structure saas with tools
This commit is contained in:
335
.venv/lib/python3.10/site-packages/urllib3/exceptions.py
Normal file
335
.venv/lib/python3.10/site-packages/urllib3/exceptions.py
Normal file
@@ -0,0 +1,335 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import socket
|
||||
import typing
|
||||
import warnings
|
||||
from email.errors import MessageDefect
|
||||
from http.client import IncompleteRead as httplib_IncompleteRead
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
from .connection import HTTPConnection
|
||||
from .connectionpool import ConnectionPool
|
||||
from .response import HTTPResponse
|
||||
from .util.retry import Retry
|
||||
|
||||
# Base Exceptions
|
||||
|
||||
|
||||
class HTTPError(Exception):
|
||||
"""Base exception used by this module."""
|
||||
|
||||
|
||||
class HTTPWarning(Warning):
|
||||
"""Base warning used by this module."""
|
||||
|
||||
|
||||
_TYPE_REDUCE_RESULT = tuple[typing.Callable[..., object], tuple[object, ...]]
|
||||
|
||||
|
||||
class PoolError(HTTPError):
|
||||
"""Base exception for errors caused within a pool."""
|
||||
|
||||
def __init__(self, pool: ConnectionPool, message: str) -> None:
|
||||
self.pool = pool
|
||||
self._message = message
|
||||
super().__init__(f"{pool}: {message}")
|
||||
|
||||
def __reduce__(self) -> _TYPE_REDUCE_RESULT:
|
||||
# For pickling purposes.
|
||||
return self.__class__, (None, self._message)
|
||||
|
||||
|
||||
class RequestError(PoolError):
|
||||
"""Base exception for PoolErrors that have associated URLs."""
|
||||
|
||||
def __init__(self, pool: ConnectionPool, url: str, message: str) -> None:
|
||||
self.url = url
|
||||
super().__init__(pool, message)
|
||||
|
||||
def __reduce__(self) -> _TYPE_REDUCE_RESULT:
|
||||
# For pickling purposes.
|
||||
return self.__class__, (None, self.url, self._message)
|
||||
|
||||
|
||||
class SSLError(HTTPError):
|
||||
"""Raised when SSL certificate fails in an HTTPS connection."""
|
||||
|
||||
|
||||
class ProxyError(HTTPError):
|
||||
"""Raised when the connection to a proxy fails."""
|
||||
|
||||
# The original error is also available as __cause__.
|
||||
original_error: Exception
|
||||
|
||||
def __init__(self, message: str, error: Exception) -> None:
|
||||
super().__init__(message, error)
|
||||
self.original_error = error
|
||||
|
||||
|
||||
class DecodeError(HTTPError):
|
||||
"""Raised when automatic decoding based on Content-Type fails."""
|
||||
|
||||
|
||||
class ProtocolError(HTTPError):
|
||||
"""Raised when something unexpected happens mid-request/response."""
|
||||
|
||||
|
||||
#: Renamed to ProtocolError but aliased for backwards compatibility.
|
||||
ConnectionError = ProtocolError
|
||||
|
||||
|
||||
# Leaf Exceptions
|
||||
|
||||
|
||||
class MaxRetryError(RequestError):
|
||||
"""Raised when the maximum number of retries is exceeded.
|
||||
|
||||
:param pool: The connection pool
|
||||
:type pool: :class:`~urllib3.connectionpool.HTTPConnectionPool`
|
||||
:param str url: The requested Url
|
||||
:param reason: The underlying error
|
||||
:type reason: :class:`Exception`
|
||||
|
||||
"""
|
||||
|
||||
def __init__(
|
||||
self, pool: ConnectionPool, url: str, reason: Exception | None = None
|
||||
) -> None:
|
||||
self.reason = reason
|
||||
|
||||
message = f"Max retries exceeded with url: {url} (Caused by {reason!r})"
|
||||
|
||||
super().__init__(pool, url, message)
|
||||
|
||||
def __reduce__(self) -> _TYPE_REDUCE_RESULT:
|
||||
# For pickling purposes.
|
||||
return self.__class__, (None, self.url, self.reason)
|
||||
|
||||
|
||||
class HostChangedError(RequestError):
|
||||
"""Raised when an existing pool gets a request for a foreign host."""
|
||||
|
||||
def __init__(
|
||||
self, pool: ConnectionPool, url: str, retries: Retry | int = 3
|
||||
) -> None:
|
||||
message = f"Tried to open a foreign host with url: {url}"
|
||||
super().__init__(pool, url, message)
|
||||
self.retries = retries
|
||||
|
||||
|
||||
class TimeoutStateError(HTTPError):
|
||||
"""Raised when passing an invalid state to a timeout"""
|
||||
|
||||
|
||||
class TimeoutError(HTTPError):
|
||||
"""Raised when a socket timeout error occurs.
|
||||
|
||||
Catching this error will catch both :exc:`ReadTimeoutErrors
|
||||
<ReadTimeoutError>` and :exc:`ConnectTimeoutErrors <ConnectTimeoutError>`.
|
||||
"""
|
||||
|
||||
|
||||
class ReadTimeoutError(TimeoutError, RequestError):
|
||||
"""Raised when a socket timeout occurs while receiving data from a server"""
|
||||
|
||||
|
||||
# This timeout error does not have a URL attached and needs to inherit from the
|
||||
# base HTTPError
|
||||
class ConnectTimeoutError(TimeoutError):
|
||||
"""Raised when a socket timeout occurs while connecting to a server"""
|
||||
|
||||
|
||||
class NewConnectionError(ConnectTimeoutError, HTTPError):
|
||||
"""Raised when we fail to establish a new connection. Usually ECONNREFUSED."""
|
||||
|
||||
def __init__(self, conn: HTTPConnection, message: str) -> None:
|
||||
self.conn = conn
|
||||
self._message = message
|
||||
super().__init__(f"{conn}: {message}")
|
||||
|
||||
def __reduce__(self) -> _TYPE_REDUCE_RESULT:
|
||||
# For pickling purposes.
|
||||
return self.__class__, (None, self._message)
|
||||
|
||||
@property
|
||||
def pool(self) -> HTTPConnection:
|
||||
warnings.warn(
|
||||
"The 'pool' property is deprecated and will be removed "
|
||||
"in urllib3 v2.1.0. Use 'conn' instead.",
|
||||
DeprecationWarning,
|
||||
stacklevel=2,
|
||||
)
|
||||
|
||||
return self.conn
|
||||
|
||||
|
||||
class NameResolutionError(NewConnectionError):
|
||||
"""Raised when host name resolution fails."""
|
||||
|
||||
def __init__(self, host: str, conn: HTTPConnection, reason: socket.gaierror):
|
||||
message = f"Failed to resolve '{host}' ({reason})"
|
||||
self._host = host
|
||||
self._reason = reason
|
||||
super().__init__(conn, message)
|
||||
|
||||
def __reduce__(self) -> _TYPE_REDUCE_RESULT:
|
||||
# For pickling purposes.
|
||||
return self.__class__, (self._host, None, self._reason)
|
||||
|
||||
|
||||
class EmptyPoolError(PoolError):
|
||||
"""Raised when a pool runs out of connections and no more are allowed."""
|
||||
|
||||
|
||||
class FullPoolError(PoolError):
|
||||
"""Raised when we try to add a connection to a full pool in blocking mode."""
|
||||
|
||||
|
||||
class ClosedPoolError(PoolError):
|
||||
"""Raised when a request enters a pool after the pool has been closed."""
|
||||
|
||||
|
||||
class LocationValueError(ValueError, HTTPError):
|
||||
"""Raised when there is something wrong with a given URL input."""
|
||||
|
||||
|
||||
class LocationParseError(LocationValueError):
|
||||
"""Raised when get_host or similar fails to parse the URL input."""
|
||||
|
||||
def __init__(self, location: str) -> None:
|
||||
message = f"Failed to parse: {location}"
|
||||
super().__init__(message)
|
||||
|
||||
self.location = location
|
||||
|
||||
|
||||
class URLSchemeUnknown(LocationValueError):
|
||||
"""Raised when a URL input has an unsupported scheme."""
|
||||
|
||||
def __init__(self, scheme: str):
|
||||
message = f"Not supported URL scheme {scheme}"
|
||||
super().__init__(message)
|
||||
|
||||
self.scheme = scheme
|
||||
|
||||
|
||||
class ResponseError(HTTPError):
|
||||
"""Used as a container for an error reason supplied in a MaxRetryError."""
|
||||
|
||||
GENERIC_ERROR = "too many error responses"
|
||||
SPECIFIC_ERROR = "too many {status_code} error responses"
|
||||
|
||||
|
||||
class SecurityWarning(HTTPWarning):
|
||||
"""Warned when performing security reducing actions"""
|
||||
|
||||
|
||||
class InsecureRequestWarning(SecurityWarning):
|
||||
"""Warned when making an unverified HTTPS request."""
|
||||
|
||||
|
||||
class NotOpenSSLWarning(SecurityWarning):
|
||||
"""Warned when using unsupported SSL library"""
|
||||
|
||||
|
||||
class SystemTimeWarning(SecurityWarning):
|
||||
"""Warned when system time is suspected to be wrong"""
|
||||
|
||||
|
||||
class InsecurePlatformWarning(SecurityWarning):
|
||||
"""Warned when certain TLS/SSL configuration is not available on a platform."""
|
||||
|
||||
|
||||
class DependencyWarning(HTTPWarning):
|
||||
"""
|
||||
Warned when an attempt is made to import a module with missing optional
|
||||
dependencies.
|
||||
"""
|
||||
|
||||
|
||||
class ResponseNotChunked(ProtocolError, ValueError):
|
||||
"""Response needs to be chunked in order to read it as chunks."""
|
||||
|
||||
|
||||
class BodyNotHttplibCompatible(HTTPError):
|
||||
"""
|
||||
Body should be :class:`http.client.HTTPResponse` like
|
||||
(have an fp attribute which returns raw chunks) for read_chunked().
|
||||
"""
|
||||
|
||||
|
||||
class IncompleteRead(HTTPError, httplib_IncompleteRead):
|
||||
"""
|
||||
Response length doesn't match expected Content-Length
|
||||
|
||||
Subclass of :class:`http.client.IncompleteRead` to allow int value
|
||||
for ``partial`` to avoid creating large objects on streamed reads.
|
||||
"""
|
||||
|
||||
partial: int # type: ignore[assignment]
|
||||
expected: int
|
||||
|
||||
def __init__(self, partial: int, expected: int) -> None:
|
||||
self.partial = partial
|
||||
self.expected = expected
|
||||
|
||||
def __repr__(self) -> str:
|
||||
return "IncompleteRead(%i bytes read, %i more expected)" % (
|
||||
self.partial,
|
||||
self.expected,
|
||||
)
|
||||
|
||||
|
||||
class InvalidChunkLength(HTTPError, httplib_IncompleteRead):
|
||||
"""Invalid chunk length in a chunked response."""
|
||||
|
||||
def __init__(self, response: HTTPResponse, length: bytes) -> None:
|
||||
self.partial: int = response.tell() # type: ignore[assignment]
|
||||
self.expected: int | None = response.length_remaining
|
||||
self.response = response
|
||||
self.length = length
|
||||
|
||||
def __repr__(self) -> str:
|
||||
return "InvalidChunkLength(got length %r, %i bytes read)" % (
|
||||
self.length,
|
||||
self.partial,
|
||||
)
|
||||
|
||||
|
||||
class InvalidHeader(HTTPError):
|
||||
"""The header provided was somehow invalid."""
|
||||
|
||||
|
||||
class ProxySchemeUnknown(AssertionError, URLSchemeUnknown):
|
||||
"""ProxyManager does not support the supplied scheme"""
|
||||
|
||||
# TODO(t-8ch): Stop inheriting from AssertionError in v2.0.
|
||||
|
||||
def __init__(self, scheme: str | None) -> None:
|
||||
# 'localhost' is here because our URL parser parses
|
||||
# localhost:8080 -> scheme=localhost, remove if we fix this.
|
||||
if scheme == "localhost":
|
||||
scheme = None
|
||||
if scheme is None:
|
||||
message = "Proxy URL had no scheme, should start with http:// or https://"
|
||||
else:
|
||||
message = f"Proxy URL had unsupported scheme {scheme}, should use http:// or https://"
|
||||
super().__init__(message)
|
||||
|
||||
|
||||
class ProxySchemeUnsupported(ValueError):
|
||||
"""Fetching HTTPS resources through HTTPS proxies is unsupported"""
|
||||
|
||||
|
||||
class HeaderParsingError(HTTPError):
|
||||
"""Raised by assert_header_parsing, but we convert it to a log.warning statement."""
|
||||
|
||||
def __init__(
|
||||
self, defects: list[MessageDefect], unparsed_data: bytes | str | None
|
||||
) -> None:
|
||||
message = f"{defects or 'Unknown'}, unparsed data: {unparsed_data!r}"
|
||||
super().__init__(message)
|
||||
|
||||
|
||||
class UnrewindableBodyError(HTTPError):
|
||||
"""urllib3 encountered an error when trying to rewind a body"""
|
||||
Reference in New Issue
Block a user