should reduce motion. + */ + if (visualElement.shouldReduceMotion && isTransformProp(key)) { + valueTransition = tslib.__assign(tslib.__assign({}, valueTransition), { + type: false, + delay: 0 + }); + } + var animation = startAnimation(key, value, valueTarget, valueTransition); + animations.push(animation); + } + return Promise.all(animations).then(function () { + transitionEnd && setTarget(visualElement, transitionEnd); + }); +} +function animateChildren(visualElement, variant, delayChildren, staggerChildren, staggerDirection, options) { + if (delayChildren === void 0) { + delayChildren = 0; + } + if (staggerChildren === void 0) { + staggerChildren = 0; + } + if (staggerDirection === void 0) { + staggerDirection = 1; + } + var animations = []; + var maxStaggerDuration = (visualElement.variantChildren.size - 1) * staggerChildren; + var generateStaggerDuration = staggerDirection === 1 ? function (i) { + if (i === void 0) { + i = 0; + } + return i * staggerChildren; + } : function (i) { + if (i === void 0) { + i = 0; + } + return maxStaggerDuration - i * staggerChildren; + }; + Array.from(visualElement.variantChildren).sort(sortByTreeOrder).forEach(function (child, i) { + animations.push(animateVariant(child, variant, tslib.__assign(tslib.__assign({}, options), { + delay: delayChildren + generateStaggerDuration(i) + })).then(function () { + return child.notifyAnimationComplete(variant); + })); + }); + return Promise.all(animations); +} +function stopAnimation(visualElement) { + visualElement.forEachValue(function (value) { + return value.stop(); + }); +} +function sortByTreeOrder(a, b) { + return a.sortNodePosition(b); +} +/** + * Decide whether we should block this animation. Previously, we achieved this + * just by checking whether the key was listed in protectedKeys, but this + * posed problems if an animation was triggered by afterChildren and protectedKeys + * had been set to true in the meantime. + */ +function shouldBlockAnimation(_a, key) { + var protectedKeys = _a.protectedKeys, + needsAnimating = _a.needsAnimating; + var shouldBlock = protectedKeys.hasOwnProperty(key) && needsAnimating[key] !== true; + needsAnimating[key] = false; + return shouldBlock; +} +var variantPriorityOrder = [exports.AnimationType.Animate, exports.AnimationType.InView, exports.AnimationType.Focus, exports.AnimationType.Hover, exports.AnimationType.Tap, exports.AnimationType.Drag, exports.AnimationType.Exit]; +var reversePriorityOrder = tslib.__spreadArray([], tslib.__read(variantPriorityOrder), false).reverse(); +var numAnimationTypes = variantPriorityOrder.length; +function animateList(visualElement) { + return function (animations) { + return Promise.all(animations.map(function (_a) { + var animation = _a.animation, + options = _a.options; + return animateVisualElement(visualElement, animation, options); + })); + }; +} +function createAnimationState(visualElement) { + var animate = animateList(visualElement); + var state = createState(); + var allAnimatedKeys = {}; + var isInitialRender = true; + /** + * This function will be used to reduce the animation definitions for + * each active animation type into an object of resolved values for it. + */ + var buildResolvedTypeValues = function (acc, definition) { + var resolved = resolveVariant(visualElement, definition); + if (resolved) { + resolved.transition; + var transitionEnd = resolved.transitionEnd, + target = tslib.__rest(resolved, ["transition", "transitionEnd"]); + acc = tslib.__assign(tslib.__assign(tslib.__assign({}, acc), target), transitionEnd); + } + return acc; + }; + function isAnimated(key) { + return allAnimatedKeys[key] !== undefined; + } + /** + * This just allows us to inject mocked animation functions + * @internal + */ + function setAnimateFunction(makeAnimator) { + animate = makeAnimator(visualElement); + } + /** + * When we receive new props, we need to: + * 1. Create a list of protected keys for each type. This is a directory of + * value keys that are currently being "handled" by types of a higher priority + * so that whenever an animation is played of a given type, these values are + * protected from being animated. + * 2. Determine if an animation type needs animating. + * 3. Determine if any values have been removed from a type and figure out + * what to animate those to. + */ + function animateChanges(options, changedActiveType) { + var _a; + var props = visualElement.getProps(); + var context = visualElement.getVariantContext(true) || {}; + /** + * A list of animations that we'll build into as we iterate through the animation + * types. This will get executed at the end of the function. + */ + var animations = []; + /** + * Keep track of which values have been removed. Then, as we hit lower priority + * animation types, we can check if they contain removed values and animate to that. + */ + var removedKeys = new Set(); + /** + * A dictionary of all encountered keys. This is an object to let us build into and + * copy it without iteration. Each time we hit an animation type we set its protected + * keys - the keys its not allowed to animate - to the latest version of this object. + */ + var encounteredKeys = {}; + /** + * If a variant has been removed at a given index, and this component is controlling + * variant animations, we want to ensure lower-priority variants are forced to animate. + */ + var removedVariantIndex = Infinity; + var _loop_1 = function (i) { + var type = reversePriorityOrder[i]; + var typeState = state[type]; + var prop = (_a = props[type]) !== null && _a !== void 0 ? _a : context[type]; + var propIsVariant = isVariantLabel(prop); + /** + * If this type has *just* changed isActive status, set activeDelta + * to that status. Otherwise set to null. + */ + var activeDelta = type === changedActiveType ? typeState.isActive : null; + if (activeDelta === false) removedVariantIndex = i; + /** + * If this prop is an inherited variant, rather than been set directly on the + * component itself, we want to make sure we allow the parent to trigger animations. + * + * TODO: Can probably change this to a !isControllingVariants check + */ + var isInherited = prop === context[type] && prop !== props[type] && propIsVariant; + /** + * + */ + if (isInherited && isInitialRender && visualElement.manuallyAnimateOnMount) { + isInherited = false; + } + /** + * Set all encountered keys so far as the protected keys for this type. This will + * be any key that has been animated or otherwise handled by active, higher-priortiy types. + */ + typeState.protectedKeys = tslib.__assign({}, encounteredKeys); + // Check if we can skip analysing this prop early + if ( + // If it isn't active and hasn't *just* been set as inactive + !typeState.isActive && activeDelta === null || + // If we didn't and don't have any defined prop for this animation type + !prop && !typeState.prevProp || + // Or if the prop doesn't define an animation + isAnimationControls(prop) || typeof prop === "boolean") { + return "continue"; + } + /** + * As we go look through the values defined on this type, if we detect + * a changed value or a value that was removed in a higher priority, we set + * this to true and add this prop to the animation list. + */ + var variantDidChange = checkVariantsDidChange(typeState.prevProp, prop); + var shouldAnimateType = variantDidChange || + // If we're making this variant active, we want to always make it active + type === changedActiveType && typeState.isActive && !isInherited && propIsVariant || + // If we removed a higher-priority variant (i is in reverse order) + i > removedVariantIndex && propIsVariant; + /** + * As animations can be set as variant lists, variants or target objects, we + * coerce everything to an array if it isn't one already + */ + var definitionList = Array.isArray(prop) ? prop : [prop]; + /** + * Build an object of all the resolved values. We'll use this in the subsequent + * animateChanges calls to determine whether a value has changed. + */ + var resolvedValues = definitionList.reduce(buildResolvedTypeValues, {}); + if (activeDelta === false) resolvedValues = {}; + /** + * Now we need to loop through all the keys in the prev prop and this prop, + * and decide: + * 1. If the value has changed, and needs animating + * 2. If it has been removed, and needs adding to the removedKeys set + * 3. If it has been removed in a higher priority type and needs animating + * 4. If it hasn't been removed in a higher priority but hasn't changed, and + * needs adding to the type's protectedKeys list. + */ + var _b = typeState.prevResolvedValues, + prevResolvedValues = _b === void 0 ? {} : _b; + var allKeys = tslib.__assign(tslib.__assign({}, prevResolvedValues), resolvedValues); + var markToAnimate = function (key) { + shouldAnimateType = true; + removedKeys.delete(key); + typeState.needsAnimating[key] = true; + }; + for (var key in allKeys) { + var next = resolvedValues[key]; + var prev = prevResolvedValues[key]; + // If we've already handled this we can just skip ahead + if (encounteredKeys.hasOwnProperty(key)) continue; + /** + * If the value has changed, we probably want to animate it. + */ + if (next !== prev) { + /** + * If both values are keyframes, we need to shallow compare them to + * detect whether any value has changed. If it has, we animate it. + */ + if (isKeyframesTarget(next) && isKeyframesTarget(prev)) { + if (!shallowCompare(next, prev) || variantDidChange) { + markToAnimate(key); + } else { + /** + * If it hasn't changed, we want to ensure it doesn't animate by + * adding it to the list of protected keys. + */ + typeState.protectedKeys[key] = true; + } + } else if (next !== undefined) { + // If next is defined and doesn't equal prev, it needs animating + markToAnimate(key); + } else { + // If it's undefined, it's been removed. + removedKeys.add(key); + } + } else if (next !== undefined && removedKeys.has(key)) { + /** + * If next hasn't changed and it isn't undefined, we want to check if it's + * been removed by a higher priority + */ + markToAnimate(key); + } else { + /** + * If it hasn't changed, we add it to the list of protected values + * to ensure it doesn't get animated. + */ + typeState.protectedKeys[key] = true; + } + } + /** + * Update the typeState so next time animateChanges is called we can compare the + * latest prop and resolvedValues to these. + */ + typeState.prevProp = prop; + typeState.prevResolvedValues = resolvedValues; + /** + * + */ + if (typeState.isActive) { + encounteredKeys = tslib.__assign(tslib.__assign({}, encounteredKeys), resolvedValues); + } + if (isInitialRender && visualElement.blockInitialAnimation) { + shouldAnimateType = false; + } + /** + * If this is an inherited prop we want to hard-block animations + * TODO: Test as this should probably still handle animations triggered + * by removed values? + */ + if (shouldAnimateType && !isInherited) { + animations.push.apply(animations, tslib.__spreadArray([], tslib.__read(definitionList.map(function (animation) { + return { + animation: animation, + options: tslib.__assign({ + type: type + }, options) + }; + })), false)); + } + }; + /** + * Iterate through all animation types in reverse priority order. For each, we want to + * detect which values it's handling and whether or not they've changed (and therefore + * need to be animated). If any values have been removed, we want to detect those in + * lower priority props and flag for animation. + */ + for (var i = 0; i < numAnimationTypes; i++) { + _loop_1(i); + } + allAnimatedKeys = tslib.__assign({}, encounteredKeys); + /** + * If there are some removed value that haven't been dealt with, + * we need to create a new animation that falls back either to the value + * defined in the style prop, or the last read value. + */ + if (removedKeys.size) { + var fallbackAnimation_1 = {}; + removedKeys.forEach(function (key) { + var fallbackTarget = visualElement.getBaseTarget(key); + if (fallbackTarget !== undefined) { + fallbackAnimation_1[key] = fallbackTarget; + } + }); + animations.push({ + animation: fallbackAnimation_1 + }); + } + var shouldAnimate = Boolean(animations.length); + if (isInitialRender && props.initial === false && !visualElement.manuallyAnimateOnMount) { + shouldAnimate = false; + } + isInitialRender = false; + return shouldAnimate ? animate(animations) : Promise.resolve(); + } + /** + * Change whether a certain animation type is active. + */ + function setActive(type, isActive, options) { + var _a; + // If the active state hasn't changed, we can safely do nothing here + if (state[type].isActive === isActive) return Promise.resolve(); + // Propagate active change to children + (_a = visualElement.variantChildren) === null || _a === void 0 ? void 0 : _a.forEach(function (child) { + var _a; + return (_a = child.animationState) === null || _a === void 0 ? void 0 : _a.setActive(type, isActive); + }); + state[type].isActive = isActive; + var animations = animateChanges(options, type); + for (var key in state) { + state[key].protectedKeys = {}; + } + return animations; + } + return { + isAnimated: isAnimated, + animateChanges: animateChanges, + setActive: setActive, + setAnimateFunction: setAnimateFunction, + getState: function () { + return state; + } + }; +} +function checkVariantsDidChange(prev, next) { + if (typeof next === "string") { + return next !== prev; + } else if (isVariantLabels(next)) { + return !shallowCompare(next, prev); + } + return false; +} +function createTypeState(isActive) { + if (isActive === void 0) { + isActive = false; + } + return { + isActive: isActive, + protectedKeys: {}, + needsAnimating: {}, + prevResolvedValues: {} + }; +} +function createState() { + var _a; + return _a = {}, _a[exports.AnimationType.Animate] = createTypeState(true), _a[exports.AnimationType.InView] = createTypeState(), _a[exports.AnimationType.Hover] = createTypeState(), _a[exports.AnimationType.Tap] = createTypeState(), _a[exports.AnimationType.Drag] = createTypeState(), _a[exports.AnimationType.Focus] = createTypeState(), _a[exports.AnimationType.Exit] = createTypeState(), _a; +} +var animations = { + animation: makeRenderlessComponent(function (_a) { + var visualElement = _a.visualElement, + animate = _a.animate; + /** + * We dynamically generate the AnimationState manager as it contains a reference + * to the underlying animation library. We only want to load that if we load this, + * so people can optionally code split it out using the `m` component. + */ + visualElement.animationState || (visualElement.animationState = createAnimationState(visualElement)); + /** + * Subscribe any provided AnimationControls to the component's VisualElement + */ + if (isAnimationControls(animate)) { + React.useEffect(function () { + return animate.subscribe(visualElement); + }, [animate]); + } + }), + exit: makeRenderlessComponent(function (props) { + var custom = props.custom, + visualElement = props.visualElement; + var _a = tslib.__read(usePresence(), 2), + isPresent = _a[0], + safeToRemove = _a[1]; + var presenceContext = React.useContext(PresenceContext); + React.useEffect(function () { + var _a, _b; + visualElement.isPresent = isPresent; + var animation = (_a = visualElement.animationState) === null || _a === void 0 ? void 0 : _a.setActive(exports.AnimationType.Exit, !isPresent, { + custom: (_b = presenceContext === null || presenceContext === void 0 ? void 0 : presenceContext.custom) !== null && _b !== void 0 ? _b : custom + }); + !isPresent && (animation === null || animation === void 0 ? void 0 : animation.then(safeToRemove)); + }, [isPresent]); + }) +}; + +/** + * @internal + */ +var PanSession = /** @class */function () { + function PanSession(event, handlers, _a) { + var _this = this; + var _b = _a === void 0 ? {} : _a, + transformPagePoint = _b.transformPagePoint; + /** + * @internal + */ + this.startEvent = null; + /** + * @internal + */ + this.lastMoveEvent = null; + /** + * @internal + */ + this.lastMoveEventInfo = null; + /** + * @internal + */ + this.handlers = {}; + this.updatePoint = function () { + if (!(_this.lastMoveEvent && _this.lastMoveEventInfo)) return; + var info = getPanInfo(_this.lastMoveEventInfo, _this.history); + var isPanStarted = _this.startEvent !== null; + // Only start panning if the offset is larger than 3 pixels. If we make it + // any larger than this we'll want to reset the pointer history + // on the first update to avoid visual snapping to the cursoe. + var isDistancePastThreshold = popmotion.distance(info.offset, { + x: 0, + y: 0 + }) >= 3; + if (!isPanStarted && !isDistancePastThreshold) return; + var point = info.point; + var timestamp = sync.getFrameData().timestamp; + _this.history.push(tslib.__assign(tslib.__assign({}, point), { + timestamp: timestamp + })); + var _a = _this.handlers, + onStart = _a.onStart, + onMove = _a.onMove; + if (!isPanStarted) { + onStart && onStart(_this.lastMoveEvent, info); + _this.startEvent = _this.lastMoveEvent; + } + onMove && onMove(_this.lastMoveEvent, info); + }; + this.handlePointerMove = function (event, info) { + _this.lastMoveEvent = event; + _this.lastMoveEventInfo = transformPoint(info, _this.transformPagePoint); + // Because Safari doesn't trigger mouseup events when it's above a ` ' + e.phrase("(Use line:column or scroll% syntax)") + ""; + } + c(i, "getJumpDialog"); + function a(e, t) { + var n = Number(t); + return /^[-+]/.test(t) ? e.getCursor().line + n : n - 1; + } + c(a, "interpretLine"), o.commands.jumpToLine = function (e) { + var t = e.getCursor(); + s(e, i(e), e.phrase("Jump to line:"), t.line + 1 + ":" + t.ch, function (n) { + if (n) { + var r; + if (r = /^\s*([\+\-]?\d+)\s*\:\s*(\d+)\s*$/.exec(n)) e.setCursor(a(e, r[1]), Number(r[2]));else if (r = /^\s*([\+\-]?\d+(\.\d+)?)\%\s*/.exec(n)) { + var l = Math.round(e.lineCount() * Number(r[1]) / 100); + /^[-+]/.test(r[1]) && (l = t.line + l + 1), e.setCursor(l - 1, t.ch); + } else (r = /^\s*\:?\s*([\+\-]?\d+)\s*/.exec(n)) && e.setCursor(a(e, r[1]), t.ch); + } + }); + }, o.keyMap.default["Alt-G"] = "jumpToLine"; + }); +})(); +var d = b.exports; +const j = f.getDefaultExportFromCjs(d), + y = h({ + __proto__: null, + default: j + }, [d]); +exports.jumpToLine = y; + +/***/ }), + +/***/ "../../graphiql-react/dist/jump.cjs.js": +/*!*********************************************!*\ + !*** ../../graphiql-react/dist/jump.cjs.js ***! + \*********************************************/ +/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) { + + + +var c = Object.defineProperty; +var s = (e, r) => c(e, "name", { + value: r, + configurable: !0 +}); +const u = __webpack_require__(/*! ./codemirror.cjs.js */ "../../graphiql-react/dist/codemirror.cjs.js"), + d = __webpack_require__(/*! ./SchemaReference.cjs.js */ "../../graphiql-react/dist/SchemaReference.cjs.js"); +__webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"); +__webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +__webpack_require__(/*! ./forEachState.cjs.js */ "../../graphiql-react/dist/forEachState.cjs.js"); +u.CodeMirror.defineOption("jump", !1, (e, r, n) => { + if (n && n !== u.CodeMirror.Init) { + const t = e.state.jump.onMouseOver; + u.CodeMirror.off(e.getWrapperElement(), "mouseover", t); + const i = e.state.jump.onMouseOut; + u.CodeMirror.off(e.getWrapperElement(), "mouseout", i), u.CodeMirror.off(document, "keydown", e.state.jump.onKeyDown), delete e.state.jump; + } + if (r) { + const t = e.state.jump = { + options: r, + onMouseOver: M.bind(null, e), + onMouseOut: m.bind(null, e), + onKeyDown: g.bind(null, e) + }; + u.CodeMirror.on(e.getWrapperElement(), "mouseover", t.onMouseOver), u.CodeMirror.on(e.getWrapperElement(), "mouseout", t.onMouseOut), u.CodeMirror.on(document, "keydown", t.onKeyDown); + } +}); +function M(e, r) { + const n = r.target || r.srcElement; + if (!(n instanceof HTMLElement) || (n == null ? void 0 : n.nodeName) !== "SPAN") return; + const t = n.getBoundingClientRect(), + i = { + left: (t.left + t.right) / 2, + top: (t.top + t.bottom) / 2 + }; + e.state.jump.cursor = i, e.state.jump.isHoldingModifier && l(e); +} +s(M, "onMouseOver"); +function m(e) { + if (!e.state.jump.isHoldingModifier && e.state.jump.cursor) { + e.state.jump.cursor = null; + return; + } + e.state.jump.isHoldingModifier && e.state.jump.marker && p(e); +} +s(m, "onMouseOut"); +function g(e, r) { + if (e.state.jump.isHoldingModifier || !k(r.key)) return; + e.state.jump.isHoldingModifier = !0, e.state.jump.cursor && l(e); + const n = s(o => { + o.code === r.code && (e.state.jump.isHoldingModifier = !1, e.state.jump.marker && p(e), u.CodeMirror.off(document, "keyup", n), u.CodeMirror.off(document, "click", t), e.off("mousedown", i)); + }, "onKeyUp"), + t = s(o => { + const { + destination: a, + options: f + } = e.state.jump; + a && f.onClick(a, o); + }, "onClick"), + i = s((o, a) => { + e.state.jump.destination && (a.codemirrorIgnore = !0); + }, "onMouseDown"); + u.CodeMirror.on(document, "keyup", n), u.CodeMirror.on(document, "click", t), e.on("mousedown", i); +} +s(g, "onKeyDown"); +const j = typeof navigator < "u" && navigator && navigator.appVersion.includes("Mac"); +function k(e) { + return e === (j ? "Meta" : "Control"); +} +s(k, "isJumpModifier"); +function l(e) { + if (e.state.jump.marker) return; + const { + cursor: r, + options: n + } = e.state.jump, + t = e.coordsChar(r), + i = e.getTokenAt(t, !0), + o = n.getDestination || e.getHelper(t, "jump"); + if (o) { + const a = o(i, n, e); + if (a) { + const f = e.markText({ + line: t.line, + ch: i.start + }, { + line: t.line, + ch: i.end + }, { + className: "CodeMirror-jump-token" + }); + e.state.jump.marker = f, e.state.jump.destination = a; + } + } +} +s(l, "enableJumpMode"); +function p(e) { + const { + marker: r + } = e.state.jump; + e.state.jump.marker = null, e.state.jump.destination = null, r.clear(); +} +s(p, "disableJumpMode"); +u.CodeMirror.registerHelper("jump", "graphql", (e, r) => { + if (!r.schema || !r.onClick || !e.state) return; + const { + state: n + } = e, + { + kind: t, + step: i + } = n, + o = d.getTypeInfo(r.schema, n); + if (t === "Field" && i === 0 && o.fieldDef || t === "AliasedField" && i === 2 && o.fieldDef) return d.getFieldReference(o); + if (t === "Directive" && i === 1 && o.directiveDef) return d.getDirectiveReference(o); + if (t === "Argument" && i === 0 && o.argDef) return d.getArgumentReference(o); + if (t === "EnumValue" && o.enumValue) return d.getEnumValueReference(o); + if (t === "NamedType" && o.type) return d.getTypeReference(o); +}); + +/***/ }), + +/***/ "../../graphiql-react/dist/lint.cjs.js": +/*!*********************************************!*\ + !*** ../../graphiql-react/dist/lint.cjs.js ***! + \*********************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +var W = Object.defineProperty; +var s = (h, v) => W(h, "name", { + value: v, + configurable: !0 +}); +const x = __webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"); +function q(h, v) { + for (var l = 0; l < v.length; l++) { + const u = v[l]; + if (typeof u != "string" && !Array.isArray(u)) { + for (const g in u) if (g !== "default" && !(g in h)) { + const c = Object.getOwnPropertyDescriptor(u, g); + c && Object.defineProperty(h, g, c.get ? c : { + enumerable: !0, + get: () => u[g] + }); + } + } + } + return Object.freeze(Object.defineProperty(h, Symbol.toStringTag, { + value: "Module" + })); +} +s(q, "_mergeNamespaces"); +var B = { + exports: {} +}; +(function (h, v) { + (function (l) { + l(x.requireCodemirror()); + })(function (l) { + var u = "CodeMirror-lint-markers", + g = "CodeMirror-lint-line-"; + function c(t, e, r) { + var n = document.createElement("div"); + n.className = "CodeMirror-lint-tooltip cm-s-" + t.options.theme, n.appendChild(r.cloneNode(!0)), t.state.lint.options.selfContain ? t.getWrapperElement().appendChild(n) : document.body.appendChild(n); + function i(o) { + if (!n.parentNode) return l.off(document, "mousemove", i); + n.style.top = Math.max(0, o.clientY - n.offsetHeight - 5) + "px", n.style.left = o.clientX + 5 + "px"; + } + return s(i, "position"), l.on(document, "mousemove", i), i(e), n.style.opacity != null && (n.style.opacity = 1), n; + } + s(c, "showTooltip"); + function L(t) { + t.parentNode && t.parentNode.removeChild(t); + } + s(L, "rm"); + function A(t) { + t.parentNode && (t.style.opacity == null && L(t), t.style.opacity = 0, setTimeout(function () { + L(t); + }, 600)); + } + s(A, "hideTooltip"); + function M(t, e, r, n) { + var i = c(t, e, r); + function o() { + l.off(n, "mouseout", o), i && (A(i), i = null); + } + s(o, "hide"); + var a = setInterval(function () { + if (i) for (var f = n;; f = f.parentNode) { + if (f && f.nodeType == 11 && (f = f.host), f == document.body) return; + if (!f) { + o(); + break; + } + } + if (!i) return clearInterval(a); + }, 400); + l.on(n, "mouseout", o); + } + s(M, "showTooltipFor"); + function F(t, e, r) { + this.marked = [], e instanceof Function && (e = { + getAnnotations: e + }), (!e || e === !0) && (e = {}), this.options = {}, this.linterOptions = e.options || {}; + for (var n in C) this.options[n] = C[n]; + for (var n in e) C.hasOwnProperty(n) ? e[n] != null && (this.options[n] = e[n]) : e.options || (this.linterOptions[n] = e[n]); + this.timeout = null, this.hasGutter = r, this.onMouseOver = function (i) { + U(t, i); + }, this.waitingFor = 0; + } + s(F, "LintState"); + var C = { + highlightLines: !1, + tooltips: !0, + delay: 500, + lintOnChange: !0, + getAnnotations: null, + async: !1, + selfContain: null, + formatAnnotation: null, + onUpdateLinting: null + }; + function E(t) { + var e = t.state.lint; + e.hasGutter && t.clearGutter(u), e.options.highlightLines && G(t); + for (var r = 0; r < e.marked.length; ++r) e.marked[r].clear(); + e.marked.length = 0; + } + s(E, "clearMarks"); + function G(t) { + t.eachLine(function (e) { + var r = e.wrapClass && /\bCodeMirror-lint-line-\w+\b/.exec(e.wrapClass); + r && t.removeLineClass(e, "wrap", r[0]); + }); + } + s(G, "clearErrorLines"); + function I(t, e, r, n, i) { + var o = document.createElement("div"), + a = o; + return o.className = "CodeMirror-lint-marker CodeMirror-lint-marker-" + r, n && (a = o.appendChild(document.createElement("div")), a.className = "CodeMirror-lint-marker CodeMirror-lint-marker-multiple"), i != !1 && l.on(a, "mouseover", function (f) { + M(t, f, e, a); + }), o; + } + s(I, "makeMarker"); + function D(t, e) { + return t == "error" ? t : e; + } + s(D, "getMaxSeverity"); + function j(t) { + for (var e = [], r = 0; r < t.length; ++r) { + var n = t[r], + i = n.from.line; + (e[i] || (e[i] = [])).push(n); + } + return e; + } + s(j, "groupByLine"); + function N(t) { + var e = t.severity; + e || (e = "error"); + var r = document.createElement("div"); + return r.className = "CodeMirror-lint-message CodeMirror-lint-message-" + e, typeof t.messageHTML < "u" ? r.innerHTML = t.messageHTML : r.appendChild(document.createTextNode(t.message)), r; + } + s(N, "annotationTooltip"); + function H(t, e) { + var r = t.state.lint, + n = ++r.waitingFor; + function i() { + n = -1, t.off("change", i); + } + s(i, "abort"), t.on("change", i), e(t.getValue(), function (o, a) { + t.off("change", i), r.waitingFor == n && (a && o instanceof l && (o = a), t.operation(function () { + O(t, o); + })); + }, r.linterOptions, t); + } + s(H, "lintAsync"); + function k(t) { + var e = t.state.lint; + if (e) { + var r = e.options, + n = r.getAnnotations || t.getHelper(l.Pos(0, 0), "lint"); + if (n) if (r.async || n.async) H(t, n);else { + var i = n(t.getValue(), e.linterOptions, t); + if (!i) return; + i.then ? i.then(function (o) { + t.operation(function () { + O(t, o); + }); + }) : t.operation(function () { + O(t, i); + }); + } + } + } + s(k, "startLinting"); + function O(t, e) { + var r = t.state.lint; + if (r) { + var n = r.options; + E(t); + for (var i = j(e), o = 0; o < i.length; ++o) { + var a = i[o]; + if (a) { + var f = []; + a = a.filter(function (w) { + return f.indexOf(w.message) > -1 ? !1 : f.push(w.message); + }); + for (var p = null, m = r.hasGutter && document.createDocumentFragment(), T = 0; T < a.length; ++T) { + var d = a[T], + y = d.severity; + y || (y = "error"), p = D(p, y), n.formatAnnotation && (d = n.formatAnnotation(d)), r.hasGutter && m.appendChild(N(d)), d.to && r.marked.push(t.markText(d.from, d.to, { + className: "CodeMirror-lint-mark CodeMirror-lint-mark-" + y, + __annotation: d + })); + } + r.hasGutter && t.setGutterMarker(o, u, I(t, m, p, i[o].length > 1, n.tooltips)), n.highlightLines && t.addLineClass(o, "wrap", g + p); + } + } + n.onUpdateLinting && n.onUpdateLinting(e, i, t); + } + } + s(O, "updateLinting"); + function b(t) { + var e = t.state.lint; + e && (clearTimeout(e.timeout), e.timeout = setTimeout(function () { + k(t); + }, e.options.delay)); + } + s(b, "onChange"); + function P(t, e, r) { + for (var n = r.target || r.srcElement, i = document.createDocumentFragment(), o = 0; o < e.length; o++) { + var a = e[o]; + i.appendChild(N(a)); + } + M(t, r, i, n); + } + s(P, "popupTooltips"); + function U(t, e) { + var r = e.target || e.srcElement; + if (/\bCodeMirror-lint-mark-/.test(r.className)) { + for (var n = r.getBoundingClientRect(), i = (n.left + n.right) / 2, o = (n.top + n.bottom) / 2, a = t.findMarksAt(t.coordsChar({ + left: i, + top: o + }, "client")), f = [], p = 0; p < a.length; ++p) { + var m = a[p].__annotation; + m && f.push(m); + } + f.length && P(t, f, e); + } + } + s(U, "onMouseOver"), l.defineOption("lint", !1, function (t, e, r) { + if (r && r != l.Init && (E(t), t.state.lint.options.lintOnChange !== !1 && t.off("change", b), l.off(t.getWrapperElement(), "mouseover", t.state.lint.onMouseOver), clearTimeout(t.state.lint.timeout), delete t.state.lint), e) { + for (var n = t.getOption("gutters"), i = !1, o = 0; o < n.length; ++o) n[o] == u && (i = !0); + var a = t.state.lint = new F(t, e, i); + a.options.lintOnChange && t.on("change", b), a.options.tooltips != !1 && a.options.tooltips != "gutter" && l.on(t.getWrapperElement(), "mouseover", a.onMouseOver), k(t); + } + }), l.defineExtension("performLint", function () { + k(this); + }); + }); +})(); +var _ = B.exports; +const R = x.getDefaultExportFromCjs(_), + V = q({ + __proto__: null, + default: R + }, [_]); +exports.lint = V; + +/***/ }), + +/***/ "../../graphiql-react/dist/lint.cjs2.js": +/*!**********************************************!*\ + !*** ../../graphiql-react/dist/lint.cjs2.js ***! + \**********************************************/ +/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) { + + + +const t = __webpack_require__(/*! ./codemirror.cjs.js */ "../../graphiql-react/dist/codemirror.cjs.js"), + c = __webpack_require__(/*! graphql-language-service */ "../../graphql-language-service/esm/index.js"); +__webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"); +const a = ["error", "warning", "information", "hint"], + g = { + "GraphQL: Validation": "validation", + "GraphQL: Deprecation": "deprecation", + "GraphQL: Syntax": "syntax" + }; +t.CodeMirror.registerHelper("lint", "graphql", (n, s) => { + const { + schema: r, + validationRules: i, + externalFragments: o + } = s; + return c.getDiagnostics(n, r, i, void 0, o).map(e => ({ + message: e.message, + severity: e.severity ? a[e.severity - 1] : a[0], + type: e.source ? g[e.source] : void 0, + from: t.CodeMirror.Pos(e.range.start.line, e.range.start.character), + to: t.CodeMirror.Pos(e.range.end.line, e.range.end.character) + })); +}); + +/***/ }), + +/***/ "../../graphiql-react/dist/lint.cjs3.js": +/*!**********************************************!*\ + !*** ../../graphiql-react/dist/lint.cjs3.js ***! + \**********************************************/ +/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) { + + + +var V = Object.defineProperty; +var t = (e, n) => V(e, "name", { + value: n, + configurable: !0 +}); +const I = __webpack_require__(/*! ./codemirror.cjs.js */ "../../graphiql-react/dist/codemirror.cjs.js"), + b = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +__webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"); +function C(e) { + d = e, E = e.length, s = u = N = -1, o(), y(); + const n = q(); + return p("EOF"), n; +} +t(C, "jsonParse"); +let d, E, s, u, N, r, l; +function q() { + const e = s, + n = []; + if (p("{"), !x("}")) { + do n.push(M()); while (x(",")); + p("}"); + } + return { + kind: "Object", + start: e, + end: N, + members: n + }; +} +t(q, "parseObj"); +function M() { + const e = s, + n = l === "String" ? G() : null; + p("String"), p(":"); + const i = B(); + return { + kind: "Member", + start: e, + end: N, + key: n, + value: i + }; +} +t(M, "parseMember"); +function v() { + const e = s, + n = []; + if (p("["), !x("]")) { + do n.push(B()); while (x(",")); + p("]"); + } + return { + kind: "Array", + start: e, + end: N, + values: n + }; +} +t(v, "parseArr"); +function B() { + switch (l) { + case "[": + return v(); + case "{": + return q(); + case "String": + case "Number": + case "Boolean": + case "Null": + const e = G(); + return y(), e; + } + p("Value"); +} +t(B, "parseVal"); +function G() { + return { + kind: l, + start: s, + end: u, + value: JSON.parse(d.slice(s, u)) + }; +} +t(G, "curToken"); +function p(e) { + if (l === e) { + y(); + return; + } + let n; + if (l === "EOF") n = "[end of file]";else if (u - s > 1) n = "`" + d.slice(s, u) + "`";else { + const i = d.slice(s).match(/^.+?\b/); + n = "`" + (i ? i[0] : d[s]) + "`"; + } + throw k(`Expected ${e} but found ${n}.`); +} +t(p, "expect"); +class j extends Error { + constructor(n, i) { + super(n), this.position = i; + } +} +t(j, "JSONSyntaxError"); +function k(e) { + return new j(e, { + start: s, + end: u + }); +} +t(k, "syntaxError"); +function x(e) { + if (l === e) return y(), !0; +} +t(x, "skip"); +function o() { + return u < E && (u++, r = u === E ? 0 : d.charCodeAt(u)), r; +} +t(o, "ch"); +function y() { + for (N = u; r === 9 || r === 10 || r === 13 || r === 32;) o(); + if (r === 0) { + l = "EOF"; + return; + } + switch (s = u, r) { + case 34: + return l = "String", D(); + case 45: + case 48: + case 49: + case 50: + case 51: + case 52: + case 53: + case 54: + case 55: + case 56: + case 57: + return l = "Number", H(); + case 102: + if (d.slice(s, s + 5) !== "false") break; + u += 4, o(), l = "Boolean"; + return; + case 110: + if (d.slice(s, s + 4) !== "null") break; + u += 3, o(), l = "Null"; + return; + case 116: + if (d.slice(s, s + 4) !== "true") break; + u += 3, o(), l = "Boolean"; + return; + } + l = d[s], o(); +} +t(y, "lex"); +function D() { + for (o(); r !== 34 && r > 31;) if (r === 92) switch (r = o(), r) { + case 34: + case 47: + case 92: + case 98: + case 102: + case 110: + case 114: + case 116: + o(); + break; + case 117: + o(), w(), w(), w(), w(); + break; + default: + throw k("Bad character escape sequence."); + } else { + if (u === E) throw k("Unterminated string."); + o(); + } + if (r === 34) { + o(); + return; + } + throw k("Unterminated string."); +} +t(D, "readString"); +function w() { + if (r >= 48 && r <= 57 || r >= 65 && r <= 70 || r >= 97 && r <= 102) return o(); + throw k("Expected hexadecimal digit."); +} +t(w, "readHex"); +function H() { + r === 45 && o(), r === 48 ? o() : $(), r === 46 && (o(), $()), (r === 69 || r === 101) && (r = o(), (r === 43 || r === 45) && o(), $()); +} +t(H, "readNumber"); +function $() { + if (r < 48 || r > 57) throw k("Expected decimal digit."); + do o(); while (r >= 48 && r <= 57); +} +t($, "readDigits"); +I.CodeMirror.registerHelper("lint", "graphql-variables", (e, n, i) => { + if (!e) return []; + let f; + try { + f = C(e); + } catch (c) { + if (c instanceof j) return [F(i, c.position, c.message)]; + throw c; + } + const { + variableToType: a + } = n; + return a ? U(i, a, f) : []; +}); +function U(e, n, i) { + var f; + const a = []; + for (const c of i.members) if (c) { + const h = (f = c.key) === null || f === void 0 ? void 0 : f.value, + m = n[h]; + if (m) for (const [O, Q] of g(m, c.value)) a.push(F(e, O, Q));else a.push(F(e, c.key, `Variable "$${h}" does not appear in any GraphQL query.`)); + } + return a; +} +t(U, "validateVariables"); +function g(e, n) { + if (!e || !n) return []; + if (e instanceof b.GraphQLNonNull) return n.kind === "Null" ? [[n, `Type "${e}" is non-nullable and cannot be null.`]] : g(e.ofType, n); + if (n.kind === "Null") return []; + if (e instanceof b.GraphQLList) { + const i = e.ofType; + if (n.kind === "Array") { + const f = n.values || []; + return L(f, a => g(i, a)); + } + return g(i, n); + } + if (e instanceof b.GraphQLInputObjectType) { + if (n.kind !== "Object") return [[n, `Type "${e}" must be an Object.`]]; + const i = Object.create(null), + f = L(n.members, a => { + var c; + const h = (c = a == null ? void 0 : a.key) === null || c === void 0 ? void 0 : c.value; + i[h] = !0; + const m = e.getFields()[h]; + if (!m) return [[a.key, `Type "${e}" does not have a field "${h}".`]]; + const O = m ? m.type : void 0; + return g(O, a.value); + }); + for (const a of Object.keys(e.getFields())) { + const c = e.getFields()[a]; + !i[a] && c.type instanceof b.GraphQLNonNull && !c.defaultValue && f.push([n, `Object of type "${e}" is missing required field "${a}".`]); + } + return f; + } + return e.name === "Boolean" && n.kind !== "Boolean" || e.name === "String" && n.kind !== "String" || e.name === "ID" && n.kind !== "Number" && n.kind !== "String" || e.name === "Float" && n.kind !== "Number" || e.name === "Int" && (n.kind !== "Number" || (n.value | 0) !== n.value) ? [[n, `Expected value of type "${e}".`]] : (e instanceof b.GraphQLEnumType || e instanceof b.GraphQLScalarType) && (n.kind !== "String" && n.kind !== "Number" && n.kind !== "Boolean" && n.kind !== "Null" || _(e.parseValue(n.value))) ? [[n, `Expected value of type "${e}".`]] : []; +} +t(g, "validateValue"); +function F(e, n, i) { + return { + message: i, + severity: "error", + type: "validation", + from: e.posFromIndex(n.start), + to: e.posFromIndex(n.end) + }; +} +t(F, "lintError"); +function _(e) { + return e == null || e !== e; +} +t(_, "isNullish"); +function L(e, n) { + return Array.prototype.concat.apply([], e.map(n)); +} +t(L, "mapCat"); + +/***/ }), + +/***/ "../../graphiql-react/dist/matchbrackets.cjs.js": +/*!******************************************************!*\ + !*** ../../graphiql-react/dist/matchbrackets.cjs.js ***! + \******************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +var i = Object.defineProperty; +var s = (e, c) => i(e, "name", { + value: c, + configurable: !0 +}); +const u = __webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"), + f = __webpack_require__(/*! ./matchbrackets.cjs2.js */ "../../graphiql-react/dist/matchbrackets.cjs2.js"); +function b(e, c) { + for (var o = 0; o < c.length; o++) { + const t = c[o]; + if (typeof t != "string" && !Array.isArray(t)) { + for (const r in t) if (r !== "default" && !(r in e)) { + const a = Object.getOwnPropertyDescriptor(t, r); + a && Object.defineProperty(e, r, a.get ? a : { + enumerable: !0, + get: () => t[r] + }); + } + } + } + return Object.freeze(Object.defineProperty(e, Symbol.toStringTag, { + value: "Module" + })); +} +s(b, "_mergeNamespaces"); +var n = f.requireMatchbrackets(); +const l = u.getDefaultExportFromCjs(n), + m = b({ + __proto__: null, + default: l + }, [n]); +exports.matchbrackets = m; + +/***/ }), + +/***/ "../../graphiql-react/dist/matchbrackets.cjs2.js": +/*!*******************************************************!*\ + !*** ../../graphiql-react/dist/matchbrackets.cjs2.js ***! + \*******************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +var R = Object.defineProperty; +var f = (L, y) => R(L, "name", { + value: y, + configurable: !0 +}); +const F = __webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"); +var T = { + exports: {} + }, + E; +function I() { + return E || (E = 1, function (L, y) { + (function (o) { + o(F.requireCodemirror()); + })(function (o) { + var S = /MSIE \d/.test(navigator.userAgent) && (document.documentMode == null || document.documentMode < 8), + g = o.Pos, + B = { + "(": ")>", + ")": "(<", + "[": "]>", + "]": "[<", + "{": "}>", + "}": "{<", + "<": ">>", + ">": "<<" + }; + function A(t) { + return t && t.bracketRegex || /[(){}[\]]/; + } + f(A, "bracketRegex"); + function b(t, r, e) { + var s = t.getLineHandle(r.line), + n = r.ch - 1, + h = e && e.afterCursor; + h == null && (h = /(^| )cm-fat-cursor($| )/.test(t.getWrapperElement().className)); + var l = A(e), + u = !h && n >= 0 && l.test(s.text.charAt(n)) && B[s.text.charAt(n)] || l.test(s.text.charAt(n + 1)) && B[s.text.charAt(++n)]; + if (!u) return null; + var a = u.charAt(1) == ">" ? 1 : -1; + if (e && e.strict && a > 0 != (n == r.ch)) return null; + var k = t.getTokenTypeAt(g(r.line, n + 1)), + i = H(t, g(r.line, n + (a > 0 ? 1 : 0)), a, k, e); + return i == null ? null : { + from: g(r.line, n), + to: i && i.pos, + match: i && i.ch == u.charAt(0), + forward: a > 0 + }; + } + f(b, "findMatchingBracket"); + function H(t, r, e, s, n) { + for (var h = n && n.maxScanLineLength || 1e4, l = n && n.maxScanLines || 1e3, u = [], a = A(n), k = e > 0 ? Math.min(r.line + l, t.lastLine() + 1) : Math.max(t.firstLine() - 1, r.line - l), i = r.line; i != k; i += e) { + var c = t.getLine(i); + if (c) { + var v = e > 0 ? 0 : c.length - 1, + q = e > 0 ? c.length : -1; + if (!(c.length > h)) for (i == r.line && (v = r.ch - (e < 0 ? 1 : 0)); v != q; v += e) { + var d = c.charAt(v); + if (a.test(d) && (s === void 0 || (t.getTokenTypeAt(g(i, v + 1)) || "") == (s || ""))) { + var m = B[d]; + if (m && m.charAt(1) == ">" == e > 0) u.push(d);else if (u.length) u.pop();else return { + pos: g(i, v), + ch: d + }; + } + } + } + } + return i - e == (e > 0 ? t.lastLine() : t.firstLine()) ? !1 : null; + } + f(H, "scanForBracket"); + function M(t, r, e) { + for (var s = t.state.matchBrackets.maxHighlightLineLength || 1e3, n = e && e.highlightNonMatching, h = [], l = t.listSelections(), u = 0; u < l.length; u++) { + var a = l[u].empty() && b(t, l[u].head, e); + if (a && (a.match || n !== !1) && t.getLine(a.from.line).length <= s) { + var k = a.match ? "CodeMirror-matchingbracket" : "CodeMirror-nonmatchingbracket"; + h.push(t.markText(a.from, g(a.from.line, a.from.ch + 1), { + className: k + })), a.to && t.getLine(a.to.line).length <= s && h.push(t.markText(a.to, g(a.to.line, a.to.ch + 1), { + className: k + })); + } + } + if (h.length) { + S && t.state.focused && t.focus(); + var i = f(function () { + t.operation(function () { + for (var c = 0; c < h.length; c++) h[c].clear(); + }); + }, "clear"); + if (r) setTimeout(i, 800);else return i; + } + } + f(M, "matchBrackets"); + function x(t) { + t.operation(function () { + t.state.matchBrackets.currentlyHighlighted && (t.state.matchBrackets.currentlyHighlighted(), t.state.matchBrackets.currentlyHighlighted = null), t.state.matchBrackets.currentlyHighlighted = M(t, !1, t.state.matchBrackets); + }); + } + f(x, "doMatchBrackets"); + function p(t) { + t.state.matchBrackets && t.state.matchBrackets.currentlyHighlighted && (t.state.matchBrackets.currentlyHighlighted(), t.state.matchBrackets.currentlyHighlighted = null); + } + f(p, "clearHighlighted"), o.defineOption("matchBrackets", !1, function (t, r, e) { + e && e != o.Init && (t.off("cursorActivity", x), t.off("focus", x), t.off("blur", p), p(t)), r && (t.state.matchBrackets = typeof r == "object" ? r : {}, t.on("cursorActivity", x), t.on("focus", x), t.on("blur", p)); + }), o.defineExtension("matchBrackets", function () { + M(this, !0); + }), o.defineExtension("findMatchingBracket", function (t, r, e) { + return (e || typeof r == "boolean") && (e ? (e.strict = r, r = e) : r = r ? { + strict: !0 + } : null), b(this, t, r); + }), o.defineExtension("scanForBracket", function (t, r, e, s) { + return H(this, t, r, e, s); + }); + }); + }()), T.exports; +} +f(I, "requireMatchbrackets"); +exports.requireMatchbrackets = I; + +/***/ }), + +/***/ "../../graphiql-react/dist/mode-indent.cjs.js": +/*!****************************************************!*\ + !*** ../../graphiql-react/dist/mode-indent.cjs.js ***! + \****************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +var o = Object.defineProperty; +var v = (n, t) => o(n, "name", { + value: t, + configurable: !0 +}); +function s(n, t) { + var e, i; + const { + levels: l, + indentLevel: d + } = n; + return ((!l || l.length === 0 ? d : l.at(-1) - (!((e = this.electricInput) === null || e === void 0) && e.test(t) ? 1 : 0)) || 0) * (((i = this.config) === null || i === void 0 ? void 0 : i.indentUnit) || 0); +} +v(s, "indent"); +exports.indent = s; + +/***/ }), + +/***/ "../../graphiql-react/dist/mode.cjs.js": +/*!*********************************************!*\ + !*** ../../graphiql-react/dist/mode.cjs.js ***! + \*********************************************/ +/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) { + + + +var n = Object.defineProperty; +var s = (e, r) => n(e, "name", { + value: r, + configurable: !0 +}); +const o = __webpack_require__(/*! ./codemirror.cjs.js */ "../../graphiql-react/dist/codemirror.cjs.js"), + t = __webpack_require__(/*! graphql-language-service */ "../../graphql-language-service/esm/index.js"), + i = __webpack_require__(/*! ./mode-indent.cjs.js */ "../../graphiql-react/dist/mode-indent.cjs.js"); +__webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"); +const l = s(e => { + const r = t.onlineParser({ + eatWhitespace: a => a.eatWhile(t.isIgnored), + lexRules: t.LexRules, + parseRules: t.ParseRules, + editorConfig: { + tabSize: e.tabSize + } + }); + return { + config: e, + startState: r.startState, + token: r.token, + indent: i.indent, + electricInput: /^\s*[})\]]/, + fold: "brace", + lineComment: "#", + closeBrackets: { + pairs: '()[]{}""', + explode: "()[]{}" + } + }; +}, "graphqlModeFactory"); +o.CodeMirror.defineMode("graphql", l); + +/***/ }), + +/***/ "../../graphiql-react/dist/mode.cjs2.js": +/*!**********************************************!*\ + !*** ../../graphiql-react/dist/mode.cjs2.js ***! + \**********************************************/ +/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) { + + + +var n = Object.defineProperty; +var u = (t, r) => n(t, "name", { + value: r, + configurable: !0 +}); +const i = __webpack_require__(/*! ./codemirror.cjs.js */ "../../graphiql-react/dist/codemirror.cjs.js"), + e = __webpack_require__(/*! graphql-language-service */ "../../graphql-language-service/esm/index.js"), + s = __webpack_require__(/*! ./mode-indent.cjs.js */ "../../graphiql-react/dist/mode-indent.cjs.js"); +__webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"); +i.CodeMirror.defineMode("graphql-variables", t => { + const r = e.onlineParser({ + eatWhitespace: a => a.eatSpace(), + lexRules: c, + parseRules: o, + editorConfig: { + tabSize: t.tabSize + } + }); + return { + config: t, + startState: r.startState, + token: r.token, + indent: s.indent, + electricInput: /^\s*[}\]]/, + fold: "brace", + closeBrackets: { + pairs: '[]{}""', + explode: "[]{}" + } + }; +}); +const c = { + Punctuation: /^\[|]|\{|\}|:|,/, + Number: /^-?(?:0|(?:[1-9][0-9]*))(?:\.[0-9]*)?(?:[eE][+-]?[0-9]+)?/, + String: /^"(?:[^"\\]|\\(?:"|\/|\\|b|f|n|r|t|u[0-9a-fA-F]{4}))*"?/, + Keyword: /^true|false|null/ + }, + o = { + Document: [e.p("{"), e.list("Variable", e.opt(e.p(","))), e.p("}")], + Variable: [l("variable"), e.p(":"), "Value"], + Value(t) { + switch (t.kind) { + case "Number": + return "NumberValue"; + case "String": + return "StringValue"; + case "Punctuation": + switch (t.value) { + case "[": + return "ListValue"; + case "{": + return "ObjectValue"; + } + return null; + case "Keyword": + switch (t.value) { + case "true": + case "false": + return "BooleanValue"; + case "null": + return "NullValue"; + } + return null; + } + }, + NumberValue: [e.t("Number", "number")], + StringValue: [e.t("String", "string")], + BooleanValue: [e.t("Keyword", "builtin")], + NullValue: [e.t("Keyword", "keyword")], + ListValue: [e.p("["), e.list("Value", e.opt(e.p(","))), e.p("]")], + ObjectValue: [e.p("{"), e.list("ObjectField", e.opt(e.p(","))), e.p("}")], + ObjectField: [l("attribute"), e.p(":"), "Value"] + }; +function l(t) { + return { + style: t, + match: r => r.kind === "String", + update(r, a) { + r.name = a.value.slice(1, -1); + } + }; +} +u(l, "namedKey"); + +/***/ }), + +/***/ "../../graphiql-react/dist/mode.cjs3.js": +/*!**********************************************!*\ + !*** ../../graphiql-react/dist/mode.cjs3.js ***! + \**********************************************/ +/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) { + + + +const a = __webpack_require__(/*! ./codemirror.cjs.js */ "../../graphiql-react/dist/codemirror.cjs.js"), + e = __webpack_require__(/*! graphql-language-service */ "../../graphql-language-service/esm/index.js"), + l = __webpack_require__(/*! ./mode-indent.cjs.js */ "../../graphiql-react/dist/mode-indent.cjs.js"); +__webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"); +a.CodeMirror.defineMode("graphql-results", r => { + const t = e.onlineParser({ + eatWhitespace: u => u.eatSpace(), + lexRules: n, + parseRules: s, + editorConfig: { + tabSize: r.tabSize + } + }); + return { + config: r, + startState: t.startState, + token: t.token, + indent: l.indent, + electricInput: /^\s*[}\]]/, + fold: "brace", + closeBrackets: { + pairs: '[]{}""', + explode: "[]{}" + } + }; +}); +const n = { + Punctuation: /^\[|]|\{|\}|:|,/, + Number: /^-?(?:0|(?:[1-9][0-9]*))(?:\.[0-9]*)?(?:[eE][+-]?[0-9]+)?/, + String: /^"(?:[^"\\]|\\(?:"|\/|\\|b|f|n|r|t|u[0-9a-fA-F]{4}))*"?/, + Keyword: /^true|false|null/ + }, + s = { + Document: [e.p("{"), e.list("Entry", e.p(",")), e.p("}")], + Entry: [e.t("String", "def"), e.p(":"), "Value"], + Value(r) { + switch (r.kind) { + case "Number": + return "NumberValue"; + case "String": + return "StringValue"; + case "Punctuation": + switch (r.value) { + case "[": + return "ListValue"; + case "{": + return "ObjectValue"; + } + return null; + case "Keyword": + switch (r.value) { + case "true": + case "false": + return "BooleanValue"; + case "null": + return "NullValue"; + } + return null; + } + }, + NumberValue: [e.t("Number", "number")], + StringValue: [e.t("String", "string")], + BooleanValue: [e.t("Keyword", "builtin")], + NullValue: [e.t("Keyword", "keyword")], + ListValue: [e.p("["), e.list("Value", e.p(",")), e.p("]")], + ObjectValue: [e.p("{"), e.list("ObjectField", e.p(",")), e.p("}")], + ObjectField: [e.t("String", "property"), e.p(":"), "Value"] + }; + +/***/ }), + +/***/ "../../graphiql-react/dist/search.cjs.js": +/*!***********************************************!*\ + !*** ../../graphiql-react/dist/search.cjs.js ***! + \***********************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +var K = Object.defineProperty; +var a = (S, O) => K(S, "name", { + value: O, + configurable: !0 +}); +const Q = __webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"), + L = __webpack_require__(/*! ./searchcursor.cjs2.js */ "../../graphiql-react/dist/searchcursor.cjs2.js"), + z = __webpack_require__(/*! ./dialog.cjs2.js */ "../../graphiql-react/dist/dialog.cjs2.js"); +function U(S, O) { + for (var i = 0; i < O.length; i++) { + const y = O[i]; + if (typeof y != "string" && !Array.isArray(y)) { + for (const v in y) if (v !== "default" && !(v in S)) { + const h = Object.getOwnPropertyDescriptor(y, v); + h && Object.defineProperty(S, v, h.get ? h : { + enumerable: !0, + get: () => y[v] + }); + } + } + } + return Object.freeze(Object.defineProperty(S, Symbol.toStringTag, { + value: "Module" + })); +} +a(U, "_mergeNamespaces"); +var B = { + exports: {} +}; +(function (S, O) { + (function (i) { + i(Q.requireCodemirror(), L.requireSearchcursor(), z.requireDialog()); + })(function (i) { + i.defineOption("search", { + bottom: !1 + }); + function y(e, n) { + return typeof e == "string" ? e = new RegExp(e.replace(/[\-\[\]\/\{\}\(\)\*\+\?\.\\\^\$\|]/g, "\\$&"), n ? "gi" : "g") : e.global || (e = new RegExp(e.source, e.ignoreCase ? "gi" : "g")), { + token: function (t) { + e.lastIndex = t.pos; + var o = e.exec(t.string); + if (o && o.index == t.pos) return t.pos += o[0].length || 1, "searching"; + o ? t.pos = o.index : t.skipToEnd(); + } + }; + } + a(y, "searchOverlay"); + function v() { + this.posFrom = this.posTo = this.lastQuery = this.query = null, this.overlay = null; + } + a(v, "SearchState"); + function h(e) { + return e.state.search || (e.state.search = new v()); + } + a(h, "getSearchState"); + function m(e) { + return typeof e == "string" && e == e.toLowerCase(); + } + a(m, "queryCaseInsensitive"); + function N(e, n, t) { + return e.getSearchCursor(n, t, { + caseFold: m(n), + multiline: !0 + }); + } + a(N, "getSearchCursor"); + function j(e, n, t, o, r) { + e.openDialog(n, o, { + value: t, + selectValueOnOpen: !0, + closeOnEnter: !1, + onClose: function () { + w(e); + }, + onKeyDown: r, + bottom: e.options.search.bottom + }); + } + a(j, "persistentDialog"); + function R(e, n, t, o, r) { + e.openDialog ? e.openDialog(n, r, { + value: o, + selectValueOnOpen: !0, + bottom: e.options.search.bottom + }) : r(prompt(t, o)); + } + a(R, "dialog"); + function k(e, n, t, o) { + e.openConfirm ? e.openConfirm(n, o) : confirm(t) && o[0](); + } + a(k, "confirmDialog"); + function C(e) { + return e.replace(/\\([nrt\\])/g, function (n, t) { + return t == "n" ? ` +` : t == "r" ? "\r" : t == "t" ? " " : t == "\\" ? "\\" : n; + }); + } + a(C, "parseString"); + function T(e) { + var n = e.match(/^\/(.*)\/([a-z]*)$/); + if (n) try { + e = new RegExp(n[1], n[2].indexOf("i") == -1 ? "" : "i"); + } catch {} else e = C(e); + return (typeof e == "string" ? e == "" : e.test("")) && (e = /x^/), e; + } + a(T, "parseQuery"); + function D(e, n, t) { + n.queryText = t, n.query = T(t), e.removeOverlay(n.overlay, m(n.query)), n.overlay = y(n.query, m(n.query)), e.addOverlay(n.overlay), e.showMatchesOnScrollbar && (n.annotate && (n.annotate.clear(), n.annotate = null), n.annotate = e.showMatchesOnScrollbar(n.query, m(n.query))); + } + a(D, "startSearch"); + function b(e, n, t, o) { + var r = h(e); + if (r.query) return P(e, n); + var s = e.getSelection() || r.lastQuery; + if (s instanceof RegExp && s.source == "x^" && (s = null), t && e.openDialog) { + var c = null, + u = a(function (f, x) { + i.e_stop(x), f && (f != r.queryText && (D(e, r, f), r.posFrom = r.posTo = e.getCursor()), c && (c.style.opacity = 1), P(e, x.shiftKey, function (d, g) { + var p; + g.line < 3 && document.querySelector && (p = e.display.wrapper.querySelector(".CodeMirror-dialog")) && p.getBoundingClientRect().bottom - 4 > e.cursorCoords(g, "window").top && ((c = p).style.opacity = .4); + })); + }, "searchNext"); + j(e, _(e), s, u, function (f, x) { + var d = i.keyName(f), + g = e.getOption("extraKeys"), + p = g && g[d] || i.keyMap[e.getOption("keyMap")][d]; + p == "findNext" || p == "findPrev" || p == "findPersistentNext" || p == "findPersistentPrev" ? (i.e_stop(f), D(e, h(e), x), e.execCommand(p)) : (p == "find" || p == "findPersistent") && (i.e_stop(f), u(x, f)); + }), o && s && (D(e, r, s), P(e, n)); + } else R(e, _(e), "Search for:", s, function (f) { + f && !r.query && e.operation(function () { + D(e, r, f), r.posFrom = r.posTo = e.getCursor(), P(e, n); + }); + }); + } + a(b, "doSearch"); + function P(e, n, t) { + e.operation(function () { + var o = h(e), + r = N(e, o.query, n ? o.posFrom : o.posTo); + !r.find(n) && (r = N(e, o.query, n ? i.Pos(e.lastLine()) : i.Pos(e.firstLine(), 0)), !r.find(n)) || (e.setSelection(r.from(), r.to()), e.scrollIntoView({ + from: r.from(), + to: r.to() + }, 20), o.posFrom = r.from(), o.posTo = r.to(), t && t(r.from(), r.to())); + }); + } + a(P, "findNext"); + function w(e) { + e.operation(function () { + var n = h(e); + n.lastQuery = n.query, n.query && (n.query = n.queryText = null, e.removeOverlay(n.overlay), n.annotate && (n.annotate.clear(), n.annotate = null)); + }); + } + a(w, "clearSearch"); + function l(e, n) { + var t = e ? document.createElement(e) : document.createDocumentFragment(); + for (var o in n) t[o] = n[o]; + for (var r = 2; r < arguments.length; r++) { + var s = arguments[r]; + t.appendChild(typeof s == "string" ? document.createTextNode(s) : s); + } + return t; + } + a(l, "el"); + function _(e) { + return l("", null, l("span", { + className: "CodeMirror-search-label" + }, e.phrase("Search:")), " ", l("input", { + type: "text", + style: "width: 10em", + className: "CodeMirror-search-field" + }), " ", l("span", { + style: "color: #888", + className: "CodeMirror-search-hint" + }, e.phrase("(Use /re/ syntax for regexp search)"))); + } + a(_, "getQueryDialog"); + function A(e) { + return l("", null, " ", l("input", { + type: "text", + style: "width: 10em", + className: "CodeMirror-search-field" + }), " ", l("span", { + style: "color: #888", + className: "CodeMirror-search-hint" + }, e.phrase("(Use /re/ syntax for regexp search)"))); + } + a(A, "getReplaceQueryDialog"); + function I(e) { + return l("", null, l("span", { + className: "CodeMirror-search-label" + }, e.phrase("With:")), " ", l("input", { + type: "text", + style: "width: 10em", + className: "CodeMirror-search-field" + })); + } + a(I, "getReplacementQueryDialog"); + function V(e) { + return l("", null, l("span", { + className: "CodeMirror-search-label" + }, e.phrase("Replace?")), " ", l("button", {}, e.phrase("Yes")), " ", l("button", {}, e.phrase("No")), " ", l("button", {}, e.phrase("All")), " ", l("button", {}, e.phrase("Stop"))); + } + a(V, "getDoReplaceConfirm"); + function E(e, n, t) { + e.operation(function () { + for (var o = N(e, n); o.findNext();) if (typeof n != "string") { + var r = e.getRange(o.from(), o.to()).match(n); + o.replace(t.replace(/\$(\d)/g, function (s, c) { + return r[c]; + })); + } else o.replace(t); + }); + } + a(E, "replaceAll"); + function F(e, n) { + if (!e.getOption("readOnly")) { + var t = e.getSelection() || h(e).lastQuery, + o = n ? e.phrase("Replace all:") : e.phrase("Replace:"), + r = l("", null, l("span", { + className: "CodeMirror-search-label" + }, o), A(e)); + R(e, r, o, t, function (s) { + s && (s = T(s), R(e, I(e), e.phrase("Replace with:"), "", function (c) { + if (c = C(c), n) E(e, s, c);else { + w(e); + var u = N(e, s, e.getCursor("from")), + f = a(function () { + var d = u.from(), + g; + !(g = u.findNext()) && (u = N(e, s), !(g = u.findNext()) || d && u.from().line == d.line && u.from().ch == d.ch) || (e.setSelection(u.from(), u.to()), e.scrollIntoView({ + from: u.from(), + to: u.to() + }), k(e, V(e), e.phrase("Replace?"), [function () { + x(g); + }, f, function () { + E(e, s, c); + }])); + }, "advance"), + x = a(function (d) { + u.replace(typeof s == "string" ? c : c.replace(/\$(\d)/g, function (g, p) { + return d[p]; + })), f(); + }, "doReplace"); + f(); + } + })); + }); + } + } + a(F, "replace"), i.commands.find = function (e) { + w(e), b(e); + }, i.commands.findPersistent = function (e) { + w(e), b(e, !1, !0); + }, i.commands.findPersistentNext = function (e) { + b(e, !1, !0, !0); + }, i.commands.findPersistentPrev = function (e) { + b(e, !0, !0, !0); + }, i.commands.findNext = b, i.commands.findPrev = function (e) { + b(e, !0); + }, i.commands.clearSearch = w, i.commands.replace = F, i.commands.replaceAll = function (e) { + F(e, !0); + }; + }); +})(); +var $ = B.exports; +const W = Q.getDefaultExportFromCjs($), + Y = U({ + __proto__: null, + default: W + }, [$]); +exports.search = Y; + +/***/ }), + +/***/ "../../graphiql-react/dist/searchcursor.cjs.js": +/*!*****************************************************!*\ + !*** ../../graphiql-react/dist/searchcursor.cjs.js ***! + \*****************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +var n = Object.defineProperty; +var u = (r, o) => n(r, "name", { + value: o, + configurable: !0 +}); +const i = __webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"), + f = __webpack_require__(/*! ./searchcursor.cjs2.js */ "../../graphiql-react/dist/searchcursor.cjs2.js"); +function l(r, o) { + for (var c = 0; c < o.length; c++) { + const e = o[c]; + if (typeof e != "string" && !Array.isArray(e)) { + for (const t in e) if (t !== "default" && !(t in r)) { + const s = Object.getOwnPropertyDescriptor(e, t); + s && Object.defineProperty(r, t, s.get ? s : { + enumerable: !0, + get: () => e[t] + }); + } + } + } + return Object.freeze(Object.defineProperty(r, Symbol.toStringTag, { + value: "Module" + })); +} +u(l, "_mergeNamespaces"); +var a = f.requireSearchcursor(); +const g = i.getDefaultExportFromCjs(a), + p = l({ + __proto__: null, + default: g + }, [a]); +exports.searchcursor = p; + +/***/ }), + +/***/ "../../graphiql-react/dist/searchcursor.cjs2.js": +/*!******************************************************!*\ + !*** ../../graphiql-react/dist/searchcursor.cjs2.js ***! + \******************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +var W = Object.defineProperty; +var o = (d, E) => W(d, "name", { + value: E, + configurable: !0 +}); +const G = __webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"); +var N = { + exports: {} + }, + b; +function H() { + return b || (b = 1, function (d, E) { + (function (m) { + m(G.requireCodemirror()); + })(function (m) { + var a = m.Pos; + function B(e) { + var t = e.flags; + return t !== null && t !== void 0 ? t : (e.ignoreCase ? "i" : "") + (e.global ? "g" : "") + (e.multiline ? "m" : ""); + } + o(B, "regexpFlags"); + function F(e, t) { + for (var n = B(e), r = n, l = 0; l < t.length; l++) r.indexOf(t.charAt(l)) == -1 && (r += t.charAt(l)); + return n == r ? e : new RegExp(e.source, r); + } + o(F, "ensureFlags"); + function R(e) { + return /\\s|\\n|\n|\\W|\\D|\[\^/.test(e.source); + } + o(R, "maybeMultiline"); + function I(e, t, n) { + t = F(t, "g"); + for (var r = n.line, l = n.ch, i = e.lastLine(); r <= i; r++, l = 0) { + t.lastIndex = l; + var h = e.getLine(r), + f = t.exec(h); + if (f) return { + from: a(r, f.index), + to: a(r, f.index + f[0].length), + match: f + }; + } + } + o(I, "searchRegexpForward"); + function j(e, t, n) { + if (!R(t)) return I(e, t, n); + t = F(t, "gm"); + for (var r, l = 1, i = n.line, h = e.lastLine(); i <= h;) { + for (var f = 0; f < l && !(i > h); f++) { + var p = e.getLine(i++); + r = r == null ? p : r + ` +` + p; + } + l = l * 2, t.lastIndex = n.ch; + var u = t.exec(r); + if (u) { + var s = r.slice(0, u.index).split(` +`), + c = u[0].split(` +`), + g = n.line + s.length - 1, + v = s[s.length - 1].length; + return { + from: a(g, v), + to: a(g + c.length - 1, c.length == 1 ? v + c[0].length : c[c.length - 1].length), + match: u + }; + } + } + } + o(j, "searchRegexpForwardMultiline"); + function z(e, t, n) { + for (var r, l = 0; l <= e.length;) { + t.lastIndex = l; + var i = t.exec(e); + if (!i) break; + var h = i.index + i[0].length; + if (h > e.length - n) break; + (!r || h > r.index + r[0].length) && (r = i), l = i.index + 1; + } + return r; + } + o(z, "lastMatchIn"); + function D(e, t, n) { + t = F(t, "g"); + for (var r = n.line, l = n.ch, i = e.firstLine(); r >= i; r--, l = -1) { + var h = e.getLine(r), + f = z(h, t, l < 0 ? 0 : h.length - l); + if (f) return { + from: a(r, f.index), + to: a(r, f.index + f[0].length), + match: f + }; + } + } + o(D, "searchRegexpBackward"); + function A(e, t, n) { + if (!R(t)) return D(e, t, n); + t = F(t, "gm"); + for (var r, l = 1, i = e.getLine(n.line).length - n.ch, h = n.line, f = e.firstLine(); h >= f;) { + for (var p = 0; p < l && h >= f; p++) { + var u = e.getLine(h--); + r = r == null ? u : u + ` +` + r; + } + l *= 2; + var s = z(r, t, i); + if (s) { + var c = r.slice(0, s.index).split(` +`), + g = s[0].split(` +`), + v = h + c.length, + x = c[c.length - 1].length; + return { + from: a(v, x), + to: a(v + g.length - 1, g.length == 1 ? x + g[0].length : g[g.length - 1].length), + match: s + }; + } + } + } + o(A, "searchRegexpBackwardMultiline"); + var P, k; + String.prototype.normalize ? (P = o(function (e) { + return e.normalize("NFD").toLowerCase(); + }, "doFold"), k = o(function (e) { + return e.normalize("NFD"); + }, "noFold")) : (P = o(function (e) { + return e.toLowerCase(); + }, "doFold"), k = o(function (e) { + return e; + }, "noFold")); + function L(e, t, n, r) { + if (e.length == t.length) return n; + for (var l = 0, i = n + Math.max(0, e.length - t.length);;) { + if (l == i) return l; + var h = l + i >> 1, + f = r(e.slice(0, h)).length; + if (f == n) return h; + f > n ? i = h : l = h + 1; + } + } + o(L, "adjustPos"); + function y(e, t, n, r) { + if (!t.length) return null; + var l = r ? P : k, + i = l(t).split(/\r|\n\r?/); + t: for (var h = n.line, f = n.ch, p = e.lastLine() + 1 - i.length; h <= p; h++, f = 0) { + var u = e.getLine(h).slice(f), + s = l(u); + if (i.length == 1) { + var c = s.indexOf(i[0]); + if (c == -1) continue t; + var n = L(u, s, c, l) + f; + return { + from: a(h, L(u, s, c, l) + f), + to: a(h, L(u, s, c + i[0].length, l) + f) + }; + } else { + var g = s.length - i[0].length; + if (s.slice(g) != i[0]) continue t; + for (var v = 1; v < i.length - 1; v++) if (l(e.getLine(h + v)) != i[v]) continue t; + var x = e.getLine(h + i.length - 1), + O = l(x), + S = i[i.length - 1]; + if (O.slice(0, S.length) != S) continue t; + return { + from: a(h, L(u, s, g, l) + f), + to: a(h + i.length - 1, L(x, O, S.length, l)) + }; + } + } + } + o(y, "searchStringForward"); + function C(e, t, n, r) { + if (!t.length) return null; + var l = r ? P : k, + i = l(t).split(/\r|\n\r?/); + t: for (var h = n.line, f = n.ch, p = e.firstLine() - 1 + i.length; h >= p; h--, f = -1) { + var u = e.getLine(h); + f > -1 && (u = u.slice(0, f)); + var s = l(u); + if (i.length == 1) { + var c = s.lastIndexOf(i[0]); + if (c == -1) continue t; + return { + from: a(h, L(u, s, c, l)), + to: a(h, L(u, s, c + i[0].length, l)) + }; + } else { + var g = i[i.length - 1]; + if (s.slice(0, g.length) != g) continue t; + for (var v = 1, n = h - i.length + 1; v < i.length - 1; v++) if (l(e.getLine(n + v)) != i[v]) continue t; + var x = e.getLine(h + 1 - i.length), + O = l(x); + if (O.slice(O.length - i[0].length) != i[0]) continue t; + return { + from: a(h + 1 - i.length, L(x, O, x.length - i[0].length, l)), + to: a(h, L(u, s, g.length, l)) + }; + } + } + } + o(C, "searchStringBackward"); + function w(e, t, n, r) { + this.atOccurrence = !1, this.afterEmptyMatch = !1, this.doc = e, n = n ? e.clipPos(n) : a(0, 0), this.pos = { + from: n, + to: n + }; + var l; + typeof r == "object" ? l = r.caseFold : (l = r, r = null), typeof t == "string" ? (l == null && (l = !1), this.matches = function (i, h) { + return (i ? C : y)(e, t, h, l); + }) : (t = F(t, "gm"), !r || r.multiline !== !1 ? this.matches = function (i, h) { + return (i ? A : j)(e, t, h); + } : this.matches = function (i, h) { + return (i ? D : I)(e, t, h); + }); + } + o(w, "SearchCursor"), w.prototype = { + findNext: function () { + return this.find(!1); + }, + findPrevious: function () { + return this.find(!0); + }, + find: function (e) { + var t = this.doc.clipPos(e ? this.pos.from : this.pos.to); + if (this.afterEmptyMatch && this.atOccurrence && (t = a(t.line, t.ch), e ? (t.ch--, t.ch < 0 && (t.line--, t.ch = (this.doc.getLine(t.line) || "").length)) : (t.ch++, t.ch > (this.doc.getLine(t.line) || "").length && (t.ch = 0, t.line++)), m.cmpPos(t, this.doc.clipPos(t)) != 0)) return this.atOccurrence = !1; + var n = this.matches(e, t); + if (this.afterEmptyMatch = n && m.cmpPos(n.from, n.to) == 0, n) return this.pos = n, this.atOccurrence = !0, this.pos.match || !0; + var r = a(e ? this.doc.firstLine() : this.doc.lastLine() + 1, 0); + return this.pos = { + from: r, + to: r + }, this.atOccurrence = !1; + }, + from: function () { + if (this.atOccurrence) return this.pos.from; + }, + to: function () { + if (this.atOccurrence) return this.pos.to; + }, + replace: function (e, t) { + if (this.atOccurrence) { + var n = m.splitLines(e); + this.doc.replaceRange(n, this.pos.from, this.pos.to, t), this.pos.to = a(this.pos.from.line + n.length - 1, n[n.length - 1].length + (n.length == 1 ? this.pos.from.ch : 0)); + } + } + }, m.defineExtension("getSearchCursor", function (e, t, n) { + return new w(this.doc, e, t, n); + }), m.defineDocExtension("getSearchCursor", function (e, t, n) { + return new w(this, e, t, n); + }), m.defineExtension("selectMatches", function (e, t) { + for (var n = [], r = this.getSearchCursor(e, this.getCursor("from"), t); r.findNext() && !(m.cmpPos(r.to(), this.getCursor("to")) > 0);) n.push({ + anchor: r.from(), + head: r.to() + }); + n.length && this.setSelections(n, 0); + }); + }); + }()), N.exports; +} +o(H, "requireSearchcursor"); +exports.requireSearchcursor = H; + +/***/ }), + +/***/ "../../graphiql-react/dist/show-hint.cjs.js": +/*!**************************************************!*\ + !*** ../../graphiql-react/dist/show-hint.cjs.js ***! + \**************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +var ct = Object.defineProperty; +var p = (H, A) => ct(H, "name", { + value: A, + configurable: !0 +}); +const G = __webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"); +function lt(H, A) { + for (var r = 0; r < A.length; r++) { + const w = A[r]; + if (typeof w != "string" && !Array.isArray(w)) { + for (const v in w) if (v !== "default" && !(v in H)) { + const b = Object.getOwnPropertyDescriptor(w, v); + b && Object.defineProperty(H, v, b.get ? b : { + enumerable: !0, + get: () => w[v] + }); + } + } + } + return Object.freeze(Object.defineProperty(H, Symbol.toStringTag, { + value: "Module" + })); +} +p(lt, "_mergeNamespaces"); +var ht = { + exports: {} +}; +(function (H, A) { + (function (r) { + r(G.requireCodemirror()); + })(function (r) { + var w = "CodeMirror-hint", + v = "CodeMirror-hint-active"; + r.showHint = function (t, e, i) { + if (!e) return t.showHint(i); + i && i.async && (e.async = !0); + var n = { + hint: e + }; + if (i) for (var s in i) n[s] = i[s]; + return t.showHint(n); + }, r.defineExtension("showHint", function (t) { + t = tt(this, this.getCursor("start"), t); + var e = this.listSelections(); + if (!(e.length > 1)) { + if (this.somethingSelected()) { + if (!t.hint.supportsSelection) return; + for (var i = 0; i < e.length; i++) if (e[i].head.line != e[i].anchor.line) return; + } + this.state.completionActive && this.state.completionActive.close(); + var n = this.state.completionActive = new b(this, t); + n.options.hint && (r.signal(this, "startCompletion", this), n.update(!0)); + } + }), r.defineExtension("closeHint", function () { + this.state.completionActive && this.state.completionActive.close(); + }); + function b(t, e) { + if (this.cm = t, this.options = e, this.widget = null, this.debounce = 0, this.tick = 0, this.startPos = this.cm.getCursor("start"), this.startLen = this.cm.getLine(this.startPos.line).length - this.cm.getSelection().length, this.options.updateOnCursorActivity) { + var i = this; + t.on("cursorActivity", this.activityFunc = function () { + i.cursorActivity(); + }); + } + } + p(b, "Completion"); + var Q = window.requestAnimationFrame || function (t) { + return setTimeout(t, 1e3 / 60); + }, + Z = window.cancelAnimationFrame || clearTimeout; + b.prototype = { + close: function () { + this.active() && (this.cm.state.completionActive = null, this.tick = null, this.options.updateOnCursorActivity && this.cm.off("cursorActivity", this.activityFunc), this.widget && this.data && r.signal(this.data, "close"), this.widget && this.widget.close(), r.signal(this.cm, "endCompletion", this.cm)); + }, + active: function () { + return this.cm.state.completionActive == this; + }, + pick: function (t, e) { + var i = t.list[e], + n = this; + this.cm.operation(function () { + i.hint ? i.hint(n.cm, t, i) : n.cm.replaceRange(_(i), i.from || t.from, i.to || t.to, "complete"), r.signal(t, "pick", i), n.cm.scrollIntoView(); + }), this.options.closeOnPick && this.close(); + }, + cursorActivity: function () { + this.debounce && (Z(this.debounce), this.debounce = 0); + var t = this.startPos; + this.data && (t = this.data.from); + var e = this.cm.getCursor(), + i = this.cm.getLine(e.line); + if (e.line != this.startPos.line || i.length - e.ch != this.startLen - this.startPos.ch || e.ch < t.ch || this.cm.somethingSelected() || !e.ch || this.options.closeCharacters.test(i.charAt(e.ch - 1))) this.close();else { + var n = this; + this.debounce = Q(function () { + n.update(); + }), this.widget && this.widget.disable(); + } + }, + update: function (t) { + if (this.tick != null) { + var e = this, + i = ++this.tick; + U(this.options.hint, this.cm, this.options, function (n) { + e.tick == i && e.finishUpdate(n, t); + }); + } + }, + finishUpdate: function (t, e) { + this.data && r.signal(this.data, "update"); + var i = this.widget && this.widget.picked || e && this.options.completeSingle; + this.widget && this.widget.close(), this.data = t, t && t.list.length && (i && t.list.length == 1 ? this.pick(t, 0) : (this.widget = new K(this, t), r.signal(t, "shown"))); + } + }; + function tt(t, e, i) { + var n = t.options.hintOptions, + s = {}; + for (var c in D) s[c] = D[c]; + if (n) for (var c in n) n[c] !== void 0 && (s[c] = n[c]); + if (i) for (var c in i) i[c] !== void 0 && (s[c] = i[c]); + return s.hint.resolve && (s.hint = s.hint.resolve(t, e)), s; + } + p(tt, "parseOptions"); + function _(t) { + return typeof t == "string" ? t : t.text; + } + p(_, "getText"); + function et(t, e) { + var i = { + Up: function () { + e.moveFocus(-1); + }, + Down: function () { + e.moveFocus(1); + }, + PageUp: function () { + e.moveFocus(-e.menuSize() + 1, !0); + }, + PageDown: function () { + e.moveFocus(e.menuSize() - 1, !0); + }, + Home: function () { + e.setFocus(0); + }, + End: function () { + e.setFocus(e.length - 1); + }, + Enter: e.pick, + Tab: e.pick, + Esc: e.close + }, + n = /Mac/.test(navigator.platform); + n && (i["Ctrl-P"] = function () { + e.moveFocus(-1); + }, i["Ctrl-N"] = function () { + e.moveFocus(1); + }); + var s = t.options.customKeys, + c = s ? {} : i; + function o(u, l) { + var a; + typeof l != "string" ? a = p(function (S) { + return l(S, e); + }, "bound") : i.hasOwnProperty(l) ? a = i[l] : a = l, c[u] = a; + } + if (p(o, "addBinding"), s) for (var f in s) s.hasOwnProperty(f) && o(f, s[f]); + var h = t.options.extraKeys; + if (h) for (var f in h) h.hasOwnProperty(f) && o(f, h[f]); + return c; + } + p(et, "buildKeyMap"); + function B(t, e) { + for (; e && e != t;) { + if (e.nodeName.toUpperCase() === "LI" && e.parentNode == t) return e; + e = e.parentNode; + } + } + p(B, "getHintElement"); + function K(t, e) { + this.id = "cm-complete-" + Math.floor(Math.random(1e6)), this.completion = t, this.data = e, this.picked = !1; + var i = this, + n = t.cm, + s = n.getInputField().ownerDocument, + c = s.defaultView || s.parentWindow, + o = this.hints = s.createElement("ul"); + o.setAttribute("role", "listbox"), o.setAttribute("aria-expanded", "true"), o.id = this.id; + var f = t.cm.options.theme; + o.className = "CodeMirror-hints " + f, this.selectedHint = e.selectedHint || 0; + for (var h = e.list, u = 0; u < h.length; ++u) { + var l = o.appendChild(s.createElement("li")), + a = h[u], + S = w + (u != this.selectedHint ? "" : " " + v); + a.className != null && (S = a.className + " " + S), l.className = S, u == this.selectedHint && l.setAttribute("aria-selected", "true"), l.id = this.id + "-" + u, l.setAttribute("role", "option"), a.render ? a.render(l, e, a) : l.appendChild(s.createTextNode(a.displayText || _(a))), l.hintId = u; + } + var T = t.options.container || s.body, + y = n.cursorCoords(t.options.alignWithWord ? e.from : null), + k = y.left, + O = y.bottom, + j = !0, + F = 0, + E = 0; + if (T !== s.body) { + var st = ["absolute", "relative", "fixed"].indexOf(c.getComputedStyle(T).position) !== -1, + W = st ? T : T.offsetParent, + M = W.getBoundingClientRect(), + q = s.body.getBoundingClientRect(); + F = M.left - q.left - W.scrollLeft, E = M.top - q.top - W.scrollTop; + } + o.style.left = k - F + "px", o.style.top = O - E + "px"; + var N = c.innerWidth || Math.max(s.body.offsetWidth, s.documentElement.offsetWidth), + L = c.innerHeight || Math.max(s.body.offsetHeight, s.documentElement.offsetHeight); + T.appendChild(o), n.getInputField().setAttribute("aria-autocomplete", "list"), n.getInputField().setAttribute("aria-owns", this.id), n.getInputField().setAttribute("aria-activedescendant", this.id + "-" + this.selectedHint); + var m = t.options.moveOnOverlap ? o.getBoundingClientRect() : new DOMRect(), + z = t.options.paddingForScrollbar ? o.scrollHeight > o.clientHeight + 1 : !1, + x; + setTimeout(function () { + x = n.getScrollInfo(); + }); + var ot = m.bottom - L; + if (ot > 0) { + var P = m.bottom - m.top, + rt = y.top - (y.bottom - m.top); + if (rt - P > 0) o.style.top = (O = y.top - P - E) + "px", j = !1;else if (P > L) { + o.style.height = L - 5 + "px", o.style.top = (O = y.bottom - m.top - E) + "px"; + var V = n.getCursor(); + e.from.ch != V.ch && (y = n.cursorCoords(V), o.style.left = (k = y.left - F) + "px", m = o.getBoundingClientRect()); + } + } + var C = m.right - N; + if (z && (C += n.display.nativeBarWidth), C > 0 && (m.right - m.left > N && (o.style.width = N - 5 + "px", C -= m.right - m.left - N), o.style.left = (k = y.left - C - F) + "px"), z) for (var I = o.firstChild; I; I = I.nextSibling) I.style.paddingRight = n.display.nativeBarWidth + "px"; + if (n.addKeyMap(this.keyMap = et(t, { + moveFocus: function (d, g) { + i.changeActive(i.selectedHint + d, g); + }, + setFocus: function (d) { + i.changeActive(d); + }, + menuSize: function () { + return i.screenAmount(); + }, + length: h.length, + close: function () { + t.close(); + }, + pick: function () { + i.pick(); + }, + data: e + })), t.options.closeOnUnfocus) { + var Y; + n.on("blur", this.onBlur = function () { + Y = setTimeout(function () { + t.close(); + }, 100); + }), n.on("focus", this.onFocus = function () { + clearTimeout(Y); + }); + } + n.on("scroll", this.onScroll = function () { + var d = n.getScrollInfo(), + g = n.getWrapperElement().getBoundingClientRect(); + x || (x = n.getScrollInfo()); + var X = O + x.top - d.top, + R = X - (c.pageYOffset || (s.documentElement || s.body).scrollTop); + if (j || (R += o.offsetHeight), R <= g.top || R >= g.bottom) return t.close(); + o.style.top = X + "px", o.style.left = k + x.left - d.left + "px"; + }), r.on(o, "dblclick", function (d) { + var g = B(o, d.target || d.srcElement); + g && g.hintId != null && (i.changeActive(g.hintId), i.pick()); + }), r.on(o, "click", function (d) { + var g = B(o, d.target || d.srcElement); + g && g.hintId != null && (i.changeActive(g.hintId), t.options.completeOnSingleClick && i.pick()); + }), r.on(o, "mousedown", function () { + setTimeout(function () { + n.focus(); + }, 20); + }); + var $ = this.getSelectedHintRange(); + return ($.from !== 0 || $.to !== 0) && this.scrollToActive(), r.signal(e, "select", h[this.selectedHint], o.childNodes[this.selectedHint]), !0; + } + p(K, "Widget"), K.prototype = { + close: function () { + if (this.completion.widget == this) { + this.completion.widget = null, this.hints.parentNode && this.hints.parentNode.removeChild(this.hints), this.completion.cm.removeKeyMap(this.keyMap); + var t = this.completion.cm.getInputField(); + t.removeAttribute("aria-activedescendant"), t.removeAttribute("aria-owns"); + var e = this.completion.cm; + this.completion.options.closeOnUnfocus && (e.off("blur", this.onBlur), e.off("focus", this.onFocus)), e.off("scroll", this.onScroll); + } + }, + disable: function () { + this.completion.cm.removeKeyMap(this.keyMap); + var t = this; + this.keyMap = { + Enter: function () { + t.picked = !0; + } + }, this.completion.cm.addKeyMap(this.keyMap); + }, + pick: function () { + this.completion.pick(this.data, this.selectedHint); + }, + changeActive: function (t, e) { + if (t >= this.data.list.length ? t = e ? this.data.list.length - 1 : 0 : t < 0 && (t = e ? 0 : this.data.list.length - 1), this.selectedHint != t) { + var i = this.hints.childNodes[this.selectedHint]; + i && (i.className = i.className.replace(" " + v, ""), i.removeAttribute("aria-selected")), i = this.hints.childNodes[this.selectedHint = t], i.className += " " + v, i.setAttribute("aria-selected", "true"), this.completion.cm.getInputField().setAttribute("aria-activedescendant", i.id), this.scrollToActive(), r.signal(this.data, "select", this.data.list[this.selectedHint], i); + } + }, + scrollToActive: function () { + var t = this.getSelectedHintRange(), + e = this.hints.childNodes[t.from], + i = this.hints.childNodes[t.to], + n = this.hints.firstChild; + e.offsetTop < this.hints.scrollTop ? this.hints.scrollTop = e.offsetTop - n.offsetTop : i.offsetTop + i.offsetHeight > this.hints.scrollTop + this.hints.clientHeight && (this.hints.scrollTop = i.offsetTop + i.offsetHeight - this.hints.clientHeight + n.offsetTop); + }, + screenAmount: function () { + return Math.floor(this.hints.clientHeight / this.hints.firstChild.offsetHeight) || 1; + }, + getSelectedHintRange: function () { + var t = this.completion.options.scrollMargin || 0; + return { + from: Math.max(0, this.selectedHint - t), + to: Math.min(this.data.list.length - 1, this.selectedHint + t) + }; + } + }; + function it(t, e) { + if (!t.somethingSelected()) return e; + for (var i = [], n = 0; n < e.length; n++) e[n].supportsSelection && i.push(e[n]); + return i; + } + p(it, "applicableHelpers"); + function U(t, e, i, n) { + if (t.async) t(e, n, i);else { + var s = t(e, i); + s && s.then ? s.then(n) : n(s); + } + } + p(U, "fetchHints"); + function nt(t, e) { + var i = t.getHelpers(e, "hint"), + n; + if (i.length) { + var s = p(function (c, o, f) { + var h = it(c, i); + function u(l) { + if (l == h.length) return o(null); + U(h[l], c, f, function (a) { + a && a.list.length > 0 ? o(a) : u(l + 1); + }); + } + p(u, "run"), u(0); + }, "resolved"); + return s.async = !0, s.supportsSelection = !0, s; + } else return (n = t.getHelper(t.getCursor(), "hintWords")) ? function (c) { + return r.hint.fromList(c, { + words: n + }); + } : r.hint.anyword ? function (c, o) { + return r.hint.anyword(c, o); + } : function () {}; + } + p(nt, "resolveAutoHints"), r.registerHelper("hint", "auto", { + resolve: nt + }), r.registerHelper("hint", "fromList", function (t, e) { + var i = t.getCursor(), + n = t.getTokenAt(i), + s, + c = r.Pos(i.line, n.start), + o = i; + n.start < i.ch && /\w/.test(n.string.charAt(i.ch - n.start - 1)) ? s = n.string.substr(0, i.ch - n.start) : (s = "", c = i); + for (var f = [], h = 0; h < e.words.length; h++) { + var u = e.words[h]; + u.slice(0, s.length) == s && f.push(u); + } + if (f.length) return { + list: f, + from: c, + to: o + }; + }), r.commands.autocomplete = r.showHint; + var D = { + hint: r.hint.auto, + completeSingle: !0, + alignWithWord: !0, + closeCharacters: /[\s()\[\]{};:>,]/, + closeOnPick: !0, + closeOnUnfocus: !0, + updateOnCursorActivity: !0, + completeOnSingleClick: !0, + container: null, + customKeys: null, + extraKeys: null, + paddingForScrollbar: !0, + moveOnOverlap: !0 + }; + r.defineOption("hintOptions", null); + }); +})(); +var J = ht.exports; +const at = G.getDefaultExportFromCjs(J), + ft = lt({ + __proto__: null, + default: at + }, [J]); +exports.showHint = ft; + +/***/ }), + +/***/ "../../graphiql-react/dist/sublime.cjs.js": +/*!************************************************!*\ + !*** ../../graphiql-react/dist/sublime.cjs.js ***! + \************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +var _ = Object.defineProperty; +var v = (m, B) => _(m, "name", { + value: B, + configurable: !0 +}); +const E = __webpack_require__(/*! ./codemirror.cjs2.js */ "../../graphiql-react/dist/codemirror.cjs2.js"), + Y = __webpack_require__(/*! ./searchcursor.cjs2.js */ "../../graphiql-react/dist/searchcursor.cjs2.js"), + z = __webpack_require__(/*! ./matchbrackets.cjs2.js */ "../../graphiql-react/dist/matchbrackets.cjs2.js"); +function J(m, B) { + for (var h = 0; h < B.length; h++) { + const a = B[h]; + if (typeof a != "string" && !Array.isArray(a)) { + for (const f in a) if (f !== "default" && !(f in m)) { + const A = Object.getOwnPropertyDescriptor(a, f); + A && Object.defineProperty(m, f, A.get ? A : { + enumerable: !0, + get: () => a[f] + }); + } + } + } + return Object.freeze(Object.defineProperty(m, Symbol.toStringTag, { + value: "Module" + })); +} +v(J, "_mergeNamespaces"); +var G = { + exports: {} +}; +(function (m, B) { + (function (h) { + h(E.requireCodemirror(), Y.requireSearchcursor(), z.requireMatchbrackets()); + })(function (h) { + var a = h.commands, + f = h.Pos; + function A(e, t, n) { + if (n < 0 && t.ch == 0) return e.clipPos(f(t.line - 1)); + var r = e.getLine(t.line); + if (n > 0 && t.ch >= r.length) return e.clipPos(f(t.line + 1, 0)); + for (var l = "start", i, o = t.ch, s = o, u = n < 0 ? 0 : r.length, d = 0; s != u; s += n, d++) { + var p = r.charAt(n < 0 ? s - 1 : s), + c = p != "_" && h.isWordChar(p) ? "w" : "o"; + if (c == "w" && p.toUpperCase() == p && (c = "W"), l == "start") c != "o" ? (l = "in", i = c) : o = s + n;else if (l == "in" && i != c) { + if (i == "w" && c == "W" && n < 0 && s--, i == "W" && c == "w" && n > 0) if (s == o + 1) { + i = "w"; + continue; + } else s--; + break; + } + } + return f(t.line, s); + } + v(A, "findPosSubword"); + function T(e, t) { + e.extendSelectionsBy(function (n) { + return e.display.shift || e.doc.extend || n.empty() ? A(e.doc, n.head, t) : t < 0 ? n.from() : n.to(); + }); + } + v(T, "moveSubword"), a.goSubwordLeft = function (e) { + T(e, -1); + }, a.goSubwordRight = function (e) { + T(e, 1); + }, a.scrollLineUp = function (e) { + var t = e.getScrollInfo(); + if (!e.somethingSelected()) { + var n = e.lineAtHeight(t.top + t.clientHeight, "local"); + e.getCursor().line >= n && e.execCommand("goLineUp"); + } + e.scrollTo(null, t.top - e.defaultTextHeight()); + }, a.scrollLineDown = function (e) { + var t = e.getScrollInfo(); + if (!e.somethingSelected()) { + var n = e.lineAtHeight(t.top, "local") + 1; + e.getCursor().line <= n && e.execCommand("goLineDown"); + } + e.scrollTo(null, t.top + e.defaultTextHeight()); + }, a.splitSelectionByLine = function (e) { + for (var t = e.listSelections(), n = [], r = 0; r < t.length; r++) for (var l = t[r].from(), i = t[r].to(), o = l.line; o <= i.line; ++o) i.line > l.line && o == i.line && i.ch == 0 || n.push({ + anchor: o == l.line ? l : f(o, 0), + head: o == i.line ? i : f(o) + }); + e.setSelections(n, 0); + }, a.singleSelectionTop = function (e) { + var t = e.listSelections()[0]; + e.setSelection(t.anchor, t.head, { + scroll: !1 + }); + }, a.selectLine = function (e) { + for (var t = e.listSelections(), n = [], r = 0; r < t.length; r++) { + var l = t[r]; + n.push({ + anchor: f(l.from().line, 0), + head: f(l.to().line + 1, 0) + }); + } + e.setSelections(n); + }; + function x(e, t) { + if (e.isReadOnly()) return h.Pass; + e.operation(function () { + for (var n = e.listSelections().length, r = [], l = -1, i = 0; i < n; i++) { + var o = e.listSelections()[i].head; + if (!(o.line <= l)) { + var s = f(o.line + (t ? 0 : 1), 0); + e.replaceRange(` +`, s, null, "+insertLine"), e.indentLine(s.line, null, !0), r.push({ + head: s, + anchor: s + }), l = o.line + 1; + } + } + e.setSelections(r); + }), e.execCommand("indentAuto"); + } + v(x, "insertLine"), a.insertLineAfter = function (e) { + return x(e, !1); + }, a.insertLineBefore = function (e) { + return x(e, !0); + }; + function K(e, t) { + for (var n = t.ch, r = n, l = e.getLine(t.line); n && h.isWordChar(l.charAt(n - 1));) --n; + for (; r < l.length && h.isWordChar(l.charAt(r));) ++r; + return { + from: f(t.line, n), + to: f(t.line, r), + word: l.slice(n, r) + }; + } + v(K, "wordAt"), a.selectNextOccurrence = function (e) { + var t = e.getCursor("from"), + n = e.getCursor("to"), + r = e.state.sublimeFindFullWord == e.doc.sel; + if (h.cmpPos(t, n) == 0) { + var l = K(e, t); + if (!l.word) return; + e.setSelection(l.from, l.to), r = !0; + } else { + var i = e.getRange(t, n), + o = r ? new RegExp("\\b" + i + "\\b") : i, + s = e.getSearchCursor(o, n), + u = s.findNext(); + if (u || (s = e.getSearchCursor(o, f(e.firstLine(), 0)), u = s.findNext()), !u || H(e.listSelections(), s.from(), s.to())) return; + e.addSelection(s.from(), s.to()); + } + r && (e.state.sublimeFindFullWord = e.doc.sel); + }, a.skipAndSelectNextOccurrence = function (e) { + var t = e.getCursor("anchor"), + n = e.getCursor("head"); + a.selectNextOccurrence(e), h.cmpPos(t, n) != 0 && e.doc.setSelections(e.doc.listSelections().filter(function (r) { + return r.anchor != t || r.head != n; + })); + }; + function y(e, t) { + for (var n = e.listSelections(), r = [], l = 0; l < n.length; l++) { + var i = n[l], + o = e.findPosV(i.anchor, t, "line", i.anchor.goalColumn), + s = e.findPosV(i.head, t, "line", i.head.goalColumn); + o.goalColumn = i.anchor.goalColumn != null ? i.anchor.goalColumn : e.cursorCoords(i.anchor, "div").left, s.goalColumn = i.head.goalColumn != null ? i.head.goalColumn : e.cursorCoords(i.head, "div").left; + var u = { + anchor: o, + head: s + }; + r.push(i), r.push(u); + } + e.setSelections(r); + } + v(y, "addCursorToSelection"), a.addCursorToPrevLine = function (e) { + y(e, -1); + }, a.addCursorToNextLine = function (e) { + y(e, 1); + }; + function H(e, t, n) { + for (var r = 0; r < e.length; r++) if (h.cmpPos(e[r].from(), t) == 0 && h.cmpPos(e[r].to(), n) == 0) return !0; + return !1; + } + v(H, "isSelectedRange"); + var P = "(){}[]"; + function U(e) { + for (var t = e.listSelections(), n = [], r = 0; r < t.length; r++) { + var l = t[r], + i = l.head, + o = e.scanForBracket(i, -1); + if (!o) return !1; + for (;;) { + var s = e.scanForBracket(i, 1); + if (!s) return !1; + if (s.ch == P.charAt(P.indexOf(o.ch) + 1)) { + var u = f(o.pos.line, o.pos.ch + 1); + if (h.cmpPos(u, l.from()) == 0 && h.cmpPos(s.pos, l.to()) == 0) { + if (o = e.scanForBracket(o.pos, -1), !o) return !1; + } else { + n.push({ + anchor: u, + head: s.pos + }); + break; + } + } + i = f(s.pos.line, s.pos.ch + 1); + } + } + return e.setSelections(n), !0; + } + v(U, "selectBetweenBrackets"), a.selectScope = function (e) { + U(e) || e.execCommand("selectAll"); + }, a.selectBetweenBrackets = function (e) { + if (!U(e)) return h.Pass; + }; + function I(e) { + return e ? /\bpunctuation\b/.test(e) ? e : void 0 : null; + } + v(I, "puncType"), a.goToBracket = function (e) { + e.extendSelectionsBy(function (t) { + var n = e.scanForBracket(t.head, 1, I(e.getTokenTypeAt(t.head))); + if (n && h.cmpPos(n.pos, t.head) != 0) return n.pos; + var r = e.scanForBracket(t.head, -1, I(e.getTokenTypeAt(f(t.head.line, t.head.ch + 1)))); + return r && f(r.pos.line, r.pos.ch + 1) || t.head; + }); + }, a.swapLineUp = function (e) { + if (e.isReadOnly()) return h.Pass; + for (var t = e.listSelections(), n = [], r = e.firstLine() - 1, l = [], i = 0; i < t.length; i++) { + var o = t[i], + s = o.from().line - 1, + u = o.to().line; + l.push({ + anchor: f(o.anchor.line - 1, o.anchor.ch), + head: f(o.head.line - 1, o.head.ch) + }), o.to().ch == 0 && !o.empty() && --u, s > r ? n.push(s, u) : n.length && (n[n.length - 1] = u), r = u; + } + e.operation(function () { + for (var d = 0; d < n.length; d += 2) { + var p = n[d], + c = n[d + 1], + b = e.getLine(p); + e.replaceRange("", f(p, 0), f(p + 1, 0), "+swapLine"), c > e.lastLine() ? e.replaceRange(` +` + b, f(e.lastLine()), null, "+swapLine") : e.replaceRange(b + ` +`, f(c, 0), null, "+swapLine"); + } + e.setSelections(l), e.scrollIntoView(); + }); + }, a.swapLineDown = function (e) { + if (e.isReadOnly()) return h.Pass; + for (var t = e.listSelections(), n = [], r = e.lastLine() + 1, l = t.length - 1; l >= 0; l--) { + var i = t[l], + o = i.to().line + 1, + s = i.from().line; + i.to().ch == 0 && !i.empty() && o--, o < r ? n.push(o, s) : n.length && (n[n.length - 1] = s), r = s; + } + e.operation(function () { + for (var u = n.length - 2; u >= 0; u -= 2) { + var d = n[u], + p = n[u + 1], + c = e.getLine(d); + d == e.lastLine() ? e.replaceRange("", f(d - 1), f(d), "+swapLine") : e.replaceRange("", f(d, 0), f(d + 1, 0), "+swapLine"), e.replaceRange(c + ` +`, f(p, 0), null, "+swapLine"); + } + e.scrollIntoView(); + }); + }, a.toggleCommentIndented = function (e) { + e.toggleComment({ + indent: !0 + }); + }, a.joinLines = function (e) { + for (var t = e.listSelections(), n = [], r = 0; r < t.length; r++) { + for (var l = t[r], i = l.from(), o = i.line, s = l.to().line; r < t.length - 1 && t[r + 1].from().line == s;) s = t[++r].to().line; + n.push({ + start: o, + end: s, + anchor: !l.empty() && i + }); + } + e.operation(function () { + for (var u = 0, d = [], p = 0; p < n.length; p++) { + for (var c = n[p], b = c.anchor && f(c.anchor.line - u, c.anchor.ch), w, g = c.start; g <= c.end; g++) { + var S = g - u; + g == c.end && (w = f(S, e.getLine(S).length + 1)), S < e.lastLine() && (e.replaceRange(" ", f(S), f(S + 1, /^\s*/.exec(e.getLine(S + 1))[0].length)), ++u); + } + d.push({ + anchor: b || w, + head: w + }); + } + e.setSelections(d, 0); + }); + }, a.duplicateLine = function (e) { + e.operation(function () { + for (var t = e.listSelections().length, n = 0; n < t; n++) { + var r = e.listSelections()[n]; + r.empty() ? e.replaceRange(e.getLine(r.head.line) + ` +`, f(r.head.line, 0)) : e.replaceRange(e.getRange(r.from(), r.to()), r.from()); + } + e.scrollIntoView(); + }); + }; + function R(e, t, n) { + if (e.isReadOnly()) return h.Pass; + for (var r = e.listSelections(), l = [], i, o = 0; o < r.length; o++) { + var s = r[o]; + if (!s.empty()) { + for (var u = s.from().line, d = s.to().line; o < r.length - 1 && r[o + 1].from().line == d;) d = r[++o].to().line; + r[o].to().ch || d--, l.push(u, d); + } + } + l.length ? i = !0 : l.push(e.firstLine(), e.lastLine()), e.operation(function () { + for (var p = [], c = 0; c < l.length; c += 2) { + var b = l[c], + w = l[c + 1], + g = f(b, 0), + S = f(w), + F = e.getRange(g, S, !1); + t ? F.sort(function (k, L) { + return k < L ? -n : k == L ? 0 : n; + }) : F.sort(function (k, L) { + var W = k.toUpperCase(), + M = L.toUpperCase(); + return W != M && (k = W, L = M), k < L ? -n : k == L ? 0 : n; + }), e.replaceRange(F, g, S), i && p.push({ + anchor: g, + head: f(w + 1, 0) + }); + } + i && e.setSelections(p, 0); + }); + } + v(R, "sortLines"), a.sortLines = function (e) { + R(e, !0, 1); + }, a.reverseSortLines = function (e) { + R(e, !0, -1); + }, a.sortLinesInsensitive = function (e) { + R(e, !1, 1); + }, a.reverseSortLinesInsensitive = function (e) { + R(e, !1, -1); + }, a.nextBookmark = function (e) { + var t = e.state.sublimeBookmarks; + if (t) for (; t.length;) { + var n = t.shift(), + r = n.find(); + if (r) return t.push(n), e.setSelection(r.from, r.to); + } + }, a.prevBookmark = function (e) { + var t = e.state.sublimeBookmarks; + if (t) for (; t.length;) { + t.unshift(t.pop()); + var n = t[t.length - 1].find(); + if (!n) t.pop();else return e.setSelection(n.from, n.to); + } + }, a.toggleBookmark = function (e) { + for (var t = e.listSelections(), n = e.state.sublimeBookmarks || (e.state.sublimeBookmarks = []), r = 0; r < t.length; r++) { + for (var l = t[r].from(), i = t[r].to(), o = t[r].empty() ? e.findMarksAt(l) : e.findMarks(l, i), s = 0; s < o.length; s++) if (o[s].sublimeBookmark) { + o[s].clear(); + for (var u = 0; u < n.length; u++) n[u] == o[s] && n.splice(u--, 1); + break; + } + s == o.length && n.push(e.markText(l, i, { + sublimeBookmark: !0, + clearWhenEmpty: !1 + })); + } + }, a.clearBookmarks = function (e) { + var t = e.state.sublimeBookmarks; + if (t) for (var n = 0; n < t.length; n++) t[n].clear(); + t.length = 0; + }, a.selectBookmarks = function (e) { + var t = e.state.sublimeBookmarks, + n = []; + if (t) for (var r = 0; r < t.length; r++) { + var l = t[r].find(); + l ? n.push({ + anchor: l.from, + head: l.to + }) : t.splice(r--, 0); + } + n.length && e.setSelections(n, 0); + }; + function D(e, t) { + e.operation(function () { + for (var n = e.listSelections(), r = [], l = [], i = 0; i < n.length; i++) { + var o = n[i]; + o.empty() ? (r.push(i), l.push("")) : l.push(t(e.getRange(o.from(), o.to()))); + } + e.replaceSelections(l, "around", "case"); + for (var i = r.length - 1, s; i >= 0; i--) { + var o = n[r[i]]; + if (!(s && h.cmpPos(o.head, s) > 0)) { + var u = K(e, o.head); + s = u.from, e.replaceRange(t(u.word), u.from, u.to); + } + } + }); + } + v(D, "modifyWordOrSelection"), a.smartBackspace = function (e) { + if (e.somethingSelected()) return h.Pass; + e.operation(function () { + for (var t = e.listSelections(), n = e.getOption("indentUnit"), r = t.length - 1; r >= 0; r--) { + var l = t[r].head, + i = e.getRange({ + line: l.line, + ch: 0 + }, l), + o = h.countColumn(i, null, e.getOption("tabSize")), + s = e.findPosH(l, -1, "char", !1); + if (i && !/\S/.test(i) && o % n == 0) { + var u = new f(l.line, h.findColumn(i, o - n, n)); + u.ch != l.ch && (s = u); + } + e.replaceRange("", s, l, "+delete"); + } + }); + }, a.delLineRight = function (e) { + e.operation(function () { + for (var t = e.listSelections(), n = t.length - 1; n >= 0; n--) e.replaceRange("", t[n].anchor, f(t[n].to().line), "+delete"); + e.scrollIntoView(); + }); + }, a.upcaseAtCursor = function (e) { + D(e, function (t) { + return t.toUpperCase(); + }); + }, a.downcaseAtCursor = function (e) { + D(e, function (t) { + return t.toLowerCase(); + }); + }, a.setSublimeMark = function (e) { + e.state.sublimeMark && e.state.sublimeMark.clear(), e.state.sublimeMark = e.setBookmark(e.getCursor()); + }, a.selectToSublimeMark = function (e) { + var t = e.state.sublimeMark && e.state.sublimeMark.find(); + t && e.setSelection(e.getCursor(), t); + }, a.deleteToSublimeMark = function (e) { + var t = e.state.sublimeMark && e.state.sublimeMark.find(); + if (t) { + var n = e.getCursor(), + r = t; + if (h.cmpPos(n, r) > 0) { + var l = r; + r = n, n = l; + } + e.state.sublimeKilled = e.getRange(n, r), e.replaceRange("", n, r); + } + }, a.swapWithSublimeMark = function (e) { + var t = e.state.sublimeMark && e.state.sublimeMark.find(); + t && (e.state.sublimeMark.clear(), e.state.sublimeMark = e.setBookmark(e.getCursor()), e.setCursor(t)); + }, a.sublimeYank = function (e) { + e.state.sublimeKilled != null && e.replaceSelection(e.state.sublimeKilled, null, "paste"); + }, a.showInCenter = function (e) { + var t = e.cursorCoords(null, "local"); + e.scrollTo(null, (t.top + t.bottom) / 2 - e.getScrollInfo().clientHeight / 2); + }; + function N(e) { + var t = e.getCursor("from"), + n = e.getCursor("to"); + if (h.cmpPos(t, n) == 0) { + var r = K(e, t); + if (!r.word) return; + t = r.from, n = r.to; + } + return { + from: t, + to: n, + query: e.getRange(t, n), + word: r + }; + } + v(N, "getTarget"); + function O(e, t) { + var n = N(e); + if (n) { + var r = n.query, + l = e.getSearchCursor(r, t ? n.to : n.from); + (t ? l.findNext() : l.findPrevious()) ? e.setSelection(l.from(), l.to()) : (l = e.getSearchCursor(r, t ? f(e.firstLine(), 0) : e.clipPos(f(e.lastLine()))), (t ? l.findNext() : l.findPrevious()) ? e.setSelection(l.from(), l.to()) : n.word && e.setSelection(n.from, n.to)); + } + } + v(O, "findAndGoTo"), a.findUnder = function (e) { + O(e, !0); + }, a.findUnderPrevious = function (e) { + O(e, !1); + }, a.findAllUnder = function (e) { + var t = N(e); + if (t) { + for (var n = e.getSearchCursor(t.query), r = [], l = -1; n.findNext();) r.push({ + anchor: n.from(), + head: n.to() + }), n.from().line <= t.from.line && n.from().ch <= t.from.ch && l++; + e.setSelections(r, l); + } + }; + var C = h.keyMap; + C.macSublime = { + "Cmd-Left": "goLineStartSmart", + "Shift-Tab": "indentLess", + "Shift-Ctrl-K": "deleteLine", + "Alt-Q": "wrapLines", + "Ctrl-Left": "goSubwordLeft", + "Ctrl-Right": "goSubwordRight", + "Ctrl-Alt-Up": "scrollLineUp", + "Ctrl-Alt-Down": "scrollLineDown", + "Cmd-L": "selectLine", + "Shift-Cmd-L": "splitSelectionByLine", + Esc: "singleSelectionTop", + "Cmd-Enter": "insertLineAfter", + "Shift-Cmd-Enter": "insertLineBefore", + "Cmd-D": "selectNextOccurrence", + "Shift-Cmd-Space": "selectScope", + "Shift-Cmd-M": "selectBetweenBrackets", + "Cmd-M": "goToBracket", + "Cmd-Ctrl-Up": "swapLineUp", + "Cmd-Ctrl-Down": "swapLineDown", + "Cmd-/": "toggleCommentIndented", + "Cmd-J": "joinLines", + "Shift-Cmd-D": "duplicateLine", + F5: "sortLines", + "Shift-F5": "reverseSortLines", + "Cmd-F5": "sortLinesInsensitive", + "Shift-Cmd-F5": "reverseSortLinesInsensitive", + F2: "nextBookmark", + "Shift-F2": "prevBookmark", + "Cmd-F2": "toggleBookmark", + "Shift-Cmd-F2": "clearBookmarks", + "Alt-F2": "selectBookmarks", + Backspace: "smartBackspace", + "Cmd-K Cmd-D": "skipAndSelectNextOccurrence", + "Cmd-K Cmd-K": "delLineRight", + "Cmd-K Cmd-U": "upcaseAtCursor", + "Cmd-K Cmd-L": "downcaseAtCursor", + "Cmd-K Cmd-Space": "setSublimeMark", + "Cmd-K Cmd-A": "selectToSublimeMark", + "Cmd-K Cmd-W": "deleteToSublimeMark", + "Cmd-K Cmd-X": "swapWithSublimeMark", + "Cmd-K Cmd-Y": "sublimeYank", + "Cmd-K Cmd-C": "showInCenter", + "Cmd-K Cmd-G": "clearBookmarks", + "Cmd-K Cmd-Backspace": "delLineLeft", + "Cmd-K Cmd-1": "foldAll", + "Cmd-K Cmd-0": "unfoldAll", + "Cmd-K Cmd-J": "unfoldAll", + "Ctrl-Shift-Up": "addCursorToPrevLine", + "Ctrl-Shift-Down": "addCursorToNextLine", + "Cmd-F3": "findUnder", + "Shift-Cmd-F3": "findUnderPrevious", + "Alt-F3": "findAllUnder", + "Shift-Cmd-[": "fold", + "Shift-Cmd-]": "unfold", + "Cmd-I": "findIncremental", + "Shift-Cmd-I": "findIncrementalReverse", + "Cmd-H": "replace", + F3: "findNext", + "Shift-F3": "findPrev", + fallthrough: "macDefault" + }, h.normalizeKeyMap(C.macSublime), C.pcSublime = { + "Shift-Tab": "indentLess", + "Shift-Ctrl-K": "deleteLine", + "Alt-Q": "wrapLines", + "Ctrl-T": "transposeChars", + "Alt-Left": "goSubwordLeft", + "Alt-Right": "goSubwordRight", + "Ctrl-Up": "scrollLineUp", + "Ctrl-Down": "scrollLineDown", + "Ctrl-L": "selectLine", + "Shift-Ctrl-L": "splitSelectionByLine", + Esc: "singleSelectionTop", + "Ctrl-Enter": "insertLineAfter", + "Shift-Ctrl-Enter": "insertLineBefore", + "Ctrl-D": "selectNextOccurrence", + "Shift-Ctrl-Space": "selectScope", + "Shift-Ctrl-M": "selectBetweenBrackets", + "Ctrl-M": "goToBracket", + "Shift-Ctrl-Up": "swapLineUp", + "Shift-Ctrl-Down": "swapLineDown", + "Ctrl-/": "toggleCommentIndented", + "Ctrl-J": "joinLines", + "Shift-Ctrl-D": "duplicateLine", + F9: "sortLines", + "Shift-F9": "reverseSortLines", + "Ctrl-F9": "sortLinesInsensitive", + "Shift-Ctrl-F9": "reverseSortLinesInsensitive", + F2: "nextBookmark", + "Shift-F2": "prevBookmark", + "Ctrl-F2": "toggleBookmark", + "Shift-Ctrl-F2": "clearBookmarks", + "Alt-F2": "selectBookmarks", + Backspace: "smartBackspace", + "Ctrl-K Ctrl-D": "skipAndSelectNextOccurrence", + "Ctrl-K Ctrl-K": "delLineRight", + "Ctrl-K Ctrl-U": "upcaseAtCursor", + "Ctrl-K Ctrl-L": "downcaseAtCursor", + "Ctrl-K Ctrl-Space": "setSublimeMark", + "Ctrl-K Ctrl-A": "selectToSublimeMark", + "Ctrl-K Ctrl-W": "deleteToSublimeMark", + "Ctrl-K Ctrl-X": "swapWithSublimeMark", + "Ctrl-K Ctrl-Y": "sublimeYank", + "Ctrl-K Ctrl-C": "showInCenter", + "Ctrl-K Ctrl-G": "clearBookmarks", + "Ctrl-K Ctrl-Backspace": "delLineLeft", + "Ctrl-K Ctrl-1": "foldAll", + "Ctrl-K Ctrl-0": "unfoldAll", + "Ctrl-K Ctrl-J": "unfoldAll", + "Ctrl-Alt-Up": "addCursorToPrevLine", + "Ctrl-Alt-Down": "addCursorToNextLine", + "Ctrl-F3": "findUnder", + "Shift-Ctrl-F3": "findUnderPrevious", + "Alt-F3": "findAllUnder", + "Shift-Ctrl-[": "fold", + "Shift-Ctrl-]": "unfold", + "Ctrl-I": "findIncremental", + "Shift-Ctrl-I": "findIncrementalReverse", + "Ctrl-H": "replace", + F3: "findNext", + "Shift-F3": "findPrev", + fallthrough: "pcDefault" + }, h.normalizeKeyMap(C.pcSublime); + var V = C.default == C.macDefault; + C.sublime = V ? C.macSublime : C.pcSublime; + }); +})(); +var q = G.exports; +const Q = E.getDefaultExportFromCjs(q), + X = J({ + __proto__: null, + default: Q + }, [q]); +exports.sublime = X; + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/async-helpers/index.js": +/*!*********************************************************!*\ + !*** ../../graphiql-toolkit/esm/async-helpers/index.js ***! + \*********************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.fetcherReturnToPromise = fetcherReturnToPromise; +exports.isAsyncIterable = isAsyncIterable; +exports.isObservable = isObservable; +exports.isPromise = isPromise; +var __awaiter = void 0 && (void 0).__awaiter || function (thisArg, _arguments, P, generator) { + function adopt(value) { + return value instanceof P ? value : new P(function (resolve) { + resolve(value); + }); + } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { + try { + step(generator.next(value)); + } catch (e) { + reject(e); + } + } + function rejected(value) { + try { + step(generator["throw"](value)); + } catch (e) { + reject(e); + } + } + function step(result) { + result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); + } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +function isPromise(value) { + return typeof value === 'object' && value !== null && typeof value.then === 'function'; +} +function observableToPromise(observable) { + return new Promise((resolve, reject) => { + const subscription = observable.subscribe({ + next(v) { + resolve(v); + subscription.unsubscribe(); + }, + error: reject, + complete() { + reject(new Error('no value resolved')); + } + }); + }); +} +function isObservable(value) { + return typeof value === 'object' && value !== null && 'subscribe' in value && typeof value.subscribe === 'function'; +} +function isAsyncIterable(input) { + return typeof input === 'object' && input !== null && (input[Symbol.toStringTag] === 'AsyncGenerator' || Symbol.asyncIterator in input); +} +function asyncIterableToPromise(input) { + var _a; + return __awaiter(this, void 0, void 0, function* () { + const iteratorReturn = (_a = ('return' in input ? input : input[Symbol.asyncIterator]()).return) === null || _a === void 0 ? void 0 : _a.bind(input); + const iteratorNext = ('next' in input ? input : input[Symbol.asyncIterator]()).next.bind(input); + const result = yield iteratorNext(); + void (iteratorReturn === null || iteratorReturn === void 0 ? void 0 : iteratorReturn()); + return result.value; + }); +} +function fetcherReturnToPromise(fetcherResult) { + return __awaiter(this, void 0, void 0, function* () { + const result = yield fetcherResult; + if (isAsyncIterable(result)) { + return asyncIterableToPromise(result); + } + if (isObservable(result)) { + return observableToPromise(result); + } + return result; + }); +} + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/create-fetcher/createFetcher.js": +/*!******************************************************************!*\ + !*** ../../graphiql-toolkit/esm/create-fetcher/createFetcher.js ***! + \******************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.createGraphiQLFetcher = createGraphiQLFetcher; +var _lib = __webpack_require__(/*! ./lib */ "../../graphiql-toolkit/esm/create-fetcher/lib.js"); +function createGraphiQLFetcher(options) { + let httpFetch; + if (typeof window !== 'undefined' && window.fetch) { + httpFetch = window.fetch; + } + if ((options === null || options === void 0 ? void 0 : options.enableIncrementalDelivery) === null || options.enableIncrementalDelivery !== false) { + options.enableIncrementalDelivery = true; + } + if (options.fetch) { + httpFetch = options.fetch; + } + if (!httpFetch) { + throw new Error('No valid fetcher implementation available'); + } + const simpleFetcher = (0, _lib.createSimpleFetcher)(options, httpFetch); + const httpFetcher = options.enableIncrementalDelivery ? (0, _lib.createMultipartFetcher)(options, httpFetch) : simpleFetcher; + return (graphQLParams, fetcherOpts) => { + if (graphQLParams.operationName === 'IntrospectionQuery') { + return (options.schemaFetcher || simpleFetcher)(graphQLParams, fetcherOpts); + } + const isSubscription = (fetcherOpts === null || fetcherOpts === void 0 ? void 0 : fetcherOpts.documentAST) ? (0, _lib.isSubscriptionWithName)(fetcherOpts.documentAST, graphQLParams.operationName || undefined) : false; + if (isSubscription) { + const wsFetcher = (0, _lib.getWsFetcher)(options, fetcherOpts); + if (!wsFetcher) { + throw new Error(`Your GraphiQL createFetcher is not properly configured for websocket subscriptions yet. ${options.subscriptionUrl ? `Provided URL ${options.subscriptionUrl} failed` : 'Please provide subscriptionUrl, wsClient or legacyClient option first.'}`); + } + return wsFetcher(graphQLParams); + } + return httpFetcher(graphQLParams, fetcherOpts); + }; +} + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/create-fetcher/index.js": +/*!**********************************************************!*\ + !*** ../../graphiql-toolkit/esm/create-fetcher/index.js ***! + \**********************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +var _exportNames = { + createGraphiQLFetcher: true +}; +Object.defineProperty(exports, "createGraphiQLFetcher", ({ + enumerable: true, + get: function () { + return _createFetcher.createGraphiQLFetcher; + } +})); +var _types = __webpack_require__(/*! ./types */ "../../graphiql-toolkit/esm/create-fetcher/types.js"); +Object.keys(_types).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (Object.prototype.hasOwnProperty.call(_exportNames, key)) return; + if (key in exports && exports[key] === _types[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _types[key]; + } + }); +}); +var _createFetcher = __webpack_require__(/*! ./createFetcher */ "../../graphiql-toolkit/esm/create-fetcher/createFetcher.js"); + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/create-fetcher/lib.js": +/*!********************************************************!*\ + !*** ../../graphiql-toolkit/esm/create-fetcher/lib.js ***! + \********************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.isSubscriptionWithName = exports.getWsFetcher = exports.createWebsocketsFetcherFromUrl = exports.createWebsocketsFetcherFromClient = exports.createSimpleFetcher = exports.createMultipartFetcher = exports.createLegacyWebsocketsFetcher = void 0; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +var _meros = __webpack_require__(/*! meros */ "../../../node_modules/meros/browser/index.mjs"); +var _pushPullAsyncIterableIterator = __webpack_require__(/*! @n1ru4l/push-pull-async-iterable-iterator */ "../../../node_modules/@n1ru4l/push-pull-async-iterable-iterator/index.js"); +var __awaiter = void 0 && (void 0).__awaiter || function (thisArg, _arguments, P, generator) { + function adopt(value) { + return value instanceof P ? value : new P(function (resolve) { + resolve(value); + }); + } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { + try { + step(generator.next(value)); + } catch (e) { + reject(e); + } + } + function rejected(value) { + try { + step(generator["throw"](value)); + } catch (e) { + reject(e); + } + } + function step(result) { + result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); + } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +var __await = void 0 && (void 0).__await || function (v) { + return this instanceof __await ? (this.v = v, this) : new __await(v); +}; +var __asyncValues = void 0 && (void 0).__asyncValues || function (o) { + if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); + var m = o[Symbol.asyncIterator], + i; + return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { + return this; + }, i); + function verb(n) { + i[n] = o[n] && function (v) { + return new Promise(function (resolve, reject) { + v = o[n](v), settle(resolve, reject, v.done, v.value); + }); + }; + } + function settle(resolve, reject, d, v) { + Promise.resolve(v).then(function (v) { + resolve({ + value: v, + done: d + }); + }, reject); + } +}; +var __asyncGenerator = void 0 && (void 0).__asyncGenerator || function (thisArg, _arguments, generator) { + if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); + var g = generator.apply(thisArg, _arguments || []), + i, + q = []; + return i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { + return this; + }, i; + function verb(n) { + if (g[n]) i[n] = function (v) { + return new Promise(function (a, b) { + q.push([n, v, a, b]) > 1 || resume(n, v); + }); + }; + } + function resume(n, v) { + try { + step(g[n](v)); + } catch (e) { + settle(q[0][3], e); + } + } + function step(r) { + r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); + } + function fulfill(value) { + resume("next", value); + } + function reject(value) { + resume("throw", value); + } + function settle(f, v) { + if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); + } +}; +const errorHasCode = err => { + return typeof err === 'object' && err !== null && 'code' in err; +}; +const isSubscriptionWithName = (document, name) => { + let isSubscription = false; + (0, _graphql.visit)(document, { + OperationDefinition(node) { + var _a; + if (name === ((_a = node.name) === null || _a === void 0 ? void 0 : _a.value) && node.operation === 'subscription') { + isSubscription = true; + } + } + }); + return isSubscription; +}; +exports.isSubscriptionWithName = isSubscriptionWithName; +const createSimpleFetcher = (options, httpFetch) => (graphQLParams, fetcherOpts) => __awaiter(void 0, void 0, void 0, function* () { + const data = yield httpFetch(options.url, { + method: 'POST', + body: JSON.stringify(graphQLParams), + headers: Object.assign(Object.assign({ + 'content-type': 'application/json' + }, options.headers), fetcherOpts === null || fetcherOpts === void 0 ? void 0 : fetcherOpts.headers) + }); + return data.json(); +}); +exports.createSimpleFetcher = createSimpleFetcher; +const createWebsocketsFetcherFromUrl = (url, connectionParams) => { + let wsClient; + try { + const { + createClient + } = __webpack_require__(/*! graphql-ws */ "../../../node_modules/graphql-ws/lib/index.js"); + wsClient = createClient({ + url, + connectionParams + }); + return createWebsocketsFetcherFromClient(wsClient); + } catch (err) { + if (errorHasCode(err) && err.code === 'MODULE_NOT_FOUND') { + throw new Error("You need to install the 'graphql-ws' package to use websockets when passing a 'subscriptionUrl'"); + } + console.error(`Error creating websocket client for ${url}`, err); + } +}; +exports.createWebsocketsFetcherFromUrl = createWebsocketsFetcherFromUrl; +const createWebsocketsFetcherFromClient = wsClient => graphQLParams => (0, _pushPullAsyncIterableIterator.makeAsyncIterableIteratorFromSink)(sink => wsClient.subscribe(graphQLParams, Object.assign(Object.assign({}, sink), { + error(err) { + if (err instanceof CloseEvent) { + sink.error(new Error(`Socket closed with event ${err.code} ${err.reason || ''}`.trim())); + } else { + sink.error(err); + } + } +}))); +exports.createWebsocketsFetcherFromClient = createWebsocketsFetcherFromClient; +const createLegacyWebsocketsFetcher = legacyWsClient => graphQLParams => { + const observable = legacyWsClient.request(graphQLParams); + return (0, _pushPullAsyncIterableIterator.makeAsyncIterableIteratorFromSink)(sink => observable.subscribe(sink).unsubscribe); +}; +exports.createLegacyWebsocketsFetcher = createLegacyWebsocketsFetcher; +const createMultipartFetcher = (options, httpFetch) => function (graphQLParams, fetcherOpts) { + return __asyncGenerator(this, arguments, function* () { + var e_1, _a; + const response = yield __await(httpFetch(options.url, { + method: 'POST', + body: JSON.stringify(graphQLParams), + headers: Object.assign(Object.assign({ + 'content-type': 'application/json', + accept: 'application/json, multipart/mixed' + }, options.headers), fetcherOpts === null || fetcherOpts === void 0 ? void 0 : fetcherOpts.headers) + }).then(r => (0, _meros.meros)(r, { + multiple: true + }))); + if (!(0, _pushPullAsyncIterableIterator.isAsyncIterable)(response)) { + return yield __await(yield yield __await(response.json())); + } + try { + for (var response_1 = __asyncValues(response), response_1_1; response_1_1 = yield __await(response_1.next()), !response_1_1.done;) { + const chunk = response_1_1.value; + if (chunk.some(part => !part.json)) { + const message = chunk.map(part => `Headers::\n${part.headers}\n\nBody::\n${part.body}`); + throw new Error(`Expected multipart chunks to be of json type. got:\n${message}`); + } + yield yield __await(chunk.map(part => part.body)); + } + } catch (e_1_1) { + e_1 = { + error: e_1_1 + }; + } finally { + try { + if (response_1_1 && !response_1_1.done && (_a = response_1.return)) yield __await(_a.call(response_1)); + } finally { + if (e_1) throw e_1.error; + } + } + }); +}; +exports.createMultipartFetcher = createMultipartFetcher; +const getWsFetcher = (options, fetcherOpts) => { + if (options.wsClient) { + return createWebsocketsFetcherFromClient(options.wsClient); + } + if (options.subscriptionUrl) { + return createWebsocketsFetcherFromUrl(options.subscriptionUrl, Object.assign(Object.assign({}, options.wsConnectionParams), fetcherOpts === null || fetcherOpts === void 0 ? void 0 : fetcherOpts.headers)); + } + const legacyWebsocketsClient = options.legacyClient || options.legacyWsClient; + if (legacyWebsocketsClient) { + return createLegacyWebsocketsFetcher(legacyWebsocketsClient); + } +}; +exports.getWsFetcher = getWsFetcher; + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/create-fetcher/types.js": +/*!**********************************************************!*\ + !*** ../../graphiql-toolkit/esm/create-fetcher/types.js ***! + \**********************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/format/index.js": +/*!**************************************************!*\ + !*** ../../graphiql-toolkit/esm/format/index.js ***! + \**************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.formatError = formatError; +exports.formatResult = formatResult; +function stringify(obj) { + return JSON.stringify(obj, null, 2); +} +function formatSingleError(error) { + return Object.assign(Object.assign({}, error), { + message: error.message, + stack: error.stack + }); +} +function handleSingleError(error) { + if (error instanceof Error) { + return formatSingleError(error); + } + return error; +} +function formatError(error) { + if (Array.isArray(error)) { + return stringify({ + errors: error.map(e => handleSingleError(e)) + }); + } + return stringify({ + errors: [handleSingleError(error)] + }); +} +function formatResult(result) { + return stringify(result); +} + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/graphql-helpers/auto-complete.js": +/*!*******************************************************************!*\ + !*** ../../graphiql-toolkit/esm/graphql-helpers/auto-complete.js ***! + \*******************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.fillLeafs = fillLeafs; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +function fillLeafs(schema, docString, getDefaultFieldNames) { + const insertions = []; + if (!schema || !docString) { + return { + insertions, + result: docString + }; + } + let ast; + try { + ast = (0, _graphql.parse)(docString); + } catch (_a) { + return { + insertions, + result: docString + }; + } + const fieldNameFn = getDefaultFieldNames || defaultGetDefaultFieldNames; + const typeInfo = new _graphql.TypeInfo(schema); + (0, _graphql.visit)(ast, { + leave(node) { + typeInfo.leave(node); + }, + enter(node) { + typeInfo.enter(node); + if (node.kind === 'Field' && !node.selectionSet) { + const fieldType = typeInfo.getType(); + const selectionSet = buildSelectionSet(isFieldType(fieldType), fieldNameFn); + if (selectionSet && node.loc) { + const indent = getIndentation(docString, node.loc.start); + insertions.push({ + index: node.loc.end, + string: ' ' + (0, _graphql.print)(selectionSet).replaceAll('\n', '\n' + indent) + }); + } + } + } + }); + return { + insertions, + result: withInsertions(docString, insertions) + }; +} +function defaultGetDefaultFieldNames(type) { + if (!('getFields' in type)) { + return []; + } + const fields = type.getFields(); + if (fields.id) { + return ['id']; + } + if (fields.edges) { + return ['edges']; + } + if (fields.node) { + return ['node']; + } + const leafFieldNames = []; + for (const fieldName of Object.keys(fields)) { + if ((0, _graphql.isLeafType)(fields[fieldName].type)) { + leafFieldNames.push(fieldName); + } + } + return leafFieldNames; +} +function buildSelectionSet(type, getDefaultFieldNames) { + const namedType = (0, _graphql.getNamedType)(type); + if (!type || (0, _graphql.isLeafType)(type)) { + return; + } + const fieldNames = getDefaultFieldNames(namedType); + if (!Array.isArray(fieldNames) || fieldNames.length === 0 || !('getFields' in namedType)) { + return; + } + return { + kind: _graphql.Kind.SELECTION_SET, + selections: fieldNames.map(fieldName => { + const fieldDef = namedType.getFields()[fieldName]; + const fieldType = fieldDef ? fieldDef.type : null; + return { + kind: _graphql.Kind.FIELD, + name: { + kind: _graphql.Kind.NAME, + value: fieldName + }, + selectionSet: buildSelectionSet(fieldType, getDefaultFieldNames) + }; + }) + }; +} +function withInsertions(initial, insertions) { + if (insertions.length === 0) { + return initial; + } + let edited = ''; + let prevIndex = 0; + for (const { + index, + string + } of insertions) { + edited += initial.slice(prevIndex, index) + string; + prevIndex = index; + } + edited += initial.slice(prevIndex); + return edited; +} +function getIndentation(str, index) { + let indentStart = index; + let indentEnd = index; + while (indentStart) { + const c = str.charCodeAt(indentStart - 1); + if (c === 10 || c === 13 || c === 0x2028 || c === 0x2029) { + break; + } + indentStart--; + if (c !== 9 && c !== 11 && c !== 12 && c !== 32 && c !== 160) { + indentEnd = indentStart; + } + } + return str.slice(indentStart, indentEnd); +} +function isFieldType(fieldType) { + if (fieldType) { + return fieldType; + } +} + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/graphql-helpers/index.js": +/*!***********************************************************!*\ + !*** ../../graphiql-toolkit/esm/graphql-helpers/index.js ***! + \***********************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +var _autoComplete = __webpack_require__(/*! ./auto-complete */ "../../graphiql-toolkit/esm/graphql-helpers/auto-complete.js"); +Object.keys(_autoComplete).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (key in exports && exports[key] === _autoComplete[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _autoComplete[key]; + } + }); +}); +var _mergeAst = __webpack_require__(/*! ./merge-ast */ "../../graphiql-toolkit/esm/graphql-helpers/merge-ast.js"); +Object.keys(_mergeAst).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (key in exports && exports[key] === _mergeAst[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _mergeAst[key]; + } + }); +}); +var _operationName = __webpack_require__(/*! ./operation-name */ "../../graphiql-toolkit/esm/graphql-helpers/operation-name.js"); +Object.keys(_operationName).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (key in exports && exports[key] === _operationName[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _operationName[key]; + } + }); +}); + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/graphql-helpers/merge-ast.js": +/*!***************************************************************!*\ + !*** ../../graphiql-toolkit/esm/graphql-helpers/merge-ast.js ***! + \***************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.mergeAst = mergeAst; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +function uniqueBy(array, iteratee) { + var _a; + const FilteredMap = new Map(); + const result = []; + for (const item of array) { + if (item.kind === 'Field') { + const uniqueValue = iteratee(item); + const existing = FilteredMap.get(uniqueValue); + if ((_a = item.directives) === null || _a === void 0 ? void 0 : _a.length) { + const itemClone = Object.assign({}, item); + result.push(itemClone); + } else if ((existing === null || existing === void 0 ? void 0 : existing.selectionSet) && item.selectionSet) { + existing.selectionSet.selections = [...existing.selectionSet.selections, ...item.selectionSet.selections]; + } else if (!existing) { + const itemClone = Object.assign({}, item); + FilteredMap.set(uniqueValue, itemClone); + result.push(itemClone); + } + } else { + result.push(item); + } + } + return result; +} +function inlineRelevantFragmentSpreads(fragmentDefinitions, selections, selectionSetType) { + var _a; + const selectionSetTypeName = selectionSetType ? (0, _graphql.getNamedType)(selectionSetType).name : null; + const outputSelections = []; + const seenSpreads = []; + for (let selection of selections) { + if (selection.kind === 'FragmentSpread') { + const fragmentName = selection.name.value; + if (!selection.directives || selection.directives.length === 0) { + if (seenSpreads.includes(fragmentName)) { + continue; + } else { + seenSpreads.push(fragmentName); + } + } + const fragmentDefinition = fragmentDefinitions[selection.name.value]; + if (fragmentDefinition) { + const { + typeCondition, + directives, + selectionSet + } = fragmentDefinition; + selection = { + kind: _graphql.Kind.INLINE_FRAGMENT, + typeCondition, + directives, + selectionSet + }; + } + } + if (selection.kind === _graphql.Kind.INLINE_FRAGMENT && (!selection.directives || ((_a = selection.directives) === null || _a === void 0 ? void 0 : _a.length) === 0)) { + const fragmentTypeName = selection.typeCondition ? selection.typeCondition.name.value : null; + if (!fragmentTypeName || fragmentTypeName === selectionSetTypeName) { + outputSelections.push(...inlineRelevantFragmentSpreads(fragmentDefinitions, selection.selectionSet.selections, selectionSetType)); + continue; + } + } + outputSelections.push(selection); + } + return outputSelections; +} +function mergeAst(documentAST, schema) { + const typeInfo = schema ? new _graphql.TypeInfo(schema) : null; + const fragmentDefinitions = Object.create(null); + for (const definition of documentAST.definitions) { + if (definition.kind === _graphql.Kind.FRAGMENT_DEFINITION) { + fragmentDefinitions[definition.name.value] = definition; + } + } + const flattenVisitors = { + SelectionSet(node) { + const selectionSetType = typeInfo ? typeInfo.getParentType() : null; + let { + selections + } = node; + selections = inlineRelevantFragmentSpreads(fragmentDefinitions, selections, selectionSetType); + return Object.assign(Object.assign({}, node), { + selections + }); + }, + FragmentDefinition() { + return null; + } + }; + const flattenedAST = (0, _graphql.visit)(documentAST, typeInfo ? (0, _graphql.visitWithTypeInfo)(typeInfo, flattenVisitors) : flattenVisitors); + const deduplicateVisitors = { + SelectionSet(node) { + let { + selections + } = node; + selections = uniqueBy(selections, selection => selection.alias ? selection.alias.value : selection.name.value); + return Object.assign(Object.assign({}, node), { + selections + }); + }, + FragmentDefinition() { + return null; + } + }; + return (0, _graphql.visit)(flattenedAST, deduplicateVisitors); +} + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/graphql-helpers/operation-name.js": +/*!********************************************************************!*\ + !*** ../../graphiql-toolkit/esm/graphql-helpers/operation-name.js ***! + \********************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.getSelectedOperationName = getSelectedOperationName; +function getSelectedOperationName(prevOperations, prevSelectedOperationName, operations) { + if (!operations || operations.length < 1) { + return; + } + const names = operations.map(op => { + var _a; + return (_a = op.name) === null || _a === void 0 ? void 0 : _a.value; + }); + if (prevSelectedOperationName && names.includes(prevSelectedOperationName)) { + return prevSelectedOperationName; + } + if (prevSelectedOperationName && prevOperations) { + const prevNames = prevOperations.map(op => { + var _a; + return (_a = op.name) === null || _a === void 0 ? void 0 : _a.value; + }); + const prevIndex = prevNames.indexOf(prevSelectedOperationName); + if (prevIndex !== -1 && prevIndex < names.length) { + return names[prevIndex]; + } + } + return names[0]; +} + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/index.js": +/*!*******************************************!*\ + !*** ../../graphiql-toolkit/esm/index.js ***! + \*******************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +var _asyncHelpers = __webpack_require__(/*! ./async-helpers */ "../../graphiql-toolkit/esm/async-helpers/index.js"); +Object.keys(_asyncHelpers).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (key in exports && exports[key] === _asyncHelpers[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _asyncHelpers[key]; + } + }); +}); +var _createFetcher = __webpack_require__(/*! ./create-fetcher */ "../../graphiql-toolkit/esm/create-fetcher/index.js"); +Object.keys(_createFetcher).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (key in exports && exports[key] === _createFetcher[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _createFetcher[key]; + } + }); +}); +var _format = __webpack_require__(/*! ./format */ "../../graphiql-toolkit/esm/format/index.js"); +Object.keys(_format).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (key in exports && exports[key] === _format[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _format[key]; + } + }); +}); +var _graphqlHelpers = __webpack_require__(/*! ./graphql-helpers */ "../../graphiql-toolkit/esm/graphql-helpers/index.js"); +Object.keys(_graphqlHelpers).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (key in exports && exports[key] === _graphqlHelpers[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _graphqlHelpers[key]; + } + }); +}); +var _storage = __webpack_require__(/*! ./storage */ "../../graphiql-toolkit/esm/storage/index.js"); +Object.keys(_storage).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (key in exports && exports[key] === _storage[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _storage[key]; + } + }); +}); + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/storage/base.js": +/*!**************************************************!*\ + !*** ../../graphiql-toolkit/esm/storage/base.js ***! + \**************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.StorageAPI = void 0; +function isQuotaError(storage, e) { + return e instanceof DOMException && (e.code === 22 || e.code === 1014 || e.name === 'QuotaExceededError' || e.name === 'NS_ERROR_DOM_QUOTA_REACHED') && storage.length !== 0; +} +class StorageAPI { + constructor(storage) { + if (storage) { + this.storage = storage; + } else if (storage === null) { + this.storage = null; + } else if (typeof window === 'undefined') { + this.storage = null; + } else { + this.storage = { + getItem: window.localStorage.getItem.bind(window.localStorage), + setItem: window.localStorage.setItem.bind(window.localStorage), + removeItem: window.localStorage.removeItem.bind(window.localStorage), + get length() { + let keys = 0; + for (const key in window.localStorage) { + if (key.indexOf(`${STORAGE_NAMESPACE}:`) === 0) { + keys += 1; + } + } + return keys; + }, + clear() { + for (const key in window.localStorage) { + if (key.indexOf(`${STORAGE_NAMESPACE}:`) === 0) { + window.localStorage.removeItem(key); + } + } + } + }; + } + } + get(name) { + if (!this.storage) { + return null; + } + const key = `${STORAGE_NAMESPACE}:${name}`; + const value = this.storage.getItem(key); + if (value === 'null' || value === 'undefined') { + this.storage.removeItem(key); + return null; + } + return value || null; + } + set(name, value) { + let quotaError = false; + let error = null; + if (this.storage) { + const key = `${STORAGE_NAMESPACE}:${name}`; + if (value) { + try { + this.storage.setItem(key, value); + } catch (e) { + error = e instanceof Error ? e : new Error(`${e}`); + quotaError = isQuotaError(this.storage, e); + } + } else { + this.storage.removeItem(key); + } + } + return { + isQuotaError: quotaError, + error + }; + } + clear() { + if (this.storage) { + this.storage.clear(); + } + } +} +exports.StorageAPI = StorageAPI; +const STORAGE_NAMESPACE = 'graphiql'; + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/storage/custom.js": +/*!****************************************************!*\ + !*** ../../graphiql-toolkit/esm/storage/custom.js ***! + \****************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.createLocalStorage = createLocalStorage; +function createLocalStorage(_ref) { + let { + namespace + } = _ref; + const storageKeyPrefix = `${namespace}:`; + const getStorageKey = key => `${storageKeyPrefix}${key}`; + const storage = { + setItem: (key, value) => localStorage.setItem(getStorageKey(key), value), + getItem: key => localStorage.getItem(getStorageKey(key)), + removeItem: key => localStorage.removeItem(getStorageKey(key)), + get length() { + let keys = 0; + for (const key in window.localStorage) { + if (key.indexOf(storageKeyPrefix) === 0) { + keys += 1; + } + } + return keys; + }, + clear() { + for (const key in window.localStorage) { + if (key.indexOf(storageKeyPrefix) === 0) { + window.localStorage.removeItem(key); + } + } + } + }; + return storage; +} + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/storage/history.js": +/*!*****************************************************!*\ + !*** ../../graphiql-toolkit/esm/storage/history.js ***! + \*****************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.HistoryStore = void 0; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +var _query = __webpack_require__(/*! ./query */ "../../graphiql-toolkit/esm/storage/query.js"); +const MAX_QUERY_SIZE = 100000; +class HistoryStore { + constructor(storage, maxHistoryLength) { + var _this = this; + this.storage = storage; + this.maxHistoryLength = maxHistoryLength; + this.updateHistory = _ref => { + let { + query, + variables, + headers, + operationName + } = _ref; + if (!this.shouldSaveQuery(query, variables, headers, this.history.fetchRecent())) { + return; + } + this.history.push({ + query, + variables, + headers, + operationName + }); + const historyQueries = this.history.items; + const favoriteQueries = this.favorite.items; + this.queries = historyQueries.concat(favoriteQueries); + }; + this.deleteHistory = function (_ref2) { + let { + query, + variables, + headers, + operationName, + favorite + } = _ref2; + let clearFavorites = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + function deleteFromStore(store) { + const found = store.items.find(x => x.query === query && x.variables === variables && x.headers === headers && x.operationName === operationName); + if (found) { + store.delete(found); + } + } + if (favorite || clearFavorites) { + deleteFromStore(_this.favorite); + } + if (!favorite || clearFavorites) { + deleteFromStore(_this.history); + } + _this.queries = [..._this.history.items, ..._this.favorite.items]; + }; + this.history = new _query.QueryStore('queries', this.storage, this.maxHistoryLength); + this.favorite = new _query.QueryStore('favorites', this.storage, null); + this.queries = [...this.history.fetchAll(), ...this.favorite.fetchAll()]; + } + shouldSaveQuery(query, variables, headers, lastQuerySaved) { + if (!query) { + return false; + } + try { + (0, _graphql.parse)(query); + } catch (_a) { + return false; + } + if (query.length > MAX_QUERY_SIZE) { + return false; + } + if (!lastQuerySaved) { + return true; + } + if (JSON.stringify(query) === JSON.stringify(lastQuerySaved.query)) { + if (JSON.stringify(variables) === JSON.stringify(lastQuerySaved.variables)) { + if (JSON.stringify(headers) === JSON.stringify(lastQuerySaved.headers)) { + return false; + } + if (headers && !lastQuerySaved.headers) { + return false; + } + } + if (variables && !lastQuerySaved.variables) { + return false; + } + } + return true; + } + toggleFavorite(_ref3) { + let { + query, + variables, + headers, + operationName, + label, + favorite + } = _ref3; + const item = { + query, + variables, + headers, + operationName, + label + }; + if (favorite) { + item.favorite = false; + this.favorite.delete(item); + this.history.push(item); + } else { + item.favorite = true; + this.favorite.push(item); + this.history.delete(item); + } + this.queries = [...this.history.items, ...this.favorite.items]; + } + editLabel(_ref4, index) { + let { + query, + variables, + headers, + operationName, + label, + favorite + } = _ref4; + const item = { + query, + variables, + headers, + operationName, + label + }; + if (favorite) { + this.favorite.edit(Object.assign(Object.assign({}, item), { + favorite + }), index); + } else { + this.history.edit(item, index); + } + this.queries = [...this.history.items, ...this.favorite.items]; + } +} +exports.HistoryStore = HistoryStore; + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/storage/index.js": +/*!***************************************************!*\ + !*** ../../graphiql-toolkit/esm/storage/index.js ***! + \***************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +var _base = __webpack_require__(/*! ./base */ "../../graphiql-toolkit/esm/storage/base.js"); +Object.keys(_base).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (key in exports && exports[key] === _base[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _base[key]; + } + }); +}); +var _history = __webpack_require__(/*! ./history */ "../../graphiql-toolkit/esm/storage/history.js"); +Object.keys(_history).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (key in exports && exports[key] === _history[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _history[key]; + } + }); +}); +var _query = __webpack_require__(/*! ./query */ "../../graphiql-toolkit/esm/storage/query.js"); +Object.keys(_query).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (key in exports && exports[key] === _query[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _query[key]; + } + }); +}); +var _custom = __webpack_require__(/*! ./custom */ "../../graphiql-toolkit/esm/storage/custom.js"); +Object.keys(_custom).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (key in exports && exports[key] === _custom[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _custom[key]; + } + }); +}); + +/***/ }), + +/***/ "../../graphiql-toolkit/esm/storage/query.js": +/*!***************************************************!*\ + !*** ../../graphiql-toolkit/esm/storage/query.js ***! + \***************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.QueryStore = void 0; +class QueryStore { + constructor(key, storage) { + let maxSize = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null; + this.key = key; + this.storage = storage; + this.maxSize = maxSize; + this.items = this.fetchAll(); + } + get length() { + return this.items.length; + } + contains(item) { + return this.items.some(x => x.query === item.query && x.variables === item.variables && x.headers === item.headers && x.operationName === item.operationName); + } + edit(item, index) { + if (typeof index === 'number' && this.items[index]) { + const found = this.items[index]; + if (found.query === item.query && found.variables === item.variables && found.headers === item.headers && found.operationName === item.operationName) { + this.items.splice(index, 1, item); + this.save(); + return; + } + } + const itemIndex = this.items.findIndex(x => x.query === item.query && x.variables === item.variables && x.headers === item.headers && x.operationName === item.operationName); + if (itemIndex !== -1) { + this.items.splice(itemIndex, 1, item); + this.save(); + } + } + delete(item) { + const itemIndex = this.items.findIndex(x => x.query === item.query && x.variables === item.variables && x.headers === item.headers && x.operationName === item.operationName); + if (itemIndex !== -1) { + this.items.splice(itemIndex, 1); + this.save(); + } + } + fetchRecent() { + return this.items.at(-1); + } + fetchAll() { + const raw = this.storage.get(this.key); + if (raw) { + return JSON.parse(raw)[this.key]; + } + return []; + } + push(item) { + const items = [...this.items, item]; + if (this.maxSize && items.length > this.maxSize) { + items.shift(); + } + for (let attempts = 0; attempts < 5; attempts++) { + const response = this.storage.set(this.key, JSON.stringify({ + [this.key]: items + })); + if (!(response === null || response === void 0 ? void 0 : response.error)) { + this.items = items; + } else if (response.isQuotaError && this.maxSize) { + items.shift(); + } else { + return; + } + } + } + save() { + this.storage.set(this.key, JSON.stringify({ + [this.key]: this.items + })); + } +} +exports.QueryStore = QueryStore; + +/***/ }), + +/***/ "./components/GraphiQL.tsx": +/*!*********************************!*\ + !*** ./components/GraphiQL.tsx ***! + \*********************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.GraphiQL = GraphiQL; +exports.GraphiQLInterface = GraphiQLInterface; +var _react = _interopRequireWildcard(__webpack_require__(/*! react */ "react")); +var _react2 = __webpack_require__(/*! @graphiql/react */ "../../graphiql-react/dist/index.js"); +function _getRequireWildcardCache(nodeInterop) { if (typeof WeakMap !== "function") return null; var cacheBabelInterop = new WeakMap(); var cacheNodeInterop = new WeakMap(); return (_getRequireWildcardCache = function (nodeInterop) { return nodeInterop ? cacheNodeInterop : cacheBabelInterop; })(nodeInterop); } +function _interopRequireWildcard(obj, nodeInterop) { if (!nodeInterop && obj && obj.__esModule) { return obj; } if (obj === null || typeof obj !== "object" && typeof obj !== "function") { return { default: obj }; } var cache = _getRequireWildcardCache(nodeInterop); if (cache && cache.has(obj)) { return cache.get(obj); } var newObj = {}; var hasPropertyDescriptor = Object.defineProperty && Object.getOwnPropertyDescriptor; for (var key in obj) { if (key !== "default" && Object.prototype.hasOwnProperty.call(obj, key)) { var desc = hasPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : null; if (desc && (desc.get || desc.set)) { Object.defineProperty(newObj, key, desc); } else { newObj[key] = obj[key]; } } } newObj.default = obj; if (cache) { cache.set(obj, newObj); } return newObj; } +function _extends() { _extends = Object.assign ? Object.assign.bind() : function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); } +const majorVersion = parseInt(_react.default.version.slice(0, 2), 10); +if (majorVersion < 16) { + throw new Error(['GraphiQL 0.18.0 and after is not compatible with React 15 or below.', 'If you are using a CDN source (jsdelivr, unpkg, etc), follow this example:', 'https://github.com/graphql/graphiql/blob/master/examples/graphiql-cdn/index.html#L49'].join('\n')); +} +/** + * The top-level React component for GraphiQL, intended to encompass the entire + * browser viewport. + * + * @see https://github.com/graphql/graphiql#usage + */ + +function GraphiQL(_ref) { + let { + dangerouslyAssumeSchemaIsValid, + defaultQuery, + defaultTabs, + externalFragments, + fetcher, + getDefaultFieldNames, + headers, + inputValueDeprecation, + introspectionQueryName, + maxHistoryLength, + onEditOperationName, + onSchemaChange, + onTabChange, + onTogglePluginVisibility, + operationName, + plugins, + query, + response, + schema, + schemaDescription, + shouldPersistHeaders, + storage, + validationRules, + variables, + visiblePlugin, + defaultHeaders, + ...props + } = _ref; + // Ensure props are correct + if (typeof fetcher !== 'function') { + throw new TypeError('The `GraphiQL` component requires a `fetcher` function to be passed as prop.'); + } + return /*#__PURE__*/_react.default.createElement(_react2.GraphiQLProvider, { + getDefaultFieldNames: getDefaultFieldNames, + dangerouslyAssumeSchemaIsValid: dangerouslyAssumeSchemaIsValid, + defaultQuery: defaultQuery, + defaultHeaders: defaultHeaders, + defaultTabs: defaultTabs, + externalFragments: externalFragments, + fetcher: fetcher, + headers: headers, + inputValueDeprecation: inputValueDeprecation, + introspectionQueryName: introspectionQueryName, + maxHistoryLength: maxHistoryLength, + onEditOperationName: onEditOperationName, + onSchemaChange: onSchemaChange, + onTabChange: onTabChange, + onTogglePluginVisibility: onTogglePluginVisibility, + plugins: plugins, + visiblePlugin: visiblePlugin, + operationName: operationName, + query: query, + response: response, + schema: schema, + schemaDescription: schemaDescription, + shouldPersistHeaders: shouldPersistHeaders, + storage: storage, + validationRules: validationRules, + variables: variables + }, /*#__PURE__*/_react.default.createElement(GraphiQLInterface, _extends({ + showPersistHeadersSettings: shouldPersistHeaders !== false + }, props))); +} + +// Export main windows/panes to be used separately if desired. +GraphiQL.Logo = GraphiQLLogo; +GraphiQL.Toolbar = GraphiQLToolbar; +GraphiQL.Footer = GraphiQLFooter; +function GraphiQLInterface(props) { + var _props$isHeadersEdito, _pluginContext$visibl, _props$toolbar, _props$toolbar2; + const isHeadersEditorEnabled = (_props$isHeadersEdito = props.isHeadersEditorEnabled) !== null && _props$isHeadersEdito !== void 0 ? _props$isHeadersEdito : true; + const editorContext = (0, _react2.useEditorContext)({ + nonNull: true + }); + const executionContext = (0, _react2.useExecutionContext)({ + nonNull: true + }); + const schemaContext = (0, _react2.useSchemaContext)({ + nonNull: true + }); + const storageContext = (0, _react2.useStorageContext)(); + const pluginContext = (0, _react2.usePluginContext)(); + const copy = (0, _react2.useCopyQuery)({ + onCopyQuery: props.onCopyQuery + }); + const merge = (0, _react2.useMergeQuery)(); + const prettify = (0, _react2.usePrettifyEditors)(); + const { + theme, + setTheme + } = (0, _react2.useTheme)(); + const PluginContent = pluginContext === null || pluginContext === void 0 ? void 0 : (_pluginContext$visibl = pluginContext.visiblePlugin) === null || _pluginContext$visibl === void 0 ? void 0 : _pluginContext$visibl.content; + const pluginResize = (0, _react2.useDragResize)({ + defaultSizeRelation: 1 / 3, + direction: 'horizontal', + initiallyHidden: pluginContext !== null && pluginContext !== void 0 && pluginContext.visiblePlugin ? undefined : 'first', + onHiddenElementChange(resizableElement) { + if (resizableElement === 'first') { + pluginContext === null || pluginContext === void 0 ? void 0 : pluginContext.setVisiblePlugin(null); + } + }, + sizeThresholdSecond: 200, + storageKey: 'docExplorerFlex' + }); + const editorResize = (0, _react2.useDragResize)({ + direction: 'horizontal', + storageKey: 'editorFlex' + }); + const editorToolsResize = (0, _react2.useDragResize)({ + defaultSizeRelation: 3, + direction: 'vertical', + initiallyHidden: (() => { + if (props.defaultEditorToolsVisibility === 'variables' || props.defaultEditorToolsVisibility === 'headers') { + return; + } + if (typeof props.defaultEditorToolsVisibility === 'boolean') { + return props.defaultEditorToolsVisibility ? undefined : 'second'; + } + return editorContext.initialVariables || editorContext.initialHeaders ? undefined : 'second'; + })(), + sizeThresholdSecond: 60, + storageKey: 'secondaryEditorFlex' + }); + const [activeSecondaryEditor, setActiveSecondaryEditor] = (0, _react.useState)(() => { + if (props.defaultEditorToolsVisibility === 'variables' || props.defaultEditorToolsVisibility === 'headers') { + return props.defaultEditorToolsVisibility; + } + return !editorContext.initialVariables && editorContext.initialHeaders && isHeadersEditorEnabled ? 'headers' : 'variables'; + }); + const [showDialog, setShowDialog] = (0, _react.useState)(null); + const [clearStorageStatus, setClearStorageStatus] = (0, _react.useState)(null); + const children = _react.default.Children.toArray(props.children); + const logo = children.find(child => isChildComponentType(child, GraphiQL.Logo)) || /*#__PURE__*/_react.default.createElement(GraphiQL.Logo, null); + const toolbar = children.find(child => isChildComponentType(child, GraphiQL.Toolbar)) || /*#__PURE__*/_react.default.createElement(_react.default.Fragment, null, /*#__PURE__*/_react.default.createElement(_react2.ToolbarButton, { + onClick: prettify, + label: "Prettify query (Shift-Ctrl-P)" + }, /*#__PURE__*/_react.default.createElement(_react2.PrettifyIcon, { + className: "graphiql-toolbar-icon", + "aria-hidden": "true" + })), /*#__PURE__*/_react.default.createElement(_react2.ToolbarButton, { + onClick: merge, + label: "Merge fragments into query (Shift-Ctrl-M)" + }, /*#__PURE__*/_react.default.createElement(_react2.MergeIcon, { + className: "graphiql-toolbar-icon", + "aria-hidden": "true" + })), /*#__PURE__*/_react.default.createElement(_react2.ToolbarButton, { + onClick: copy, + label: "Copy query (Shift-Ctrl-C)" + }, /*#__PURE__*/_react.default.createElement(_react2.CopyIcon, { + className: "graphiql-toolbar-icon", + "aria-hidden": "true" + })), ((_props$toolbar = props.toolbar) === null || _props$toolbar === void 0 ? void 0 : _props$toolbar.additionalContent) && props.toolbar.additionalContent, ((_props$toolbar2 = props.toolbar) === null || _props$toolbar2 === void 0 ? void 0 : _props$toolbar2.additionalComponent) && /*#__PURE__*/_react.default.createElement(props.toolbar.additionalComponent, null)); + const footer = children.find(child => isChildComponentType(child, GraphiQL.Footer)); + const onClickReference = (0, _react.useCallback)(() => { + if (pluginResize.hiddenElement === 'first') { + pluginResize.setHiddenElement(null); + } + }, [pluginResize]); + const handleClearData = (0, _react.useCallback)(() => { + try { + storageContext === null || storageContext === void 0 ? void 0 : storageContext.clear(); + setClearStorageStatus('success'); + } catch { + setClearStorageStatus('error'); + } + }, [storageContext]); + const handlePersistHeaders = (0, _react.useCallback)(event => { + editorContext.setShouldPersistHeaders(event.currentTarget.dataset.value === 'true'); + }, [editorContext]); + const handleChangeTheme = (0, _react.useCallback)(event => { + const selectedTheme = event.currentTarget.dataset.theme; + setTheme(selectedTheme || null); + }, [setTheme]); + const handleAddTab = editorContext.addTab; + const handleRefetchSchema = schemaContext.introspect; + const handleReorder = editorContext.moveTab; + const handleShowDialog = (0, _react.useCallback)(event => { + setShowDialog(event.currentTarget.dataset.value); + }, []); + const handlePluginClick = (0, _react.useCallback)(e => { + const context = pluginContext; + const pluginIndex = Number(e.currentTarget.dataset.index); + const plugin = context.plugins.find((_, index) => pluginIndex === index); + const isVisible = plugin === context.visiblePlugin; + if (isVisible) { + context.setVisiblePlugin(null); + pluginResize.setHiddenElement('first'); + } else { + context.setVisiblePlugin(plugin); + pluginResize.setHiddenElement(null); + } + }, [pluginContext, pluginResize]); + const handleToolsTabClick = (0, _react.useCallback)(event => { + if (editorToolsResize.hiddenElement === 'second') { + editorToolsResize.setHiddenElement(null); + } + setActiveSecondaryEditor(event.currentTarget.dataset.name); + }, [editorToolsResize]); + const toggleEditorTools = (0, _react.useCallback)(() => { + editorToolsResize.setHiddenElement(editorToolsResize.hiddenElement === 'second' ? null : 'second'); + }, [editorToolsResize]); + const handleOpenShortKeysDialog = (0, _react.useCallback)(isOpen => { + if (!isOpen) { + setShowDialog(null); + } + }, []); + const handleOpenSettingsDialog = (0, _react.useCallback)(isOpen => { + if (!isOpen) { + setShowDialog(null); + setClearStorageStatus(null); + } + }, []); + const addTab = /*#__PURE__*/_react.default.createElement(_react2.Tooltip, { + label: "Add tab" + }, /*#__PURE__*/_react.default.createElement(_react2.UnStyledButton, { + type: "button", + className: "graphiql-tab-add", + onClick: handleAddTab, + "aria-label": "Add tab" + }, /*#__PURE__*/_react.default.createElement(_react2.PlusIcon, { + "aria-hidden": "true" + }))); + return /*#__PURE__*/_react.default.createElement(_react2.Tooltip.Provider, null, /*#__PURE__*/_react.default.createElement("div", { + "data-testid": "graphiql-container", + className: "graphiql-container" + }, /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-sidebar" + }, /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-sidebar-section" + }, pluginContext === null || pluginContext === void 0 ? void 0 : pluginContext.plugins.map((plugin, index) => { + const isVisible = plugin === pluginContext.visiblePlugin; + const label = `${isVisible ? 'Hide' : 'Show'} ${plugin.title}`; + const Icon = plugin.icon; + return /*#__PURE__*/_react.default.createElement(_react2.Tooltip, { + key: plugin.title, + label: label + }, /*#__PURE__*/_react.default.createElement(_react2.UnStyledButton, { + type: "button", + className: isVisible ? 'active' : '', + onClick: handlePluginClick, + "data-index": index, + "aria-label": label + }, /*#__PURE__*/_react.default.createElement(Icon, { + "aria-hidden": "true" + }))); + })), /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-sidebar-section" + }, /*#__PURE__*/_react.default.createElement(_react2.Tooltip, { + label: "Re-fetch GraphQL schema" + }, /*#__PURE__*/_react.default.createElement(_react2.UnStyledButton, { + type: "button", + disabled: schemaContext.isFetching, + onClick: handleRefetchSchema, + "aria-label": "Re-fetch GraphQL schema" + }, /*#__PURE__*/_react.default.createElement(_react2.ReloadIcon, { + className: schemaContext.isFetching ? 'graphiql-spin' : '', + "aria-hidden": "true" + }))), /*#__PURE__*/_react.default.createElement(_react2.Tooltip, { + label: "Open short keys dialog" + }, /*#__PURE__*/_react.default.createElement(_react2.UnStyledButton, { + type: "button", + "data-value": "short-keys", + onClick: handleShowDialog, + "aria-label": "Open short keys dialog" + }, /*#__PURE__*/_react.default.createElement(_react2.KeyboardShortcutIcon, { + "aria-hidden": "true" + }))), /*#__PURE__*/_react.default.createElement(_react2.Tooltip, { + label: "Open settings dialog" + }, /*#__PURE__*/_react.default.createElement(_react2.UnStyledButton, { + type: "button", + "data-value": "settings", + onClick: handleShowDialog, + "aria-label": "Open settings dialog" + }, /*#__PURE__*/_react.default.createElement(_react2.SettingsIcon, { + "aria-hidden": "true" + }))))), /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-main" + }, /*#__PURE__*/_react.default.createElement("div", { + ref: pluginResize.firstRef, + style: { + // Make sure the container shrinks when containing long + // non-breaking texts + minWidth: '200px' + } + }, /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-plugin" + }, PluginContent ? /*#__PURE__*/_react.default.createElement(PluginContent, null) : null)), (pluginContext === null || pluginContext === void 0 ? void 0 : pluginContext.visiblePlugin) && /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-horizontal-drag-bar", + ref: pluginResize.dragBarRef + }), /*#__PURE__*/_react.default.createElement("div", { + ref: pluginResize.secondRef, + className: "graphiql-sessions" + }, /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-session-header" + }, /*#__PURE__*/_react.default.createElement(_react2.Tabs, { + values: editorContext.tabs, + onReorder: handleReorder, + "aria-label": "Select active operation" + }, editorContext.tabs.length > 1 && /*#__PURE__*/_react.default.createElement(_react.default.Fragment, null, editorContext.tabs.map((tab, index) => /*#__PURE__*/_react.default.createElement(_react2.Tab, { + key: tab.id, + value: tab, + isActive: index === editorContext.activeTabIndex + }, /*#__PURE__*/_react.default.createElement(_react2.Tab.Button, { + "aria-controls": "graphiql-session", + id: `graphiql-session-tab-${index}`, + onClick: () => { + executionContext.stop(); + editorContext.changeTab(index); + } + }, tab.title), /*#__PURE__*/_react.default.createElement(_react2.Tab.Close, { + onClick: () => { + if (editorContext.activeTabIndex === index) { + executionContext.stop(); + } + editorContext.closeTab(index); + } + }))), addTab)), /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-session-header-right" + }, editorContext.tabs.length === 1 && addTab, logo)), /*#__PURE__*/_react.default.createElement("div", { + role: "tabpanel", + id: "graphiql-session", + className: "graphiql-session", + "aria-labelledby": `graphiql-session-tab-${editorContext.activeTabIndex}` + }, /*#__PURE__*/_react.default.createElement("div", { + ref: editorResize.firstRef + }, /*#__PURE__*/_react.default.createElement("div", { + className: `graphiql-editors${editorContext.tabs.length === 1 ? ' full-height' : ''}` + }, /*#__PURE__*/_react.default.createElement("div", { + ref: editorToolsResize.firstRef + }, /*#__PURE__*/_react.default.createElement("section", { + className: "graphiql-query-editor", + "aria-label": "Query Editor" + }, /*#__PURE__*/_react.default.createElement(_react2.QueryEditor, { + editorTheme: props.editorTheme, + keyMap: props.keyMap, + onClickReference: onClickReference, + onCopyQuery: props.onCopyQuery, + onEdit: props.onEditQuery, + readOnly: props.readOnly + }), /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-toolbar", + role: "toolbar", + "aria-label": "Editor Commands" + }, /*#__PURE__*/_react.default.createElement(_react2.ExecuteButton, null), toolbar))), /*#__PURE__*/_react.default.createElement("div", { + ref: editorToolsResize.dragBarRef + }, /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-editor-tools" + }, /*#__PURE__*/_react.default.createElement(_react2.UnStyledButton, { + type: "button", + className: activeSecondaryEditor === 'variables' && editorToolsResize.hiddenElement !== 'second' ? 'active' : '', + onClick: handleToolsTabClick, + "data-name": "variables" + }, "Variables"), isHeadersEditorEnabled && /*#__PURE__*/_react.default.createElement(_react2.UnStyledButton, { + type: "button", + className: activeSecondaryEditor === 'headers' && editorToolsResize.hiddenElement !== 'second' ? 'active' : '', + onClick: handleToolsTabClick, + "data-name": "headers" + }, "Headers"), /*#__PURE__*/_react.default.createElement(_react2.Tooltip, { + label: editorToolsResize.hiddenElement === 'second' ? 'Show editor tools' : 'Hide editor tools' + }, /*#__PURE__*/_react.default.createElement(_react2.UnStyledButton, { + type: "button", + onClick: toggleEditorTools, + "aria-label": editorToolsResize.hiddenElement === 'second' ? 'Show editor tools' : 'Hide editor tools', + className: "graphiql-toggle-editor-tools" + }, editorToolsResize.hiddenElement === 'second' ? /*#__PURE__*/_react.default.createElement(_react2.ChevronUpIcon, { + className: "graphiql-chevron-icon", + "aria-hidden": "true" + }) : /*#__PURE__*/_react.default.createElement(_react2.ChevronDownIcon, { + className: "graphiql-chevron-icon", + "aria-hidden": "true" + }))))), /*#__PURE__*/_react.default.createElement("div", { + ref: editorToolsResize.secondRef + }, /*#__PURE__*/_react.default.createElement("section", { + className: "graphiql-editor-tool", + "aria-label": activeSecondaryEditor === 'variables' ? 'Variables' : 'Headers' + }, /*#__PURE__*/_react.default.createElement(_react2.VariableEditor, { + editorTheme: props.editorTheme, + isHidden: activeSecondaryEditor !== 'variables', + keyMap: props.keyMap, + onEdit: props.onEditVariables, + onClickReference: onClickReference, + readOnly: props.readOnly + }), isHeadersEditorEnabled && /*#__PURE__*/_react.default.createElement(_react2.HeaderEditor, { + editorTheme: props.editorTheme, + isHidden: activeSecondaryEditor !== 'headers', + keyMap: props.keyMap, + onEdit: props.onEditHeaders, + readOnly: props.readOnly + }))))), /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-horizontal-drag-bar", + ref: editorResize.dragBarRef + }), /*#__PURE__*/_react.default.createElement("div", { + ref: editorResize.secondRef + }, /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-response" + }, executionContext.isFetching ? /*#__PURE__*/_react.default.createElement(_react2.Spinner, null) : null, /*#__PURE__*/_react.default.createElement(_react2.ResponseEditor, { + editorTheme: props.editorTheme, + responseTooltip: props.responseTooltip, + keyMap: props.keyMap + }), footer))))), /*#__PURE__*/_react.default.createElement(_react2.Dialog, { + open: showDialog === 'short-keys', + onOpenChange: handleOpenShortKeysDialog + }, /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-dialog-header" + }, /*#__PURE__*/_react.default.createElement(_react2.Dialog.Title, { + className: "graphiql-dialog-title" + }, "Short Keys"), /*#__PURE__*/_react.default.createElement(_react2.Dialog.Close, null)), /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-dialog-section" + }, /*#__PURE__*/_react.default.createElement(ShortKeys, { + keyMap: props.keyMap || 'sublime' + }))), /*#__PURE__*/_react.default.createElement(_react2.Dialog, { + open: showDialog === 'settings', + onOpenChange: handleOpenSettingsDialog + }, /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-dialog-header" + }, /*#__PURE__*/_react.default.createElement(_react2.Dialog.Title, { + className: "graphiql-dialog-title" + }, "Settings"), /*#__PURE__*/_react.default.createElement(_react2.Dialog.Close, null)), props.showPersistHeadersSettings ? /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-dialog-section" + }, /*#__PURE__*/_react.default.createElement("div", null, /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-dialog-section-title" + }, "Persist headers"), /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-dialog-section-caption" + }, "Save headers upon reloading.", ' ', /*#__PURE__*/_react.default.createElement("span", { + className: "graphiql-warning-text" + }, "Only enable if you trust this device."))), /*#__PURE__*/_react.default.createElement(_react2.ButtonGroup, null, /*#__PURE__*/_react.default.createElement(_react2.Button, { + type: "button", + id: "enable-persist-headers", + className: editorContext.shouldPersistHeaders ? 'active' : '', + "data-value": "true", + onClick: handlePersistHeaders + }, "On"), /*#__PURE__*/_react.default.createElement(_react2.Button, { + type: "button", + id: "disable-persist-headers", + className: editorContext.shouldPersistHeaders ? '' : 'active', + onClick: handlePersistHeaders + }, "Off"))) : null, /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-dialog-section" + }, /*#__PURE__*/_react.default.createElement("div", null, /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-dialog-section-title" + }, "Theme"), /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-dialog-section-caption" + }, "Adjust how the interface looks like.")), /*#__PURE__*/_react.default.createElement(_react2.ButtonGroup, null, /*#__PURE__*/_react.default.createElement(_react2.Button, { + type: "button", + className: theme === null ? 'active' : '', + onClick: handleChangeTheme + }, "System"), /*#__PURE__*/_react.default.createElement(_react2.Button, { + type: "button", + className: theme === 'light' ? 'active' : '', + "data-theme": "light", + onClick: handleChangeTheme + }, "Light"), /*#__PURE__*/_react.default.createElement(_react2.Button, { + type: "button", + className: theme === 'dark' ? 'active' : '', + "data-theme": "dark", + onClick: handleChangeTheme + }, "Dark"))), storageContext ? /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-dialog-section" + }, /*#__PURE__*/_react.default.createElement("div", null, /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-dialog-section-title" + }, "Clear storage"), /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-dialog-section-caption" + }, "Remove all locally stored data and start fresh.")), /*#__PURE__*/_react.default.createElement(_react2.Button, { + type: "button", + state: clearStorageStatus || undefined, + disabled: clearStorageStatus === 'success', + onClick: handleClearData + }, { + success: 'Cleared data', + error: 'Failed' + }[clearStorageStatus] || 'Clear data')) : null))); +} +const modifier = typeof window !== 'undefined' && window.navigator.platform.toLowerCase().indexOf('mac') === 0 ? 'Cmd' : 'Ctrl'; +const SHORT_KEYS = Object.entries({ + 'Search in editor': [modifier, 'F'], + 'Search in documentation': [modifier, 'K'], + 'Execute query': [modifier, 'Enter'], + 'Prettify editors': ['Ctrl', 'Shift', 'P'], + 'Merge fragments definitions into operation definition': ['Ctrl', 'Shift', 'M'], + 'Copy query': ['Ctrl', 'Shift', 'C'], + 'Re-fetch schema using introspection': ['Ctrl', 'Shift', 'R'] +}); +function ShortKeys(_ref2) { + let { + keyMap + } = _ref2; + return /*#__PURE__*/_react.default.createElement("div", null, /*#__PURE__*/_react.default.createElement("table", { + className: "graphiql-table" + }, /*#__PURE__*/_react.default.createElement("thead", null, /*#__PURE__*/_react.default.createElement("tr", null, /*#__PURE__*/_react.default.createElement("th", null, "Short Key"), /*#__PURE__*/_react.default.createElement("th", null, "Function"))), /*#__PURE__*/_react.default.createElement("tbody", null, SHORT_KEYS.map(_ref3 => { + let [title, keys] = _ref3; + return /*#__PURE__*/_react.default.createElement("tr", { + key: title + }, /*#__PURE__*/_react.default.createElement("td", null, keys.map((key, index, array) => /*#__PURE__*/_react.default.createElement(_react.Fragment, { + key: key + }, /*#__PURE__*/_react.default.createElement("code", { + className: "graphiql-key" + }, key), index !== array.length - 1 && ' + '))), /*#__PURE__*/_react.default.createElement("td", null, title)); + }))), /*#__PURE__*/_react.default.createElement("p", null, "The editors use", ' ', /*#__PURE__*/_react.default.createElement("a", { + href: "https://codemirror.net/5/doc/manual.html#keymaps", + target: "_blank", + rel: "noopener noreferrer" + }, "CodeMirror Key Maps"), ' ', "that add more short keys. This instance of Graph", /*#__PURE__*/_react.default.createElement("em", null, "i"), "QL uses", ' ', /*#__PURE__*/_react.default.createElement("code", null, keyMap), ".")); +} + +// Configure the UI by providing this Component as a child of GraphiQL. +function GraphiQLLogo(props) { + return /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-logo" + }, props.children || /*#__PURE__*/_react.default.createElement("a", { + className: "graphiql-logo-link", + href: "https://github.com/graphql/graphiql", + target: "_blank", + rel: "noreferrer" + }, "Graph", /*#__PURE__*/_react.default.createElement("em", null, "i"), "QL")); +} +GraphiQLLogo.displayName = 'GraphiQLLogo'; + +// Configure the UI by providing this Component as a child of GraphiQL. +function GraphiQLToolbar(props) { + // eslint-disable-next-line react/jsx-no-useless-fragment + return /*#__PURE__*/_react.default.createElement(_react.default.Fragment, null, props.children); +} +GraphiQLToolbar.displayName = 'GraphiQLToolbar'; + +// Configure the UI by providing this Component as a child of GraphiQL. +function GraphiQLFooter(props) { + return /*#__PURE__*/_react.default.createElement("div", { + className: "graphiql-footer" + }, props.children); +} +GraphiQLFooter.displayName = 'GraphiQLFooter'; + +// Determines if the React child is of the same type of the provided React component +function isChildComponentType(child, component) { + var _child$type; + if (child !== null && child !== void 0 && (_child$type = child.type) !== null && _child$type !== void 0 && _child$type.displayName && child.type.displayName === component.displayName) { + return true; + } + return child.type === component; +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/index.js": +/*!***************************************************!*\ + !*** ../../graphql-language-service/esm/index.js ***! + \***************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +Object.defineProperty(exports, "CharacterStream", ({ + enumerable: true, + get: function () { + return _parser.CharacterStream; + } +})); +Object.defineProperty(exports, "CompletionItemKind", ({ + enumerable: true, + get: function () { + return _types.CompletionItemKind; + } +})); +Object.defineProperty(exports, "DIAGNOSTIC_SEVERITY", ({ + enumerable: true, + get: function () { + return _interface.DIAGNOSTIC_SEVERITY; + } +})); +Object.defineProperty(exports, "FileChangeTypeKind", ({ + enumerable: true, + get: function () { + return _types.FileChangeTypeKind; + } +})); +Object.defineProperty(exports, "LexRules", ({ + enumerable: true, + get: function () { + return _parser.LexRules; + } +})); +Object.defineProperty(exports, "ParseRules", ({ + enumerable: true, + get: function () { + return _parser.ParseRules; + } +})); +Object.defineProperty(exports, "Position", ({ + enumerable: true, + get: function () { + return _utils.Position; + } +})); +Object.defineProperty(exports, "Range", ({ + enumerable: true, + get: function () { + return _utils.Range; + } +})); +Object.defineProperty(exports, "RuleKinds", ({ + enumerable: true, + get: function () { + return _parser.RuleKinds; + } +})); +Object.defineProperty(exports, "SEVERITY", ({ + enumerable: true, + get: function () { + return _interface.SEVERITY; + } +})); +Object.defineProperty(exports, "SuggestionCommand", ({ + enumerable: true, + get: function () { + return _interface.SuggestionCommand; + } +})); +Object.defineProperty(exports, "canUseDirective", ({ + enumerable: true, + get: function () { + return _interface.canUseDirective; + } +})); +Object.defineProperty(exports, "collectVariables", ({ + enumerable: true, + get: function () { + return _utils.collectVariables; + } +})); +Object.defineProperty(exports, "getASTNodeAtPosition", ({ + enumerable: true, + get: function () { + return _utils.getASTNodeAtPosition; + } +})); +Object.defineProperty(exports, "getAutocompleteSuggestions", ({ + enumerable: true, + get: function () { + return _interface.getAutocompleteSuggestions; + } +})); +Object.defineProperty(exports, "getDefinitionQueryResultForDefinitionNode", ({ + enumerable: true, + get: function () { + return _interface.getDefinitionQueryResultForDefinitionNode; + } +})); +Object.defineProperty(exports, "getDefinitionQueryResultForField", ({ + enumerable: true, + get: function () { + return _interface.getDefinitionQueryResultForField; + } +})); +Object.defineProperty(exports, "getDefinitionQueryResultForFragmentSpread", ({ + enumerable: true, + get: function () { + return _interface.getDefinitionQueryResultForFragmentSpread; + } +})); +Object.defineProperty(exports, "getDefinitionQueryResultForNamedType", ({ + enumerable: true, + get: function () { + return _interface.getDefinitionQueryResultForNamedType; + } +})); +Object.defineProperty(exports, "getDefinitionState", ({ + enumerable: true, + get: function () { + return _interface.getDefinitionState; + } +})); +Object.defineProperty(exports, "getDiagnostics", ({ + enumerable: true, + get: function () { + return _interface.getDiagnostics; + } +})); +Object.defineProperty(exports, "getFieldDef", ({ + enumerable: true, + get: function () { + return _interface.getFieldDef; + } +})); +Object.defineProperty(exports, "getFragmentDefinitions", ({ + enumerable: true, + get: function () { + return _interface.getFragmentDefinitions; + } +})); +Object.defineProperty(exports, "getFragmentDependencies", ({ + enumerable: true, + get: function () { + return _utils.getFragmentDependencies; + } +})); +Object.defineProperty(exports, "getFragmentDependenciesForAST", ({ + enumerable: true, + get: function () { + return _utils.getFragmentDependenciesForAST; + } +})); +Object.defineProperty(exports, "getHoverInformation", ({ + enumerable: true, + get: function () { + return _interface.getHoverInformation; + } +})); +Object.defineProperty(exports, "getOperationASTFacts", ({ + enumerable: true, + get: function () { + return _utils.getOperationASTFacts; + } +})); +Object.defineProperty(exports, "getOperationFacts", ({ + enumerable: true, + get: function () { + return _utils.getOperationFacts; + } +})); +Object.defineProperty(exports, "getOutline", ({ + enumerable: true, + get: function () { + return _interface.getOutline; + } +})); +Object.defineProperty(exports, "getQueryFacts", ({ + enumerable: true, + get: function () { + return _utils.getQueryFacts; + } +})); +Object.defineProperty(exports, "getRange", ({ + enumerable: true, + get: function () { + return _interface.getRange; + } +})); +Object.defineProperty(exports, "getTokenAtPosition", ({ + enumerable: true, + get: function () { + return _interface.getTokenAtPosition; + } +})); +Object.defineProperty(exports, "getTypeInfo", ({ + enumerable: true, + get: function () { + return _interface.getTypeInfo; + } +})); +Object.defineProperty(exports, "getVariableCompletions", ({ + enumerable: true, + get: function () { + return _interface.getVariableCompletions; + } +})); +Object.defineProperty(exports, "getVariablesJSONSchema", ({ + enumerable: true, + get: function () { + return _utils.getVariablesJSONSchema; + } +})); +Object.defineProperty(exports, "isIgnored", ({ + enumerable: true, + get: function () { + return _parser.isIgnored; + } +})); +Object.defineProperty(exports, "list", ({ + enumerable: true, + get: function () { + return _parser.list; + } +})); +Object.defineProperty(exports, "offsetToPosition", ({ + enumerable: true, + get: function () { + return _utils.offsetToPosition; + } +})); +Object.defineProperty(exports, "onlineParser", ({ + enumerable: true, + get: function () { + return _parser.onlineParser; + } +})); +Object.defineProperty(exports, "opt", ({ + enumerable: true, + get: function () { + return _parser.opt; + } +})); +Object.defineProperty(exports, "p", ({ + enumerable: true, + get: function () { + return _parser.p; + } +})); +Object.defineProperty(exports, "pointToOffset", ({ + enumerable: true, + get: function () { + return _utils.pointToOffset; + } +})); +Object.defineProperty(exports, "t", ({ + enumerable: true, + get: function () { + return _parser.t; + } +})); +Object.defineProperty(exports, "validateQuery", ({ + enumerable: true, + get: function () { + return _interface.validateQuery; + } +})); +Object.defineProperty(exports, "validateWithCustomRules", ({ + enumerable: true, + get: function () { + return _utils.validateWithCustomRules; + } +})); +var _interface = __webpack_require__(/*! ./interface */ "../../graphql-language-service/esm/interface/index.js"); +var _parser = __webpack_require__(/*! ./parser */ "../../graphql-language-service/esm/parser/index.js"); +var _types = __webpack_require__(/*! ./types */ "../../graphql-language-service/esm/types.js"); +var _utils = __webpack_require__(/*! ./utils */ "../../graphql-language-service/esm/utils/index.js"); + +/***/ }), + +/***/ "../../graphql-language-service/esm/interface/autocompleteUtils.js": +/*!*************************************************************************!*\ + !*** ../../graphql-language-service/esm/interface/autocompleteUtils.js ***! + \*************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.forEachState = forEachState; +exports.getDefinitionState = getDefinitionState; +exports.getFieldDef = getFieldDef; +exports.hintList = hintList; +exports.objectValues = objectValues; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +function getDefinitionState(tokenState) { + let definitionState; + forEachState(tokenState, state => { + switch (state.kind) { + case 'Query': + case 'ShortQuery': + case 'Mutation': + case 'Subscription': + case 'FragmentDefinition': + definitionState = state; + break; + } + }); + return definitionState; +} +function getFieldDef(schema, type, fieldName) { + if (fieldName === _graphql.SchemaMetaFieldDef.name && schema.getQueryType() === type) { + return _graphql.SchemaMetaFieldDef; + } + if (fieldName === _graphql.TypeMetaFieldDef.name && schema.getQueryType() === type) { + return _graphql.TypeMetaFieldDef; + } + if (fieldName === _graphql.TypeNameMetaFieldDef.name && (0, _graphql.isCompositeType)(type)) { + return _graphql.TypeNameMetaFieldDef; + } + if ('getFields' in type) { + return type.getFields()[fieldName]; + } + return null; +} +function forEachState(stack, fn) { + const reverseStateStack = []; + let state = stack; + while (state === null || state === void 0 ? void 0 : state.kind) { + reverseStateStack.push(state); + state = state.prevState; + } + for (let i = reverseStateStack.length - 1; i >= 0; i--) { + fn(reverseStateStack[i]); + } +} +function objectValues(object) { + const keys = Object.keys(object); + const len = keys.length; + const values = new Array(len); + for (let i = 0; i < len; ++i) { + values[i] = object[keys[i]]; + } + return values; +} +function hintList(token, list) { + return filterAndSortList(list, normalizeText(token.string)); +} +function filterAndSortList(list, text) { + if (!text) { + return filterNonEmpty(list, entry => !entry.isDeprecated); + } + const byProximity = list.map(entry => ({ + proximity: getProximity(normalizeText(entry.label), text), + entry + })); + return filterNonEmpty(filterNonEmpty(byProximity, pair => pair.proximity <= 2), pair => !pair.entry.isDeprecated).sort((a, b) => (a.entry.isDeprecated ? 1 : 0) - (b.entry.isDeprecated ? 1 : 0) || a.proximity - b.proximity || a.entry.label.length - b.entry.label.length).map(pair => pair.entry); +} +function filterNonEmpty(array, predicate) { + const filtered = array.filter(predicate); + return filtered.length === 0 ? array : filtered; +} +function normalizeText(text) { + return text.toLowerCase().replaceAll(/\W/g, ''); +} +function getProximity(suggestion, text) { + let proximity = lexicalDistance(text, suggestion); + if (suggestion.length > text.length) { + proximity -= suggestion.length - text.length - 1; + proximity += suggestion.indexOf(text) === 0 ? 0 : 0.5; + } + return proximity; +} +function lexicalDistance(a, b) { + let i; + let j; + const d = []; + const aLength = a.length; + const bLength = b.length; + for (i = 0; i <= aLength; i++) { + d[i] = [i]; + } + for (j = 1; j <= bLength; j++) { + d[0][j] = j; + } + for (i = 1; i <= aLength; i++) { + for (j = 1; j <= bLength; j++) { + const cost = a[i - 1] === b[j - 1] ? 0 : 1; + d[i][j] = Math.min(d[i - 1][j] + 1, d[i][j - 1] + 1, d[i - 1][j - 1] + cost); + if (i > 1 && j > 1 && a[i - 1] === b[j - 2] && a[i - 2] === b[j - 1]) { + d[i][j] = Math.min(d[i][j], d[i - 2][j - 2] + cost); + } + } + } + return d[aLength][bLength]; +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/interface/getAutocompleteSuggestions.js": +/*!**********************************************************************************!*\ + !*** ../../graphql-language-service/esm/interface/getAutocompleteSuggestions.js ***! + \**********************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.SuggestionCommand = exports.GraphQLDocumentMode = void 0; +exports.canUseDirective = canUseDirective; +exports.getAutocompleteSuggestions = getAutocompleteSuggestions; +exports.getFragmentDefinitions = getFragmentDefinitions; +exports.getTokenAtPosition = getTokenAtPosition; +exports.getTypeInfo = getTypeInfo; +exports.getVariableCompletions = getVariableCompletions; +exports.runOnlineParser = runOnlineParser; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +var _types = __webpack_require__(/*! ../types */ "../../graphql-language-service/esm/types.js"); +var _parser = __webpack_require__(/*! ../parser */ "../../graphql-language-service/esm/parser/index.js"); +var _autocompleteUtils = __webpack_require__(/*! ./autocompleteUtils */ "../../graphql-language-service/esm/interface/autocompleteUtils.js"); +const SuggestionCommand = { + command: 'editor.action.triggerSuggest', + title: 'Suggestions' +}; +exports.SuggestionCommand = SuggestionCommand; +const collectFragmentDefs = op => { + const externalFragments = []; + if (op) { + try { + (0, _graphql.visit)((0, _graphql.parse)(op), { + FragmentDefinition(def) { + externalFragments.push(def); + } + }); + } catch (_a) { + return []; + } + } + return externalFragments; +}; +const typeSystemKinds = [_graphql.Kind.SCHEMA_DEFINITION, _graphql.Kind.OPERATION_TYPE_DEFINITION, _graphql.Kind.SCALAR_TYPE_DEFINITION, _graphql.Kind.OBJECT_TYPE_DEFINITION, _graphql.Kind.INTERFACE_TYPE_DEFINITION, _graphql.Kind.UNION_TYPE_DEFINITION, _graphql.Kind.ENUM_TYPE_DEFINITION, _graphql.Kind.INPUT_OBJECT_TYPE_DEFINITION, _graphql.Kind.DIRECTIVE_DEFINITION, _graphql.Kind.SCHEMA_EXTENSION, _graphql.Kind.SCALAR_TYPE_EXTENSION, _graphql.Kind.OBJECT_TYPE_EXTENSION, _graphql.Kind.INTERFACE_TYPE_EXTENSION, _graphql.Kind.UNION_TYPE_EXTENSION, _graphql.Kind.ENUM_TYPE_EXTENSION, _graphql.Kind.INPUT_OBJECT_TYPE_EXTENSION]; +const hasTypeSystemDefinitions = sdl => { + let hasTypeSystemDef = false; + if (sdl) { + try { + (0, _graphql.visit)((0, _graphql.parse)(sdl), { + enter(node) { + if (node.kind === 'Document') { + return; + } + if (typeSystemKinds.includes(node.kind)) { + hasTypeSystemDef = true; + return _graphql.BREAK; + } + return false; + } + }); + } catch (_a) { + return hasTypeSystemDef; + } + } + return hasTypeSystemDef; +}; +function getAutocompleteSuggestions(schema, queryText, cursor, contextToken, fragmentDefs, options) { + var _a; + const opts = Object.assign(Object.assign({}, options), { + schema + }); + const token = contextToken || getTokenAtPosition(queryText, cursor, 1); + const state = token.state.kind === 'Invalid' ? token.state.prevState : token.state; + const mode = (options === null || options === void 0 ? void 0 : options.mode) || getDocumentMode(queryText, options === null || options === void 0 ? void 0 : options.uri); + if (!state) { + return []; + } + const { + kind, + step, + prevState + } = state; + const typeInfo = getTypeInfo(schema, token.state); + if (kind === _parser.RuleKinds.DOCUMENT) { + if (mode === GraphQLDocumentMode.TYPE_SYSTEM) { + return getSuggestionsForTypeSystemDefinitions(token); + } + return getSuggestionsForExecutableDefinitions(token); + } + if (kind === _parser.RuleKinds.EXTEND_DEF) { + return getSuggestionsForExtensionDefinitions(token); + } + if (((_a = prevState === null || prevState === void 0 ? void 0 : prevState.prevState) === null || _a === void 0 ? void 0 : _a.kind) === _parser.RuleKinds.EXTENSION_DEFINITION && state.name) { + return (0, _autocompleteUtils.hintList)(token, []); + } + if ((prevState === null || prevState === void 0 ? void 0 : prevState.kind) === _graphql.Kind.SCALAR_TYPE_EXTENSION) { + return (0, _autocompleteUtils.hintList)(token, Object.values(schema.getTypeMap()).filter(_graphql.isScalarType).map(type => ({ + label: type.name, + kind: _types.CompletionItemKind.Function + }))); + } + if ((prevState === null || prevState === void 0 ? void 0 : prevState.kind) === _graphql.Kind.OBJECT_TYPE_EXTENSION) { + return (0, _autocompleteUtils.hintList)(token, Object.values(schema.getTypeMap()).filter(type => (0, _graphql.isObjectType)(type) && !type.name.startsWith('__')).map(type => ({ + label: type.name, + kind: _types.CompletionItemKind.Function + }))); + } + if ((prevState === null || prevState === void 0 ? void 0 : prevState.kind) === _graphql.Kind.INTERFACE_TYPE_EXTENSION) { + return (0, _autocompleteUtils.hintList)(token, Object.values(schema.getTypeMap()).filter(_graphql.isInterfaceType).map(type => ({ + label: type.name, + kind: _types.CompletionItemKind.Function + }))); + } + if ((prevState === null || prevState === void 0 ? void 0 : prevState.kind) === _graphql.Kind.UNION_TYPE_EXTENSION) { + return (0, _autocompleteUtils.hintList)(token, Object.values(schema.getTypeMap()).filter(_graphql.isUnionType).map(type => ({ + label: type.name, + kind: _types.CompletionItemKind.Function + }))); + } + if ((prevState === null || prevState === void 0 ? void 0 : prevState.kind) === _graphql.Kind.ENUM_TYPE_EXTENSION) { + return (0, _autocompleteUtils.hintList)(token, Object.values(schema.getTypeMap()).filter(type => (0, _graphql.isEnumType)(type) && !type.name.startsWith('__')).map(type => ({ + label: type.name, + kind: _types.CompletionItemKind.Function + }))); + } + if ((prevState === null || prevState === void 0 ? void 0 : prevState.kind) === _graphql.Kind.INPUT_OBJECT_TYPE_EXTENSION) { + return (0, _autocompleteUtils.hintList)(token, Object.values(schema.getTypeMap()).filter(_graphql.isInputObjectType).map(type => ({ + label: type.name, + kind: _types.CompletionItemKind.Function + }))); + } + if (kind === _parser.RuleKinds.IMPLEMENTS || kind === _parser.RuleKinds.NAMED_TYPE && (prevState === null || prevState === void 0 ? void 0 : prevState.kind) === _parser.RuleKinds.IMPLEMENTS) { + return getSuggestionsForImplements(token, state, schema, queryText, typeInfo); + } + if (kind === _parser.RuleKinds.SELECTION_SET || kind === _parser.RuleKinds.FIELD || kind === _parser.RuleKinds.ALIASED_FIELD) { + return getSuggestionsForFieldNames(token, typeInfo, opts); + } + if (kind === _parser.RuleKinds.ARGUMENTS || kind === _parser.RuleKinds.ARGUMENT && step === 0) { + const { + argDefs + } = typeInfo; + if (argDefs) { + return (0, _autocompleteUtils.hintList)(token, argDefs.map(argDef => { + var _a; + return { + label: argDef.name, + insertText: argDef.name + ': ', + command: SuggestionCommand, + detail: String(argDef.type), + documentation: (_a = argDef.description) !== null && _a !== void 0 ? _a : undefined, + kind: _types.CompletionItemKind.Variable, + type: argDef.type + }; + })); + } + } + if ((kind === _parser.RuleKinds.OBJECT_VALUE || kind === _parser.RuleKinds.OBJECT_FIELD && step === 0) && typeInfo.objectFieldDefs) { + const objectFields = (0, _autocompleteUtils.objectValues)(typeInfo.objectFieldDefs); + const completionKind = kind === _parser.RuleKinds.OBJECT_VALUE ? _types.CompletionItemKind.Value : _types.CompletionItemKind.Field; + return (0, _autocompleteUtils.hintList)(token, objectFields.map(field => { + var _a; + return { + label: field.name, + detail: String(field.type), + documentation: (_a = field.description) !== null && _a !== void 0 ? _a : undefined, + kind: completionKind, + type: field.type + }; + })); + } + if (kind === _parser.RuleKinds.ENUM_VALUE || kind === _parser.RuleKinds.LIST_VALUE && step === 1 || kind === _parser.RuleKinds.OBJECT_FIELD && step === 2 || kind === _parser.RuleKinds.ARGUMENT && step === 2) { + return getSuggestionsForInputValues(token, typeInfo, queryText, schema); + } + if (kind === _parser.RuleKinds.VARIABLE && step === 1) { + const namedInputType = (0, _graphql.getNamedType)(typeInfo.inputType); + const variableDefinitions = getVariableCompletions(queryText, schema, token); + return (0, _autocompleteUtils.hintList)(token, variableDefinitions.filter(v => v.detail === (namedInputType === null || namedInputType === void 0 ? void 0 : namedInputType.name))); + } + if (kind === _parser.RuleKinds.TYPE_CONDITION && step === 1 || kind === _parser.RuleKinds.NAMED_TYPE && prevState != null && prevState.kind === _parser.RuleKinds.TYPE_CONDITION) { + return getSuggestionsForFragmentTypeConditions(token, typeInfo, schema, kind); + } + if (kind === _parser.RuleKinds.FRAGMENT_SPREAD && step === 1) { + return getSuggestionsForFragmentSpread(token, typeInfo, schema, queryText, Array.isArray(fragmentDefs) ? fragmentDefs : collectFragmentDefs(fragmentDefs)); + } + const unwrappedState = unwrapType(state); + if (mode === GraphQLDocumentMode.TYPE_SYSTEM && !unwrappedState.needsAdvance && kind === _parser.RuleKinds.NAMED_TYPE || kind === _parser.RuleKinds.LIST_TYPE) { + if (unwrappedState.kind === _parser.RuleKinds.FIELD_DEF) { + return (0, _autocompleteUtils.hintList)(token, Object.values(schema.getTypeMap()).filter(type => (0, _graphql.isOutputType)(type) && !type.name.startsWith('__')).map(type => ({ + label: type.name, + kind: _types.CompletionItemKind.Function + }))); + } + if (unwrappedState.kind === _parser.RuleKinds.INPUT_VALUE_DEF) { + return (0, _autocompleteUtils.hintList)(token, Object.values(schema.getTypeMap()).filter(type => (0, _graphql.isInputType)(type) && !type.name.startsWith('__')).map(type => ({ + label: type.name, + kind: _types.CompletionItemKind.Function + }))); + } + } + if (kind === _parser.RuleKinds.VARIABLE_DEFINITION && step === 2 || kind === _parser.RuleKinds.LIST_TYPE && step === 1 || kind === _parser.RuleKinds.NAMED_TYPE && prevState && (prevState.kind === _parser.RuleKinds.VARIABLE_DEFINITION || prevState.kind === _parser.RuleKinds.LIST_TYPE || prevState.kind === _parser.RuleKinds.NON_NULL_TYPE)) { + return getSuggestionsForVariableDefinition(token, schema, kind); + } + if (kind === _parser.RuleKinds.DIRECTIVE) { + return getSuggestionsForDirective(token, state, schema, kind); + } + return []; +} +const insertSuffix = ' {\n $1\n}'; +const getInsertText = field => { + const { + type + } = field; + if ((0, _graphql.isCompositeType)(type)) { + return insertSuffix; + } + if ((0, _graphql.isListType)(type) && (0, _graphql.isCompositeType)(type.ofType)) { + return insertSuffix; + } + if ((0, _graphql.isNonNullType)(type)) { + if ((0, _graphql.isCompositeType)(type.ofType)) { + return insertSuffix; + } + if ((0, _graphql.isListType)(type.ofType) && (0, _graphql.isCompositeType)(type.ofType.ofType)) { + return insertSuffix; + } + } + return null; +}; +function getSuggestionsForTypeSystemDefinitions(token) { + return (0, _autocompleteUtils.hintList)(token, [{ + label: 'extend', + kind: _types.CompletionItemKind.Function + }, { + label: 'type', + kind: _types.CompletionItemKind.Function + }, { + label: 'interface', + kind: _types.CompletionItemKind.Function + }, { + label: 'union', + kind: _types.CompletionItemKind.Function + }, { + label: 'input', + kind: _types.CompletionItemKind.Function + }, { + label: 'scalar', + kind: _types.CompletionItemKind.Function + }, { + label: 'schema', + kind: _types.CompletionItemKind.Function + }]); +} +function getSuggestionsForExecutableDefinitions(token) { + return (0, _autocompleteUtils.hintList)(token, [{ + label: 'query', + kind: _types.CompletionItemKind.Function + }, { + label: 'mutation', + kind: _types.CompletionItemKind.Function + }, { + label: 'subscription', + kind: _types.CompletionItemKind.Function + }, { + label: 'fragment', + kind: _types.CompletionItemKind.Function + }, { + label: '{', + kind: _types.CompletionItemKind.Constructor + }]); +} +function getSuggestionsForExtensionDefinitions(token) { + return (0, _autocompleteUtils.hintList)(token, [{ + label: 'type', + kind: _types.CompletionItemKind.Function + }, { + label: 'interface', + kind: _types.CompletionItemKind.Function + }, { + label: 'union', + kind: _types.CompletionItemKind.Function + }, { + label: 'input', + kind: _types.CompletionItemKind.Function + }, { + label: 'scalar', + kind: _types.CompletionItemKind.Function + }, { + label: 'schema', + kind: _types.CompletionItemKind.Function + }]); +} +function getSuggestionsForFieldNames(token, typeInfo, options) { + var _a; + if (typeInfo.parentType) { + const { + parentType + } = typeInfo; + let fields = []; + if ('getFields' in parentType) { + fields = (0, _autocompleteUtils.objectValues)(parentType.getFields()); + } + if ((0, _graphql.isCompositeType)(parentType)) { + fields.push(_graphql.TypeNameMetaFieldDef); + } + if (parentType === ((_a = options === null || options === void 0 ? void 0 : options.schema) === null || _a === void 0 ? void 0 : _a.getQueryType())) { + fields.push(_graphql.SchemaMetaFieldDef, _graphql.TypeMetaFieldDef); + } + return (0, _autocompleteUtils.hintList)(token, fields.map((field, index) => { + var _a; + const suggestion = { + sortText: String(index) + field.name, + label: field.name, + detail: String(field.type), + documentation: (_a = field.description) !== null && _a !== void 0 ? _a : undefined, + deprecated: Boolean(field.deprecationReason), + isDeprecated: Boolean(field.deprecationReason), + deprecationReason: field.deprecationReason, + kind: _types.CompletionItemKind.Field, + type: field.type + }; + if (options === null || options === void 0 ? void 0 : options.fillLeafsOnComplete) { + const insertText = getInsertText(field); + if (insertText) { + suggestion.insertText = field.name + insertText; + suggestion.insertTextFormat = _types.InsertTextFormat.Snippet; + suggestion.command = SuggestionCommand; + } + } + return suggestion; + })); + } + return []; +} +function getSuggestionsForInputValues(token, typeInfo, queryText, schema) { + const namedInputType = (0, _graphql.getNamedType)(typeInfo.inputType); + const queryVariables = getVariableCompletions(queryText, schema, token).filter(v => v.detail === namedInputType.name); + if (namedInputType instanceof _graphql.GraphQLEnumType) { + const values = namedInputType.getValues(); + return (0, _autocompleteUtils.hintList)(token, values.map(value => { + var _a; + return { + label: value.name, + detail: String(namedInputType), + documentation: (_a = value.description) !== null && _a !== void 0 ? _a : undefined, + deprecated: Boolean(value.deprecationReason), + isDeprecated: Boolean(value.deprecationReason), + deprecationReason: value.deprecationReason, + kind: _types.CompletionItemKind.EnumMember, + type: namedInputType + }; + }).concat(queryVariables)); + } + if (namedInputType === _graphql.GraphQLBoolean) { + return (0, _autocompleteUtils.hintList)(token, queryVariables.concat([{ + label: 'true', + detail: String(_graphql.GraphQLBoolean), + documentation: 'Not false.', + kind: _types.CompletionItemKind.Variable, + type: _graphql.GraphQLBoolean + }, { + label: 'false', + detail: String(_graphql.GraphQLBoolean), + documentation: 'Not true.', + kind: _types.CompletionItemKind.Variable, + type: _graphql.GraphQLBoolean + }])); + } + return queryVariables; +} +function getSuggestionsForImplements(token, tokenState, schema, documentText, typeInfo) { + if (tokenState.needsSeparator) { + return []; + } + const typeMap = schema.getTypeMap(); + const schemaInterfaces = (0, _autocompleteUtils.objectValues)(typeMap).filter(_graphql.isInterfaceType); + const schemaInterfaceNames = schemaInterfaces.map(_ref => { + let { + name + } = _ref; + return name; + }); + const inlineInterfaces = new Set(); + runOnlineParser(documentText, (_, state) => { + var _a, _b, _c, _d, _e; + if (state.name) { + if (state.kind === _parser.RuleKinds.INTERFACE_DEF && !schemaInterfaceNames.includes(state.name)) { + inlineInterfaces.add(state.name); + } + if (state.kind === _parser.RuleKinds.NAMED_TYPE && ((_a = state.prevState) === null || _a === void 0 ? void 0 : _a.kind) === _parser.RuleKinds.IMPLEMENTS) { + if (typeInfo.interfaceDef) { + const existingType = (_b = typeInfo.interfaceDef) === null || _b === void 0 ? void 0 : _b.getInterfaces().find(_ref2 => { + let { + name + } = _ref2; + return name === state.name; + }); + if (existingType) { + return; + } + const type = schema.getType(state.name); + const interfaceConfig = (_c = typeInfo.interfaceDef) === null || _c === void 0 ? void 0 : _c.toConfig(); + typeInfo.interfaceDef = new _graphql.GraphQLInterfaceType(Object.assign(Object.assign({}, interfaceConfig), { + interfaces: [...interfaceConfig.interfaces, type || new _graphql.GraphQLInterfaceType({ + name: state.name, + fields: {} + })] + })); + } else if (typeInfo.objectTypeDef) { + const existingType = (_d = typeInfo.objectTypeDef) === null || _d === void 0 ? void 0 : _d.getInterfaces().find(_ref3 => { + let { + name + } = _ref3; + return name === state.name; + }); + if (existingType) { + return; + } + const type = schema.getType(state.name); + const objectTypeConfig = (_e = typeInfo.objectTypeDef) === null || _e === void 0 ? void 0 : _e.toConfig(); + typeInfo.objectTypeDef = new _graphql.GraphQLObjectType(Object.assign(Object.assign({}, objectTypeConfig), { + interfaces: [...objectTypeConfig.interfaces, type || new _graphql.GraphQLInterfaceType({ + name: state.name, + fields: {} + })] + })); + } + } + } + }); + const currentTypeToExtend = typeInfo.interfaceDef || typeInfo.objectTypeDef; + const siblingInterfaces = (currentTypeToExtend === null || currentTypeToExtend === void 0 ? void 0 : currentTypeToExtend.getInterfaces()) || []; + const siblingInterfaceNames = siblingInterfaces.map(_ref4 => { + let { + name + } = _ref4; + return name; + }); + const possibleInterfaces = schemaInterfaces.concat([...inlineInterfaces].map(name => ({ + name + }))).filter(_ref5 => { + let { + name + } = _ref5; + return name !== (currentTypeToExtend === null || currentTypeToExtend === void 0 ? void 0 : currentTypeToExtend.name) && !siblingInterfaceNames.includes(name); + }); + return (0, _autocompleteUtils.hintList)(token, possibleInterfaces.map(type => { + const result = { + label: type.name, + kind: _types.CompletionItemKind.Interface, + type + }; + if (type === null || type === void 0 ? void 0 : type.description) { + result.documentation = type.description; + } + return result; + })); +} +function getSuggestionsForFragmentTypeConditions(token, typeInfo, schema, _kind) { + let possibleTypes; + if (typeInfo.parentType) { + if ((0, _graphql.isAbstractType)(typeInfo.parentType)) { + const abstractType = (0, _graphql.assertAbstractType)(typeInfo.parentType); + const possibleObjTypes = schema.getPossibleTypes(abstractType); + const possibleIfaceMap = Object.create(null); + for (const type of possibleObjTypes) { + for (const iface of type.getInterfaces()) { + possibleIfaceMap[iface.name] = iface; + } + } + possibleTypes = possibleObjTypes.concat((0, _autocompleteUtils.objectValues)(possibleIfaceMap)); + } else { + possibleTypes = [typeInfo.parentType]; + } + } else { + const typeMap = schema.getTypeMap(); + possibleTypes = (0, _autocompleteUtils.objectValues)(typeMap).filter(type => (0, _graphql.isCompositeType)(type) && !type.name.startsWith('__')); + } + return (0, _autocompleteUtils.hintList)(token, possibleTypes.map(type => { + const namedType = (0, _graphql.getNamedType)(type); + return { + label: String(type), + documentation: (namedType === null || namedType === void 0 ? void 0 : namedType.description) || '', + kind: _types.CompletionItemKind.Field + }; + })); +} +function getSuggestionsForFragmentSpread(token, typeInfo, schema, queryText, fragmentDefs) { + if (!queryText) { + return []; + } + const typeMap = schema.getTypeMap(); + const defState = (0, _autocompleteUtils.getDefinitionState)(token.state); + const fragments = getFragmentDefinitions(queryText); + if (fragmentDefs && fragmentDefs.length > 0) { + fragments.push(...fragmentDefs); + } + const relevantFrags = fragments.filter(frag => typeMap[frag.typeCondition.name.value] && !(defState && defState.kind === _parser.RuleKinds.FRAGMENT_DEFINITION && defState.name === frag.name.value) && (0, _graphql.isCompositeType)(typeInfo.parentType) && (0, _graphql.isCompositeType)(typeMap[frag.typeCondition.name.value]) && (0, _graphql.doTypesOverlap)(schema, typeInfo.parentType, typeMap[frag.typeCondition.name.value])); + return (0, _autocompleteUtils.hintList)(token, relevantFrags.map(frag => ({ + label: frag.name.value, + detail: String(typeMap[frag.typeCondition.name.value]), + documentation: `fragment ${frag.name.value} on ${frag.typeCondition.name.value}`, + kind: _types.CompletionItemKind.Field, + type: typeMap[frag.typeCondition.name.value] + }))); +} +const getParentDefinition = (state, kind) => { + var _a, _b, _c, _d, _e, _f, _g, _h, _j, _k; + if (((_a = state.prevState) === null || _a === void 0 ? void 0 : _a.kind) === kind) { + return state.prevState; + } + if (((_c = (_b = state.prevState) === null || _b === void 0 ? void 0 : _b.prevState) === null || _c === void 0 ? void 0 : _c.kind) === kind) { + return state.prevState.prevState; + } + if (((_f = (_e = (_d = state.prevState) === null || _d === void 0 ? void 0 : _d.prevState) === null || _e === void 0 ? void 0 : _e.prevState) === null || _f === void 0 ? void 0 : _f.kind) === kind) { + return state.prevState.prevState.prevState; + } + if (((_k = (_j = (_h = (_g = state.prevState) === null || _g === void 0 ? void 0 : _g.prevState) === null || _h === void 0 ? void 0 : _h.prevState) === null || _j === void 0 ? void 0 : _j.prevState) === null || _k === void 0 ? void 0 : _k.kind) === kind) { + return state.prevState.prevState.prevState.prevState; + } +}; +function getVariableCompletions(queryText, schema, token) { + let variableName = null; + let variableType; + const definitions = Object.create({}); + runOnlineParser(queryText, (_, state) => { + if ((state === null || state === void 0 ? void 0 : state.kind) === _parser.RuleKinds.VARIABLE && state.name) { + variableName = state.name; + } + if ((state === null || state === void 0 ? void 0 : state.kind) === _parser.RuleKinds.NAMED_TYPE && variableName) { + const parentDefinition = getParentDefinition(state, _parser.RuleKinds.TYPE); + if (parentDefinition === null || parentDefinition === void 0 ? void 0 : parentDefinition.type) { + variableType = schema.getType(parentDefinition === null || parentDefinition === void 0 ? void 0 : parentDefinition.type); + } + } + if (variableName && variableType && !definitions[variableName]) { + definitions[variableName] = { + detail: variableType.toString(), + insertText: token.string === '$' ? variableName : '$' + variableName, + label: variableName, + type: variableType, + kind: _types.CompletionItemKind.Variable + }; + variableName = null; + variableType = null; + } + }); + return (0, _autocompleteUtils.objectValues)(definitions); +} +function getFragmentDefinitions(queryText) { + const fragmentDefs = []; + runOnlineParser(queryText, (_, state) => { + if (state.kind === _parser.RuleKinds.FRAGMENT_DEFINITION && state.name && state.type) { + fragmentDefs.push({ + kind: _parser.RuleKinds.FRAGMENT_DEFINITION, + name: { + kind: _graphql.Kind.NAME, + value: state.name + }, + selectionSet: { + kind: _parser.RuleKinds.SELECTION_SET, + selections: [] + }, + typeCondition: { + kind: _parser.RuleKinds.NAMED_TYPE, + name: { + kind: _graphql.Kind.NAME, + value: state.type + } + } + }); + } + }); + return fragmentDefs; +} +function getSuggestionsForVariableDefinition(token, schema, _kind) { + const inputTypeMap = schema.getTypeMap(); + const inputTypes = (0, _autocompleteUtils.objectValues)(inputTypeMap).filter(_graphql.isInputType); + return (0, _autocompleteUtils.hintList)(token, inputTypes.map(type => ({ + label: type.name, + documentation: type.description, + kind: _types.CompletionItemKind.Variable + }))); +} +function getSuggestionsForDirective(token, state, schema, _kind) { + var _a; + if ((_a = state.prevState) === null || _a === void 0 ? void 0 : _a.kind) { + const directives = schema.getDirectives().filter(directive => canUseDirective(state.prevState, directive)); + return (0, _autocompleteUtils.hintList)(token, directives.map(directive => ({ + label: directive.name, + documentation: directive.description || '', + kind: _types.CompletionItemKind.Function + }))); + } + return []; +} +function getTokenAtPosition(queryText, cursor) { + let offset = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 0; + let styleAtCursor = null; + let stateAtCursor = null; + let stringAtCursor = null; + const token = runOnlineParser(queryText, (stream, state, style, index) => { + if (index !== cursor.line || stream.getCurrentPosition() + offset < cursor.character + 1) { + return; + } + styleAtCursor = style; + stateAtCursor = Object.assign({}, state); + stringAtCursor = stream.current(); + return 'BREAK'; + }); + return { + start: token.start, + end: token.end, + string: stringAtCursor || token.string, + state: stateAtCursor || token.state, + style: styleAtCursor || token.style + }; +} +function runOnlineParser(queryText, callback) { + const lines = queryText.split('\n'); + const parser = (0, _parser.onlineParser)(); + let state = parser.startState(); + let style = ''; + let stream = new _parser.CharacterStream(''); + for (let i = 0; i < lines.length; i++) { + stream = new _parser.CharacterStream(lines[i]); + while (!stream.eol()) { + style = parser.token(stream, state); + const code = callback(stream, state, style, i); + if (code === 'BREAK') { + break; + } + } + callback(stream, state, style, i); + if (!state.kind) { + state = parser.startState(); + } + } + return { + start: stream.getStartOfToken(), + end: stream.getCurrentPosition(), + string: stream.current(), + state, + style + }; +} +function canUseDirective(state, directive) { + if (!(state === null || state === void 0 ? void 0 : state.kind)) { + return false; + } + const { + kind, + prevState + } = state; + const { + locations + } = directive; + switch (kind) { + case _parser.RuleKinds.QUERY: + return locations.includes(_graphql.DirectiveLocation.QUERY); + case _parser.RuleKinds.MUTATION: + return locations.includes(_graphql.DirectiveLocation.MUTATION); + case _parser.RuleKinds.SUBSCRIPTION: + return locations.includes(_graphql.DirectiveLocation.SUBSCRIPTION); + case _parser.RuleKinds.FIELD: + case _parser.RuleKinds.ALIASED_FIELD: + return locations.includes(_graphql.DirectiveLocation.FIELD); + case _parser.RuleKinds.FRAGMENT_DEFINITION: + return locations.includes(_graphql.DirectiveLocation.FRAGMENT_DEFINITION); + case _parser.RuleKinds.FRAGMENT_SPREAD: + return locations.includes(_graphql.DirectiveLocation.FRAGMENT_SPREAD); + case _parser.RuleKinds.INLINE_FRAGMENT: + return locations.includes(_graphql.DirectiveLocation.INLINE_FRAGMENT); + case _parser.RuleKinds.SCHEMA_DEF: + return locations.includes(_graphql.DirectiveLocation.SCHEMA); + case _parser.RuleKinds.SCALAR_DEF: + return locations.includes(_graphql.DirectiveLocation.SCALAR); + case _parser.RuleKinds.OBJECT_TYPE_DEF: + return locations.includes(_graphql.DirectiveLocation.OBJECT); + case _parser.RuleKinds.FIELD_DEF: + return locations.includes(_graphql.DirectiveLocation.FIELD_DEFINITION); + case _parser.RuleKinds.INTERFACE_DEF: + return locations.includes(_graphql.DirectiveLocation.INTERFACE); + case _parser.RuleKinds.UNION_DEF: + return locations.includes(_graphql.DirectiveLocation.UNION); + case _parser.RuleKinds.ENUM_DEF: + return locations.includes(_graphql.DirectiveLocation.ENUM); + case _parser.RuleKinds.ENUM_VALUE: + return locations.includes(_graphql.DirectiveLocation.ENUM_VALUE); + case _parser.RuleKinds.INPUT_DEF: + return locations.includes(_graphql.DirectiveLocation.INPUT_OBJECT); + case _parser.RuleKinds.INPUT_VALUE_DEF: + const prevStateKind = prevState === null || prevState === void 0 ? void 0 : prevState.kind; + switch (prevStateKind) { + case _parser.RuleKinds.ARGUMENTS_DEF: + return locations.includes(_graphql.DirectiveLocation.ARGUMENT_DEFINITION); + case _parser.RuleKinds.INPUT_DEF: + return locations.includes(_graphql.DirectiveLocation.INPUT_FIELD_DEFINITION); + } + } + return false; +} +function getTypeInfo(schema, tokenState) { + let argDef; + let argDefs; + let directiveDef; + let enumValue; + let fieldDef; + let inputType; + let objectTypeDef; + let objectFieldDefs; + let parentType; + let type; + let interfaceDef; + (0, _autocompleteUtils.forEachState)(tokenState, state => { + var _a; + switch (state.kind) { + case _parser.RuleKinds.QUERY: + case 'ShortQuery': + type = schema.getQueryType(); + break; + case _parser.RuleKinds.MUTATION: + type = schema.getMutationType(); + break; + case _parser.RuleKinds.SUBSCRIPTION: + type = schema.getSubscriptionType(); + break; + case _parser.RuleKinds.INLINE_FRAGMENT: + case _parser.RuleKinds.FRAGMENT_DEFINITION: + if (state.type) { + type = schema.getType(state.type); + } + break; + case _parser.RuleKinds.FIELD: + case _parser.RuleKinds.ALIASED_FIELD: + { + if (!type || !state.name) { + fieldDef = null; + } else { + fieldDef = parentType ? (0, _autocompleteUtils.getFieldDef)(schema, parentType, state.name) : null; + type = fieldDef ? fieldDef.type : null; + } + break; + } + case _parser.RuleKinds.SELECTION_SET: + parentType = (0, _graphql.getNamedType)(type); + break; + case _parser.RuleKinds.DIRECTIVE: + directiveDef = state.name ? schema.getDirective(state.name) : null; + break; + case _parser.RuleKinds.INTERFACE_DEF: + if (state.name) { + objectTypeDef = null; + interfaceDef = new _graphql.GraphQLInterfaceType({ + name: state.name, + interfaces: [], + fields: {} + }); + } + break; + case _parser.RuleKinds.OBJECT_TYPE_DEF: + if (state.name) { + interfaceDef = null; + objectTypeDef = new _graphql.GraphQLObjectType({ + name: state.name, + interfaces: [], + fields: {} + }); + } + break; + case _parser.RuleKinds.ARGUMENTS: + { + if (state.prevState) { + switch (state.prevState.kind) { + case _parser.RuleKinds.FIELD: + argDefs = fieldDef && fieldDef.args; + break; + case _parser.RuleKinds.DIRECTIVE: + argDefs = directiveDef && directiveDef.args; + break; + case _parser.RuleKinds.ALIASED_FIELD: + { + const name = (_a = state.prevState) === null || _a === void 0 ? void 0 : _a.name; + if (!name) { + argDefs = null; + break; + } + const field = parentType ? (0, _autocompleteUtils.getFieldDef)(schema, parentType, name) : null; + if (!field) { + argDefs = null; + break; + } + argDefs = field.args; + break; + } + default: + argDefs = null; + break; + } + } else { + argDefs = null; + } + break; + } + case _parser.RuleKinds.ARGUMENT: + if (argDefs) { + for (let i = 0; i < argDefs.length; i++) { + if (argDefs[i].name === state.name) { + argDef = argDefs[i]; + break; + } + } + } + inputType = argDef === null || argDef === void 0 ? void 0 : argDef.type; + break; + case _parser.RuleKinds.ENUM_VALUE: + const enumType = (0, _graphql.getNamedType)(inputType); + enumValue = enumType instanceof _graphql.GraphQLEnumType ? enumType.getValues().find(val => val.value === state.name) : null; + break; + case _parser.RuleKinds.LIST_VALUE: + const nullableType = (0, _graphql.getNullableType)(inputType); + inputType = nullableType instanceof _graphql.GraphQLList ? nullableType.ofType : null; + break; + case _parser.RuleKinds.OBJECT_VALUE: + const objectType = (0, _graphql.getNamedType)(inputType); + objectFieldDefs = objectType instanceof _graphql.GraphQLInputObjectType ? objectType.getFields() : null; + break; + case _parser.RuleKinds.OBJECT_FIELD: + const objectField = state.name && objectFieldDefs ? objectFieldDefs[state.name] : null; + inputType = objectField === null || objectField === void 0 ? void 0 : objectField.type; + break; + case _parser.RuleKinds.NAMED_TYPE: + if (state.name) { + type = schema.getType(state.name); + } + break; + } + }); + return { + argDef, + argDefs, + directiveDef, + enumValue, + fieldDef, + inputType, + objectFieldDefs, + parentType, + type, + interfaceDef, + objectTypeDef + }; +} +var GraphQLDocumentMode; +exports.GraphQLDocumentMode = GraphQLDocumentMode; +(function (GraphQLDocumentMode) { + GraphQLDocumentMode["TYPE_SYSTEM"] = "TYPE_SYSTEM"; + GraphQLDocumentMode["EXECUTABLE"] = "EXECUTABLE"; +})(GraphQLDocumentMode || (exports.GraphQLDocumentMode = GraphQLDocumentMode = {})); +function getDocumentMode(documentText, uri) { + if (uri === null || uri === void 0 ? void 0 : uri.endsWith('.graphqls')) { + return GraphQLDocumentMode.TYPE_SYSTEM; + } + return hasTypeSystemDefinitions(documentText) ? GraphQLDocumentMode.TYPE_SYSTEM : GraphQLDocumentMode.EXECUTABLE; +} +function unwrapType(state) { + if (state.prevState && state.kind && [_parser.RuleKinds.NAMED_TYPE, _parser.RuleKinds.LIST_TYPE, _parser.RuleKinds.TYPE, _parser.RuleKinds.NON_NULL_TYPE].includes(state.kind)) { + return unwrapType(state.prevState); + } + return state; +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/interface/getDefinition.js": +/*!*********************************************************************!*\ + !*** ../../graphql-language-service/esm/interface/getDefinition.js ***! + \*********************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.LANGUAGE = void 0; +exports.getDefinitionQueryResultForDefinitionNode = getDefinitionQueryResultForDefinitionNode; +exports.getDefinitionQueryResultForField = getDefinitionQueryResultForField; +exports.getDefinitionQueryResultForFragmentSpread = getDefinitionQueryResultForFragmentSpread; +exports.getDefinitionQueryResultForNamedType = getDefinitionQueryResultForNamedType; +var _utils = __webpack_require__(/*! ../utils */ "../../graphql-language-service/esm/utils/index.js"); +var __awaiter = void 0 && (void 0).__awaiter || function (thisArg, _arguments, P, generator) { + function adopt(value) { + return value instanceof P ? value : new P(function (resolve) { + resolve(value); + }); + } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { + try { + step(generator.next(value)); + } catch (e) { + reject(e); + } + } + function rejected(value) { + try { + step(generator["throw"](value)); + } catch (e) { + reject(e); + } + } + function step(result) { + result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); + } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +const LANGUAGE = 'GraphQL'; +exports.LANGUAGE = LANGUAGE; +function assert(value, message) { + if (!value) { + throw new Error(message); + } +} +function getRange(text, node) { + const location = node.loc; + assert(location, 'Expected ASTNode to have a location.'); + return (0, _utils.locToRange)(text, location); +} +function getPosition(text, node) { + const location = node.loc; + assert(location, 'Expected ASTNode to have a location.'); + return (0, _utils.offsetToPosition)(text, location.start); +} +function getDefinitionQueryResultForNamedType(text, node, dependencies) { + return __awaiter(this, void 0, void 0, function* () { + const name = node.name.value; + const defNodes = dependencies.filter(_ref => { + let { + definition + } = _ref; + return definition.name && definition.name.value === name; + }); + if (defNodes.length === 0) { + throw new Error(`Definition not found for GraphQL type ${name}`); + } + const definitions = defNodes.map(_ref2 => { + let { + filePath, + content, + definition + } = _ref2; + return getDefinitionForNodeDefinition(filePath || '', content, definition); + }); + return { + definitions, + queryRange: definitions.map(_ => getRange(text, node)) + }; + }); +} +function getDefinitionQueryResultForField(fieldName, typeName, dependencies) { + var _a; + return __awaiter(this, void 0, void 0, function* () { + const defNodes = dependencies.filter(_ref3 => { + let { + definition + } = _ref3; + return definition.name && definition.name.value === typeName; + }); + if (defNodes.length === 0) { + throw new Error(`Definition not found for GraphQL type ${typeName}`); + } + const definitions = []; + for (const { + filePath, + content, + definition + } of defNodes) { + const fieldDefinition = (_a = definition.fields) === null || _a === void 0 ? void 0 : _a.find(item => item.name.value === fieldName); + if (fieldDefinition == null) { + continue; + } + definitions.push(getDefinitionForFieldDefinition(filePath || '', content, fieldDefinition)); + } + return { + definitions, + queryRange: [] + }; + }); +} +function getDefinitionQueryResultForFragmentSpread(text, fragment, dependencies) { + return __awaiter(this, void 0, void 0, function* () { + const name = fragment.name.value; + const defNodes = dependencies.filter(_ref4 => { + let { + definition + } = _ref4; + return definition.name.value === name; + }); + if (defNodes.length === 0) { + throw new Error(`Definition not found for GraphQL fragment ${name}`); + } + const definitions = defNodes.map(_ref5 => { + let { + filePath, + content, + definition + } = _ref5; + return getDefinitionForFragmentDefinition(filePath || '', content, definition); + }); + return { + definitions, + queryRange: definitions.map(_ => getRange(text, fragment)) + }; + }); +} +function getDefinitionQueryResultForDefinitionNode(path, text, definition) { + return { + definitions: [getDefinitionForFragmentDefinition(path, text, definition)], + queryRange: definition.name ? [getRange(text, definition.name)] : [] + }; +} +function getDefinitionForFragmentDefinition(path, text, definition) { + const { + name + } = definition; + if (!name) { + throw new Error('Expected ASTNode to have a Name.'); + } + return { + path, + position: getPosition(text, definition), + range: getRange(text, definition), + name: name.value || '', + language: LANGUAGE, + projectRoot: path + }; +} +function getDefinitionForNodeDefinition(path, text, definition) { + const { + name + } = definition; + assert(name, 'Expected ASTNode to have a Name.'); + return { + path, + position: getPosition(text, definition), + range: getRange(text, definition), + name: name.value || '', + language: LANGUAGE, + projectRoot: path + }; +} +function getDefinitionForFieldDefinition(path, text, definition) { + const { + name + } = definition; + assert(name, 'Expected ASTNode to have a Name.'); + return { + path, + position: getPosition(text, definition), + range: getRange(text, definition), + name: name.value || '', + language: LANGUAGE, + projectRoot: path + }; +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/interface/getDiagnostics.js": +/*!**********************************************************************!*\ + !*** ../../graphql-language-service/esm/interface/getDiagnostics.js ***! + \**********************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.SEVERITY = exports.DIAGNOSTIC_SEVERITY = void 0; +exports.getDiagnostics = getDiagnostics; +exports.getRange = getRange; +exports.validateQuery = validateQuery; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +var _parser = __webpack_require__(/*! ../parser */ "../../graphql-language-service/esm/parser/index.js"); +var _utils = __webpack_require__(/*! ../utils */ "../../graphql-language-service/esm/utils/index.js"); +const SEVERITY = { + Error: 'Error', + Warning: 'Warning', + Information: 'Information', + Hint: 'Hint' +}; +exports.SEVERITY = SEVERITY; +const DIAGNOSTIC_SEVERITY = { + [SEVERITY.Error]: 1, + [SEVERITY.Warning]: 2, + [SEVERITY.Information]: 3, + [SEVERITY.Hint]: 4 +}; +exports.DIAGNOSTIC_SEVERITY = DIAGNOSTIC_SEVERITY; +const invariant = (condition, message) => { + if (!condition) { + throw new Error(message); + } +}; +function getDiagnostics(query) { + let schema = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : null; + let customRules = arguments.length > 2 ? arguments[2] : undefined; + let isRelayCompatMode = arguments.length > 3 ? arguments[3] : undefined; + let externalFragments = arguments.length > 4 ? arguments[4] : undefined; + var _a, _b; + let ast = null; + let fragments = ''; + if (externalFragments) { + fragments = typeof externalFragments === 'string' ? externalFragments : externalFragments.reduce((acc, node) => acc + (0, _graphql.print)(node) + '\n\n', ''); + } + const enhancedQuery = fragments ? `${query}\n\n${fragments}` : query; + try { + ast = (0, _graphql.parse)(enhancedQuery); + } catch (error) { + if (error instanceof _graphql.GraphQLError) { + const range = getRange((_b = (_a = error.locations) === null || _a === void 0 ? void 0 : _a[0]) !== null && _b !== void 0 ? _b : { + line: 0, + column: 0 + }, enhancedQuery); + return [{ + severity: DIAGNOSTIC_SEVERITY.Error, + message: error.message, + source: 'GraphQL: Syntax', + range + }]; + } + throw error; + } + return validateQuery(ast, schema, customRules, isRelayCompatMode); +} +function validateQuery(ast) { + let schema = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : null; + let customRules = arguments.length > 2 ? arguments[2] : undefined; + let isRelayCompatMode = arguments.length > 3 ? arguments[3] : undefined; + if (!schema) { + return []; + } + const validationErrorAnnotations = (0, _utils.validateWithCustomRules)(schema, ast, customRules, isRelayCompatMode).flatMap(error => annotations(error, DIAGNOSTIC_SEVERITY.Error, 'Validation')); + const deprecationWarningAnnotations = (0, _graphql.validate)(schema, ast, [_graphql.NoDeprecatedCustomRule]).flatMap(error => annotations(error, DIAGNOSTIC_SEVERITY.Warning, 'Deprecation')); + return validationErrorAnnotations.concat(deprecationWarningAnnotations); +} +function annotations(error, severity, type) { + if (!error.nodes) { + return []; + } + const highlightedNodes = []; + for (const [i, node] of error.nodes.entries()) { + const highlightNode = node.kind !== 'Variable' && 'name' in node && node.name !== undefined ? node.name : 'variable' in node && node.variable !== undefined ? node.variable : node; + if (highlightNode) { + invariant(error.locations, 'GraphQL validation error requires locations.'); + const loc = error.locations[i]; + const highlightLoc = getLocation(highlightNode); + const end = loc.column + (highlightLoc.end - highlightLoc.start); + highlightedNodes.push({ + source: `GraphQL: ${type}`, + message: error.message, + severity, + range: new _utils.Range(new _utils.Position(loc.line - 1, loc.column - 1), new _utils.Position(loc.line - 1, end)) + }); + } + } + return highlightedNodes; +} +function getRange(location, queryText) { + const parser = (0, _parser.onlineParser)(); + const state = parser.startState(); + const lines = queryText.split('\n'); + invariant(lines.length >= location.line, 'Query text must have more lines than where the error happened'); + let stream = null; + for (let i = 0; i < location.line; i++) { + stream = new _parser.CharacterStream(lines[i]); + while (!stream.eol()) { + const style = parser.token(stream, state); + if (style === 'invalidchar') { + break; + } + } + } + invariant(stream, 'Expected Parser stream to be available.'); + const line = location.line - 1; + const start = stream.getStartOfToken(); + const end = stream.getCurrentPosition(); + return new _utils.Range(new _utils.Position(line, start), new _utils.Position(line, end)); +} +function getLocation(node) { + const typeCastedNode = node; + const location = typeCastedNode.loc; + invariant(location, 'Expected ASTNode to have a location.'); + return location; +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/interface/getHoverInformation.js": +/*!***************************************************************************!*\ + !*** ../../graphql-language-service/esm/interface/getHoverInformation.js ***! + \***************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.getHoverInformation = getHoverInformation; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +var _getAutocompleteSuggestions = __webpack_require__(/*! ./getAutocompleteSuggestions */ "../../graphql-language-service/esm/interface/getAutocompleteSuggestions.js"); +function getHoverInformation(schema, queryText, cursor, contextToken, config) { + const token = contextToken || (0, _getAutocompleteSuggestions.getTokenAtPosition)(queryText, cursor); + if (!schema || !token || !token.state) { + return ''; + } + const { + kind, + step + } = token.state; + const typeInfo = (0, _getAutocompleteSuggestions.getTypeInfo)(schema, token.state); + const options = Object.assign(Object.assign({}, config), { + schema + }); + if (kind === 'Field' && step === 0 && typeInfo.fieldDef || kind === 'AliasedField' && step === 2 && typeInfo.fieldDef) { + const into = []; + renderMdCodeStart(into, options); + renderField(into, typeInfo, options); + renderMdCodeEnd(into, options); + renderDescription(into, options, typeInfo.fieldDef); + return into.join('').trim(); + } + if (kind === 'Directive' && step === 1 && typeInfo.directiveDef) { + const into = []; + renderMdCodeStart(into, options); + renderDirective(into, typeInfo, options); + renderMdCodeEnd(into, options); + renderDescription(into, options, typeInfo.directiveDef); + return into.join('').trim(); + } + if (kind === 'Argument' && step === 0 && typeInfo.argDef) { + const into = []; + renderMdCodeStart(into, options); + renderArg(into, typeInfo, options); + renderMdCodeEnd(into, options); + renderDescription(into, options, typeInfo.argDef); + return into.join('').trim(); + } + if (kind === 'EnumValue' && typeInfo.enumValue && 'description' in typeInfo.enumValue) { + const into = []; + renderMdCodeStart(into, options); + renderEnumValue(into, typeInfo, options); + renderMdCodeEnd(into, options); + renderDescription(into, options, typeInfo.enumValue); + return into.join('').trim(); + } + if (kind === 'NamedType' && typeInfo.type && 'description' in typeInfo.type) { + const into = []; + renderMdCodeStart(into, options); + renderType(into, typeInfo, options, typeInfo.type); + renderMdCodeEnd(into, options); + renderDescription(into, options, typeInfo.type); + return into.join('').trim(); + } + return ''; +} +function renderMdCodeStart(into, options) { + if (options.useMarkdown) { + text(into, '```graphql\n'); + } +} +function renderMdCodeEnd(into, options) { + if (options.useMarkdown) { + text(into, '\n```'); + } +} +function renderField(into, typeInfo, options) { + renderQualifiedField(into, typeInfo, options); + renderTypeAnnotation(into, typeInfo, options, typeInfo.type); +} +function renderQualifiedField(into, typeInfo, options) { + if (!typeInfo.fieldDef) { + return; + } + const fieldName = typeInfo.fieldDef.name; + if (fieldName.slice(0, 2) !== '__') { + renderType(into, typeInfo, options, typeInfo.parentType); + text(into, '.'); + } + text(into, fieldName); +} +function renderDirective(into, typeInfo, _options) { + if (!typeInfo.directiveDef) { + return; + } + const name = '@' + typeInfo.directiveDef.name; + text(into, name); +} +function renderArg(into, typeInfo, options) { + if (typeInfo.directiveDef) { + renderDirective(into, typeInfo, options); + } else if (typeInfo.fieldDef) { + renderQualifiedField(into, typeInfo, options); + } + if (!typeInfo.argDef) { + return; + } + const { + name + } = typeInfo.argDef; + text(into, '('); + text(into, name); + renderTypeAnnotation(into, typeInfo, options, typeInfo.inputType); + text(into, ')'); +} +function renderTypeAnnotation(into, typeInfo, options, t) { + text(into, ': '); + renderType(into, typeInfo, options, t); +} +function renderEnumValue(into, typeInfo, options) { + if (!typeInfo.enumValue) { + return; + } + const { + name + } = typeInfo.enumValue; + renderType(into, typeInfo, options, typeInfo.inputType); + text(into, '.'); + text(into, name); +} +function renderType(into, typeInfo, options, t) { + if (!t) { + return; + } + if (t instanceof _graphql.GraphQLNonNull) { + renderType(into, typeInfo, options, t.ofType); + text(into, '!'); + } else if (t instanceof _graphql.GraphQLList) { + text(into, '['); + renderType(into, typeInfo, options, t.ofType); + text(into, ']'); + } else { + text(into, t.name); + } +} +function renderDescription(into, options, def) { + if (!def) { + return; + } + const description = typeof def.description === 'string' ? def.description : null; + if (description) { + text(into, '\n\n'); + text(into, description); + } + renderDeprecation(into, options, def); +} +function renderDeprecation(into, _options, def) { + if (!def) { + return; + } + const reason = def.deprecationReason || null; + if (!reason) { + return; + } + text(into, '\n\n'); + text(into, 'Deprecated: '); + text(into, reason); +} +function text(into, content) { + into.push(content); +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/interface/getOutline.js": +/*!******************************************************************!*\ + !*** ../../graphql-language-service/esm/interface/getOutline.js ***! + \******************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.getOutline = getOutline; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +var _utils = __webpack_require__(/*! ../utils */ "../../graphql-language-service/esm/utils/index.js"); +const { + INLINE_FRAGMENT +} = _graphql.Kind; +const OUTLINEABLE_KINDS = { + Field: true, + OperationDefinition: true, + Document: true, + SelectionSet: true, + Name: true, + FragmentDefinition: true, + FragmentSpread: true, + InlineFragment: true, + ObjectTypeDefinition: true, + InputObjectTypeDefinition: true, + InterfaceTypeDefinition: true, + EnumTypeDefinition: true, + EnumValueDefinition: true, + InputValueDefinition: true, + FieldDefinition: true +}; +function getOutline(documentText) { + let ast; + try { + ast = (0, _graphql.parse)(documentText); + } catch (_a) { + return null; + } + const visitorFns = outlineTreeConverter(documentText); + const outlineTrees = (0, _graphql.visit)(ast, { + leave(node) { + if (visitorFns !== undefined && node.kind in visitorFns) { + return visitorFns[node.kind](node); + } + return null; + } + }); + return { + outlineTrees + }; +} +function outlineTreeConverter(docText) { + const meta = node => { + return { + representativeName: node.name, + startPosition: (0, _utils.offsetToPosition)(docText, node.loc.start), + endPosition: (0, _utils.offsetToPosition)(docText, node.loc.end), + kind: node.kind, + children: node.selectionSet || node.fields || node.values || node.arguments || [] + }; + }; + return { + Field(node) { + const tokenizedText = node.alias ? [buildToken('plain', node.alias), buildToken('plain', ': ')] : []; + tokenizedText.push(buildToken('plain', node.name)); + return Object.assign({ + tokenizedText + }, meta(node)); + }, + OperationDefinition: node => Object.assign({ + tokenizedText: [buildToken('keyword', node.operation), buildToken('whitespace', ' '), buildToken('class-name', node.name)] + }, meta(node)), + Document: node => node.definitions, + SelectionSet: node => concatMap(node.selections, child => { + return child.kind === INLINE_FRAGMENT ? child.selectionSet : child; + }), + Name: node => node.value, + FragmentDefinition: node => Object.assign({ + tokenizedText: [buildToken('keyword', 'fragment'), buildToken('whitespace', ' '), buildToken('class-name', node.name)] + }, meta(node)), + InterfaceTypeDefinition: node => Object.assign({ + tokenizedText: [buildToken('keyword', 'interface'), buildToken('whitespace', ' '), buildToken('class-name', node.name)] + }, meta(node)), + EnumTypeDefinition: node => Object.assign({ + tokenizedText: [buildToken('keyword', 'enum'), buildToken('whitespace', ' '), buildToken('class-name', node.name)] + }, meta(node)), + EnumValueDefinition: node => Object.assign({ + tokenizedText: [buildToken('plain', node.name)] + }, meta(node)), + ObjectTypeDefinition: node => Object.assign({ + tokenizedText: [buildToken('keyword', 'type'), buildToken('whitespace', ' '), buildToken('class-name', node.name)] + }, meta(node)), + InputObjectTypeDefinition: node => Object.assign({ + tokenizedText: [buildToken('keyword', 'input'), buildToken('whitespace', ' '), buildToken('class-name', node.name)] + }, meta(node)), + FragmentSpread: node => Object.assign({ + tokenizedText: [buildToken('plain', '...'), buildToken('class-name', node.name)] + }, meta(node)), + InputValueDefinition(node) { + return Object.assign({ + tokenizedText: [buildToken('plain', node.name)] + }, meta(node)); + }, + FieldDefinition(node) { + return Object.assign({ + tokenizedText: [buildToken('plain', node.name)] + }, meta(node)); + }, + InlineFragment: node => node.selectionSet + }; +} +function buildToken(kind, value) { + return { + kind, + value + }; +} +function concatMap(arr, fn) { + const res = []; + for (let i = 0; i < arr.length; i++) { + const x = fn(arr[i], i); + if (Array.isArray(x)) { + res.push(...x); + } else { + res.push(x); + } + } + return res; +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/interface/index.js": +/*!*************************************************************!*\ + !*** ../../graphql-language-service/esm/interface/index.js ***! + \*************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +var _exportNames = { + getOutline: true, + getHoverInformation: true +}; +Object.defineProperty(exports, "getHoverInformation", ({ + enumerable: true, + get: function () { + return _getHoverInformation.getHoverInformation; + } +})); +Object.defineProperty(exports, "getOutline", ({ + enumerable: true, + get: function () { + return _getOutline.getOutline; + } +})); +var _autocompleteUtils = __webpack_require__(/*! ./autocompleteUtils */ "../../graphql-language-service/esm/interface/autocompleteUtils.js"); +Object.keys(_autocompleteUtils).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (Object.prototype.hasOwnProperty.call(_exportNames, key)) return; + if (key in exports && exports[key] === _autocompleteUtils[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _autocompleteUtils[key]; + } + }); +}); +var _getAutocompleteSuggestions = __webpack_require__(/*! ./getAutocompleteSuggestions */ "../../graphql-language-service/esm/interface/getAutocompleteSuggestions.js"); +Object.keys(_getAutocompleteSuggestions).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (Object.prototype.hasOwnProperty.call(_exportNames, key)) return; + if (key in exports && exports[key] === _getAutocompleteSuggestions[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _getAutocompleteSuggestions[key]; + } + }); +}); +var _getDefinition = __webpack_require__(/*! ./getDefinition */ "../../graphql-language-service/esm/interface/getDefinition.js"); +Object.keys(_getDefinition).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (Object.prototype.hasOwnProperty.call(_exportNames, key)) return; + if (key in exports && exports[key] === _getDefinition[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _getDefinition[key]; + } + }); +}); +var _getDiagnostics = __webpack_require__(/*! ./getDiagnostics */ "../../graphql-language-service/esm/interface/getDiagnostics.js"); +Object.keys(_getDiagnostics).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (Object.prototype.hasOwnProperty.call(_exportNames, key)) return; + if (key in exports && exports[key] === _getDiagnostics[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _getDiagnostics[key]; + } + }); +}); +var _getOutline = __webpack_require__(/*! ./getOutline */ "../../graphql-language-service/esm/interface/getOutline.js"); +var _getHoverInformation = __webpack_require__(/*! ./getHoverInformation */ "../../graphql-language-service/esm/interface/getHoverInformation.js"); + +/***/ }), + +/***/ "../../graphql-language-service/esm/parser/CharacterStream.js": +/*!********************************************************************!*\ + !*** ../../graphql-language-service/esm/parser/CharacterStream.js ***! + \********************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; +class CharacterStream { + constructor(sourceText) { + var _this = this; + this._start = 0; + this._pos = 0; + this.getStartOfToken = () => this._start; + this.getCurrentPosition = () => this._pos; + this.eol = () => this._sourceText.length === this._pos; + this.sol = () => this._pos === 0; + this.peek = () => { + return this._sourceText.charAt(this._pos) || null; + }; + this.next = () => { + const char = this._sourceText.charAt(this._pos); + this._pos++; + return char; + }; + this.eat = pattern => { + const isMatched = this._testNextCharacter(pattern); + if (isMatched) { + this._start = this._pos; + this._pos++; + return this._sourceText.charAt(this._pos - 1); + } + return undefined; + }; + this.eatWhile = match => { + let isMatched = this._testNextCharacter(match); + let didEat = false; + if (isMatched) { + didEat = isMatched; + this._start = this._pos; + } + while (isMatched) { + this._pos++; + isMatched = this._testNextCharacter(match); + didEat = true; + } + return didEat; + }; + this.eatSpace = () => this.eatWhile(/[\s\u00a0]/); + this.skipToEnd = () => { + this._pos = this._sourceText.length; + }; + this.skipTo = position => { + this._pos = position; + }; + this.match = function (pattern) { + let consume = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true; + let caseFold = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; + let token = null; + let match = null; + if (typeof pattern === 'string') { + const regex = new RegExp(pattern, caseFold ? 'i' : 'g'); + match = regex.test(_this._sourceText.slice(_this._pos, _this._pos + pattern.length)); + token = pattern; + } else if (pattern instanceof RegExp) { + match = _this._sourceText.slice(_this._pos).match(pattern); + token = match === null || match === void 0 ? void 0 : match[0]; + } + if (match != null && (typeof pattern === 'string' || match instanceof Array && _this._sourceText.startsWith(match[0], _this._pos))) { + if (consume) { + _this._start = _this._pos; + if (token && token.length) { + _this._pos += token.length; + } + } + return match; + } + return false; + }; + this.backUp = num => { + this._pos -= num; + }; + this.column = () => this._pos; + this.indentation = () => { + const match = this._sourceText.match(/\s*/); + let indent = 0; + if (match && match.length !== 0) { + const whiteSpaces = match[0]; + let pos = 0; + while (whiteSpaces.length > pos) { + if (whiteSpaces.charCodeAt(pos) === 9) { + indent += 2; + } else { + indent++; + } + pos++; + } + } + return indent; + }; + this.current = () => this._sourceText.slice(this._start, this._pos); + this._sourceText = sourceText; + } + _testNextCharacter(pattern) { + const character = this._sourceText.charAt(this._pos); + let isMatched = false; + if (typeof pattern === 'string') { + isMatched = character === pattern; + } else { + isMatched = pattern instanceof RegExp ? pattern.test(character) : pattern(character); + } + return isMatched; + } +} +exports["default"] = CharacterStream; + +/***/ }), + +/***/ "../../graphql-language-service/esm/parser/RuleHelpers.js": +/*!****************************************************************!*\ + !*** ../../graphql-language-service/esm/parser/RuleHelpers.js ***! + \****************************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.butNot = butNot; +exports.list = list; +exports.opt = opt; +exports.p = p; +exports.t = t; +function opt(ofRule) { + return { + ofRule + }; +} +function list(ofRule, separator) { + return { + ofRule, + isList: true, + separator + }; +} +function butNot(rule, exclusions) { + const ruleMatch = rule.match; + rule.match = token => { + let check = false; + if (ruleMatch) { + check = ruleMatch(token); + } + return check && exclusions.every(exclusion => exclusion.match && !exclusion.match(token)); + }; + return rule; +} +function t(kind, style) { + return { + style, + match: token => token.kind === kind + }; +} +function p(value, style) { + return { + style: style || 'punctuation', + match: token => token.kind === 'Punctuation' && token.value === value + }; +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/parser/Rules.js": +/*!**********************************************************!*\ + !*** ../../graphql-language-service/esm/parser/Rules.js ***! + \**********************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.isIgnored = exports.ParseRules = exports.LexRules = void 0; +var _RuleHelpers = __webpack_require__(/*! ./RuleHelpers */ "../../graphql-language-service/esm/parser/RuleHelpers.js"); +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +const isIgnored = ch => ch === ' ' || ch === '\t' || ch === ',' || ch === '\n' || ch === '\r' || ch === '\uFEFF' || ch === '\u00A0'; +exports.isIgnored = isIgnored; +const LexRules = { + Name: /^[_A-Za-z][_0-9A-Za-z]*/, + Punctuation: /^(?:!|\$|\(|\)|\.\.\.|:|=|&|@|\[|]|\{|\||\})/, + Number: /^-?(?:0|(?:[1-9][0-9]*))(?:\.[0-9]*)?(?:[eE][+-]?[0-9]+)?/, + String: /^(?:"""(?:\\"""|[^"]|"[^"]|""[^"])*(?:""")?|"(?:[^"\\]|\\(?:"|\/|\\|b|f|n|r|t|u[0-9a-fA-F]{4}))*"?)/, + Comment: /^#.*/ +}; +exports.LexRules = LexRules; +const ParseRules = { + Document: [(0, _RuleHelpers.list)('Definition')], + Definition(token) { + switch (token.value) { + case '{': + return 'ShortQuery'; + case 'query': + return 'Query'; + case 'mutation': + return 'Mutation'; + case 'subscription': + return 'Subscription'; + case 'fragment': + return _graphql.Kind.FRAGMENT_DEFINITION; + case 'schema': + return 'SchemaDef'; + case 'scalar': + return 'ScalarDef'; + case 'type': + return 'ObjectTypeDef'; + case 'interface': + return 'InterfaceDef'; + case 'union': + return 'UnionDef'; + case 'enum': + return 'EnumDef'; + case 'input': + return 'InputDef'; + case 'extend': + return 'ExtendDef'; + case 'directive': + return 'DirectiveDef'; + } + }, + ShortQuery: ['SelectionSet'], + Query: [word('query'), (0, _RuleHelpers.opt)(name('def')), (0, _RuleHelpers.opt)('VariableDefinitions'), (0, _RuleHelpers.list)('Directive'), 'SelectionSet'], + Mutation: [word('mutation'), (0, _RuleHelpers.opt)(name('def')), (0, _RuleHelpers.opt)('VariableDefinitions'), (0, _RuleHelpers.list)('Directive'), 'SelectionSet'], + Subscription: [word('subscription'), (0, _RuleHelpers.opt)(name('def')), (0, _RuleHelpers.opt)('VariableDefinitions'), (0, _RuleHelpers.list)('Directive'), 'SelectionSet'], + VariableDefinitions: [(0, _RuleHelpers.p)('('), (0, _RuleHelpers.list)('VariableDefinition'), (0, _RuleHelpers.p)(')')], + VariableDefinition: ['Variable', (0, _RuleHelpers.p)(':'), 'Type', (0, _RuleHelpers.opt)('DefaultValue')], + Variable: [(0, _RuleHelpers.p)('$', 'variable'), name('variable')], + DefaultValue: [(0, _RuleHelpers.p)('='), 'Value'], + SelectionSet: [(0, _RuleHelpers.p)('{'), (0, _RuleHelpers.list)('Selection'), (0, _RuleHelpers.p)('}')], + Selection(token, stream) { + return token.value === '...' ? stream.match(/[\s\u00a0,]*(on\b|@|{)/, false) ? 'InlineFragment' : 'FragmentSpread' : stream.match(/[\s\u00a0,]*:/, false) ? 'AliasedField' : 'Field'; + }, + AliasedField: [name('property'), (0, _RuleHelpers.p)(':'), name('qualifier'), (0, _RuleHelpers.opt)('Arguments'), (0, _RuleHelpers.list)('Directive'), (0, _RuleHelpers.opt)('SelectionSet')], + Field: [name('property'), (0, _RuleHelpers.opt)('Arguments'), (0, _RuleHelpers.list)('Directive'), (0, _RuleHelpers.opt)('SelectionSet')], + Arguments: [(0, _RuleHelpers.p)('('), (0, _RuleHelpers.list)('Argument'), (0, _RuleHelpers.p)(')')], + Argument: [name('attribute'), (0, _RuleHelpers.p)(':'), 'Value'], + FragmentSpread: [(0, _RuleHelpers.p)('...'), name('def'), (0, _RuleHelpers.list)('Directive')], + InlineFragment: [(0, _RuleHelpers.p)('...'), (0, _RuleHelpers.opt)('TypeCondition'), (0, _RuleHelpers.list)('Directive'), 'SelectionSet'], + FragmentDefinition: [word('fragment'), (0, _RuleHelpers.opt)((0, _RuleHelpers.butNot)(name('def'), [word('on')])), 'TypeCondition', (0, _RuleHelpers.list)('Directive'), 'SelectionSet'], + TypeCondition: [word('on'), 'NamedType'], + Value(token) { + switch (token.kind) { + case 'Number': + return 'NumberValue'; + case 'String': + return 'StringValue'; + case 'Punctuation': + switch (token.value) { + case '[': + return 'ListValue'; + case '{': + return 'ObjectValue'; + case '$': + return 'Variable'; + case '&': + return 'NamedType'; + } + return null; + case 'Name': + switch (token.value) { + case 'true': + case 'false': + return 'BooleanValue'; + } + if (token.value === 'null') { + return 'NullValue'; + } + return 'EnumValue'; + } + }, + NumberValue: [(0, _RuleHelpers.t)('Number', 'number')], + StringValue: [{ + style: 'string', + match: token => token.kind === 'String', + update(state, token) { + if (token.value.startsWith('"""')) { + state.inBlockstring = !token.value.slice(3).endsWith('"""'); + } + } + }], + BooleanValue: [(0, _RuleHelpers.t)('Name', 'builtin')], + NullValue: [(0, _RuleHelpers.t)('Name', 'keyword')], + EnumValue: [name('string-2')], + ListValue: [(0, _RuleHelpers.p)('['), (0, _RuleHelpers.list)('Value'), (0, _RuleHelpers.p)(']')], + ObjectValue: [(0, _RuleHelpers.p)('{'), (0, _RuleHelpers.list)('ObjectField'), (0, _RuleHelpers.p)('}')], + ObjectField: [name('attribute'), (0, _RuleHelpers.p)(':'), 'Value'], + Type(token) { + return token.value === '[' ? 'ListType' : 'NonNullType'; + }, + ListType: [(0, _RuleHelpers.p)('['), 'Type', (0, _RuleHelpers.p)(']'), (0, _RuleHelpers.opt)((0, _RuleHelpers.p)('!'))], + NonNullType: ['NamedType', (0, _RuleHelpers.opt)((0, _RuleHelpers.p)('!'))], + NamedType: [type('atom')], + Directive: [(0, _RuleHelpers.p)('@', 'meta'), name('meta'), (0, _RuleHelpers.opt)('Arguments')], + DirectiveDef: [word('directive'), (0, _RuleHelpers.p)('@', 'meta'), name('meta'), (0, _RuleHelpers.opt)('ArgumentsDef'), word('on'), (0, _RuleHelpers.list)('DirectiveLocation', (0, _RuleHelpers.p)('|'))], + InterfaceDef: [word('interface'), name('atom'), (0, _RuleHelpers.opt)('Implements'), (0, _RuleHelpers.list)('Directive'), (0, _RuleHelpers.p)('{'), (0, _RuleHelpers.list)('FieldDef'), (0, _RuleHelpers.p)('}')], + Implements: [word('implements'), (0, _RuleHelpers.list)('NamedType', (0, _RuleHelpers.p)('&'))], + DirectiveLocation: [name('string-2')], + SchemaDef: [word('schema'), (0, _RuleHelpers.list)('Directive'), (0, _RuleHelpers.p)('{'), (0, _RuleHelpers.list)('OperationTypeDef'), (0, _RuleHelpers.p)('}')], + OperationTypeDef: [name('keyword'), (0, _RuleHelpers.p)(':'), name('atom')], + ScalarDef: [word('scalar'), name('atom'), (0, _RuleHelpers.list)('Directive')], + ObjectTypeDef: [word('type'), name('atom'), (0, _RuleHelpers.opt)('Implements'), (0, _RuleHelpers.list)('Directive'), (0, _RuleHelpers.p)('{'), (0, _RuleHelpers.list)('FieldDef'), (0, _RuleHelpers.p)('}')], + FieldDef: [name('property'), (0, _RuleHelpers.opt)('ArgumentsDef'), (0, _RuleHelpers.p)(':'), 'Type', (0, _RuleHelpers.list)('Directive')], + ArgumentsDef: [(0, _RuleHelpers.p)('('), (0, _RuleHelpers.list)('InputValueDef'), (0, _RuleHelpers.p)(')')], + InputValueDef: [name('attribute'), (0, _RuleHelpers.p)(':'), 'Type', (0, _RuleHelpers.opt)('DefaultValue'), (0, _RuleHelpers.list)('Directive')], + UnionDef: [word('union'), name('atom'), (0, _RuleHelpers.list)('Directive'), (0, _RuleHelpers.p)('='), (0, _RuleHelpers.list)('UnionMember', (0, _RuleHelpers.p)('|'))], + UnionMember: ['NamedType'], + EnumDef: [word('enum'), name('atom'), (0, _RuleHelpers.list)('Directive'), (0, _RuleHelpers.p)('{'), (0, _RuleHelpers.list)('EnumValueDef'), (0, _RuleHelpers.p)('}')], + EnumValueDef: [name('string-2'), (0, _RuleHelpers.list)('Directive')], + InputDef: [word('input'), name('atom'), (0, _RuleHelpers.list)('Directive'), (0, _RuleHelpers.p)('{'), (0, _RuleHelpers.list)('InputValueDef'), (0, _RuleHelpers.p)('}')], + ExtendDef: [word('extend'), 'ExtensionDefinition'], + ExtensionDefinition(token) { + switch (token.value) { + case 'schema': + return _graphql.Kind.SCHEMA_EXTENSION; + case 'scalar': + return _graphql.Kind.SCALAR_TYPE_EXTENSION; + case 'type': + return _graphql.Kind.OBJECT_TYPE_EXTENSION; + case 'interface': + return _graphql.Kind.INTERFACE_TYPE_EXTENSION; + case 'union': + return _graphql.Kind.UNION_TYPE_EXTENSION; + case 'enum': + return _graphql.Kind.ENUM_TYPE_EXTENSION; + case 'input': + return _graphql.Kind.INPUT_OBJECT_TYPE_EXTENSION; + } + }, + [_graphql.Kind.SCHEMA_EXTENSION]: ['SchemaDef'], + [_graphql.Kind.SCALAR_TYPE_EXTENSION]: ['ScalarDef'], + [_graphql.Kind.OBJECT_TYPE_EXTENSION]: ['ObjectTypeDef'], + [_graphql.Kind.INTERFACE_TYPE_EXTENSION]: ['InterfaceDef'], + [_graphql.Kind.UNION_TYPE_EXTENSION]: ['UnionDef'], + [_graphql.Kind.ENUM_TYPE_EXTENSION]: ['EnumDef'], + [_graphql.Kind.INPUT_OBJECT_TYPE_EXTENSION]: ['InputDef'] +}; +exports.ParseRules = ParseRules; +function word(value) { + return { + style: 'keyword', + match: token => token.kind === 'Name' && token.value === value + }; +} +function name(style) { + return { + style, + match: token => token.kind === 'Name', + update(state, token) { + state.name = token.value; + } + }; +} +function type(style) { + return { + style, + match: token => token.kind === 'Name', + update(state, token) { + var _a; + if ((_a = state.prevState) === null || _a === void 0 ? void 0 : _a.prevState) { + state.name = token.value; + state.prevState.prevState.type = token.value; + } + } + }; +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/parser/index.js": +/*!**********************************************************!*\ + !*** ../../graphql-language-service/esm/parser/index.js ***! + \**********************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +var _exportNames = { + CharacterStream: true, + LexRules: true, + ParseRules: true, + isIgnored: true, + butNot: true, + list: true, + opt: true, + p: true, + t: true, + onlineParser: true +}; +Object.defineProperty(exports, "CharacterStream", ({ + enumerable: true, + get: function () { + return _CharacterStream.default; + } +})); +Object.defineProperty(exports, "LexRules", ({ + enumerable: true, + get: function () { + return _Rules.LexRules; + } +})); +Object.defineProperty(exports, "ParseRules", ({ + enumerable: true, + get: function () { + return _Rules.ParseRules; + } +})); +Object.defineProperty(exports, "butNot", ({ + enumerable: true, + get: function () { + return _RuleHelpers.butNot; + } +})); +Object.defineProperty(exports, "isIgnored", ({ + enumerable: true, + get: function () { + return _Rules.isIgnored; + } +})); +Object.defineProperty(exports, "list", ({ + enumerable: true, + get: function () { + return _RuleHelpers.list; + } +})); +Object.defineProperty(exports, "onlineParser", ({ + enumerable: true, + get: function () { + return _onlineParser.default; + } +})); +Object.defineProperty(exports, "opt", ({ + enumerable: true, + get: function () { + return _RuleHelpers.opt; + } +})); +Object.defineProperty(exports, "p", ({ + enumerable: true, + get: function () { + return _RuleHelpers.p; + } +})); +Object.defineProperty(exports, "t", ({ + enumerable: true, + get: function () { + return _RuleHelpers.t; + } +})); +var _CharacterStream = _interopRequireDefault(__webpack_require__(/*! ./CharacterStream */ "../../graphql-language-service/esm/parser/CharacterStream.js")); +var _Rules = __webpack_require__(/*! ./Rules */ "../../graphql-language-service/esm/parser/Rules.js"); +var _RuleHelpers = __webpack_require__(/*! ./RuleHelpers */ "../../graphql-language-service/esm/parser/RuleHelpers.js"); +var _onlineParser = _interopRequireDefault(__webpack_require__(/*! ./onlineParser */ "../../graphql-language-service/esm/parser/onlineParser.js")); +var _types = __webpack_require__(/*! ./types */ "../../graphql-language-service/esm/parser/types.js"); +Object.keys(_types).forEach(function (key) { + if (key === "default" || key === "__esModule") return; + if (Object.prototype.hasOwnProperty.call(_exportNames, key)) return; + if (key in exports && exports[key] === _types[key]) return; + Object.defineProperty(exports, key, { + enumerable: true, + get: function () { + return _types[key]; + } + }); +}); +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +/***/ }), + +/***/ "../../graphql-language-service/esm/parser/onlineParser.js": +/*!*****************************************************************!*\ + !*** ../../graphql-language-service/esm/parser/onlineParser.js ***! + \*****************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = onlineParser; +var _Rules = __webpack_require__(/*! ./Rules */ "../../graphql-language-service/esm/parser/Rules.js"); +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +function onlineParser() { + let options = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : { + eatWhitespace: stream => stream.eatWhile(_Rules.isIgnored), + lexRules: _Rules.LexRules, + parseRules: _Rules.ParseRules, + editorConfig: {} + }; + return { + startState() { + const initialState = { + level: 0, + step: 0, + name: null, + kind: null, + type: null, + rule: null, + needsSeparator: false, + prevState: null + }; + pushRule(options.parseRules, initialState, _graphql.Kind.DOCUMENT); + return initialState; + }, + token(stream, state) { + return getToken(stream, state, options); + } + }; +} +function getToken(stream, state, options) { + var _a; + if (state.inBlockstring) { + if (stream.match(/.*"""/)) { + state.inBlockstring = false; + return 'string'; + } + stream.skipToEnd(); + return 'string'; + } + const { + lexRules, + parseRules, + eatWhitespace, + editorConfig + } = options; + if (state.rule && state.rule.length === 0) { + popRule(state); + } else if (state.needsAdvance) { + state.needsAdvance = false; + advanceRule(state, true); + } + if (stream.sol()) { + const tabSize = (editorConfig === null || editorConfig === void 0 ? void 0 : editorConfig.tabSize) || 2; + state.indentLevel = Math.floor(stream.indentation() / tabSize); + } + if (eatWhitespace(stream)) { + return 'ws'; + } + const token = lex(lexRules, stream); + if (!token) { + const matchedSomething = stream.match(/\S+/); + if (!matchedSomething) { + stream.match(/\s/); + } + pushRule(SpecialParseRules, state, 'Invalid'); + return 'invalidchar'; + } + if (token.kind === 'Comment') { + pushRule(SpecialParseRules, state, 'Comment'); + return 'comment'; + } + const backupState = assign({}, state); + if (token.kind === 'Punctuation') { + if (/^[{([]/.test(token.value)) { + if (state.indentLevel !== undefined) { + state.levels = (state.levels || []).concat(state.indentLevel + 1); + } + } else if (/^[})\]]/.test(token.value)) { + const levels = state.levels = (state.levels || []).slice(0, -1); + if (state.indentLevel && levels.length > 0 && levels.at(-1) < state.indentLevel) { + state.indentLevel = levels.at(-1); + } + } + } + while (state.rule) { + let expected = typeof state.rule === 'function' ? state.step === 0 ? state.rule(token, stream) : null : state.rule[state.step]; + if (state.needsSeparator) { + expected = expected === null || expected === void 0 ? void 0 : expected.separator; + } + if (expected) { + if (expected.ofRule) { + expected = expected.ofRule; + } + if (typeof expected === 'string') { + pushRule(parseRules, state, expected); + continue; + } + if ((_a = expected.match) === null || _a === void 0 ? void 0 : _a.call(expected, token)) { + if (expected.update) { + expected.update(state, token); + } + if (token.kind === 'Punctuation') { + advanceRule(state, true); + } else { + state.needsAdvance = true; + } + return expected.style; + } + } + unsuccessful(state); + } + assign(state, backupState); + pushRule(SpecialParseRules, state, 'Invalid'); + return 'invalidchar'; +} +function assign(to, from) { + const keys = Object.keys(from); + for (let i = 0; i < keys.length; i++) { + to[keys[i]] = from[keys[i]]; + } + return to; +} +const SpecialParseRules = { + Invalid: [], + Comment: [] +}; +function pushRule(rules, state, ruleKind) { + if (!rules[ruleKind]) { + throw new TypeError('Unknown rule: ' + ruleKind); + } + state.prevState = Object.assign({}, state); + state.kind = ruleKind; + state.name = null; + state.type = null; + state.rule = rules[ruleKind]; + state.step = 0; + state.needsSeparator = false; +} +function popRule(state) { + if (!state.prevState) { + return; + } + state.kind = state.prevState.kind; + state.name = state.prevState.name; + state.type = state.prevState.type; + state.rule = state.prevState.rule; + state.step = state.prevState.step; + state.needsSeparator = state.prevState.needsSeparator; + state.prevState = state.prevState.prevState; +} +function advanceRule(state, successful) { + var _a; + if (isList(state) && state.rule) { + const step = state.rule[state.step]; + if (step.separator) { + const { + separator + } = step; + state.needsSeparator = !state.needsSeparator; + if (!state.needsSeparator && separator.ofRule) { + return; + } + } + if (successful) { + return; + } + } + state.needsSeparator = false; + state.step++; + while (state.rule && !(Array.isArray(state.rule) && state.step < state.rule.length)) { + popRule(state); + if (state.rule) { + if (isList(state)) { + if ((_a = state.rule) === null || _a === void 0 ? void 0 : _a[state.step].separator) { + state.needsSeparator = !state.needsSeparator; + } + } else { + state.needsSeparator = false; + state.step++; + } + } + } +} +function isList(state) { + const step = Array.isArray(state.rule) && typeof state.rule[state.step] !== 'string' && state.rule[state.step]; + return step && step.isList; +} +function unsuccessful(state) { + while (state.rule && !(Array.isArray(state.rule) && state.rule[state.step].ofRule)) { + popRule(state); + } + if (state.rule) { + advanceRule(state, false); + } +} +function lex(lexRules, stream) { + const kinds = Object.keys(lexRules); + for (let i = 0; i < kinds.length; i++) { + const match = stream.match(lexRules[kinds[i]]); + if (match && match instanceof Array) { + return { + kind: kinds[i], + value: match[0] + }; + } + } +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/parser/types.js": +/*!**********************************************************!*\ + !*** ../../graphql-language-service/esm/parser/types.js ***! + \**********************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.RuleKinds = exports.AdditionalRuleKinds = void 0; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +const AdditionalRuleKinds = { + ALIASED_FIELD: 'AliasedField', + ARGUMENTS: 'Arguments', + SHORT_QUERY: 'ShortQuery', + QUERY: 'Query', + MUTATION: 'Mutation', + SUBSCRIPTION: 'Subscription', + TYPE_CONDITION: 'TypeCondition', + INVALID: 'Invalid', + COMMENT: 'Comment', + SCHEMA_DEF: 'SchemaDef', + SCALAR_DEF: 'ScalarDef', + OBJECT_TYPE_DEF: 'ObjectTypeDef', + OBJECT_VALUE: 'ObjectValue', + LIST_VALUE: 'ListValue', + INTERFACE_DEF: 'InterfaceDef', + UNION_DEF: 'UnionDef', + ENUM_DEF: 'EnumDef', + ENUM_VALUE: 'EnumValue', + FIELD_DEF: 'FieldDef', + INPUT_DEF: 'InputDef', + INPUT_VALUE_DEF: 'InputValueDef', + ARGUMENTS_DEF: 'ArgumentsDef', + EXTEND_DEF: 'ExtendDef', + EXTENSION_DEFINITION: 'ExtensionDefinition', + DIRECTIVE_DEF: 'DirectiveDef', + IMPLEMENTS: 'Implements', + VARIABLE_DEFINITIONS: 'VariableDefinitions', + TYPE: 'Type' +}; +exports.AdditionalRuleKinds = AdditionalRuleKinds; +const RuleKinds = Object.assign(Object.assign({}, _graphql.Kind), AdditionalRuleKinds); +exports.RuleKinds = RuleKinds; + +/***/ }), + +/***/ "../../graphql-language-service/esm/types.js": +/*!***************************************************!*\ + !*** ../../graphql-language-service/esm/types.js ***! + \***************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.FileChangeTypeKind = exports.CompletionItemKind = void 0; +Object.defineProperty(exports, "InsertTextFormat", ({ + enumerable: true, + get: function () { + return _vscodeLanguageserverTypes.InsertTextFormat; + } +})); +var _vscodeLanguageserverTypes = __webpack_require__(/*! vscode-languageserver-types */ "../../../node_modules/vscode-languageserver-types/lib/esm/main.js"); +const FileChangeTypeKind = { + Created: 1, + Changed: 2, + Deleted: 3 +}; +exports.FileChangeTypeKind = FileChangeTypeKind; +var CompletionItemKind; +exports.CompletionItemKind = CompletionItemKind; +(function (CompletionItemKind) { + CompletionItemKind.Text = 1; + CompletionItemKind.Method = 2; + CompletionItemKind.Function = 3; + CompletionItemKind.Constructor = 4; + CompletionItemKind.Field = 5; + CompletionItemKind.Variable = 6; + CompletionItemKind.Class = 7; + CompletionItemKind.Interface = 8; + CompletionItemKind.Module = 9; + CompletionItemKind.Property = 10; + CompletionItemKind.Unit = 11; + CompletionItemKind.Value = 12; + CompletionItemKind.Enum = 13; + CompletionItemKind.Keyword = 14; + CompletionItemKind.Snippet = 15; + CompletionItemKind.Color = 16; + CompletionItemKind.File = 17; + CompletionItemKind.Reference = 18; + CompletionItemKind.Folder = 19; + CompletionItemKind.EnumMember = 20; + CompletionItemKind.Constant = 21; + CompletionItemKind.Struct = 22; + CompletionItemKind.Event = 23; + CompletionItemKind.Operator = 24; + CompletionItemKind.TypeParameter = 25; +})(CompletionItemKind || (exports.CompletionItemKind = CompletionItemKind = {})); + +/***/ }), + +/***/ "../../graphql-language-service/esm/utils/Range.js": +/*!*********************************************************!*\ + !*** ../../graphql-language-service/esm/utils/Range.js ***! + \*********************************************************/ +/***/ (function(__unused_webpack_module, exports) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.Range = exports.Position = void 0; +exports.locToRange = locToRange; +exports.offsetToPosition = offsetToPosition; +class Range { + constructor(start, end) { + this.containsPosition = position => { + if (this.start.line === position.line) { + return this.start.character <= position.character; + } + if (this.end.line === position.line) { + return this.end.character >= position.character; + } + return this.start.line <= position.line && this.end.line >= position.line; + }; + this.start = start; + this.end = end; + } + setStart(line, character) { + this.start = new Position(line, character); + } + setEnd(line, character) { + this.end = new Position(line, character); + } +} +exports.Range = Range; +class Position { + constructor(line, character) { + this.lessThanOrEqualTo = position => this.line < position.line || this.line === position.line && this.character <= position.character; + this.line = line; + this.character = character; + } + setLine(line) { + this.line = line; + } + setCharacter(character) { + this.character = character; + } +} +exports.Position = Position; +function offsetToPosition(text, loc) { + const EOL = '\n'; + const buf = text.slice(0, loc); + const lines = buf.split(EOL).length - 1; + const lastLineIndex = buf.lastIndexOf(EOL); + return new Position(lines, loc - lastLineIndex - 1); +} +function locToRange(text, loc) { + const start = offsetToPosition(text, loc.start); + const end = offsetToPosition(text, loc.end); + return new Range(start, end); +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/utils/collectVariables.js": +/*!********************************************************************!*\ + !*** ../../graphql-language-service/esm/utils/collectVariables.js ***! + \********************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.collectVariables = collectVariables; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +function collectVariables(schema, documentAST) { + const variableToType = Object.create(null); + for (const definition of documentAST.definitions) { + if (definition.kind === 'OperationDefinition') { + const { + variableDefinitions + } = definition; + if (variableDefinitions) { + for (const { + variable, + type + } of variableDefinitions) { + const inputType = (0, _graphql.typeFromAST)(schema, type); + if (inputType) { + variableToType[variable.name.value] = inputType; + } else if (type.kind === _graphql.Kind.NAMED_TYPE && type.name.value === 'Float') { + variableToType[variable.name.value] = _graphql.GraphQLFloat; + } + } + } + } + } + return variableToType; +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/utils/fragmentDependencies.js": +/*!************************************************************************!*\ + !*** ../../graphql-language-service/esm/utils/fragmentDependencies.js ***! + \************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.getFragmentDependenciesForAST = exports.getFragmentDependencies = void 0; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +var _nullthrows = _interopRequireDefault(__webpack_require__(/*! nullthrows */ "../../../node_modules/nullthrows/nullthrows.js")); +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } +const getFragmentDependencies = (operationString, fragmentDefinitions) => { + if (!fragmentDefinitions) { + return []; + } + let parsedOperation; + try { + parsedOperation = (0, _graphql.parse)(operationString); + } catch (_a) { + return []; + } + return getFragmentDependenciesForAST(parsedOperation, fragmentDefinitions); +}; +exports.getFragmentDependencies = getFragmentDependencies; +const getFragmentDependenciesForAST = (parsedOperation, fragmentDefinitions) => { + if (!fragmentDefinitions) { + return []; + } + const existingFrags = new Map(); + const referencedFragNames = new Set(); + (0, _graphql.visit)(parsedOperation, { + FragmentDefinition(node) { + existingFrags.set(node.name.value, true); + }, + FragmentSpread(node) { + if (!referencedFragNames.has(node.name.value)) { + referencedFragNames.add(node.name.value); + } + } + }); + const asts = new Set(); + for (const name of referencedFragNames) { + if (!existingFrags.has(name) && fragmentDefinitions.has(name)) { + asts.add((0, _nullthrows.default)(fragmentDefinitions.get(name))); + } + } + const referencedFragments = []; + for (const ast of asts) { + (0, _graphql.visit)(ast, { + FragmentSpread(node) { + if (!referencedFragNames.has(node.name.value) && fragmentDefinitions.get(node.name.value)) { + asts.add((0, _nullthrows.default)(fragmentDefinitions.get(node.name.value))); + referencedFragNames.add(node.name.value); + } + } + }); + if (!existingFrags.has(ast.name.value)) { + referencedFragments.push(ast); + } + } + return referencedFragments; +}; +exports.getFragmentDependenciesForAST = getFragmentDependenciesForAST; + +/***/ }), + +/***/ "../../graphql-language-service/esm/utils/getASTNodeAtPosition.js": +/*!************************************************************************!*\ + !*** ../../graphql-language-service/esm/utils/getASTNodeAtPosition.js ***! + \************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.getASTNodeAtPosition = getASTNodeAtPosition; +exports.pointToOffset = pointToOffset; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +function getASTNodeAtPosition(query, ast, point) { + const offset = pointToOffset(query, point); + let nodeContainingPosition; + (0, _graphql.visit)(ast, { + enter(node) { + if (node.kind !== 'Name' && node.loc && node.loc.start <= offset && offset <= node.loc.end) { + nodeContainingPosition = node; + } else { + return false; + } + }, + leave(node) { + if (node.loc && node.loc.start <= offset && offset <= node.loc.end) { + return false; + } + } + }); + return nodeContainingPosition; +} +function pointToOffset(text, point) { + const linesUntilPosition = text.split('\n').slice(0, point.line); + return point.character + linesUntilPosition.map(line => line.length + 1).reduce((a, b) => a + b, 0); +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/utils/getOperationFacts.js": +/*!*********************************************************************!*\ + !*** ../../graphql-language-service/esm/utils/getOperationFacts.js ***! + \*********************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = getOperationFacts; +exports.getOperationASTFacts = getOperationASTFacts; +exports.getQueryFacts = void 0; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +var _collectVariables = __webpack_require__(/*! ./collectVariables */ "../../graphql-language-service/esm/utils/collectVariables.js"); +function getOperationASTFacts(documentAST, schema) { + const variableToType = schema ? (0, _collectVariables.collectVariables)(schema, documentAST) : undefined; + const operations = []; + (0, _graphql.visit)(documentAST, { + OperationDefinition(node) { + operations.push(node); + } + }); + return { + variableToType, + operations + }; +} +function getOperationFacts(schema, documentString) { + if (!documentString) { + return; + } + try { + const documentAST = (0, _graphql.parse)(documentString); + return Object.assign(Object.assign({}, getOperationASTFacts(documentAST, schema)), { + documentAST + }); + } catch (_a) { + return; + } +} +const getQueryFacts = getOperationFacts; +exports.getQueryFacts = getQueryFacts; + +/***/ }), + +/***/ "../../graphql-language-service/esm/utils/getVariablesJSONSchema.js": +/*!**************************************************************************!*\ + !*** ../../graphql-language-service/esm/utils/getVariablesJSONSchema.js ***! + \**************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.defaultJSONSchemaOptions = void 0; +exports.getVariablesJSONSchema = getVariablesJSONSchema; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +const defaultJSONSchemaOptions = { + useMarkdownDescription: false +}; +exports.defaultJSONSchemaOptions = defaultJSONSchemaOptions; +function text(into, newText) { + into.push(newText); +} +function renderType(into, t) { + if ((0, _graphql.isNonNullType)(t)) { + renderType(into, t.ofType); + text(into, '!'); + } else if ((0, _graphql.isListType)(t)) { + text(into, '['); + renderType(into, t.ofType); + text(into, ']'); + } else { + text(into, t.name); + } +} +function renderDefinitionDescription(t, useMarkdown, description) { + const into = []; + const type = 'type' in t ? t.type : t; + if ('type' in t && t.description) { + text(into, t.description); + text(into, '\n\n'); + } + text(into, renderTypeToString(type, useMarkdown)); + if (description) { + text(into, '\n'); + text(into, description); + } else if (!(0, _graphql.isScalarType)(type) && 'description' in type && type.description) { + text(into, '\n'); + text(into, type.description); + } else if ('ofType' in type && !(0, _graphql.isScalarType)(type.ofType) && 'description' in type.ofType && type.ofType.description) { + text(into, '\n'); + text(into, type.ofType.description); + } + return into.join(''); +} +function renderTypeToString(t, useMarkdown) { + const into = []; + if (useMarkdown) { + text(into, '```graphql\n'); + } + renderType(into, t); + if (useMarkdown) { + text(into, '\n```'); + } + return into.join(''); +} +const defaultScalarTypesMap = { + Int: { + type: 'integer' + }, + String: { + type: 'string' + }, + Float: { + type: 'number' + }, + ID: { + type: 'string' + }, + Boolean: { + type: 'boolean' + }, + DateTime: { + type: 'string' + } +}; +class Marker { + constructor() { + this.set = new Set(); + } + mark(name) { + if (this.set.has(name)) { + return false; + } + this.set.add(name); + return true; + } +} +function getJSONSchemaFromGraphQLType(fieldOrType, options) { + var _a, _b; + let definition = Object.create(null); + const definitions = Object.create(null); + const isField = ('type' in fieldOrType); + const type = isField ? fieldOrType.type : fieldOrType; + const baseType = (0, _graphql.isNonNullType)(type) ? type.ofType : type; + const required = (0, _graphql.isNonNullType)(type); + if ((0, _graphql.isScalarType)(baseType)) { + if ((_a = options === null || options === void 0 ? void 0 : options.scalarSchemas) === null || _a === void 0 ? void 0 : _a[baseType.name]) { + definition = JSON.parse(JSON.stringify(options.scalarSchemas[baseType.name])); + } else { + definition.type = ['string', 'number', 'boolean', 'integer']; + } + if (!required) { + if (Array.isArray(definition.type)) { + definition.type.push('null'); + } else if (definition.type) { + definition.type = [definition.type, 'null']; + } else if (definition.enum) { + definition.enum.push(null); + } else if (definition.oneOf) { + definition.oneOf.push({ + type: 'null' + }); + } else { + definition = { + oneOf: [definition, { + type: 'null' + }] + }; + } + } + } else if ((0, _graphql.isEnumType)(baseType)) { + definition.enum = baseType.getValues().map(val => val.name); + if (!required) { + definition.enum.push(null); + } + } else if ((0, _graphql.isListType)(baseType)) { + if (required) { + definition.type = 'array'; + } else { + definition.type = ['array', 'null']; + } + const { + definition: def, + definitions: defs + } = getJSONSchemaFromGraphQLType(baseType.ofType, options); + definition.items = def; + if (defs) { + for (const defName of Object.keys(defs)) { + definitions[defName] = defs[defName]; + } + } + } else if ((0, _graphql.isInputObjectType)(baseType)) { + if (required) { + definition.$ref = `#/definitions/${baseType.name}`; + } else { + definition.oneOf = [{ + $ref: `#/definitions/${baseType.name}` + }, { + type: 'null' + }]; + } + if ((_b = options === null || options === void 0 ? void 0 : options.definitionMarker) === null || _b === void 0 ? void 0 : _b.mark(baseType.name)) { + const fields = baseType.getFields(); + const fieldDef = { + type: 'object', + properties: {}, + required: [] + }; + fieldDef.description = renderDefinitionDescription(baseType); + if (options === null || options === void 0 ? void 0 : options.useMarkdownDescription) { + fieldDef.markdownDescription = renderDefinitionDescription(baseType, true); + } + for (const fieldName of Object.keys(fields)) { + const field = fields[fieldName]; + const { + required: fieldRequired, + definition: fieldDefinition, + definitions: typeDefinitions + } = getJSONSchemaFromGraphQLType(field, options); + fieldDef.properties[fieldName] = fieldDefinition; + if (fieldRequired) { + fieldDef.required.push(fieldName); + } + if (typeDefinitions) { + for (const [defName, value] of Object.entries(typeDefinitions)) { + definitions[defName] = value; + } + } + } + definitions[baseType.name] = fieldDef; + } + } + if ('defaultValue' in fieldOrType && fieldOrType.defaultValue !== undefined) { + definition.default = fieldOrType.defaultValue; + } + const { + description + } = definition; + definition.description = renderDefinitionDescription(fieldOrType, false, description); + if (options === null || options === void 0 ? void 0 : options.useMarkdownDescription) { + definition.markdownDescription = renderDefinitionDescription(fieldOrType, true, description); + } + return { + required, + definition, + definitions + }; +} +function getVariablesJSONSchema(variableToType, options) { + var _a; + const jsonSchema = { + $schema: 'http://json-schema.org/draft-04/schema', + type: 'object', + properties: {}, + required: [] + }; + const runtimeOptions = Object.assign(Object.assign({}, options), { + definitionMarker: new Marker(), + scalarSchemas: Object.assign(Object.assign({}, defaultScalarTypesMap), options === null || options === void 0 ? void 0 : options.scalarSchemas) + }); + if (variableToType) { + for (const [variableName, type] of Object.entries(variableToType)) { + const { + definition, + required, + definitions + } = getJSONSchemaFromGraphQLType(type, runtimeOptions); + jsonSchema.properties[variableName] = definition; + if (required) { + (_a = jsonSchema.required) === null || _a === void 0 ? void 0 : _a.push(variableName); + } + if (definitions) { + jsonSchema.definitions = Object.assign(Object.assign({}, jsonSchema === null || jsonSchema === void 0 ? void 0 : jsonSchema.definitions), definitions); + } + } + } + return jsonSchema; +} + +/***/ }), + +/***/ "../../graphql-language-service/esm/utils/index.js": +/*!*********************************************************!*\ + !*** ../../graphql-language-service/esm/utils/index.js ***! + \*********************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +Object.defineProperty(exports, "Position", ({ + enumerable: true, + get: function () { + return _Range.Position; + } +})); +Object.defineProperty(exports, "Range", ({ + enumerable: true, + get: function () { + return _Range.Range; + } +})); +Object.defineProperty(exports, "collectVariables", ({ + enumerable: true, + get: function () { + return _collectVariables.collectVariables; + } +})); +Object.defineProperty(exports, "getASTNodeAtPosition", ({ + enumerable: true, + get: function () { + return _getASTNodeAtPosition.getASTNodeAtPosition; + } +})); +Object.defineProperty(exports, "getFragmentDependencies", ({ + enumerable: true, + get: function () { + return _fragmentDependencies.getFragmentDependencies; + } +})); +Object.defineProperty(exports, "getFragmentDependenciesForAST", ({ + enumerable: true, + get: function () { + return _fragmentDependencies.getFragmentDependenciesForAST; + } +})); +Object.defineProperty(exports, "getOperationASTFacts", ({ + enumerable: true, + get: function () { + return _getOperationFacts.getOperationASTFacts; + } +})); +Object.defineProperty(exports, "getOperationFacts", ({ + enumerable: true, + get: function () { + return _getOperationFacts.default; + } +})); +Object.defineProperty(exports, "getQueryFacts", ({ + enumerable: true, + get: function () { + return _getOperationFacts.getQueryFacts; + } +})); +Object.defineProperty(exports, "getVariablesJSONSchema", ({ + enumerable: true, + get: function () { + return _getVariablesJSONSchema.getVariablesJSONSchema; + } +})); +Object.defineProperty(exports, "locToRange", ({ + enumerable: true, + get: function () { + return _Range.locToRange; + } +})); +Object.defineProperty(exports, "offsetToPosition", ({ + enumerable: true, + get: function () { + return _Range.offsetToPosition; + } +})); +Object.defineProperty(exports, "pointToOffset", ({ + enumerable: true, + get: function () { + return _getASTNodeAtPosition.pointToOffset; + } +})); +Object.defineProperty(exports, "validateWithCustomRules", ({ + enumerable: true, + get: function () { + return _validateWithCustomRules.validateWithCustomRules; + } +})); +var _fragmentDependencies = __webpack_require__(/*! ./fragmentDependencies */ "../../graphql-language-service/esm/utils/fragmentDependencies.js"); +var _getVariablesJSONSchema = __webpack_require__(/*! ./getVariablesJSONSchema */ "../../graphql-language-service/esm/utils/getVariablesJSONSchema.js"); +var _getASTNodeAtPosition = __webpack_require__(/*! ./getASTNodeAtPosition */ "../../graphql-language-service/esm/utils/getASTNodeAtPosition.js"); +var _Range = __webpack_require__(/*! ./Range */ "../../graphql-language-service/esm/utils/Range.js"); +var _validateWithCustomRules = __webpack_require__(/*! ./validateWithCustomRules */ "../../graphql-language-service/esm/utils/validateWithCustomRules.js"); +var _collectVariables = __webpack_require__(/*! ./collectVariables */ "../../graphql-language-service/esm/utils/collectVariables.js"); +var _getOperationFacts = _interopRequireWildcard(__webpack_require__(/*! ./getOperationFacts */ "../../graphql-language-service/esm/utils/getOperationFacts.js")); +function _getRequireWildcardCache(nodeInterop) { if (typeof WeakMap !== "function") return null; var cacheBabelInterop = new WeakMap(); var cacheNodeInterop = new WeakMap(); return (_getRequireWildcardCache = function (nodeInterop) { return nodeInterop ? cacheNodeInterop : cacheBabelInterop; })(nodeInterop); } +function _interopRequireWildcard(obj, nodeInterop) { if (!nodeInterop && obj && obj.__esModule) { return obj; } if (obj === null || typeof obj !== "object" && typeof obj !== "function") { return { default: obj }; } var cache = _getRequireWildcardCache(nodeInterop); if (cache && cache.has(obj)) { return cache.get(obj); } var newObj = {}; var hasPropertyDescriptor = Object.defineProperty && Object.getOwnPropertyDescriptor; for (var key in obj) { if (key !== "default" && Object.prototype.hasOwnProperty.call(obj, key)) { var desc = hasPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : null; if (desc && (desc.get || desc.set)) { Object.defineProperty(newObj, key, desc); } else { newObj[key] = obj[key]; } } } newObj.default = obj; if (cache) { cache.set(obj, newObj); } return newObj; } + +/***/ }), + +/***/ "../../graphql-language-service/esm/utils/validateWithCustomRules.js": +/*!***************************************************************************!*\ + !*** ../../graphql-language-service/esm/utils/validateWithCustomRules.js ***! + \***************************************************************************/ +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.validateWithCustomRules = validateWithCustomRules; +var _graphql = __webpack_require__(/*! graphql */ "../../../node_modules/graphql/index.mjs"); +const specifiedSDLRules = [_graphql.LoneSchemaDefinitionRule, _graphql.UniqueOperationTypesRule, _graphql.UniqueTypeNamesRule, _graphql.UniqueEnumValueNamesRule, _graphql.UniqueFieldDefinitionNamesRule, _graphql.UniqueDirectiveNamesRule, _graphql.KnownTypeNamesRule, _graphql.KnownDirectivesRule, _graphql.UniqueDirectivesPerLocationRule, _graphql.PossibleTypeExtensionsRule, _graphql.UniqueArgumentNamesRule, _graphql.UniqueInputFieldNamesRule]; +function validateWithCustomRules(schema, ast, customRules, isRelayCompatMode, isSchemaDocument) { + const rules = _graphql.specifiedRules.filter(rule => { + if (rule === _graphql.NoUnusedFragmentsRule || rule === _graphql.ExecutableDefinitionsRule) { + return false; + } + if (isRelayCompatMode && rule === _graphql.KnownFragmentNamesRule) { + return false; + } + return true; + }); + if (customRules) { + Array.prototype.push.apply(rules, customRules); + } + if (isSchemaDocument) { + Array.prototype.push.apply(rules, specifiedSDLRules); + } + const errors = (0, _graphql.validate)(schema, ast, rules); + return errors.filter(error => { + if (error.message.includes('Unknown directive') && error.nodes) { + const node = error.nodes[0]; + if (node && node.kind === _graphql.Kind.DIRECTIVE) { + const name = node.name.value; + if (name === 'arguments' || name === 'argumentDefinitions') { + return false; + } + } + } + return true; + }); +} + +/***/ }), + +/***/ "./style.css": +/*!*******************!*\ + !*** ./style.css ***! + \*******************/ +/***/ (function(__unused_webpack_module, __webpack_exports__, __webpack_require__) { + +__webpack_require__.r(__webpack_exports__); +// extracted by mini-css-extract-plugin + + +/***/ }), + +/***/ "../../graphiql-react/dist/style.css": +/*!*******************************************!*\ + !*** ../../graphiql-react/dist/style.css ***! + \*******************************************/ +/***/ (function(__unused_webpack_module, __webpack_exports__, __webpack_require__) { + +__webpack_require__.r(__webpack_exports__); +// extracted by mini-css-extract-plugin + + +/***/ }), + +/***/ "../../graphiql-react/font/fira-code.css": +/*!***********************************************!*\ + !*** ../../graphiql-react/font/fira-code.css ***! + \***********************************************/ +/***/ (function(__unused_webpack_module, __webpack_exports__, __webpack_require__) { + +__webpack_require__.r(__webpack_exports__); +// extracted by mini-css-extract-plugin + + +/***/ }), + +/***/ "../../graphiql-react/font/roboto.css": +/*!********************************************!*\ + !*** ../../graphiql-react/font/roboto.css ***! + \********************************************/ +/***/ (function(__unused_webpack_module, __webpack_exports__, __webpack_require__) { + +__webpack_require__.r(__webpack_exports__); +// extracted by mini-css-extract-plugin + + +/***/ }), + +/***/ "react": +/*!************************!*\ + !*** external "React" ***! + \************************/ +/***/ (function(module) { + +module.exports = window["React"]; + +/***/ }), + +/***/ "react-dom": +/*!***************************!*\ + !*** external "ReactDOM" ***! + \***************************/ +/***/ (function(module) { + +module.exports = window["ReactDOM"]; + +/***/ }), + +/***/ "../../../node_modules/@headlessui/react/dist/headlessui.dev.cjs": +/*!***********************************************************************!*\ + !*** ../../../node_modules/@headlessui/react/dist/headlessui.dev.cjs ***! + \***********************************************************************/ +/***/ (function(module, __unused_webpack_exports, __webpack_require__) { + + +var __create = Object.create; +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __getProtoOf = Object.getPrototypeOf; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value; +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, + mod +)); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +var __publicField = (obj, key, value) => { + __defNormalProp(obj, typeof key !== "symbol" ? key + "" : key, value); + return value; +}; + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + Combobox: () => Combobox, + Dialog: () => Dialog, + Disclosure: () => Disclosure, + FocusTrap: () => FocusTrap, + Listbox: () => Listbox, + Menu: () => Menu, + Popover: () => Popover, + Portal: () => Portal, + RadioGroup: () => RadioGroup, + Switch: () => Switch, + Tab: () => Tab, + Transition: () => Transition +}); +module.exports = __toCommonJS(src_exports); + +// src/components/combobox/combobox.tsx +var import_react19 = __toESM(__webpack_require__(/*! react */ "react"), 1); + +// src/hooks/use-computed.ts +var import_react3 = __webpack_require__(/*! react */ "react"); + +// src/hooks/use-iso-morphic-effect.ts +var import_react = __webpack_require__(/*! react */ "react"); + +// src/utils/env.ts +var Env = class { + constructor() { + __publicField(this, "current", this.detect()); + __publicField(this, "handoffState", "pending"); + __publicField(this, "currentId", 0); + } + set(env2) { + if (this.current === env2) + return; + this.handoffState = "pending"; + this.currentId = 0; + this.current = env2; + } + reset() { + this.set(this.detect()); + } + nextId() { + return ++this.currentId; + } + get isServer() { + return this.current === "server"; + } + get isClient() { + return this.current === "client"; + } + detect() { + if (typeof window === "undefined" || typeof document === "undefined") { + return "server"; + } + return "client"; + } + handoff() { + if (this.handoffState === "pending") { + this.handoffState = "complete"; + } + } + get isHandoffComplete() { + return this.handoffState === "complete"; + } +}; +var env = new Env(); + +// src/hooks/use-iso-morphic-effect.ts +var useIsoMorphicEffect = (effect, deps) => { + if (env.isServer) { + (0, import_react.useEffect)(effect, deps); + } else { + (0, import_react.useLayoutEffect)(effect, deps); + } +}; + +// src/hooks/use-latest-value.ts +var import_react2 = __webpack_require__(/*! react */ "react"); +function useLatestValue(value) { + let cache = (0, import_react2.useRef)(value); + useIsoMorphicEffect(() => { + cache.current = value; + }, [value]); + return cache; +} + +// src/hooks/use-computed.ts +function useComputed(cb, dependencies) { + let [value, setValue] = (0, import_react3.useState)(cb); + let cbRef = useLatestValue(cb); + useIsoMorphicEffect(() => setValue(cbRef.current), [cbRef, setValue, ...dependencies]); + return value; +} + +// src/hooks/use-disposables.ts +var import_react4 = __webpack_require__(/*! react */ "react"); + +// src/utils/micro-task.ts +function microTask(cb) { + if (typeof queueMicrotask === "function") { + queueMicrotask(cb); + } else { + Promise.resolve().then(cb).catch( + (e) => setTimeout(() => { + throw e; + }) + ); + } +} + +// src/utils/disposables.ts +function disposables() { + let _disposables = []; + let api = { + addEventListener(element, name, listener, options) { + element.addEventListener(name, listener, options); + return api.add(() => element.removeEventListener(name, listener, options)); + }, + requestAnimationFrame(...args) { + let raf = requestAnimationFrame(...args); + return api.add(() => cancelAnimationFrame(raf)); + }, + nextFrame(...args) { + return api.requestAnimationFrame(() => { + return api.requestAnimationFrame(...args); + }); + }, + setTimeout(...args) { + let timer = setTimeout(...args); + return api.add(() => clearTimeout(timer)); + }, + microTask(...args) { + let task = { current: true }; + microTask(() => { + if (task.current) { + args[0](); + } + }); + return api.add(() => { + task.current = false; + }); + }, + style(node, property, value) { + let previous = node.style.getPropertyValue(property); + Object.assign(node.style, { [property]: value }); + return this.add(() => { + Object.assign(node.style, { [property]: previous }); + }); + }, + group(cb) { + let d = disposables(); + cb(d); + return this.add(() => d.dispose()); + }, + add(cb) { + _disposables.push(cb); + return () => { + let idx = _disposables.indexOf(cb); + if (idx >= 0) { + for (let dispose of _disposables.splice(idx, 1)) { + dispose(); + } + } + }; + }, + dispose() { + for (let dispose of _disposables.splice(0)) { + dispose(); + } + } + }; + return api; +} + +// src/hooks/use-disposables.ts +function useDisposables() { + let [d] = (0, import_react4.useState)(disposables); + (0, import_react4.useEffect)(() => () => d.dispose(), [d]); + return d; +} + +// src/hooks/use-event.ts +var import_react5 = __toESM(__webpack_require__(/*! react */ "react"), 1); +var useEvent = ( + // TODO: Add React.useEvent ?? once the useEvent hook is available + function useEvent2(cb) { + let cache = useLatestValue(cb); + return import_react5.default.useCallback((...args) => cache.current(...args), [cache]); + } +); + +// src/hooks/use-id.ts +var import_react7 = __toESM(__webpack_require__(/*! react */ "react"), 1); + +// src/hooks/use-server-handoff-complete.ts +var import_react6 = __webpack_require__(/*! react */ "react"); +function useServerHandoffComplete() { + let [complete, setComplete] = (0, import_react6.useState)(env.isHandoffComplete); + if (complete && env.isHandoffComplete === false) { + setComplete(false); + } + (0, import_react6.useEffect)(() => { + if (complete === true) + return; + setComplete(true); + }, [complete]); + (0, import_react6.useEffect)(() => env.handoff(), []); + return complete; +} + +// src/hooks/use-id.ts +var _a; +var useId = ( + // Prefer React's `useId` if it's available. + // @ts-expect-error - `useId` doesn't exist in React < 18. + (_a = import_react7.default.useId) != null ? _a : function useId2() { + let ready = useServerHandoffComplete(); + let [id, setId] = import_react7.default.useState(ready ? () => env.nextId() : null); + useIsoMorphicEffect(() => { + if (id === null) + setId(env.nextId()); + }, [id]); + return id != null ? "" + id : void 0; + } +); + +// src/hooks/use-outside-click.ts +var import_react10 = __webpack_require__(/*! react */ "react"); + +// src/utils/match.ts +function match(value, lookup, ...args) { + if (value in lookup) { + let returnValue = lookup[value]; + return typeof returnValue === "function" ? returnValue(...args) : returnValue; + } + let error = new Error( + `Tried to handle "${value}" but there is no handler defined. Only defined handlers are: ${Object.keys( + lookup + ).map((key) => `"${key}"`).join(", ")}.` + ); + if (Error.captureStackTrace) + Error.captureStackTrace(error, match); + throw error; +} + +// src/utils/owner.ts +function getOwnerDocument(element) { + if (env.isServer) + return null; + if (element instanceof Node) + return element.ownerDocument; + if (element == null ? void 0 : element.hasOwnProperty("current")) { + if (element.current instanceof Node) + return element.current.ownerDocument; + } + return document; +} + +// src/utils/focus-management.ts +var focusableSelector = [ + "[contentEditable=true]", + "[tabindex]", + "a[href]", + "area[href]", + "button:not([disabled])", + "iframe", + "input:not([disabled])", + "select:not([disabled])", + "textarea:not([disabled])" +].map( + false ? ( + // TODO: Remove this once JSDOM fixes the issue where an element that is + // "hidden" can be the document.activeElement, because this is not possible + // in real browsers. + 0 + ) : (selector) => `${selector}:not([tabindex='-1'])` +).join(","); +function getFocusableElements(container = document.body) { + if (container == null) + return []; + return Array.from(container.querySelectorAll(focusableSelector)).sort( + // We want to move `tabIndex={0}` to the end of the list, this is what the browser does as well. + (a, z) => Math.sign((a.tabIndex || Number.MAX_SAFE_INTEGER) - (z.tabIndex || Number.MAX_SAFE_INTEGER)) + ); +} +function isFocusableElement(element, mode = 0 /* Strict */) { + var _a3; + if (element === ((_a3 = getOwnerDocument(element)) == null ? void 0 : _a3.body)) + return false; + return match(mode, { + [0 /* Strict */]() { + return element.matches(focusableSelector); + }, + [1 /* Loose */]() { + let next = element; + while (next !== null) { + if (next.matches(focusableSelector)) + return true; + next = next.parentElement; + } + return false; + } + }); +} +function restoreFocusIfNecessary(element) { + let ownerDocument = getOwnerDocument(element); + disposables().nextFrame(() => { + if (ownerDocument && !isFocusableElement(ownerDocument.activeElement, 0 /* Strict */)) { + focusElement(element); + } + }); +} +if (typeof window !== "undefined" && typeof document !== "undefined") { + document.addEventListener( + "keydown", + (event) => { + if (event.metaKey || event.altKey || event.ctrlKey) { + return; + } + document.documentElement.dataset.headlessuiFocusVisible = ""; + }, + true + ); + document.addEventListener( + "click", + (event) => { + if (event.detail === 1 /* Mouse */) { + delete document.documentElement.dataset.headlessuiFocusVisible; + } else if (event.detail === 0 /* Keyboard */) { + document.documentElement.dataset.headlessuiFocusVisible = ""; + } + }, + true + ); +} +function focusElement(element) { + element == null ? void 0 : element.focus({ preventScroll: true }); +} +var selectableSelector = ["textarea", "input"].join(","); +function isSelectableElement(element) { + var _a3, _b; + return (_b = (_a3 = element == null ? void 0 : element.matches) == null ? void 0 : _a3.call(element, selectableSelector)) != null ? _b : false; +} +function sortByDomNode(nodes, resolveKey = (i) => i) { + return nodes.slice().sort((aItem, zItem) => { + let a = resolveKey(aItem); + let z = resolveKey(zItem); + if (a === null || z === null) + return 0; + let position = a.compareDocumentPosition(z); + if (position & Node.DOCUMENT_POSITION_FOLLOWING) + return -1; + if (position & Node.DOCUMENT_POSITION_PRECEDING) + return 1; + return 0; + }); +} +function focusFrom(current, focus) { + return focusIn(getFocusableElements(), focus, { relativeTo: current }); +} +function focusIn(container, focus, { + sorted = true, + relativeTo = null, + skipElements = [] +} = {}) { + let ownerDocument = Array.isArray(container) ? container.length > 0 ? container[0].ownerDocument : document : container.ownerDocument; + let elements = Array.isArray(container) ? sorted ? sortByDomNode(container) : container : getFocusableElements(container); + if (skipElements.length > 0 && elements.length > 1) { + elements = elements.filter((x) => !skipElements.includes(x)); + } + relativeTo = relativeTo != null ? relativeTo : ownerDocument.activeElement; + let direction = (() => { + if (focus & (1 /* First */ | 4 /* Next */)) + return 1 /* Next */; + if (focus & (2 /* Previous */ | 8 /* Last */)) + return -1 /* Previous */; + throw new Error("Missing Focus.First, Focus.Previous, Focus.Next or Focus.Last"); + })(); + let startIndex = (() => { + if (focus & 1 /* First */) + return 0; + if (focus & 2 /* Previous */) + return Math.max(0, elements.indexOf(relativeTo)) - 1; + if (focus & 4 /* Next */) + return Math.max(0, elements.indexOf(relativeTo)) + 1; + if (focus & 8 /* Last */) + return elements.length - 1; + throw new Error("Missing Focus.First, Focus.Previous, Focus.Next or Focus.Last"); + })(); + let focusOptions = focus & 32 /* NoScroll */ ? { preventScroll: true } : {}; + let offset = 0; + let total = elements.length; + let next = void 0; + do { + if (offset >= total || offset + total <= 0) + return 0 /* Error */; + let nextIdx = startIndex + offset; + if (focus & 16 /* WrapAround */) { + nextIdx = (nextIdx + total) % total; + } else { + if (nextIdx < 0) + return 3 /* Underflow */; + if (nextIdx >= total) + return 1 /* Overflow */; + } + next = elements[nextIdx]; + next == null ? void 0 : next.focus(focusOptions); + offset += direction; + } while (next !== ownerDocument.activeElement); + if (focus & (4 /* Next */ | 2 /* Previous */) && isSelectableElement(next)) { + next.select(); + } + return 2 /* Success */; +} + +// src/hooks/use-document-event.ts +var import_react8 = __webpack_require__(/*! react */ "react"); +function useDocumentEvent(type, listener, options) { + let listenerRef = useLatestValue(listener); + (0, import_react8.useEffect)(() => { + function handler(event) { + listenerRef.current(event); + } + document.addEventListener(type, handler, options); + return () => document.removeEventListener(type, handler, options); + }, [type, options]); +} + +// src/hooks/use-window-event.ts +var import_react9 = __webpack_require__(/*! react */ "react"); +function useWindowEvent(type, listener, options) { + let listenerRef = useLatestValue(listener); + (0, import_react9.useEffect)(() => { + function handler(event) { + listenerRef.current(event); + } + window.addEventListener(type, handler, options); + return () => window.removeEventListener(type, handler, options); + }, [type, options]); +} + +// src/hooks/use-outside-click.ts +function useOutsideClick(containers, cb, enabled = true) { + let enabledRef = (0, import_react10.useRef)(false); + (0, import_react10.useEffect)( + false ? 0 : () => { + requestAnimationFrame(() => { + enabledRef.current = enabled; + }); + }, + [enabled] + ); + function handleOutsideClick(event, resolveTarget) { + if (!enabledRef.current) + return; + if (event.defaultPrevented) + return; + let target = resolveTarget(event); + if (target === null) { + return; + } + if (!target.getRootNode().contains(target)) + return; + let _containers = function resolve(containers2) { + if (typeof containers2 === "function") { + return resolve(containers2()); + } + if (Array.isArray(containers2)) { + return containers2; + } + if (containers2 instanceof Set) { + return containers2; + } + return [containers2]; + }(containers); + for (let container of _containers) { + if (container === null) + continue; + let domNode = container instanceof HTMLElement ? container : container.current; + if (domNode == null ? void 0 : domNode.contains(target)) { + return; + } + if (event.composed && event.composedPath().includes(domNode)) { + return; + } + } + if ( + // This check alllows us to know whether or not we clicked on a "focusable" element like a + // button or an input. This is a backwards compatibility check so that you can open a and click on another which should close Menu A and open Menu B. We might + // revisit that so that you will require 2 clicks instead. + !isFocusableElement(target, 1 /* Loose */) && // This could be improved, but the `Combobox.Button` adds tabIndex={-1} to make it + // unfocusable via the keyboard so that tabbing to the next item from the input doesn't + // first go to the button. + target.tabIndex !== -1 + ) { + event.preventDefault(); + } + return cb(event, target); + } + let initialClickTarget = (0, import_react10.useRef)(null); + useDocumentEvent( + "mousedown", + (event) => { + var _a3, _b; + if (enabledRef.current) { + initialClickTarget.current = ((_b = (_a3 = event.composedPath) == null ? void 0 : _a3.call(event)) == null ? void 0 : _b[0]) || event.target; + } + }, + true + ); + useDocumentEvent( + "click", + (event) => { + if (!initialClickTarget.current) { + return; + } + handleOutsideClick(event, () => { + return initialClickTarget.current; + }); + initialClickTarget.current = null; + }, + // We will use the `capture` phase so that layers in between with `event.stopPropagation()` + // don't "cancel" this outside click check. E.g.: A `Menu` inside a `DialogPanel` if the `Menu` + // is open, and you click outside of it in the `DialogPanel` the `Menu` should close. However, + // the `DialogPanel` has a `onClick(e) { e.stopPropagation() }` which would cancel this. + true + ); + useWindowEvent( + "blur", + (event) => handleOutsideClick( + event, + () => window.document.activeElement instanceof HTMLIFrameElement ? window.document.activeElement : null + ), + true + ); +} + +// src/hooks/use-resolve-button-type.ts +var import_react11 = __webpack_require__(/*! react */ "react"); +function resolveType(props) { + var _a3; + if (props.type) + return props.type; + let tag = (_a3 = props.as) != null ? _a3 : "button"; + if (typeof tag === "string" && tag.toLowerCase() === "button") + return "button"; + return void 0; +} +function useResolveButtonType(props, ref) { + let [type, setType] = (0, import_react11.useState)(() => resolveType(props)); + useIsoMorphicEffect(() => { + setType(resolveType(props)); + }, [props.type, props.as]); + useIsoMorphicEffect(() => { + if (type) + return; + if (!ref.current) + return; + if (ref.current instanceof HTMLButtonElement && !ref.current.hasAttribute("type")) { + setType("button"); + } + }, [type, ref]); + return type; +} + +// src/hooks/use-sync-refs.ts +var import_react12 = __webpack_require__(/*! react */ "react"); +var Optional = Symbol(); +function optionalRef(cb, isOptional = true) { + return Object.assign(cb, { [Optional]: isOptional }); +} +function useSyncRefs(...refs) { + let cache = (0, import_react12.useRef)(refs); + (0, import_react12.useEffect)(() => { + cache.current = refs; + }, [refs]); + let syncRefs = useEvent((value) => { + for (let ref of cache.current) { + if (ref == null) + continue; + if (typeof ref === "function") + ref(value); + else + ref.current = value; + } + }); + return refs.every( + (ref) => ref == null || // @ts-expect-error + (ref == null ? void 0 : ref[Optional]) + ) ? void 0 : syncRefs; +} + +// src/hooks/use-tree-walker.ts +var import_react13 = __webpack_require__(/*! react */ "react"); +function useTreeWalker({ + container, + accept, + walk, + enabled = true +}) { + let acceptRef = (0, import_react13.useRef)(accept); + let walkRef = (0, import_react13.useRef)(walk); + (0, import_react13.useEffect)(() => { + acceptRef.current = accept; + walkRef.current = walk; + }, [accept, walk]); + useIsoMorphicEffect(() => { + if (!container) + return; + if (!enabled) + return; + let ownerDocument = getOwnerDocument(container); + if (!ownerDocument) + return; + let accept2 = acceptRef.current; + let walk2 = walkRef.current; + let acceptNode = Object.assign((node) => accept2(node), { acceptNode: accept2 }); + let walker = ownerDocument.createTreeWalker( + container, + NodeFilter.SHOW_ELEMENT, + acceptNode, + // @ts-expect-error This `false` is a simple small fix for older browsers + false + ); + while (walker.nextNode()) + walk2(walker.currentNode); + }, [container, enabled, acceptRef, walkRef]); +} + +// src/utils/calculate-active-index.ts +function assertNever(x) { + throw new Error("Unexpected object: " + x); +} +function calculateActiveIndex(action, resolvers) { + let items = resolvers.resolveItems(); + if (items.length <= 0) + return null; + let currentActiveIndex = resolvers.resolveActiveIndex(); + let activeIndex = currentActiveIndex != null ? currentActiveIndex : -1; + let nextActiveIndex = (() => { + switch (action.focus) { + case 0 /* First */: + return items.findIndex((item) => !resolvers.resolveDisabled(item)); + case 1 /* Previous */: { + let idx = items.slice().reverse().findIndex((item, idx2, all) => { + if (activeIndex !== -1 && all.length - idx2 - 1 >= activeIndex) + return false; + return !resolvers.resolveDisabled(item); + }); + if (idx === -1) + return idx; + return items.length - 1 - idx; + } + case 2 /* Next */: + return items.findIndex((item, idx) => { + if (idx <= activeIndex) + return false; + return !resolvers.resolveDisabled(item); + }); + case 3 /* Last */: { + let idx = items.slice().reverse().findIndex((item) => !resolvers.resolveDisabled(item)); + if (idx === -1) + return idx; + return items.length - 1 - idx; + } + case 4 /* Specific */: + return items.findIndex((item) => resolvers.resolveId(item) === action.id); + case 5 /* Nothing */: + return null; + default: + assertNever(action); + } + })(); + return nextActiveIndex === -1 ? currentActiveIndex : nextActiveIndex; +} + +// src/utils/render.ts +var import_react14 = __webpack_require__(/*! react */ "react"); + +// src/utils/class-names.ts +function classNames(...classes) { + return classes.filter(Boolean).join(" "); +} + +// src/utils/render.ts +function render({ + ourProps, + theirProps, + slot, + defaultTag, + features, + visible = true, + name +}) { + let props = mergeProps(theirProps, ourProps); + if (visible) + return _render(props, slot, defaultTag, name); + let featureFlags = features != null ? features : 0 /* None */; + if (featureFlags & 2 /* Static */) { + let { static: isStatic = false, ...rest } = props; + if (isStatic) + return _render(rest, slot, defaultTag, name); + } + if (featureFlags & 1 /* RenderStrategy */) { + let { unmount = true, ...rest } = props; + let strategy = unmount ? 0 /* Unmount */ : 1 /* Hidden */; + return match(strategy, { + [0 /* Unmount */]() { + return null; + }, + [1 /* Hidden */]() { + return _render( + { ...rest, ...{ hidden: true, style: { display: "none" } } }, + slot, + defaultTag, + name + ); + } + }); + } + return _render(props, slot, defaultTag, name); +} +function _render(props, slot = {}, tag, name) { + let { + as: Component = tag, + children, + refName = "ref", + ...rest + } = omit(props, ["unmount", "static"]); + let refRelatedProps = props.ref !== void 0 ? { [refName]: props.ref } : {}; + let resolvedChildren = typeof children === "function" ? children(slot) : children; + if ("className" in rest && rest.className && typeof rest.className === "function") { + rest.className = rest.className(slot); + } + let dataAttributes = {}; + if (slot) { + let exposeState = false; + let states = []; + for (let [k, v] of Object.entries(slot)) { + if (typeof v === "boolean") { + exposeState = true; + } + if (v === true) { + states.push(k); + } + } + if (exposeState) + dataAttributes[`data-headlessui-state`] = states.join(" "); + } + if (Component === import_react14.Fragment) { + if (Object.keys(compact(rest)).length > 0) { + if (!(0, import_react14.isValidElement)(resolvedChildren) || Array.isArray(resolvedChildren) && resolvedChildren.length > 1) { + throw new Error( + [ + 'Passing props on "Fragment"!', + "", + `The current component <${name} /> is rendering a "Fragment".`, + `However we need to passthrough the following props:`, + Object.keys(rest).map((line) => ` - ${line}`).join("\n"), + "", + "You can apply a few solutions:", + [ + 'Add an `as="..."` prop, to ensure that we render an actual element instead of a "Fragment".', + "Render a single element as the child so that we can forward the props onto that element." + ].map((line) => ` - ${line}`).join("\n") + ].join("\n") + ); + } + let childProps = resolvedChildren.props; + let newClassName = typeof (childProps == null ? void 0 : childProps.className) === "function" ? (...args) => classNames(childProps == null ? void 0 : childProps.className(...args), rest.className) : classNames(childProps == null ? void 0 : childProps.className, rest.className); + let classNameProps = newClassName ? { className: newClassName } : {}; + return (0, import_react14.cloneElement)( + resolvedChildren, + Object.assign( + {}, + // Filter out undefined values so that they don't override the existing values + mergeProps(resolvedChildren.props, compact(omit(rest, ["ref"]))), + dataAttributes, + refRelatedProps, + mergeRefs(resolvedChildren.ref, refRelatedProps.ref), + classNameProps + ) + ); + } + } + return (0, import_react14.createElement)( + Component, + Object.assign( + {}, + omit(rest, ["ref"]), + Component !== import_react14.Fragment && refRelatedProps, + Component !== import_react14.Fragment && dataAttributes + ), + resolvedChildren + ); +} +function mergeRefs(...refs) { + return { + ref: refs.every((ref) => ref == null) ? void 0 : (value) => { + for (let ref of refs) { + if (ref == null) + continue; + if (typeof ref === "function") + ref(value); + else + ref.current = value; + } + } + }; +} +function mergeProps(...listOfProps) { + var _a3; + if (listOfProps.length === 0) + return {}; + if (listOfProps.length === 1) + return listOfProps[0]; + let target = {}; + let eventHandlers = {}; + for (let props of listOfProps) { + for (let prop in props) { + if (prop.startsWith("on") && typeof props[prop] === "function") { + (_a3 = eventHandlers[prop]) != null ? _a3 : eventHandlers[prop] = []; + eventHandlers[prop].push(props[prop]); + } else { + target[prop] = props[prop]; + } + } + } + if (target.disabled || target["aria-disabled"]) { + return Object.assign( + target, + // Set all event listeners that we collected to `undefined`. This is + // important because of the `cloneElement` from above, which merges the + // existing and new props, they don't just override therefore we have to + // explicitly nullify them. + Object.fromEntries(Object.keys(eventHandlers).map((eventName) => [eventName, void 0])) + ); + } + for (let eventName in eventHandlers) { + Object.assign(target, { + [eventName](event, ...args) { + let handlers = eventHandlers[eventName]; + for (let handler of handlers) { + if ((event instanceof Event || (event == null ? void 0 : event.nativeEvent) instanceof Event) && event.defaultPrevented) { + return; + } + handler(event, ...args); + } + } + }); + } + return target; +} +function forwardRefWithAs(component) { + var _a3; + return Object.assign((0, import_react14.forwardRef)(component), { + displayName: (_a3 = component.displayName) != null ? _a3 : component.name + }); +} +function compact(object) { + let clone = Object.assign({}, object); + for (let key in clone) { + if (clone[key] === void 0) + delete clone[key]; + } + return clone; +} +function omit(object, keysToOmit = []) { + let clone = Object.assign({}, object); + for (let key of keysToOmit) { + if (key in clone) + delete clone[key]; + } + return clone; +} + +// src/utils/bugs.ts +function isDisabledReactIssue7711(element) { + let parent = element.parentElement; + let legend = null; + while (parent && !(parent instanceof HTMLFieldSetElement)) { + if (parent instanceof HTMLLegendElement) + legend = parent; + parent = parent.parentElement; + } + let isParentDisabled = (parent == null ? void 0 : parent.getAttribute("disabled")) === ""; + if (isParentDisabled && isFirstLegend(legend)) + return false; + return isParentDisabled; +} +function isFirstLegend(element) { + if (!element) + return false; + let previous = element.previousElementSibling; + while (previous !== null) { + if (previous instanceof HTMLLegendElement) + return false; + previous = previous.previousElementSibling; + } + return true; +} + +// src/utils/form.ts +function objectToFormEntries(source = {}, parentKey = null, entries = []) { + for (let [key, value] of Object.entries(source)) { + append(entries, composeKey(parentKey, key), value); + } + return entries; +} +function composeKey(parent, key) { + return parent ? parent + "[" + key + "]" : key; +} +function append(entries, key, value) { + if (Array.isArray(value)) { + for (let [subkey, subvalue] of value.entries()) { + append(entries, composeKey(key, subkey.toString()), subvalue); + } + } else if (value instanceof Date) { + entries.push([key, value.toISOString()]); + } else if (typeof value === "boolean") { + entries.push([key, value ? "1" : "0"]); + } else if (typeof value === "string") { + entries.push([key, value]); + } else if (typeof value === "number") { + entries.push([key, `${value}`]); + } else if (value === null || value === void 0) { + entries.push([key, ""]); + } else { + objectToFormEntries(value, key, entries); + } +} +function attemptSubmit(element) { + var _a3; + let form = (_a3 = element == null ? void 0 : element.form) != null ? _a3 : element.closest("form"); + if (!form) + return; + for (let element2 of form.elements) { + if (element2.tagName === "INPUT" && element2.type === "submit" || element2.tagName === "BUTTON" && element2.type === "submit" || element2.nodeName === "INPUT" && element2.type === "image") { + element2.click(); + return; + } + } +} + +// src/internal/hidden.tsx +var DEFAULT_VISUALLY_HIDDEN_TAG = "div"; +function VisuallyHidden(props, ref) { + let { features = 1 /* None */, ...theirProps } = props; + let ourProps = { + ref, + "aria-hidden": (features & 2 /* Focusable */) === 2 /* Focusable */ ? true : void 0, + style: { + position: "fixed", + top: 1, + left: 1, + width: 1, + height: 0, + padding: 0, + margin: -1, + overflow: "hidden", + clip: "rect(0, 0, 0, 0)", + whiteSpace: "nowrap", + borderWidth: "0", + ...(features & 4 /* Hidden */) === 4 /* Hidden */ && !((features & 2 /* Focusable */) === 2 /* Focusable */) && { display: "none" } + } + }; + return render({ + ourProps, + theirProps, + slot: {}, + defaultTag: DEFAULT_VISUALLY_HIDDEN_TAG, + name: "Hidden" + }); +} +var Hidden = forwardRefWithAs(VisuallyHidden); + +// src/internal/open-closed.tsx +var import_react15 = __toESM(__webpack_require__(/*! react */ "react"), 1); +var Context = (0, import_react15.createContext)(null); +Context.displayName = "OpenClosedContext"; +function useOpenClosed() { + return (0, import_react15.useContext)(Context); +} +function OpenClosedProvider({ value, children }) { + return /* @__PURE__ */ import_react15.default.createElement(Context.Provider, { value }, children); +} + +// src/hooks/use-controllable.ts +var import_react16 = __webpack_require__(/*! react */ "react"); +function useControllable(controlledValue, onChange, defaultValue) { + let [internalValue, setInternalValue] = (0, import_react16.useState)(defaultValue); + let isControlled = controlledValue !== void 0; + let wasControlled = (0, import_react16.useRef)(isControlled); + let didWarnOnUncontrolledToControlled = (0, import_react16.useRef)(false); + let didWarnOnControlledToUncontrolled = (0, import_react16.useRef)(false); + if (isControlled && !wasControlled.current && !didWarnOnUncontrolledToControlled.current) { + didWarnOnUncontrolledToControlled.current = true; + wasControlled.current = isControlled; + console.error( + "A component is changing from uncontrolled to controlled. This may be caused by the value changing from undefined to a defined value, which should not happen." + ); + } else if (!isControlled && wasControlled.current && !didWarnOnControlledToUncontrolled.current) { + didWarnOnControlledToUncontrolled.current = true; + wasControlled.current = isControlled; + console.error( + "A component is changing from controlled to uncontrolled. This may be caused by the value changing from a defined value to undefined, which should not happen." + ); + } + return [ + isControlled ? controlledValue : internalValue, + useEvent((value) => { + if (isControlled) { + return onChange == null ? void 0 : onChange(value); + } else { + setInternalValue(value); + return onChange == null ? void 0 : onChange(value); + } + }) + ]; +} + +// src/hooks/use-watch.ts +var import_react17 = __webpack_require__(/*! react */ "react"); +function useWatch(cb, dependencies) { + let track = (0, import_react17.useRef)([]); + let action = useEvent(cb); + (0, import_react17.useEffect)(() => { + let oldValues = [...track.current]; + for (let [idx, value] of dependencies.entries()) { + if (track.current[idx] !== value) { + let returnValue = action(dependencies, oldValues); + track.current = dependencies; + return returnValue; + } + } + }, [action, ...dependencies]); +} + +// src/hooks/use-tracked-pointer.ts +var import_react18 = __webpack_require__(/*! react */ "react"); +function eventToPosition(evt) { + return [evt.screenX, evt.screenY]; +} +function useTrackedPointer() { + let lastPos = (0, import_react18.useRef)([-1, -1]); + return { + wasMoved(evt) { + if (false) {} + let newPos = eventToPosition(evt); + if (lastPos.current[0] === newPos[0] && lastPos.current[1] === newPos[1]) { + return false; + } + lastPos.current = newPos; + return true; + }, + update(evt) { + lastPos.current = eventToPosition(evt); + } + }; +} + +// src/utils/platform.ts +function isIOS() { + return ( + // Check if it is an iPhone + /iPhone/gi.test(window.navigator.platform) || // Check if it is an iPad. iPad reports itself as "MacIntel", but we can check if it is a touch + // screen. Let's hope that Apple doesn't release a touch screen Mac (or maybe this would then + // work as expected 🤔). + /Mac/gi.test(window.navigator.platform) && window.navigator.maxTouchPoints > 0 + ); +} +function isAndroid() { + return /Android/gi.test(window.navigator.userAgent); +} +function isMobile() { + return isIOS() || isAndroid(); +} + +// src/components/combobox/combobox.tsx +function adjustOrderedState(state, adjustment = (i) => i) { + let currentActiveOption = state.activeOptionIndex !== null ? state.options[state.activeOptionIndex] : null; + let sortedOptions = sortByDomNode( + adjustment(state.options.slice()), + (option) => option.dataRef.current.domRef.current + ); + let adjustedActiveOptionIndex = currentActiveOption ? sortedOptions.indexOf(currentActiveOption) : null; + if (adjustedActiveOptionIndex === -1) { + adjustedActiveOptionIndex = null; + } + return { + options: sortedOptions, + activeOptionIndex: adjustedActiveOptionIndex + }; +} +var reducers = { + [1 /* CloseCombobox */](state) { + var _a3; + if ((_a3 = state.dataRef.current) == null ? void 0 : _a3.disabled) + return state; + if (state.comboboxState === 1 /* Closed */) + return state; + return { ...state, activeOptionIndex: null, comboboxState: 1 /* Closed */ }; + }, + [0 /* OpenCombobox */](state) { + var _a3; + if ((_a3 = state.dataRef.current) == null ? void 0 : _a3.disabled) + return state; + if (state.comboboxState === 0 /* Open */) + return state; + let activeOptionIndex = state.activeOptionIndex; + if (state.dataRef.current) { + let { isSelected } = state.dataRef.current; + let optionIdx = state.options.findIndex((option) => isSelected(option.dataRef.current.value)); + if (optionIdx !== -1) { + activeOptionIndex = optionIdx; + } + } + return { ...state, comboboxState: 0 /* Open */, activeOptionIndex }; + }, + [2 /* GoToOption */](state, action) { + var _a3, _b, _c, _d; + if ((_a3 = state.dataRef.current) == null ? void 0 : _a3.disabled) + return state; + if (((_b = state.dataRef.current) == null ? void 0 : _b.optionsRef.current) && !((_c = state.dataRef.current) == null ? void 0 : _c.optionsPropsRef.current.static) && state.comboboxState === 1 /* Closed */) { + return state; + } + let adjustedState = adjustOrderedState(state); + if (adjustedState.activeOptionIndex === null) { + let localActiveOptionIndex = adjustedState.options.findIndex( + (option) => !option.dataRef.current.disabled + ); + if (localActiveOptionIndex !== -1) { + adjustedState.activeOptionIndex = localActiveOptionIndex; + } + } + let activeOptionIndex = calculateActiveIndex(action, { + resolveItems: () => adjustedState.options, + resolveActiveIndex: () => adjustedState.activeOptionIndex, + resolveId: (item) => item.id, + resolveDisabled: (item) => item.dataRef.current.disabled + }); + return { + ...state, + ...adjustedState, + activeOptionIndex, + activationTrigger: (_d = action.trigger) != null ? _d : 1 /* Other */ + }; + }, + [3 /* RegisterOption */]: (state, action) => { + var _a3, _b; + let option = { id: action.id, dataRef: action.dataRef }; + let adjustedState = adjustOrderedState(state, (options) => [...options, option]); + if (state.activeOptionIndex === null) { + if ((_a3 = state.dataRef.current) == null ? void 0 : _a3.isSelected(action.dataRef.current.value)) { + adjustedState.activeOptionIndex = adjustedState.options.indexOf(option); + } + } + let nextState = { + ...state, + ...adjustedState, + activationTrigger: 1 /* Other */ + }; + if (((_b = state.dataRef.current) == null ? void 0 : _b.__demoMode) && state.dataRef.current.value === void 0) { + nextState.activeOptionIndex = 0; + } + return nextState; + }, + [4 /* UnregisterOption */]: (state, action) => { + let adjustedState = adjustOrderedState(state, (options) => { + let idx = options.findIndex((a) => a.id === action.id); + if (idx !== -1) + options.splice(idx, 1); + return options; + }); + return { + ...state, + ...adjustedState, + activationTrigger: 1 /* Other */ + }; + }, + [5 /* RegisterLabel */]: (state, action) => { + return { + ...state, + labelId: action.id + }; + } +}; +var ComboboxActionsContext = (0, import_react19.createContext)(null); +ComboboxActionsContext.displayName = "ComboboxActionsContext"; +function useActions(component) { + let context = (0, import_react19.useContext)(ComboboxActionsContext); + if (context === null) { + let err = new Error(`<${component} /> is missing a parent component.`); + if (Error.captureStackTrace) + Error.captureStackTrace(err, useActions); + throw err; + } + return context; +} +var ComboboxDataContext = (0, import_react19.createContext)(null); +ComboboxDataContext.displayName = "ComboboxDataContext"; +function useData(component) { + let context = (0, import_react19.useContext)(ComboboxDataContext); + if (context === null) { + let err = new Error(`<${component} /> is missing a parent component.`); + if (Error.captureStackTrace) + Error.captureStackTrace(err, useData); + throw err; + } + return context; +} +function stateReducer(state, action) { + return match(action.type, reducers, state, action); +} +var DEFAULT_COMBOBOX_TAG = import_react19.Fragment; +function ComboboxFn(props, ref) { + let { + value: controlledValue, + defaultValue, + onChange: controlledOnChange, + form: formName, + name, + by = (a, z) => a === z, + disabled = false, + __demoMode = false, + nullable = false, + multiple = false, + ...theirProps + } = props; + let [value = multiple ? [] : void 0, theirOnChange] = useControllable( + controlledValue, + controlledOnChange, + defaultValue + ); + let [state, dispatch] = (0, import_react19.useReducer)(stateReducer, { + dataRef: (0, import_react19.createRef)(), + comboboxState: __demoMode ? 0 /* Open */ : 1 /* Closed */, + options: [], + activeOptionIndex: null, + activationTrigger: 1 /* Other */, + labelId: null + }); + let defaultToFirstOption = (0, import_react19.useRef)(false); + let optionsPropsRef = (0, import_react19.useRef)({ static: false, hold: false }); + let labelRef = (0, import_react19.useRef)(null); + let inputRef = (0, import_react19.useRef)(null); + let buttonRef = (0, import_react19.useRef)(null); + let optionsRef = (0, import_react19.useRef)(null); + let compare = useEvent( + // @ts-expect-error Eventually we'll want to tackle this, but for now this will do. + typeof by === "string" ? (a, z) => { + let property = by; + return (a == null ? void 0 : a[property]) === (z == null ? void 0 : z[property]); + } : by + ); + let isSelected = (0, import_react19.useCallback)( + (compareValue) => match(data.mode, { + [1 /* Multi */]: () => value.some((option) => compare(option, compareValue)), + [0 /* Single */]: () => compare(value, compareValue) + }), + [value] + ); + let data = (0, import_react19.useMemo)( + () => ({ + ...state, + optionsPropsRef, + labelRef, + inputRef, + buttonRef, + optionsRef, + value, + defaultValue, + disabled, + mode: multiple ? 1 /* Multi */ : 0 /* Single */, + get activeOptionIndex() { + if (defaultToFirstOption.current && state.activeOptionIndex === null && state.options.length > 0) { + let localActiveOptionIndex = state.options.findIndex( + (option) => !option.dataRef.current.disabled + ); + if (localActiveOptionIndex !== -1) { + return localActiveOptionIndex; + } + } + return state.activeOptionIndex; + }, + compare, + isSelected, + nullable, + __demoMode + }), + [value, defaultValue, disabled, multiple, nullable, __demoMode, state] + ); + let lastActiveOption = (0, import_react19.useRef)( + data.activeOptionIndex !== null ? data.options[data.activeOptionIndex] : null + ); + (0, import_react19.useEffect)(() => { + let currentActiveOption = data.activeOptionIndex !== null ? data.options[data.activeOptionIndex] : null; + if (lastActiveOption.current !== currentActiveOption) { + lastActiveOption.current = currentActiveOption; + } + }); + useIsoMorphicEffect(() => { + state.dataRef.current = data; + }, [data]); + useOutsideClick( + [data.buttonRef, data.inputRef, data.optionsRef], + () => actions.closeCombobox(), + data.comboboxState === 0 /* Open */ + ); + let slot = (0, import_react19.useMemo)( + () => ({ + open: data.comboboxState === 0 /* Open */, + disabled, + activeIndex: data.activeOptionIndex, + activeOption: data.activeOptionIndex === null ? null : data.options[data.activeOptionIndex].dataRef.current.value, + value + }), + [data, disabled, value] + ); + let selectOption = useEvent((id) => { + let option = data.options.find((item) => item.id === id); + if (!option) + return; + onChange(option.dataRef.current.value); + }); + let selectActiveOption = useEvent(() => { + if (data.activeOptionIndex !== null) { + let { dataRef, id } = data.options[data.activeOptionIndex]; + onChange(dataRef.current.value); + actions.goToOption(4 /* Specific */, id); + } + }); + let openCombobox = useEvent(() => { + dispatch({ type: 0 /* OpenCombobox */ }); + defaultToFirstOption.current = true; + }); + let closeCombobox = useEvent(() => { + dispatch({ type: 1 /* CloseCombobox */ }); + defaultToFirstOption.current = false; + }); + let goToOption = useEvent((focus, id, trigger) => { + defaultToFirstOption.current = false; + if (focus === 4 /* Specific */) { + return dispatch({ type: 2 /* GoToOption */, focus: 4 /* Specific */, id, trigger }); + } + return dispatch({ type: 2 /* GoToOption */, focus, trigger }); + }); + let registerOption = useEvent((id, dataRef) => { + dispatch({ type: 3 /* RegisterOption */, id, dataRef }); + return () => { + var _a3; + if (((_a3 = lastActiveOption.current) == null ? void 0 : _a3.id) === id) { + defaultToFirstOption.current = true; + } + dispatch({ type: 4 /* UnregisterOption */, id }); + }; + }); + let registerLabel = useEvent((id) => { + dispatch({ type: 5 /* RegisterLabel */, id }); + return () => dispatch({ type: 5 /* RegisterLabel */, id: null }); + }); + let onChange = useEvent((value2) => { + return match(data.mode, { + [0 /* Single */]() { + return theirOnChange == null ? void 0 : theirOnChange(value2); + }, + [1 /* Multi */]() { + let copy = data.value.slice(); + let idx = copy.findIndex((item) => compare(item, value2)); + if (idx === -1) { + copy.push(value2); + } else { + copy.splice(idx, 1); + } + return theirOnChange == null ? void 0 : theirOnChange(copy); + } + }); + }); + let actions = (0, import_react19.useMemo)( + () => ({ + onChange, + registerOption, + registerLabel, + goToOption, + closeCombobox, + openCombobox, + selectActiveOption, + selectOption + }), + [] + ); + let ourProps = ref === null ? {} : { ref }; + let form = (0, import_react19.useRef)(null); + let d = useDisposables(); + (0, import_react19.useEffect)(() => { + if (!form.current) + return; + if (defaultValue === void 0) + return; + d.addEventListener(form.current, "reset", () => { + onChange(defaultValue); + }); + }, [ + form, + onChange + /* Explicitly ignoring `defaultValue` */ + ]); + return /* @__PURE__ */ import_react19.default.createElement(ComboboxActionsContext.Provider, { value: actions }, /* @__PURE__ */ import_react19.default.createElement(ComboboxDataContext.Provider, { value: data }, /* @__PURE__ */ import_react19.default.createElement( + OpenClosedProvider, + { + value: match(data.comboboxState, { + [0 /* Open */]: 1 /* Open */, + [1 /* Closed */]: 2 /* Closed */ + }) + }, + name != null && value != null && objectToFormEntries({ [name]: value }).map(([name2, value2], idx) => /* @__PURE__ */ import_react19.default.createElement( + Hidden, + { + features: 4 /* Hidden */, + ref: idx === 0 ? (element) => { + var _a3; + form.current = (_a3 = element == null ? void 0 : element.closest("form")) != null ? _a3 : null; + } : void 0, + ...compact({ + key: name2, + as: "input", + type: "hidden", + hidden: true, + readOnly: true, + form: formName, + name: name2, + value: value2 + }) + } + )), + render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_COMBOBOX_TAG, + name: "Combobox" + }) + ))); +} +var DEFAULT_INPUT_TAG = "input"; +function InputFn(props, ref) { + var _a3, _b, _c, _d; + let internalId = useId(); + let { + id = `headlessui-combobox-input-${internalId}`, + onChange, + displayValue, + // @ts-ignore: We know this MAY NOT exist for a given tag but we only care when it _does_ exist. + type = "text", + ...theirProps + } = props; + let data = useData("Combobox.Input"); + let actions = useActions("Combobox.Input"); + let inputRef = useSyncRefs(data.inputRef, ref); + let isTyping = (0, import_react19.useRef)(false); + let d = useDisposables(); + let currentDisplayValue = function() { + var _a4; + if (typeof displayValue === "function" && data.value !== void 0) { + return (_a4 = displayValue(data.value)) != null ? _a4 : ""; + } else if (typeof data.value === "string") { + return data.value; + } else { + return ""; + } + }(); + useWatch( + ([currentDisplayValue2, state], [oldCurrentDisplayValue, oldState]) => { + if (isTyping.current) + return; + if (!data.inputRef.current) + return; + if (oldState === 0 /* Open */ && state === 1 /* Closed */) { + data.inputRef.current.value = currentDisplayValue2; + } else if (currentDisplayValue2 !== oldCurrentDisplayValue) { + data.inputRef.current.value = currentDisplayValue2; + } + }, + [currentDisplayValue, data.comboboxState] + ); + useWatch( + ([newState], [oldState]) => { + if (newState === 0 /* Open */ && oldState === 1 /* Closed */) { + let input = data.inputRef.current; + if (!input) + return; + let currentValue = input.value; + let { selectionStart, selectionEnd, selectionDirection } = input; + input.value = ""; + input.value = currentValue; + if (selectionDirection !== null) { + input.setSelectionRange(selectionStart, selectionEnd, selectionDirection); + } else { + input.setSelectionRange(selectionStart, selectionEnd); + } + } + }, + [data.comboboxState] + ); + let isComposing = (0, import_react19.useRef)(false); + let composedChangeEvent = (0, import_react19.useRef)(null); + let handleCompositionStart = useEvent(() => { + isComposing.current = true; + }); + let handleCompositionEnd = useEvent(() => { + d.nextFrame(() => { + isComposing.current = false; + if (composedChangeEvent.current) { + actions.openCombobox(); + onChange == null ? void 0 : onChange(composedChangeEvent.current); + composedChangeEvent.current = null; + } + }); + }); + let handleKeyDown = useEvent((event) => { + isTyping.current = true; + switch (event.key) { + case "Backspace" /* Backspace */: + case "Delete" /* Delete */: + if (data.mode !== 0 /* Single */) + return; + if (!data.nullable) + return; + let input = event.currentTarget; + d.requestAnimationFrame(() => { + if (input.value === "") { + actions.onChange(null); + if (data.optionsRef.current) { + data.optionsRef.current.scrollTop = 0; + } + actions.goToOption(5 /* Nothing */); + } + }); + break; + case "Enter" /* Enter */: + isTyping.current = false; + if (data.comboboxState !== 0 /* Open */) + return; + if (isComposing.current) + return; + event.preventDefault(); + event.stopPropagation(); + if (data.activeOptionIndex === null) { + actions.closeCombobox(); + return; + } + actions.selectActiveOption(); + if (data.mode === 0 /* Single */) { + actions.closeCombobox(); + } + break; + case "ArrowDown" /* ArrowDown */: + isTyping.current = false; + event.preventDefault(); + event.stopPropagation(); + return match(data.comboboxState, { + [0 /* Open */]: () => { + actions.goToOption(2 /* Next */); + }, + [1 /* Closed */]: () => { + actions.openCombobox(); + } + }); + case "ArrowUp" /* ArrowUp */: + isTyping.current = false; + event.preventDefault(); + event.stopPropagation(); + return match(data.comboboxState, { + [0 /* Open */]: () => { + actions.goToOption(1 /* Previous */); + }, + [1 /* Closed */]: () => { + actions.openCombobox(); + d.nextFrame(() => { + if (!data.value) { + actions.goToOption(3 /* Last */); + } + }); + } + }); + case "Home" /* Home */: + if (event.shiftKey) { + break; + } + isTyping.current = false; + event.preventDefault(); + event.stopPropagation(); + return actions.goToOption(0 /* First */); + case "PageUp" /* PageUp */: + isTyping.current = false; + event.preventDefault(); + event.stopPropagation(); + return actions.goToOption(0 /* First */); + case "End" /* End */: + if (event.shiftKey) { + break; + } + isTyping.current = false; + event.preventDefault(); + event.stopPropagation(); + return actions.goToOption(3 /* Last */); + case "PageDown" /* PageDown */: + isTyping.current = false; + event.preventDefault(); + event.stopPropagation(); + return actions.goToOption(3 /* Last */); + case "Escape" /* Escape */: + isTyping.current = false; + if (data.comboboxState !== 0 /* Open */) + return; + event.preventDefault(); + if (data.optionsRef.current && !data.optionsPropsRef.current.static) { + event.stopPropagation(); + } + return actions.closeCombobox(); + case "Tab" /* Tab */: + isTyping.current = false; + if (data.comboboxState !== 0 /* Open */) + return; + if (data.mode === 0 /* Single */) + actions.selectActiveOption(); + actions.closeCombobox(); + break; + } + }); + let handleChange = useEvent((event) => { + if (isComposing.current) { + composedChangeEvent.current = event; + return; + } + actions.openCombobox(); + onChange == null ? void 0 : onChange(event); + }); + let handleBlur = useEvent(() => { + isTyping.current = false; + }); + let labelledby = useComputed(() => { + if (!data.labelId) + return void 0; + return [data.labelId].join(" "); + }, [data.labelId]); + let slot = (0, import_react19.useMemo)( + () => ({ open: data.comboboxState === 0 /* Open */, disabled: data.disabled }), + [data] + ); + let ourProps = { + ref: inputRef, + id, + role: "combobox", + type, + "aria-controls": (_a3 = data.optionsRef.current) == null ? void 0 : _a3.id, + "aria-expanded": data.disabled ? void 0 : data.comboboxState === 0 /* Open */, + "aria-activedescendant": data.activeOptionIndex === null ? void 0 : (_b = data.options[data.activeOptionIndex]) == null ? void 0 : _b.id, + "aria-labelledby": labelledby, + "aria-autocomplete": "list", + defaultValue: (_d = (_c = props.defaultValue) != null ? _c : data.defaultValue !== void 0 ? displayValue == null ? void 0 : displayValue(data.defaultValue) : null) != null ? _d : data.defaultValue, + disabled: data.disabled, + onCompositionStart: handleCompositionStart, + onCompositionEnd: handleCompositionEnd, + onKeyDown: handleKeyDown, + onChange: handleChange, + onBlur: handleBlur + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_INPUT_TAG, + name: "Combobox.Input" + }); +} +var DEFAULT_BUTTON_TAG = "button"; +function ButtonFn(props, ref) { + var _a3; + let data = useData("Combobox.Button"); + let actions = useActions("Combobox.Button"); + let buttonRef = useSyncRefs(data.buttonRef, ref); + let internalId = useId(); + let { id = `headlessui-combobox-button-${internalId}`, ...theirProps } = props; + let d = useDisposables(); + let handleKeyDown = useEvent((event) => { + switch (event.key) { + case "ArrowDown" /* ArrowDown */: + event.preventDefault(); + event.stopPropagation(); + if (data.comboboxState === 1 /* Closed */) { + actions.openCombobox(); + } + return d.nextFrame(() => { + var _a4; + return (_a4 = data.inputRef.current) == null ? void 0 : _a4.focus({ preventScroll: true }); + }); + case "ArrowUp" /* ArrowUp */: + event.preventDefault(); + event.stopPropagation(); + if (data.comboboxState === 1 /* Closed */) { + actions.openCombobox(); + d.nextFrame(() => { + if (!data.value) { + actions.goToOption(3 /* Last */); + } + }); + } + return d.nextFrame(() => { + var _a4; + return (_a4 = data.inputRef.current) == null ? void 0 : _a4.focus({ preventScroll: true }); + }); + case "Escape" /* Escape */: + if (data.comboboxState !== 0 /* Open */) + return; + event.preventDefault(); + if (data.optionsRef.current && !data.optionsPropsRef.current.static) { + event.stopPropagation(); + } + actions.closeCombobox(); + return d.nextFrame(() => { + var _a4; + return (_a4 = data.inputRef.current) == null ? void 0 : _a4.focus({ preventScroll: true }); + }); + default: + return; + } + }); + let handleClick = useEvent((event) => { + if (isDisabledReactIssue7711(event.currentTarget)) + return event.preventDefault(); + if (data.comboboxState === 0 /* Open */) { + actions.closeCombobox(); + } else { + event.preventDefault(); + actions.openCombobox(); + } + d.nextFrame(() => { + var _a4; + return (_a4 = data.inputRef.current) == null ? void 0 : _a4.focus({ preventScroll: true }); + }); + }); + let labelledby = useComputed(() => { + if (!data.labelId) + return void 0; + return [data.labelId, id].join(" "); + }, [data.labelId, id]); + let slot = (0, import_react19.useMemo)( + () => ({ + open: data.comboboxState === 0 /* Open */, + disabled: data.disabled, + value: data.value + }), + [data] + ); + let ourProps = { + ref: buttonRef, + id, + type: useResolveButtonType(props, data.buttonRef), + tabIndex: -1, + "aria-haspopup": "listbox", + "aria-controls": (_a3 = data.optionsRef.current) == null ? void 0 : _a3.id, + "aria-expanded": data.disabled ? void 0 : data.comboboxState === 0 /* Open */, + "aria-labelledby": labelledby, + disabled: data.disabled, + onClick: handleClick, + onKeyDown: handleKeyDown + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_BUTTON_TAG, + name: "Combobox.Button" + }); +} +var DEFAULT_LABEL_TAG = "label"; +function LabelFn(props, ref) { + let internalId = useId(); + let { id = `headlessui-combobox-label-${internalId}`, ...theirProps } = props; + let data = useData("Combobox.Label"); + let actions = useActions("Combobox.Label"); + let labelRef = useSyncRefs(data.labelRef, ref); + useIsoMorphicEffect(() => actions.registerLabel(id), [id]); + let handleClick = useEvent(() => { + var _a3; + return (_a3 = data.inputRef.current) == null ? void 0 : _a3.focus({ preventScroll: true }); + }); + let slot = (0, import_react19.useMemo)( + () => ({ open: data.comboboxState === 0 /* Open */, disabled: data.disabled }), + [data] + ); + let ourProps = { ref: labelRef, id, onClick: handleClick }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_LABEL_TAG, + name: "Combobox.Label" + }); +} +var DEFAULT_OPTIONS_TAG = "ul"; +var OptionsRenderFeatures = 1 /* RenderStrategy */ | 2 /* Static */; +function OptionsFn(props, ref) { + let internalId = useId(); + let { id = `headlessui-combobox-options-${internalId}`, hold = false, ...theirProps } = props; + let data = useData("Combobox.Options"); + let optionsRef = useSyncRefs(data.optionsRef, ref); + let usesOpenClosedState = useOpenClosed(); + let visible = (() => { + if (usesOpenClosedState !== null) { + return (usesOpenClosedState & 1 /* Open */) === 1 /* Open */; + } + return data.comboboxState === 0 /* Open */; + })(); + useIsoMorphicEffect(() => { + var _a3; + data.optionsPropsRef.current.static = (_a3 = props.static) != null ? _a3 : false; + }, [data.optionsPropsRef, props.static]); + useIsoMorphicEffect(() => { + data.optionsPropsRef.current.hold = hold; + }, [data.optionsPropsRef, hold]); + useTreeWalker({ + container: data.optionsRef.current, + enabled: data.comboboxState === 0 /* Open */, + accept(node) { + if (node.getAttribute("role") === "option") + return NodeFilter.FILTER_REJECT; + if (node.hasAttribute("role")) + return NodeFilter.FILTER_SKIP; + return NodeFilter.FILTER_ACCEPT; + }, + walk(node) { + node.setAttribute("role", "none"); + } + }); + let labelledby = useComputed( + () => { + var _a3, _b; + return (_b = data.labelId) != null ? _b : (_a3 = data.buttonRef.current) == null ? void 0 : _a3.id; + }, + [data.labelId, data.buttonRef.current] + ); + let slot = (0, import_react19.useMemo)( + () => ({ open: data.comboboxState === 0 /* Open */ }), + [data] + ); + let ourProps = { + "aria-labelledby": labelledby, + role: "listbox", + "aria-multiselectable": data.mode === 1 /* Multi */ ? true : void 0, + id, + ref: optionsRef + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_OPTIONS_TAG, + features: OptionsRenderFeatures, + visible, + name: "Combobox.Options" + }); +} +var DEFAULT_OPTION_TAG = "li"; +function OptionFn(props, ref) { + var _a3, _b; + let internalId = useId(); + let { + id = `headlessui-combobox-option-${internalId}`, + disabled = false, + value, + ...theirProps + } = props; + let data = useData("Combobox.Option"); + let actions = useActions("Combobox.Option"); + let active = data.activeOptionIndex !== null ? data.options[data.activeOptionIndex].id === id : false; + let selected = data.isSelected(value); + let internalOptionRef = (0, import_react19.useRef)(null); + let bag = useLatestValue({ + disabled, + value, + domRef: internalOptionRef, + textValue: (_b = (_a3 = internalOptionRef.current) == null ? void 0 : _a3.textContent) == null ? void 0 : _b.toLowerCase() + }); + let optionRef = useSyncRefs(ref, internalOptionRef); + let select = useEvent(() => actions.selectOption(id)); + useIsoMorphicEffect(() => actions.registerOption(id, bag), [bag, id]); + let enableScrollIntoView = (0, import_react19.useRef)(data.__demoMode ? false : true); + useIsoMorphicEffect(() => { + if (!data.__demoMode) + return; + let d = disposables(); + d.requestAnimationFrame(() => { + enableScrollIntoView.current = true; + }); + return d.dispose; + }, []); + useIsoMorphicEffect(() => { + if (data.comboboxState !== 0 /* Open */) + return; + if (!active) + return; + if (!enableScrollIntoView.current) + return; + if (data.activationTrigger === 0 /* Pointer */) + return; + let d = disposables(); + d.requestAnimationFrame(() => { + var _a4, _b2; + (_b2 = (_a4 = internalOptionRef.current) == null ? void 0 : _a4.scrollIntoView) == null ? void 0 : _b2.call(_a4, { block: "nearest" }); + }); + return d.dispose; + }, [ + internalOptionRef, + active, + data.comboboxState, + data.activationTrigger, + /* We also want to trigger this when the position of the active item changes so that we can re-trigger the scrollIntoView */ + data.activeOptionIndex + ]); + let handleClick = useEvent((event) => { + if (disabled) + return event.preventDefault(); + select(); + if (data.mode === 0 /* Single */) { + actions.closeCombobox(); + } + if (!isMobile()) { + requestAnimationFrame(() => { + var _a4; + return (_a4 = data.inputRef.current) == null ? void 0 : _a4.focus(); + }); + } + }); + let handleFocus = useEvent(() => { + if (disabled) + return actions.goToOption(5 /* Nothing */); + actions.goToOption(4 /* Specific */, id); + }); + let pointer = useTrackedPointer(); + let handleEnter = useEvent((evt) => pointer.update(evt)); + let handleMove = useEvent((evt) => { + if (!pointer.wasMoved(evt)) + return; + if (disabled) + return; + if (active) + return; + actions.goToOption(4 /* Specific */, id, 0 /* Pointer */); + }); + let handleLeave = useEvent((evt) => { + if (!pointer.wasMoved(evt)) + return; + if (disabled) + return; + if (!active) + return; + if (data.optionsPropsRef.current.hold) + return; + actions.goToOption(5 /* Nothing */); + }); + let slot = (0, import_react19.useMemo)( + () => ({ active, selected, disabled }), + [active, selected, disabled] + ); + let ourProps = { + id, + ref: optionRef, + role: "option", + tabIndex: disabled === true ? void 0 : -1, + "aria-disabled": disabled === true ? true : void 0, + // According to the WAI-ARIA best practices, we should use aria-checked for + // multi-select,but Voice-Over disagrees. So we use aria-checked instead for + // both single and multi-select. + "aria-selected": selected, + disabled: void 0, + // Never forward the `disabled` prop + onClick: handleClick, + onFocus: handleFocus, + onPointerEnter: handleEnter, + onMouseEnter: handleEnter, + onPointerMove: handleMove, + onMouseMove: handleMove, + onPointerLeave: handleLeave, + onMouseLeave: handleLeave + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_OPTION_TAG, + name: "Combobox.Option" + }); +} +var ComboboxRoot = forwardRefWithAs(ComboboxFn); +var Button = forwardRefWithAs(ButtonFn); +var Input = forwardRefWithAs(InputFn); +var Label = forwardRefWithAs(LabelFn); +var Options = forwardRefWithAs(OptionsFn); +var Option = forwardRefWithAs(OptionFn); +var Combobox = Object.assign(ComboboxRoot, { Input, Button, Label, Options, Option }); + +// src/components/dialog/dialog.tsx +var import_react31 = __toESM(__webpack_require__(/*! react */ "react"), 1); + +// src/components/focus-trap/focus-trap.tsx +var import_react25 = __toESM(__webpack_require__(/*! react */ "react"), 1); + +// src/hooks/use-tab-direction.ts +var import_react20 = __webpack_require__(/*! react */ "react"); +function useTabDirection() { + let direction = (0, import_react20.useRef)(0 /* Forwards */); + useWindowEvent( + "keydown", + (event) => { + if (event.key === "Tab") { + direction.current = event.shiftKey ? 1 /* Backwards */ : 0 /* Forwards */; + } + }, + true + ); + return direction; +} + +// src/hooks/use-is-mounted.ts +var import_react21 = __webpack_require__(/*! react */ "react"); +function useIsMounted() { + let mounted = (0, import_react21.useRef)(false); + useIsoMorphicEffect(() => { + mounted.current = true; + return () => { + mounted.current = false; + }; + }, []); + return mounted; +} + +// src/hooks/use-owner.ts +var import_react22 = __webpack_require__(/*! react */ "react"); +function useOwnerDocument(...args) { + return (0, import_react22.useMemo)(() => getOwnerDocument(...args), [...args]); +} + +// src/hooks/use-event-listener.ts +var import_react23 = __webpack_require__(/*! react */ "react"); +function useEventListener(element, type, listener, options) { + let listenerRef = useLatestValue(listener); + (0, import_react23.useEffect)(() => { + element = element != null ? element : window; + function handler(event) { + listenerRef.current(event); + } + element.addEventListener(type, handler, options); + return () => element.removeEventListener(type, handler, options); + }, [element, type, options]); +} + +// src/utils/document-ready.ts +function onDocumentReady(cb) { + function check() { + if (document.readyState === "loading") + return; + cb(); + document.removeEventListener("DOMContentLoaded", check); + } + if (typeof window !== "undefined" && typeof document !== "undefined") { + document.addEventListener("DOMContentLoaded", check); + check(); + } +} + +// src/hooks/use-on-unmount.ts +var import_react24 = __webpack_require__(/*! react */ "react"); +function useOnUnmount(cb) { + let stableCb = useEvent(cb); + let trulyUnmounted = (0, import_react24.useRef)(false); + (0, import_react24.useEffect)(() => { + trulyUnmounted.current = false; + return () => { + trulyUnmounted.current = true; + microTask(() => { + if (!trulyUnmounted.current) + return; + stableCb(); + }); + }; + }, [stableCb]); +} + +// src/components/focus-trap/focus-trap.tsx +function resolveContainers(containers) { + if (!containers) + return /* @__PURE__ */ new Set(); + if (typeof containers === "function") + return new Set(containers()); + let all = /* @__PURE__ */ new Set(); + for (let container of containers.current) { + if (container.current instanceof HTMLElement) { + all.add(container.current); + } + } + return all; +} +var DEFAULT_FOCUS_TRAP_TAG = "div"; +var Features3 = /* @__PURE__ */ ((Features4) => { + Features4[Features4["None"] = 1] = "None"; + Features4[Features4["InitialFocus"] = 2] = "InitialFocus"; + Features4[Features4["TabLock"] = 4] = "TabLock"; + Features4[Features4["FocusLock"] = 8] = "FocusLock"; + Features4[Features4["RestoreFocus"] = 16] = "RestoreFocus"; + Features4[Features4["All"] = 30] = "All"; + return Features4; +})(Features3 || {}); +function FocusTrapFn(props, ref) { + let container = (0, import_react25.useRef)(null); + let focusTrapRef = useSyncRefs(container, ref); + let { initialFocus, containers, features = 30 /* All */, ...theirProps } = props; + if (!useServerHandoffComplete()) { + features = 1 /* None */; + } + let ownerDocument = useOwnerDocument(container); + useRestoreFocus({ ownerDocument }, Boolean(features & 16 /* RestoreFocus */)); + let previousActiveElement = useInitialFocus( + { ownerDocument, container, initialFocus }, + Boolean(features & 2 /* InitialFocus */) + ); + useFocusLock( + { ownerDocument, container, containers, previousActiveElement }, + Boolean(features & 8 /* FocusLock */) + ); + let direction = useTabDirection(); + let handleFocus = useEvent((e) => { + let el = container.current; + if (!el) + return; + let wrapper = false ? 0 : (cb) => cb(); + wrapper(() => { + match(direction.current, { + [0 /* Forwards */]: () => { + focusIn(el, 1 /* First */, { skipElements: [e.relatedTarget] }); + }, + [1 /* Backwards */]: () => { + focusIn(el, 8 /* Last */, { skipElements: [e.relatedTarget] }); + } + }); + }); + }); + let d = useDisposables(); + let recentlyUsedTabKey = (0, import_react25.useRef)(false); + let ourProps = { + ref: focusTrapRef, + onKeyDown(e) { + if (e.key == "Tab") { + recentlyUsedTabKey.current = true; + d.requestAnimationFrame(() => { + recentlyUsedTabKey.current = false; + }); + } + }, + onBlur(e) { + let allContainers = resolveContainers(containers); + if (container.current instanceof HTMLElement) + allContainers.add(container.current); + let relatedTarget = e.relatedTarget; + if (!(relatedTarget instanceof HTMLElement)) + return; + if (relatedTarget.dataset.headlessuiFocusGuard === "true") { + return; + } + if (!contains(allContainers, relatedTarget)) { + if (recentlyUsedTabKey.current) { + focusIn( + container.current, + match(direction.current, { + [0 /* Forwards */]: () => 4 /* Next */, + [1 /* Backwards */]: () => 2 /* Previous */ + }) | 16 /* WrapAround */, + { relativeTo: e.target } + ); + } else if (e.target instanceof HTMLElement) { + focusElement(e.target); + } + } + } + }; + return /* @__PURE__ */ import_react25.default.createElement(import_react25.default.Fragment, null, Boolean(features & 4 /* TabLock */) && /* @__PURE__ */ import_react25.default.createElement( + Hidden, + { + as: "button", + type: "button", + "data-headlessui-focus-guard": true, + onFocus: handleFocus, + features: 2 /* Focusable */ + } + ), render({ + ourProps, + theirProps, + defaultTag: DEFAULT_FOCUS_TRAP_TAG, + name: "FocusTrap" + }), Boolean(features & 4 /* TabLock */) && /* @__PURE__ */ import_react25.default.createElement( + Hidden, + { + as: "button", + type: "button", + "data-headlessui-focus-guard": true, + onFocus: handleFocus, + features: 2 /* Focusable */ + } + )); +} +var FocusTrapRoot = forwardRefWithAs(FocusTrapFn); +var FocusTrap = Object.assign(FocusTrapRoot, { + features: Features3 +}); +var history = []; +onDocumentReady(() => { + function handle(e) { + if (!(e.target instanceof HTMLElement)) + return; + if (e.target === document.body) + return; + if (history[0] === e.target) + return; + history.unshift(e.target); + history = history.filter((x) => x != null && x.isConnected); + history.splice(10); + } + window.addEventListener("click", handle, { capture: true }); + window.addEventListener("mousedown", handle, { capture: true }); + window.addEventListener("focus", handle, { capture: true }); + document.body.addEventListener("click", handle, { capture: true }); + document.body.addEventListener("mousedown", handle, { capture: true }); + document.body.addEventListener("focus", handle, { capture: true }); +}); +function useRestoreElement(enabled = true) { + let localHistory = (0, import_react25.useRef)(history.slice()); + useWatch( + ([newEnabled], [oldEnabled]) => { + if (oldEnabled === true && newEnabled === false) { + microTask(() => { + localHistory.current.splice(0); + }); + } + if (oldEnabled === false && newEnabled === true) { + localHistory.current = history.slice(); + } + }, + [enabled, history, localHistory] + ); + return useEvent(() => { + var _a3; + return (_a3 = localHistory.current.find((x) => x != null && x.isConnected)) != null ? _a3 : null; + }); +} +function useRestoreFocus({ ownerDocument }, enabled) { + let getRestoreElement = useRestoreElement(enabled); + useWatch(() => { + if (enabled) + return; + if ((ownerDocument == null ? void 0 : ownerDocument.activeElement) === (ownerDocument == null ? void 0 : ownerDocument.body)) { + focusElement(getRestoreElement()); + } + }, [enabled]); + useOnUnmount(() => { + if (!enabled) + return; + focusElement(getRestoreElement()); + }); +} +function useInitialFocus({ + ownerDocument, + container, + initialFocus +}, enabled) { + let previousActiveElement = (0, import_react25.useRef)(null); + let mounted = useIsMounted(); + useWatch(() => { + if (!enabled) + return; + let containerElement = container.current; + if (!containerElement) + return; + microTask(() => { + if (!mounted.current) { + return; + } + let activeElement = ownerDocument == null ? void 0 : ownerDocument.activeElement; + if (initialFocus == null ? void 0 : initialFocus.current) { + if ((initialFocus == null ? void 0 : initialFocus.current) === activeElement) { + previousActiveElement.current = activeElement; + return; + } + } else if (containerElement.contains(activeElement)) { + previousActiveElement.current = activeElement; + return; + } + if (initialFocus == null ? void 0 : initialFocus.current) { + focusElement(initialFocus.current); + } else { + if (focusIn(containerElement, 1 /* First */) === 0 /* Error */) { + console.warn("There are no focusable elements inside the "); + } + } + previousActiveElement.current = ownerDocument == null ? void 0 : ownerDocument.activeElement; + }); + }, [enabled]); + return previousActiveElement; +} +function useFocusLock({ + ownerDocument, + container, + containers, + previousActiveElement +}, enabled) { + let mounted = useIsMounted(); + useEventListener( + ownerDocument == null ? void 0 : ownerDocument.defaultView, + "focus", + (event) => { + if (!enabled) + return; + if (!mounted.current) + return; + let allContainers = resolveContainers(containers); + if (container.current instanceof HTMLElement) + allContainers.add(container.current); + let previous = previousActiveElement.current; + if (!previous) + return; + let toElement = event.target; + if (toElement && toElement instanceof HTMLElement) { + if (!contains(allContainers, toElement)) { + event.preventDefault(); + event.stopPropagation(); + focusElement(previous); + } else { + previousActiveElement.current = toElement; + focusElement(toElement); + } + } else { + focusElement(previousActiveElement.current); + } + }, + true + ); +} +function contains(containers, element) { + for (let container of containers) { + if (container.contains(element)) + return true; + } + return false; +} + +// src/components/portal/portal.tsx +var import_react27 = __toESM(__webpack_require__(/*! react */ "react"), 1); +var import_react_dom = __webpack_require__(/*! react-dom */ "react-dom"); + +// src/internal/portal-force-root.tsx +var import_react26 = __toESM(__webpack_require__(/*! react */ "react"), 1); +var ForcePortalRootContext = (0, import_react26.createContext)(false); +function usePortalRoot() { + return (0, import_react26.useContext)(ForcePortalRootContext); +} +function ForcePortalRoot(props) { + return /* @__PURE__ */ import_react26.default.createElement(ForcePortalRootContext.Provider, { value: props.force }, props.children); +} + +// src/components/portal/portal.tsx +function usePortalTarget(ref) { + let forceInRoot = usePortalRoot(); + let groupTarget = (0, import_react27.useContext)(PortalGroupContext); + let ownerDocument = useOwnerDocument(ref); + let [target, setTarget] = (0, import_react27.useState)(() => { + if (!forceInRoot && groupTarget !== null) + return null; + if (env.isServer) + return null; + let existingRoot = ownerDocument == null ? void 0 : ownerDocument.getElementById("headlessui-portal-root"); + if (existingRoot) + return existingRoot; + if (ownerDocument === null) + return null; + let root = ownerDocument.createElement("div"); + root.setAttribute("id", "headlessui-portal-root"); + return ownerDocument.body.appendChild(root); + }); + (0, import_react27.useEffect)(() => { + if (target === null) + return; + if (!(ownerDocument == null ? void 0 : ownerDocument.body.contains(target))) { + ownerDocument == null ? void 0 : ownerDocument.body.appendChild(target); + } + }, [target, ownerDocument]); + (0, import_react27.useEffect)(() => { + if (forceInRoot) + return; + if (groupTarget === null) + return; + setTarget(groupTarget.current); + }, [groupTarget, setTarget, forceInRoot]); + return target; +} +var DEFAULT_PORTAL_TAG = import_react27.Fragment; +function PortalFn(props, ref) { + let theirProps = props; + let internalPortalRootRef = (0, import_react27.useRef)(null); + let portalRef = useSyncRefs( + optionalRef((ref2) => { + internalPortalRootRef.current = ref2; + }), + ref + ); + let ownerDocument = useOwnerDocument(internalPortalRootRef); + let target = usePortalTarget(internalPortalRootRef); + let [element] = (0, import_react27.useState)( + () => { + var _a3; + return env.isServer ? null : (_a3 = ownerDocument == null ? void 0 : ownerDocument.createElement("div")) != null ? _a3 : null; + } + ); + let parent = (0, import_react27.useContext)(PortalParentContext); + let ready = useServerHandoffComplete(); + useIsoMorphicEffect(() => { + if (!target || !element) + return; + if (!target.contains(element)) { + element.setAttribute("data-headlessui-portal", ""); + target.appendChild(element); + } + }, [target, element]); + useIsoMorphicEffect(() => { + if (!element) + return; + if (!parent) + return; + return parent.register(element); + }, [parent, element]); + useOnUnmount(() => { + var _a3; + if (!target || !element) + return; + if (element instanceof Node && target.contains(element)) { + target.removeChild(element); + } + if (target.childNodes.length <= 0) { + (_a3 = target.parentElement) == null ? void 0 : _a3.removeChild(target); + } + }); + if (!ready) + return null; + let ourProps = { ref: portalRef }; + return !target || !element ? null : (0, import_react_dom.createPortal)( + render({ + ourProps, + theirProps, + defaultTag: DEFAULT_PORTAL_TAG, + name: "Portal" + }), + element + ); +} +var DEFAULT_GROUP_TAG = import_react27.Fragment; +var PortalGroupContext = (0, import_react27.createContext)(null); +function GroupFn(props, ref) { + let { target, ...theirProps } = props; + let groupRef = useSyncRefs(ref); + let ourProps = { ref: groupRef }; + return /* @__PURE__ */ import_react27.default.createElement(PortalGroupContext.Provider, { value: target }, render({ + ourProps, + theirProps, + defaultTag: DEFAULT_GROUP_TAG, + name: "Popover.Group" + })); +} +var PortalParentContext = (0, import_react27.createContext)(null); +function useNestedPortals() { + let parent = (0, import_react27.useContext)(PortalParentContext); + let portals = (0, import_react27.useRef)([]); + let register = useEvent((portal) => { + portals.current.push(portal); + if (parent) + parent.register(portal); + return () => unregister(portal); + }); + let unregister = useEvent((portal) => { + let idx = portals.current.indexOf(portal); + if (idx !== -1) + portals.current.splice(idx, 1); + if (parent) + parent.unregister(portal); + }); + let api = (0, import_react27.useMemo)( + () => ({ register, unregister, portals }), + [register, unregister, portals] + ); + return [ + portals, + (0, import_react27.useMemo)(() => { + return function PortalWrapper({ children }) { + return /* @__PURE__ */ import_react27.default.createElement(PortalParentContext.Provider, { value: api }, children); + }; + }, [api]) + ]; +} +var PortalRoot = forwardRefWithAs(PortalFn); +var Group = forwardRefWithAs(GroupFn); +var Portal = Object.assign(PortalRoot, { Group }); + +// src/components/description/description.tsx +var import_react28 = __toESM(__webpack_require__(/*! react */ "react"), 1); +var DescriptionContext = (0, import_react28.createContext)(null); +function useDescriptionContext() { + let context = (0, import_react28.useContext)(DescriptionContext); + if (context === null) { + let err = new Error( + "You used a component, but it is not inside a relevant parent." + ); + if (Error.captureStackTrace) + Error.captureStackTrace(err, useDescriptionContext); + throw err; + } + return context; +} +function useDescriptions() { + let [descriptionIds, setDescriptionIds] = (0, import_react28.useState)([]); + return [ + // The actual id's as string or undefined + descriptionIds.length > 0 ? descriptionIds.join(" ") : void 0, + // The provider component + (0, import_react28.useMemo)(() => { + return function DescriptionProvider(props) { + let register = useEvent((value) => { + setDescriptionIds((existing) => [...existing, value]); + return () => setDescriptionIds((existing) => { + let clone = existing.slice(); + let idx = clone.indexOf(value); + if (idx !== -1) + clone.splice(idx, 1); + return clone; + }); + }); + let contextBag = (0, import_react28.useMemo)( + () => ({ register, slot: props.slot, name: props.name, props: props.props }), + [register, props.slot, props.name, props.props] + ); + return /* @__PURE__ */ import_react28.default.createElement(DescriptionContext.Provider, { value: contextBag }, props.children); + }; + }, [setDescriptionIds]) + ]; +} +var DEFAULT_DESCRIPTION_TAG = "p"; +function DescriptionFn(props, ref) { + let internalId = useId(); + let { id = `headlessui-description-${internalId}`, ...theirProps } = props; + let context = useDescriptionContext(); + let descriptionRef = useSyncRefs(ref); + useIsoMorphicEffect(() => context.register(id), [id, context.register]); + let ourProps = { ref: descriptionRef, ...context.props, id }; + return render({ + ourProps, + theirProps, + slot: context.slot || {}, + defaultTag: DEFAULT_DESCRIPTION_TAG, + name: context.name || "Description" + }); +} +var DescriptionRoot = forwardRefWithAs(DescriptionFn); +var Description = Object.assign(DescriptionRoot, { + // +}); + +// src/internal/stack-context.tsx +var import_react29 = __toESM(__webpack_require__(/*! react */ "react"), 1); +var StackContext = (0, import_react29.createContext)(() => { +}); +StackContext.displayName = "StackContext"; +function useStackContext() { + return (0, import_react29.useContext)(StackContext); +} +function StackProvider({ + children, + onUpdate, + type, + element, + enabled +}) { + let parentUpdate = useStackContext(); + let notify = useEvent((...args) => { + onUpdate == null ? void 0 : onUpdate(...args); + parentUpdate(...args); + }); + useIsoMorphicEffect(() => { + let shouldNotify = enabled === void 0 || enabled === true; + shouldNotify && notify(0 /* Add */, type, element); + return () => { + shouldNotify && notify(1 /* Remove */, type, element); + }; + }, [notify, type, element, enabled]); + return /* @__PURE__ */ import_react29.default.createElement(StackContext.Provider, { value: notify }, children); +} + +// src/use-sync-external-store-shim/index.ts +var React11 = __toESM(__webpack_require__(/*! react */ "react"), 1); + +// src/use-sync-external-store-shim/useSyncExternalStoreShimClient.ts +var React10 = __toESM(__webpack_require__(/*! react */ "react"), 1); +function isPolyfill(x, y) { + return x === y && (x !== 0 || 1 / x === 1 / y) || x !== x && y !== y; +} +var is = typeof Object.is === "function" ? Object.is : isPolyfill; +var { useState: useState8, useEffect: useEffect14, useLayoutEffect: useLayoutEffect2, useDebugValue } = React10; +var didWarnOld18Alpha = false; +var didWarnUncachedGetSnapshot = false; +function useSyncExternalStore(subscribe, getSnapshot, getServerSnapshot) { + if (true) { + if (!didWarnOld18Alpha) { + if ("startTransition" in React10) { + didWarnOld18Alpha = true; + console.error( + "You are using an outdated, pre-release alpha of React 18 that does not support useSyncExternalStore. The use-sync-external-store shim will not work correctly. Upgrade to a newer pre-release." + ); + } + } + } + const value = getSnapshot(); + if (true) { + if (!didWarnUncachedGetSnapshot) { + const cachedValue = getSnapshot(); + if (!is(value, cachedValue)) { + console.error("The result of getSnapshot should be cached to avoid an infinite loop"); + didWarnUncachedGetSnapshot = true; + } + } + } + const [{ inst }, forceUpdate] = useState8({ inst: { value, getSnapshot } }); + useLayoutEffect2(() => { + inst.value = value; + inst.getSnapshot = getSnapshot; + if (checkIfSnapshotChanged(inst)) { + forceUpdate({ inst }); + } + }, [subscribe, value, getSnapshot]); + useEffect14(() => { + if (checkIfSnapshotChanged(inst)) { + forceUpdate({ inst }); + } + const handleStoreChange = () => { + if (checkIfSnapshotChanged(inst)) { + forceUpdate({ inst }); + } + }; + return subscribe(handleStoreChange); + }, [subscribe]); + useDebugValue(value); + return value; +} +function checkIfSnapshotChanged(inst) { + const latestGetSnapshot = inst.getSnapshot; + const prevValue = inst.value; + try { + const nextValue = latestGetSnapshot(); + return !is(prevValue, nextValue); + } catch (error) { + return true; + } +} + +// src/use-sync-external-store-shim/useSyncExternalStoreShimServer.ts +function useSyncExternalStore2(subscribe, getSnapshot, getServerSnapshot) { + return getSnapshot(); +} + +// src/use-sync-external-store-shim/index.ts +var canUseDOM = !!(typeof window !== "undefined" && typeof window.document !== "undefined" && typeof window.document.createElement !== "undefined"); +var isServerEnvironment = !canUseDOM; +var shim = isServerEnvironment ? useSyncExternalStore2 : useSyncExternalStore; +var useSyncExternalStore3 = "useSyncExternalStore" in React11 ? ((r) => r.useSyncExternalStore)(React11) : shim; + +// src/hooks/use-store.ts +function useStore(store) { + return useSyncExternalStore3(store.subscribe, store.getSnapshot, store.getSnapshot); +} + +// src/utils/store.ts +function createStore(initial, actions) { + let state = initial(); + let listeners = /* @__PURE__ */ new Set(); + return { + getSnapshot() { + return state; + }, + subscribe(onChange) { + listeners.add(onChange); + return () => listeners.delete(onChange); + }, + dispatch(key, ...args) { + let newState = actions[key].call(state, ...args); + if (newState) { + state = newState; + listeners.forEach((listener) => listener()); + } + } + }; +} + +// src/hooks/document-overflow/adjust-scrollbar-padding.ts +function adjustScrollbarPadding() { + let scrollbarWidthBefore; + return { + before({ doc }) { + var _a3; + let documentElement = doc.documentElement; + let ownerWindow = (_a3 = doc.defaultView) != null ? _a3 : window; + scrollbarWidthBefore = ownerWindow.innerWidth - documentElement.clientWidth; + }, + after({ doc, d }) { + let documentElement = doc.documentElement; + let scrollbarWidthAfter = documentElement.clientWidth - documentElement.offsetWidth; + let scrollbarWidth = scrollbarWidthBefore - scrollbarWidthAfter; + d.style(documentElement, "paddingRight", `${scrollbarWidth}px`); + } + }; +} + +// src/hooks/document-overflow/handle-ios-locking.ts +function handleIOSLocking() { + if (!isIOS()) { + return {}; + } + let scrollPosition; + return { + before() { + scrollPosition = window.pageYOffset; + }, + after({ doc, d, meta }) { + function inAllowedContainer(el) { + return meta.containers.flatMap((resolve) => resolve()).some((container) => container.contains(el)); + } + d.style(doc.body, "marginTop", `-${scrollPosition}px`); + window.scrollTo(0, 0); + let scrollToElement = null; + d.addEventListener( + doc, + "click", + (e) => { + if (!(e.target instanceof HTMLElement)) { + return; + } + try { + let anchor = e.target.closest("a"); + if (!anchor) + return; + let { hash } = new URL(anchor.href); + let el = doc.querySelector(hash); + if (el && !inAllowedContainer(el)) { + scrollToElement = el; + } + } catch (err) { + } + }, + true + ); + d.addEventListener( + doc, + "touchmove", + (e) => { + if (e.target instanceof HTMLElement && !inAllowedContainer(e.target)) { + e.preventDefault(); + } + }, + { passive: false } + ); + d.add(() => { + window.scrollTo(0, window.pageYOffset + scrollPosition); + if (scrollToElement && scrollToElement.isConnected) { + scrollToElement.scrollIntoView({ block: "nearest" }); + scrollToElement = null; + } + }); + } + }; +} + +// src/hooks/document-overflow/prevent-scroll.ts +function preventScroll() { + return { + before({ doc, d }) { + d.style(doc.documentElement, "overflow", "hidden"); + } + }; +} + +// src/hooks/document-overflow/overflow-store.ts +function buildMeta(fns) { + let tmp = {}; + for (let fn of fns) { + Object.assign(tmp, fn(tmp)); + } + return tmp; +} +var overflows = createStore(() => /* @__PURE__ */ new Map(), { + PUSH(doc, meta) { + var _a3; + let entry = (_a3 = this.get(doc)) != null ? _a3 : { + doc, + count: 0, + d: disposables(), + meta: /* @__PURE__ */ new Set() + }; + entry.count++; + entry.meta.add(meta); + this.set(doc, entry); + return this; + }, + POP(doc, meta) { + let entry = this.get(doc); + if (entry) { + entry.count--; + entry.meta.delete(meta); + } + return this; + }, + SCROLL_PREVENT({ doc, d, meta }) { + let ctx = { + doc, + d, + meta: buildMeta(meta) + }; + let steps = [ + handleIOSLocking(), + adjustScrollbarPadding(), + preventScroll() + ]; + steps.forEach(({ before }) => before == null ? void 0 : before(ctx)); + steps.forEach(({ after }) => after == null ? void 0 : after(ctx)); + }, + SCROLL_ALLOW({ d }) { + d.dispose(); + }, + TEARDOWN({ doc }) { + this.delete(doc); + } +}); +overflows.subscribe(() => { + let docs = overflows.getSnapshot(); + let styles = /* @__PURE__ */ new Map(); + for (let [doc] of docs) { + styles.set(doc, doc.documentElement.style.overflow); + } + for (let entry of docs.values()) { + let isHidden = styles.get(entry.doc) === "hidden"; + let isLocked = entry.count !== 0; + let willChange = isLocked && !isHidden || !isLocked && isHidden; + if (willChange) { + overflows.dispatch(entry.count > 0 ? "SCROLL_PREVENT" : "SCROLL_ALLOW", entry); + } + if (entry.count === 0) { + overflows.dispatch("TEARDOWN", entry); + } + } +}); + +// src/hooks/document-overflow/use-document-overflow.ts +function useDocumentOverflowLockedEffect(doc, shouldBeLocked, meta) { + let store = useStore(overflows); + let entry = doc ? store.get(doc) : void 0; + let locked = entry ? entry.count > 0 : false; + useIsoMorphicEffect(() => { + if (!doc || !shouldBeLocked) { + return; + } + overflows.dispatch("PUSH", doc, meta); + return () => overflows.dispatch("POP", doc, meta); + }, [shouldBeLocked, doc]); + return locked; +} + +// src/hooks/use-inert.tsx +var originals = /* @__PURE__ */ new Map(); +var counts = /* @__PURE__ */ new Map(); +function useInert(node, enabled = true) { + useIsoMorphicEffect(() => { + var _a3; + if (!enabled) + return; + let element = typeof node === "function" ? node() : node.current; + if (!element) + return; + function cleanup() { + var _a4; + if (!element) + return; + let count2 = (_a4 = counts.get(element)) != null ? _a4 : 1; + if (count2 === 1) + counts.delete(element); + else + counts.set(element, count2 - 1); + if (count2 !== 1) + return; + let original = originals.get(element); + if (!original) + return; + if (original["aria-hidden"] === null) + element.removeAttribute("aria-hidden"); + else + element.setAttribute("aria-hidden", original["aria-hidden"]); + element.inert = original.inert; + originals.delete(element); + } + let count = (_a3 = counts.get(element)) != null ? _a3 : 0; + counts.set(element, count + 1); + if (count !== 0) + return cleanup; + originals.set(element, { + "aria-hidden": element.getAttribute("aria-hidden"), + inert: element.inert + }); + element.setAttribute("aria-hidden", "true"); + element.inert = true; + return cleanup; + }, [node, enabled]); +} + +// src/hooks/use-root-containers.tsx +var import_react30 = __toESM(__webpack_require__(/*! react */ "react"), 1); +function useRootContainers({ + defaultContainers = [], + portals +} = {}) { + let mainTreeNodeRef = (0, import_react30.useRef)(null); + let ownerDocument = useOwnerDocument(mainTreeNodeRef); + let resolveContainers2 = useEvent(() => { + var _a3; + let containers = []; + for (let container of defaultContainers) { + if (container === null) + continue; + if (container instanceof HTMLElement) { + containers.push(container); + } else if ("current" in container && container.current instanceof HTMLElement) { + containers.push(container.current); + } + } + if (portals == null ? void 0 : portals.current) { + for (let portal of portals.current) { + containers.push(portal); + } + } + for (let container of (_a3 = ownerDocument == null ? void 0 : ownerDocument.querySelectorAll("html > *, body > *")) != null ? _a3 : []) { + if (container === document.body) + continue; + if (container === document.head) + continue; + if (!(container instanceof HTMLElement)) + continue; + if (container.id === "headlessui-portal-root") + continue; + if (container.contains(mainTreeNodeRef.current)) + continue; + if (containers.some((defaultContainer) => container.contains(defaultContainer))) + continue; + containers.push(container); + } + return containers; + }); + return { + resolveContainers: resolveContainers2, + contains: useEvent( + (element) => resolveContainers2().some((container) => container.contains(element)) + ), + mainTreeNodeRef, + MainTreeNode: (0, import_react30.useMemo)(() => { + return function MainTreeNode() { + return /* @__PURE__ */ import_react30.default.createElement(Hidden, { features: 4 /* Hidden */, ref: mainTreeNodeRef }); + }; + }, [mainTreeNodeRef]) + }; +} + +// src/components/dialog/dialog.tsx +var reducers2 = { + [0 /* SetTitleId */](state, action) { + if (state.titleId === action.id) + return state; + return { ...state, titleId: action.id }; + } +}; +var DialogContext = (0, import_react31.createContext)(null); +DialogContext.displayName = "DialogContext"; +function useDialogContext(component) { + let context = (0, import_react31.useContext)(DialogContext); + if (context === null) { + let err = new Error(`<${component} /> is missing a parent component.`); + if (Error.captureStackTrace) + Error.captureStackTrace(err, useDialogContext); + throw err; + } + return context; +} +function useScrollLock(ownerDocument, enabled, resolveAllowedContainers = () => [document.body]) { + useDocumentOverflowLockedEffect(ownerDocument, enabled, (meta) => { + var _a3; + return { + containers: [...(_a3 = meta.containers) != null ? _a3 : [], resolveAllowedContainers] + }; + }); +} +function stateReducer2(state, action) { + return match(action.type, reducers2, state, action); +} +var DEFAULT_DIALOG_TAG = "div"; +var DialogRenderFeatures = 1 /* RenderStrategy */ | 2 /* Static */; +function DialogFn(props, ref) { + var _a3; + let internalId = useId(); + let { + id = `headlessui-dialog-${internalId}`, + open, + onClose, + initialFocus, + __demoMode = false, + ...theirProps + } = props; + let [nestedDialogCount, setNestedDialogCount] = (0, import_react31.useState)(0); + let usesOpenClosedState = useOpenClosed(); + if (open === void 0 && usesOpenClosedState !== null) { + open = (usesOpenClosedState & 1 /* Open */) === 1 /* Open */; + } + let internalDialogRef = (0, import_react31.useRef)(null); + let dialogRef = useSyncRefs(internalDialogRef, ref); + let ownerDocument = useOwnerDocument(internalDialogRef); + let hasOpen = props.hasOwnProperty("open") || usesOpenClosedState !== null; + let hasOnClose = props.hasOwnProperty("onClose"); + if (!hasOpen && !hasOnClose) { + throw new Error( + `You have to provide an \`open\` and an \`onClose\` prop to the \`Dialog\` component.` + ); + } + if (!hasOpen) { + throw new Error( + `You provided an \`onClose\` prop to the \`Dialog\`, but forgot an \`open\` prop.` + ); + } + if (!hasOnClose) { + throw new Error( + `You provided an \`open\` prop to the \`Dialog\`, but forgot an \`onClose\` prop.` + ); + } + if (typeof open !== "boolean") { + throw new Error( + `You provided an \`open\` prop to the \`Dialog\`, but the value is not a boolean. Received: ${open}` + ); + } + if (typeof onClose !== "function") { + throw new Error( + `You provided an \`onClose\` prop to the \`Dialog\`, but the value is not a function. Received: ${onClose}` + ); + } + let dialogState = open ? 0 /* Open */ : 1 /* Closed */; + let [state, dispatch] = (0, import_react31.useReducer)(stateReducer2, { + titleId: null, + descriptionId: null, + panelRef: (0, import_react31.createRef)() + }); + let close = useEvent(() => onClose(false)); + let setTitleId = useEvent((id2) => dispatch({ type: 0 /* SetTitleId */, id: id2 })); + let ready = useServerHandoffComplete(); + let enabled = ready ? __demoMode ? false : dialogState === 0 /* Open */ : false; + let hasNestedDialogs = nestedDialogCount > 1; + let hasParentDialog = (0, import_react31.useContext)(DialogContext) !== null; + let [portals, PortalWrapper] = useNestedPortals(); + let { + resolveContainers: resolveRootContainers, + mainTreeNodeRef, + MainTreeNode + } = useRootContainers({ + portals, + defaultContainers: [(_a3 = state.panelRef.current) != null ? _a3 : internalDialogRef.current] + }); + let position = !hasNestedDialogs ? "leaf" : "parent"; + let isClosing = usesOpenClosedState !== null ? (usesOpenClosedState & 4 /* Closing */) === 4 /* Closing */ : false; + let inertOthersEnabled = (() => { + if (hasParentDialog) + return false; + if (isClosing) + return false; + return enabled; + })(); + let resolveRootOfMainTreeNode = (0, import_react31.useCallback)(() => { + var _a4, _b; + return (_b = Array.from((_a4 = ownerDocument == null ? void 0 : ownerDocument.querySelectorAll("body > *")) != null ? _a4 : []).find((root) => { + if (root.id === "headlessui-portal-root") + return false; + return root.contains(mainTreeNodeRef.current) && root instanceof HTMLElement; + })) != null ? _b : null; + }, [mainTreeNodeRef]); + useInert(resolveRootOfMainTreeNode, inertOthersEnabled); + let inertParentDialogs = (() => { + if (hasNestedDialogs) + return true; + return enabled; + })(); + let resolveRootOfParentDialog = (0, import_react31.useCallback)(() => { + var _a4, _b; + return (_b = Array.from((_a4 = ownerDocument == null ? void 0 : ownerDocument.querySelectorAll("[data-headlessui-portal]")) != null ? _a4 : []).find( + (root) => root.contains(mainTreeNodeRef.current) && root instanceof HTMLElement + )) != null ? _b : null; + }, [mainTreeNodeRef]); + useInert(resolveRootOfParentDialog, inertParentDialogs); + let outsideClickEnabled = (() => { + if (!enabled) + return false; + if (hasNestedDialogs) + return false; + return true; + })(); + useOutsideClick(resolveRootContainers, close, outsideClickEnabled); + let escapeToCloseEnabled = (() => { + if (hasNestedDialogs) + return false; + if (dialogState !== 0 /* Open */) + return false; + return true; + })(); + useEventListener(ownerDocument == null ? void 0 : ownerDocument.defaultView, "keydown", (event) => { + if (!escapeToCloseEnabled) + return; + if (event.defaultPrevented) + return; + if (event.key !== "Escape" /* Escape */) + return; + event.preventDefault(); + event.stopPropagation(); + close(); + }); + let scrollLockEnabled = (() => { + if (isClosing) + return false; + if (dialogState !== 0 /* Open */) + return false; + if (hasParentDialog) + return false; + return true; + })(); + useScrollLock(ownerDocument, scrollLockEnabled, resolveRootContainers); + (0, import_react31.useEffect)(() => { + if (dialogState !== 0 /* Open */) + return; + if (!internalDialogRef.current) + return; + let observer = new ResizeObserver((entries) => { + for (let entry of entries) { + let rect = entry.target.getBoundingClientRect(); + if (rect.x === 0 && rect.y === 0 && rect.width === 0 && rect.height === 0) { + close(); + } + } + }); + observer.observe(internalDialogRef.current); + return () => observer.disconnect(); + }, [dialogState, internalDialogRef, close]); + let [describedby, DescriptionProvider] = useDescriptions(); + let contextBag = (0, import_react31.useMemo)( + () => [{ dialogState, close, setTitleId }, state], + [dialogState, state, close, setTitleId] + ); + let slot = (0, import_react31.useMemo)( + () => ({ open: dialogState === 0 /* Open */ }), + [dialogState] + ); + let ourProps = { + ref: dialogRef, + id, + role: "dialog", + "aria-modal": dialogState === 0 /* Open */ ? true : void 0, + "aria-labelledby": state.titleId, + "aria-describedby": describedby + }; + return /* @__PURE__ */ import_react31.default.createElement( + StackProvider, + { + type: "Dialog", + enabled: dialogState === 0 /* Open */, + element: internalDialogRef, + onUpdate: useEvent((message, type) => { + if (type !== "Dialog") + return; + match(message, { + [0 /* Add */]: () => setNestedDialogCount((count) => count + 1), + [1 /* Remove */]: () => setNestedDialogCount((count) => count - 1) + }); + }) + }, + /* @__PURE__ */ import_react31.default.createElement(ForcePortalRoot, { force: true }, /* @__PURE__ */ import_react31.default.createElement(Portal, null, /* @__PURE__ */ import_react31.default.createElement(DialogContext.Provider, { value: contextBag }, /* @__PURE__ */ import_react31.default.createElement(Portal.Group, { target: internalDialogRef }, /* @__PURE__ */ import_react31.default.createElement(ForcePortalRoot, { force: false }, /* @__PURE__ */ import_react31.default.createElement(DescriptionProvider, { slot, name: "Dialog.Description" }, /* @__PURE__ */ import_react31.default.createElement( + FocusTrap, + { + initialFocus, + containers: resolveRootContainers, + features: enabled ? match(position, { + parent: FocusTrap.features.RestoreFocus, + leaf: FocusTrap.features.All & ~FocusTrap.features.FocusLock + }) : FocusTrap.features.None + }, + /* @__PURE__ */ import_react31.default.createElement(PortalWrapper, null, render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_DIALOG_TAG, + features: DialogRenderFeatures, + visible: dialogState === 0 /* Open */, + name: "Dialog" + })) + ))))))), + /* @__PURE__ */ import_react31.default.createElement(MainTreeNode, null) + ); +} +var DEFAULT_OVERLAY_TAG = "div"; +function OverlayFn(props, ref) { + let internalId = useId(); + let { id = `headlessui-dialog-overlay-${internalId}`, ...theirProps } = props; + let [{ dialogState, close }] = useDialogContext("Dialog.Overlay"); + let overlayRef = useSyncRefs(ref); + let handleClick = useEvent((event) => { + if (event.target !== event.currentTarget) + return; + if (isDisabledReactIssue7711(event.currentTarget)) + return event.preventDefault(); + event.preventDefault(); + event.stopPropagation(); + close(); + }); + let slot = (0, import_react31.useMemo)( + () => ({ open: dialogState === 0 /* Open */ }), + [dialogState] + ); + let ourProps = { + ref: overlayRef, + id, + "aria-hidden": true, + onClick: handleClick + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_OVERLAY_TAG, + name: "Dialog.Overlay" + }); +} +var DEFAULT_BACKDROP_TAG = "div"; +function BackdropFn(props, ref) { + let internalId = useId(); + let { id = `headlessui-dialog-backdrop-${internalId}`, ...theirProps } = props; + let [{ dialogState }, state] = useDialogContext("Dialog.Backdrop"); + let backdropRef = useSyncRefs(ref); + (0, import_react31.useEffect)(() => { + if (state.panelRef.current === null) { + throw new Error( + `A component is being used, but a component is missing.` + ); + } + }, [state.panelRef]); + let slot = (0, import_react31.useMemo)( + () => ({ open: dialogState === 0 /* Open */ }), + [dialogState] + ); + let ourProps = { + ref: backdropRef, + id, + "aria-hidden": true + }; + return /* @__PURE__ */ import_react31.default.createElement(ForcePortalRoot, { force: true }, /* @__PURE__ */ import_react31.default.createElement(Portal, null, render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_BACKDROP_TAG, + name: "Dialog.Backdrop" + }))); +} +var DEFAULT_PANEL_TAG = "div"; +function PanelFn(props, ref) { + let internalId = useId(); + let { id = `headlessui-dialog-panel-${internalId}`, ...theirProps } = props; + let [{ dialogState }, state] = useDialogContext("Dialog.Panel"); + let panelRef = useSyncRefs(ref, state.panelRef); + let slot = (0, import_react31.useMemo)( + () => ({ open: dialogState === 0 /* Open */ }), + [dialogState] + ); + let handleClick = useEvent((event) => { + event.stopPropagation(); + }); + let ourProps = { + ref: panelRef, + id, + onClick: handleClick + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_PANEL_TAG, + name: "Dialog.Panel" + }); +} +var DEFAULT_TITLE_TAG = "h2"; +function TitleFn(props, ref) { + let internalId = useId(); + let { id = `headlessui-dialog-title-${internalId}`, ...theirProps } = props; + let [{ dialogState, setTitleId }] = useDialogContext("Dialog.Title"); + let titleRef = useSyncRefs(ref); + (0, import_react31.useEffect)(() => { + setTitleId(id); + return () => setTitleId(null); + }, [id, setTitleId]); + let slot = (0, import_react31.useMemo)( + () => ({ open: dialogState === 0 /* Open */ }), + [dialogState] + ); + let ourProps = { ref: titleRef, id }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_TITLE_TAG, + name: "Dialog.Title" + }); +} +var DialogRoot = forwardRefWithAs(DialogFn); +var Backdrop = forwardRefWithAs(BackdropFn); +var Panel = forwardRefWithAs(PanelFn); +var Overlay = forwardRefWithAs(OverlayFn); +var Title = forwardRefWithAs(TitleFn); +var Dialog = Object.assign(DialogRoot, { + Backdrop, + Panel, + Overlay, + Title, + Description +}); + +// src/components/disclosure/disclosure.tsx +var import_react33 = __toESM(__webpack_require__(/*! react */ "react"), 1); + +// src/utils/start-transition.ts +var import_react32 = __toESM(__webpack_require__(/*! react */ "react"), 1); +var _a2; +var startTransition = ( + // Prefer React's `startTransition` if it's available. + // @ts-expect-error - `startTransition` doesn't exist in React < 18. + (_a2 = import_react32.default.startTransition) != null ? _a2 : function startTransition2(cb) { + cb(); + } +); + +// src/components/disclosure/disclosure.tsx +var reducers3 = { + [0 /* ToggleDisclosure */]: (state) => ({ + ...state, + disclosureState: match(state.disclosureState, { + [0 /* Open */]: 1 /* Closed */, + [1 /* Closed */]: 0 /* Open */ + }) + }), + [1 /* CloseDisclosure */]: (state) => { + if (state.disclosureState === 1 /* Closed */) + return state; + return { ...state, disclosureState: 1 /* Closed */ }; + }, + [4 /* LinkPanel */](state) { + if (state.linkedPanel === true) + return state; + return { ...state, linkedPanel: true }; + }, + [5 /* UnlinkPanel */](state) { + if (state.linkedPanel === false) + return state; + return { ...state, linkedPanel: false }; + }, + [2 /* SetButtonId */](state, action) { + if (state.buttonId === action.buttonId) + return state; + return { ...state, buttonId: action.buttonId }; + }, + [3 /* SetPanelId */](state, action) { + if (state.panelId === action.panelId) + return state; + return { ...state, panelId: action.panelId }; + } +}; +var DisclosureContext = (0, import_react33.createContext)(null); +DisclosureContext.displayName = "DisclosureContext"; +function useDisclosureContext(component) { + let context = (0, import_react33.useContext)(DisclosureContext); + if (context === null) { + let err = new Error(`<${component} /> is missing a parent component.`); + if (Error.captureStackTrace) + Error.captureStackTrace(err, useDisclosureContext); + throw err; + } + return context; +} +var DisclosureAPIContext = (0, import_react33.createContext)(null); +DisclosureAPIContext.displayName = "DisclosureAPIContext"; +function useDisclosureAPIContext(component) { + let context = (0, import_react33.useContext)(DisclosureAPIContext); + if (context === null) { + let err = new Error(`<${component} /> is missing a parent component.`); + if (Error.captureStackTrace) + Error.captureStackTrace(err, useDisclosureAPIContext); + throw err; + } + return context; +} +var DisclosurePanelContext = (0, import_react33.createContext)(null); +DisclosurePanelContext.displayName = "DisclosurePanelContext"; +function useDisclosurePanelContext() { + return (0, import_react33.useContext)(DisclosurePanelContext); +} +function stateReducer3(state, action) { + return match(action.type, reducers3, state, action); +} +var DEFAULT_DISCLOSURE_TAG = import_react33.Fragment; +function DisclosureFn(props, ref) { + let { defaultOpen = false, ...theirProps } = props; + let internalDisclosureRef = (0, import_react33.useRef)(null); + let disclosureRef = useSyncRefs( + ref, + optionalRef( + (ref2) => { + internalDisclosureRef.current = ref2; + }, + props.as === void 0 || // @ts-expect-error The `as` prop _can_ be a Fragment + props.as === import_react33.Fragment + ) + ); + let panelRef = (0, import_react33.useRef)(null); + let buttonRef = (0, import_react33.useRef)(null); + let reducerBag = (0, import_react33.useReducer)(stateReducer3, { + disclosureState: defaultOpen ? 0 /* Open */ : 1 /* Closed */, + linkedPanel: false, + buttonRef, + panelRef, + buttonId: null, + panelId: null + }); + let [{ disclosureState, buttonId }, dispatch] = reducerBag; + let close = useEvent((focusableElement) => { + dispatch({ type: 1 /* CloseDisclosure */ }); + let ownerDocument = getOwnerDocument(internalDisclosureRef); + if (!ownerDocument) + return; + if (!buttonId) + return; + let restoreElement = (() => { + if (!focusableElement) + return ownerDocument.getElementById(buttonId); + if (focusableElement instanceof HTMLElement) + return focusableElement; + if (focusableElement.current instanceof HTMLElement) + return focusableElement.current; + return ownerDocument.getElementById(buttonId); + })(); + restoreElement == null ? void 0 : restoreElement.focus(); + }); + let api = (0, import_react33.useMemo)(() => ({ close }), [close]); + let slot = (0, import_react33.useMemo)( + () => ({ open: disclosureState === 0 /* Open */, close }), + [disclosureState, close] + ); + let ourProps = { + ref: disclosureRef + }; + return /* @__PURE__ */ import_react33.default.createElement(DisclosureContext.Provider, { value: reducerBag }, /* @__PURE__ */ import_react33.default.createElement(DisclosureAPIContext.Provider, { value: api }, /* @__PURE__ */ import_react33.default.createElement( + OpenClosedProvider, + { + value: match(disclosureState, { + [0 /* Open */]: 1 /* Open */, + [1 /* Closed */]: 2 /* Closed */ + }) + }, + render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_DISCLOSURE_TAG, + name: "Disclosure" + }) + ))); +} +var DEFAULT_BUTTON_TAG2 = "button"; +function ButtonFn2(props, ref) { + let internalId = useId(); + let { id = `headlessui-disclosure-button-${internalId}`, ...theirProps } = props; + let [state, dispatch] = useDisclosureContext("Disclosure.Button"); + let panelContext = useDisclosurePanelContext(); + let isWithinPanel = panelContext === null ? false : panelContext === state.panelId; + let internalButtonRef = (0, import_react33.useRef)(null); + let buttonRef = useSyncRefs(internalButtonRef, ref, !isWithinPanel ? state.buttonRef : null); + (0, import_react33.useEffect)(() => { + if (isWithinPanel) + return; + dispatch({ type: 2 /* SetButtonId */, buttonId: id }); + return () => { + dispatch({ type: 2 /* SetButtonId */, buttonId: null }); + }; + }, [id, dispatch, isWithinPanel]); + let handleKeyDown = useEvent((event) => { + var _a3; + if (isWithinPanel) { + if (state.disclosureState === 1 /* Closed */) + return; + switch (event.key) { + case " " /* Space */: + case "Enter" /* Enter */: + event.preventDefault(); + event.stopPropagation(); + dispatch({ type: 0 /* ToggleDisclosure */ }); + (_a3 = state.buttonRef.current) == null ? void 0 : _a3.focus(); + break; + } + } else { + switch (event.key) { + case " " /* Space */: + case "Enter" /* Enter */: + event.preventDefault(); + event.stopPropagation(); + dispatch({ type: 0 /* ToggleDisclosure */ }); + break; + } + } + }); + let handleKeyUp = useEvent((event) => { + switch (event.key) { + case " " /* Space */: + event.preventDefault(); + break; + } + }); + let handleClick = useEvent((event) => { + var _a3; + if (isDisabledReactIssue7711(event.currentTarget)) + return; + if (props.disabled) + return; + if (isWithinPanel) { + dispatch({ type: 0 /* ToggleDisclosure */ }); + (_a3 = state.buttonRef.current) == null ? void 0 : _a3.focus(); + } else { + dispatch({ type: 0 /* ToggleDisclosure */ }); + } + }); + let slot = (0, import_react33.useMemo)( + () => ({ open: state.disclosureState === 0 /* Open */ }), + [state] + ); + let type = useResolveButtonType(props, internalButtonRef); + let ourProps = isWithinPanel ? { ref: buttonRef, type, onKeyDown: handleKeyDown, onClick: handleClick } : { + ref: buttonRef, + id, + type, + "aria-expanded": props.disabled ? void 0 : state.disclosureState === 0 /* Open */, + "aria-controls": state.linkedPanel ? state.panelId : void 0, + onKeyDown: handleKeyDown, + onKeyUp: handleKeyUp, + onClick: handleClick + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_BUTTON_TAG2, + name: "Disclosure.Button" + }); +} +var DEFAULT_PANEL_TAG2 = "div"; +var PanelRenderFeatures = 1 /* RenderStrategy */ | 2 /* Static */; +function PanelFn2(props, ref) { + let internalId = useId(); + let { id = `headlessui-disclosure-panel-${internalId}`, ...theirProps } = props; + let [state, dispatch] = useDisclosureContext("Disclosure.Panel"); + let { close } = useDisclosureAPIContext("Disclosure.Panel"); + let panelRef = useSyncRefs(ref, state.panelRef, (el) => { + startTransition(() => dispatch({ type: el ? 4 /* LinkPanel */ : 5 /* UnlinkPanel */ })); + }); + (0, import_react33.useEffect)(() => { + dispatch({ type: 3 /* SetPanelId */, panelId: id }); + return () => { + dispatch({ type: 3 /* SetPanelId */, panelId: null }); + }; + }, [id, dispatch]); + let usesOpenClosedState = useOpenClosed(); + let visible = (() => { + if (usesOpenClosedState !== null) { + return (usesOpenClosedState & 1 /* Open */) === 1 /* Open */; + } + return state.disclosureState === 0 /* Open */; + })(); + let slot = (0, import_react33.useMemo)( + () => ({ open: state.disclosureState === 0 /* Open */, close }), + [state, close] + ); + let ourProps = { + ref: panelRef, + id + }; + return /* @__PURE__ */ import_react33.default.createElement(DisclosurePanelContext.Provider, { value: state.panelId }, render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_PANEL_TAG2, + features: PanelRenderFeatures, + visible, + name: "Disclosure.Panel" + })); +} +var DisclosureRoot = forwardRefWithAs(DisclosureFn); +var Button2 = forwardRefWithAs(ButtonFn2); +var Panel2 = forwardRefWithAs(PanelFn2); +var Disclosure = Object.assign(DisclosureRoot, { Button: Button2, Panel: Panel2 }); + +// src/components/listbox/listbox.tsx +var import_react35 = __toESM(__webpack_require__(/*! react */ "react"), 1); + +// src/hooks/use-text-value.ts +var import_react34 = __webpack_require__(/*! react */ "react"); + +// src/utils/get-text-value.ts +var emojiRegex = /([\u2700-\u27BF]|[\uE000-\uF8FF]|\uD83C[\uDC00-\uDFFF]|\uD83D[\uDC00-\uDFFF]|[\u2011-\u26FF]|\uD83E[\uDD10-\uDDFF])/g; +function getTextContents(element) { + var _a3, _b; + let currentInnerText = (_a3 = element.innerText) != null ? _a3 : ""; + let copy = element.cloneNode(true); + if (!(copy instanceof HTMLElement)) { + return currentInnerText; + } + let dropped = false; + for (let child of copy.querySelectorAll('[hidden],[aria-hidden],[role="img"]')) { + child.remove(); + dropped = true; + } + let value = dropped ? (_b = copy.innerText) != null ? _b : "" : currentInnerText; + if (emojiRegex.test(value)) { + value = value.replace(emojiRegex, ""); + } + return value; +} +function getTextValue(element) { + let label = element.getAttribute("aria-label"); + if (typeof label === "string") + return label.trim(); + let labelledby = element.getAttribute("aria-labelledby"); + if (labelledby) { + let labels = labelledby.split(" ").map((labelledby2) => { + let labelEl = document.getElementById(labelledby2); + if (labelEl) { + let label2 = labelEl.getAttribute("aria-label"); + if (typeof label2 === "string") + return label2.trim(); + return getTextContents(labelEl).trim(); + } + return null; + }).filter(Boolean); + if (labels.length > 0) + return labels.join(", "); + } + return getTextContents(element).trim(); +} + +// src/hooks/use-text-value.ts +function useTextValue(element) { + let cacheKey = (0, import_react34.useRef)(""); + let cacheValue = (0, import_react34.useRef)(""); + return useEvent(() => { + let el = element.current; + if (!el) + return ""; + let currentKey = el.innerText; + if (cacheKey.current === currentKey) { + return cacheValue.current; + } + let value = getTextValue(el).trim().toLowerCase(); + cacheKey.current = currentKey; + cacheValue.current = value; + return value; + }); +} + +// src/components/listbox/listbox.tsx +function adjustOrderedState2(state, adjustment = (i) => i) { + let currentActiveOption = state.activeOptionIndex !== null ? state.options[state.activeOptionIndex] : null; + let sortedOptions = sortByDomNode( + adjustment(state.options.slice()), + (option) => option.dataRef.current.domRef.current + ); + let adjustedActiveOptionIndex = currentActiveOption ? sortedOptions.indexOf(currentActiveOption) : null; + if (adjustedActiveOptionIndex === -1) { + adjustedActiveOptionIndex = null; + } + return { + options: sortedOptions, + activeOptionIndex: adjustedActiveOptionIndex + }; +} +var reducers4 = { + [1 /* CloseListbox */](state) { + if (state.dataRef.current.disabled) + return state; + if (state.listboxState === 1 /* Closed */) + return state; + return { ...state, activeOptionIndex: null, listboxState: 1 /* Closed */ }; + }, + [0 /* OpenListbox */](state) { + if (state.dataRef.current.disabled) + return state; + if (state.listboxState === 0 /* Open */) + return state; + let activeOptionIndex = state.activeOptionIndex; + let { isSelected } = state.dataRef.current; + let optionIdx = state.options.findIndex((option) => isSelected(option.dataRef.current.value)); + if (optionIdx !== -1) { + activeOptionIndex = optionIdx; + } + return { ...state, listboxState: 0 /* Open */, activeOptionIndex }; + }, + [2 /* GoToOption */](state, action) { + var _a3; + if (state.dataRef.current.disabled) + return state; + if (state.listboxState === 1 /* Closed */) + return state; + let adjustedState = adjustOrderedState2(state); + let activeOptionIndex = calculateActiveIndex(action, { + resolveItems: () => adjustedState.options, + resolveActiveIndex: () => adjustedState.activeOptionIndex, + resolveId: (option) => option.id, + resolveDisabled: (option) => option.dataRef.current.disabled + }); + return { + ...state, + ...adjustedState, + searchQuery: "", + activeOptionIndex, + activationTrigger: (_a3 = action.trigger) != null ? _a3 : 1 /* Other */ + }; + }, + [3 /* Search */]: (state, action) => { + if (state.dataRef.current.disabled) + return state; + if (state.listboxState === 1 /* Closed */) + return state; + let wasAlreadySearching = state.searchQuery !== ""; + let offset = wasAlreadySearching ? 0 : 1; + let searchQuery = state.searchQuery + action.value.toLowerCase(); + let reOrderedOptions = state.activeOptionIndex !== null ? state.options.slice(state.activeOptionIndex + offset).concat(state.options.slice(0, state.activeOptionIndex + offset)) : state.options; + let matchingOption = reOrderedOptions.find( + (option) => { + var _a3; + return !option.dataRef.current.disabled && ((_a3 = option.dataRef.current.textValue) == null ? void 0 : _a3.startsWith(searchQuery)); + } + ); + let matchIdx = matchingOption ? state.options.indexOf(matchingOption) : -1; + if (matchIdx === -1 || matchIdx === state.activeOptionIndex) + return { ...state, searchQuery }; + return { + ...state, + searchQuery, + activeOptionIndex: matchIdx, + activationTrigger: 1 /* Other */ + }; + }, + [4 /* ClearSearch */](state) { + if (state.dataRef.current.disabled) + return state; + if (state.listboxState === 1 /* Closed */) + return state; + if (state.searchQuery === "") + return state; + return { ...state, searchQuery: "" }; + }, + [5 /* RegisterOption */]: (state, action) => { + let option = { id: action.id, dataRef: action.dataRef }; + let adjustedState = adjustOrderedState2(state, (options) => [...options, option]); + if (state.activeOptionIndex === null) { + if (state.dataRef.current.isSelected(action.dataRef.current.value)) { + adjustedState.activeOptionIndex = adjustedState.options.indexOf(option); + } + } + return { ...state, ...adjustedState }; + }, + [6 /* UnregisterOption */]: (state, action) => { + let adjustedState = adjustOrderedState2(state, (options) => { + let idx = options.findIndex((a) => a.id === action.id); + if (idx !== -1) + options.splice(idx, 1); + return options; + }); + return { + ...state, + ...adjustedState, + activationTrigger: 1 /* Other */ + }; + }, + [7 /* RegisterLabel */]: (state, action) => { + return { + ...state, + labelId: action.id + }; + } +}; +var ListboxActionsContext = (0, import_react35.createContext)(null); +ListboxActionsContext.displayName = "ListboxActionsContext"; +function useActions2(component) { + let context = (0, import_react35.useContext)(ListboxActionsContext); + if (context === null) { + let err = new Error(`<${component} /> is missing a parent component.`); + if (Error.captureStackTrace) + Error.captureStackTrace(err, useActions2); + throw err; + } + return context; +} +var ListboxDataContext = (0, import_react35.createContext)(null); +ListboxDataContext.displayName = "ListboxDataContext"; +function useData2(component) { + let context = (0, import_react35.useContext)(ListboxDataContext); + if (context === null) { + let err = new Error(`<${component} /> is missing a parent component.`); + if (Error.captureStackTrace) + Error.captureStackTrace(err, useData2); + throw err; + } + return context; +} +function stateReducer4(state, action) { + return match(action.type, reducers4, state, action); +} +var DEFAULT_LISTBOX_TAG = import_react35.Fragment; +function ListboxFn(props, ref) { + let { + value: controlledValue, + defaultValue, + form: formName, + name, + onChange: controlledOnChange, + by = (a, z) => a === z, + disabled = false, + horizontal = false, + multiple = false, + ...theirProps + } = props; + const orientation = horizontal ? "horizontal" : "vertical"; + let listboxRef = useSyncRefs(ref); + let [value = multiple ? [] : void 0, theirOnChange] = useControllable( + controlledValue, + controlledOnChange, + defaultValue + ); + let [state, dispatch] = (0, import_react35.useReducer)(stateReducer4, { + dataRef: (0, import_react35.createRef)(), + listboxState: 1 /* Closed */, + options: [], + searchQuery: "", + labelId: null, + activeOptionIndex: null, + activationTrigger: 1 /* Other */ + }); + let optionsPropsRef = (0, import_react35.useRef)({ static: false, hold: false }); + let labelRef = (0, import_react35.useRef)(null); + let buttonRef = (0, import_react35.useRef)(null); + let optionsRef = (0, import_react35.useRef)(null); + let compare = useEvent( + typeof by === "string" ? (a, z) => { + let property = by; + return (a == null ? void 0 : a[property]) === (z == null ? void 0 : z[property]); + } : by + ); + let isSelected = (0, import_react35.useCallback)( + (compareValue) => match(data.mode, { + [1 /* Multi */]: () => value.some((option) => compare(option, compareValue)), + [0 /* Single */]: () => compare(value, compareValue) + }), + [value] + ); + let data = (0, import_react35.useMemo)( + () => ({ + ...state, + value, + disabled, + mode: multiple ? 1 /* Multi */ : 0 /* Single */, + orientation, + compare, + isSelected, + optionsPropsRef, + labelRef, + buttonRef, + optionsRef + }), + [value, disabled, multiple, state] + ); + useIsoMorphicEffect(() => { + state.dataRef.current = data; + }, [data]); + useOutsideClick( + [data.buttonRef, data.optionsRef], + (event, target) => { + var _a3; + dispatch({ type: 1 /* CloseListbox */ }); + if (!isFocusableElement(target, 1 /* Loose */)) { + event.preventDefault(); + (_a3 = data.buttonRef.current) == null ? void 0 : _a3.focus(); + } + }, + data.listboxState === 0 /* Open */ + ); + let slot = (0, import_react35.useMemo)( + () => ({ open: data.listboxState === 0 /* Open */, disabled, value }), + [data, disabled, value] + ); + let selectOption = useEvent((id) => { + let option = data.options.find((item) => item.id === id); + if (!option) + return; + onChange(option.dataRef.current.value); + }); + let selectActiveOption = useEvent(() => { + if (data.activeOptionIndex !== null) { + let { dataRef, id } = data.options[data.activeOptionIndex]; + onChange(dataRef.current.value); + dispatch({ type: 2 /* GoToOption */, focus: 4 /* Specific */, id }); + } + }); + let openListbox = useEvent(() => dispatch({ type: 0 /* OpenListbox */ })); + let closeListbox = useEvent(() => dispatch({ type: 1 /* CloseListbox */ })); + let goToOption = useEvent((focus, id, trigger) => { + if (focus === 4 /* Specific */) { + return dispatch({ type: 2 /* GoToOption */, focus: 4 /* Specific */, id, trigger }); + } + return dispatch({ type: 2 /* GoToOption */, focus, trigger }); + }); + let registerOption = useEvent((id, dataRef) => { + dispatch({ type: 5 /* RegisterOption */, id, dataRef }); + return () => dispatch({ type: 6 /* UnregisterOption */, id }); + }); + let registerLabel = useEvent((id) => { + dispatch({ type: 7 /* RegisterLabel */, id }); + return () => dispatch({ type: 7 /* RegisterLabel */, id: null }); + }); + let onChange = useEvent((value2) => { + return match(data.mode, { + [0 /* Single */]() { + return theirOnChange == null ? void 0 : theirOnChange(value2); + }, + [1 /* Multi */]() { + let copy = data.value.slice(); + let idx = copy.findIndex((item) => compare(item, value2)); + if (idx === -1) { + copy.push(value2); + } else { + copy.splice(idx, 1); + } + return theirOnChange == null ? void 0 : theirOnChange(copy); + } + }); + }); + let search = useEvent((value2) => dispatch({ type: 3 /* Search */, value: value2 })); + let clearSearch = useEvent(() => dispatch({ type: 4 /* ClearSearch */ })); + let actions = (0, import_react35.useMemo)( + () => ({ + onChange, + registerOption, + registerLabel, + goToOption, + closeListbox, + openListbox, + selectActiveOption, + selectOption, + search, + clearSearch + }), + [] + ); + let ourProps = { ref: listboxRef }; + let form = (0, import_react35.useRef)(null); + let d = useDisposables(); + (0, import_react35.useEffect)(() => { + if (!form.current) + return; + if (defaultValue === void 0) + return; + d.addEventListener(form.current, "reset", () => { + onChange(defaultValue); + }); + }, [ + form, + onChange + /* Explicitly ignoring `defaultValue` */ + ]); + return /* @__PURE__ */ import_react35.default.createElement(ListboxActionsContext.Provider, { value: actions }, /* @__PURE__ */ import_react35.default.createElement(ListboxDataContext.Provider, { value: data }, /* @__PURE__ */ import_react35.default.createElement( + OpenClosedProvider, + { + value: match(data.listboxState, { + [0 /* Open */]: 1 /* Open */, + [1 /* Closed */]: 2 /* Closed */ + }) + }, + name != null && value != null && objectToFormEntries({ [name]: value }).map(([name2, value2], idx) => /* @__PURE__ */ import_react35.default.createElement( + Hidden, + { + features: 4 /* Hidden */, + ref: idx === 0 ? (element) => { + var _a3; + form.current = (_a3 = element == null ? void 0 : element.closest("form")) != null ? _a3 : null; + } : void 0, + ...compact({ + key: name2, + as: "input", + type: "hidden", + hidden: true, + readOnly: true, + form: formName, + name: name2, + value: value2 + }) + } + )), + render({ ourProps, theirProps, slot, defaultTag: DEFAULT_LISTBOX_TAG, name: "Listbox" }) + ))); +} +var DEFAULT_BUTTON_TAG3 = "button"; +function ButtonFn3(props, ref) { + var _a3; + let internalId = useId(); + let { id = `headlessui-listbox-button-${internalId}`, ...theirProps } = props; + let data = useData2("Listbox.Button"); + let actions = useActions2("Listbox.Button"); + let buttonRef = useSyncRefs(data.buttonRef, ref); + let d = useDisposables(); + let handleKeyDown = useEvent((event) => { + switch (event.key) { + case " " /* Space */: + case "Enter" /* Enter */: + case "ArrowDown" /* ArrowDown */: + event.preventDefault(); + actions.openListbox(); + d.nextFrame(() => { + if (!data.value) + actions.goToOption(0 /* First */); + }); + break; + case "ArrowUp" /* ArrowUp */: + event.preventDefault(); + actions.openListbox(); + d.nextFrame(() => { + if (!data.value) + actions.goToOption(3 /* Last */); + }); + break; + } + }); + let handleKeyUp = useEvent((event) => { + switch (event.key) { + case " " /* Space */: + event.preventDefault(); + break; + } + }); + let handleClick = useEvent((event) => { + if (isDisabledReactIssue7711(event.currentTarget)) + return event.preventDefault(); + if (data.listboxState === 0 /* Open */) { + actions.closeListbox(); + d.nextFrame(() => { + var _a4; + return (_a4 = data.buttonRef.current) == null ? void 0 : _a4.focus({ preventScroll: true }); + }); + } else { + event.preventDefault(); + actions.openListbox(); + } + }); + let labelledby = useComputed(() => { + if (!data.labelId) + return void 0; + return [data.labelId, id].join(" "); + }, [data.labelId, id]); + let slot = (0, import_react35.useMemo)( + () => ({ + open: data.listboxState === 0 /* Open */, + disabled: data.disabled, + value: data.value + }), + [data] + ); + let ourProps = { + ref: buttonRef, + id, + type: useResolveButtonType(props, data.buttonRef), + "aria-haspopup": "listbox", + "aria-controls": (_a3 = data.optionsRef.current) == null ? void 0 : _a3.id, + "aria-expanded": data.disabled ? void 0 : data.listboxState === 0 /* Open */, + "aria-labelledby": labelledby, + disabled: data.disabled, + onKeyDown: handleKeyDown, + onKeyUp: handleKeyUp, + onClick: handleClick + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_BUTTON_TAG3, + name: "Listbox.Button" + }); +} +var DEFAULT_LABEL_TAG2 = "label"; +function LabelFn2(props, ref) { + let internalId = useId(); + let { id = `headlessui-listbox-label-${internalId}`, ...theirProps } = props; + let data = useData2("Listbox.Label"); + let actions = useActions2("Listbox.Label"); + let labelRef = useSyncRefs(data.labelRef, ref); + useIsoMorphicEffect(() => actions.registerLabel(id), [id]); + let handleClick = useEvent(() => { + var _a3; + return (_a3 = data.buttonRef.current) == null ? void 0 : _a3.focus({ preventScroll: true }); + }); + let slot = (0, import_react35.useMemo)( + () => ({ open: data.listboxState === 0 /* Open */, disabled: data.disabled }), + [data] + ); + let ourProps = { ref: labelRef, id, onClick: handleClick }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_LABEL_TAG2, + name: "Listbox.Label" + }); +} +var DEFAULT_OPTIONS_TAG2 = "ul"; +var OptionsRenderFeatures2 = 1 /* RenderStrategy */ | 2 /* Static */; +function OptionsFn2(props, ref) { + var _a3; + let internalId = useId(); + let { id = `headlessui-listbox-options-${internalId}`, ...theirProps } = props; + let data = useData2("Listbox.Options"); + let actions = useActions2("Listbox.Options"); + let optionsRef = useSyncRefs(data.optionsRef, ref); + let d = useDisposables(); + let searchDisposables = useDisposables(); + let usesOpenClosedState = useOpenClosed(); + let visible = (() => { + if (usesOpenClosedState !== null) { + return (usesOpenClosedState & 1 /* Open */) === 1 /* Open */; + } + return data.listboxState === 0 /* Open */; + })(); + (0, import_react35.useEffect)(() => { + var _a4; + let container = data.optionsRef.current; + if (!container) + return; + if (data.listboxState !== 0 /* Open */) + return; + if (container === ((_a4 = getOwnerDocument(container)) == null ? void 0 : _a4.activeElement)) + return; + container.focus({ preventScroll: true }); + }, [data.listboxState, data.optionsRef]); + let handleKeyDown = useEvent((event) => { + searchDisposables.dispose(); + switch (event.key) { + case " " /* Space */: + if (data.searchQuery !== "") { + event.preventDefault(); + event.stopPropagation(); + return actions.search(event.key); + } + case "Enter" /* Enter */: + event.preventDefault(); + event.stopPropagation(); + if (data.activeOptionIndex !== null) { + let { dataRef } = data.options[data.activeOptionIndex]; + actions.onChange(dataRef.current.value); + } + if (data.mode === 0 /* Single */) { + actions.closeListbox(); + disposables().nextFrame(() => { + var _a4; + return (_a4 = data.buttonRef.current) == null ? void 0 : _a4.focus({ preventScroll: true }); + }); + } + break; + case match(data.orientation, { vertical: "ArrowDown" /* ArrowDown */, horizontal: "ArrowRight" /* ArrowRight */ }): + event.preventDefault(); + event.stopPropagation(); + return actions.goToOption(2 /* Next */); + case match(data.orientation, { vertical: "ArrowUp" /* ArrowUp */, horizontal: "ArrowLeft" /* ArrowLeft */ }): + event.preventDefault(); + event.stopPropagation(); + return actions.goToOption(1 /* Previous */); + case "Home" /* Home */: + case "PageUp" /* PageUp */: + event.preventDefault(); + event.stopPropagation(); + return actions.goToOption(0 /* First */); + case "End" /* End */: + case "PageDown" /* PageDown */: + event.preventDefault(); + event.stopPropagation(); + return actions.goToOption(3 /* Last */); + case "Escape" /* Escape */: + event.preventDefault(); + event.stopPropagation(); + actions.closeListbox(); + return d.nextFrame(() => { + var _a4; + return (_a4 = data.buttonRef.current) == null ? void 0 : _a4.focus({ preventScroll: true }); + }); + case "Tab" /* Tab */: + event.preventDefault(); + event.stopPropagation(); + break; + default: + if (event.key.length === 1) { + actions.search(event.key); + searchDisposables.setTimeout(() => actions.clearSearch(), 350); + } + break; + } + }); + let labelledby = useComputed( + () => { + var _a4, _b, _c; + return (_c = (_a4 = data.labelRef.current) == null ? void 0 : _a4.id) != null ? _c : (_b = data.buttonRef.current) == null ? void 0 : _b.id; + }, + [data.labelRef.current, data.buttonRef.current] + ); + let slot = (0, import_react35.useMemo)( + () => ({ open: data.listboxState === 0 /* Open */ }), + [data] + ); + let ourProps = { + "aria-activedescendant": data.activeOptionIndex === null ? void 0 : (_a3 = data.options[data.activeOptionIndex]) == null ? void 0 : _a3.id, + "aria-multiselectable": data.mode === 1 /* Multi */ ? true : void 0, + "aria-labelledby": labelledby, + "aria-orientation": data.orientation, + id, + onKeyDown: handleKeyDown, + role: "listbox", + tabIndex: 0, + ref: optionsRef + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_OPTIONS_TAG2, + features: OptionsRenderFeatures2, + visible, + name: "Listbox.Options" + }); +} +var DEFAULT_OPTION_TAG2 = "li"; +function OptionFn2(props, ref) { + let internalId = useId(); + let { + id = `headlessui-listbox-option-${internalId}`, + disabled = false, + value, + ...theirProps + } = props; + let data = useData2("Listbox.Option"); + let actions = useActions2("Listbox.Option"); + let active = data.activeOptionIndex !== null ? data.options[data.activeOptionIndex].id === id : false; + let selected = data.isSelected(value); + let internalOptionRef = (0, import_react35.useRef)(null); + let getTextValue2 = useTextValue(internalOptionRef); + let bag = useLatestValue({ + disabled, + value, + domRef: internalOptionRef, + get textValue() { + return getTextValue2(); + } + }); + let optionRef = useSyncRefs(ref, internalOptionRef); + useIsoMorphicEffect(() => { + if (data.listboxState !== 0 /* Open */) + return; + if (!active) + return; + if (data.activationTrigger === 0 /* Pointer */) + return; + let d = disposables(); + d.requestAnimationFrame(() => { + var _a3, _b; + (_b = (_a3 = internalOptionRef.current) == null ? void 0 : _a3.scrollIntoView) == null ? void 0 : _b.call(_a3, { block: "nearest" }); + }); + return d.dispose; + }, [ + internalOptionRef, + active, + data.listboxState, + data.activationTrigger, + /* We also want to trigger this when the position of the active item changes so that we can re-trigger the scrollIntoView */ + data.activeOptionIndex + ]); + useIsoMorphicEffect(() => actions.registerOption(id, bag), [bag, id]); + let handleClick = useEvent((event) => { + if (disabled) + return event.preventDefault(); + actions.onChange(value); + if (data.mode === 0 /* Single */) { + actions.closeListbox(); + disposables().nextFrame(() => { + var _a3; + return (_a3 = data.buttonRef.current) == null ? void 0 : _a3.focus({ preventScroll: true }); + }); + } + }); + let handleFocus = useEvent(() => { + if (disabled) + return actions.goToOption(5 /* Nothing */); + actions.goToOption(4 /* Specific */, id); + }); + let pointer = useTrackedPointer(); + let handleEnter = useEvent((evt) => pointer.update(evt)); + let handleMove = useEvent((evt) => { + if (!pointer.wasMoved(evt)) + return; + if (disabled) + return; + if (active) + return; + actions.goToOption(4 /* Specific */, id, 0 /* Pointer */); + }); + let handleLeave = useEvent((evt) => { + if (!pointer.wasMoved(evt)) + return; + if (disabled) + return; + if (!active) + return; + actions.goToOption(5 /* Nothing */); + }); + let slot = (0, import_react35.useMemo)( + () => ({ active, selected, disabled }), + [active, selected, disabled] + ); + let ourProps = { + id, + ref: optionRef, + role: "option", + tabIndex: disabled === true ? void 0 : -1, + "aria-disabled": disabled === true ? true : void 0, + // According to the WAI-ARIA best practices, we should use aria-checked for + // multi-select,but Voice-Over disagrees. So we use aria-checked instead for + // both single and multi-select. + "aria-selected": selected, + disabled: void 0, + // Never forward the `disabled` prop + onClick: handleClick, + onFocus: handleFocus, + onPointerEnter: handleEnter, + onMouseEnter: handleEnter, + onPointerMove: handleMove, + onMouseMove: handleMove, + onPointerLeave: handleLeave, + onMouseLeave: handleLeave + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_OPTION_TAG2, + name: "Listbox.Option" + }); +} +var ListboxRoot = forwardRefWithAs(ListboxFn); +var Button3 = forwardRefWithAs(ButtonFn3); +var Label2 = forwardRefWithAs(LabelFn2); +var Options2 = forwardRefWithAs(OptionsFn2); +var Option2 = forwardRefWithAs(OptionFn2); +var Listbox = Object.assign(ListboxRoot, { Button: Button3, Label: Label2, Options: Options2, Option: Option2 }); + +// src/components/menu/menu.tsx +var import_react36 = __toESM(__webpack_require__(/*! react */ "react"), 1); +function adjustOrderedState3(state, adjustment = (i) => i) { + let currentActiveItem = state.activeItemIndex !== null ? state.items[state.activeItemIndex] : null; + let sortedItems = sortByDomNode( + adjustment(state.items.slice()), + (item) => item.dataRef.current.domRef.current + ); + let adjustedActiveItemIndex = currentActiveItem ? sortedItems.indexOf(currentActiveItem) : null; + if (adjustedActiveItemIndex === -1) { + adjustedActiveItemIndex = null; + } + return { + items: sortedItems, + activeItemIndex: adjustedActiveItemIndex + }; +} +var reducers5 = { + [1 /* CloseMenu */](state) { + if (state.menuState === 1 /* Closed */) + return state; + return { ...state, activeItemIndex: null, menuState: 1 /* Closed */ }; + }, + [0 /* OpenMenu */](state) { + if (state.menuState === 0 /* Open */) + return state; + return { + ...state, + /* We can turn off demo mode once we re-open the `Menu` */ + __demoMode: false, + menuState: 0 /* Open */ + }; + }, + [2 /* GoToItem */]: (state, action) => { + var _a3; + let adjustedState = adjustOrderedState3(state); + let activeItemIndex = calculateActiveIndex(action, { + resolveItems: () => adjustedState.items, + resolveActiveIndex: () => adjustedState.activeItemIndex, + resolveId: (item) => item.id, + resolveDisabled: (item) => item.dataRef.current.disabled + }); + return { + ...state, + ...adjustedState, + searchQuery: "", + activeItemIndex, + activationTrigger: (_a3 = action.trigger) != null ? _a3 : 1 /* Other */ + }; + }, + [3 /* Search */]: (state, action) => { + let wasAlreadySearching = state.searchQuery !== ""; + let offset = wasAlreadySearching ? 0 : 1; + let searchQuery = state.searchQuery + action.value.toLowerCase(); + let reOrderedItems = state.activeItemIndex !== null ? state.items.slice(state.activeItemIndex + offset).concat(state.items.slice(0, state.activeItemIndex + offset)) : state.items; + let matchingItem = reOrderedItems.find( + (item) => { + var _a3; + return ((_a3 = item.dataRef.current.textValue) == null ? void 0 : _a3.startsWith(searchQuery)) && !item.dataRef.current.disabled; + } + ); + let matchIdx = matchingItem ? state.items.indexOf(matchingItem) : -1; + if (matchIdx === -1 || matchIdx === state.activeItemIndex) + return { ...state, searchQuery }; + return { + ...state, + searchQuery, + activeItemIndex: matchIdx, + activationTrigger: 1 /* Other */ + }; + }, + [4 /* ClearSearch */](state) { + if (state.searchQuery === "") + return state; + return { ...state, searchQuery: "", searchActiveItemIndex: null }; + }, + [5 /* RegisterItem */]: (state, action) => { + let adjustedState = adjustOrderedState3(state, (items) => [ + ...items, + { id: action.id, dataRef: action.dataRef } + ]); + return { ...state, ...adjustedState }; + }, + [6 /* UnregisterItem */]: (state, action) => { + let adjustedState = adjustOrderedState3(state, (items) => { + let idx = items.findIndex((a) => a.id === action.id); + if (idx !== -1) + items.splice(idx, 1); + return items; + }); + return { + ...state, + ...adjustedState, + activationTrigger: 1 /* Other */ + }; + } +}; +var MenuContext = (0, import_react36.createContext)(null); +MenuContext.displayName = "MenuContext"; +function useMenuContext(component) { + let context = (0, import_react36.useContext)(MenuContext); + if (context === null) { + let err = new Error(`<${component} /> is missing a parent component.`); + if (Error.captureStackTrace) + Error.captureStackTrace(err, useMenuContext); + throw err; + } + return context; +} +function stateReducer5(state, action) { + return match(action.type, reducers5, state, action); +} +var DEFAULT_MENU_TAG = import_react36.Fragment; +function MenuFn(props, ref) { + let { __demoMode = false, ...theirProps } = props; + let reducerBag = (0, import_react36.useReducer)(stateReducer5, { + __demoMode, + menuState: __demoMode ? 0 /* Open */ : 1 /* Closed */, + buttonRef: (0, import_react36.createRef)(), + itemsRef: (0, import_react36.createRef)(), + items: [], + searchQuery: "", + activeItemIndex: null, + activationTrigger: 1 /* Other */ + }); + let [{ menuState, itemsRef, buttonRef }, dispatch] = reducerBag; + let menuRef = useSyncRefs(ref); + useOutsideClick( + [buttonRef, itemsRef], + (event, target) => { + var _a3; + dispatch({ type: 1 /* CloseMenu */ }); + if (!isFocusableElement(target, 1 /* Loose */)) { + event.preventDefault(); + (_a3 = buttonRef.current) == null ? void 0 : _a3.focus(); + } + }, + menuState === 0 /* Open */ + ); + let close = useEvent(() => { + dispatch({ type: 1 /* CloseMenu */ }); + }); + let slot = (0, import_react36.useMemo)( + () => ({ open: menuState === 0 /* Open */, close }), + [menuState, close] + ); + let ourProps = { ref: menuRef }; + return /* @__PURE__ */ import_react36.default.createElement(MenuContext.Provider, { value: reducerBag }, /* @__PURE__ */ import_react36.default.createElement( + OpenClosedProvider, + { + value: match(menuState, { + [0 /* Open */]: 1 /* Open */, + [1 /* Closed */]: 2 /* Closed */ + }) + }, + render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_MENU_TAG, + name: "Menu" + }) + )); +} +var DEFAULT_BUTTON_TAG4 = "button"; +function ButtonFn4(props, ref) { + var _a3; + let internalId = useId(); + let { id = `headlessui-menu-button-${internalId}`, ...theirProps } = props; + let [state, dispatch] = useMenuContext("Menu.Button"); + let buttonRef = useSyncRefs(state.buttonRef, ref); + let d = useDisposables(); + let handleKeyDown = useEvent((event) => { + switch (event.key) { + case " " /* Space */: + case "Enter" /* Enter */: + case "ArrowDown" /* ArrowDown */: + event.preventDefault(); + event.stopPropagation(); + dispatch({ type: 0 /* OpenMenu */ }); + d.nextFrame(() => dispatch({ type: 2 /* GoToItem */, focus: 0 /* First */ })); + break; + case "ArrowUp" /* ArrowUp */: + event.preventDefault(); + event.stopPropagation(); + dispatch({ type: 0 /* OpenMenu */ }); + d.nextFrame(() => dispatch({ type: 2 /* GoToItem */, focus: 3 /* Last */ })); + break; + } + }); + let handleKeyUp = useEvent((event) => { + switch (event.key) { + case " " /* Space */: + event.preventDefault(); + break; + } + }); + let handleClick = useEvent((event) => { + if (isDisabledReactIssue7711(event.currentTarget)) + return event.preventDefault(); + if (props.disabled) + return; + if (state.menuState === 0 /* Open */) { + dispatch({ type: 1 /* CloseMenu */ }); + d.nextFrame(() => { + var _a4; + return (_a4 = state.buttonRef.current) == null ? void 0 : _a4.focus({ preventScroll: true }); + }); + } else { + event.preventDefault(); + dispatch({ type: 0 /* OpenMenu */ }); + } + }); + let slot = (0, import_react36.useMemo)( + () => ({ open: state.menuState === 0 /* Open */ }), + [state] + ); + let ourProps = { + ref: buttonRef, + id, + type: useResolveButtonType(props, state.buttonRef), + "aria-haspopup": "menu", + "aria-controls": (_a3 = state.itemsRef.current) == null ? void 0 : _a3.id, + "aria-expanded": props.disabled ? void 0 : state.menuState === 0 /* Open */, + onKeyDown: handleKeyDown, + onKeyUp: handleKeyUp, + onClick: handleClick + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_BUTTON_TAG4, + name: "Menu.Button" + }); +} +var DEFAULT_ITEMS_TAG = "div"; +var ItemsRenderFeatures = 1 /* RenderStrategy */ | 2 /* Static */; +function ItemsFn(props, ref) { + var _a3, _b; + let internalId = useId(); + let { id = `headlessui-menu-items-${internalId}`, ...theirProps } = props; + let [state, dispatch] = useMenuContext("Menu.Items"); + let itemsRef = useSyncRefs(state.itemsRef, ref); + let ownerDocument = useOwnerDocument(state.itemsRef); + let searchDisposables = useDisposables(); + let usesOpenClosedState = useOpenClosed(); + let visible = (() => { + if (usesOpenClosedState !== null) { + return (usesOpenClosedState & 1 /* Open */) === 1 /* Open */; + } + return state.menuState === 0 /* Open */; + })(); + (0, import_react36.useEffect)(() => { + let container = state.itemsRef.current; + if (!container) + return; + if (state.menuState !== 0 /* Open */) + return; + if (container === (ownerDocument == null ? void 0 : ownerDocument.activeElement)) + return; + container.focus({ preventScroll: true }); + }, [state.menuState, state.itemsRef, ownerDocument]); + useTreeWalker({ + container: state.itemsRef.current, + enabled: state.menuState === 0 /* Open */, + accept(node) { + if (node.getAttribute("role") === "menuitem") + return NodeFilter.FILTER_REJECT; + if (node.hasAttribute("role")) + return NodeFilter.FILTER_SKIP; + return NodeFilter.FILTER_ACCEPT; + }, + walk(node) { + node.setAttribute("role", "none"); + } + }); + let handleKeyDown = useEvent((event) => { + var _a4, _b2; + searchDisposables.dispose(); + switch (event.key) { + case " " /* Space */: + if (state.searchQuery !== "") { + event.preventDefault(); + event.stopPropagation(); + return dispatch({ type: 3 /* Search */, value: event.key }); + } + case "Enter" /* Enter */: + event.preventDefault(); + event.stopPropagation(); + dispatch({ type: 1 /* CloseMenu */ }); + if (state.activeItemIndex !== null) { + let { dataRef } = state.items[state.activeItemIndex]; + (_b2 = (_a4 = dataRef.current) == null ? void 0 : _a4.domRef.current) == null ? void 0 : _b2.click(); + } + restoreFocusIfNecessary(state.buttonRef.current); + break; + case "ArrowDown" /* ArrowDown */: + event.preventDefault(); + event.stopPropagation(); + return dispatch({ type: 2 /* GoToItem */, focus: 2 /* Next */ }); + case "ArrowUp" /* ArrowUp */: + event.preventDefault(); + event.stopPropagation(); + return dispatch({ type: 2 /* GoToItem */, focus: 1 /* Previous */ }); + case "Home" /* Home */: + case "PageUp" /* PageUp */: + event.preventDefault(); + event.stopPropagation(); + return dispatch({ type: 2 /* GoToItem */, focus: 0 /* First */ }); + case "End" /* End */: + case "PageDown" /* PageDown */: + event.preventDefault(); + event.stopPropagation(); + return dispatch({ type: 2 /* GoToItem */, focus: 3 /* Last */ }); + case "Escape" /* Escape */: + event.preventDefault(); + event.stopPropagation(); + dispatch({ type: 1 /* CloseMenu */ }); + disposables().nextFrame(() => { + var _a5; + return (_a5 = state.buttonRef.current) == null ? void 0 : _a5.focus({ preventScroll: true }); + }); + break; + case "Tab" /* Tab */: + event.preventDefault(); + event.stopPropagation(); + dispatch({ type: 1 /* CloseMenu */ }); + disposables().nextFrame(() => { + focusFrom( + state.buttonRef.current, + event.shiftKey ? 2 /* Previous */ : 4 /* Next */ + ); + }); + break; + default: + if (event.key.length === 1) { + dispatch({ type: 3 /* Search */, value: event.key }); + searchDisposables.setTimeout(() => dispatch({ type: 4 /* ClearSearch */ }), 350); + } + break; + } + }); + let handleKeyUp = useEvent((event) => { + switch (event.key) { + case " " /* Space */: + event.preventDefault(); + break; + } + }); + let slot = (0, import_react36.useMemo)( + () => ({ open: state.menuState === 0 /* Open */ }), + [state] + ); + let ourProps = { + "aria-activedescendant": state.activeItemIndex === null ? void 0 : (_a3 = state.items[state.activeItemIndex]) == null ? void 0 : _a3.id, + "aria-labelledby": (_b = state.buttonRef.current) == null ? void 0 : _b.id, + id, + onKeyDown: handleKeyDown, + onKeyUp: handleKeyUp, + role: "menu", + tabIndex: 0, + ref: itemsRef + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_ITEMS_TAG, + features: ItemsRenderFeatures, + visible, + name: "Menu.Items" + }); +} +var DEFAULT_ITEM_TAG = import_react36.Fragment; +function ItemFn(props, ref) { + let internalId = useId(); + let { id = `headlessui-menu-item-${internalId}`, disabled = false, ...theirProps } = props; + let [state, dispatch] = useMenuContext("Menu.Item"); + let active = state.activeItemIndex !== null ? state.items[state.activeItemIndex].id === id : false; + let internalItemRef = (0, import_react36.useRef)(null); + let itemRef = useSyncRefs(ref, internalItemRef); + useIsoMorphicEffect(() => { + if (state.__demoMode) + return; + if (state.menuState !== 0 /* Open */) + return; + if (!active) + return; + if (state.activationTrigger === 0 /* Pointer */) + return; + let d = disposables(); + d.requestAnimationFrame(() => { + var _a3, _b; + (_b = (_a3 = internalItemRef.current) == null ? void 0 : _a3.scrollIntoView) == null ? void 0 : _b.call(_a3, { block: "nearest" }); + }); + return d.dispose; + }, [ + state.__demoMode, + internalItemRef, + active, + state.menuState, + state.activationTrigger, + /* We also want to trigger this when the position of the active item changes so that we can re-trigger the scrollIntoView */ + state.activeItemIndex + ]); + let getTextValue2 = useTextValue(internalItemRef); + let bag = (0, import_react36.useRef)({ + disabled, + domRef: internalItemRef, + get textValue() { + return getTextValue2(); + } + }); + useIsoMorphicEffect(() => { + bag.current.disabled = disabled; + }, [bag, disabled]); + useIsoMorphicEffect(() => { + dispatch({ type: 5 /* RegisterItem */, id, dataRef: bag }); + return () => dispatch({ type: 6 /* UnregisterItem */, id }); + }, [bag, id]); + let close = useEvent(() => { + dispatch({ type: 1 /* CloseMenu */ }); + }); + let handleClick = useEvent((event) => { + if (disabled) + return event.preventDefault(); + dispatch({ type: 1 /* CloseMenu */ }); + restoreFocusIfNecessary(state.buttonRef.current); + }); + let handleFocus = useEvent(() => { + if (disabled) + return dispatch({ type: 2 /* GoToItem */, focus: 5 /* Nothing */ }); + dispatch({ type: 2 /* GoToItem */, focus: 4 /* Specific */, id }); + }); + let pointer = useTrackedPointer(); + let handleEnter = useEvent((evt) => pointer.update(evt)); + let handleMove = useEvent((evt) => { + if (!pointer.wasMoved(evt)) + return; + if (disabled) + return; + if (active) + return; + dispatch({ + type: 2 /* GoToItem */, + focus: 4 /* Specific */, + id, + trigger: 0 /* Pointer */ + }); + }); + let handleLeave = useEvent((evt) => { + if (!pointer.wasMoved(evt)) + return; + if (disabled) + return; + if (!active) + return; + dispatch({ type: 2 /* GoToItem */, focus: 5 /* Nothing */ }); + }); + let slot = (0, import_react36.useMemo)( + () => ({ active, disabled, close }), + [active, disabled, close] + ); + let ourProps = { + id, + ref: itemRef, + role: "menuitem", + tabIndex: disabled === true ? void 0 : -1, + "aria-disabled": disabled === true ? true : void 0, + disabled: void 0, + // Never forward the `disabled` prop + onClick: handleClick, + onFocus: handleFocus, + onPointerEnter: handleEnter, + onMouseEnter: handleEnter, + onPointerMove: handleMove, + onMouseMove: handleMove, + onPointerLeave: handleLeave, + onMouseLeave: handleLeave + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_ITEM_TAG, + name: "Menu.Item" + }); +} +var MenuRoot = forwardRefWithAs(MenuFn); +var Button4 = forwardRefWithAs(ButtonFn4); +var Items = forwardRefWithAs(ItemsFn); +var Item = forwardRefWithAs(ItemFn); +var Menu = Object.assign(MenuRoot, { Button: Button4, Items, Item }); + +// src/components/popover/popover.tsx +var import_react37 = __toESM(__webpack_require__(/*! react */ "react"), 1); +var reducers6 = { + [0 /* TogglePopover */]: (state) => { + let nextState = { + ...state, + popoverState: match(state.popoverState, { + [0 /* Open */]: 1 /* Closed */, + [1 /* Closed */]: 0 /* Open */ + }) + }; + if (nextState.popoverState === 0 /* Open */) { + nextState.__demoMode = false; + } + return nextState; + }, + [1 /* ClosePopover */](state) { + if (state.popoverState === 1 /* Closed */) + return state; + return { ...state, popoverState: 1 /* Closed */ }; + }, + [2 /* SetButton */](state, action) { + if (state.button === action.button) + return state; + return { ...state, button: action.button }; + }, + [3 /* SetButtonId */](state, action) { + if (state.buttonId === action.buttonId) + return state; + return { ...state, buttonId: action.buttonId }; + }, + [4 /* SetPanel */](state, action) { + if (state.panel === action.panel) + return state; + return { ...state, panel: action.panel }; + }, + [5 /* SetPanelId */](state, action) { + if (state.panelId === action.panelId) + return state; + return { ...state, panelId: action.panelId }; + } +}; +var PopoverContext = (0, import_react37.createContext)(null); +PopoverContext.displayName = "PopoverContext"; +function usePopoverContext(component) { + let context = (0, import_react37.useContext)(PopoverContext); + if (context === null) { + let err = new Error(`<${component} /> is missing a parent component.`); + if (Error.captureStackTrace) + Error.captureStackTrace(err, usePopoverContext); + throw err; + } + return context; +} +var PopoverAPIContext = (0, import_react37.createContext)(null); +PopoverAPIContext.displayName = "PopoverAPIContext"; +function usePopoverAPIContext(component) { + let context = (0, import_react37.useContext)(PopoverAPIContext); + if (context === null) { + let err = new Error(`<${component} /> is missing a parent component.`); + if (Error.captureStackTrace) + Error.captureStackTrace(err, usePopoverAPIContext); + throw err; + } + return context; +} +var PopoverGroupContext = (0, import_react37.createContext)(null); +PopoverGroupContext.displayName = "PopoverGroupContext"; +function usePopoverGroupContext() { + return (0, import_react37.useContext)(PopoverGroupContext); +} +var PopoverPanelContext = (0, import_react37.createContext)(null); +PopoverPanelContext.displayName = "PopoverPanelContext"; +function usePopoverPanelContext() { + return (0, import_react37.useContext)(PopoverPanelContext); +} +function stateReducer6(state, action) { + return match(action.type, reducers6, state, action); +} +var DEFAULT_POPOVER_TAG = "div"; +function PopoverFn(props, ref) { + var _a3; + let { __demoMode = false, ...theirProps } = props; + let internalPopoverRef = (0, import_react37.useRef)(null); + let popoverRef = useSyncRefs( + ref, + optionalRef((ref2) => { + internalPopoverRef.current = ref2; + }) + ); + let buttons = (0, import_react37.useRef)([]); + let reducerBag = (0, import_react37.useReducer)(stateReducer6, { + __demoMode, + popoverState: __demoMode ? 0 /* Open */ : 1 /* Closed */, + buttons, + button: null, + buttonId: null, + panel: null, + panelId: null, + beforePanelSentinel: (0, import_react37.createRef)(), + afterPanelSentinel: (0, import_react37.createRef)() + }); + let [ + { popoverState, button, buttonId, panel, panelId, beforePanelSentinel, afterPanelSentinel }, + dispatch + ] = reducerBag; + let ownerDocument = useOwnerDocument((_a3 = internalPopoverRef.current) != null ? _a3 : button); + let isPortalled = (0, import_react37.useMemo)(() => { + if (!button) + return false; + if (!panel) + return false; + for (let root2 of document.querySelectorAll("body > *")) { + if (Number(root2 == null ? void 0 : root2.contains(button)) ^ Number(root2 == null ? void 0 : root2.contains(panel))) { + return true; + } + } + let elements = getFocusableElements(); + let buttonIdx = elements.indexOf(button); + let beforeIdx = (buttonIdx + elements.length - 1) % elements.length; + let afterIdx = (buttonIdx + 1) % elements.length; + let beforeElement = elements[beforeIdx]; + let afterElement = elements[afterIdx]; + if (!panel.contains(beforeElement) && !panel.contains(afterElement)) { + return true; + } + return false; + }, [button, panel]); + let buttonIdRef = useLatestValue(buttonId); + let panelIdRef = useLatestValue(panelId); + let registerBag = (0, import_react37.useMemo)( + () => ({ + buttonId: buttonIdRef, + panelId: panelIdRef, + close: () => dispatch({ type: 1 /* ClosePopover */ }) + }), + [buttonIdRef, panelIdRef, dispatch] + ); + let groupContext = usePopoverGroupContext(); + let registerPopover = groupContext == null ? void 0 : groupContext.registerPopover; + let isFocusWithinPopoverGroup = useEvent(() => { + var _a4; + return (_a4 = groupContext == null ? void 0 : groupContext.isFocusWithinPopoverGroup()) != null ? _a4 : (ownerDocument == null ? void 0 : ownerDocument.activeElement) && ((button == null ? void 0 : button.contains(ownerDocument.activeElement)) || (panel == null ? void 0 : panel.contains(ownerDocument.activeElement))); + }); + (0, import_react37.useEffect)(() => registerPopover == null ? void 0 : registerPopover(registerBag), [registerPopover, registerBag]); + let [portals, PortalWrapper] = useNestedPortals(); + let root = useRootContainers({ + portals, + defaultContainers: [button, panel] + }); + useEventListener( + ownerDocument == null ? void 0 : ownerDocument.defaultView, + "focus", + (event) => { + var _a4, _b, _c, _d; + if (event.target === window) + return; + if (!(event.target instanceof HTMLElement)) + return; + if (popoverState !== 0 /* Open */) + return; + if (isFocusWithinPopoverGroup()) + return; + if (!button) + return; + if (!panel) + return; + if (root.contains(event.target)) + return; + if ((_b = (_a4 = beforePanelSentinel.current) == null ? void 0 : _a4.contains) == null ? void 0 : _b.call(_a4, event.target)) + return; + if ((_d = (_c = afterPanelSentinel.current) == null ? void 0 : _c.contains) == null ? void 0 : _d.call(_c, event.target)) + return; + dispatch({ type: 1 /* ClosePopover */ }); + }, + true + ); + useOutsideClick( + root.resolveContainers, + (event, target) => { + dispatch({ type: 1 /* ClosePopover */ }); + if (!isFocusableElement(target, 1 /* Loose */)) { + event.preventDefault(); + button == null ? void 0 : button.focus(); + } + }, + popoverState === 0 /* Open */ + ); + let close = useEvent( + (focusableElement) => { + dispatch({ type: 1 /* ClosePopover */ }); + let restoreElement = (() => { + if (!focusableElement) + return button; + if (focusableElement instanceof HTMLElement) + return focusableElement; + if ("current" in focusableElement && focusableElement.current instanceof HTMLElement) + return focusableElement.current; + return button; + })(); + restoreElement == null ? void 0 : restoreElement.focus(); + } + ); + let api = (0, import_react37.useMemo)( + () => ({ close, isPortalled }), + [close, isPortalled] + ); + let slot = (0, import_react37.useMemo)( + () => ({ open: popoverState === 0 /* Open */, close }), + [popoverState, close] + ); + let ourProps = { ref: popoverRef }; + return /* @__PURE__ */ import_react37.default.createElement(PopoverPanelContext.Provider, { value: null }, /* @__PURE__ */ import_react37.default.createElement(PopoverContext.Provider, { value: reducerBag }, /* @__PURE__ */ import_react37.default.createElement(PopoverAPIContext.Provider, { value: api }, /* @__PURE__ */ import_react37.default.createElement( + OpenClosedProvider, + { + value: match(popoverState, { + [0 /* Open */]: 1 /* Open */, + [1 /* Closed */]: 2 /* Closed */ + }) + }, + /* @__PURE__ */ import_react37.default.createElement(PortalWrapper, null, render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_POPOVER_TAG, + name: "Popover" + }), /* @__PURE__ */ import_react37.default.createElement(root.MainTreeNode, null)) + )))); +} +var DEFAULT_BUTTON_TAG5 = "button"; +function ButtonFn5(props, ref) { + let internalId = useId(); + let { id = `headlessui-popover-button-${internalId}`, ...theirProps } = props; + let [state, dispatch] = usePopoverContext("Popover.Button"); + let { isPortalled } = usePopoverAPIContext("Popover.Button"); + let internalButtonRef = (0, import_react37.useRef)(null); + let sentinelId = `headlessui-focus-sentinel-${useId()}`; + let groupContext = usePopoverGroupContext(); + let closeOthers = groupContext == null ? void 0 : groupContext.closeOthers; + let panelContext = usePopoverPanelContext(); + let isWithinPanel = panelContext !== null; + (0, import_react37.useEffect)(() => { + if (isWithinPanel) + return; + dispatch({ type: 3 /* SetButtonId */, buttonId: id }); + return () => { + dispatch({ type: 3 /* SetButtonId */, buttonId: null }); + }; + }, [isWithinPanel, id, dispatch]); + let [uniqueIdentifier] = (0, import_react37.useState)(() => Symbol()); + let buttonRef = useSyncRefs( + internalButtonRef, + ref, + isWithinPanel ? null : (button) => { + if (button) { + state.buttons.current.push(uniqueIdentifier); + } else { + let idx = state.buttons.current.indexOf(uniqueIdentifier); + if (idx !== -1) + state.buttons.current.splice(idx, 1); + } + if (state.buttons.current.length > 1) { + console.warn( + "You are already using a but only 1 is supported." + ); + } + button && dispatch({ type: 2 /* SetButton */, button }); + } + ); + let withinPanelButtonRef = useSyncRefs(internalButtonRef, ref); + let ownerDocument = useOwnerDocument(internalButtonRef); + let handleKeyDown = useEvent((event) => { + var _a3, _b, _c; + if (isWithinPanel) { + if (state.popoverState === 1 /* Closed */) + return; + switch (event.key) { + case " " /* Space */: + case "Enter" /* Enter */: + event.preventDefault(); + (_b = (_a3 = event.target).click) == null ? void 0 : _b.call(_a3); + dispatch({ type: 1 /* ClosePopover */ }); + (_c = state.button) == null ? void 0 : _c.focus(); + break; + } + } else { + switch (event.key) { + case " " /* Space */: + case "Enter" /* Enter */: + event.preventDefault(); + event.stopPropagation(); + if (state.popoverState === 1 /* Closed */) + closeOthers == null ? void 0 : closeOthers(state.buttonId); + dispatch({ type: 0 /* TogglePopover */ }); + break; + case "Escape" /* Escape */: + if (state.popoverState !== 0 /* Open */) + return closeOthers == null ? void 0 : closeOthers(state.buttonId); + if (!internalButtonRef.current) + return; + if ((ownerDocument == null ? void 0 : ownerDocument.activeElement) && !internalButtonRef.current.contains(ownerDocument.activeElement)) { + return; + } + event.preventDefault(); + event.stopPropagation(); + dispatch({ type: 1 /* ClosePopover */ }); + break; + } + } + }); + let handleKeyUp = useEvent((event) => { + if (isWithinPanel) + return; + if (event.key === " " /* Space */) { + event.preventDefault(); + } + }); + let handleClick = useEvent((event) => { + var _a3, _b; + if (isDisabledReactIssue7711(event.currentTarget)) + return; + if (props.disabled) + return; + if (isWithinPanel) { + dispatch({ type: 1 /* ClosePopover */ }); + (_a3 = state.button) == null ? void 0 : _a3.focus(); + } else { + event.preventDefault(); + event.stopPropagation(); + if (state.popoverState === 1 /* Closed */) + closeOthers == null ? void 0 : closeOthers(state.buttonId); + dispatch({ type: 0 /* TogglePopover */ }); + (_b = state.button) == null ? void 0 : _b.focus(); + } + }); + let handleMouseDown = useEvent((event) => { + event.preventDefault(); + event.stopPropagation(); + }); + let visible = state.popoverState === 0 /* Open */; + let slot = (0, import_react37.useMemo)(() => ({ open: visible }), [visible]); + let type = useResolveButtonType(props, internalButtonRef); + let ourProps = isWithinPanel ? { + ref: withinPanelButtonRef, + type, + onKeyDown: handleKeyDown, + onClick: handleClick + } : { + ref: buttonRef, + id: state.buttonId, + type, + "aria-expanded": props.disabled ? void 0 : state.popoverState === 0 /* Open */, + "aria-controls": state.panel ? state.panelId : void 0, + onKeyDown: handleKeyDown, + onKeyUp: handleKeyUp, + onClick: handleClick, + onMouseDown: handleMouseDown + }; + let direction = useTabDirection(); + let handleFocus = useEvent(() => { + let el = state.panel; + if (!el) + return; + function run() { + let result = match(direction.current, { + [0 /* Forwards */]: () => focusIn(el, 1 /* First */), + [1 /* Backwards */]: () => focusIn(el, 8 /* Last */) + }); + if (result === 0 /* Error */) { + focusIn( + getFocusableElements().filter((el2) => el2.dataset.headlessuiFocusGuard !== "true"), + match(direction.current, { + [0 /* Forwards */]: 4 /* Next */, + [1 /* Backwards */]: 2 /* Previous */ + }), + { relativeTo: state.button } + ); + } + } + if (false) {} else { + run(); + } + }); + return /* @__PURE__ */ import_react37.default.createElement(import_react37.default.Fragment, null, render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_BUTTON_TAG5, + name: "Popover.Button" + }), visible && !isWithinPanel && isPortalled && /* @__PURE__ */ import_react37.default.createElement( + Hidden, + { + id: sentinelId, + features: 2 /* Focusable */, + "data-headlessui-focus-guard": true, + as: "button", + type: "button", + onFocus: handleFocus + } + )); +} +var DEFAULT_OVERLAY_TAG2 = "div"; +var OverlayRenderFeatures = 1 /* RenderStrategy */ | 2 /* Static */; +function OverlayFn2(props, ref) { + let internalId = useId(); + let { id = `headlessui-popover-overlay-${internalId}`, ...theirProps } = props; + let [{ popoverState }, dispatch] = usePopoverContext("Popover.Overlay"); + let overlayRef = useSyncRefs(ref); + let usesOpenClosedState = useOpenClosed(); + let visible = (() => { + if (usesOpenClosedState !== null) { + return (usesOpenClosedState & 1 /* Open */) === 1 /* Open */; + } + return popoverState === 0 /* Open */; + })(); + let handleClick = useEvent((event) => { + if (isDisabledReactIssue7711(event.currentTarget)) + return event.preventDefault(); + dispatch({ type: 1 /* ClosePopover */ }); + }); + let slot = (0, import_react37.useMemo)( + () => ({ open: popoverState === 0 /* Open */ }), + [popoverState] + ); + let ourProps = { + ref: overlayRef, + id, + "aria-hidden": true, + onClick: handleClick + }; + return render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_OVERLAY_TAG2, + features: OverlayRenderFeatures, + visible, + name: "Popover.Overlay" + }); +} +var DEFAULT_PANEL_TAG3 = "div"; +var PanelRenderFeatures2 = 1 /* RenderStrategy */ | 2 /* Static */; +function PanelFn3(props, ref) { + let internalId = useId(); + let { id = `headlessui-popover-panel-${internalId}`, focus = false, ...theirProps } = props; + let [state, dispatch] = usePopoverContext("Popover.Panel"); + let { close, isPortalled } = usePopoverAPIContext("Popover.Panel"); + let beforePanelSentinelId = `headlessui-focus-sentinel-before-${useId()}`; + let afterPanelSentinelId = `headlessui-focus-sentinel-after-${useId()}`; + let internalPanelRef = (0, import_react37.useRef)(null); + let panelRef = useSyncRefs(internalPanelRef, ref, (panel) => { + dispatch({ type: 4 /* SetPanel */, panel }); + }); + let ownerDocument = useOwnerDocument(internalPanelRef); + useIsoMorphicEffect(() => { + dispatch({ type: 5 /* SetPanelId */, panelId: id }); + return () => { + dispatch({ type: 5 /* SetPanelId */, panelId: null }); + }; + }, [id, dispatch]); + let usesOpenClosedState = useOpenClosed(); + let visible = (() => { + if (usesOpenClosedState !== null) { + return (usesOpenClosedState & 1 /* Open */) === 1 /* Open */; + } + return state.popoverState === 0 /* Open */; + })(); + let handleKeyDown = useEvent((event) => { + var _a3; + switch (event.key) { + case "Escape" /* Escape */: + if (state.popoverState !== 0 /* Open */) + return; + if (!internalPanelRef.current) + return; + if ((ownerDocument == null ? void 0 : ownerDocument.activeElement) && !internalPanelRef.current.contains(ownerDocument.activeElement)) { + return; + } + event.preventDefault(); + event.stopPropagation(); + dispatch({ type: 1 /* ClosePopover */ }); + (_a3 = state.button) == null ? void 0 : _a3.focus(); + break; + } + }); + (0, import_react37.useEffect)(() => { + var _a3; + if (props.static) + return; + if (state.popoverState === 1 /* Closed */ && ((_a3 = props.unmount) != null ? _a3 : true)) { + dispatch({ type: 4 /* SetPanel */, panel: null }); + } + }, [state.popoverState, props.unmount, props.static, dispatch]); + (0, import_react37.useEffect)(() => { + if (state.__demoMode) + return; + if (!focus) + return; + if (state.popoverState !== 0 /* Open */) + return; + if (!internalPanelRef.current) + return; + let activeElement = ownerDocument == null ? void 0 : ownerDocument.activeElement; + if (internalPanelRef.current.contains(activeElement)) + return; + focusIn(internalPanelRef.current, 1 /* First */); + }, [state.__demoMode, focus, internalPanelRef, state.popoverState]); + let slot = (0, import_react37.useMemo)( + () => ({ open: state.popoverState === 0 /* Open */, close }), + [state, close] + ); + let ourProps = { + ref: panelRef, + id, + onKeyDown: handleKeyDown, + onBlur: focus && state.popoverState === 0 /* Open */ ? (event) => { + var _a3, _b, _c, _d, _e; + let el = event.relatedTarget; + if (!el) + return; + if (!internalPanelRef.current) + return; + if ((_a3 = internalPanelRef.current) == null ? void 0 : _a3.contains(el)) + return; + dispatch({ type: 1 /* ClosePopover */ }); + if (((_c = (_b = state.beforePanelSentinel.current) == null ? void 0 : _b.contains) == null ? void 0 : _c.call(_b, el)) || ((_e = (_d = state.afterPanelSentinel.current) == null ? void 0 : _d.contains) == null ? void 0 : _e.call(_d, el))) { + el.focus({ preventScroll: true }); + } + } : void 0, + tabIndex: -1 + }; + let direction = useTabDirection(); + let handleBeforeFocus = useEvent(() => { + let el = internalPanelRef.current; + if (!el) + return; + function run() { + match(direction.current, { + [0 /* Forwards */]: () => { + var _a3; + let result = focusIn(el, 1 /* First */); + if (result === 0 /* Error */) { + (_a3 = state.afterPanelSentinel.current) == null ? void 0 : _a3.focus(); + } + }, + [1 /* Backwards */]: () => { + var _a3; + (_a3 = state.button) == null ? void 0 : _a3.focus({ preventScroll: true }); + } + }); + } + if (false) {} else { + run(); + } + }); + let handleAfterFocus = useEvent(() => { + let el = internalPanelRef.current; + if (!el) + return; + function run() { + match(direction.current, { + [0 /* Forwards */]: () => { + var _a3; + if (!state.button) + return; + let elements = getFocusableElements(); + let idx = elements.indexOf(state.button); + let before = elements.slice(0, idx + 1); + let after = elements.slice(idx + 1); + let combined = [...after, ...before]; + for (let element of combined.slice()) { + if (element.dataset.headlessuiFocusGuard === "true" || ((_a3 = state.panel) == null ? void 0 : _a3.contains(element))) { + let idx2 = combined.indexOf(element); + if (idx2 !== -1) + combined.splice(idx2, 1); + } + } + focusIn(combined, 1 /* First */, { sorted: false }); + }, + [1 /* Backwards */]: () => { + var _a3; + let result = focusIn(el, 2 /* Previous */); + if (result === 0 /* Error */) { + (_a3 = state.button) == null ? void 0 : _a3.focus(); + } + } + }); + } + if (false) {} else { + run(); + } + }); + return /* @__PURE__ */ import_react37.default.createElement(PopoverPanelContext.Provider, { value: id }, visible && isPortalled && /* @__PURE__ */ import_react37.default.createElement( + Hidden, + { + id: beforePanelSentinelId, + ref: state.beforePanelSentinel, + features: 2 /* Focusable */, + "data-headlessui-focus-guard": true, + as: "button", + type: "button", + onFocus: handleBeforeFocus + } + ), render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_PANEL_TAG3, + features: PanelRenderFeatures2, + visible, + name: "Popover.Panel" + }), visible && isPortalled && /* @__PURE__ */ import_react37.default.createElement( + Hidden, + { + id: afterPanelSentinelId, + ref: state.afterPanelSentinel, + features: 2 /* Focusable */, + "data-headlessui-focus-guard": true, + as: "button", + type: "button", + onFocus: handleAfterFocus + } + )); +} +var DEFAULT_GROUP_TAG2 = "div"; +function GroupFn2(props, ref) { + let internalGroupRef = (0, import_react37.useRef)(null); + let groupRef = useSyncRefs(internalGroupRef, ref); + let [popovers, setPopovers] = (0, import_react37.useState)([]); + let unregisterPopover = useEvent((registerbag) => { + setPopovers((existing) => { + let idx = existing.indexOf(registerbag); + if (idx !== -1) { + let clone = existing.slice(); + clone.splice(idx, 1); + return clone; + } + return existing; + }); + }); + let registerPopover = useEvent((registerbag) => { + setPopovers((existing) => [...existing, registerbag]); + return () => unregisterPopover(registerbag); + }); + let isFocusWithinPopoverGroup = useEvent(() => { + var _a3; + let ownerDocument = getOwnerDocument(internalGroupRef); + if (!ownerDocument) + return false; + let element = ownerDocument.activeElement; + if ((_a3 = internalGroupRef.current) == null ? void 0 : _a3.contains(element)) + return true; + return popovers.some((bag) => { + var _a4, _b; + return ((_a4 = ownerDocument.getElementById(bag.buttonId.current)) == null ? void 0 : _a4.contains(element)) || ((_b = ownerDocument.getElementById(bag.panelId.current)) == null ? void 0 : _b.contains(element)); + }); + }); + let closeOthers = useEvent((buttonId) => { + for (let popover of popovers) { + if (popover.buttonId.current !== buttonId) + popover.close(); + } + }); + let contextBag = (0, import_react37.useMemo)( + () => ({ + registerPopover, + unregisterPopover, + isFocusWithinPopoverGroup, + closeOthers + }), + [registerPopover, unregisterPopover, isFocusWithinPopoverGroup, closeOthers] + ); + let slot = (0, import_react37.useMemo)(() => ({}), []); + let theirProps = props; + let ourProps = { ref: groupRef }; + return /* @__PURE__ */ import_react37.default.createElement(PopoverGroupContext.Provider, { value: contextBag }, render({ + ourProps, + theirProps, + slot, + defaultTag: DEFAULT_GROUP_TAG2, + name: "Popover.Group" + })); +} +var PopoverRoot = forwardRefWithAs(PopoverFn); +var Button5 = forwardRefWithAs(ButtonFn5); +var Overlay2 = forwardRefWithAs(OverlayFn2); +var Panel3 = forwardRefWithAs(PanelFn3); +var Group2 = forwardRefWithAs(GroupFn2); +var Popover = Object.assign(PopoverRoot, { Button: Button5, Overlay: Overlay2, Panel: Panel3, Group: Group2 }); + +// src/components/radio-group/radio-group.tsx +var import_react40 = __toESM(__webpack_require__(/*! react */ "react"), 1); + +// src/hooks/use-flags.ts +var import_react38 = __webpack_require__(/*! react */ "react"); +function useFlags(initialFlags = 0) { + let [flags, setFlags] = (0, import_react38.useState)(initialFlags); + let mounted = useIsMounted(); + let addFlag = (0, import_react38.useCallback)( + (flag) => { + if (!mounted.current) + return; + setFlags((flags2) => flags2 | flag); + }, + [flags, mounted] + ); + let hasFlag = (0, import_react38.useCallback)((flag) => Boolean(flags & flag), [flags]); + let removeFlag = (0, import_react38.useCallback)( + (flag) => { + if (!mounted.current) + return; + setFlags((flags2) => flags2 & ~flag); + }, + [setFlags, mounted] + ); + let toggleFlag = (0, import_react38.useCallback)( + (flag) => { + if (!mounted.current) + return; + setFlags((flags2) => flags2 ^ flag); + }, + [setFlags] + ); + return { flags, addFlag, hasFlag, removeFlag, toggleFlag }; +} + +// src/components/label/label.tsx +var import_react39 = __toESM(__webpack_require__(/*! react */ "react"), 1); +var LabelContext = (0, import_react39.createContext)( + null +); +function useLabelContext() { + let context = (0, import_react39.useContext)(LabelContext); + if (context === null) { + let err = new Error("You used a